diff --git a/client/.eslintrc.cjs b/client/.eslintrc.cjs new file mode 100644 index 000000000..4dcb43901 --- /dev/null +++ b/client/.eslintrc.cjs @@ -0,0 +1,20 @@ +module.exports = { + root: true, + env: { browser: true, es2020: true }, + extends: [ + 'eslint:recommended', + 'plugin:react/recommended', + 'plugin:react/jsx-runtime', + 'plugin:react-hooks/recommended', + ], + ignorePatterns: ['dist', '.eslintrc.cjs'], + parserOptions: { ecmaVersion: 'latest', sourceType: 'module' }, + settings: { react: { version: '18.2' } }, + plugins: ['react-refresh'], + rules: { + 'react-refresh/only-export-components': [ + 'warn', + { allowConstantExport: true }, + ], + }, +} diff --git a/client/.gitignore b/client/.gitignore new file mode 100644 index 000000000..a547bf36d --- /dev/null +++ b/client/.gitignore @@ -0,0 +1,24 @@ +# Logs +logs +*.log +npm-debug.log* +yarn-debug.log* +yarn-error.log* +pnpm-debug.log* +lerna-debug.log* + +node_modules +dist +dist-ssr +*.local + +# Editor directories and files +.vscode/* +!.vscode/extensions.json +.idea +.DS_Store +*.suo +*.ntvs* +*.njsproj +*.sln +*.sw? diff --git a/client/README.md b/client/README.md new file mode 100644 index 000000000..f768e33fc --- /dev/null +++ b/client/README.md @@ -0,0 +1,8 @@ +# React + Vite + +This template provides a minimal setup to get React working in Vite with HMR and some ESLint rules. + +Currently, two official plugins are available: + +- [@vitejs/plugin-react](https://github.com/vitejs/vite-plugin-react/blob/main/packages/plugin-react/README.md) uses [Babel](https://babeljs.io/) for Fast Refresh +- [@vitejs/plugin-react-swc](https://github.com/vitejs/vite-plugin-react-swc) uses [SWC](https://swc.rs/) for Fast Refresh diff --git a/client/index.html b/client/index.html new file mode 100644 index 000000000..0c589eccd --- /dev/null +++ b/client/index.html @@ -0,0 +1,13 @@ + + + + + + + Vite + React + + +
+ + + diff --git a/client/package-lock.json b/client/package-lock.json new file mode 100644 index 000000000..9b0bd0e31 --- /dev/null +++ b/client/package-lock.json @@ -0,0 +1,4185 @@ +{ + "name": "client", + "version": "0.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "name": "client", + "version": "0.0.0", + "dependencies": { + "axios": "^1.6.2", + "bootstrap": "^5.3.0", + "react": "^18.2.0", + "react-dom": "^18.2.0", + "react-router-dom": "^6.21.1" + }, + "devDependencies": { + "@types/react": "^18.2.43", + "@types/react-dom": "^18.2.17", + "@vitejs/plugin-react": "^4.2.1", + "eslint": "^8.55.0", + "eslint-plugin-react": "^7.33.2", + "eslint-plugin-react-hooks": "^4.6.0", + "eslint-plugin-react-refresh": "^0.4.5", + "vite": "^5.0.8" + } + }, + "node_modules/@aashutoshrathi/word-wrap": { + "version": "1.2.6", + "resolved": "https://registry.npmjs.org/@aashutoshrathi/word-wrap/-/word-wrap-1.2.6.tgz", + "integrity": "sha512-1Yjs2SvM8TflER/OD3cOjhWWOZb58A2t7wpE2S9XfBYTiIl+XFhQG2bjy4Pu1I+EAlCNUzRDYDdFwFYUKvXcIA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@ampproject/remapping": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/@ampproject/remapping/-/remapping-2.2.1.tgz", + "integrity": "sha512-lFMjJTrFL3j7L9yBxwYfCq2k6qqwHyzuUl/XBnif78PWTJYyL/dfowQHWE3sp6U6ZzqWiiIZnpTMO96zhkjwtg==", + "dev": true, + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.0", + "@jridgewell/trace-mapping": "^0.3.9" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/code-frame": { + "version": "7.23.5", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.23.5.tgz", + "integrity": "sha512-CgH3s1a96LipHCmSUmYFPwY7MNx8C3avkq7i4Wl3cfa662ldtUe4VM1TPXX70pfmrlWTb6jLqTYrZyT2ZTJBgA==", + "dev": true, + "dependencies": { + "@babel/highlight": "^7.23.4", + "chalk": "^2.4.2" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/compat-data": { + "version": "7.23.5", + "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.23.5.tgz", + "integrity": "sha512-uU27kfDRlhfKl+w1U6vp16IuvSLtjAxdArVXPa9BvLkrr7CYIsxH5adpHObeAGY/41+syctUWOZ140a2Rvkgjw==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/core": { + "version": "7.23.6", + "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.23.6.tgz", + "integrity": "sha512-FxpRyGjrMJXh7X3wGLGhNDCRiwpWEF74sKjTLDJSG5Kyvow3QZaG0Adbqzi9ZrVjTWpsX+2cxWXD71NMg93kdw==", + "dev": true, + "dependencies": { + "@ampproject/remapping": "^2.2.0", + "@babel/code-frame": "^7.23.5", + "@babel/generator": "^7.23.6", + "@babel/helper-compilation-targets": "^7.23.6", + "@babel/helper-module-transforms": "^7.23.3", + "@babel/helpers": "^7.23.6", + "@babel/parser": "^7.23.6", + "@babel/template": "^7.22.15", + "@babel/traverse": "^7.23.6", + "@babel/types": "^7.23.6", + "convert-source-map": "^2.0.0", + "debug": "^4.1.0", + "gensync": "^1.0.0-beta.2", + "json5": "^2.2.3", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/babel" + } + }, + "node_modules/@babel/generator": { + "version": "7.23.6", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.23.6.tgz", + "integrity": "sha512-qrSfCYxYQB5owCmGLbl8XRpX1ytXlpueOb0N0UmQwA073KZxejgQTzAmJezxvpwQD9uGtK2shHdi55QT+MbjIw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.23.6", + "@jridgewell/gen-mapping": "^0.3.2", + "@jridgewell/trace-mapping": "^0.3.17", + "jsesc": "^2.5.1" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-compilation-targets": { + "version": "7.23.6", + "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.23.6.tgz", + "integrity": "sha512-9JB548GZoQVmzrFgp8o7KxdgkTGm6xs9DW0o/Pim72UDjzr5ObUQ6ZzYPqA+g9OTS2bBQoctLJrky0RDCAWRgQ==", + "dev": true, + "dependencies": { + "@babel/compat-data": "^7.23.5", + "@babel/helper-validator-option": "^7.23.5", + "browserslist": "^4.22.2", + "lru-cache": "^5.1.1", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-environment-visitor": { + "version": "7.22.20", + "resolved": "https://registry.npmjs.org/@babel/helper-environment-visitor/-/helper-environment-visitor-7.22.20.tgz", + "integrity": "sha512-zfedSIzFhat/gFhWfHtgWvlec0nqB9YEIVrpuwjruLlXfUSnA8cJB0miHKwqDnQ7d32aKo2xt88/xZptwxbfhA==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-function-name": { + "version": "7.23.0", + "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.23.0.tgz", + "integrity": "sha512-OErEqsrxjZTJciZ4Oo+eoZqeW9UIiOcuYKRJA4ZAgV9myA+pOXhhmpfNCKjEH/auVfEYVFJ6y1Tc4r0eIApqiw==", + "dev": true, + "dependencies": { + "@babel/template": "^7.22.15", + "@babel/types": "^7.23.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-hoist-variables": { + "version": "7.22.5", + "resolved": "https://registry.npmjs.org/@babel/helper-hoist-variables/-/helper-hoist-variables-7.22.5.tgz", + "integrity": "sha512-wGjk9QZVzvknA6yKIUURb8zY3grXCcOZt+/7Wcy8O2uctxhplmUPkOdlgoNhmdVee2c92JXbf1xpMtVNbfoxRw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.22.5" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-module-imports": { + "version": "7.22.15", + "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.22.15.tgz", + "integrity": "sha512-0pYVBnDKZO2fnSPCrgM/6WMc7eS20Fbok+0r88fp+YtWVLZrp4CkafFGIp+W0VKw4a22sgebPT99y+FDNMdP4w==", + "dev": true, + "dependencies": { + "@babel/types": "^7.22.15" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-module-transforms": { + "version": "7.23.3", + "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.23.3.tgz", + "integrity": "sha512-7bBs4ED9OmswdfDzpz4MpWgSrV7FXlc3zIagvLFjS5H+Mk7Snr21vQ6QwrsoCGMfNC4e4LQPdoULEt4ykz0SRQ==", + "dev": true, + "dependencies": { + "@babel/helper-environment-visitor": "^7.22.20", + "@babel/helper-module-imports": "^7.22.15", + "@babel/helper-simple-access": "^7.22.5", + "@babel/helper-split-export-declaration": "^7.22.6", + "@babel/helper-validator-identifier": "^7.22.20" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0" + } + }, + "node_modules/@babel/helper-plugin-utils": { + "version": "7.22.5", + "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.22.5.tgz", + "integrity": "sha512-uLls06UVKgFG9QD4OeFYLEGteMIAa5kpTPcFL28yuCIIzsf6ZyKZMllKVOCZFhiZ5ptnwX4mtKdWCBE/uT4amg==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-simple-access": { + "version": "7.22.5", + "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.22.5.tgz", + "integrity": "sha512-n0H99E/K+Bika3++WNL17POvo4rKWZ7lZEp1Q+fStVbUi8nxPQEBOlTmCOxW/0JsS56SKKQ+ojAe2pHKJHN35w==", + "dev": true, + "dependencies": { + "@babel/types": "^7.22.5" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-split-export-declaration": { + "version": "7.22.6", + "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.22.6.tgz", + "integrity": "sha512-AsUnxuLhRYsisFiaJwvp1QF+I3KjD5FOxut14q/GzovUe6orHLesW2C7d754kRm53h5gqrz6sFl6sxc4BVtE/g==", + "dev": true, + "dependencies": { + "@babel/types": "^7.22.5" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-string-parser": { + "version": "7.23.4", + "resolved": "https://registry.npmjs.org/@babel/helper-string-parser/-/helper-string-parser-7.23.4.tgz", + "integrity": "sha512-803gmbQdqwdf4olxrX4AJyFBV/RTr3rSmOj0rKwesmzlfhYNDEs+/iOcznzpNWlJlIlTJC2QfPFcHB6DlzdVLQ==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-validator-identifier": { + "version": "7.22.20", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.22.20.tgz", + "integrity": "sha512-Y4OZ+ytlatR8AI+8KZfKuL5urKp7qey08ha31L8b3BwewJAoJamTzyvxPR/5D+KkdJCGPq/+8TukHBlY10FX9A==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-validator-option": { + "version": "7.23.5", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-option/-/helper-validator-option-7.23.5.tgz", + "integrity": "sha512-85ttAOMLsr53VgXkTbkx8oA6YTfT4q7/HzXSLEYmjcSTJPMPQtvq1BD79Byep5xMUYbGRzEpDsjUf3dyp54IKw==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helpers": { + "version": "7.23.6", + "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.23.6.tgz", + "integrity": "sha512-wCfsbN4nBidDRhpDhvcKlzHWCTlgJYUUdSJfzXb2NuBssDSIjc3xcb+znA7l+zYsFljAcGM0aFkN40cR3lXiGA==", + "dev": true, + "dependencies": { + "@babel/template": "^7.22.15", + "@babel/traverse": "^7.23.6", + "@babel/types": "^7.23.6" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/highlight": { + "version": "7.23.4", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.23.4.tgz", + "integrity": "sha512-acGdbYSfp2WheJoJm/EBBBLh/ID8KDc64ISZ9DYtBmC8/Q204PZJLHyzeB5qMzJ5trcOkybd78M4x2KWsUq++A==", + "dev": true, + "dependencies": { + "@babel/helper-validator-identifier": "^7.22.20", + "chalk": "^2.4.2", + "js-tokens": "^4.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/parser": { + "version": "7.23.6", + "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.23.6.tgz", + "integrity": "sha512-Z2uID7YJ7oNvAI20O9X0bblw7Qqs8Q2hFy0R9tAfnfLkp5MW0UH9eUvnDSnFwKZ0AvgS1ucqR4KzvVHgnke1VQ==", + "dev": true, + "bin": { + "parser": "bin/babel-parser.js" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/plugin-transform-react-jsx-self": { + "version": "7.23.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-react-jsx-self/-/plugin-transform-react-jsx-self-7.23.3.tgz", + "integrity": "sha512-qXRvbeKDSfwnlJnanVRp0SfuWE5DQhwQr5xtLBzp56Wabyo+4CMosF6Kfp+eOD/4FYpql64XVJ2W0pVLlJZxOQ==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.22.5" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-transform-react-jsx-source": { + "version": "7.23.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-react-jsx-source/-/plugin-transform-react-jsx-source-7.23.3.tgz", + "integrity": "sha512-91RS0MDnAWDNvGC6Wio5XYkyWI39FMFO+JK9+4AlgaTH+yWwVTsw7/sn6LK0lH7c5F+TFkpv/3LfCJ1Ydwof/g==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.22.5" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/template": { + "version": "7.22.15", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.22.15.tgz", + "integrity": "sha512-QPErUVm4uyJa60rkI73qneDacvdvzxshT3kksGqlGWYdOTIUOwJ7RDUL8sGqslY1uXWSL6xMFKEXDS3ox2uF0w==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.22.13", + "@babel/parser": "^7.22.15", + "@babel/types": "^7.22.15" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/traverse": { + "version": "7.23.6", + "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.23.6.tgz", + "integrity": "sha512-czastdK1e8YByZqezMPFiZ8ahwVMh/ESl9vPgvgdB9AmFMGP5jfpFax74AQgl5zj4XHzqeYAg2l8PuUeRS1MgQ==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.23.5", + "@babel/generator": "^7.23.6", + "@babel/helper-environment-visitor": "^7.22.20", + "@babel/helper-function-name": "^7.23.0", + "@babel/helper-hoist-variables": "^7.22.5", + "@babel/helper-split-export-declaration": "^7.22.6", + "@babel/parser": "^7.23.6", + "@babel/types": "^7.23.6", + "debug": "^4.3.1", + "globals": "^11.1.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/types": { + "version": "7.23.6", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.23.6.tgz", + "integrity": "sha512-+uarb83brBzPKN38NX1MkB6vb6+mwvR6amUulqAE7ccQw1pEl+bCia9TbdG1lsnFP7lZySvUn37CHyXQdfTwzg==", + "dev": true, + "dependencies": { + "@babel/helper-string-parser": "^7.23.4", + "@babel/helper-validator-identifier": "^7.22.20", + "to-fast-properties": "^2.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@esbuild/aix-ppc64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.19.10.tgz", + "integrity": "sha512-Q+mk96KJ+FZ30h9fsJl+67IjNJm3x2eX+GBWGmocAKgzp27cowCOOqSdscX80s0SpdFXZnIv/+1xD1EctFx96Q==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "aix" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-arm": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.19.10.tgz", + "integrity": "sha512-7W0bK7qfkw1fc2viBfrtAEkDKHatYfHzr/jKAHNr9BvkYDXPcC6bodtm8AyLJNNuqClLNaeTLuwURt4PRT9d7w==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-arm64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.19.10.tgz", + "integrity": "sha512-1X4CClKhDgC3by7k8aOWZeBXQX8dHT5QAMCAQDArCLaYfkppoARvh0fit3X2Qs+MXDngKcHv6XXyQCpY0hkK1Q==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-x64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.19.10.tgz", + "integrity": "sha512-O/nO/g+/7NlitUxETkUv/IvADKuZXyH4BHf/g/7laqKC4i/7whLpB0gvpPc2zpF0q9Q6FXS3TS75QHac9MvVWw==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-arm64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.19.10.tgz", + "integrity": "sha512-YSRRs2zOpwypck+6GL3wGXx2gNP7DXzetmo5pHXLrY/VIMsS59yKfjPizQ4lLt5vEI80M41gjm2BxrGZ5U+VMA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-x64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.19.10.tgz", + "integrity": "sha512-alfGtT+IEICKtNE54hbvPg13xGBe4GkVxyGWtzr+yHO7HIiRJppPDhOKq3zstTcVf8msXb/t4eavW3jCDpMSmA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-arm64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.19.10.tgz", + "integrity": "sha512-dMtk1wc7FSH8CCkE854GyGuNKCewlh+7heYP/sclpOG6Cectzk14qdUIY5CrKDbkA/OczXq9WesqnPl09mj5dg==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-x64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.19.10.tgz", + "integrity": "sha512-G5UPPspryHu1T3uX8WiOEUa6q6OlQh6gNl4CO4Iw5PS+Kg5bVggVFehzXBJY6X6RSOMS8iXDv2330VzaObm4Ag==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.19.10.tgz", + "integrity": "sha512-j6gUW5aAaPgD416Hk9FHxn27On28H4eVI9rJ4az7oCGTFW48+LcgNDBN+9f8rKZz7EEowo889CPKyeaD0iw9Kg==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.19.10.tgz", + "integrity": "sha512-QxaouHWZ+2KWEj7cGJmvTIHVALfhpGxo3WLmlYfJ+dA5fJB6lDEIg+oe/0//FuyVHuS3l79/wyBxbHr0NgtxJQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ia32": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.19.10.tgz", + "integrity": "sha512-4ub1YwXxYjj9h1UIZs2hYbnTZBtenPw5NfXCRgEkGb0b6OJ2gpkMvDqRDYIDRjRdWSe/TBiZltm3Y3Q8SN1xNg==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-loong64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.19.10.tgz", + "integrity": "sha512-lo3I9k+mbEKoxtoIbM0yC/MZ1i2wM0cIeOejlVdZ3D86LAcFXFRdeuZmh91QJvUTW51bOK5W2BznGNIl4+mDaA==", + "cpu": [ + "loong64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-mips64el": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.19.10.tgz", + "integrity": "sha512-J4gH3zhHNbdZN0Bcr1QUGVNkHTdpijgx5VMxeetSk6ntdt+vR1DqGmHxQYHRmNb77tP6GVvD+K0NyO4xjd7y4A==", + "cpu": [ + "mips64el" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ppc64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.19.10.tgz", + "integrity": "sha512-tgT/7u+QhV6ge8wFMzaklOY7KqiyitgT1AUHMApau32ZlvTB/+efeCtMk4eXS+uEymYK249JsoiklZN64xt6oQ==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-riscv64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.19.10.tgz", + "integrity": "sha512-0f/spw0PfBMZBNqtKe5FLzBDGo0SKZKvMl5PHYQr3+eiSscfJ96XEknCe+JoOayybWUFQbcJTrk946i3j9uYZA==", + "cpu": [ + "riscv64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-s390x": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.19.10.tgz", + "integrity": "sha512-pZFe0OeskMHzHa9U38g+z8Yx5FNCLFtUnJtQMpwhS+r4S566aK2ci3t4NCP4tjt6d5j5uo4h7tExZMjeKoehAA==", + "cpu": [ + "s390x" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-x64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.19.10.tgz", + "integrity": "sha512-SpYNEqg/6pZYoc+1zLCjVOYvxfZVZj6w0KROZ3Fje/QrM3nfvT2llI+wmKSrWuX6wmZeTapbarvuNNK/qepSgA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/netbsd-x64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.19.10.tgz", + "integrity": "sha512-ACbZ0vXy9zksNArWlk2c38NdKg25+L9pr/mVaj9SUq6lHZu/35nx2xnQVRGLrC1KKQqJKRIB0q8GspiHI3J80Q==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/openbsd-x64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.19.10.tgz", + "integrity": "sha512-PxcgvjdSjtgPMiPQrM3pwSaG4kGphP+bLSb+cihuP0LYdZv1epbAIecHVl5sD3npkfYBZ0ZnOjR878I7MdJDFg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/sunos-x64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.19.10.tgz", + "integrity": "sha512-ZkIOtrRL8SEJjr+VHjmW0znkPs+oJXhlJbNwfI37rvgeMtk3sxOQevXPXjmAPZPigVTncvFqLMd+uV0IBSEzqA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "sunos" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-arm64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.19.10.tgz", + "integrity": "sha512-+Sa4oTDbpBfGpl3Hn3XiUe4f8TU2JF7aX8cOfqFYMMjXp6ma6NJDztl5FDG8Ezx0OjwGikIHw+iA54YLDNNVfw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-ia32": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.19.10.tgz", + "integrity": "sha512-EOGVLK1oWMBXgfttJdPHDTiivYSjX6jDNaATeNOaCOFEVcfMjtbx7WVQwPSE1eIfCp/CaSF2nSrDtzc4I9f8TQ==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-x64": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.19.10.tgz", + "integrity": "sha512-whqLG6Sc70AbU73fFYvuYzaE4MNMBIlR1Y/IrUeOXFrWHxBEjjbZaQ3IXIQS8wJdAzue2GwYZCjOrgrU1oUHoA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@eslint-community/eslint-utils": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/@eslint-community/eslint-utils/-/eslint-utils-4.4.0.tgz", + "integrity": "sha512-1/sA4dwrzBAyeUoQ6oxahHKmrZvsnLCg4RfxW3ZFGGmQkSNQPFNLV9CUEFQP1x9EYXHTo5p6xdhZM1Ne9p/AfA==", + "dev": true, + "dependencies": { + "eslint-visitor-keys": "^3.3.0" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "peerDependencies": { + "eslint": "^6.0.0 || ^7.0.0 || >=8.0.0" + } + }, + "node_modules/@eslint-community/regexpp": { + "version": "4.10.0", + "resolved": "https://registry.npmjs.org/@eslint-community/regexpp/-/regexpp-4.10.0.tgz", + "integrity": "sha512-Cu96Sd2By9mCNTx2iyKOmq10v22jUVQv0lQnlGNy16oE9589yE+QADPbrMGCkA51cKZSg3Pu/aTJVTGfL/qjUA==", + "dev": true, + "engines": { + "node": "^12.0.0 || ^14.0.0 || >=16.0.0" + } + }, + "node_modules/@eslint/eslintrc": { + "version": "2.1.4", + "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-2.1.4.tgz", + "integrity": "sha512-269Z39MS6wVJtsoUl10L60WdkhJVdPG24Q4eZTH3nnF6lpvSShEK3wQjDX9JRWAUPvPh7COouPpU9IrqaZFvtQ==", + "dev": true, + "dependencies": { + "ajv": "^6.12.4", + "debug": "^4.3.2", + "espree": "^9.6.0", + "globals": "^13.19.0", + "ignore": "^5.2.0", + "import-fresh": "^3.2.1", + "js-yaml": "^4.1.0", + "minimatch": "^3.1.2", + "strip-json-comments": "^3.1.1" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/@eslint/eslintrc/node_modules/globals": { + "version": "13.24.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz", + "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==", + "dev": true, + "dependencies": { + "type-fest": "^0.20.2" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/@eslint/js": { + "version": "8.56.0", + "resolved": "https://registry.npmjs.org/@eslint/js/-/js-8.56.0.tgz", + "integrity": "sha512-gMsVel9D7f2HLkBma9VbtzZRehRogVRfbr++f06nL2vnCGCNlzOD+/MUov/F4p8myyAHspEhVobgjpX64q5m6A==", + "dev": true, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + } + }, + "node_modules/@humanwhocodes/config-array": { + "version": "0.11.13", + "resolved": "https://registry.npmjs.org/@humanwhocodes/config-array/-/config-array-0.11.13.tgz", + "integrity": "sha512-JSBDMiDKSzQVngfRjOdFXgFfklaXI4K9nLF49Auh21lmBWRLIK3+xTErTWD4KU54pb6coM6ESE7Awz/FNU3zgQ==", + "dev": true, + "dependencies": { + "@humanwhocodes/object-schema": "^2.0.1", + "debug": "^4.1.1", + "minimatch": "^3.0.5" + }, + "engines": { + "node": ">=10.10.0" + } + }, + "node_modules/@humanwhocodes/module-importer": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz", + "integrity": "sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==", + "dev": true, + "engines": { + "node": ">=12.22" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/nzakas" + } + }, + "node_modules/@humanwhocodes/object-schema": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/@humanwhocodes/object-schema/-/object-schema-2.0.1.tgz", + "integrity": "sha512-dvuCeX5fC9dXgJn9t+X5atfmgQAzUOWqS1254Gh0m6i8wKd10ebXkfNKiRK+1GWi/yTvvLDHpoxLr0xxxeslWw==", + "dev": true + }, + "node_modules/@jridgewell/gen-mapping": { + "version": "0.3.3", + "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.3.tgz", + "integrity": "sha512-HLhSWOLRi875zjjMG/r+Nv0oCW8umGb0BgEhyX3dDX3egwZtB8PqLnjz3yedt8R5StBrzcg4aBpnh8UA9D1BoQ==", + "dev": true, + "dependencies": { + "@jridgewell/set-array": "^1.0.1", + "@jridgewell/sourcemap-codec": "^1.4.10", + "@jridgewell/trace-mapping": "^0.3.9" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/resolve-uri": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.1.tgz", + "integrity": "sha512-dSYZh7HhCDtCKm4QakX0xFpsRDqjjtZf/kjI/v3T3Nwt5r8/qz/M19F9ySyOqU94SXBmeG9ttTul+YnR4LOxFA==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/set-array": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/@jridgewell/set-array/-/set-array-1.1.2.tgz", + "integrity": "sha512-xnkseuNADM0gt2bs+BvhO0p78Mk762YnZdsuzFV018NoG1Sj1SCQvpSqa7XUaTam5vAGasABV9qXASMKnFMwMw==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/sourcemap-codec": { + "version": "1.4.15", + "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz", + "integrity": "sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==", + "dev": true + }, + "node_modules/@jridgewell/trace-mapping": { + "version": "0.3.20", + "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.20.tgz", + "integrity": "sha512-R8LcPeWZol2zR8mmH3JeKQ6QRCFb7XgUhV9ZlGhHLGyg4wpPiPZNQOOWhFZhxKw8u//yTbNGI42Bx/3paXEQ+Q==", + "dev": true, + "dependencies": { + "@jridgewell/resolve-uri": "^3.1.0", + "@jridgewell/sourcemap-codec": "^1.4.14" + } + }, + "node_modules/@nodelib/fs.scandir": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz", + "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==", + "dev": true, + "dependencies": { + "@nodelib/fs.stat": "2.0.5", + "run-parallel": "^1.1.9" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.stat": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz", + "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==", + "dev": true, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.walk": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz", + "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==", + "dev": true, + "dependencies": { + "@nodelib/fs.scandir": "2.1.5", + "fastq": "^1.6.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@popperjs/core": { + "version": "2.11.8", + "resolved": "https://registry.npmjs.org/@popperjs/core/-/core-2.11.8.tgz", + "integrity": "sha512-P1st0aksCrn9sGZhp8GMYwBnQsbvAWsZAX44oXNNvLHGqAOcoVxmjZiohstwQ7SqKnbR47akdNi+uleWD8+g6A==", + "peer": true, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/popperjs" + } + }, + "node_modules/@remix-run/router": { + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/@remix-run/router/-/router-1.14.1.tgz", + "integrity": "sha512-Qg4DMQsfPNAs88rb2xkdk03N3bjK4jgX5fR24eHCTR9q6PrhZQZ4UJBPzCHJkIpTRN1UKxx2DzjZmnC+7Lj0Ow==", + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@rollup/rollup-android-arm-eabi": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.9.1.tgz", + "integrity": "sha512-6vMdBZqtq1dVQ4CWdhFwhKZL6E4L1dV6jUjuBvsavvNJSppzi6dLBbuV+3+IyUREaj9ZFvQefnQm28v4OCXlig==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-android-arm64": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.9.1.tgz", + "integrity": "sha512-Jto9Fl3YQ9OLsTDWtLFPtaIMSL2kwGyGoVCmPC8Gxvym9TCZm4Sie+cVeblPO66YZsYH8MhBKDMGZ2NDxuk/XQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-darwin-arm64": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.9.1.tgz", + "integrity": "sha512-LtYcLNM+bhsaKAIGwVkh5IOWhaZhjTfNOkGzGqdHvhiCUVuJDalvDxEdSnhFzAn+g23wgsycmZk1vbnaibZwwA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-darwin-x64": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.9.1.tgz", + "integrity": "sha512-KyP/byeXu9V+etKO6Lw3E4tW4QdcnzDG/ake031mg42lob5tN+5qfr+lkcT/SGZaH2PdW4Z1NX9GHEkZ8xV7og==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-linux-arm-gnueabihf": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.9.1.tgz", + "integrity": "sha512-Yqz/Doumf3QTKplwGNrCHe/B2p9xqDghBZSlAY0/hU6ikuDVQuOUIpDP/YcmoT+447tsZTmirmjgG3znvSCR0Q==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-gnu": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.9.1.tgz", + "integrity": "sha512-u3XkZVvxcvlAOlQJ3UsD1rFvLWqu4Ef/Ggl40WAVCuogf4S1nJPHh5RTgqYFpCOvuGJ7H5yGHabjFKEZGExk5Q==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-musl": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.9.1.tgz", + "integrity": "sha512-0XSYN/rfWShW+i+qjZ0phc6vZ7UWI8XWNz4E/l+6edFt+FxoEghrJHjX1EY/kcUGCnZzYYRCl31SNdfOi450Aw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-riscv64-gnu": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.9.1.tgz", + "integrity": "sha512-LmYIO65oZVfFt9t6cpYkbC4d5lKHLYv5B4CSHRpnANq0VZUQXGcCPXHzbCXCz4RQnx7jvlYB1ISVNCE/omz5cw==", + "cpu": [ + "riscv64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-gnu": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.9.1.tgz", + "integrity": "sha512-kr8rEPQ6ns/Lmr/hiw8sEVj9aa07gh1/tQF2Y5HrNCCEPiCBGnBUt9tVusrcBBiJfIt1yNaXN6r1CCmpbFEDpg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-musl": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.9.1.tgz", + "integrity": "sha512-t4QSR7gN+OEZLG0MiCgPqMWZGwmeHhsM4AkegJ0Kiy6TnJ9vZ8dEIwHw1LcZKhbHxTY32hp9eVCMdR3/I8MGRw==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-win32-arm64-msvc": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.9.1.tgz", + "integrity": "sha512-7XI4ZCBN34cb+BH557FJPmh0kmNz2c25SCQeT9OiFWEgf8+dL6ZwJ8f9RnUIit+j01u07Yvrsuu1rZGxJCc51g==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-ia32-msvc": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.9.1.tgz", + "integrity": "sha512-yE5c2j1lSWOH5jp+Q0qNL3Mdhr8WuqCNVjc6BxbVfS5cAS6zRmdiw7ktb8GNpDCEUJphILY6KACoFoRtKoqNQg==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-x64-msvc": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.9.1.tgz", + "integrity": "sha512-PyJsSsafjmIhVgaI1Zdj7m8BB8mMckFah/xbpplObyHfiXzKcI5UOUXRyOdHW7nz4DpMCuzLnF7v5IWHenCwYA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@types/babel__core": { + "version": "7.20.5", + "resolved": "https://registry.npmjs.org/@types/babel__core/-/babel__core-7.20.5.tgz", + "integrity": "sha512-qoQprZvz5wQFJwMDqeseRXWv3rqMvhgpbXFfVyWhbx9X47POIA6i/+dXefEmZKoAgOaTdaIgNSMqMIU61yRyzA==", + "dev": true, + "dependencies": { + "@babel/parser": "^7.20.7", + "@babel/types": "^7.20.7", + "@types/babel__generator": "*", + "@types/babel__template": "*", + "@types/babel__traverse": "*" + } + }, + "node_modules/@types/babel__generator": { + "version": "7.6.8", + "resolved": "https://registry.npmjs.org/@types/babel__generator/-/babel__generator-7.6.8.tgz", + "integrity": "sha512-ASsj+tpEDsEiFr1arWrlN6V3mdfjRMZt6LtK/Vp/kreFLnr5QH5+DhvD5nINYZXzwJvXeGq+05iUXcAzVrqWtw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.0.0" + } + }, + "node_modules/@types/babel__template": { + "version": "7.4.4", + "resolved": "https://registry.npmjs.org/@types/babel__template/-/babel__template-7.4.4.tgz", + "integrity": "sha512-h/NUaSyG5EyxBIp8YRxo4RMe2/qQgvyowRwVMzhYhBCONbW8PUsg4lkFMrhgZhUe5z3L3MiLDuvyJ/CaPa2A8A==", + "dev": true, + "dependencies": { + "@babel/parser": "^7.1.0", + "@babel/types": "^7.0.0" + } + }, + "node_modules/@types/babel__traverse": { + "version": "7.20.4", + "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.20.4.tgz", + "integrity": "sha512-mSM/iKUk5fDDrEV/e83qY+Cr3I1+Q3qqTuEn++HAWYjEa1+NxZr6CNrcJGf2ZTnq4HoFGC3zaTPZTobCzCFukA==", + "dev": true, + "dependencies": { + "@babel/types": "^7.20.7" + } + }, + "node_modules/@types/prop-types": { + "version": "15.7.11", + "resolved": "https://registry.npmjs.org/@types/prop-types/-/prop-types-15.7.11.tgz", + "integrity": "sha512-ga8y9v9uyeiLdpKddhxYQkxNDrfvuPrlFb0N1qnZZByvcElJaXthF1UhvCh9TLWJBEHeNtdnbysW7Y6Uq8CVng==", + "dev": true + }, + "node_modules/@types/react": { + "version": "18.2.45", + "resolved": "https://registry.npmjs.org/@types/react/-/react-18.2.45.tgz", + "integrity": "sha512-TtAxCNrlrBp8GoeEp1npd5g+d/OejJHFxS3OWmrPBMFaVQMSN0OFySozJio5BHxTuTeug00AVXVAjfDSfk+lUg==", + "dev": true, + "dependencies": { + "@types/prop-types": "*", + "@types/scheduler": "*", + "csstype": "^3.0.2" + } + }, + "node_modules/@types/react-dom": { + "version": "18.2.18", + "resolved": "https://registry.npmjs.org/@types/react-dom/-/react-dom-18.2.18.tgz", + "integrity": "sha512-TJxDm6OfAX2KJWJdMEVTwWke5Sc/E/RlnPGvGfS0W7+6ocy2xhDVQVh/KvC2Uf7kACs+gDytdusDSdWfWkaNzw==", + "dev": true, + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/scheduler": { + "version": "0.16.8", + "resolved": "https://registry.npmjs.org/@types/scheduler/-/scheduler-0.16.8.tgz", + "integrity": "sha512-WZLiwShhwLRmeV6zH+GkbOFT6Z6VklCItrDioxUnv+u4Ll+8vKeFySoFyK/0ctcRpOmwAicELfmys1sDc/Rw+A==", + "dev": true + }, + "node_modules/@ungap/structured-clone": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/@ungap/structured-clone/-/structured-clone-1.2.0.tgz", + "integrity": "sha512-zuVdFrMJiuCDQUMCzQaD6KL28MjnqqN8XnAqiEq9PNm/hCPTSGfrXCOfwj1ow4LFb/tNymJPwsNbVePc1xFqrQ==", + "dev": true + }, + "node_modules/@vitejs/plugin-react": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/@vitejs/plugin-react/-/plugin-react-4.2.1.tgz", + "integrity": "sha512-oojO9IDc4nCUUi8qIR11KoQm0XFFLIwsRBwHRR4d/88IWghn1y6ckz/bJ8GHDCsYEJee8mDzqtJxh15/cisJNQ==", + "dev": true, + "dependencies": { + "@babel/core": "^7.23.5", + "@babel/plugin-transform-react-jsx-self": "^7.23.3", + "@babel/plugin-transform-react-jsx-source": "^7.23.3", + "@types/babel__core": "^7.20.5", + "react-refresh": "^0.14.0" + }, + "engines": { + "node": "^14.18.0 || >=16.0.0" + }, + "peerDependencies": { + "vite": "^4.2.0 || ^5.0.0" + } + }, + "node_modules/acorn": { + "version": "8.11.2", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.11.2.tgz", + "integrity": "sha512-nc0Axzp/0FILLEVsm4fNwLCwMttvhEI263QtVPQcbpfZZ3ts0hLsZGOpE6czNlid7CJ9MlyH8reXkpsf3YUY4w==", + "dev": true, + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/acorn-jsx": { + "version": "5.3.2", + "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.3.2.tgz", + "integrity": "sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==", + "dev": true, + "peerDependencies": { + "acorn": "^6.0.0 || ^7.0.0 || ^8.0.0" + } + }, + "node_modules/ajv": { + "version": "6.12.6", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", + "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", + "dev": true, + "dependencies": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/epoberezkin" + } + }, + "node_modules/ansi-regex": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/ansi-styles": { + "version": "3.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", + "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", + "dev": true, + "dependencies": { + "color-convert": "^1.9.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/argparse": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz", + "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==", + "dev": true + }, + "node_modules/array-buffer-byte-length": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/array-buffer-byte-length/-/array-buffer-byte-length-1.0.0.tgz", + "integrity": "sha512-LPuwb2P+NrQw3XhxGc36+XSvuBPopovXYTR9Ew++Du9Yb/bx5AzBfrIsBoj0EZUifjQU+sHL21sseZ3jerWO/A==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "is-array-buffer": "^3.0.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array-includes": { + "version": "3.1.7", + "resolved": "https://registry.npmjs.org/array-includes/-/array-includes-3.1.7.tgz", + "integrity": "sha512-dlcsNBIiWhPkHdOEEKnehA+RNUWDc4UqFtnIXU4uuYDPtA4LDkr7qip2p0VvFAEXNDr0yWZ9PJyIRiGjRLQzwQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "get-intrinsic": "^1.2.1", + "is-string": "^1.0.7" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array.prototype.flat": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/array.prototype.flat/-/array.prototype.flat-1.3.2.tgz", + "integrity": "sha512-djYB+Zx2vLewY8RWlNCUdHjDXs2XOgm602S9E7P/UpHgfeHL00cRiIF+IN/G/aUJ7kGPb6yO/ErDI5V2s8iycA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "es-shim-unscopables": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array.prototype.flatmap": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/array.prototype.flatmap/-/array.prototype.flatmap-1.3.2.tgz", + "integrity": "sha512-Ewyx0c9PmpcsByhSW4r+9zDU7sGjFc86qf/kKtuSCRdhfbk0SNLLkaT5qvcHnRGgc5NP/ly/y+qkXkqONX54CQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "es-shim-unscopables": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array.prototype.tosorted": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/array.prototype.tosorted/-/array.prototype.tosorted-1.1.2.tgz", + "integrity": "sha512-HuQCHOlk1Weat5jzStICBCd83NxiIMwqDg/dHEsoefabn/hJRj5pVdWcPUSpRrwhwxZOsQassMpgN/xRYFBMIg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "es-shim-unscopables": "^1.0.0", + "get-intrinsic": "^1.2.1" + } + }, + "node_modules/arraybuffer.prototype.slice": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/arraybuffer.prototype.slice/-/arraybuffer.prototype.slice-1.0.2.tgz", + "integrity": "sha512-yMBKppFur/fbHu9/6USUe03bZ4knMYiwFBcyiaXB8Go0qNehwX6inYPzK9U0NeQvGxKthcmHcaR8P5MStSRBAw==", + "dev": true, + "dependencies": { + "array-buffer-byte-length": "^1.0.0", + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "get-intrinsic": "^1.2.1", + "is-array-buffer": "^3.0.2", + "is-shared-array-buffer": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/asynciterator.prototype": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/asynciterator.prototype/-/asynciterator.prototype-1.0.0.tgz", + "integrity": "sha512-wwHYEIS0Q80f5mosx3L/dfG5t5rjEa9Ft51GTaNt862EnpyGHpgz2RkZvLPp1oF5TnAiTohkEKVEu8pQPJI7Vg==", + "dev": true, + "dependencies": { + "has-symbols": "^1.0.3" + } + }, + "node_modules/asynckit": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", + "integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q==" + }, + "node_modules/available-typed-arrays": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/available-typed-arrays/-/available-typed-arrays-1.0.5.tgz", + "integrity": "sha512-DMD0KiN46eipeziST1LPP/STfDU0sufISXmjSgvVsoU2tqxctQeASejWcfNtxYKqETM1UxQ8sp2OrSBWpHY6sw==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/axios": { + "version": "1.6.2", + "resolved": "https://registry.npmjs.org/axios/-/axios-1.6.2.tgz", + "integrity": "sha512-7i24Ri4pmDRfJTR7LDBhsOTtcm+9kjX5WiY1X3wIisx6G9So3pfMkEiU7emUBe46oceVImccTEM3k6C5dbVW8A==", + "dependencies": { + "follow-redirects": "^1.15.0", + "form-data": "^4.0.0", + "proxy-from-env": "^1.1.0" + } + }, + "node_modules/balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", + "dev": true + }, + "node_modules/bootstrap": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/bootstrap/-/bootstrap-5.3.0.tgz", + "integrity": "sha512-UnBV3E3v4STVNQdms6jSGO2CvOkjUMdDAVR2V5N4uCMdaIkaQjbcEAMqRimDHIs4uqBYzDAKCQwCB+97tJgHQw==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/twbs" + }, + { + "type": "opencollective", + "url": "https://opencollective.com/bootstrap" + } + ], + "peerDependencies": { + "@popperjs/core": "^2.11.7" + } + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "dev": true, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/browserslist": { + "version": "4.22.2", + "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.22.2.tgz", + "integrity": "sha512-0UgcrvQmBDvZHFGdYUehrCNIazki7/lUP3kkoi/r3YB2amZbFM9J43ZRkJTXBUZK4gmx56+Sqk9+Vs9mwZx9+A==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "caniuse-lite": "^1.0.30001565", + "electron-to-chromium": "^1.4.601", + "node-releases": "^2.0.14", + "update-browserslist-db": "^1.0.13" + }, + "bin": { + "browserslist": "cli.js" + }, + "engines": { + "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" + } + }, + "node_modules/call-bind": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.5.tgz", + "integrity": "sha512-C3nQxfFZxFRVoJoGKKI8y3MOEo129NQ+FgQ08iye+Mk4zNZZGdjfs06bVTr+DBSlA66Q2VEcMki/cUCP4SercQ==", + "dev": true, + "dependencies": { + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.1", + "set-function-length": "^1.1.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/callsites": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz", + "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/caniuse-lite": { + "version": "1.0.30001571", + "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001571.tgz", + "integrity": "sha512-tYq/6MoXhdezDLFZuCO/TKboTzuQ/xR5cFdgXPfDtM7/kchBO3b4VWghE/OAi/DV7tTdhmLjZiZBZi1fA/GheQ==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/caniuse-lite" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ] + }, + "node_modules/chalk": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", + "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", + "dev": true, + "dependencies": { + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/color-convert": { + "version": "1.9.3", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", + "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", + "dev": true, + "dependencies": { + "color-name": "1.1.3" + } + }, + "node_modules/color-name": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", + "integrity": "sha512-72fSenhMw2HZMTVHeCA9KCmpEIbzWiQsjN+BHcBbS9vr1mtt+vJjPdksIBNUmKAW8TFUDPJK5SUU3QhE9NEXDw==", + "dev": true + }, + "node_modules/combined-stream": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz", + "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==", + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", + "dev": true + }, + "node_modules/convert-source-map": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-2.0.0.tgz", + "integrity": "sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg==", + "dev": true + }, + "node_modules/cross-spawn": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.3.tgz", + "integrity": "sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==", + "dev": true, + "dependencies": { + "path-key": "^3.1.0", + "shebang-command": "^2.0.0", + "which": "^2.0.1" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/csstype": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/csstype/-/csstype-3.1.3.tgz", + "integrity": "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw==", + "dev": true + }, + "node_modules/debug": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "dev": true, + "dependencies": { + "ms": "2.1.2" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/deep-is": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.4.tgz", + "integrity": "sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==", + "dev": true + }, + "node_modules/define-data-property": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.1.tgz", + "integrity": "sha512-E7uGkTzkk1d0ByLeSc6ZsFS79Axg+m1P/VsgYsxHgiuc3tFSj+MjMIwe90FC4lOAZzNBdY7kkO2P2wKdsQ1vgQ==", + "dev": true, + "dependencies": { + "get-intrinsic": "^1.2.1", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/define-properties": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.2.1.tgz", + "integrity": "sha512-8QmQKqEASLd5nx0U1B1okLElbUuuttJ/AnYmRXbbbGDWh6uS208EjD4Xqq/I9wK7u0v6O08XhTWnt5XtEbR6Dg==", + "dev": true, + "dependencies": { + "define-data-property": "^1.0.1", + "has-property-descriptors": "^1.0.0", + "object-keys": "^1.1.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/delayed-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz", + "integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/doctrine": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-3.0.0.tgz", + "integrity": "sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==", + "dev": true, + "dependencies": { + "esutils": "^2.0.2" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/electron-to-chromium": { + "version": "1.4.616", + "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.4.616.tgz", + "integrity": "sha512-1n7zWYh8eS0L9Uy+GskE0lkBUNK83cXTVJI0pU3mGprFsbfSdAc15VTFbo+A+Bq4pwstmL30AVcEU3Fo463lNg==", + "dev": true + }, + "node_modules/es-abstract": { + "version": "1.22.3", + "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.22.3.tgz", + "integrity": "sha512-eiiY8HQeYfYH2Con2berK+To6GrK2RxbPawDkGq4UiCQQfZHb6wX9qQqkbpPqaxQFcl8d9QzZqo0tGE0VcrdwA==", + "dev": true, + "dependencies": { + "array-buffer-byte-length": "^1.0.0", + "arraybuffer.prototype.slice": "^1.0.2", + "available-typed-arrays": "^1.0.5", + "call-bind": "^1.0.5", + "es-set-tostringtag": "^2.0.1", + "es-to-primitive": "^1.2.1", + "function.prototype.name": "^1.1.6", + "get-intrinsic": "^1.2.2", + "get-symbol-description": "^1.0.0", + "globalthis": "^1.0.3", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.0", + "has-proto": "^1.0.1", + "has-symbols": "^1.0.3", + "hasown": "^2.0.0", + "internal-slot": "^1.0.5", + "is-array-buffer": "^3.0.2", + "is-callable": "^1.2.7", + "is-negative-zero": "^2.0.2", + "is-regex": "^1.1.4", + "is-shared-array-buffer": "^1.0.2", + "is-string": "^1.0.7", + "is-typed-array": "^1.1.12", + "is-weakref": "^1.0.2", + "object-inspect": "^1.13.1", + "object-keys": "^1.1.1", + "object.assign": "^4.1.4", + "regexp.prototype.flags": "^1.5.1", + "safe-array-concat": "^1.0.1", + "safe-regex-test": "^1.0.0", + "string.prototype.trim": "^1.2.8", + "string.prototype.trimend": "^1.0.7", + "string.prototype.trimstart": "^1.0.7", + "typed-array-buffer": "^1.0.0", + "typed-array-byte-length": "^1.0.0", + "typed-array-byte-offset": "^1.0.0", + "typed-array-length": "^1.0.4", + "unbox-primitive": "^1.0.2", + "which-typed-array": "^1.1.13" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/es-iterator-helpers": { + "version": "1.0.15", + "resolved": "https://registry.npmjs.org/es-iterator-helpers/-/es-iterator-helpers-1.0.15.tgz", + "integrity": "sha512-GhoY8uYqd6iwUl2kgjTm4CZAf6oo5mHK7BPqx3rKgx893YSsy0LGHV6gfqqQvZt/8xM8xeOnfXBCfqclMKkJ5g==", + "dev": true, + "dependencies": { + "asynciterator.prototype": "^1.0.0", + "call-bind": "^1.0.2", + "define-properties": "^1.2.1", + "es-abstract": "^1.22.1", + "es-set-tostringtag": "^2.0.1", + "function-bind": "^1.1.1", + "get-intrinsic": "^1.2.1", + "globalthis": "^1.0.3", + "has-property-descriptors": "^1.0.0", + "has-proto": "^1.0.1", + "has-symbols": "^1.0.3", + "internal-slot": "^1.0.5", + "iterator.prototype": "^1.1.2", + "safe-array-concat": "^1.0.1" + } + }, + "node_modules/es-set-tostringtag": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/es-set-tostringtag/-/es-set-tostringtag-2.0.2.tgz", + "integrity": "sha512-BuDyupZt65P9D2D2vA/zqcI3G5xRsklm5N3xCwuiy+/vKy8i0ifdsQP1sLgO4tZDSCaQUSnmC48khknGMV3D2Q==", + "dev": true, + "dependencies": { + "get-intrinsic": "^1.2.2", + "has-tostringtag": "^1.0.0", + "hasown": "^2.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-shim-unscopables": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/es-shim-unscopables/-/es-shim-unscopables-1.0.2.tgz", + "integrity": "sha512-J3yBRXCzDu4ULnQwxyToo/OjdMx6akgVC7K6few0a7F/0wLtmKKN7I73AH5T2836UuXRqN7Qg+IIUw/+YJksRw==", + "dev": true, + "dependencies": { + "hasown": "^2.0.0" + } + }, + "node_modules/es-to-primitive": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz", + "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==", + "dev": true, + "dependencies": { + "is-callable": "^1.1.4", + "is-date-object": "^1.0.1", + "is-symbol": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/esbuild": { + "version": "0.19.10", + "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.19.10.tgz", + "integrity": "sha512-S1Y27QGt/snkNYrRcswgRFqZjaTG5a5xM3EQo97uNBnH505pdzSNe/HLBq1v0RO7iK/ngdbhJB6mDAp0OK+iUA==", + "dev": true, + "hasInstallScript": true, + "bin": { + "esbuild": "bin/esbuild" + }, + "engines": { + "node": ">=12" + }, + "optionalDependencies": { + "@esbuild/aix-ppc64": "0.19.10", + "@esbuild/android-arm": "0.19.10", + "@esbuild/android-arm64": "0.19.10", + "@esbuild/android-x64": "0.19.10", + "@esbuild/darwin-arm64": "0.19.10", + "@esbuild/darwin-x64": "0.19.10", + "@esbuild/freebsd-arm64": "0.19.10", + "@esbuild/freebsd-x64": "0.19.10", + "@esbuild/linux-arm": "0.19.10", + "@esbuild/linux-arm64": "0.19.10", + "@esbuild/linux-ia32": "0.19.10", + "@esbuild/linux-loong64": "0.19.10", + "@esbuild/linux-mips64el": "0.19.10", + "@esbuild/linux-ppc64": "0.19.10", + "@esbuild/linux-riscv64": "0.19.10", + "@esbuild/linux-s390x": "0.19.10", + "@esbuild/linux-x64": "0.19.10", + "@esbuild/netbsd-x64": "0.19.10", + "@esbuild/openbsd-x64": "0.19.10", + "@esbuild/sunos-x64": "0.19.10", + "@esbuild/win32-arm64": "0.19.10", + "@esbuild/win32-ia32": "0.19.10", + "@esbuild/win32-x64": "0.19.10" + } + }, + "node_modules/escalade": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.1.tgz", + "integrity": "sha512-k0er2gUkLf8O0zKJiAhmkTnJlTvINGv7ygDNPbeIsX/TJjGJZHuh9B2UxbsaEkmlEo9MfhrSzmhIlhRlI2GXnw==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/escape-string-regexp": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", + "integrity": "sha512-vbRorB5FUQWvla16U8R/qgaFIya2qGzwDrNmCZuYKrbdSUMG6I1ZCGQRefkRVhuOkIGVne7BQ35DSfo1qvJqFg==", + "dev": true, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/eslint": { + "version": "8.56.0", + "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.56.0.tgz", + "integrity": "sha512-Go19xM6T9puCOWntie1/P997aXxFsOi37JIHRWI514Hc6ZnaHGKY9xFhrU65RT6CcBEzZoGG1e6Nq+DT04ZtZQ==", + "dev": true, + "dependencies": { + "@eslint-community/eslint-utils": "^4.2.0", + "@eslint-community/regexpp": "^4.6.1", + "@eslint/eslintrc": "^2.1.4", + "@eslint/js": "8.56.0", + "@humanwhocodes/config-array": "^0.11.13", + "@humanwhocodes/module-importer": "^1.0.1", + "@nodelib/fs.walk": "^1.2.8", + "@ungap/structured-clone": "^1.2.0", + "ajv": "^6.12.4", + "chalk": "^4.0.0", + "cross-spawn": "^7.0.2", + "debug": "^4.3.2", + "doctrine": "^3.0.0", + "escape-string-regexp": "^4.0.0", + "eslint-scope": "^7.2.2", + "eslint-visitor-keys": "^3.4.3", + "espree": "^9.6.1", + "esquery": "^1.4.2", + "esutils": "^2.0.2", + "fast-deep-equal": "^3.1.3", + "file-entry-cache": "^6.0.1", + "find-up": "^5.0.0", + "glob-parent": "^6.0.2", + "globals": "^13.19.0", + "graphemer": "^1.4.0", + "ignore": "^5.2.0", + "imurmurhash": "^0.1.4", + "is-glob": "^4.0.0", + "is-path-inside": "^3.0.3", + "js-yaml": "^4.1.0", + "json-stable-stringify-without-jsonify": "^1.0.1", + "levn": "^0.4.1", + "lodash.merge": "^4.6.2", + "minimatch": "^3.1.2", + "natural-compare": "^1.4.0", + "optionator": "^0.9.3", + "strip-ansi": "^6.0.1", + "text-table": "^0.2.0" + }, + "bin": { + "eslint": "bin/eslint.js" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/eslint-plugin-react": { + "version": "7.33.2", + "resolved": "https://registry.npmjs.org/eslint-plugin-react/-/eslint-plugin-react-7.33.2.tgz", + "integrity": "sha512-73QQMKALArI8/7xGLNI/3LylrEYrlKZSb5C9+q3OtOewTnMQi5cT+aE9E41sLCmli3I9PGGmD1yiZydyo4FEPw==", + "dev": true, + "dependencies": { + "array-includes": "^3.1.6", + "array.prototype.flatmap": "^1.3.1", + "array.prototype.tosorted": "^1.1.1", + "doctrine": "^2.1.0", + "es-iterator-helpers": "^1.0.12", + "estraverse": "^5.3.0", + "jsx-ast-utils": "^2.4.1 || ^3.0.0", + "minimatch": "^3.1.2", + "object.entries": "^1.1.6", + "object.fromentries": "^2.0.6", + "object.hasown": "^1.1.2", + "object.values": "^1.1.6", + "prop-types": "^15.8.1", + "resolve": "^2.0.0-next.4", + "semver": "^6.3.1", + "string.prototype.matchall": "^4.0.8" + }, + "engines": { + "node": ">=4" + }, + "peerDependencies": { + "eslint": "^3 || ^4 || ^5 || ^6 || ^7 || ^8" + } + }, + "node_modules/eslint-plugin-react-hooks": { + "version": "4.6.0", + "resolved": "https://registry.npmjs.org/eslint-plugin-react-hooks/-/eslint-plugin-react-hooks-4.6.0.tgz", + "integrity": "sha512-oFc7Itz9Qxh2x4gNHStv3BqJq54ExXmfC+a1NjAta66IAN87Wu0R/QArgIS9qKzX3dXKPI9H5crl9QchNMY9+g==", + "dev": true, + "engines": { + "node": ">=10" + }, + "peerDependencies": { + "eslint": "^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0 || ^7.0.0 || ^8.0.0-0" + } + }, + "node_modules/eslint-plugin-react-refresh": { + "version": "0.4.5", + "resolved": "https://registry.npmjs.org/eslint-plugin-react-refresh/-/eslint-plugin-react-refresh-0.4.5.tgz", + "integrity": "sha512-D53FYKJa+fDmZMtriODxvhwrO+IOqrxoEo21gMA0sjHdU6dPVH4OhyFip9ypl8HOF5RV5KdTo+rBQLvnY2cO8w==", + "dev": true, + "peerDependencies": { + "eslint": ">=7" + } + }, + "node_modules/eslint-plugin-react/node_modules/doctrine": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-2.1.0.tgz", + "integrity": "sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==", + "dev": true, + "dependencies": { + "esutils": "^2.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/eslint-scope": { + "version": "7.2.2", + "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.2.tgz", + "integrity": "sha512-dOt21O7lTMhDM+X9mB4GX+DZrZtCUJPL/wlcTqxyrx5IvO0IYtILdtrQGQp+8n5S0gwSVmOf9NQrjMOgfQZlIg==", + "dev": true, + "dependencies": { + "esrecurse": "^4.3.0", + "estraverse": "^5.2.0" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/eslint-visitor-keys": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz", + "integrity": "sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==", + "dev": true, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/eslint/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dev": true, + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/chalk/ansi-styles?sponsor=1" + } + }, + "node_modules/eslint/node_modules/chalk": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz", + "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==", + "dev": true, + "dependencies": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/chalk/chalk?sponsor=1" + } + }, + "node_modules/eslint/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dev": true, + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/eslint/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", + "dev": true + }, + "node_modules/eslint/node_modules/escape-string-regexp": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz", + "integrity": "sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/eslint/node_modules/globals": { + "version": "13.24.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz", + "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==", + "dev": true, + "dependencies": { + "type-fest": "^0.20.2" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/eslint/node_modules/has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/eslint/node_modules/supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dev": true, + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/espree": { + "version": "9.6.1", + "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.1.tgz", + "integrity": "sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==", + "dev": true, + "dependencies": { + "acorn": "^8.9.0", + "acorn-jsx": "^5.3.2", + "eslint-visitor-keys": "^3.4.1" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/esquery": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.5.0.tgz", + "integrity": "sha512-YQLXUplAwJgCydQ78IMJywZCceoqk1oH01OERdSAJc/7U2AylwjhSCLDEtqwg811idIS/9fIU5GjG73IgjKMVg==", + "dev": true, + "dependencies": { + "estraverse": "^5.1.0" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/esrecurse": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz", + "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==", + "dev": true, + "dependencies": { + "estraverse": "^5.2.0" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/estraverse": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.3.0.tgz", + "integrity": "sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==", + "dev": true, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/esutils": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", + "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/fast-deep-equal": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", + "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==", + "dev": true + }, + "node_modules/fast-json-stable-stringify": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", + "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==", + "dev": true + }, + "node_modules/fast-levenshtein": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz", + "integrity": "sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==", + "dev": true + }, + "node_modules/fastq": { + "version": "1.16.0", + "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.16.0.tgz", + "integrity": "sha512-ifCoaXsDrsdkWTtiNJX5uzHDsrck5TzfKKDcuFFTIrrc/BS076qgEIfoIy1VeZqViznfKiysPYTh/QeHtnIsYA==", + "dev": true, + "dependencies": { + "reusify": "^1.0.4" + } + }, + "node_modules/file-entry-cache": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-6.0.1.tgz", + "integrity": "sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==", + "dev": true, + "dependencies": { + "flat-cache": "^3.0.4" + }, + "engines": { + "node": "^10.12.0 || >=12.0.0" + } + }, + "node_modules/find-up": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-5.0.0.tgz", + "integrity": "sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==", + "dev": true, + "dependencies": { + "locate-path": "^6.0.0", + "path-exists": "^4.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/flat-cache": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-3.2.0.tgz", + "integrity": "sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==", + "dev": true, + "dependencies": { + "flatted": "^3.2.9", + "keyv": "^4.5.3", + "rimraf": "^3.0.2" + }, + "engines": { + "node": "^10.12.0 || >=12.0.0" + } + }, + "node_modules/flatted": { + "version": "3.2.9", + "resolved": "https://registry.npmjs.org/flatted/-/flatted-3.2.9.tgz", + "integrity": "sha512-36yxDn5H7OFZQla0/jFJmbIKTdZAQHngCedGxiMmpNfEZM0sdEeT+WczLQrjK6D7o2aiyLYDnkw0R3JK0Qv1RQ==", + "dev": true + }, + "node_modules/follow-redirects": { + "version": "1.15.3", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.15.3.tgz", + "integrity": "sha512-1VzOtuEM8pC9SFU1E+8KfTjZyMztRsgEfwQl44z8A25uy13jSzTj6dyK2Df52iV0vgHCfBwLhDWevLn95w5v6Q==", + "funding": [ + { + "type": "individual", + "url": "https://github.com/sponsors/RubenVerborgh" + } + ], + "engines": { + "node": ">=4.0" + }, + "peerDependenciesMeta": { + "debug": { + "optional": true + } + } + }, + "node_modules/for-each": { + "version": "0.3.3", + "resolved": "https://registry.npmjs.org/for-each/-/for-each-0.3.3.tgz", + "integrity": "sha512-jqYfLp7mo9vIyQf8ykW2v7A+2N4QjeCeI5+Dz9XraiO1ign81wjiH7Fb9vSOWvQfNtmSa4H2RoQTrrXivdUZmw==", + "dev": true, + "dependencies": { + "is-callable": "^1.1.3" + } + }, + "node_modules/form-data": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/form-data/-/form-data-4.0.0.tgz", + "integrity": "sha512-ETEklSGi5t0QMZuiXoA/Q6vcnxcLQP5vdugSpuAyi6SVGi2clPPp+xgEhuMaHC+zGgn31Kd235W35f7Hykkaww==", + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.8", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw==", + "dev": true + }, + "node_modules/fsevents": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz", + "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==", + "dev": true, + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/function.prototype.name": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/function.prototype.name/-/function.prototype.name-1.1.6.tgz", + "integrity": "sha512-Z5kx79swU5P27WEayXM1tBi5Ze/lbIyiNgU3qyXUOf9b2rgXYyF9Dy9Cx+IQv/Lc8WCG6L82zwUPpSS9hGehIg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "functions-have-names": "^1.2.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/functions-have-names": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/functions-have-names/-/functions-have-names-1.2.3.tgz", + "integrity": "sha512-xckBUXyTIqT97tq2x2AMb+g163b5JFysYk0x4qxNFwbfQkmNZoiRHb6sPzI9/QV33WeuvVYBUIiD4NzNIyqaRQ==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gensync": { + "version": "1.0.0-beta.2", + "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.2.tgz", + "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/get-intrinsic": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.2.tgz", + "integrity": "sha512-0gSo4ml/0j98Y3lngkFEot/zhiCeWsbYIlZ+uZOVgzLyLaUw7wxUL+nCTP0XJvJg1AXulJRI3UJi8GsbDuxdGA==", + "dev": true, + "dependencies": { + "function-bind": "^1.1.2", + "has-proto": "^1.0.1", + "has-symbols": "^1.0.3", + "hasown": "^2.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-symbol-description": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/get-symbol-description/-/get-symbol-description-1.0.0.tgz", + "integrity": "sha512-2EmdH1YvIQiZpltCNgkuiUnyukzxM/R6NDJX31Ke3BG1Nq5b0S2PhX59UKi9vZpPDQVdqn+1IcaAwnzTT5vCjw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "get-intrinsic": "^1.1.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/glob": { + "version": "7.2.3", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.2.3.tgz", + "integrity": "sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q==", + "dev": true, + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.1.1", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/glob-parent": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz", + "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.3" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/globals": { + "version": "11.12.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", + "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/globalthis": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/globalthis/-/globalthis-1.0.3.tgz", + "integrity": "sha512-sFdI5LyBiNTHjRd7cGPWapiHWMOXKyuBNX/cWJ3NfzrZQVa8GI/8cofCl74AOVqq9W5kNmguTIzJ/1s2gyI9wA==", + "dev": true, + "dependencies": { + "define-properties": "^1.1.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gopd": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz", + "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==", + "dev": true, + "dependencies": { + "get-intrinsic": "^1.1.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/graphemer": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/graphemer/-/graphemer-1.4.0.tgz", + "integrity": "sha512-EtKwoO6kxCL9WO5xipiHTZlSzBm7WLT627TqC/uVRd0HKmq8NXyebnNYxDoBi7wt8eTWrUrKXCOVaFq9x1kgag==", + "dev": true + }, + "node_modules/has-bigints": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/has-bigints/-/has-bigints-1.0.2.tgz", + "integrity": "sha512-tSvCKtBr9lkF0Ex0aQiP9N+OpV4zi2r/Nee5VkRDbaqv35RLYMzbwQfFSZZH0kR+Rd6302UJZ2p/bJCEoR3VoQ==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-flag": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", + "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/has-property-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.1.tgz", + "integrity": "sha512-VsX8eaIewvas0xnvinAe9bw4WfIeODpGYikiWYLH+dma0Jw6KHYqWiWfhQlgOVK8D6PvjubK5Uc4P0iIhIcNVg==", + "dev": true, + "dependencies": { + "get-intrinsic": "^1.2.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-proto": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.1.tgz", + "integrity": "sha512-7qE+iP+O+bgF9clE5+UoBFzE65mlBiVj3tKCrlNQ0Ogwm0BjpT/gK4SlLYDMybDh5I3TCTKnPPa0oMG7JDYrhg==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-symbols": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz", + "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-tostringtag": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/has-tostringtag/-/has-tostringtag-1.0.0.tgz", + "integrity": "sha512-kFjcSNhnlGV1kyoGk7OXKSawH5JOb/LzUc5w9B02hOTO0dfFRjbHQKvg1d6cf3HbeUmtU9VbbV3qzZ2Teh97WQ==", + "dev": true, + "dependencies": { + "has-symbols": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/hasown": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.0.tgz", + "integrity": "sha512-vUptKVTpIJhcczKBbgnS+RtcuYMB8+oNzPK2/Hp3hanz8JmpATdmmgLgSaadVREkDm+e2giHwY3ZRkyjSIDDFA==", + "dev": true, + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/ignore": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/ignore/-/ignore-5.3.0.tgz", + "integrity": "sha512-g7dmpshy+gD7mh88OC9NwSGTKoc3kyLAZQRU1mt53Aw/vnvfXnbC+F/7F7QoYVKbV+KNvJx8wArewKy1vXMtlg==", + "dev": true, + "engines": { + "node": ">= 4" + } + }, + "node_modules/import-fresh": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.0.tgz", + "integrity": "sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw==", + "dev": true, + "dependencies": { + "parent-module": "^1.0.0", + "resolve-from": "^4.0.0" + }, + "engines": { + "node": ">=6" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/imurmurhash": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", + "integrity": "sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA==", + "dev": true, + "engines": { + "node": ">=0.8.19" + } + }, + "node_modules/inflight": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", + "integrity": "sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA==", + "dev": true, + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "dev": true + }, + "node_modules/internal-slot": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/internal-slot/-/internal-slot-1.0.6.tgz", + "integrity": "sha512-Xj6dv+PsbtwyPpEflsejS+oIZxmMlV44zAhG479uYu89MsjcYOhCFnNyKrkJrihbsiasQyY0afoCl/9BLR65bg==", + "dev": true, + "dependencies": { + "get-intrinsic": "^1.2.2", + "hasown": "^2.0.0", + "side-channel": "^1.0.4" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-array-buffer": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/is-array-buffer/-/is-array-buffer-3.0.2.tgz", + "integrity": "sha512-y+FyyR/w8vfIRq4eQcM1EYgSTnmHXPqaF+IgzgraytCFq5Xh8lllDVmAZolPJiZttZLeFSINPYMaEJ7/vWUa1w==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "get-intrinsic": "^1.2.0", + "is-typed-array": "^1.1.10" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-async-function": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-async-function/-/is-async-function-2.0.0.tgz", + "integrity": "sha512-Y1JXKrfykRJGdlDwdKlLpLyMIiWqWvuSd17TvZk68PLAOGOoF4Xyav1z0Xhoi+gCYjZVeC5SI+hYFOfvXmGRCA==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-bigint": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/is-bigint/-/is-bigint-1.0.4.tgz", + "integrity": "sha512-zB9CruMamjym81i2JZ3UMn54PKGsQzsJeo6xvN3HJJ4CAsQNB6iRutp2To77OfCNuoxspsIhzaPoO1zyCEhFOg==", + "dev": true, + "dependencies": { + "has-bigints": "^1.0.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-boolean-object": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/is-boolean-object/-/is-boolean-object-1.1.2.tgz", + "integrity": "sha512-gDYaKHJmnj4aWxyj6YHyXVpdQawtVLHU5cb+eztPGczf6cjuTdwve5ZIEfgXqH4e57An1D1AKf8CZ3kYrQRqYA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-callable": { + "version": "1.2.7", + "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.2.7.tgz", + "integrity": "sha512-1BC0BVFhS/p0qtw6enp8e+8OD0UrK0oFLztSjNzhcKA3WDuJxxAPXzPuPtKkjEY9UUoEWlX/8fgKeu2S8i9JTA==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-core-module": { + "version": "2.13.1", + "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.13.1.tgz", + "integrity": "sha512-hHrIjvZsftOsvKSn2TRYl63zvxsgE0K+0mYMoH6gD4omR5IWB2KynivBQczo3+wF1cCkjzvptnI9Q0sPU66ilw==", + "dev": true, + "dependencies": { + "hasown": "^2.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-date-object": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.5.tgz", + "integrity": "sha512-9YQaSxsAiSwcvS33MBk3wTCVnWK+HhF8VZR2jRxehM16QcVOdHqPn4VPHmRK4lSr38n9JriurInLcP90xsYNfQ==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-finalizationregistry": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-finalizationregistry/-/is-finalizationregistry-1.0.2.tgz", + "integrity": "sha512-0by5vtUJs8iFQb5TYUHHPudOR+qXYIMKtiUzvLIZITZUjknFmziyBJuLhVRc+Ds0dREFlskDNJKYIdIzu/9pfw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-generator-function": { + "version": "1.0.10", + "resolved": "https://registry.npmjs.org/is-generator-function/-/is-generator-function-1.0.10.tgz", + "integrity": "sha512-jsEjy9l3yiXEQ+PsXdmBwEPcOxaXWLspKdplFUVI9vq1iZgIekeC0L167qeu86czQaxed3q/Uzuw0swL0irL8A==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dev": true, + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-map": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/is-map/-/is-map-2.0.2.tgz", + "integrity": "sha512-cOZFQQozTha1f4MxLFzlgKYPTyj26picdZTx82hbc/Xf4K/tZOOXSCkMvU4pKioRXGDLJRn0GM7Upe7kR721yg==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-negative-zero": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.2.tgz", + "integrity": "sha512-dqJvarLawXsFbNDeJW7zAz8ItJ9cd28YufuuFzh0G8pNHjJMnY08Dv7sYX2uF5UpQOwieAeOExEYAWWfu7ZZUA==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-number-object": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/is-number-object/-/is-number-object-1.0.7.tgz", + "integrity": "sha512-k1U0IRzLMo7ZlYIfzRu23Oh6MiIFasgpb9X76eqfFZAqwH44UI4KTBvBYIZ1dSL9ZzChTB9ShHfLkR4pdW5krQ==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-path-inside": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-3.0.3.tgz", + "integrity": "sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-regex": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.4.tgz", + "integrity": "sha512-kvRdxDsxZjhzUX07ZnLydzS1TU/TJlTUHHY4YLL87e37oUA49DfkLqgy+VjFocowy29cKvcSiu+kIv728jTTVg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-set": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/is-set/-/is-set-2.0.2.tgz", + "integrity": "sha512-+2cnTEZeY5z/iXGbLhPrOAaK/Mau5k5eXq9j14CpRTftq0pAJu2MwVRSZhyZWBzx3o6X795Lz6Bpb6R0GKf37g==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-shared-array-buffer": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-shared-array-buffer/-/is-shared-array-buffer-1.0.2.tgz", + "integrity": "sha512-sqN2UDu1/0y6uvXyStCOzyhAjCSlHceFoMKJW8W9EU9cvic/QdsZ0kEU93HEy3IUEFZIiH/3w+AH/UQbPHNdhA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-string": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/is-string/-/is-string-1.0.7.tgz", + "integrity": "sha512-tE2UXzivje6ofPW7l23cjDOMa09gb7xlAqG6jG5ej6uPV32TlWP3NKPigtaGeHNu9fohccRYvIiZMfOOnOYUtg==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-symbol": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.4.tgz", + "integrity": "sha512-C/CPBqKWnvdcxqIARxyOh4v1UUEOCHpgDa0WYgpKDFMszcrPcffg5uhwSgPCLD2WWxmq6isisz87tzT01tuGhg==", + "dev": true, + "dependencies": { + "has-symbols": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-typed-array": { + "version": "1.1.12", + "resolved": "https://registry.npmjs.org/is-typed-array/-/is-typed-array-1.1.12.tgz", + "integrity": "sha512-Z14TF2JNG8Lss5/HMqt0//T9JeHXttXy5pH/DBU4vi98ozO2btxzq9MwYDZYnKwU8nRsz/+GVFVRDq3DkVuSPg==", + "dev": true, + "dependencies": { + "which-typed-array": "^1.1.11" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-weakmap": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/is-weakmap/-/is-weakmap-2.0.1.tgz", + "integrity": "sha512-NSBR4kH5oVj1Uwvv970ruUkCV7O1mzgVFO4/rev2cLRda9Tm9HrL70ZPut4rOHgY0FNrUu9BCbXA2sdQ+x0chA==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-weakref": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-weakref/-/is-weakref-1.0.2.tgz", + "integrity": "sha512-qctsuLZmIQ0+vSSMfoVvyFe2+GSEvnmZ2ezTup1SBse9+twCCeial6EEi3Nc2KFcf6+qz2FBPnjXsk8xhKSaPQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-weakset": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/is-weakset/-/is-weakset-2.0.2.tgz", + "integrity": "sha512-t2yVvttHkQktwnNNmBQ98AhENLdPUTDTE21uPqAQ0ARwQfGeQKRVS0NNurH7bTf7RrvcVn1OOge45CnBeHCSmg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "get-intrinsic": "^1.1.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/isarray": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.5.tgz", + "integrity": "sha512-xHjhDr3cNBK0BzdUJSPXZntQUx/mwMS5Rw4A7lPJ90XGAO6ISP/ePDNuo0vhqOZU+UD5JoodwCAAoZQd3FeAKw==", + "dev": true + }, + "node_modules/isexe": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", + "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==", + "dev": true + }, + "node_modules/iterator.prototype": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/iterator.prototype/-/iterator.prototype-1.1.2.tgz", + "integrity": "sha512-DR33HMMr8EzwuRL8Y9D3u2BMj8+RqSE850jfGu59kS7tbmPLzGkZmVSfyCFSDxuZiEY6Rzt3T2NA/qU+NwVj1w==", + "dev": true, + "dependencies": { + "define-properties": "^1.2.1", + "get-intrinsic": "^1.2.1", + "has-symbols": "^1.0.3", + "reflect.getprototypeof": "^1.0.4", + "set-function-name": "^2.0.1" + } + }, + "node_modules/js-tokens": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", + "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==" + }, + "node_modules/js-yaml": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.0.tgz", + "integrity": "sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==", + "dev": true, + "dependencies": { + "argparse": "^2.0.1" + }, + "bin": { + "js-yaml": "bin/js-yaml.js" + } + }, + "node_modules/jsesc": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", + "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", + "dev": true, + "bin": { + "jsesc": "bin/jsesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/json-buffer": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/json-buffer/-/json-buffer-3.0.1.tgz", + "integrity": "sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==", + "dev": true + }, + "node_modules/json-schema-traverse": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", + "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==", + "dev": true + }, + "node_modules/json-stable-stringify-without-jsonify": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz", + "integrity": "sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==", + "dev": true + }, + "node_modules/json5": { + "version": "2.2.3", + "resolved": "https://registry.npmjs.org/json5/-/json5-2.2.3.tgz", + "integrity": "sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg==", + "dev": true, + "bin": { + "json5": "lib/cli.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/jsx-ast-utils": { + "version": "3.3.5", + "resolved": "https://registry.npmjs.org/jsx-ast-utils/-/jsx-ast-utils-3.3.5.tgz", + "integrity": "sha512-ZZow9HBI5O6EPgSJLUb8n2NKgmVWTwCvHGwFuJlMjvLFqlGG6pjirPhtdsseaLZjSibD8eegzmYpUZwoIlj2cQ==", + "dev": true, + "dependencies": { + "array-includes": "^3.1.6", + "array.prototype.flat": "^1.3.1", + "object.assign": "^4.1.4", + "object.values": "^1.1.6" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/keyv": { + "version": "4.5.4", + "resolved": "https://registry.npmjs.org/keyv/-/keyv-4.5.4.tgz", + "integrity": "sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==", + "dev": true, + "dependencies": { + "json-buffer": "3.0.1" + } + }, + "node_modules/levn": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/levn/-/levn-0.4.1.tgz", + "integrity": "sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==", + "dev": true, + "dependencies": { + "prelude-ls": "^1.2.1", + "type-check": "~0.4.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/locate-path": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-6.0.0.tgz", + "integrity": "sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==", + "dev": true, + "dependencies": { + "p-locate": "^5.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/lodash.merge": { + "version": "4.6.2", + "resolved": "https://registry.npmjs.org/lodash.merge/-/lodash.merge-4.6.2.tgz", + "integrity": "sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==", + "dev": true + }, + "node_modules/loose-envify": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", + "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", + "dependencies": { + "js-tokens": "^3.0.0 || ^4.0.0" + }, + "bin": { + "loose-envify": "cli.js" + } + }, + "node_modules/lru-cache": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", + "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", + "dev": true, + "dependencies": { + "yallist": "^3.0.2" + } + }, + "node_modules/mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "dependencies": { + "mime-db": "1.52.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dev": true, + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "dev": true + }, + "node_modules/nanoid": { + "version": "3.3.7", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.7.tgz", + "integrity": "sha512-eSRppjcPIatRIMC1U6UngP8XFcz8MQWGQdt1MTBQ7NaAmvXDfvNxbvWV3x2y6CdEUciCSsDHDQZbhYaB8QEo2g==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "bin": { + "nanoid": "bin/nanoid.cjs" + }, + "engines": { + "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" + } + }, + "node_modules/natural-compare": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/natural-compare/-/natural-compare-1.4.0.tgz", + "integrity": "sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==", + "dev": true + }, + "node_modules/node-releases": { + "version": "2.0.14", + "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.14.tgz", + "integrity": "sha512-y10wOWt8yZpqXmOgRo77WaHEmhYQYGNA6y421PKsKYWEK8aW+cqAphborZDhqfyKrbZEN92CN1X2KbafY2s7Yw==", + "dev": true + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-inspect": { + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.1.tgz", + "integrity": "sha512-5qoj1RUiKOMsCCNLV1CBiPYE10sziTsnmNxkAI/rZhiD63CF7IqdFGC/XzjWjpSgLf0LxXX3bDFIh0E18f6UhQ==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/object-keys": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz", + "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==", + "dev": true, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object.assign": { + "version": "4.1.5", + "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.5.tgz", + "integrity": "sha512-byy+U7gp+FVwmyzKPYhW2h5l3crpmGsxl7X2s8y43IgxvG4g3QZ6CffDtsNQy1WsmZpQbO+ybo0AlW7TY6DcBQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.5", + "define-properties": "^1.2.1", + "has-symbols": "^1.0.3", + "object-keys": "^1.1.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/object.entries": { + "version": "1.1.7", + "resolved": "https://registry.npmjs.org/object.entries/-/object.entries-1.1.7.tgz", + "integrity": "sha512-jCBs/0plmPsOnrKAfFQXRG2NFjlhZgjjcBLSmTnEhU8U6vVTsVe8ANeQJCHTl3gSsI4J+0emOoCgoKlmQPMgmA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object.fromentries": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/object.fromentries/-/object.fromentries-2.0.7.tgz", + "integrity": "sha512-UPbPHML6sL8PI/mOqPwsH4G6iyXcCGzLin8KvEPenOZN5lpCNBZZQ+V62vdjB1mQHrmqGQt5/OJzemUA+KJmEA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/object.hasown": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/object.hasown/-/object.hasown-1.1.3.tgz", + "integrity": "sha512-fFI4VcYpRHvSLXxP7yiZOMAd331cPfd2p7PFDVbgUsYOfCT3tICVqXWngbjr4m49OvsBwUBQ6O2uQoJvy3RexA==", + "dev": true, + "dependencies": { + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/object.values": { + "version": "1.1.7", + "resolved": "https://registry.npmjs.org/object.values/-/object.values-1.1.7.tgz", + "integrity": "sha512-aU6xnDFYT3x17e/f0IiiwlGPTy2jzMySGfUB4fq6z7CV8l85CWHDk5ErhyhpfDHhrOMwGFhSQkhMGHaIotA6Ng==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==", + "dev": true, + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/optionator": { + "version": "0.9.3", + "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.3.tgz", + "integrity": "sha512-JjCoypp+jKn1ttEFExxhetCKeJt9zhAgAve5FXHixTvFDW/5aEktX9bufBKLRRMdU7bNtpLfcGu94B3cdEJgjg==", + "dev": true, + "dependencies": { + "@aashutoshrathi/word-wrap": "^1.2.3", + "deep-is": "^0.1.3", + "fast-levenshtein": "^2.0.6", + "levn": "^0.4.1", + "prelude-ls": "^1.2.1", + "type-check": "^0.4.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/p-limit": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-3.1.0.tgz", + "integrity": "sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==", + "dev": true, + "dependencies": { + "yocto-queue": "^0.1.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/p-locate": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-5.0.0.tgz", + "integrity": "sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==", + "dev": true, + "dependencies": { + "p-limit": "^3.0.2" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/parent-module": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/parent-module/-/parent-module-1.0.1.tgz", + "integrity": "sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==", + "dev": true, + "dependencies": { + "callsites": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/path-is-absolute": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "integrity": "sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/path-key": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz", + "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/path-parse": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz", + "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==", + "dev": true + }, + "node_modules/picocolors": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.0.0.tgz", + "integrity": "sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==", + "dev": true + }, + "node_modules/postcss": { + "version": "8.4.32", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.32.tgz", + "integrity": "sha512-D/kj5JNu6oo2EIy+XL/26JEDTlIbB8hw85G8StOE6L74RQAVVP5rej6wxCNqyMbR4RkPfqvezVbPw81Ngd6Kcw==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/postcss" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "nanoid": "^3.3.7", + "picocolors": "^1.0.0", + "source-map-js": "^1.0.2" + }, + "engines": { + "node": "^10 || ^12 || >=14" + } + }, + "node_modules/prelude-ls": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.2.1.tgz", + "integrity": "sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==", + "dev": true, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/prop-types": { + "version": "15.8.1", + "resolved": "https://registry.npmjs.org/prop-types/-/prop-types-15.8.1.tgz", + "integrity": "sha512-oj87CgZICdulUohogVAR7AjlC0327U4el4L6eAvOqCeudMDVU0NThNaV+b9Df4dXgSP1gXMTnPdhfe/2qDH5cg==", + "dev": true, + "dependencies": { + "loose-envify": "^1.4.0", + "object-assign": "^4.1.1", + "react-is": "^16.13.1" + } + }, + "node_modules/proxy-from-env": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz", + "integrity": "sha512-D+zkORCbA9f1tdWRK0RaCR3GPv50cMxcrz4X8k5LTSUD1Dkw47mKJEZQNunItRTkWwgtaUSo1RVFRIG9ZXiFYg==" + }, + "node_modules/punycode": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.3.1.tgz", + "integrity": "sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/queue-microtask": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz", + "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ] + }, + "node_modules/react": { + "version": "18.2.0", + "resolved": "https://registry.npmjs.org/react/-/react-18.2.0.tgz", + "integrity": "sha512-/3IjMdb2L9QbBdWiW5e3P2/npwMBaU9mHCSCUzNln0ZCYbcfTsGbTJrU/kGemdH2IWmB2ioZ+zkxtmq6g09fGQ==", + "dependencies": { + "loose-envify": "^1.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/react-dom": { + "version": "18.2.0", + "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-18.2.0.tgz", + "integrity": "sha512-6IMTriUmvsjHUjNtEDudZfuDQUoWXVxKHhlEGSk81n4YFS+r/Kl99wXiwlVXtPBtJenozv2P+hxDsw9eA7Xo6g==", + "dependencies": { + "loose-envify": "^1.1.0", + "scheduler": "^0.23.0" + }, + "peerDependencies": { + "react": "^18.2.0" + } + }, + "node_modules/react-is": { + "version": "16.13.1", + "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.1.tgz", + "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==", + "dev": true + }, + "node_modules/react-refresh": { + "version": "0.14.0", + "resolved": "https://registry.npmjs.org/react-refresh/-/react-refresh-0.14.0.tgz", + "integrity": "sha512-wViHqhAd8OHeLS/IRMJjTSDHF3U9eWi62F/MledQGPdJGDhodXJ9PBLNGr6WWL7qlH12Mt3TyTpbS+hGXMjCzQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/react-router": { + "version": "6.21.1", + "resolved": "https://registry.npmjs.org/react-router/-/react-router-6.21.1.tgz", + "integrity": "sha512-W0l13YlMTm1YrpVIOpjCADJqEUpz1vm+CMo47RuFX4Ftegwm6KOYsL5G3eiE52jnJpKvzm6uB/vTKTPKM8dmkA==", + "dependencies": { + "@remix-run/router": "1.14.1" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "react": ">=16.8" + } + }, + "node_modules/react-router-dom": { + "version": "6.21.1", + "resolved": "https://registry.npmjs.org/react-router-dom/-/react-router-dom-6.21.1.tgz", + "integrity": "sha512-QCNrtjtDPwHDO+AO21MJd7yIcr41UetYt5jzaB9Y1UYaPTCnVuJq6S748g1dE11OQlCFIQg+RtAA1SEZIyiBeA==", + "dependencies": { + "@remix-run/router": "1.14.1", + "react-router": "6.21.1" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "react": ">=16.8", + "react-dom": ">=16.8" + } + }, + "node_modules/reflect.getprototypeof": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/reflect.getprototypeof/-/reflect.getprototypeof-1.0.4.tgz", + "integrity": "sha512-ECkTw8TmJwW60lOTR+ZkODISW6RQ8+2CL3COqtiJKLd6MmB45hN51HprHFziKLGkAuTGQhBb91V8cy+KHlaCjw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "get-intrinsic": "^1.2.1", + "globalthis": "^1.0.3", + "which-builtin-type": "^1.1.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/regexp.prototype.flags": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/regexp.prototype.flags/-/regexp.prototype.flags-1.5.1.tgz", + "integrity": "sha512-sy6TXMN+hnP/wMy+ISxg3krXx7BAtWVO4UouuCN/ziM9UEne0euamVNafDfvC83bRNr95y0V5iijeDQFUNpvrg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "set-function-name": "^2.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/resolve": { + "version": "2.0.0-next.5", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-2.0.0-next.5.tgz", + "integrity": "sha512-U7WjGVG9sH8tvjW5SmGbQuui75FiyjAX72HX15DwBBwF9dNiQZRQAg9nnPhYy+TUnE0+VcrttuvNI8oSxZcocA==", + "dev": true, + "dependencies": { + "is-core-module": "^2.13.0", + "path-parse": "^1.0.7", + "supports-preserve-symlinks-flag": "^1.0.0" + }, + "bin": { + "resolve": "bin/resolve" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/resolve-from": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-4.0.0.tgz", + "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/reusify": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz", + "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==", + "dev": true, + "engines": { + "iojs": ">=1.0.0", + "node": ">=0.10.0" + } + }, + "node_modules/rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/rollup": { + "version": "4.9.1", + "resolved": "https://registry.npmjs.org/rollup/-/rollup-4.9.1.tgz", + "integrity": "sha512-pgPO9DWzLoW/vIhlSoDByCzcpX92bKEorbgXuZrqxByte3JFk2xSW2JEeAcyLc9Ru9pqcNNW+Ob7ntsk2oT/Xw==", + "dev": true, + "bin": { + "rollup": "dist/bin/rollup" + }, + "engines": { + "node": ">=18.0.0", + "npm": ">=8.0.0" + }, + "optionalDependencies": { + "@rollup/rollup-android-arm-eabi": "4.9.1", + "@rollup/rollup-android-arm64": "4.9.1", + "@rollup/rollup-darwin-arm64": "4.9.1", + "@rollup/rollup-darwin-x64": "4.9.1", + "@rollup/rollup-linux-arm-gnueabihf": "4.9.1", + "@rollup/rollup-linux-arm64-gnu": "4.9.1", + "@rollup/rollup-linux-arm64-musl": "4.9.1", + "@rollup/rollup-linux-riscv64-gnu": "4.9.1", + "@rollup/rollup-linux-x64-gnu": "4.9.1", + "@rollup/rollup-linux-x64-musl": "4.9.1", + "@rollup/rollup-win32-arm64-msvc": "4.9.1", + "@rollup/rollup-win32-ia32-msvc": "4.9.1", + "@rollup/rollup-win32-x64-msvc": "4.9.1", + "fsevents": "~2.3.2" + } + }, + "node_modules/run-parallel": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz", + "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "dependencies": { + "queue-microtask": "^1.2.2" + } + }, + "node_modules/safe-array-concat": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/safe-array-concat/-/safe-array-concat-1.0.1.tgz", + "integrity": "sha512-6XbUAseYE2KtOuGueyeobCySj9L4+66Tn6KQMOPQJrAJEowYKW/YR/MGJZl7FdydUdaFu4LYyDZjxf4/Nmo23Q==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "get-intrinsic": "^1.2.1", + "has-symbols": "^1.0.3", + "isarray": "^2.0.5" + }, + "engines": { + "node": ">=0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/safe-regex-test": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/safe-regex-test/-/safe-regex-test-1.0.0.tgz", + "integrity": "sha512-JBUUzyOgEwXQY1NuPtvcj/qcBDbDmEvWufhlnXZIm75DEHp+afM1r1ujJpJsV/gSM4t59tpDyPi1sd6ZaPFfsA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "get-intrinsic": "^1.1.3", + "is-regex": "^1.1.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/scheduler": { + "version": "0.23.0", + "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.23.0.tgz", + "integrity": "sha512-CtuThmgHNg7zIZWAXi3AsyIzA3n4xx7aNyjwC2VJldO2LMVDhFK+63xGqq6CsJH4rTAt6/M+N4GhZiDYPx9eUw==", + "dependencies": { + "loose-envify": "^1.1.0" + } + }, + "node_modules/semver": { + "version": "6.3.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz", + "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/set-function-length": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.1.1.tgz", + "integrity": "sha512-VoaqjbBJKiWtg4yRcKBQ7g7wnGnLV3M8oLvVWwOk2PdYY6PEFegR1vezXR0tw6fZGF9csVakIRjrJiy2veSBFQ==", + "dev": true, + "dependencies": { + "define-data-property": "^1.1.1", + "get-intrinsic": "^1.2.1", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/set-function-name": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/set-function-name/-/set-function-name-2.0.1.tgz", + "integrity": "sha512-tMNCiqYVkXIZgc2Hnoy2IvC/f8ezc5koaRFkCjrpWzGpCd3qbZXPzVy9MAZzK1ch/X0jvSkojys3oqJN0qCmdA==", + "dev": true, + "dependencies": { + "define-data-property": "^1.0.1", + "functions-have-names": "^1.2.3", + "has-property-descriptors": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/shebang-command": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz", + "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==", + "dev": true, + "dependencies": { + "shebang-regex": "^3.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/shebang-regex": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz", + "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/side-channel": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.4.tgz", + "integrity": "sha512-q5XPytqFEIKHkGdiMIrY10mvLRvnQh42/+GoBlFW3b2LXLE2xxJpZFdm94we0BaoV3RwJyGqg5wS7epxTv0Zvw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.0", + "get-intrinsic": "^1.0.2", + "object-inspect": "^1.9.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/source-map-js": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.0.2.tgz", + "integrity": "sha512-R0XvVJ9WusLiqTCEiGCmICCMplcCkIwwR11mOSD9CR5u+IXYdiseeEuXCVAjS54zqwkLcPNnmU4OeJ6tUrWhDw==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/string.prototype.matchall": { + "version": "4.0.10", + "resolved": "https://registry.npmjs.org/string.prototype.matchall/-/string.prototype.matchall-4.0.10.tgz", + "integrity": "sha512-rGXbGmOEosIQi6Qva94HUjgPs9vKW+dkG7Y8Q5O2OYkWL6wFaTRZO8zM4mhP94uX55wgyrXzfS2aGtGzUL7EJQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "get-intrinsic": "^1.2.1", + "has-symbols": "^1.0.3", + "internal-slot": "^1.0.5", + "regexp.prototype.flags": "^1.5.0", + "set-function-name": "^2.0.0", + "side-channel": "^1.0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/string.prototype.trim": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/string.prototype.trim/-/string.prototype.trim-1.2.8.tgz", + "integrity": "sha512-lfjY4HcixfQXOfaqCvcBuOIapyaroTXhbkfJN3gcB1OtyupngWK4sEET9Knd0cXd28kTUqu/kHoV4HKSJdnjiQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/string.prototype.trimend": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.7.tgz", + "integrity": "sha512-Ni79DqeB72ZFq1uH/L6zJ+DKZTkOtPIHovb3YZHQViE+HDouuU4mBrLOLDn5Dde3RF8qw5qVETEjhu9locMLvA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/string.prototype.trimstart": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.7.tgz", + "integrity": "sha512-NGhtDFu3jCEm7B4Fy0DpLewdJQOZcQ0rGbwQ/+stjnrp2i+rlKeCvos9hOIeCmqwratM47OBxY7uFZzjxHXmrg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/strip-ansi": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "dev": true, + "dependencies": { + "ansi-regex": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/strip-json-comments": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.1.1.tgz", + "integrity": "sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==", + "dev": true, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/supports-color": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", + "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", + "dev": true, + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/supports-preserve-symlinks-flag": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz", + "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/text-table": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/text-table/-/text-table-0.2.0.tgz", + "integrity": "sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==", + "dev": true + }, + "node_modules/to-fast-properties": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", + "integrity": "sha512-/OaKK0xYrs3DmxRYqL/yDc+FxFUVYhDlXMhRmv3z915w2HF1tnN1omB354j8VUGO/hbRzyD6Y3sA7v7GS/ceog==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/type-check": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.4.0.tgz", + "integrity": "sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==", + "dev": true, + "dependencies": { + "prelude-ls": "^1.2.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/type-fest": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.20.2.tgz", + "integrity": "sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/typed-array-buffer": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/typed-array-buffer/-/typed-array-buffer-1.0.0.tgz", + "integrity": "sha512-Y8KTSIglk9OZEr8zywiIHG/kmQ7KWyjseXs1CbSo8vC42w7hg2HgYTxSWwP0+is7bWDc1H+Fo026CpHFwm8tkw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "get-intrinsic": "^1.2.1", + "is-typed-array": "^1.1.10" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/typed-array-byte-length": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/typed-array-byte-length/-/typed-array-byte-length-1.0.0.tgz", + "integrity": "sha512-Or/+kvLxNpeQ9DtSydonMxCx+9ZXOswtwJn17SNLvhptaXYDJvkFFP5zbfU/uLmvnBJlI4yrnXRxpdWH/M5tNA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "for-each": "^0.3.3", + "has-proto": "^1.0.1", + "is-typed-array": "^1.1.10" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/typed-array-byte-offset": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/typed-array-byte-offset/-/typed-array-byte-offset-1.0.0.tgz", + "integrity": "sha512-RD97prjEt9EL8YgAgpOkf3O4IF9lhJFr9g0htQkm0rchFp/Vx7LW5Q8fSXXub7BXAODyUQohRMyOc3faCPd0hg==", + "dev": true, + "dependencies": { + "available-typed-arrays": "^1.0.5", + "call-bind": "^1.0.2", + "for-each": "^0.3.3", + "has-proto": "^1.0.1", + "is-typed-array": "^1.1.10" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/typed-array-length": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/typed-array-length/-/typed-array-length-1.0.4.tgz", + "integrity": "sha512-KjZypGq+I/H7HI5HlOoGHkWUUGq+Q0TPhQurLbyrVrvnKTBgzLhIJ7j6J/XTQOi0d1RjyZ0wdas8bKs2p0x3Ng==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "for-each": "^0.3.3", + "is-typed-array": "^1.1.9" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/unbox-primitive": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/unbox-primitive/-/unbox-primitive-1.0.2.tgz", + "integrity": "sha512-61pPlCD9h51VoreyJ0BReideM3MDKMKnh6+V9L08331ipq6Q8OFXZYiqP6n/tbHx4s5I9uRhcye6BrbkizkBDw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "has-bigints": "^1.0.2", + "has-symbols": "^1.0.3", + "which-boxed-primitive": "^1.0.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/update-browserslist-db": { + "version": "1.0.13", + "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.0.13.tgz", + "integrity": "sha512-xebP81SNcPuNpPP3uzeW1NYXxI3rxyJzF3pD6sH4jE7o/IX+WtSpwnVU+qIsDPyk0d3hmFQ7mjqc6AtV604hbg==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "escalade": "^3.1.1", + "picocolors": "^1.0.0" + }, + "bin": { + "update-browserslist-db": "cli.js" + }, + "peerDependencies": { + "browserslist": ">= 4.21.0" + } + }, + "node_modules/uri-js": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.1.tgz", + "integrity": "sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==", + "dev": true, + "dependencies": { + "punycode": "^2.1.0" + } + }, + "node_modules/vite": { + "version": "5.0.10", + "resolved": "https://registry.npmjs.org/vite/-/vite-5.0.10.tgz", + "integrity": "sha512-2P8J7WWgmc355HUMlFrwofacvr98DAjoE52BfdbwQtyLH06XKwaL/FMnmKM2crF0iX4MpmMKoDlNCB1ok7zHCw==", + "dev": true, + "dependencies": { + "esbuild": "^0.19.3", + "postcss": "^8.4.32", + "rollup": "^4.2.0" + }, + "bin": { + "vite": "bin/vite.js" + }, + "engines": { + "node": "^18.0.0 || >=20.0.0" + }, + "funding": { + "url": "https://github.com/vitejs/vite?sponsor=1" + }, + "optionalDependencies": { + "fsevents": "~2.3.3" + }, + "peerDependencies": { + "@types/node": "^18.0.0 || >=20.0.0", + "less": "*", + "lightningcss": "^1.21.0", + "sass": "*", + "stylus": "*", + "sugarss": "*", + "terser": "^5.4.0" + }, + "peerDependenciesMeta": { + "@types/node": { + "optional": true + }, + "less": { + "optional": true + }, + "lightningcss": { + "optional": true + }, + "sass": { + "optional": true + }, + "stylus": { + "optional": true + }, + "sugarss": { + "optional": true + }, + "terser": { + "optional": true + } + } + }, + "node_modules/which": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", + "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", + "dev": true, + "dependencies": { + "isexe": "^2.0.0" + }, + "bin": { + "node-which": "bin/node-which" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/which-boxed-primitive": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/which-boxed-primitive/-/which-boxed-primitive-1.0.2.tgz", + "integrity": "sha512-bwZdv0AKLpplFY2KZRX6TvyuN7ojjr7lwkg6ml0roIy9YeuSr7JS372qlNW18UQYzgYK9ziGcerWqZOmEn9VNg==", + "dev": true, + "dependencies": { + "is-bigint": "^1.0.1", + "is-boolean-object": "^1.1.0", + "is-number-object": "^1.0.4", + "is-string": "^1.0.5", + "is-symbol": "^1.0.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/which-builtin-type": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/which-builtin-type/-/which-builtin-type-1.1.3.tgz", + "integrity": "sha512-YmjsSMDBYsM1CaFiayOVT06+KJeXf0o5M/CAd4o1lTadFAtacTUM49zoYxr/oroopFDfhvN6iEcBxUyc3gvKmw==", + "dev": true, + "dependencies": { + "function.prototype.name": "^1.1.5", + "has-tostringtag": "^1.0.0", + "is-async-function": "^2.0.0", + "is-date-object": "^1.0.5", + "is-finalizationregistry": "^1.0.2", + "is-generator-function": "^1.0.10", + "is-regex": "^1.1.4", + "is-weakref": "^1.0.2", + "isarray": "^2.0.5", + "which-boxed-primitive": "^1.0.2", + "which-collection": "^1.0.1", + "which-typed-array": "^1.1.9" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/which-collection": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/which-collection/-/which-collection-1.0.1.tgz", + "integrity": "sha512-W8xeTUwaln8i3K/cY1nGXzdnVZlidBcagyNFtBdD5kxnb4TvGKR7FfSIS3mYpwWS1QUCutfKz8IY8RjftB0+1A==", + "dev": true, + "dependencies": { + "is-map": "^2.0.1", + "is-set": "^2.0.1", + "is-weakmap": "^2.0.1", + "is-weakset": "^2.0.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/which-typed-array": { + "version": "1.1.13", + "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.13.tgz", + "integrity": "sha512-P5Nra0qjSncduVPEAr7xhoF5guty49ArDTwzJ/yNuPIbZppyRxFQsRCWrocxIY+CnMVG+qfbU2FmDKyvSGClow==", + "dev": true, + "dependencies": { + "available-typed-arrays": "^1.0.5", + "call-bind": "^1.0.4", + "for-each": "^0.3.3", + "gopd": "^1.0.1", + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==", + "dev": true + }, + "node_modules/yallist": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", + "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", + "dev": true + }, + "node_modules/yocto-queue": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/yocto-queue/-/yocto-queue-0.1.0.tgz", + "integrity": "sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + } + } +} diff --git a/client/package.json b/client/package.json new file mode 100644 index 000000000..1037f4906 --- /dev/null +++ b/client/package.json @@ -0,0 +1,29 @@ +{ + "name": "client", + "private": true, + "version": "0.0.0", + "type": "module", + "scripts": { + "dev": "vite", + "build": "vite build", + "lint": "eslint . --ext js,jsx --report-unused-disable-directives --max-warnings 0", + "preview": "vite preview" + }, + "dependencies": { + "axios": "^1.6.2", + "bootstrap": "^5.3.0", + "react": "^18.2.0", + "react-dom": "^18.2.0", + "react-router-dom": "^6.21.1" + }, + "devDependencies": { + "@types/react": "^18.2.43", + "@types/react-dom": "^18.2.17", + "@vitejs/plugin-react": "^4.2.1", + "eslint": "^8.55.0", + "eslint-plugin-react": "^7.33.2", + "eslint-plugin-react-hooks": "^4.6.0", + "eslint-plugin-react-refresh": "^0.4.5", + "vite": "^5.0.8" + } +} diff --git a/assets/images/Galaxy_S7.png b/client/public/images/Galaxy_S7.png similarity index 100% rename from assets/images/Galaxy_S7.png rename to client/public/images/Galaxy_S7.png diff --git a/assets/images/Honor_10.png b/client/public/images/Honor_10.png similarity index 100% rename from assets/images/Honor_10.png rename to client/public/images/Honor_10.png diff --git a/assets/images/IPhone_7.png b/client/public/images/IPhone_7.png similarity index 100% rename from assets/images/IPhone_7.png rename to client/public/images/IPhone_7.png diff --git a/assets/images/Moto_G6.png b/client/public/images/Moto_G6.png similarity index 100% rename from assets/images/Moto_G6.png rename to client/public/images/Moto_G6.png diff --git a/assets/images/Nokia_7.1.jpg b/client/public/images/Nokia_7.1.jpg similarity index 100% rename from assets/images/Nokia_7.1.jpg rename to client/public/images/Nokia_7.1.jpg diff --git a/assets/images/P10_Lite.jpg b/client/public/images/P10_Lite.jpg similarity index 100% rename from assets/images/P10_Lite.jpg rename to client/public/images/P10_Lite.jpg diff --git a/assets/images/Xiaomi_MI_A2.jpeg b/client/public/images/Xiaomi_MI_A2.jpeg similarity index 100% rename from assets/images/Xiaomi_MI_A2.jpeg rename to client/public/images/Xiaomi_MI_A2.jpeg diff --git a/assets/images/ZenPhone_5.jpg b/client/public/images/ZenPhone_5.jpg similarity index 100% rename from assets/images/ZenPhone_5.jpg rename to client/public/images/ZenPhone_5.jpg diff --git a/client/public/vite.svg b/client/public/vite.svg new file mode 100644 index 000000000..e7b8dfb1b --- /dev/null +++ b/client/public/vite.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/client/src/App.css b/client/src/App.css new file mode 100644 index 000000000..b9d355df2 --- /dev/null +++ b/client/src/App.css @@ -0,0 +1,42 @@ +#root { + max-width: 1280px; + margin: 0 auto; + padding: 2rem; + text-align: center; +} + +.logo { + height: 6em; + padding: 1.5em; + will-change: filter; + transition: filter 300ms; +} +.logo:hover { + filter: drop-shadow(0 0 2em #646cffaa); +} +.logo.react:hover { + filter: drop-shadow(0 0 2em #61dafbaa); +} + +@keyframes logo-spin { + from { + transform: rotate(0deg); + } + to { + transform: rotate(360deg); + } +} + +@media (prefers-reduced-motion: no-preference) { + a:nth-of-type(2) .logo { + animation: logo-spin infinite 20s linear; + } +} + +.card { + padding: 2em; +} + +.read-the-docs { + color: #888; +} diff --git a/client/src/App.jsx b/client/src/App.jsx new file mode 100644 index 000000000..a6ff14abf --- /dev/null +++ b/client/src/App.jsx @@ -0,0 +1,18 @@ +import './App.css' +import React from 'react' +import { Route, Routes } from 'react-router-dom' +import HomePage from "./Pages/HomePage/index.jsx" +import 'bootstrap/dist/css/bootstrap.min.css'; + + +function App() { + return( +
+ + }/> + +
+ ) +} + +export default App diff --git a/client/src/Pages/HomePage/index.jsx b/client/src/Pages/HomePage/index.jsx new file mode 100644 index 000000000..6cdc3a74d --- /dev/null +++ b/client/src/Pages/HomePage/index.jsx @@ -0,0 +1,81 @@ +import axios from "axios"; +import { useState, useEffect } from 'react'; +import 'bootstrap/dist/css/bootstrap.min.css'; + + +export default function HomePage() { + const API = "http://localhost:3000/phones"; + + const [phoneList, setPhoneList] = useState([]); + const [loadingPage, setLoadingPage] = useState(true); + const [loadingPhoneSimulation, setLoadingPhoneSimulation] = useState(true); + const [phone, setPhone] = useState(null); + + useEffect(() => { + getAllPhones(); + }, []) + + const getAllPhones = async () => { + try { + const response = await axios.get(API); + console.log(response.data); + setPhoneList(response.data); + } catch (error) { + console.error(error); + } finally { + setTimeout(() => { + setLoadingPage(false); + }, 1000); + } + } + + const getPhone = async (id) => { + try { + const response = await axios.get(`${API}/${id}`); + setPhone(response.data[0]); + } catch (error) { + console.error(error); + } finally { + setTimeout(() => { + setLoadingPhoneSimulation(false); + }, 1000); + } + } + + return ( +
+

All Phones

+
+
+
    + {phoneList.map((phone, index) => ( +
  • +

    {phone.name}

    + {phone.name} + +
  • + ))} +
+
+ +
+ {phone && ( +
+ {phone.name} +
+
{phone.name}
+

Manufacturer: {phone.manufacturer}

+

Description: {phone.description}

+

Color: {phone.color}

+

Price: ${phone.price}

+

Screen: {phone.screen}

+

Processor: {phone.processor}

+

RAM: {phone.ram} GB

+
+
+ )} +
+
+
+ ); +} diff --git a/client/src/assets/react.svg b/client/src/assets/react.svg new file mode 100644 index 000000000..6c87de9bb --- /dev/null +++ b/client/src/assets/react.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/client/src/index.css b/client/src/index.css new file mode 100644 index 000000000..6119ad9a8 --- /dev/null +++ b/client/src/index.css @@ -0,0 +1,68 @@ +:root { + font-family: Inter, system-ui, Avenir, Helvetica, Arial, sans-serif; + line-height: 1.5; + font-weight: 400; + + color-scheme: light dark; + color: rgba(255, 255, 255, 0.87); + background-color: #242424; + + font-synthesis: none; + text-rendering: optimizeLegibility; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} + +a { + font-weight: 500; + color: #646cff; + text-decoration: inherit; +} +a:hover { + color: #535bf2; +} + +body { + margin: 0; + display: flex; + place-items: center; + min-width: 320px; + min-height: 100vh; +} + +h1 { + font-size: 3.2em; + line-height: 1.1; +} + +button { + border-radius: 8px; + border: 1px solid transparent; + padding: 0.6em 1.2em; + font-size: 1em; + font-weight: 500; + font-family: inherit; + background-color: #1a1a1a; + cursor: pointer; + transition: border-color 0.25s; +} +button:hover { + border-color: #646cff; +} +button:focus, +button:focus-visible { + outline: 4px auto -webkit-focus-ring-color; +} + +@media (prefers-color-scheme: light) { + :root { + color: #213547; + background-color: #ffffff; + } + a:hover { + color: #747bff; + } + button { + background-color: #f9f9f9; + } +} diff --git a/client/src/main.jsx b/client/src/main.jsx new file mode 100644 index 000000000..27b95f0c5 --- /dev/null +++ b/client/src/main.jsx @@ -0,0 +1,13 @@ +import React from 'react' +import ReactDOM from 'react-dom/client' +import App from './App.jsx' +import './index.css' +import { BrowserRouter as Router, Route } from "react-router-dom" + +ReactDOM.createRoot(document.getElementById('root')).render( + + + + + , +) diff --git a/client/vite.config.js b/client/vite.config.js new file mode 100644 index 000000000..5a33944a9 --- /dev/null +++ b/client/vite.config.js @@ -0,0 +1,7 @@ +import { defineConfig } from 'vite' +import react from '@vitejs/plugin-react' + +// https://vitejs.dev/config/ +export default defineConfig({ + plugins: [react()], +}) diff --git a/server/app.js b/server/app.js new file mode 100644 index 000000000..ef994c39c --- /dev/null +++ b/server/app.js @@ -0,0 +1,26 @@ +const cors = require('cors'); +const express = require('express'); +const app = express(); + +const phones = require('./data/phones.json'); +app.use(express.static('./assets/images')); + +app.use(cors()); + +app.get('/', (req, res) => { + res.send('Server is Running!'); +}); + +app.get('/phones', (req,res) => { + res.send(phones) +}) + +app.get('/phones/:phoneId', (req,res) => { + const {phoneId} = req.params; + const foundPhone = phones.filter((phone) =>{ return phone.id == phoneId}); + res.send(foundPhone); +}) + +const port = process.env.PORT || 3000; +app.listen(port, () => { console.log(`Server is running on port ${port}`); +}); \ No newline at end of file diff --git a/server/assets/images/Galaxy_S7.png b/server/assets/images/Galaxy_S7.png new file mode 100644 index 000000000..137e356f5 Binary files /dev/null and b/server/assets/images/Galaxy_S7.png differ diff --git a/server/assets/images/Honor_10.png b/server/assets/images/Honor_10.png new file mode 100644 index 000000000..28b752d09 Binary files /dev/null and b/server/assets/images/Honor_10.png differ diff --git a/server/assets/images/IPhone_7.png b/server/assets/images/IPhone_7.png new file mode 100644 index 000000000..d6647be20 Binary files /dev/null and b/server/assets/images/IPhone_7.png differ diff --git a/server/assets/images/Moto_G6.png b/server/assets/images/Moto_G6.png new file mode 100644 index 000000000..4f81a52fe Binary files /dev/null and b/server/assets/images/Moto_G6.png differ diff --git a/server/assets/images/Nokia_7.1.jpg b/server/assets/images/Nokia_7.1.jpg new file mode 100644 index 000000000..3b0711b18 Binary files /dev/null and b/server/assets/images/Nokia_7.1.jpg differ diff --git a/server/assets/images/P10_Lite.jpg b/server/assets/images/P10_Lite.jpg new file mode 100644 index 000000000..02d2d52f3 Binary files /dev/null and b/server/assets/images/P10_Lite.jpg differ diff --git a/server/assets/images/Xiaomi_MI_A2.jpeg b/server/assets/images/Xiaomi_MI_A2.jpeg new file mode 100644 index 000000000..12d0665df Binary files /dev/null and b/server/assets/images/Xiaomi_MI_A2.jpeg differ diff --git a/server/assets/images/ZenPhone_5.jpg b/server/assets/images/ZenPhone_5.jpg new file mode 100644 index 000000000..2d5512a22 Binary files /dev/null and b/server/assets/images/ZenPhone_5.jpg differ diff --git a/data/phones.json b/server/data/phones.json similarity index 100% rename from data/phones.json rename to server/data/phones.json diff --git a/server/node_modules/.bin/mime b/server/node_modules/.bin/mime new file mode 120000 index 000000000..fbb7ee0ee --- /dev/null +++ b/server/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/server/node_modules/.package-lock.json b/server/node_modules/.package-lock.json new file mode 100644 index 000000000..da1880873 --- /dev/null +++ b/server/node_modules/.package-lock.json @@ -0,0 +1,680 @@ +{ + "name": "server", + "version": "1.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "node_modules/accepts": { + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz", + "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg==" + }, + "node_modules/body-parser": { + "version": "1.20.1", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.1.tgz", + "integrity": "sha512-jWi7abTbYwajOytWCQc37VulmWiRae5RyTpaCyDcS5/lMdtwSz5lOpDE67srw/HYe35f1z3fDQw+3txg7gNtWw==", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.11.0", + "raw-body": "2.5.1", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + } + }, + "node_modules/bytes": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz", + "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/call-bind": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.5.tgz", + "integrity": "sha512-C3nQxfFZxFRVoJoGKKI8y3MOEo129NQ+FgQ08iye+Mk4zNZZGdjfs06bVTr+DBSlA66Q2VEcMki/cUCP4SercQ==", + "dependencies": { + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.1", + "set-function-length": "^1.1.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/content-disposition": { + "version": "0.5.4", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz", + "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/content-type": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz", + "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.5.0.tgz", + "integrity": "sha512-YZ3GUyn/o8gfKJlnlX7g7xq4gyO6OSuhGPKaaGssGB2qgDUS0gPgtTvoyZLTt9Ab6dC4hfc9dV5arkvc/OCmrw==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ==" + }, + "node_modules/cors": { + "version": "2.8.5", + "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.5.tgz", + "integrity": "sha512-KIHbLJqu73RGr/hnbrO9uBeixNGuvSQjul/jdFvS/KFSIH1hWVd1ng7zOHx+YrEfInLG7q4n6GHQ9cDtxv/P6g==", + "dependencies": { + "object-assign": "^4", + "vary": "^1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/define-data-property": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.1.tgz", + "integrity": "sha512-E7uGkTzkk1d0ByLeSc6ZsFS79Axg+m1P/VsgYsxHgiuc3tFSj+MjMIwe90FC4lOAZzNBdY7kkO2P2wKdsQ1vgQ==", + "dependencies": { + "get-intrinsic": "^1.2.1", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/destroy": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz", + "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==", + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + } + }, + "node_modules/dotenv": { + "version": "16.3.1", + "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-16.3.1.tgz", + "integrity": "sha512-IPzF4w4/Rd94bA9imS68tZBaYyBWSCE47V1RGuMrB94iyTOIEwRmVL2x/4An+6mETpLrKJ5hQkB8W4kFAadeIQ==", + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/motdotla/dotenv?sponsor=1" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==" + }, + "node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==" + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/express": { + "version": "4.18.2", + "resolved": "https://registry.npmjs.org/express/-/express-4.18.2.tgz", + "integrity": "sha512-5/PsL6iGPdfQ/lKM1UuielYgv3BUoJfz1aUwU9vHZ+J7gyvwdQXFEBIEIaxeGf0GIcreATNyBExtalisDbuMqQ==", + "dependencies": { + "accepts": "~1.3.8", + "array-flatten": "1.1.1", + "body-parser": "1.20.1", + "content-disposition": "0.5.4", + "content-type": "~1.0.4", + "cookie": "0.5.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "2.0.0", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "1.2.0", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.7", + "proxy-addr": "~2.0.7", + "qs": "6.11.0", + "range-parser": "~1.2.1", + "safe-buffer": "5.2.1", + "send": "0.18.0", + "serve-static": "1.15.0", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/finalhandler": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.2.0.tgz", + "integrity": "sha512-5uXcUVftlQMFnWC9qu/svkWv3GTd2PfUhK/3PLkYNAe7FbqJMt3515HaxE6eRL74GdsriiwujiawdaB1BpEISg==", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "statuses": "2.0.1", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/forwarded": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz", + "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-intrinsic": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.2.tgz", + "integrity": "sha512-0gSo4ml/0j98Y3lngkFEot/zhiCeWsbYIlZ+uZOVgzLyLaUw7wxUL+nCTP0XJvJg1AXulJRI3UJi8GsbDuxdGA==", + "dependencies": { + "function-bind": "^1.1.2", + "has-proto": "^1.0.1", + "has-symbols": "^1.0.3", + "hasown": "^2.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gopd": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz", + "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==", + "dependencies": { + "get-intrinsic": "^1.1.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-property-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.1.tgz", + "integrity": "sha512-VsX8eaIewvas0xnvinAe9bw4WfIeODpGYikiWYLH+dma0Jw6KHYqWiWfhQlgOVK8D6PvjubK5Uc4P0iIhIcNVg==", + "dependencies": { + "get-intrinsic": "^1.2.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-proto": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.1.tgz", + "integrity": "sha512-7qE+iP+O+bgF9clE5+UoBFzE65mlBiVj3tKCrlNQ0Ogwm0BjpT/gK4SlLYDMybDh5I3TCTKnPPa0oMG7JDYrhg==", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-symbols": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz", + "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/hasown": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.0.tgz", + "integrity": "sha512-vUptKVTpIJhcczKBbgnS+RtcuYMB8+oNzPK2/Hp3hanz8JmpATdmmgLgSaadVREkDm+e2giHwY3ZRkyjSIDDFA==", + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/http-errors": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz", + "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==", + "dependencies": { + "depd": "2.0.0", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "toidentifier": "1.0.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" + }, + "node_modules/ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/merge-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "integrity": "sha512-cCi6g3/Zr1iqQi6ySbseM1Xvooa98N0w31jzUYrXPX2xqObmFGHJ0tQ5u74H3mVh7wLouTseZyYIq39g8cNp1w==" + }, + "node_modules/methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "dependencies": { + "mime-db": "1.52.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A==" + }, + "node_modules/negotiator": { + "version": "0.6.3", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz", + "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-inspect": { + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.1.tgz", + "integrity": "sha512-5qoj1RUiKOMsCCNLV1CBiPYE10sziTsnmNxkAI/rZhiD63CF7IqdFGC/XzjWjpSgLf0LxXX3bDFIh0E18f6UhQ==", + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/on-finished": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz", + "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/path-to-regexp": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "integrity": "sha512-5DFkuoqlv1uYQKxy8omFBeJPQcdoE07Kv2sferDCrAq1ohOU+MSDswDIbnx3YAM60qIOnYa53wBhXW0EbMonrQ==" + }, + "node_modules/proxy-addr": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz", + "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==", + "dependencies": { + "forwarded": "0.2.0", + "ipaddr.js": "1.9.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/qs": { + "version": "6.11.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.11.0.tgz", + "integrity": "sha512-MvjoMCJwEarSbUYk5O+nmoSzSutSsTwF85zcHPQ9OrlFoZOYIjaqBAJIqIXjptyD5vThxGq52Xu/MaJzRkIk4Q==", + "dependencies": { + "side-channel": "^1.0.4" + }, + "engines": { + "node": ">=0.6" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/raw-body": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.1.tgz", + "integrity": "sha512-qqJBtEyVgS0ZmPGdCFPWJ3FreoqvG4MVQln/kCgF7Olq95IbOp0/BWyMwbdtn4VTvkM8Y7khCQ2Xgk/tcrCXig==", + "dependencies": { + "bytes": "3.1.2", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ] + }, + "node_modules/safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" + }, + "node_modules/send": { + "version": "0.18.0", + "resolved": "https://registry.npmjs.org/send/-/send-0.18.0.tgz", + "integrity": "sha512-qqWzuOjSFOuqPjFe4NOsMLafToQQwBSOEpS+FwEt3A2V3vKubTquT3vmLTQpFgMXp8AlFWFuP1qKaJZOtPpVXg==", + "dependencies": { + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "mime": "1.6.0", + "ms": "2.1.3", + "on-finished": "2.4.1", + "range-parser": "~1.2.1", + "statuses": "2.0.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/send/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==" + }, + "node_modules/serve-static": { + "version": "1.15.0", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.15.0.tgz", + "integrity": "sha512-XGuRDNjXUijsUL0vl6nSD7cwURuzEgglbOaFuZM9g3kwDXOWVTck0jLzjPzGD+TazWbboZYu52/9/XPdUgne9g==", + "dependencies": { + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.18.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/set-function-length": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.1.1.tgz", + "integrity": "sha512-VoaqjbBJKiWtg4yRcKBQ7g7wnGnLV3M8oLvVWwOk2PdYY6PEFegR1vezXR0tw6fZGF9csVakIRjrJiy2veSBFQ==", + "dependencies": { + "define-data-property": "^1.1.1", + "get-intrinsic": "^1.2.1", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==" + }, + "node_modules/side-channel": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.4.tgz", + "integrity": "sha512-q5XPytqFEIKHkGdiMIrY10mvLRvnQh42/+GoBlFW3b2LXLE2xxJpZFdm94we0BaoV3RwJyGqg5wS7epxTv0Zvw==", + "dependencies": { + "call-bind": "^1.0.0", + "get-intrinsic": "^1.0.2", + "object-inspect": "^1.9.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/statuses": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz", + "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==", + "engines": { + "node": ">= 0.8" + } + } + } +} diff --git a/server/node_modules/accepts/HISTORY.md b/server/node_modules/accepts/HISTORY.md new file mode 100644 index 000000000..cb5990c7c --- /dev/null +++ b/server/node_modules/accepts/HISTORY.md @@ -0,0 +1,243 @@ +1.3.8 / 2022-02-02 +================== + + * deps: mime-types@~2.1.34 + - deps: mime-db@~1.51.0 + * deps: negotiator@0.6.3 + +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/server/node_modules/accepts/LICENSE b/server/node_modules/accepts/LICENSE new file mode 100644 index 000000000..06166077b --- /dev/null +++ b/server/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/server/node_modules/accepts/README.md b/server/node_modules/accepts/README.md new file mode 100644 index 000000000..82680c530 --- /dev/null +++ b/server/node_modules/accepts/README.md @@ -0,0 +1,140 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts diff --git a/server/node_modules/accepts/index.js b/server/node_modules/accepts/index.js new file mode 100644 index 000000000..e9b2f63fb --- /dev/null +++ b/server/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/server/node_modules/accepts/package.json b/server/node_modules/accepts/package.json new file mode 100644 index 000000000..0f2d15da9 --- /dev/null +++ b/server/node_modules/accepts/package.json @@ -0,0 +1,47 @@ +{ + "name": "accepts", + "description": "Higher-level content negotiation", + "version": "1.3.8", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "jshttp/accepts", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.3.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ] +} diff --git a/server/node_modules/array-flatten/LICENSE b/server/node_modules/array-flatten/LICENSE new file mode 100644 index 000000000..983fbe8ae --- /dev/null +++ b/server/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/server/node_modules/array-flatten/README.md b/server/node_modules/array-flatten/README.md new file mode 100644 index 000000000..91fa5b637 --- /dev/null +++ b/server/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/server/node_modules/array-flatten/array-flatten.js b/server/node_modules/array-flatten/array-flatten.js new file mode 100644 index 000000000..089117b32 --- /dev/null +++ b/server/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/server/node_modules/array-flatten/package.json b/server/node_modules/array-flatten/package.json new file mode 100644 index 000000000..1a24e2a1a --- /dev/null +++ b/server/node_modules/array-flatten/package.json @@ -0,0 +1,39 @@ +{ + "name": "array-flatten", + "version": "1.1.1", + "description": "Flatten an array of nested arrays into a single flat array", + "main": "array-flatten.js", + "files": [ + "array-flatten.js", + "LICENSE" + ], + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "homepage": "https://github.com/blakeembrey/array-flatten", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + } +} diff --git a/server/node_modules/body-parser/HISTORY.md b/server/node_modules/body-parser/HISTORY.md new file mode 100644 index 000000000..fb212b360 --- /dev/null +++ b/server/node_modules/body-parser/HISTORY.md @@ -0,0 +1,657 @@ +1.20.1 / 2022-10-06 +=================== + + * deps: qs@6.11.0 + * perf: remove unnecessary object clone + +1.20.0 / 2022-04-02 +=================== + + * Fix error message for json parse whitespace in `strict` + * Fix internal error when inflated body exceeds limit + * Prevent loss of async hooks context + * Prevent hanging when request already read + * deps: depd@2.0.0 + - Replace internal `eval` usage with `Function` constructor + - Use instance methods on `process` to check for listeners + * deps: http-errors@2.0.0 + - deps: depd@2.0.0 + - deps: statuses@2.0.1 + * deps: on-finished@2.4.1 + * deps: qs@6.10.3 + * deps: raw-body@2.5.1 + - deps: http-errors@2.0.0 + +1.19.2 / 2022-02-15 +=================== + + * deps: bytes@3.1.2 + * deps: qs@6.9.7 + * Fix handling of `__proto__` keys + * deps: raw-body@2.4.3 + - deps: bytes@3.1.2 + +1.19.1 / 2021-12-10 +=================== + + * deps: bytes@3.1.1 + * deps: http-errors@1.8.1 + - deps: inherits@2.0.4 + - deps: toidentifier@1.0.1 + - deps: setprototypeof@1.2.0 + * deps: qs@6.9.6 + * deps: raw-body@2.4.2 + - deps: bytes@3.1.1 + - deps: http-errors@1.8.1 + * deps: safe-buffer@5.2.1 + * deps: type-is@~1.6.18 + +1.19.0 / 2019-04-25 +=================== + + * deps: bytes@3.1.0 + - Add petabyte (`pb`) support + * deps: http-errors@1.7.2 + - Set constructor name when possible + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: iconv-lite@0.4.24 + - Added encoding MIK + * deps: qs@6.7.0 + - Fix parsing array brackets after index + * deps: raw-body@2.4.0 + - deps: bytes@3.1.0 + - deps: http-errors@1.7.2 + - deps: iconv-lite@0.4.24 + * deps: type-is@~1.6.17 + - deps: mime-types@~2.1.24 + - perf: prevent internal `throw` on invalid type + +1.18.3 / 2018-05-14 +=================== + + * Fix stack trace for strict json parse error + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: http-errors@~1.6.3 + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.0 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.23 + - Fix loading encoding with year appended + - Fix deprecation warnings on Node.js 10+ + * deps: qs@6.5.2 + * deps: raw-body@2.3.3 + - deps: http-errors@1.6.3 + - deps: iconv-lite@0.4.23 + * deps: type-is@~1.6.16 + - deps: mime-types@~2.1.18 + +1.18.2 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: remove argument reassignment + +1.18.1 / 2017-09-12 +=================== + + * deps: content-type@~1.0.4 + - perf: remove argument reassignment + - perf: skip parameter parsing when no parameters + * deps: iconv-lite@0.4.19 + - Fix ISO-8859-1 regression + - Update Windows-1255 + * deps: qs@6.5.1 + - Fix parsing & compacting very deep objects + * deps: raw-body@2.3.2 + - deps: iconv-lite@0.4.19 + +1.18.0 / 2017-09-08 +=================== + + * Fix JSON strict violation error to match native parse error + * Include the `body` property on verify errors + * Include the `type` property on all generated errors + * Use `http-errors` to set status code on errors + * deps: bytes@3.0.0 + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + * deps: iconv-lite@0.4.18 + - Add support for React Native + - Add a warning if not loaded as utf-8 + - Fix CESU-8 decoding in Node.js 8 + - Improve speed of ISO-8859-1 encoding + * deps: qs@6.5.0 + * deps: raw-body@2.3.1 + - Use `http-errors` for standard emitted errors + - deps: bytes@3.0.0 + - deps: iconv-lite@0.4.18 + - perf: skip buffer decoding on overage chunk + * perf: prevent internal `throw` when missing charset + +1.17.2 / 2017-05-17 +=================== + + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + +1.17.1 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +1.17.0 / 2017-03-01 +=================== + + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + * deps: qs@6.3.1 + - Fix compacting nested arrays + +1.16.1 / 2017-02-10 +=================== + + * deps: debug@2.6.1 + - Fix deprecation messages in WebStorm and other editors + - Undeprecate `DEBUG_FD` set to `1` or `2` + +1.16.0 / 2017-01-17 +=================== + + * deps: debug@2.6.0 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.15 + - Added encoding MS-31J + - Added encoding MS-932 + - Added encoding MS-936 + - Added encoding MS-949 + - Added encoding MS-950 + - Fix GBK/GB18030 handling of Euro character + * deps: qs@6.2.1 + - Fix array parsing from skipping empty values + * deps: raw-body@~2.2.0 + - deps: iconv-lite@0.4.15 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +1.15.2 / 2016-06-19 +=================== + + * deps: bytes@2.4.0 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: http-errors@~1.5.0 + - Use `setprototypeof` module to replace `__proto__` setting + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: qs@6.2.0 + * deps: raw-body@~2.1.7 + - deps: bytes@2.4.0 + - perf: remove double-cleanup on happy path + * deps: type-is@~1.6.13 + - deps: mime-types@~2.1.11 + +1.15.1 / 2016-05-05 +=================== + + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + * deps: raw-body@~2.1.6 + - deps: bytes@2.3.0 + * deps: type-is@~1.6.12 + - deps: mime-types@~2.1.10 + +1.15.0 / 2016-02-10 +=================== + + * deps: http-errors@~1.4.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.2.1 < 2' + * deps: qs@6.1.0 + * deps: type-is@~1.6.11 + - deps: mime-types@~2.1.9 + +1.14.2 / 2015-12-16 +=================== + + * deps: bytes@2.2.0 + * deps: iconv-lite@0.4.13 + * deps: qs@5.2.0 + * deps: raw-body@~2.1.5 + - deps: bytes@2.2.0 + - deps: iconv-lite@0.4.13 + * deps: type-is@~1.6.10 + - deps: mime-types@~2.1.8 + +1.14.1 / 2015-09-27 +=================== + + * Fix issue where invalid charset results in 400 when `verify` used + * deps: iconv-lite@0.4.12 + - Fix CESU-8 decoding in Node.js 4.x + * deps: raw-body@~2.1.4 + - Fix masking critical errors from `iconv-lite` + - deps: iconv-lite@0.4.12 + * deps: type-is@~1.6.9 + - deps: mime-types@~2.1.7 + +1.14.0 / 2015-09-16 +=================== + + * Fix JSON strict parse error to match syntax errors + * Provide static `require` analysis in `urlencoded` parser + * deps: depd@~1.1.0 + - Support web browser loading + * deps: qs@5.1.0 + * deps: raw-body@~2.1.3 + - Fix sync callback when attaching data listener causes sync read + * deps: type-is@~1.6.8 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.6 + +1.13.3 / 2015-07-31 +=================== + + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +1.13.2 / 2015-07-05 +=================== + + * deps: iconv-lite@0.4.11 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix user-visible incompatibilities from 3.1.0 + - Fix various parsing edge cases + * deps: raw-body@~2.1.2 + - Fix error stack traces to skip `makeError` + - deps: iconv-lite@0.4.11 + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +1.13.1 / 2015-06-16 +=================== + + * deps: qs@2.4.2 + - Downgraded from 3.1.0 because of user-visible incompatibilities + +1.13.0 / 2015-06-14 +=================== + + * Add `statusCode` property on `Error`s, in addition to `status` + * Change `type` default to `application/json` for JSON parser + * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser + * Provide static `require` analysis + * Use the `http-errors` module to generate errors + * deps: bytes@2.1.0 + - Slight optimizations + * deps: iconv-lite@0.4.10 + - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails + - Leading BOM is now removed when decoding + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: qs@3.1.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + - Parsed object now has `null` prototype + * deps: raw-body@~2.1.1 + - Use `unpipe` module for unpiping requests + - deps: iconv-lite@0.4.10 + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: remove argument reassignment + * perf: remove delete call + +1.12.4 / 2015-05-10 +=================== + + * deps: debug@~2.2.0 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: on-finished@~2.2.1 + * deps: raw-body@~2.0.1 + - Fix a false-positive when unpiping in Node.js 0.8 + - deps: bytes@2.0.1 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +1.12.3 / 2015-04-15 +=================== + + * Slight efficiency improvement when not debugging + * deps: depd@~1.0.1 + * deps: iconv-lite@0.4.8 + - Add encoding alias UNICODE-1-1-UTF-7 + * deps: raw-body@1.3.4 + - Fix hanging callback if request aborts during read + - deps: iconv-lite@0.4.8 + +1.12.2 / 2015-03-16 +=================== + + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + +1.12.1 / 2015-03-15 +=================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +1.12.0 / 2015-02-13 +=================== + + * add `debug` messages + * accept a function for the `type` option + * use `content-type` to parse `Content-Type` headers + * deps: iconv-lite@0.4.7 + - Gracefully support enumerables on `Object.prototype` + * deps: raw-body@1.3.3 + - deps: iconv-lite@0.4.7 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +1.11.0 / 2015-01-30 +=================== + + * make internal `extended: true` depth limit infinity + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +1.10.2 / 2015-01-20 +=================== + + * deps: iconv-lite@0.4.6 + - Fix rare aliases of single-byte encodings + * deps: raw-body@1.3.2 + - deps: iconv-lite@0.4.6 + +1.10.1 / 2015-01-01 +=================== + + * deps: on-finished@~2.2.0 + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +1.10.0 / 2014-12-02 +=================== + + * make internal `extended: true` array limit dynamic + +1.9.3 / 2014-11-21 +================== + + * deps: iconv-lite@0.4.5 + - Fix Windows-31J and X-SJIS encoding support + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + * deps: raw-body@1.3.1 + - deps: iconv-lite@0.4.5 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +1.9.2 / 2014-10-27 +================== + + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +1.9.1 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +1.9.0 / 2014-09-24 +================== + + * include the charset in "unsupported charset" error message + * include the encoding in "unsupported content encoding" error message + * deps: depd@~1.0.0 + +1.8.4 / 2014-09-23 +================== + + * fix content encoding to be case-insensitive + +1.8.3 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +1.8.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + +1.8.1 / 2014-09-07 +================== + + * deps: media-typer@0.3.0 + * deps: type-is@~1.5.1 + +1.8.0 / 2014-09-05 +================== + + * make empty-body-handling consistent between chunked requests + - empty `json` produces `{}` + - empty `raw` produces `new Buffer(0)` + - empty `text` produces `''` + - empty `urlencoded` produces `{}` + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: type-is@~1.5.0 + - fix `hasbody` to be true for `content-length: 0` + +1.7.0 / 2014-09-01 +================== + + * add `parameterLimit` option to `urlencoded` parser + * change `urlencoded` extended array limit to 100 + * respond with 413 when over `parameterLimit` in `urlencoded` + +1.6.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +1.6.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +1.6.5 / 2014-08-16 +================== + + * deps: on-finished@2.1.0 + +1.6.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + +1.6.3 / 2014-08-10 +================== + + * deps: qs@1.2.1 + +1.6.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +1.6.1 / 2014-08-06 +================== + + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +1.6.0 / 2014-08-05 +================== + + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + +1.5.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +1.5.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +1.5.0 / 2014-07-20 +================== + + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + * deps: raw-body@1.3.0 + - deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + - Fix `Cannot switch to old mode now` error on Node.js 0.10+ + * deps: type-is@~1.3.2 + +1.4.3 / 2014-06-19 +================== + + * deps: type-is@1.3.1 + - fix global variable leak + +1.4.2 / 2014-06-19 +================== + + * deps: type-is@1.3.0 + - improve type parsing + +1.4.1 / 2014-06-19 +================== + + * fix urlencoded extended deprecation message + +1.4.0 / 2014-06-19 +================== + + * add `text` parser + * add `raw` parser + * check accepted charset in content-type (accepts utf-8) + * check accepted encoding in content-encoding (accepts identity) + * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed + * deprecate `urlencoded()` without provided `extended` option + * lazy-load urlencoded parsers + * parsers split into files for reduced mem usage + * support gzip and deflate bodies + - set `inflate: false` to turn off + * deps: raw-body@1.2.2 + - Support all encodings from `iconv-lite` + +1.3.1 / 2014-06-11 +================== + + * deps: type-is@1.2.1 + - Switch dependency from mime to mime-types@1.0.0 + +1.3.0 / 2014-05-31 +================== + + * add `extended` option to urlencoded parser + +1.2.2 / 2014-05-27 +================== + + * deps: raw-body@1.1.6 + - assert stream encoding on node.js 0.8 + - assert stream encoding on node.js < 0.10.6 + - deps: bytes@1 + +1.2.1 / 2014-05-26 +================== + + * invoke `next(err)` after request fully read + - prevents hung responses and socket hang ups + +1.2.0 / 2014-05-11 +================== + + * add `verify` option + * deps: type-is@1.2.0 + - support suffix matching + +1.1.2 / 2014-05-11 +================== + + * improve json parser speed + +1.1.1 / 2014-05-11 +================== + + * fix repeated limit parsing with every request + +1.1.0 / 2014-05-10 +================== + + * add `type` option + * deps: pin for safety and consistency + +1.0.2 / 2014-04-14 +================== + + * use `type-is` module + +1.0.1 / 2014-03-20 +================== + + * lower default limits to 100kb diff --git a/server/node_modules/body-parser/LICENSE b/server/node_modules/body-parser/LICENSE new file mode 100644 index 000000000..386b7b694 --- /dev/null +++ b/server/node_modules/body-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/server/node_modules/body-parser/README.md b/server/node_modules/body-parser/README.md new file mode 100644 index 000000000..c507cbb03 --- /dev/null +++ b/server/node_modules/body-parser/README.md @@ -0,0 +1,464 @@ +# body-parser + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js body parsing middleware. + +Parse incoming request bodies in a middleware before your handlers, available +under the `req.body` property. + +**Note** As `req.body`'s shape is based on user-controlled input, all +properties and values in this object are untrusted and should be validated +before trusting. For example, `req.body.foo.toString()` may fail in multiple +ways, for example the `foo` property may not be there or may not be a string, +and `toString` may not be a function and instead a string or other user input. + +[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/). + +_This does not handle multipart bodies_, due to their complex and typically +large nature. For multipart bodies, you may be interested in the following +modules: + + * [busboy](https://www.npmjs.org/package/busboy#readme) and + [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme) + * [multiparty](https://www.npmjs.org/package/multiparty#readme) and + [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme) + * [formidable](https://www.npmjs.org/package/formidable#readme) + * [multer](https://www.npmjs.org/package/multer#readme) + +This module provides the following parsers: + + * [JSON body parser](#bodyparserjsonoptions) + * [Raw body parser](#bodyparserrawoptions) + * [Text body parser](#bodyparsertextoptions) + * [URL-encoded form body parser](#bodyparserurlencodedoptions) + +Other body parsers you might be interested in: + +- [body](https://www.npmjs.org/package/body#readme) +- [co-body](https://www.npmjs.org/package/co-body#readme) + +## Installation + +```sh +$ npm install body-parser +``` + +## API + +```js +var bodyParser = require('body-parser') +``` + +The `bodyParser` object exposes various factories to create middlewares. All +middlewares will populate the `req.body` property with the parsed body when +the `Content-Type` request header matches the `type` option, or an empty +object (`{}`) if there was no body to parse, the `Content-Type` was not matched, +or an error occurred. + +The various errors returned by this module are described in the +[errors section](#errors). + +### bodyParser.json([options]) + +Returns middleware that only parses `json` and only looks at requests where +the `Content-Type` header matches the `type` option. This parser accepts any +Unicode encoding of the body and supports automatic inflation of `gzip` and +`deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). + +#### Options + +The `json` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### reviver + +The `reviver` option is passed directly to `JSON.parse` as the second +argument. You can find more information on this argument +[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter). + +##### strict + +When set to `true`, will only accept arrays and objects; when `false` will +accept anything `JSON.parse` accepts. Defaults to `true`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not a +function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `json`), a mime type (like `application/json`), or +a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a truthy +value. Defaults to `application/json`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.raw([options]) + +Returns middleware that parses all bodies as a `Buffer` and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a `Buffer` object +of the body. + +#### Options + +The `raw` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. +If not a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this +can be an extension name (like `bin`), a mime type (like +`application/octet-stream`), or a mime type with a wildcard (like `*/*` or +`application/*`). If a function, the `type` option is called as `fn(req)` +and the request is parsed if it returns a truthy value. Defaults to +`application/octet-stream`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.text([options]) + +Returns middleware that parses all bodies as a string and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` string containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a string of the +body. + +#### Options + +The `text` function takes an optional `options` object that may contain any of +the following keys: + +##### defaultCharset + +Specify the default character set for the text content if the charset is not +specified in the `Content-Type` header of the request. Defaults to `utf-8`. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `txt`), a mime type (like `text/plain`), or a mime +type with a wildcard (like `*/*` or `text/*`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a +truthy value. Defaults to `text/plain`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.urlencoded([options]) + +Returns middleware that only parses `urlencoded` bodies and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser accepts only UTF-8 encoding of the body and supports automatic +inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This object will contain +key-value pairs, where the value can be a string or array (when `extended` is +`false`), or any type (when `extended` is `true`). + +#### Options + +The `urlencoded` function takes an optional `options` object that may contain +any of the following keys: + +##### extended + +The `extended` option allows to choose between parsing the URL-encoded data +with the `querystring` library (when `false`) or the `qs` library (when +`true`). The "extended" syntax allows for rich objects and arrays to be +encoded into the URL-encoded format, allowing for a JSON-like experience +with URL-encoded. For more information, please +[see the qs library](https://www.npmjs.org/package/qs#readme). + +Defaults to `true`, but using the default has been deprecated. Please +research into the difference between `qs` and `querystring` and choose the +appropriate setting. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### parameterLimit + +The `parameterLimit` option controls the maximum number of parameters that +are allowed in the URL-encoded data. If a request contains more parameters +than this value, a 413 will be returned to the client. Defaults to `1000`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `urlencoded`), a mime type (like +`application/x-www-form-urlencoded`), or a mime type with a wildcard (like +`*/x-www-form-urlencoded`). If a function, the `type` option is called as +`fn(req)` and the request is parsed if it returns a truthy value. Defaults +to `application/x-www-form-urlencoded`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +## Errors + +The middlewares provided by this module create errors using the +[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors +will typically have a `status`/`statusCode` property that contains the suggested +HTTP response code, an `expose` property to determine if the `message` property +should be displayed to the client, a `type` property to determine the type of +error without matching against the `message`, and a `body` property containing +the read body, if available. + +The following are the common errors created, though any error can come through +for various reasons. + +### content encoding unsupported + +This error will occur when the request had a `Content-Encoding` header that +contained an encoding but the "inflation" option was set to `false`. The +`status` property is set to `415`, the `type` property is set to +`'encoding.unsupported'`, and the `charset` property will be set to the +encoding that is unsupported. + +### entity parse failed + +This error will occur when the request contained an entity that could not be +parsed by the middleware. The `status` property is set to `400`, the `type` +property is set to `'entity.parse.failed'`, and the `body` property is set to +the entity value that failed parsing. + +### entity verify failed + +This error will occur when the request contained an entity that could not be +failed verification by the defined `verify` option. The `status` property is +set to `403`, the `type` property is set to `'entity.verify.failed'`, and the +`body` property is set to the entity value that failed verification. + +### request aborted + +This error will occur when the request is aborted by the client before reading +the body has finished. The `received` property will be set to the number of +bytes received before the request was aborted and the `expected` property is +set to the number of expected bytes. The `status` property is set to `400` +and `type` property is set to `'request.aborted'`. + +### request entity too large + +This error will occur when the request body's size is larger than the "limit" +option. The `limit` property will be set to the byte limit and the `length` +property will be set to the request body's length. The `status` property is +set to `413` and the `type` property is set to `'entity.too.large'`. + +### request size did not match content length + +This error will occur when the request's length did not match the length from +the `Content-Length` header. This typically occurs when the request is malformed, +typically when the `Content-Length` header was calculated based on characters +instead of bytes. The `status` property is set to `400` and the `type` property +is set to `'request.size.invalid'`. + +### stream encoding should not be set + +This error will occur when something called the `req.setEncoding` method prior +to this middleware. This module operates directly on bytes only and you cannot +call `req.setEncoding` when using this module. The `status` property is set to +`500` and the `type` property is set to `'stream.encoding.set'`. + +### stream is not readable + +This error will occur when the request is no longer readable when this middleware +attempts to read it. This typically means something other than a middleware from +this module read the request body already and the middleware was also configured to +read the same request. The `status` property is set to `500` and the `type` +property is set to `'stream.not.readable'`. + +### too many parameters + +This error will occur when the content of the request exceeds the configured +`parameterLimit` for the `urlencoded` parser. The `status` property is set to +`413` and the `type` property is set to `'parameters.too.many'`. + +### unsupported charset "BOGUS" + +This error will occur when the request had a charset parameter in the +`Content-Type` header, but the `iconv-lite` module does not support it OR the +parser does not support it. The charset is contained in the message as well +as in the `charset` property. The `status` property is set to `415`, the +`type` property is set to `'charset.unsupported'`, and the `charset` property +is set to the charset that is unsupported. + +### unsupported content encoding "bogus" + +This error will occur when the request had a `Content-Encoding` header that +contained an unsupported encoding. The encoding is contained in the message +as well as in the `encoding` property. The `status` property is set to `415`, +the `type` property is set to `'encoding.unsupported'`, and the `encoding` +property is set to the encoding that is unsupported. + +## Examples + +### Express/Connect top-level generic + +This example demonstrates adding a generic JSON and URL-encoded parser as a +top-level middleware, which will parse the bodies of all incoming requests. +This is the simplest setup. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse application/x-www-form-urlencoded +app.use(bodyParser.urlencoded({ extended: false })) + +// parse application/json +app.use(bodyParser.json()) + +app.use(function (req, res) { + res.setHeader('Content-Type', 'text/plain') + res.write('you posted:\n') + res.end(JSON.stringify(req.body, null, 2)) +}) +``` + +### Express route-specific + +This example demonstrates adding body parsers specifically to the routes that +need them. In general, this is the most recommended way to use body-parser with +Express. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// create application/json parser +var jsonParser = bodyParser.json() + +// create application/x-www-form-urlencoded parser +var urlencodedParser = bodyParser.urlencoded({ extended: false }) + +// POST /login gets urlencoded bodies +app.post('/login', urlencodedParser, function (req, res) { + res.send('welcome, ' + req.body.username) +}) + +// POST /api/users gets JSON bodies +app.post('/api/users', jsonParser, function (req, res) { + // create user in req.body +}) +``` + +### Change accepted type for parsers + +All the parsers accept a `type` option which allows you to change the +`Content-Type` that the middleware will parse. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse various different custom JSON types as JSON +app.use(bodyParser.json({ type: 'application/*+json' })) + +// parse some custom thing into a Buffer +app.use(bodyParser.raw({ type: 'application/vnd.custom-type' })) + +// parse an HTML body into a string +app.use(bodyParser.text({ type: 'text/html' })) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/body-parser.svg +[npm-url]: https://npmjs.org/package/body-parser +[coveralls-image]: https://img.shields.io/coveralls/expressjs/body-parser/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master +[downloads-image]: https://img.shields.io/npm/dm/body-parser.svg +[downloads-url]: https://npmjs.org/package/body-parser +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/expressjs/body-parser/ci/master?label=ci +[github-actions-ci-url]: https://github.com/expressjs/body-parser/actions/workflows/ci.yml diff --git a/server/node_modules/body-parser/SECURITY.md b/server/node_modules/body-parser/SECURITY.md new file mode 100644 index 000000000..9694d4296 --- /dev/null +++ b/server/node_modules/body-parser/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The Express team and community take all security bugs seriously. Thank you +for improving the security of Express. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `body-parser`. This +information can be found in the npm registry using the command +`npm owner ls body-parser`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/expressjs/body-parser/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/server/node_modules/body-parser/index.js b/server/node_modules/body-parser/index.js new file mode 100644 index 000000000..bb24d739d --- /dev/null +++ b/server/node_modules/body-parser/index.js @@ -0,0 +1,156 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('body-parser') + +/** + * Cache of loaded parsers. + * @private + */ + +var parsers = Object.create(null) + +/** + * @typedef Parsers + * @type {function} + * @property {function} json + * @property {function} raw + * @property {function} text + * @property {function} urlencoded + */ + +/** + * Module exports. + * @type {Parsers} + */ + +exports = module.exports = deprecate.function(bodyParser, + 'bodyParser: use individual json/urlencoded middlewares') + +/** + * JSON parser. + * @public + */ + +Object.defineProperty(exports, 'json', { + configurable: true, + enumerable: true, + get: createParserGetter('json') +}) + +/** + * Raw parser. + * @public + */ + +Object.defineProperty(exports, 'raw', { + configurable: true, + enumerable: true, + get: createParserGetter('raw') +}) + +/** + * Text parser. + * @public + */ + +Object.defineProperty(exports, 'text', { + configurable: true, + enumerable: true, + get: createParserGetter('text') +}) + +/** + * URL-encoded parser. + * @public + */ + +Object.defineProperty(exports, 'urlencoded', { + configurable: true, + enumerable: true, + get: createParserGetter('urlencoded') +}) + +/** + * Create a middleware to parse json and urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @deprecated + * @public + */ + +function bodyParser (options) { + // use default type for parsers + var opts = Object.create(options || null, { + type: { + configurable: true, + enumerable: true, + value: undefined, + writable: true + } + }) + + var _urlencoded = exports.urlencoded(opts) + var _json = exports.json(opts) + + return function bodyParser (req, res, next) { + _json(req, res, function (err) { + if (err) return next(err) + _urlencoded(req, res, next) + }) + } +} + +/** + * Create a getter for loading a parser. + * @private + */ + +function createParserGetter (name) { + return function get () { + return loadParser(name) + } +} + +/** + * Load a parser module. + * @private + */ + +function loadParser (parserName) { + var parser = parsers[parserName] + + if (parser !== undefined) { + return parser + } + + // this uses a switch for static require analysis + switch (parserName) { + case 'json': + parser = require('./lib/types/json') + break + case 'raw': + parser = require('./lib/types/raw') + break + case 'text': + parser = require('./lib/types/text') + break + case 'urlencoded': + parser = require('./lib/types/urlencoded') + break + } + + // store to prevent invoking require() + return (parsers[parserName] = parser) +} diff --git a/server/node_modules/body-parser/lib/read.js b/server/node_modules/body-parser/lib/read.js new file mode 100644 index 000000000..fce6283f5 --- /dev/null +++ b/server/node_modules/body-parser/lib/read.js @@ -0,0 +1,205 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var destroy = require('destroy') +var getBody = require('raw-body') +var iconv = require('iconv-lite') +var onFinished = require('on-finished') +var unpipe = require('unpipe') +var zlib = require('zlib') + +/** + * Module exports. + */ + +module.exports = read + +/** + * Read a request into a buffer and parse. + * + * @param {object} req + * @param {object} res + * @param {function} next + * @param {function} parse + * @param {function} debug + * @param {object} options + * @private + */ + +function read (req, res, next, parse, debug, options) { + var length + var opts = options + var stream + + // flag as parsed + req._body = true + + // read options + var encoding = opts.encoding !== null + ? opts.encoding + : null + var verify = opts.verify + + try { + // get the content stream + stream = contentstream(req, debug, opts.inflate) + length = stream.length + stream.length = undefined + } catch (err) { + return next(err) + } + + // set raw-body options + opts.length = length + opts.encoding = verify + ? null + : encoding + + // assert charset is supported + if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) { + return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + })) + } + + // read body + debug('read body') + getBody(stream, opts, function (error, body) { + if (error) { + var _error + + if (error.type === 'encoding.unsupported') { + // echo back charset + _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + }) + } else { + // set status code on error + _error = createError(400, error) + } + + // unpipe from stream and destroy + if (stream !== req) { + unpipe(req) + destroy(stream, true) + } + + // read off entire request + dump(req, function onfinished () { + next(createError(400, _error)) + }) + return + } + + // verify + if (verify) { + try { + debug('verify body') + verify(req, res, body, encoding) + } catch (err) { + next(createError(403, err, { + body: body, + type: err.type || 'entity.verify.failed' + })) + return + } + } + + // parse + var str = body + try { + debug('parse body') + str = typeof body !== 'string' && encoding !== null + ? iconv.decode(body, encoding) + : body + req.body = parse(str) + } catch (err) { + next(createError(400, err, { + body: str, + type: err.type || 'entity.parse.failed' + })) + return + } + + next() + }) +} + +/** + * Get the content stream of the request. + * + * @param {object} req + * @param {function} debug + * @param {boolean} [inflate=true] + * @return {object} + * @api private + */ + +function contentstream (req, debug, inflate) { + var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase() + var length = req.headers['content-length'] + var stream + + debug('content-encoding "%s"', encoding) + + if (inflate === false && encoding !== 'identity') { + throw createError(415, 'content encoding unsupported', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + switch (encoding) { + case 'deflate': + stream = zlib.createInflate() + debug('inflate body') + req.pipe(stream) + break + case 'gzip': + stream = zlib.createGunzip() + debug('gunzip body') + req.pipe(stream) + break + case 'identity': + stream = req + stream.length = length + break + default: + throw createError(415, 'unsupported content encoding "' + encoding + '"', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + return stream +} + +/** + * Dump the contents of a request. + * + * @param {object} req + * @param {function} callback + * @api private + */ + +function dump (req, callback) { + if (onFinished.isFinished(req)) { + callback(null) + } else { + onFinished(req, callback) + req.resume() + } +} diff --git a/server/node_modules/body-parser/lib/types/json.js b/server/node_modules/body-parser/lib/types/json.js new file mode 100644 index 000000000..c2745be3a --- /dev/null +++ b/server/node_modules/body-parser/lib/types/json.js @@ -0,0 +1,236 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:json') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = json + +/** + * RegExp to match the first non-space in a string. + * + * Allowed whitespace is defined in RFC 7159: + * + * ws = *( + * %x20 / ; Space + * %x09 / ; Horizontal tab + * %x0A / ; Line feed or New line + * %x0D ) ; Carriage return + */ + +var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*([^\x20\x09\x0a\x0d])/ // eslint-disable-line no-control-regex + +/** + * Create a middleware to parse JSON bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function json (options) { + var opts = options || {} + + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var inflate = opts.inflate !== false + var reviver = opts.reviver + var strict = opts.strict !== false + var type = opts.type || 'application/json' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + if (body.length === 0) { + // special-case empty json body, as it's a common client-side mistake + // TODO: maybe make this configurable or part of "strict" option + return {} + } + + if (strict) { + var first = firstchar(body) + + if (first !== '{' && first !== '[') { + debug('strict violation') + throw createStrictSyntaxError(body, first) + } + } + + try { + debug('parse json') + return JSON.parse(body, reviver) + } catch (e) { + throw normalizeJsonSyntaxError(e, { + message: e.message, + stack: e.stack + }) + } + } + + return function jsonParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset per RFC 7159 sec 8.1 + var charset = getCharset(req) || 'utf-8' + if (charset.slice(0, 4) !== 'utf-') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Create strict violation syntax error matching native error. + * + * @param {string} str + * @param {string} char + * @return {Error} + * @private + */ + +function createStrictSyntaxError (str, char) { + var index = str.indexOf(char) + var partial = index !== -1 + ? str.substring(0, index) + '#' + : '' + + try { + JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation') + } catch (e) { + return normalizeJsonSyntaxError(e, { + message: e.message.replace('#', char), + stack: e.stack + }) + } +} + +/** + * Get the first non-whitespace character in a string. + * + * @param {string} str + * @return {function} + * @private + */ + +function firstchar (str) { + var match = FIRST_CHAR_REGEXP.exec(str) + + return match + ? match[1] + : undefined +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Normalize a SyntaxError for JSON.parse. + * + * @param {SyntaxError} error + * @param {object} obj + * @return {SyntaxError} + */ + +function normalizeJsonSyntaxError (error, obj) { + var keys = Object.getOwnPropertyNames(error) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + if (key !== 'stack' && key !== 'message') { + delete error[key] + } + } + + // replace stack before message for Node.js 0.10 and below + error.stack = obj.stack.replace(error.message, obj.message) + error.message = obj.message + + return error +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/server/node_modules/body-parser/lib/types/raw.js b/server/node_modules/body-parser/lib/types/raw.js new file mode 100644 index 000000000..f5d1b6747 --- /dev/null +++ b/server/node_modules/body-parser/lib/types/raw.js @@ -0,0 +1,101 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var debug = require('debug')('body-parser:raw') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = raw + +/** + * Create a middleware to parse raw bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function raw (options) { + var opts = options || {} + + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/octet-stream' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function rawParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // read + read(req, res, next, parse, debug, { + encoding: null, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/server/node_modules/body-parser/lib/types/text.js b/server/node_modules/body-parser/lib/types/text.js new file mode 100644 index 000000000..083a00908 --- /dev/null +++ b/server/node_modules/body-parser/lib/types/text.js @@ -0,0 +1,121 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var debug = require('debug')('body-parser:text') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = text + +/** + * Create a middleware to parse text bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function text (options) { + var opts = options || {} + + var defaultCharset = opts.defaultCharset || 'utf-8' + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'text/plain' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function textParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // get charset + var charset = getCharset(req) || defaultCharset + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/server/node_modules/body-parser/lib/types/urlencoded.js b/server/node_modules/body-parser/lib/types/urlencoded.js new file mode 100644 index 000000000..b2ca8f16d --- /dev/null +++ b/server/node_modules/body-parser/lib/types/urlencoded.js @@ -0,0 +1,284 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:urlencoded') +var deprecate = require('depd')('body-parser') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = urlencoded + +/** + * Cache of parser modules. + */ + +var parsers = Object.create(null) + +/** + * Create a middleware to parse urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function urlencoded (options) { + var opts = options || {} + + // notice because option default will flip in next major + if (opts.extended === undefined) { + deprecate('undefined extended: provide extended option') + } + + var extended = opts.extended !== false + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/x-www-form-urlencoded' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate query parser + var queryparse = extended + ? extendedparser(opts) + : simpleparser(opts) + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + return body.length + ? queryparse(body) + : {} + } + + return function urlencodedParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset + var charset = getCharset(req) || 'utf-8' + if (charset !== 'utf-8') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + debug: debug, + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the extended query parser. + * + * @param {object} options + */ + +function extendedparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('qs') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + var arrayLimit = Math.max(100, paramCount) + + debug('parse extended urlencoding') + return parse(body, { + allowPrototypes: true, + arrayLimit: arrayLimit, + depth: Infinity, + parameterLimit: parameterLimit + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Count the number of parameters, stopping once limit reached + * + * @param {string} body + * @param {number} limit + * @api private + */ + +function parameterCount (body, limit) { + var count = 0 + var index = 0 + + while ((index = body.indexOf('&', index)) !== -1) { + count++ + index++ + + if (count === limit) { + return undefined + } + } + + return count +} + +/** + * Get parser for module name dynamically. + * + * @param {string} name + * @return {function} + * @api private + */ + +function parser (name) { + var mod = parsers[name] + + if (mod !== undefined) { + return mod.parse + } + + // this uses a switch for static require analysis + switch (name) { + case 'qs': + mod = require('qs') + break + case 'querystring': + mod = require('querystring') + break + } + + // store to prevent invoking require() + parsers[name] = mod + + return mod.parse +} + +/** + * Get the simple query parser. + * + * @param {object} options + */ + +function simpleparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('querystring') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + debug('parse urlencoding') + return parse(body, undefined, undefined, { maxKeys: parameterLimit }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/server/node_modules/body-parser/package.json b/server/node_modules/body-parser/package.json new file mode 100644 index 000000000..9cd2ccbba --- /dev/null +++ b/server/node_modules/body-parser/package.json @@ -0,0 +1,56 @@ +{ + "name": "body-parser", + "description": "Node.js body parsing middleware", + "version": "1.20.1", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "expressjs/body-parser", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.11.0", + "raw-body": "2.5.1", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "devDependencies": { + "eslint": "8.24.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.26.0", + "eslint-plugin-markdown": "3.0.0", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.0.1", + "eslint-plugin-standard": "4.1.0", + "methods": "1.1.2", + "mocha": "10.0.0", + "nyc": "15.1.0", + "safe-buffer": "5.2.1", + "supertest": "6.3.0" + }, + "files": [ + "lib/", + "LICENSE", + "HISTORY.md", + "SECURITY.md", + "index.js" + ], + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/server/node_modules/bytes/History.md b/server/node_modules/bytes/History.md new file mode 100644 index 000000000..d60ce0e6d --- /dev/null +++ b/server/node_modules/bytes/History.md @@ -0,0 +1,97 @@ +3.1.2 / 2022-01-27 +================== + + * Fix return value for un-parsable strings + +3.1.1 / 2021-11-15 +================== + + * Fix "thousandsSeparator" incorrecting formatting fractional part + +3.1.0 / 2019-01-22 +================== + + * Add petabyte (`pb`) support + +3.0.0 / 2017-08-31 +================== + + * Change "kB" to "KB" in format output + * Remove support for Node.js 0.6 + * Remove support for ComponentJS + +2.5.0 / 2017-03-24 +================== + + * Add option "unit" + +2.4.0 / 2016-06-01 +================== + + * Add option "unitSeparator" + +2.3.0 / 2016-02-15 +================== + + * Drop partial bytes on all parsed units + * Fix non-finite numbers to `.format` to return `null` + * Fix parsing byte string that looks like hex + * perf: hoist regular expressions + +2.2.0 / 2015-11-13 +================== + + * add option "decimalPlaces" + * add option "fixedDecimals" + +2.1.0 / 2015-05-21 +================== + + * add `.format` export + * add `.parse` export + +2.0.2 / 2015-05-20 +================== + + * remove map recreation + * remove unnecessary object construction + +2.0.1 / 2015-05-07 +================== + + * fix browserify require + * remove node.extend dependency + +2.0.0 / 2015-04-12 +================== + + * add option "case" + * add option "thousandsSeparator" + * return "null" on invalid parse input + * support proper round-trip: bytes(bytes(num)) === num + * units no longer case sensitive when parsing + +1.0.0 / 2014-05-05 +================== + + * add negative support. fixes #6 + +0.3.0 / 2014-03-19 +================== + + * added terabyte support + +0.2.1 / 2013-04-01 +================== + + * add .component + +0.2.0 / 2012-10-28 +================== + + * bytes(200).should.eql('200b') + +0.1.0 / 2012-07-04 +================== + + * add bytes to string conversion [yields] diff --git a/server/node_modules/bytes/LICENSE b/server/node_modules/bytes/LICENSE new file mode 100644 index 000000000..63e95a963 --- /dev/null +++ b/server/node_modules/bytes/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015 Jed Watson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/server/node_modules/bytes/Readme.md b/server/node_modules/bytes/Readme.md new file mode 100644 index 000000000..5790e23e3 --- /dev/null +++ b/server/node_modules/bytes/Readme.md @@ -0,0 +1,152 @@ +# Bytes utility + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install bytes +``` + +## Usage + +```js +var bytes = require('bytes'); +``` + +#### bytes(number|string value, [options]): number|string|null + +Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number`|`string` | Number value to format or string value to parse | +| options | `Object` | Conversion options for `format` | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`|`number`|`null` | Return null upon error. Numeric value in bytes, or string value otherwise. | + +**Example** + +```js +bytes(1024); +// output: '1KB' + +bytes('1KB'); +// output: 1024 +``` + +#### bytes.format(number value, [options]): string|null + +Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is + rounded. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number` | Value in bytes | +| options | `Object` | Conversion options | + +**Options** + +| Property | Type | Description | +|-------------------|--------|-----------------------------------------------------------------------------------------| +| decimalPlaces | `number`|`null` | Maximum number of decimal places to include in output. Default value to `2`. | +| fixedDecimals | `boolean`|`null` | Whether to always display the maximum number of decimal places. Default value to `false` | +| thousandsSeparator | `string`|`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. | +| unit | `string`|`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). | +| unitSeparator | `string`|`null` | Separator to use between number and unit. Default value to `''`. | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`|`null` | Return null upon error. String value otherwise. | + +**Example** + +```js +bytes.format(1024); +// output: '1KB' + +bytes.format(1000); +// output: '1000B' + +bytes.format(1000, {thousandsSeparator: ' '}); +// output: '1 000B' + +bytes.format(1024 * 1.7, {decimalPlaces: 0}); +// output: '2KB' + +bytes.format(1024, {unitSeparator: ' '}); +// output: '1 KB' +``` + +#### bytes.parse(string|number value): number|null + +Parse the string value into an integer in bytes. If no unit is given, or `value` +is a number, it is assumed the value is in bytes. + +Supported units and abbreviations are as follows and are case-insensitive: + + * `b` for bytes + * `kb` for kilobytes + * `mb` for megabytes + * `gb` for gigabytes + * `tb` for terabytes + * `pb` for petabytes + +The units are in powers of two, not ten. This means 1kb = 1024b according to this parser. + +**Arguments** + +| Name | Type | Description | +|---------------|--------|--------------------| +| value | `string`|`number` | String to parse, or number in bytes. | + +**Returns** + +| Name | Type | Description | +|---------|-------------|-------------------------| +| results | `number`|`null` | Return null upon error. Value in bytes otherwise. | + +**Example** + +```js +bytes.parse('1KB'); +// output: 1024 + +bytes.parse('1024'); +// output: 1024 + +bytes.parse(1024); +// output: 1024 +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci +[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master +[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master +[downloads-image]: https://badgen.net/npm/dm/bytes +[downloads-url]: https://npmjs.org/package/bytes +[npm-image]: https://badgen.net/npm/v/bytes +[npm-url]: https://npmjs.org/package/bytes diff --git a/server/node_modules/bytes/index.js b/server/node_modules/bytes/index.js new file mode 100644 index 000000000..6f2d0f89e --- /dev/null +++ b/server/node_modules/bytes/index.js @@ -0,0 +1,170 @@ +/*! + * bytes + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015 Jed Watson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = bytes; +module.exports.format = format; +module.exports.parse = parse; + +/** + * Module variables. + * @private + */ + +var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g; + +var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/; + +var map = { + b: 1, + kb: 1 << 10, + mb: 1 << 20, + gb: 1 << 30, + tb: Math.pow(1024, 4), + pb: Math.pow(1024, 5), +}; + +var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i; + +/** + * Convert the given value in bytes into a string or parse to string to an integer in bytes. + * + * @param {string|number} value + * @param {{ + * case: [string], + * decimalPlaces: [number] + * fixedDecimals: [boolean] + * thousandsSeparator: [string] + * unitSeparator: [string] + * }} [options] bytes options. + * + * @returns {string|number|null} + */ + +function bytes(value, options) { + if (typeof value === 'string') { + return parse(value); + } + + if (typeof value === 'number') { + return format(value, options); + } + + return null; +} + +/** + * Format the given value in bytes into a string. + * + * If the value is negative, it is kept as such. If it is a float, + * it is rounded. + * + * @param {number} value + * @param {object} [options] + * @param {number} [options.decimalPlaces=2] + * @param {number} [options.fixedDecimals=false] + * @param {string} [options.thousandsSeparator=] + * @param {string} [options.unit=] + * @param {string} [options.unitSeparator=] + * + * @returns {string|null} + * @public + */ + +function format(value, options) { + if (!Number.isFinite(value)) { + return null; + } + + var mag = Math.abs(value); + var thousandsSeparator = (options && options.thousandsSeparator) || ''; + var unitSeparator = (options && options.unitSeparator) || ''; + var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2; + var fixedDecimals = Boolean(options && options.fixedDecimals); + var unit = (options && options.unit) || ''; + + if (!unit || !map[unit.toLowerCase()]) { + if (mag >= map.pb) { + unit = 'PB'; + } else if (mag >= map.tb) { + unit = 'TB'; + } else if (mag >= map.gb) { + unit = 'GB'; + } else if (mag >= map.mb) { + unit = 'MB'; + } else if (mag >= map.kb) { + unit = 'KB'; + } else { + unit = 'B'; + } + } + + var val = value / map[unit.toLowerCase()]; + var str = val.toFixed(decimalPlaces); + + if (!fixedDecimals) { + str = str.replace(formatDecimalsRegExp, '$1'); + } + + if (thousandsSeparator) { + str = str.split('.').map(function (s, i) { + return i === 0 + ? s.replace(formatThousandsRegExp, thousandsSeparator) + : s + }).join('.'); + } + + return str + unitSeparator + unit; +} + +/** + * Parse the string value into an integer in bytes. + * + * If no unit is given, it is assumed the value is in bytes. + * + * @param {number|string} val + * + * @returns {number|null} + * @public + */ + +function parse(val) { + if (typeof val === 'number' && !isNaN(val)) { + return val; + } + + if (typeof val !== 'string') { + return null; + } + + // Test if the string passed is valid + var results = parseRegExp.exec(val); + var floatValue; + var unit = 'b'; + + if (!results) { + // Nothing could be extracted from the given string + floatValue = parseInt(val, 10); + unit = 'b' + } else { + // Retrieve the value and the unit + floatValue = parseFloat(results[1]); + unit = results[4].toLowerCase(); + } + + if (isNaN(floatValue)) { + return null; + } + + return Math.floor(map[unit] * floatValue); +} diff --git a/server/node_modules/bytes/package.json b/server/node_modules/bytes/package.json new file mode 100644 index 000000000..f2b6a8b0e --- /dev/null +++ b/server/node_modules/bytes/package.json @@ -0,0 +1,42 @@ +{ + "name": "bytes", + "description": "Utility to parse a string bytes to bytes and vice-versa", + "version": "3.1.2", + "author": "TJ Holowaychuk (http://tjholowaychuk.com)", + "contributors": [ + "Jed Watson ", + "Théo FIDRY " + ], + "license": "MIT", + "keywords": [ + "byte", + "bytes", + "utility", + "parse", + "parser", + "convert", + "converter" + ], + "repository": "visionmedia/bytes.js", + "devDependencies": { + "eslint": "7.32.0", + "eslint-plugin-markdown": "2.2.1", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "History.md", + "LICENSE", + "Readme.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/server/node_modules/call-bind/.eslintignore b/server/node_modules/call-bind/.eslintignore new file mode 100644 index 000000000..404abb221 --- /dev/null +++ b/server/node_modules/call-bind/.eslintignore @@ -0,0 +1 @@ +coverage/ diff --git a/server/node_modules/call-bind/.eslintrc b/server/node_modules/call-bind/.eslintrc new file mode 100644 index 000000000..dfa9a6cdc --- /dev/null +++ b/server/node_modules/call-bind/.eslintrc @@ -0,0 +1,16 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "func-name-matching": 0, + "id-length": 0, + "new-cap": [2, { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + "no-magic-numbers": 0, + }, +} diff --git a/server/node_modules/call-bind/.github/FUNDING.yml b/server/node_modules/call-bind/.github/FUNDING.yml new file mode 100644 index 000000000..c70c2ecdb --- /dev/null +++ b/server/node_modules/call-bind/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/call-bind +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/server/node_modules/call-bind/.nycrc b/server/node_modules/call-bind/.nycrc new file mode 100644 index 000000000..bdd626ce9 --- /dev/null +++ b/server/node_modules/call-bind/.nycrc @@ -0,0 +1,9 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "exclude": [ + "coverage", + "test" + ] +} diff --git a/server/node_modules/call-bind/CHANGELOG.md b/server/node_modules/call-bind/CHANGELOG.md new file mode 100644 index 000000000..717bcc3e9 --- /dev/null +++ b/server/node_modules/call-bind/CHANGELOG.md @@ -0,0 +1,77 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.0.5](https://github.com/ljharb/call-bind/compare/v1.0.4...v1.0.5) - 2023-10-19 + +### Commits + +- [Fix] throw an error on non-functions as early as possible [`f262408`](https://github.com/ljharb/call-bind/commit/f262408f822c840fbc268080f3ad7c429611066d) +- [Deps] update `set-function-length` [`3fff271`](https://github.com/ljharb/call-bind/commit/3fff27145a1e3a76a5b74f1d7c3c43d0fa3b9871) + +## [v1.0.4](https://github.com/ljharb/call-bind/compare/v1.0.3...v1.0.4) - 2023-10-19 + +## [v1.0.3](https://github.com/ljharb/call-bind/compare/v1.0.2...v1.0.3) - 2023-10-19 + +### Commits + +- [actions] reuse common workflows [`a994df6`](https://github.com/ljharb/call-bind/commit/a994df69f401f4bf735a4ccd77029b85d1549453) +- [meta] use `npmignore` to autogenerate an npmignore file [`eef3ef2`](https://github.com/ljharb/call-bind/commit/eef3ef21e1f002790837fedb8af2679c761fbdf5) +- [readme] flesh out content [`1845ccf`](https://github.com/ljharb/call-bind/commit/1845ccfd9976a607884cfc7157c93192cc16cf22) +- [actions] use `node/install` instead of `node/run`; use `codecov` action [`5b47d53`](https://github.com/ljharb/call-bind/commit/5b47d53d2fd74af5ea0a44f1d51e503cd42f7a90) +- [Refactor] use `set-function-length` [`a0e165c`](https://github.com/ljharb/call-bind/commit/a0e165c5dc61db781cbc919b586b1c2b8da0b150) +- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`9c50103`](https://github.com/ljharb/call-bind/commit/9c50103f44137279a817317cf6cc421a658f85b4) +- [meta] simplify "exports" [`019c6d0`](https://github.com/ljharb/call-bind/commit/019c6d06b0e1246ceed8e579f57e44441cbbf6d9) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `safe-publish-latest`, `tape` [`23bd718`](https://github.com/ljharb/call-bind/commit/23bd718a288d3b03042062b4ef5153b3cea83f11) +- [actions] update codecov uploader [`62552d7`](https://github.com/ljharb/call-bind/commit/62552d79cc79e05825e99aaba134ae5b37f33da5) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `tape` [`ec81665`](https://github.com/ljharb/call-bind/commit/ec81665b300f87eabff597afdc8b8092adfa7afd) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `safe-publish-latest`, `tape` [`35d67fc`](https://github.com/ljharb/call-bind/commit/35d67fcea883e686650f736f61da5ddca2592de8) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`0266d8d`](https://github.com/ljharb/call-bind/commit/0266d8d2a45086a922db366d0c2932fa463662ff) +- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`43a5b28`](https://github.com/ljharb/call-bind/commit/43a5b28a444e710e1bbf92adb8afb5cf7523a223) +- [Deps] update `define-data-property`, `function-bind`, `get-intrinsic` [`780eb36`](https://github.com/ljharb/call-bind/commit/780eb36552514f8cc99c70821ce698697c2726a5) +- [Dev Deps] update `aud`, `tape` [`90d50ad`](https://github.com/ljharb/call-bind/commit/90d50ad03b061e0268b3380b0065fcaec183dc05) +- [meta] use `prepublishOnly` script for npm 7+ [`44c5433`](https://github.com/ljharb/call-bind/commit/44c5433b7980e02b4870007046407cf6fc543329) +- [Deps] update `get-intrinsic` [`86bfbfc`](https://github.com/ljharb/call-bind/commit/86bfbfcf34afdc6eabc93ce3d408548d0e27d958) +- [Deps] update `get-intrinsic` [`5c53354`](https://github.com/ljharb/call-bind/commit/5c5335489be0294c18cd7a8bb6e08226ee019ff5) +- [actions] update checkout action [`4c393a8`](https://github.com/ljharb/call-bind/commit/4c393a8173b3c8e5b30d5b3297b3b94d48bf87f3) +- [Deps] update `get-intrinsic` [`4e70bde`](https://github.com/ljharb/call-bind/commit/4e70bdec0626acb11616d66250fc14565e716e91) +- [Deps] update `get-intrinsic` [`55ae803`](https://github.com/ljharb/call-bind/commit/55ae803a920bd93c369cd798c20de31f91e9fc60) + +## [v1.0.2](https://github.com/ljharb/call-bind/compare/v1.0.1...v1.0.2) - 2021-01-11 + +### Commits + +- [Fix] properly include the receiver in the bound length [`dbae7bc`](https://github.com/ljharb/call-bind/commit/dbae7bc676c079a0d33c0a43e9ef92cb7b01345d) + +## [v1.0.1](https://github.com/ljharb/call-bind/compare/v1.0.0...v1.0.1) - 2021-01-08 + +### Commits + +- [Tests] migrate tests to Github Actions [`b6db284`](https://github.com/ljharb/call-bind/commit/b6db284c36f8ccd195b88a6764fe84b7223a0da1) +- [meta] do not publish github action workflow files [`ec7fe46`](https://github.com/ljharb/call-bind/commit/ec7fe46e60cfa4764ee943d2755f5e5a366e578e) +- [Fix] preserve original function’s length when possible [`adbceaa`](https://github.com/ljharb/call-bind/commit/adbceaa3cac4b41ea78bb19d7ccdbaaf7e0bdadb) +- [Tests] gather coverage data on every job [`d69e23c`](https://github.com/ljharb/call-bind/commit/d69e23cc65f101ba1d4c19bb07fa8eb0ec624be8) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`2fd3586`](https://github.com/ljharb/call-bind/commit/2fd3586c5d47b335364c14293114c6b625ae1f71) +- [Deps] update `get-intrinsic` [`f23e931`](https://github.com/ljharb/call-bind/commit/f23e9318cc271c2add8bb38cfded85ee7baf8eee) +- [Deps] update `get-intrinsic` [`72d9f44`](https://github.com/ljharb/call-bind/commit/72d9f44e184465ba8dd3fb48260bbcff234985f2) +- [meta] fix FUNDING.yml [`e723573`](https://github.com/ljharb/call-bind/commit/e723573438c5a68dcec31fb5d96ea6b7e4a93be8) +- [eslint] ignore coverage output [`15e76d2`](https://github.com/ljharb/call-bind/commit/15e76d28a5f43e504696401e5b31ebb78ee1b532) +- [meta] add Automatic Rebase and Require Allow Edits workflows [`8fa4dab`](https://github.com/ljharb/call-bind/commit/8fa4dabb23ba3dd7bb92c9571c1241c08b56e4b6) + +## v1.0.0 - 2020-10-30 + +### Commits + +- Initial commit [`306cf98`](https://github.com/ljharb/call-bind/commit/306cf98c7ec9e7ef66b653ec152277ac1381eb50) +- Tests [`e10d0bb`](https://github.com/ljharb/call-bind/commit/e10d0bbdadc7a10ecedc9a1c035112d3e368b8df) +- Implementation [`43852ed`](https://github.com/ljharb/call-bind/commit/43852eda0f187327b7fad2423ca972149a52bd65) +- npm init [`408f860`](https://github.com/ljharb/call-bind/commit/408f860b773a2f610805fd3613d0d71bac1b6249) +- [meta] add Automatic Rebase and Require Allow Edits workflows [`fb349b2`](https://github.com/ljharb/call-bind/commit/fb349b2e48defbec8b5ec8a8395cc8f69f220b13) +- [meta] add `auto-changelog` [`c4001fc`](https://github.com/ljharb/call-bind/commit/c4001fc43031799ef908211c98d3b0fb2b60fde4) +- [meta] add "funding"; create `FUNDING.yml` [`d4d6d29`](https://github.com/ljharb/call-bind/commit/d4d6d2974a14bc2e98830468eda7fe6d6a776717) +- [Tests] add `npm run lint` [`dedfb98`](https://github.com/ljharb/call-bind/commit/dedfb98bd0ecefb08ddb9a94061bd10cde4332af) +- Only apps should have lockfiles [`54ac776`](https://github.com/ljharb/call-bind/commit/54ac77653db45a7361dc153d2f478e743f110650) +- [meta] add `safe-publish-latest` [`9ea8e43`](https://github.com/ljharb/call-bind/commit/9ea8e435b950ce9b705559cd651039f9bf40140f) diff --git a/server/node_modules/call-bind/LICENSE b/server/node_modules/call-bind/LICENSE new file mode 100644 index 000000000..48f05d01d --- /dev/null +++ b/server/node_modules/call-bind/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2020 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/server/node_modules/call-bind/README.md b/server/node_modules/call-bind/README.md new file mode 100644 index 000000000..48e9047f0 --- /dev/null +++ b/server/node_modules/call-bind/README.md @@ -0,0 +1,64 @@ +# call-bind [![Version Badge][npm-version-svg]][package-url] + +[![github actions][actions-image]][actions-url] +[![coverage][codecov-image]][codecov-url] +[![dependency status][deps-svg]][deps-url] +[![dev dependency status][dev-deps-svg]][dev-deps-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][npm-badge-png]][package-url] + +Robustly `.call.bind()` a function. + +## Getting started + +```sh +npm install --save call-bind +``` + +## Usage/Examples + +```js +const assert = require('assert'); +const callBind = require('call-bind'); +const callBound = require('call-bind/callBound'); + +function f(a, b) { + assert.equal(this, 1); + assert.equal(a, 2); + assert.equal(b, 3); + assert.equal(arguments.length, 2); +} + +const fBound = callBind(f); + +const slice = callBound('Array.prototype.slice'); + +delete Function.prototype.call; +delete Function.prototype.bind; + +fBound(1, 2, 3); + +assert.deepEqual(slice([1, 2, 3, 4], 1, -1), [2, 3]); +``` + +## Tests + +Clone the repo, `npm install`, and run `npm test` + +[package-url]: https://npmjs.org/package/call-bind +[npm-version-svg]: https://versionbadg.es/ljharb/call-bind.svg +[deps-svg]: https://david-dm.org/ljharb/call-bind.svg +[deps-url]: https://david-dm.org/ljharb/call-bind +[dev-deps-svg]: https://david-dm.org/ljharb/call-bind/dev-status.svg +[dev-deps-url]: https://david-dm.org/ljharb/call-bind#info=devDependencies +[npm-badge-png]: https://nodei.co/npm/call-bind.png?downloads=true&stars=true +[license-image]: https://img.shields.io/npm/l/call-bind.svg +[license-url]: LICENSE +[downloads-image]: https://img.shields.io/npm/dm/call-bind.svg +[downloads-url]: https://npm-stat.com/charts.html?package=call-bind +[codecov-image]: https://codecov.io/gh/ljharb/call-bind/branch/main/graphs/badge.svg +[codecov-url]: https://app.codecov.io/gh/ljharb/call-bind/ +[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bind +[actions-url]: https://github.com/ljharb/call-bind/actions diff --git a/server/node_modules/call-bind/callBound.js b/server/node_modules/call-bind/callBound.js new file mode 100644 index 000000000..8374adfd0 --- /dev/null +++ b/server/node_modules/call-bind/callBound.js @@ -0,0 +1,15 @@ +'use strict'; + +var GetIntrinsic = require('get-intrinsic'); + +var callBind = require('./'); + +var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf')); + +module.exports = function callBoundIntrinsic(name, allowMissing) { + var intrinsic = GetIntrinsic(name, !!allowMissing); + if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.') > -1) { + return callBind(intrinsic); + } + return intrinsic; +}; diff --git a/server/node_modules/call-bind/index.js b/server/node_modules/call-bind/index.js new file mode 100644 index 000000000..184ee2be3 --- /dev/null +++ b/server/node_modules/call-bind/index.js @@ -0,0 +1,44 @@ +'use strict'; + +var bind = require('function-bind'); +var GetIntrinsic = require('get-intrinsic'); +var setFunctionLength = require('set-function-length'); + +var $TypeError = GetIntrinsic('%TypeError%'); +var $apply = GetIntrinsic('%Function.prototype.apply%'); +var $call = GetIntrinsic('%Function.prototype.call%'); +var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply); + +var $defineProperty = GetIntrinsic('%Object.defineProperty%', true); +var $max = GetIntrinsic('%Math.max%'); + +if ($defineProperty) { + try { + $defineProperty({}, 'a', { value: 1 }); + } catch (e) { + // IE 8 has a broken defineProperty + $defineProperty = null; + } +} + +module.exports = function callBind(originalFunction) { + if (typeof originalFunction !== 'function') { + throw new $TypeError('a function is required'); + } + var func = $reflectApply(bind, $call, arguments); + return setFunctionLength( + func, + 1 + $max(0, originalFunction.length - (arguments.length - 1)), + true + ); +}; + +var applyBind = function applyBind() { + return $reflectApply(bind, $apply, arguments); +}; + +if ($defineProperty) { + $defineProperty(module.exports, 'apply', { value: applyBind }); +} else { + module.exports.apply = applyBind; +} diff --git a/server/node_modules/call-bind/package.json b/server/node_modules/call-bind/package.json new file mode 100644 index 000000000..f946e1a91 --- /dev/null +++ b/server/node_modules/call-bind/package.json @@ -0,0 +1,90 @@ +{ + "name": "call-bind", + "version": "1.0.5", + "description": "Robustly `.call.bind()` a function", + "main": "index.js", + "exports": { + ".": "./index.js", + "./callBound": "./callBound.js", + "./package.json": "./package.json" + }, + "scripts": { + "prepack": "npmignore --auto --commentLines=auto", + "prepublish": "not-in-publish || npm run prepublishOnly", + "prepublishOnly": "safe-publish-latest", + "lint": "eslint --ext=.js,.mjs .", + "postlint": "evalmd README.md", + "pretest": "npm run lint", + "tests-only": "nyc tape 'test/**/*.js'", + "test": "npm run tests-only", + "posttest": "aud --production", + "version": "auto-changelog && git add CHANGELOG.md", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/call-bind.git" + }, + "keywords": [ + "javascript", + "ecmascript", + "es", + "js", + "callbind", + "callbound", + "call", + "bind", + "bound", + "call-bind", + "call-bound", + "function", + "es-abstract" + ], + "author": "Jordan Harband ", + "funding": { + "url": "https://github.com/sponsors/ljharb" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/ljharb/call-bind/issues" + }, + "homepage": "https://github.com/ljharb/call-bind#readme", + "devDependencies": { + "@ljharb/eslint-config": "^21.1.0", + "aud": "^2.0.3", + "auto-changelog": "^2.4.0", + "es-value-fixtures": "^1.4.2", + "eslint": "=8.8.0", + "evalmd": "^0.0.19", + "for-each": "^0.3.3", + "gopd": "^1.0.1", + "has-strict-mode": "^1.0.1", + "in-publish": "^2.0.1", + "npmignore": "^0.3.0", + "nyc": "^10.3.2", + "object-inspect": "^1.13.1", + "safe-publish-latest": "^2.0.0", + "tape": "^5.7.1" + }, + "dependencies": { + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.1", + "set-function-length": "^1.1.1" + }, + "testling": { + "files": "test/index.js" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "publishConfig": { + "ignore": [ + ".github/workflows" + ] + } +} diff --git a/server/node_modules/call-bind/test/callBound.js b/server/node_modules/call-bind/test/callBound.js new file mode 100644 index 000000000..c32319d70 --- /dev/null +++ b/server/node_modules/call-bind/test/callBound.js @@ -0,0 +1,54 @@ +'use strict'; + +var test = require('tape'); + +var callBound = require('../callBound'); + +test('callBound', function (t) { + // static primitive + t.equal(callBound('Array.length'), Array.length, 'Array.length yields itself'); + t.equal(callBound('%Array.length%'), Array.length, '%Array.length% yields itself'); + + // static non-function object + t.equal(callBound('Array.prototype'), Array.prototype, 'Array.prototype yields itself'); + t.equal(callBound('%Array.prototype%'), Array.prototype, '%Array.prototype% yields itself'); + t.equal(callBound('Array.constructor'), Array.constructor, 'Array.constructor yields itself'); + t.equal(callBound('%Array.constructor%'), Array.constructor, '%Array.constructor% yields itself'); + + // static function + t.equal(callBound('Date.parse'), Date.parse, 'Date.parse yields itself'); + t.equal(callBound('%Date.parse%'), Date.parse, '%Date.parse% yields itself'); + + // prototype primitive + t.equal(callBound('Error.prototype.message'), Error.prototype.message, 'Error.prototype.message yields itself'); + t.equal(callBound('%Error.prototype.message%'), Error.prototype.message, '%Error.prototype.message% yields itself'); + + // prototype function + t.notEqual(callBound('Object.prototype.toString'), Object.prototype.toString, 'Object.prototype.toString does not yield itself'); + t.notEqual(callBound('%Object.prototype.toString%'), Object.prototype.toString, '%Object.prototype.toString% does not yield itself'); + t.equal(callBound('Object.prototype.toString')(true), Object.prototype.toString.call(true), 'call-bound Object.prototype.toString calls into the original'); + t.equal(callBound('%Object.prototype.toString%')(true), Object.prototype.toString.call(true), 'call-bound %Object.prototype.toString% calls into the original'); + + t['throws']( + function () { callBound('does not exist'); }, + SyntaxError, + 'nonexistent intrinsic throws' + ); + t['throws']( + function () { callBound('does not exist', true); }, + SyntaxError, + 'allowMissing arg still throws for unknown intrinsic' + ); + + t.test('real but absent intrinsic', { skip: typeof WeakRef !== 'undefined' }, function (st) { + st['throws']( + function () { callBound('WeakRef'); }, + TypeError, + 'real but absent intrinsic throws' + ); + st.equal(callBound('WeakRef', true), undefined, 'allowMissing arg avoids exception'); + st.end(); + }); + + t.end(); +}); diff --git a/server/node_modules/call-bind/test/index.js b/server/node_modules/call-bind/test/index.js new file mode 100644 index 000000000..1fd46689e --- /dev/null +++ b/server/node_modules/call-bind/test/index.js @@ -0,0 +1,80 @@ +'use strict'; + +var callBind = require('../'); +var bind = require('function-bind'); +var gOPD = require('gopd'); +var hasStrictMode = require('has-strict-mode')(); +var forEach = require('for-each'); +var inspect = require('object-inspect'); +var v = require('es-value-fixtures'); + +var test = require('tape'); + +/* + * older engines have length nonconfigurable + * in io.js v3, it is configurable except on bound functions, hence the .bind() + */ +var functionsHaveConfigurableLengths = !!( + gOPD + && Object.getOwnPropertyDescriptor + && Object.getOwnPropertyDescriptor(bind.call(function () {}), 'length').configurable +); + +test('callBind', function (t) { + forEach(v.nonFunctions, function (nonFunction) { + t['throws']( + function () { callBind(nonFunction); }, + TypeError, + inspect(nonFunction) + ' is not a function' + ); + }); + + var sentinel = { sentinel: true }; + var func = function (a, b) { + // eslint-disable-next-line no-invalid-this + return [!hasStrictMode && this === global ? undefined : this, a, b]; + }; + t.equal(func.length, 2, 'original function length is 2'); + t.deepEqual(func(), [undefined, undefined, undefined], 'unbound func with too few args'); + t.deepEqual(func(1, 2), [undefined, 1, 2], 'unbound func with right args'); + t.deepEqual(func(1, 2, 3), [undefined, 1, 2], 'unbound func with too many args'); + + var bound = callBind(func); + t.equal(bound.length, func.length + 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(bound(), [undefined, undefined, undefined], 'bound func with too few args'); + t.deepEqual(bound(1, 2), [hasStrictMode ? 1 : Object(1), 2, undefined], 'bound func with right args'); + t.deepEqual(bound(1, 2, 3), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with too many args'); + + var boundR = callBind(func, sentinel); + t.equal(boundR.length, func.length, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(boundR(), [sentinel, undefined, undefined], 'bound func with receiver, with too few args'); + t.deepEqual(boundR(1, 2), [sentinel, 1, 2], 'bound func with receiver, with right args'); + t.deepEqual(boundR(1, 2, 3), [sentinel, 1, 2], 'bound func with receiver, with too many args'); + + var boundArg = callBind(func, sentinel, 1); + t.equal(boundArg.length, func.length - 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(boundArg(), [sentinel, 1, undefined], 'bound func with receiver and arg, with too few args'); + t.deepEqual(boundArg(2), [sentinel, 1, 2], 'bound func with receiver and arg, with right arg'); + t.deepEqual(boundArg(2, 3), [sentinel, 1, 2], 'bound func with receiver and arg, with too many args'); + + t.test('callBind.apply', function (st) { + var aBound = callBind.apply(func); + st.deepEqual(aBound(sentinel), [sentinel, undefined, undefined], 'apply-bound func with no args'); + st.deepEqual(aBound(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args'); + st.deepEqual(aBound(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args'); + + var aBoundArg = callBind.apply(func); + st.deepEqual(aBoundArg(sentinel, [1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with too many args'); + st.deepEqual(aBoundArg(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args'); + st.deepEqual(aBoundArg(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args'); + + var aBoundR = callBind.apply(func, sentinel); + st.deepEqual(aBoundR([1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with receiver and too many args'); + st.deepEqual(aBoundR([1, 2], 4), [sentinel, 1, 2], 'apply-bound func with receiver and right args'); + st.deepEqual(aBoundR([1], 4), [sentinel, 1, undefined], 'apply-bound func with receiver and too few args'); + + st.end(); + }); + + t.end(); +}); diff --git a/server/node_modules/content-disposition/HISTORY.md b/server/node_modules/content-disposition/HISTORY.md new file mode 100644 index 000000000..488effa0c --- /dev/null +++ b/server/node_modules/content-disposition/HISTORY.md @@ -0,0 +1,60 @@ +0.5.4 / 2021-12-10 +================== + + * deps: safe-buffer@5.2.1 + +0.5.3 / 2018-12-17 +================== + + * Use `safe-buffer` for improved Buffer API + +0.5.2 / 2016-12-08 +================== + + * Fix `parse` to accept any linear whitespace character + +0.5.1 / 2016-01-17 +================== + + * perf: enable strict mode + +0.5.0 / 2014-10-11 +================== + + * Add `parse` function + +0.4.0 / 2014-09-21 +================== + + * Expand non-Unicode `filename` to the full ISO-8859-1 charset + +0.3.0 / 2014-09-20 +================== + + * Add `fallback` option + * Add `type` option + +0.2.0 / 2014-09-19 +================== + + * Reduce ambiguity of file names with hex escape in buggy browsers + +0.1.2 / 2014-09-19 +================== + + * Fix periodic invalid Unicode filename header + +0.1.1 / 2014-09-19 +================== + + * Fix invalid characters appearing in `filename*` parameter + +0.1.0 / 2014-09-18 +================== + + * Make the `filename` argument optional + +0.0.0 / 2014-09-18 +================== + + * Initial release diff --git a/server/node_modules/content-disposition/LICENSE b/server/node_modules/content-disposition/LICENSE new file mode 100644 index 000000000..84441fbb5 --- /dev/null +++ b/server/node_modules/content-disposition/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/server/node_modules/content-disposition/README.md b/server/node_modules/content-disposition/README.md new file mode 100644 index 000000000..3a0bb0559 --- /dev/null +++ b/server/node_modules/content-disposition/README.md @@ -0,0 +1,142 @@ +# content-disposition + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP `Content-Disposition` header + +## Installation + +```sh +$ npm install content-disposition +``` + +## API + +```js +var contentDisposition = require('content-disposition') +``` + +### contentDisposition(filename, options) + +Create an attachment `Content-Disposition` header value using the given file name, +if supplied. The `filename` is optional and if no file name is desired, but you +want to specify `options`, set `filename` to `undefined`. + +```js +res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf')) +``` + +**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this +header through a means different from `setHeader` in Node.js, you'll want to specify +the `'binary'` encoding in Node.js. + +#### Options + +`contentDisposition` accepts these properties in the options object. + +##### fallback + +If the `filename` option is outside ISO-8859-1, then the file name is actually +stored in a supplemental field for clients that support Unicode file names and +a ISO-8859-1 version of the file name is automatically generated. + +This specifies the ISO-8859-1 file name to override the automatic generation or +disables the generation all together, defaults to `true`. + + - A string will specify the ISO-8859-1 file name to use in place of automatic + generation. + - `false` will disable including a ISO-8859-1 file name and only include the + Unicode version (unless the file name is already ISO-8859-1). + - `true` will enable automatic generation if the file name is outside ISO-8859-1. + +If the `filename` option is ISO-8859-1 and this option is specified and has a +different value, then the `filename` option is encoded in the extended field +and this set as the fallback field, even though they are both ISO-8859-1. + +##### type + +Specifies the disposition type, defaults to `"attachment"`. This can also be +`"inline"`, or any other value (all values except inline are treated like +`attachment`, but can convey additional information if both parties agree to +it). The type is normalized to lower-case. + +### contentDisposition.parse(string) + +```js +var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt') +``` + +Parse a `Content-Disposition` header string. This automatically handles extended +("Unicode") parameters by decoding them and providing them under the standard +parameter name. This will return an object with the following properties (examples +are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`): + + - `type`: The disposition type (always lower case). Example: `'attachment'` + + - `parameters`: An object of the parameters in the disposition (name of parameter + always lower case and extended versions replace non-extended versions). Example: + `{filename: "€ rates.txt"}` + +## Examples + +### Send a file for download + +```js +var contentDisposition = require('content-disposition') +var destroy = require('destroy') +var fs = require('fs') +var http = require('http') +var onFinished = require('on-finished') + +var filePath = '/path/to/public/plans.pdf' + +http.createServer(function onRequest (req, res) { + // set headers + res.setHeader('Content-Type', 'application/pdf') + res.setHeader('Content-Disposition', contentDisposition(filePath)) + + // send file + var stream = fs.createReadStream(filePath) + stream.pipe(res) + onFinished(res, function () { + destroy(stream) + }) +}) +``` + +## Testing + +```sh +$ npm test +``` + +## References + +- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616] +- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987] +- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266] +- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231] + +[rfc-2616]: https://tools.ietf.org/html/rfc2616 +[rfc-5987]: https://tools.ietf.org/html/rfc5987 +[rfc-6266]: https://tools.ietf.org/html/rfc6266 +[tc-2231]: http://greenbytes.de/tech/tc2231/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-disposition.svg +[npm-url]: https://npmjs.org/package/content-disposition +[node-version-image]: https://img.shields.io/node/v/content-disposition.svg +[node-version-url]: https://nodejs.org/en/download +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg +[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master +[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg +[downloads-url]: https://npmjs.org/package/content-disposition +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/content-disposition/ci/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/content-disposition?query=workflow%3Aci diff --git a/server/node_modules/content-disposition/index.js b/server/node_modules/content-disposition/index.js new file mode 100644 index 000000000..ecec899a9 --- /dev/null +++ b/server/node_modules/content-disposition/index.js @@ -0,0 +1,458 @@ +/*! + * content-disposition + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = contentDisposition +module.exports.parse = parse + +/** + * Module dependencies. + * @private + */ + +var basename = require('path').basename +var Buffer = require('safe-buffer').Buffer + +/** + * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%") + * @private + */ + +var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex + +/** + * RegExp to match percent encoding escape. + * @private + */ + +var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/ +var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g + +/** + * RegExp to match non-latin1 characters. + * @private + */ + +var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = + * @private + */ + +var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + * @private + */ + +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp for various RFC 2616 grammar + * + * parameter = token "=" ( token | quoted-string ) + * token = 1* + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = > + * quoted-pair = "\" CHAR + * CHAR = + * TEXT = + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = + * LF = + * SP = + * HT = + * CTL = + * OCTET = + * @private + */ + +var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/ +var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/ + +/** + * RegExp for various RFC 5987 grammar + * + * ext-value = charset "'" [ language ] "'" value-chars + * charset = "UTF-8" / "ISO-8859-1" / mime-charset + * mime-charset = 1*mime-charsetc + * mime-charsetc = ALPHA / DIGIT + * / "!" / "#" / "$" / "%" / "&" + * / "+" / "-" / "^" / "_" / "`" + * / "{" / "}" / "~" + * language = ( 2*3ALPHA [ extlang ] ) + * / 4ALPHA + * / 5*8ALPHA + * extlang = *3( "-" 3ALPHA ) + * value-chars = *( pct-encoded / attr-char ) + * pct-encoded = "%" HEXDIG HEXDIG + * attr-char = ALPHA / DIGIT + * / "!" / "#" / "$" / "&" / "+" / "-" / "." + * / "^" / "_" / "`" / "|" / "~" + * @private + */ + +var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/ + +/** + * RegExp for various RFC 6266 grammar + * + * disposition-type = "inline" | "attachment" | disp-ext-type + * disp-ext-type = token + * disposition-parm = filename-parm | disp-ext-parm + * filename-parm = "filename" "=" value + * | "filename*" "=" ext-value + * disp-ext-parm = token "=" value + * | ext-token "=" ext-value + * ext-token = + * @private + */ + +var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex + +/** + * Create an attachment Content-Disposition header. + * + * @param {string} [filename] + * @param {object} [options] + * @param {string} [options.type=attachment] + * @param {string|boolean} [options.fallback=true] + * @return {string} + * @public + */ + +function contentDisposition (filename, options) { + var opts = options || {} + + // get type + var type = opts.type || 'attachment' + + // get parameters + var params = createparams(filename, opts.fallback) + + // format into string + return format(new ContentDisposition(type, params)) +} + +/** + * Create parameters object from filename and fallback. + * + * @param {string} [filename] + * @param {string|boolean} [fallback=true] + * @return {object} + * @private + */ + +function createparams (filename, fallback) { + if (filename === undefined) { + return + } + + var params = {} + + if (typeof filename !== 'string') { + throw new TypeError('filename must be a string') + } + + // fallback defaults to true + if (fallback === undefined) { + fallback = true + } + + if (typeof fallback !== 'string' && typeof fallback !== 'boolean') { + throw new TypeError('fallback must be a string or boolean') + } + + if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) { + throw new TypeError('fallback must be ISO-8859-1 string') + } + + // restrict to file base name + var name = basename(filename) + + // determine if name is suitable for quoted string + var isQuotedString = TEXT_REGEXP.test(name) + + // generate fallback name + var fallbackName = typeof fallback !== 'string' + ? fallback && getlatin1(name) + : basename(fallback) + var hasFallback = typeof fallbackName === 'string' && fallbackName !== name + + // set extended filename parameter + if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) { + params['filename*'] = name + } + + // set filename parameter + if (isQuotedString || hasFallback) { + params.filename = hasFallback + ? fallbackName + : name + } + + return params +} + +/** + * Format object to Content-Disposition header. + * + * @param {object} obj + * @param {string} obj.type + * @param {object} [obj.parameters] + * @return {string} + * @private + */ + +function format (obj) { + var parameters = obj.parameters + var type = obj.type + + if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + // start with normalized type + var string = String(type).toLowerCase() + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + var val = param.substr(-1) === '*' + ? ustring(parameters[param]) + : qstring(parameters[param]) + + string += '; ' + param + '=' + val + } + } + + return string +} + +/** + * Decode a RFC 5987 field value (gracefully). + * + * @param {string} str + * @return {string} + * @private + */ + +function decodefield (str) { + var match = EXT_VALUE_REGEXP.exec(str) + + if (!match) { + throw new TypeError('invalid extended field value') + } + + var charset = match[1].toLowerCase() + var encoded = match[2] + var value + + // to binary string + var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode) + + switch (charset) { + case 'iso-8859-1': + value = getlatin1(binary) + break + case 'utf-8': + value = Buffer.from(binary, 'binary').toString('utf8') + break + default: + throw new TypeError('unsupported charset in extended field') + } + + return value +} + +/** + * Get ISO-8859-1 version of string. + * + * @param {string} val + * @return {string} + * @private + */ + +function getlatin1 (val) { + // simple Unicode -> ISO-8859-1 transformation + return String(val).replace(NON_LATIN1_REGEXP, '?') +} + +/** + * Parse Content-Disposition header string. + * + * @param {string} string + * @return {object} + * @public + */ + +function parse (string) { + if (!string || typeof string !== 'string') { + throw new TypeError('argument string is required') + } + + var match = DISPOSITION_TYPE_REGEXP.exec(string) + + if (!match) { + throw new TypeError('invalid type format') + } + + // normalize type + var index = match[0].length + var type = match[1].toLowerCase() + + var key + var names = [] + var params = {} + var value + + // calculate index to start at + index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';' + ? index - 1 + : index + + // match parameters + while ((match = PARAM_REGEXP.exec(string))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (names.indexOf(key) !== -1) { + throw new TypeError('invalid duplicate parameter') + } + + names.push(key) + + if (key.indexOf('*') + 1 === key.length) { + // decode extended value + key = key.slice(0, -1) + value = decodefield(value) + + // overwrite existing value + params[key] = value + continue + } + + if (typeof params[key] === 'string') { + continue + } + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(QESC_REGEXP, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return new ContentDisposition(type, params) +} + +/** + * Percent decode a single character. + * + * @param {string} str + * @param {string} hex + * @return {string} + * @private + */ + +function pdecode (str, hex) { + return String.fromCharCode(parseInt(hex, 16)) +} + +/** + * Percent encode a single character. + * + * @param {string} char + * @return {string} + * @private + */ + +function pencode (char) { + return '%' + String(char) + .charCodeAt(0) + .toString(16) + .toUpperCase() +} + +/** + * Quote a string for HTTP. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Encode a Unicode string for HTTP (RFC 5987). + * + * @param {string} val + * @return {string} + * @private + */ + +function ustring (val) { + var str = String(val) + + // percent encode as UTF-8 + var encoded = encodeURIComponent(str) + .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode) + + return 'UTF-8\'\'' + encoded +} + +/** + * Class for parsed Content-Disposition header for v8 optimization + * + * @public + * @param {string} type + * @param {object} parameters + * @constructor + */ + +function ContentDisposition (type, parameters) { + this.type = type + this.parameters = parameters +} diff --git a/server/node_modules/content-disposition/package.json b/server/node_modules/content-disposition/package.json new file mode 100644 index 000000000..43c70ce24 --- /dev/null +++ b/server/node_modules/content-disposition/package.json @@ -0,0 +1,44 @@ +{ + "name": "content-disposition", + "description": "Create and parse Content-Disposition header", + "version": "0.5.4", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "content-disposition", + "http", + "rfc6266", + "res" + ], + "repository": "jshttp/content-disposition", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "13.0.1", + "eslint-plugin-import": "2.25.3", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "istanbul": "0.4.5", + "mocha": "9.1.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + } +} diff --git a/server/node_modules/content-type/HISTORY.md b/server/node_modules/content-type/HISTORY.md new file mode 100644 index 000000000..458367139 --- /dev/null +++ b/server/node_modules/content-type/HISTORY.md @@ -0,0 +1,29 @@ +1.0.5 / 2023-01-29 +================== + + * perf: skip value escaping when unnecessary + +1.0.4 / 2017-09-11 +================== + + * perf: skip parameter parsing when no parameters + +1.0.3 / 2017-09-10 +================== + + * perf: remove argument reassignment + +1.0.2 / 2016-05-09 +================== + + * perf: enable strict mode + +1.0.1 / 2015-02-13 +================== + + * Improve missing `Content-Type` header error message + +1.0.0 / 2015-02-01 +================== + + * Initial implementation, derived from `media-typer@0.3.0` diff --git a/server/node_modules/content-type/LICENSE b/server/node_modules/content-type/LICENSE new file mode 100644 index 000000000..34b1a2de3 --- /dev/null +++ b/server/node_modules/content-type/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/server/node_modules/content-type/README.md b/server/node_modules/content-type/README.md new file mode 100644 index 000000000..c1a922a9a --- /dev/null +++ b/server/node_modules/content-type/README.md @@ -0,0 +1,94 @@ +# content-type + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Create and parse HTTP Content-Type header according to RFC 7231 + +## Installation + +```sh +$ npm install content-type +``` + +## API + +```js +var contentType = require('content-type') +``` + +### contentType.parse(string) + +```js +var obj = contentType.parse('image/svg+xml; charset=utf-8') +``` + +Parse a `Content-Type` header. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (the type and subtype, always lower case). + Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter + always lower case). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the string is missing or invalid. + +### contentType.parse(req) + +```js +var obj = contentType.parse(req) +``` + +Parse the `Content-Type` header from the given `req`. Short-cut for +`contentType.parse(req.headers['content-type'])`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.parse(res) + +```js +var obj = contentType.parse(res) +``` + +Parse the `Content-Type` header set on the given `res`. Short-cut for +`contentType.parse(res.getHeader('content-type'))`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.format(obj) + +```js +var str = contentType.format({ + type: 'image/svg+xml', + parameters: { charset: 'utf-8' } +}) +``` + +Format an object into a `Content-Type` header. This will return a string of the +content type for the given object with the following properties (examples are +shown that produce the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of the + parameter will be lower-cased). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the object contains an invalid type or parameter names. + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/content-type/master?label=ci +[ci-url]: https://github.com/jshttp/content-type/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/content-type/master +[coveralls-url]: https://coveralls.io/r/jshttp/content-type?branch=master +[node-image]: https://badgen.net/npm/node/content-type +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/content-type +[npm-url]: https://npmjs.org/package/content-type +[npm-version-image]: https://badgen.net/npm/v/content-type diff --git a/server/node_modules/content-type/index.js b/server/node_modules/content-type/index.js new file mode 100644 index 000000000..41840e7bc --- /dev/null +++ b/server/node_modules/content-type/index.js @@ -0,0 +1,225 @@ +/*! + * content-type + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1 + * + * parameter = token "=" ( token / quoted-string ) + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE + * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text + * obs-text = %x80-FF + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + */ +var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ // eslint-disable-line no-control-regex +var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * RegExp to match quoted-pair in RFC 7230 sec 3.2.6 + * + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + * obs-text = %x80-FF + */ +var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6 + */ +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp to match type in RFC 7231 sec 3.1.1.1 + * + * media-type = type "/" subtype + * type = token + * subtype = token + */ +var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * Module exports. + * @public + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @public + */ + +function format (obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var type = obj.type + + if (!type || !TYPE_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + var string = type + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!TOKEN_REGEXP.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @public + */ + +function parse (string) { + if (!string) { + throw new TypeError('argument string is required') + } + + // support req/res-like objects as argument + var header = typeof string === 'object' + ? getcontenttype(string) + : string + + if (typeof header !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = header.indexOf(';') + var type = index !== -1 + ? header.slice(0, index).trim() + : header.trim() + + if (!TYPE_REGEXP.test(type)) { + throw new TypeError('invalid media type') + } + + var obj = new ContentType(type.toLowerCase()) + + // parse parameters + if (index !== -1) { + var key + var match + var value + + PARAM_REGEXP.lastIndex = index + + while ((match = PARAM_REGEXP.exec(header))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value.charCodeAt(0) === 0x22 /* " */) { + // remove quotes + value = value.slice(1, -1) + + // remove escapes + if (value.indexOf('\\') !== -1) { + value = value.replace(QESC_REGEXP, '$1') + } + } + + obj.parameters[key] = value + } + + if (index !== header.length) { + throw new TypeError('invalid parameter format') + } + } + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @private + */ + +function getcontenttype (obj) { + var header + + if (typeof obj.getHeader === 'function') { + // res-like + header = obj.getHeader('content-type') + } else if (typeof obj.headers === 'object') { + // req-like + header = obj.headers && obj.headers['content-type'] + } + + if (typeof header !== 'string') { + throw new TypeError('content-type header is missing from object') + } + + return header +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + // no need to quote tokens + if (TOKEN_REGEXP.test(str)) { + return str + } + + if (str.length > 0 && !TEXT_REGEXP.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Class to represent a content type. + * @private + */ +function ContentType (type) { + this.parameters = Object.create(null) + this.type = type +} diff --git a/server/node_modules/content-type/package.json b/server/node_modules/content-type/package.json new file mode 100644 index 000000000..9db19f63f --- /dev/null +++ b/server/node_modules/content-type/package.json @@ -0,0 +1,42 @@ +{ + "name": "content-type", + "description": "Create and parse HTTP Content-Type header", + "version": "1.0.5", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "content-type", + "http", + "req", + "res", + "rfc7231" + ], + "repository": "jshttp/content-type", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "8.32.0", + "eslint-config-standard": "15.0.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "10.2.0", + "nyc": "15.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/server/node_modules/cookie-signature/.npmignore b/server/node_modules/cookie-signature/.npmignore new file mode 100644 index 000000000..f1250e584 --- /dev/null +++ b/server/node_modules/cookie-signature/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/server/node_modules/cookie-signature/History.md b/server/node_modules/cookie-signature/History.md new file mode 100644 index 000000000..78513cc3d --- /dev/null +++ b/server/node_modules/cookie-signature/History.md @@ -0,0 +1,38 @@ +1.0.6 / 2015-02-03 +================== + +* use `npm test` instead of `make test` to run tests +* clearer assertion messages when checking input + + +1.0.5 / 2014-09-05 +================== + +* add license to package.json + +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/server/node_modules/cookie-signature/Readme.md b/server/node_modules/cookie-signature/Readme.md new file mode 100644 index 000000000..2559e841b --- /dev/null +++ b/server/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/server/node_modules/cookie-signature/index.js b/server/node_modules/cookie-signature/index.js new file mode 100644 index 000000000..b8c9463a2 --- /dev/null +++ b/server/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/server/node_modules/cookie-signature/package.json b/server/node_modules/cookie-signature/package.json new file mode 100644 index 000000000..29c4498e0 --- /dev/null +++ b/server/node_modules/cookie-signature/package.json @@ -0,0 +1,18 @@ +{ + "name": "cookie-signature", + "version": "1.0.6", + "description": "Sign and unsign cookies", + "keywords": ["cookie", "sign", "unsign"], + "author": "TJ Holowaychuk ", + "license": "MIT", + "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"}, + "dependencies": {}, + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "scripts": { + "test": "mocha --require should --reporter spec" + }, + "main": "index" +} diff --git a/server/node_modules/cookie/HISTORY.md b/server/node_modules/cookie/HISTORY.md new file mode 100644 index 000000000..ae9b995b4 --- /dev/null +++ b/server/node_modules/cookie/HISTORY.md @@ -0,0 +1,142 @@ +0.5.0 / 2022-04-11 +================== + + * Add `priority` option + * Fix `expires` option to reject invalid dates + * pref: improve default decode speed + * pref: remove slow string split in parse + +0.4.2 / 2022-02-02 +================== + + * pref: read value only when assigning in parse + * pref: remove unnecessary regexp in parse + +0.4.1 / 2020-04-21 +================== + + * Fix `maxAge` option to reject invalid values + +0.4.0 / 2019-05-15 +================== + + * Add `SameSite=None` support + +0.3.1 / 2016-05-26 +================== + + * Fix `sameSite: true` to work with draft-7 clients + - `true` now sends `SameSite=Strict` instead of `SameSite` + +0.3.0 / 2016-05-26 +================== + + * Add `sameSite` option + - Replaces `firstPartyOnly` option, never implemented by browsers + * Improve error message when `encode` is not a function + * Improve error message when `expires` is not a `Date` + +0.2.4 / 2016-05-20 +================== + + * perf: enable strict mode + * perf: use for loop in parse + * perf: use string concatination for serialization + +0.2.3 / 2015-10-25 +================== + + * Fix cookie `Max-Age` to never be a floating point number + +0.2.2 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.2.1 / 2015-09-17 +================== + + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.2.0 / 2015-08-13 +================== + + * Add `firstPartyOnly` option + * Throw better error for invalid argument to parse + * perf: hoist regular expression + +0.1.5 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.1.4 / 2015-09-17 +================== + + * Throw better error for invalid argument to parse + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.1.3 / 2015-05-19 +================== + + * Reduce the scope of try-catch deopt + * Remove argument reassignments + +0.1.2 / 2014-04-16 +================== + + * Remove unnecessary files from npm package + +0.1.1 / 2014-02-23 +================== + + * Fix bad parse when cookie value contained a comma + * Fix support for `maxAge` of `0` + +0.1.0 / 2013-05-01 +================== + + * Add `decode` option + * Add `encode` option + +0.0.6 / 2013-04-08 +================== + + * Ignore cookie parts missing `=` + +0.0.5 / 2012-10-29 +================== + + * Return raw cookie value if value unescape errors + +0.0.4 / 2012-06-21 +================== + + * Use encode/decodeURIComponent for cookie encoding/decoding + - Improve server/client interoperability + +0.0.3 / 2012-06-06 +================== + + * Only escape special characters per the cookie RFC + +0.0.2 / 2012-06-01 +================== + + * Fix `maxAge` option to not throw error + +0.0.1 / 2012-05-28 +================== + + * Add more tests + +0.0.0 / 2012-05-28 +================== + + * Initial release diff --git a/server/node_modules/cookie/LICENSE b/server/node_modules/cookie/LICENSE new file mode 100644 index 000000000..058b6b4ef --- /dev/null +++ b/server/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/server/node_modules/cookie/README.md b/server/node_modules/cookie/README.md new file mode 100644 index 000000000..5449c3a25 --- /dev/null +++ b/server/node_modules/cookie/README.md @@ -0,0 +1,302 @@ +# cookie + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `encodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path +is considered the ["default path"][rfc-6265-5.1.4]. + +##### priority + +Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1]. + + - `'low'` will set the `Priority` attribute to `Low`. + - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set. + - `'high'` will set the `Priority` attribute to `High`. + +More information about the different priority levels can be found in +[the specification][rfc-west-cookie-priority-00-4.1]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-09-5.4.7]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in +[the specification][rfc-6265bis-09-5.4.7]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('

Welcome back, ' + escapeHtml(name) + '!

'); + } else { + res.write('

Hello, new visitor!

'); + } + + res.write('
'); + res.write(' '); + res.end('
'); +} + +http.createServer(onRequest).listen(3000); +``` + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +``` +$ npm run bench + +> cookie@0.4.2 bench +> node benchmark/index.js + + node@16.14.0 + v8@9.4.146.24-node.20 + uv@1.43.0 + zlib@1.2.11 + brotli@1.0.9 + ares@1.18.1 + modules@93 + nghttp2@1.45.1 + napi@8 + llhttp@6.0.4 + openssl@1.1.1m+quic + cldr@40.0 + icu@70.1 + tz@2021a3 + unicode@14.0 + ngtcp2@0.1.0-DEV + nghttp3@0.1.0-DEV + +> node benchmark/parse-top.js + + cookie.parse - top sites + + 15 tests completed. + + parse accounts.google.com x 2,421,245 ops/sec ±0.80% (188 runs sampled) + parse apple.com x 2,684,710 ops/sec ±0.59% (189 runs sampled) + parse cloudflare.com x 2,231,418 ops/sec ±0.76% (186 runs sampled) + parse docs.google.com x 2,316,357 ops/sec ±1.28% (187 runs sampled) + parse drive.google.com x 2,363,543 ops/sec ±0.49% (189 runs sampled) + parse en.wikipedia.org x 839,414 ops/sec ±0.53% (189 runs sampled) + parse linkedin.com x 553,797 ops/sec ±0.63% (190 runs sampled) + parse maps.google.com x 1,314,779 ops/sec ±0.72% (189 runs sampled) + parse microsoft.com x 153,783 ops/sec ±0.53% (190 runs sampled) + parse play.google.com x 2,249,574 ops/sec ±0.59% (187 runs sampled) + parse plus.google.com x 2,258,682 ops/sec ±0.60% (188 runs sampled) + parse sites.google.com x 2,247,069 ops/sec ±0.68% (189 runs sampled) + parse support.google.com x 1,456,840 ops/sec ±0.70% (187 runs sampled) + parse www.google.com x 1,046,028 ops/sec ±0.58% (188 runs sampled) + parse youtu.be x 937,428 ops/sec ±1.47% (190 runs sampled) + parse youtube.com x 963,878 ops/sec ±0.59% (190 runs sampled) + +> node benchmark/parse.js + + cookie.parse - generic + + 6 tests completed. + + simple x 2,745,604 ops/sec ±0.77% (185 runs sampled) + decode x 557,287 ops/sec ±0.60% (188 runs sampled) + unquote x 2,498,475 ops/sec ±0.55% (189 runs sampled) + duplicates x 868,591 ops/sec ±0.89% (187 runs sampled) + 10 cookies x 306,745 ops/sec ±0.49% (190 runs sampled) + 100 cookies x 22,414 ops/sec ±2.38% (182 runs sampled) +``` + +## References + +- [RFC 6265: HTTP State Management Mechanism][rfc-6265] +- [Same-site Cookies][rfc-6265bis-09-5.4.7] + +[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1 +[rfc-6265bis-09-5.4.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-09#section-5.4.7 +[rfc-6265]: https://tools.ietf.org/html/rfc6265 +[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4 +[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1 +[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2 +[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3 +[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4 +[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5 +[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6 +[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3 + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master +[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/cookie/ci/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml +[node-version-image]: https://badgen.net/npm/node/cookie +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/cookie +[npm-url]: https://npmjs.org/package/cookie +[npm-version-image]: https://badgen.net/npm/v/cookie diff --git a/server/node_modules/cookie/SECURITY.md b/server/node_modules/cookie/SECURITY.md new file mode 100644 index 000000000..fd4a6c53a --- /dev/null +++ b/server/node_modules/cookie/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The `cookie` team and community take all security bugs seriously. Thank +you for improving the security of the project. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `cookie`. This +information can be found in the npm registry using the command +`npm owner ls cookie`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/jshttp/cookie/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/server/node_modules/cookie/index.js b/server/node_modules/cookie/index.js new file mode 100644 index 000000000..9c3d07d89 --- /dev/null +++ b/server/node_modules/cookie/index.js @@ -0,0 +1,270 @@ +/*! + * cookie + * Copyright(c) 2012-2014 Roman Shtylman + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +exports.parse = parse; +exports.serialize = serialize; + +/** + * Module variables. + * @private + */ + +var __toString = Object.prototype.toString + +/** + * RegExp to match field-content in RFC 7230 sec 3.2 + * + * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ] + * field-vchar = VCHAR / obs-text + * obs-text = %x80-FF + */ + +var fieldContentRegExp = /^[\u0009\u0020-\u007e\u0080-\u00ff]+$/; + +/** + * Parse a cookie header. + * + * Parse the given cookie header string into an object + * The object has the various cookies as keys(names) => values + * + * @param {string} str + * @param {object} [options] + * @return {object} + * @public + */ + +function parse(str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {} + var opt = options || {}; + var dec = opt.decode || decode; + + var index = 0 + while (index < str.length) { + var eqIdx = str.indexOf('=', index) + + // no more cookie pairs + if (eqIdx === -1) { + break + } + + var endIdx = str.indexOf(';', index) + + if (endIdx === -1) { + endIdx = str.length + } else if (endIdx < eqIdx) { + // backtrack on prior semicolon + index = str.lastIndexOf(';', eqIdx - 1) + 1 + continue + } + + var key = str.slice(index, eqIdx).trim() + + // only assign once + if (undefined === obj[key]) { + var val = str.slice(eqIdx + 1, endIdx).trim() + + // quoted values + if (val.charCodeAt(0) === 0x22) { + val = val.slice(1, -1) + } + + obj[key] = tryDecode(val, dec); + } + + index = endIdx + 1 + } + + return obj; +} + +/** + * Serialize data into a cookie header. + * + * Serialize the a name value pair into a cookie string suitable for + * http headers. An optional options object specified cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [options] + * @return {string} + * @public + */ + +function serialize(name, val, options) { + var opt = options || {}; + var enc = opt.encode || encode; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!fieldContentRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (value && !fieldContentRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + + if (isNaN(maxAge) || !isFinite(maxAge)) { + throw new TypeError('option maxAge is invalid') + } + + str += '; Max-Age=' + Math.floor(maxAge); + } + + if (opt.domain) { + if (!fieldContentRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!fieldContentRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + var expires = opt.expires + + if (!isDate(expires) || isNaN(expires.valueOf())) { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + expires.toUTCString() + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.priority) { + var priority = typeof opt.priority === 'string' + ? opt.priority.toLowerCase() + : opt.priority + + switch (priority) { + case 'low': + str += '; Priority=Low' + break + case 'medium': + str += '; Priority=Medium' + break + case 'high': + str += '; Priority=High' + break + default: + throw new TypeError('option priority is invalid') + } + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + case 'none': + str += '; SameSite=None'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * URL-decode string value. Optimized to skip native call when no %. + * + * @param {string} str + * @returns {string} + */ + +function decode (str) { + return str.indexOf('%') !== -1 + ? decodeURIComponent(str) + : str +} + +/** + * URL-encode value. + * + * @param {string} str + * @returns {string} + */ + +function encode (val) { + return encodeURIComponent(val) +} + +/** + * Determine if value is a Date. + * + * @param {*} val + * @private + */ + +function isDate (val) { + return __toString.call(val) === '[object Date]' || + val instanceof Date +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/server/node_modules/cookie/package.json b/server/node_modules/cookie/package.json new file mode 100644 index 000000000..ed5606a98 --- /dev/null +++ b/server/node_modules/cookie/package.json @@ -0,0 +1,44 @@ +{ + "name": "cookie", + "description": "HTTP server cookie parsing and serialization", + "version": "0.5.0", + "author": "Roman Shtylman ", + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "keywords": [ + "cookie", + "cookies" + ], + "repository": "jshttp/cookie", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "7.32.0", + "eslint-plugin-markdown": "2.2.1", + "mocha": "9.2.2", + "nyc": "15.1.0", + "safe-buffer": "5.2.1", + "top-sites": "1.1.97" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "SECURITY.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "update-bench": "node scripts/update-benchmark.js", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/server/node_modules/cors/CONTRIBUTING.md b/server/node_modules/cors/CONTRIBUTING.md new file mode 100644 index 000000000..591b09a13 --- /dev/null +++ b/server/node_modules/cors/CONTRIBUTING.md @@ -0,0 +1,33 @@ +# contributing to `cors` + +CORS is a node.js package for providing a [connect](http://www.senchalabs.org/connect/)/[express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options. Learn more about the project in [the README](README.md). + +## The CORS Spec + +[http://www.w3.org/TR/cors/](http://www.w3.org/TR/cors/) + +## Pull Requests Welcome + +* Include `'use strict';` in every javascript file. +* 2 space indentation. +* Please run the testing steps below before submitting. + +## Testing + +```bash +$ npm install +$ npm test +``` + +## Interactive Testing Harness + +[http://node-cors-client.herokuapp.com](http://node-cors-client.herokuapp.com) + +Related git repositories: + +* [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server) +* [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client) + +## License + +[MIT License](http://www.opensource.org/licenses/mit-license.php) diff --git a/server/node_modules/cors/HISTORY.md b/server/node_modules/cors/HISTORY.md new file mode 100644 index 000000000..5762bce92 --- /dev/null +++ b/server/node_modules/cors/HISTORY.md @@ -0,0 +1,58 @@ +2.8.5 / 2018-11-04 +================== + + * Fix setting `maxAge` option to `0` + +2.8.4 / 2017-07-12 +================== + + * Work-around Safari bug in default pre-flight response + +2.8.3 / 2017-03-29 +================== + + * Fix error when options delegate missing `methods` option + +2.8.2 / 2017-03-28 +================== + + * Fix error when frozen options are passed + * Send "Vary: Origin" when using regular expressions + * Send "Vary: Access-Control-Request-Headers" when dynamic `allowedHeaders` + +2.8.1 / 2016-09-08 +================== + +This release only changed documentation. + +2.8.0 / 2016-08-23 +================== + + * Add `optionsSuccessStatus` option + +2.7.2 / 2016-08-23 +================== + + * Fix error when Node.js running in strict mode + +2.7.1 / 2015-05-28 +================== + + * Move module into expressjs organization + +2.7.0 / 2015-05-28 +================== + + * Allow array of matching condition as `origin` option + * Allow regular expression as `origin` option + +2.6.1 / 2015-05-28 +================== + + * Update `license` in package.json + +2.6.0 / 2015-04-27 +================== + + * Add `preflightContinue` option + * Fix "Vary: Origin" header added for "*" diff --git a/server/node_modules/cors/LICENSE b/server/node_modules/cors/LICENSE new file mode 100644 index 000000000..fd10c843f --- /dev/null +++ b/server/node_modules/cors/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2013 Troy Goode + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/server/node_modules/cors/README.md b/server/node_modules/cors/README.md new file mode 100644 index 000000000..732b847ed --- /dev/null +++ b/server/node_modules/cors/README.md @@ -0,0 +1,243 @@ +# cors + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +CORS is a node.js package for providing a [Connect](http://www.senchalabs.org/connect/)/[Express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options. + +**[Follow me (@troygoode) on Twitter!](https://twitter.com/intent/user?screen_name=troygoode)** + +* [Installation](#installation) +* [Usage](#usage) + * [Simple Usage](#simple-usage-enable-all-cors-requests) + * [Enable CORS for a Single Route](#enable-cors-for-a-single-route) + * [Configuring CORS](#configuring-cors) + * [Configuring CORS Asynchronously](#configuring-cors-asynchronously) + * [Enabling CORS Pre-Flight](#enabling-cors-pre-flight) +* [Configuration Options](#configuration-options) +* [Demo](#demo) +* [License](#license) +* [Author](#author) + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cors +``` + +## Usage + +### Simple Usage (Enable *All* CORS Requests) + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.use(cors()) + +app.get('/products/:id', function (req, res, next) { + res.json({msg: 'This is CORS-enabled for all origins!'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Enable CORS for a Single Route + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.get('/products/:id', cors(), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a Single Route'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Configuring CORS + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var corsOptions = { + origin: 'http://example.com', + optionsSuccessStatus: 200 // some legacy browsers (IE11, various SmartTVs) choke on 204 +} + +app.get('/products/:id', cors(corsOptions), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for only example.com.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +### Configuring CORS w/ Dynamic Origin + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var whitelist = ['http://example1.com', 'http://example2.com'] +var corsOptions = { + origin: function (origin, callback) { + if (whitelist.indexOf(origin) !== -1) { + callback(null, true) + } else { + callback(new Error('Not allowed by CORS')) + } + } +} + +app.get('/products/:id', cors(corsOptions), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a whitelisted domain.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +If you do not want to block REST tools or server-to-server requests, +add a `!origin` check in the origin function like so: + +```javascript +var corsOptions = { + origin: function (origin, callback) { + if (whitelist.indexOf(origin) !== -1 || !origin) { + callback(null, true) + } else { + callback(new Error('Not allowed by CORS')) + } + } +} +``` + +### Enabling CORS Pre-Flight + +Certain CORS requests are considered 'complex' and require an initial +`OPTIONS` request (called the "pre-flight request"). An example of a +'complex' CORS request is one that uses an HTTP verb other than +GET/HEAD/POST (such as DELETE) or that uses custom headers. To enable +pre-flighting, you must add a new OPTIONS handler for the route you want +to support: + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +app.options('/products/:id', cors()) // enable pre-flight request for DELETE request +app.del('/products/:id', cors(), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for all origins!'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +You can also enable pre-flight across-the-board like so: + +```javascript +app.options('*', cors()) // include before other routes +``` + +### Configuring CORS Asynchronously + +```javascript +var express = require('express') +var cors = require('cors') +var app = express() + +var whitelist = ['http://example1.com', 'http://example2.com'] +var corsOptionsDelegate = function (req, callback) { + var corsOptions; + if (whitelist.indexOf(req.header('Origin')) !== -1) { + corsOptions = { origin: true } // reflect (enable) the requested origin in the CORS response + } else { + corsOptions = { origin: false } // disable CORS for this request + } + callback(null, corsOptions) // callback expects two parameters: error and options +} + +app.get('/products/:id', cors(corsOptionsDelegate), function (req, res, next) { + res.json({msg: 'This is CORS-enabled for a whitelisted domain.'}) +}) + +app.listen(80, function () { + console.log('CORS-enabled web server listening on port 80') +}) +``` + +## Configuration Options + +* `origin`: Configures the **Access-Control-Allow-Origin** CORS header. Possible values: + - `Boolean` - set `origin` to `true` to reflect the [request origin](http://tools.ietf.org/html/draft-abarth-origin-09), as defined by `req.header('Origin')`, or set it to `false` to disable CORS. + - `String` - set `origin` to a specific origin. For example if you set it to `"http://example.com"` only requests from "http://example.com" will be allowed. + - `RegExp` - set `origin` to a regular expression pattern which will be used to test the request origin. If it's a match, the request origin will be reflected. For example the pattern `/example\.com$/` will reflect any request that is coming from an origin ending with "example.com". + - `Array` - set `origin` to an array of valid origins. Each origin can be a `String` or a `RegExp`. For example `["http://example1.com", /\.example2\.com$/]` will accept any request from "http://example1.com" or from a subdomain of "example2.com". + - `Function` - set `origin` to a function implementing some custom logic. The function takes the request origin as the first parameter and a callback (which expects the signature `err [object], allow [bool]`) as the second. +* `methods`: Configures the **Access-Control-Allow-Methods** CORS header. Expects a comma-delimited string (ex: 'GET,PUT,POST') or an array (ex: `['GET', 'PUT', 'POST']`). +* `allowedHeaders`: Configures the **Access-Control-Allow-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Type,Authorization') or an array (ex: `['Content-Type', 'Authorization']`). If not specified, defaults to reflecting the headers specified in the request's **Access-Control-Request-Headers** header. +* `exposedHeaders`: Configures the **Access-Control-Expose-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Range,X-Content-Range') or an array (ex: `['Content-Range', 'X-Content-Range']`). If not specified, no custom headers are exposed. +* `credentials`: Configures the **Access-Control-Allow-Credentials** CORS header. Set to `true` to pass the header, otherwise it is omitted. +* `maxAge`: Configures the **Access-Control-Max-Age** CORS header. Set to an integer to pass the header, otherwise it is omitted. +* `preflightContinue`: Pass the CORS preflight response to the next handler. +* `optionsSuccessStatus`: Provides a status code to use for successful `OPTIONS` requests, since some legacy browsers (IE11, various SmartTVs) choke on `204`. + +The default configuration is the equivalent of: + +```json +{ + "origin": "*", + "methods": "GET,HEAD,PUT,PATCH,POST,DELETE", + "preflightContinue": false, + "optionsSuccessStatus": 204 +} +``` + +For details on the effect of each CORS header, read [this](http://www.html5rocks.com/en/tutorials/cors/) article on HTML5 Rocks. + +## Demo + +A demo that illustrates CORS working (and not working) using jQuery is available here: [http://node-cors-client.herokuapp.com/](http://node-cors-client.herokuapp.com/) + +Code for that demo can be found here: + +* Client: [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client) +* Server: [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server) + +## License + +[MIT License](http://www.opensource.org/licenses/mit-license.php) + +## Author + +[Troy Goode](https://github.com/TroyGoode) ([troygoode@gmail.com](mailto:troygoode@gmail.com)) + +[coveralls-image]: https://img.shields.io/coveralls/expressjs/cors/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/cors?branch=master +[downloads-image]: https://img.shields.io/npm/dm/cors.svg +[downloads-url]: https://npmjs.org/package/cors +[npm-image]: https://img.shields.io/npm/v/cors.svg +[npm-url]: https://npmjs.org/package/cors +[travis-image]: https://img.shields.io/travis/expressjs/cors/master.svg +[travis-url]: https://travis-ci.org/expressjs/cors diff --git a/server/node_modules/cors/lib/index.js b/server/node_modules/cors/lib/index.js new file mode 100644 index 000000000..5475aecd6 --- /dev/null +++ b/server/node_modules/cors/lib/index.js @@ -0,0 +1,238 @@ +(function () { + + 'use strict'; + + var assign = require('object-assign'); + var vary = require('vary'); + + var defaults = { + origin: '*', + methods: 'GET,HEAD,PUT,PATCH,POST,DELETE', + preflightContinue: false, + optionsSuccessStatus: 204 + }; + + function isString(s) { + return typeof s === 'string' || s instanceof String; + } + + function isOriginAllowed(origin, allowedOrigin) { + if (Array.isArray(allowedOrigin)) { + for (var i = 0; i < allowedOrigin.length; ++i) { + if (isOriginAllowed(origin, allowedOrigin[i])) { + return true; + } + } + return false; + } else if (isString(allowedOrigin)) { + return origin === allowedOrigin; + } else if (allowedOrigin instanceof RegExp) { + return allowedOrigin.test(origin); + } else { + return !!allowedOrigin; + } + } + + function configureOrigin(options, req) { + var requestOrigin = req.headers.origin, + headers = [], + isAllowed; + + if (!options.origin || options.origin === '*') { + // allow any origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: '*' + }]); + } else if (isString(options.origin)) { + // fixed origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: options.origin + }]); + headers.push([{ + key: 'Vary', + value: 'Origin' + }]); + } else { + isAllowed = isOriginAllowed(requestOrigin, options.origin); + // reflect origin + headers.push([{ + key: 'Access-Control-Allow-Origin', + value: isAllowed ? requestOrigin : false + }]); + headers.push([{ + key: 'Vary', + value: 'Origin' + }]); + } + + return headers; + } + + function configureMethods(options) { + var methods = options.methods; + if (methods.join) { + methods = options.methods.join(','); // .methods is an array, so turn it into a string + } + return { + key: 'Access-Control-Allow-Methods', + value: methods + }; + } + + function configureCredentials(options) { + if (options.credentials === true) { + return { + key: 'Access-Control-Allow-Credentials', + value: 'true' + }; + } + return null; + } + + function configureAllowedHeaders(options, req) { + var allowedHeaders = options.allowedHeaders || options.headers; + var headers = []; + + if (!allowedHeaders) { + allowedHeaders = req.headers['access-control-request-headers']; // .headers wasn't specified, so reflect the request headers + headers.push([{ + key: 'Vary', + value: 'Access-Control-Request-Headers' + }]); + } else if (allowedHeaders.join) { + allowedHeaders = allowedHeaders.join(','); // .headers is an array, so turn it into a string + } + if (allowedHeaders && allowedHeaders.length) { + headers.push([{ + key: 'Access-Control-Allow-Headers', + value: allowedHeaders + }]); + } + + return headers; + } + + function configureExposedHeaders(options) { + var headers = options.exposedHeaders; + if (!headers) { + return null; + } else if (headers.join) { + headers = headers.join(','); // .headers is an array, so turn it into a string + } + if (headers && headers.length) { + return { + key: 'Access-Control-Expose-Headers', + value: headers + }; + } + return null; + } + + function configureMaxAge(options) { + var maxAge = (typeof options.maxAge === 'number' || options.maxAge) && options.maxAge.toString() + if (maxAge && maxAge.length) { + return { + key: 'Access-Control-Max-Age', + value: maxAge + }; + } + return null; + } + + function applyHeaders(headers, res) { + for (var i = 0, n = headers.length; i < n; i++) { + var header = headers[i]; + if (header) { + if (Array.isArray(header)) { + applyHeaders(header, res); + } else if (header.key === 'Vary' && header.value) { + vary(res, header.value); + } else if (header.value) { + res.setHeader(header.key, header.value); + } + } + } + } + + function cors(options, req, res, next) { + var headers = [], + method = req.method && req.method.toUpperCase && req.method.toUpperCase(); + + if (method === 'OPTIONS') { + // preflight + headers.push(configureOrigin(options, req)); + headers.push(configureCredentials(options, req)); + headers.push(configureMethods(options, req)); + headers.push(configureAllowedHeaders(options, req)); + headers.push(configureMaxAge(options, req)); + headers.push(configureExposedHeaders(options, req)); + applyHeaders(headers, res); + + if (options.preflightContinue) { + next(); + } else { + // Safari (and potentially other browsers) need content-length 0, + // for 204 or they just hang waiting for a body + res.statusCode = options.optionsSuccessStatus; + res.setHeader('Content-Length', '0'); + res.end(); + } + } else { + // actual response + headers.push(configureOrigin(options, req)); + headers.push(configureCredentials(options, req)); + headers.push(configureExposedHeaders(options, req)); + applyHeaders(headers, res); + next(); + } + } + + function middlewareWrapper(o) { + // if options are static (either via defaults or custom options passed in), wrap in a function + var optionsCallback = null; + if (typeof o === 'function') { + optionsCallback = o; + } else { + optionsCallback = function (req, cb) { + cb(null, o); + }; + } + + return function corsMiddleware(req, res, next) { + optionsCallback(req, function (err, options) { + if (err) { + next(err); + } else { + var corsOptions = assign({}, defaults, options); + var originCallback = null; + if (corsOptions.origin && typeof corsOptions.origin === 'function') { + originCallback = corsOptions.origin; + } else if (corsOptions.origin) { + originCallback = function (origin, cb) { + cb(null, corsOptions.origin); + }; + } + + if (originCallback) { + originCallback(req.headers.origin, function (err2, origin) { + if (err2 || !origin) { + next(err2); + } else { + corsOptions.origin = origin; + cors(corsOptions, req, res, next); + } + }); + } else { + next(); + } + } + }); + }; + } + + // can pass either an options hash, an options delegate, or nothing + module.exports = middlewareWrapper; + +}()); diff --git a/server/node_modules/cors/package.json b/server/node_modules/cors/package.json new file mode 100644 index 000000000..ff37d9843 --- /dev/null +++ b/server/node_modules/cors/package.json @@ -0,0 +1,41 @@ +{ + "name": "cors", + "description": "Node.js CORS middleware", + "version": "2.8.5", + "author": "Troy Goode (https://github.com/troygoode/)", + "license": "MIT", + "keywords": [ + "cors", + "express", + "connect", + "middleware" + ], + "repository": "expressjs/cors", + "main": "./lib/index.js", + "dependencies": { + "object-assign": "^4", + "vary": "^1" + }, + "devDependencies": { + "after": "0.8.2", + "eslint": "2.13.1", + "express": "4.16.3", + "mocha": "5.2.0", + "nyc": "13.1.0", + "supertest": "3.3.0" + }, + "files": [ + "lib/index.js", + "CONTRIBUTING.md", + "HISTORY.md", + "LICENSE", + "README.md" + ], + "engines": { + "node": ">= 0.10" + }, + "scripts": { + "test": "npm run lint && nyc --reporter=html --reporter=text mocha --require test/support/env", + "lint": "eslint lib test" + } +} diff --git a/server/node_modules/debug/.coveralls.yml b/server/node_modules/debug/.coveralls.yml new file mode 100644 index 000000000..20a706858 --- /dev/null +++ b/server/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/server/node_modules/debug/.eslintrc b/server/node_modules/debug/.eslintrc new file mode 100644 index 000000000..8a37ae2c2 --- /dev/null +++ b/server/node_modules/debug/.eslintrc @@ -0,0 +1,11 @@ +{ + "env": { + "browser": true, + "node": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/server/node_modules/debug/.npmignore b/server/node_modules/debug/.npmignore new file mode 100644 index 000000000..5f60eecc8 --- /dev/null +++ b/server/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/server/node_modules/debug/.travis.yml b/server/node_modules/debug/.travis.yml new file mode 100644 index 000000000..6c6090c3b --- /dev/null +++ b/server/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/server/node_modules/debug/CHANGELOG.md b/server/node_modules/debug/CHANGELOG.md new file mode 100644 index 000000000..eadaa1895 --- /dev/null +++ b/server/node_modules/debug/CHANGELOG.md @@ -0,0 +1,362 @@ + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/server/node_modules/debug/LICENSE b/server/node_modules/debug/LICENSE new file mode 100644 index 000000000..658c933d2 --- /dev/null +++ b/server/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/server/node_modules/debug/Makefile b/server/node_modules/debug/Makefile new file mode 100644 index 000000000..584da8bf9 --- /dev/null +++ b/server/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/server/node_modules/debug/README.md b/server/node_modules/debug/README.md new file mode 100644 index 000000000..f67be6b31 --- /dev/null +++ b/server/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/server/node_modules/debug/component.json b/server/node_modules/debug/component.json new file mode 100644 index 000000000..9de26410f --- /dev/null +++ b/server/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.9", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/server/node_modules/debug/karma.conf.js b/server/node_modules/debug/karma.conf.js new file mode 100644 index 000000000..103a82d15 --- /dev/null +++ b/server/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/server/node_modules/debug/node.js b/server/node_modules/debug/node.js new file mode 100644 index 000000000..7fc36fe6d --- /dev/null +++ b/server/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/server/node_modules/debug/package.json b/server/node_modules/debug/package.json new file mode 100644 index 000000000..dc787ba76 --- /dev/null +++ b/server/node_modules/debug/package.json @@ -0,0 +1,49 @@ +{ + "name": "debug", + "version": "2.6.9", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "description": "small debugging utility", + "keywords": [ + "debug", + "log", + "debugger" + ], + "author": "TJ Holowaychuk ", + "contributors": [ + "Nathan Rajlich (http://n8.io)", + "Andrew Rhyne " + ], + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + }, + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + } +} diff --git a/server/node_modules/debug/src/browser.js b/server/node_modules/debug/src/browser.js new file mode 100644 index 000000000..710692493 --- /dev/null +++ b/server/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/server/node_modules/debug/src/debug.js b/server/node_modules/debug/src/debug.js new file mode 100644 index 000000000..6a5e3fc94 --- /dev/null +++ b/server/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/server/node_modules/debug/src/index.js b/server/node_modules/debug/src/index.js new file mode 100644 index 000000000..e12cf4d58 --- /dev/null +++ b/server/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/server/node_modules/debug/src/inspector-log.js b/server/node_modules/debug/src/inspector-log.js new file mode 100644 index 000000000..60ea6c04a --- /dev/null +++ b/server/node_modules/debug/src/inspector-log.js @@ -0,0 +1,15 @@ +module.exports = inspectorLog; + +// black hole +const nullStream = new (require('stream').Writable)(); +nullStream._write = () => {}; + +/** + * Outputs a `console.log()` to the Node.js Inspector console *only*. + */ +function inspectorLog() { + const stdout = console._stdout; + console._stdout = nullStream; + console.log.apply(console, arguments); + console._stdout = stdout; +} diff --git a/server/node_modules/debug/src/node.js b/server/node_modules/debug/src/node.js new file mode 100644 index 000000000..b15109c90 --- /dev/null +++ b/server/node_modules/debug/src/node.js @@ -0,0 +1,248 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/server/node_modules/define-data-property/.eslintrc b/server/node_modules/define-data-property/.eslintrc new file mode 100644 index 000000000..75443e81e --- /dev/null +++ b/server/node_modules/define-data-property/.eslintrc @@ -0,0 +1,24 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "complexity": 0, + "id-length": 0, + "new-cap": ["error", { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + }, + + "overrides": [ + { + "files": "test/**", + "rules": { + "max-lines-per-function": "off", + }, + }, + ], +} diff --git a/server/node_modules/define-data-property/.github/FUNDING.yml b/server/node_modules/define-data-property/.github/FUNDING.yml new file mode 100644 index 000000000..3e17725dd --- /dev/null +++ b/server/node_modules/define-data-property/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/define-data-property +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/server/node_modules/define-data-property/.nycrc b/server/node_modules/define-data-property/.nycrc new file mode 100644 index 000000000..1826526e0 --- /dev/null +++ b/server/node_modules/define-data-property/.nycrc @@ -0,0 +1,13 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "lines": 86, + "statements": 85.93, + "functions": 82.43, + "branches": 76.06, + "exclude": [ + "coverage", + "test" + ] +} diff --git a/server/node_modules/define-data-property/CHANGELOG.md b/server/node_modules/define-data-property/CHANGELOG.md new file mode 100644 index 000000000..94bad092d --- /dev/null +++ b/server/node_modules/define-data-property/CHANGELOG.md @@ -0,0 +1,41 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.1.1](https://github.com/ljharb/define-data-property/compare/v1.1.0...v1.1.1) - 2023-10-12 + +### Commits + +- [Tests] fix tests in ES3 engines [`5c6920e`](https://github.com/ljharb/define-data-property/commit/5c6920edd1f52f675b02f417e539c28135b43f94) +- [Dev Deps] update `@types/es-value-fixtures`, `@types/for-each`, `@types/gopd`, `@types/has-property-descriptors`, `tape`, `typescript` [`7d82dfc`](https://github.com/ljharb/define-data-property/commit/7d82dfc20f778b4465bba06335dd53f6f431aea3) +- [Fix] IE 8 has a broken `Object.defineProperty` [`0672e1a`](https://github.com/ljharb/define-data-property/commit/0672e1af2a9fcc787e7c23b96dea60d290df5548) +- [meta] emit types on prepack [`73acb1f`](https://github.com/ljharb/define-data-property/commit/73acb1f903c21b314ec7156bf10f73c7910530c0) +- [Dev Deps] update `tape`, `typescript` [`9489a77`](https://github.com/ljharb/define-data-property/commit/9489a7738bf2ecf0ac71d5b78ec4ca6ad7ba0142) + +## [v1.1.0](https://github.com/ljharb/define-data-property/compare/v1.0.1...v1.1.0) - 2023-09-13 + +### Commits + +- [New] add `loose` arg [`155235a`](https://github.com/ljharb/define-data-property/commit/155235a4c4d7741f6de01cd87c99599a56654b72) +- [New] allow `null` to be passed for the non* args [`7d2fa5f`](https://github.com/ljharb/define-data-property/commit/7d2fa5f06be0392736c13b126f7cd38979f34792) + +## [v1.0.1](https://github.com/ljharb/define-data-property/compare/v1.0.0...v1.0.1) - 2023-09-12 + +### Commits + +- [meta] add TS types [`43d763c`](https://github.com/ljharb/define-data-property/commit/43d763c6c883f652de1c9c02ef6216ee507ffa69) +- [Dev Deps] update `@types/tape`, `typescript` [`f444985`](https://github.com/ljharb/define-data-property/commit/f444985811c36f3e6448a03ad2f9b7898917f4c7) +- [meta] add `safe-publish-latest`, [`172bb10`](https://github.com/ljharb/define-data-property/commit/172bb10890896ebb160e64398f6ee55760107bee) + +## v1.0.0 - 2023-09-12 + +### Commits + +- Initial implementation, tests, readme [`5b43d6b`](https://github.com/ljharb/define-data-property/commit/5b43d6b44e675a904810467a7d4e0adb7efc3196) +- Initial commit [`35e577a`](https://github.com/ljharb/define-data-property/commit/35e577a6ba59a98befa97776d70d90f3bea9009d) +- npm init [`82a0a04`](https://github.com/ljharb/define-data-property/commit/82a0a04a321ca7de220af02d41e2745e8a9962ed) +- Only apps should have lockfiles [`96df244`](https://github.com/ljharb/define-data-property/commit/96df244a3c6f426f9a2437be825d1c6f5dd7158e) +- [meta] use `npmignore` to autogenerate an npmignore file [`a87ff18`](https://github.com/ljharb/define-data-property/commit/a87ff18cb79e14c2eb5720486c4759fd9a189375) diff --git a/server/node_modules/define-data-property/LICENSE b/server/node_modules/define-data-property/LICENSE new file mode 100644 index 000000000..b4213ac64 --- /dev/null +++ b/server/node_modules/define-data-property/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2023 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/server/node_modules/define-data-property/README.md b/server/node_modules/define-data-property/README.md new file mode 100644 index 000000000..f2304daef --- /dev/null +++ b/server/node_modules/define-data-property/README.md @@ -0,0 +1,67 @@ +# define-data-property [![Version Badge][npm-version-svg]][package-url] + +[![github actions][actions-image]][actions-url] +[![coverage][codecov-image]][codecov-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][npm-badge-png]][package-url] + +Define a data property on an object. Will fall back to assignment in an engine without descriptors. + +The three `non*` argument can also be passed `null`, which will use the existing state if available. + +The `loose` argument will mean that if you attempt to set a non-normal data property, in an environment without descriptor support, it will fall back to normal assignment. + +## Usage + +```javascript +var defineDataProperty = require('define-data-property'); +var assert = require('assert'); + +var obj = {}; +defineDataProperty(obj, 'key', 'value'); +defineDataProperty( + obj, + 'key2', + 'value', + true, // nonEnumerable, optional + false, // nonWritable, optional + true, // nonConfigurable, optional + false // loose, optional +); + +assert.deepEqual( + Object.getOwnPropertyDescriptors(obj), + { + key: { + configurable: true, + enumerable: true, + value: 'value', + writable: true, + }, + key2: { + configurable: false, + enumerable: false, + value: 'value', + writable: true, + }, + } +); +``` + +[package-url]: https://npmjs.org/package/define-data-property +[npm-version-svg]: https://versionbadg.es/ljharb/define-data-property.svg +[deps-svg]: https://david-dm.org/ljharb/define-data-property.svg +[deps-url]: https://david-dm.org/ljharb/define-data-property +[dev-deps-svg]: https://david-dm.org/ljharb/define-data-property/dev-status.svg +[dev-deps-url]: https://david-dm.org/ljharb/define-data-property#info=devDependencies +[npm-badge-png]: https://nodei.co/npm/define-data-property.png?downloads=true&stars=true +[license-image]: https://img.shields.io/npm/l/define-data-property.svg +[license-url]: LICENSE +[downloads-image]: https://img.shields.io/npm/dm/define-data-property.svg +[downloads-url]: https://npm-stat.com/charts.html?package=define-data-property +[codecov-image]: https://codecov.io/gh/ljharb/define-data-property/branch/main/graphs/badge.svg +[codecov-url]: https://app.codecov.io/gh/ljharb/define-data-property/ +[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/define-data-property +[actions-url]: https://github.com/ljharb/define-data-property/actions diff --git a/server/node_modules/define-data-property/index.d.ts b/server/node_modules/define-data-property/index.d.ts new file mode 100644 index 000000000..d2e353d10 --- /dev/null +++ b/server/node_modules/define-data-property/index.d.ts @@ -0,0 +1,3 @@ +declare const _exports: (obj: Record, property: PropertyKey, value: unknown, nonEnumerable?: boolean | null, nonWritable?: boolean | null, nonConfigurable?: boolean | null, loose?: boolean) => void; +export = _exports; +//# sourceMappingURL=index.d.ts.map \ No newline at end of file diff --git a/server/node_modules/define-data-property/index.d.ts.map b/server/node_modules/define-data-property/index.d.ts.map new file mode 100644 index 000000000..39aca4b8d --- /dev/null +++ b/server/node_modules/define-data-property/index.d.ts.map @@ -0,0 +1 @@ +{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["index.js"],"names":[],"mappings":"8BAqBiB,OAAO,WAAW,EAAE,OAAO,CAAC,YAAY,WAAW,SAAS,OAAO,kBAAkB,OAAO,GAAG,IAAI,gBAAgB,OAAO,GAAG,IAAI,oBAAoB,OAAO,GAAG,IAAI,UAAU,OAAO,KAAK,IAAI"} \ No newline at end of file diff --git a/server/node_modules/define-data-property/index.js b/server/node_modules/define-data-property/index.js new file mode 100644 index 000000000..953406519 --- /dev/null +++ b/server/node_modules/define-data-property/index.js @@ -0,0 +1,68 @@ +'use strict'; + +var hasPropertyDescriptors = require('has-property-descriptors')(); + +var GetIntrinsic = require('get-intrinsic'); + +var $defineProperty = hasPropertyDescriptors && GetIntrinsic('%Object.defineProperty%', true); +if ($defineProperty) { + try { + $defineProperty({}, 'a', { value: 1 }); + } catch (e) { + // IE 8 has a broken defineProperty + $defineProperty = false; + } +} + +var $SyntaxError = GetIntrinsic('%SyntaxError%'); +var $TypeError = GetIntrinsic('%TypeError%'); + +var gopd = require('gopd'); + +/** @type {(obj: Record, property: PropertyKey, value: unknown, nonEnumerable?: boolean | null, nonWritable?: boolean | null, nonConfigurable?: boolean | null, loose?: boolean) => void} */ +module.exports = function defineDataProperty( + obj, + property, + value +) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new $TypeError('`obj` must be an object or a function`'); + } + if (typeof property !== 'string' && typeof property !== 'symbol') { + throw new $TypeError('`property` must be a string or a symbol`'); + } + if (arguments.length > 3 && typeof arguments[3] !== 'boolean' && arguments[3] !== null) { + throw new $TypeError('`nonEnumerable`, if provided, must be a boolean or null'); + } + if (arguments.length > 4 && typeof arguments[4] !== 'boolean' && arguments[4] !== null) { + throw new $TypeError('`nonWritable`, if provided, must be a boolean or null'); + } + if (arguments.length > 5 && typeof arguments[5] !== 'boolean' && arguments[5] !== null) { + throw new $TypeError('`nonConfigurable`, if provided, must be a boolean or null'); + } + if (arguments.length > 6 && typeof arguments[6] !== 'boolean') { + throw new $TypeError('`loose`, if provided, must be a boolean'); + } + + var nonEnumerable = arguments.length > 3 ? arguments[3] : null; + var nonWritable = arguments.length > 4 ? arguments[4] : null; + var nonConfigurable = arguments.length > 5 ? arguments[5] : null; + var loose = arguments.length > 6 ? arguments[6] : false; + + /* @type {false | TypedPropertyDescriptor} */ + var desc = !!gopd && gopd(obj, property); + + if ($defineProperty) { + $defineProperty(obj, property, { + configurable: nonConfigurable === null && desc ? desc.configurable : !nonConfigurable, + enumerable: nonEnumerable === null && desc ? desc.enumerable : !nonEnumerable, + value: value, + writable: nonWritable === null && desc ? desc.writable : !nonWritable + }); + } else if (loose || (!nonEnumerable && !nonWritable && !nonConfigurable)) { + // must fall back to [[Set]], and was not explicitly asked to make non-enumerable, non-writable, or non-configurable + obj[property] = value; // eslint-disable-line no-param-reassign + } else { + throw new $SyntaxError('This environment does not support defining a property as non-configurable, non-writable, or non-enumerable.'); + } +}; diff --git a/server/node_modules/define-data-property/package.json b/server/node_modules/define-data-property/package.json new file mode 100644 index 000000000..1bb5815ba --- /dev/null +++ b/server/node_modules/define-data-property/package.json @@ -0,0 +1,113 @@ +{ + "name": "define-data-property", + "version": "1.1.1", + "description": "Define a data property on an object. Will fall back to assignment in an engine without descriptors.", + "main": "index.js", + "exports": { + ".": [ + { + "types": "./index.d.ts", + "default": "./index.js" + }, + "./index.js" + ], + "./package.json": "./package.json" + }, + "sideEffects": false, + "types": "./index.d.ts", + "scripts": { + "prepack": "npmignore --auto --commentLines=autogenerated && npm run emit-types", + "prepublish": "not-in-publish || npm run prepublishOnly", + "prepublishOnly": "safe-publish-latest", + "tsc": "tsc -p .", + "preemit-types": "rm -f *.ts *.ts.map test/*.ts test/*.ts.map", + "emit-types": "npm run tsc -- --noEmit false --emitDeclarationOnly", + "postemit-types": "rm test/*.ts test/*.ts.map", + "prelint": "evalmd README.md", + "lint": "eslint --ext=js,mjs .", + "postlint": "npm run tsc", + "pretest": "npm run lint", + "tests-only": "nyc tape 'test/**/*.js'", + "test": "npm run tests-only", + "posttest": "aud --production", + "version": "auto-changelog && git add CHANGELOG.md", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/define-data-property.git" + }, + "keywords": [ + "define", + "data", + "property", + "object", + "accessor", + "javascript", + "ecmascript", + "enumerable", + "configurable", + "writable" + ], + "author": "Jordan Harband ", + "license": "MIT", + "bugs": { + "url": "https://github.com/ljharb/define-data-property/issues" + }, + "homepage": "https://github.com/ljharb/define-data-property#readme", + "dependencies": { + "get-intrinsic": "^1.2.1", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.0" + }, + "devDependencies": { + "@ljharb/eslint-config": "^21.1.0", + "@types/es-value-fixtures": "^1.4.1", + "@types/for-each": "^0.3.1", + "@types/get-intrinsic": "^1.2.0", + "@types/gopd": "^1.0.1", + "@types/has": "^1.0.0", + "@types/has-property-descriptors": "^1.0.1", + "@types/object-inspect": "^1.8.2", + "@types/object.getownpropertydescriptors": "^2.1.2", + "@types/tape": "^5.6.1", + "aud": "^2.0.3", + "auto-changelog": "^2.4.0", + "es-value-fixtures": "^1.4.2", + "eslint": "=8.8.0", + "evalmd": "^0.0.19", + "for-each": "^0.3.3", + "has": "^1.0.3", + "in-publish": "^2.0.1", + "npmignore": "^0.3.0", + "nyc": "^10.3.2", + "object-inspect": "^1.12.3", + "object.getownpropertydescriptors": "^2.1.7", + "reflect.ownkeys": "^1.1.4", + "safe-publish-latest": "^2.0.0", + "tape": "^5.7.1", + "typescript": "^5.3.0-dev.20231012" + }, + "engines": { + "node": ">= 0.4" + }, + "testling": { + "files": "test/index.js" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "publishConfig": { + "ignore": [ + ".github/workflows", + "!*.ts", + "!*.ts.map", + "types/reflect.ownkeys" + ] + } +} diff --git a/server/node_modules/define-data-property/test/index.js b/server/node_modules/define-data-property/test/index.js new file mode 100644 index 000000000..405508ec5 --- /dev/null +++ b/server/node_modules/define-data-property/test/index.js @@ -0,0 +1,392 @@ +'use strict'; + +var test = require('tape'); +var v = require('es-value-fixtures'); +var forEach = require('for-each'); +var inspect = require('object-inspect'); +var has = require('has'); +var hasPropertyDescriptors = require('has-property-descriptors')(); +var getOwnPropertyDescriptors = require('object.getownpropertydescriptors'); +var ownKeys = require('reflect.ownkeys'); + +var defineDataProperty = require('../'); + +test('defineDataProperty', function (t) { + t.test('argument validation', function (st) { + forEach(v.primitives, function (nonObject) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty(nonObject, 'key', 'value'); }, + TypeError, + 'throws on non-object input: ' + inspect(nonObject) + ); + }); + + forEach(v.nonPropertyKeys, function (nonPropertyKey) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, nonPropertyKey, 'value'); }, + TypeError, + 'throws on non-PropertyKey input: ' + inspect(nonPropertyKey) + ); + }); + + forEach(v.nonBooleans, function (nonBoolean) { + if (nonBoolean !== null) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', nonBoolean); }, + TypeError, + 'throws on non-boolean nonEnumerable: ' + inspect(nonBoolean) + ); + + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', false, nonBoolean); }, + TypeError, + 'throws on non-boolean nonWritable: ' + inspect(nonBoolean) + ); + + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', false, false, nonBoolean); }, + TypeError, + 'throws on non-boolean nonConfigurable: ' + inspect(nonBoolean) + ); + } + }); + + st.end(); + }); + + t.test('normal data property', function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + st.ok(has(obj, 'existing'), 'has initial own property'); + st.equal(obj.existing, 'existing property', 'has expected initial value'); + + var res = defineDataProperty(obj, 'added', 'added property'); + st.equal(res, void undefined, 'returns `undefined`'); + st.ok(has(obj, 'added'), 'has expected own property'); + st.equal(obj.added, 'added property', 'has expected value'); + + defineDataProperty(obj, 'existing', 'new value'); + st.ok(has(obj, 'existing'), 'still has expected own property'); + st.equal(obj.existing, 'new value', 'has new expected value'); + + defineDataProperty(obj, 'explicit1', 'new value', false); + st.ok(has(obj, 'explicit1'), 'has expected own property (explicit enumerable)'); + st.equal(obj.explicit1, 'new value', 'has new expected value (explicit enumerable)'); + + defineDataProperty(obj, 'explicit2', 'new value', false, false); + st.ok(has(obj, 'explicit2'), 'has expected own property (explicit writable)'); + st.equal(obj.explicit2, 'new value', 'has new expected value (explicit writable)'); + + defineDataProperty(obj, 'explicit3', 'new value', false, false, false); + st.ok(has(obj, 'explicit3'), 'has expected own property (explicit configurable)'); + st.equal(obj.explicit3, 'new value', 'has new expected value (explicit configurable)'); + + st.end(); + }); + + t.test('loose mode', { skip: !hasPropertyDescriptors }, function (st) { + var obj = { existing: 'existing property' }; + + defineDataProperty(obj, 'added', 'added value 1', true, null, null, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: true, + enumerable: !hasPropertyDescriptors, + value: 'added value 1', + writable: true + } + }, + 'in loose mode, obj still adds property 1' + ); + + defineDataProperty(obj, 'added', 'added value 2', false, true, null, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: true, + enumerable: true, + value: 'added value 2', + writable: !hasPropertyDescriptors + } + }, + 'in loose mode, obj still adds property 2' + ); + + defineDataProperty(obj, 'added', 'added value 3', false, false, true, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: !hasPropertyDescriptors, + enumerable: true, + value: 'added value 3', + writable: true + } + }, + 'in loose mode, obj still adds property 3' + ); + + st.end(); + }); + + t.test('non-normal data property, ES3', { skip: hasPropertyDescriptors }, function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', true); }, + SyntaxError, + 'nonEnumerable throws a Syntax Error' + ); + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', false, true); }, + SyntaxError, + 'nonWritable throws a Syntax Error' + ); + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', false, false, true); }, + SyntaxError, + 'nonWritable throws a Syntax Error' + ); + + st.deepEqual( + ownKeys(obj), + ['existing'], + 'obj still has expected keys' + ); + st.equal(obj.existing, 'existing property', 'obj still has expected values'); + + st.end(); + }); + + t.test('new non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + + defineDataProperty(obj, 'nonEnum', null, true); + defineDataProperty(obj, 'nonWrit', null, false, true); + defineDataProperty(obj, 'nonConf', null, false, false, true); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + nonEnum: { + configurable: true, + enumerable: false, + value: null, + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: null, + writable: false + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj has expected property descriptors' + ); + + st.end(); + }); + + t.test('existing non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + // test case changing an existing non-normal property + + /** @type {Record} */ + var obj = {}; + Object.defineProperty(obj, 'nonEnum', { configurable: true, enumerable: false, value: null, writable: true }); + Object.defineProperty(obj, 'nonWrit', { configurable: true, enumerable: true, value: null, writable: false }); + Object.defineProperty(obj, 'nonConf', { configurable: false, enumerable: true, value: null, writable: true }); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + nonEnum: { + configurable: true, + enumerable: false, + value: null, + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: null, + writable: false + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj initially has expected property descriptors' + ); + + defineDataProperty(obj, 'nonEnum', 'new value', false); + defineDataProperty(obj, 'nonWrit', 'new value', false, false); + st['throws']( + function () { defineDataProperty(obj, 'nonConf', 'new value', false, false, false); }, + TypeError, + 'can not alter a nonconfigurable property' + ); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + nonEnum: { + configurable: true, + enumerable: true, + value: 'new value', + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: 'new value', + writable: true + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj ends up with expected property descriptors' + ); + + st.end(); + }); + + t.test('frozen object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var frozen = Object.freeze({ existing: true }); + + st['throws']( + function () { defineDataProperty(frozen, 'existing', 'new value'); }, + TypeError, + 'frozen object can not modify an existing property' + ); + + st['throws']( + function () { defineDataProperty(frozen, 'new', 'new property'); }, + TypeError, + 'frozen object can not add a new property' + ); + + st.end(); + }); + + t.test('sealed object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var sealed = Object.seal({ existing: true }); + st.deepEqual( + Object.getOwnPropertyDescriptor(sealed, 'existing'), + { + configurable: false, + enumerable: true, + value: true, + writable: true + }, + 'existing value on sealed object has expected descriptor' + ); + + defineDataProperty(sealed, 'existing', 'new value'); + + st.deepEqual( + Object.getOwnPropertyDescriptor(sealed, 'existing'), + { + configurable: false, + enumerable: true, + value: 'new value', + writable: true + }, + 'existing value on sealed object has changed descriptor' + ); + + st['throws']( + function () { defineDataProperty(sealed, 'new', 'new property'); }, + TypeError, + 'sealed object can not add a new property' + ); + + st.end(); + }); + + t.test('nonextensible object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var nonExt = Object.preventExtensions({ existing: true }); + + st.deepEqual( + Object.getOwnPropertyDescriptor(nonExt, 'existing'), + { + configurable: true, + enumerable: true, + value: true, + writable: true + }, + 'existing value on non-extensible object has expected descriptor' + ); + + defineDataProperty(nonExt, 'existing', 'new value', true); + + st.deepEqual( + Object.getOwnPropertyDescriptor(nonExt, 'existing'), + { + configurable: true, + enumerable: false, + value: 'new value', + writable: true + }, + 'existing value on non-extensible object has changed descriptor' + ); + + st['throws']( + function () { defineDataProperty(nonExt, 'new', 'new property'); }, + TypeError, + 'non-extensible object can not add a new property' + ); + + st.end(); + }); + + t.end(); +}); diff --git a/server/node_modules/define-data-property/tsconfig.json b/server/node_modules/define-data-property/tsconfig.json new file mode 100644 index 000000000..69f060dcc --- /dev/null +++ b/server/node_modules/define-data-property/tsconfig.json @@ -0,0 +1,59 @@ +{ + "compilerOptions": { + /* Visit https://aka.ms/tsconfig to read more about this file */ + + /* Projects */ + + /* Language and Environment */ + "target": "es2022", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */ + // "lib": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */ + // "noLib": true, /* Disable including any library files, including the default lib.d.ts. */ + "useDefineForClassFields": true, /* Emit ECMAScript-standard-compliant class fields. */ + // "moduleDetection": "auto", /* Control what method is used to detect module-format JS files. */ + + /* Modules */ + "module": "commonjs", /* Specify what module code is generated. */ + // "rootDir": "./", /* Specify the root folder within your source files. */ + // "moduleResolution": "node10", /* Specify how TypeScript looks up a file from a given module specifier. */ + // "baseUrl": "./", /* Specify the base directory to resolve non-relative module names. */ + // "paths": {}, /* Specify a set of entries that re-map imports to additional lookup locations. */ + // "rootDirs": [], /* Allow multiple folders to be treated as one when resolving modules. */ + "typeRoots": ["types"], /* Specify multiple folders that act like './node_modules/@types'. */ + "resolveJsonModule": true, /* Enable importing .json files. */ + + /* JavaScript Support */ + "allowJs": true, /* Allow JavaScript files to be a part of your program. Use the 'checkJS' option to get errors from these files. */ + "checkJs": true, /* Enable error reporting in type-checked JavaScript files. */ + "maxNodeModuleJsDepth": 1, /* Specify the maximum folder depth used for checking JavaScript files from 'node_modules'. Only applicable with 'allowJs'. */ + + /* Emit */ + "declaration": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */ + "declarationMap": true, /* Create sourcemaps for d.ts files. */ + // "emitDeclarationOnly": true, /* Only output d.ts files and not JavaScript files. */ + "noEmit": true, /* Disable emitting files from a compilation. */ + + /* Interop Constraints */ + "allowSyntheticDefaultImports": true, /* Allow 'import x from y' when a module doesn't have a default export. */ + "esModuleInterop": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables 'allowSyntheticDefaultImports' for type compatibility. */ + "forceConsistentCasingInFileNames": true, /* Ensure that casing is correct in imports. */ + + /* Type Checking */ + "strict": true, /* Enable all strict type-checking options. */ + "noImplicitAny": true, /* Enable error reporting for expressions and declarations with an implied 'any' type. */ + "noImplicitThis": true, /* Enable error reporting when 'this' is given the type 'any'. */ + "useUnknownInCatchVariables": true, /* Default catch clause variables as 'unknown' instead of 'any'. */ + "noUnusedLocals": true, /* Enable error reporting when local variables aren't read. */ + "noUnusedParameters": true, /* Raise an error when a function parameter isn't read. */ + "noImplicitReturns": true, /* Enable error reporting for codepaths that do not explicitly return in a function. */ + "noFallthroughCasesInSwitch": true, /* Enable error reporting for fallthrough cases in switch statements. */ + "noUncheckedIndexedAccess": true, /* Add 'undefined' to a type when accessed using an index. */ + "noImplicitOverride": true, /* Ensure overriding members in derived classes are marked with an override modifier. */ + // "noPropertyAccessFromIndexSignature": true, /* Enforces using indexed accessors for keys declared using an indexed type. */ + + /* Completeness */ + // "skipLibCheck": true /* Skip type checking all .d.ts files. */ + }, + "exclude": [ + "coverage" + ] +} diff --git a/server/node_modules/depd/History.md b/server/node_modules/depd/History.md new file mode 100644 index 000000000..cd9ebaaa9 --- /dev/null +++ b/server/node_modules/depd/History.md @@ -0,0 +1,103 @@ +2.0.0 / 2018-10-26 +================== + + * Drop support for Node.js 0.6 + * Replace internal `eval` usage with `Function` constructor + * Use instance methods on `process` to check for listeners + +1.1.2 / 2018-01-11 +================== + + * perf: remove argument reassignment + * Support Node.js 0.6 to 9.x + +1.1.1 / 2017-07-27 +================== + + * Remove unnecessary `Buffer` loading + * Support Node.js 0.6 to 8.x + +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/server/node_modules/depd/LICENSE b/server/node_modules/depd/LICENSE new file mode 100644 index 000000000..248de7af2 --- /dev/null +++ b/server/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2018 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/server/node_modules/depd/Readme.md b/server/node_modules/depd/Readme.md new file mode 100644 index 000000000..043d1ca28 --- /dev/null +++ b/server/node_modules/depd/Readme.md @@ -0,0 +1,280 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + + + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object. ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + +![message](files/message.png) + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +▼ ▼ ▼ ▼ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ ▲ +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction () { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/nodejs-depd/master?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://badgen.net/coveralls/c/github/dougwilson/nodejs-depd/master +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://badgen.net/npm/node/depd +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/depd +[npm-url]: https://npmjs.org/package/depd +[npm-version-image]: https://badgen.net/npm/v/depd +[travis-image]: https://badgen.net/travis/dougwilson/nodejs-depd/master?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd diff --git a/server/node_modules/depd/index.js b/server/node_modules/depd/index.js new file mode 100644 index 000000000..1bf2fcfde --- /dev/null +++ b/server/node_modules/depd/index.js @@ -0,0 +1,538 @@ +/*! + * depd + * Copyright(c) 2014-2018 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace (str, namespace) { + var vals = str.split(/[ ,]+/) + var ns = String(namespace).toLowerCase() + + for (var i = 0; i < vals.length; i++) { + var val = vals[i] + + // namespace contained + if (val && (val === '*' || val.toLowerCase() === ns)) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor (obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter () { return value } + + if (descriptor.writable) { + descriptor.set = function setter (val) { return (value = val) } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString (arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString (stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + stack[i].toString() + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate (message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if event emitter has listeners of a given type. + * + * The way to do this check is done three different ways in Node.js >= 0.8 + * so this consolidates them into a minimal set using instance methods. + * + * @param {EventEmitter} emitter + * @param {string} type + * @returns {boolean} + * @private + */ + +function eehaslisteners (emitter, type) { + var count = typeof emitter.listenerCount !== 'function' + ? emitter.listeners(type).length + : emitter.listenerCount(type) + + return count > 0 +} + +/** + * Determine if namespace is ignored. + */ + +function isignored (namespace) { + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced (namespace) { + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log (message, site) { + var haslisteners = eehaslisteners(process, 'deprecation') + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var depSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + depSite = site + callSite = callSiteLocation(stack[1]) + callSite.name = depSite.name + file = callSite[0] + } else { + // get call site + i = 2 + depSite = callSiteLocation(stack[i]) + callSite = depSite + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? depSite.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + var msg = message + if (!msg) { + msg = callSite === depSite || !callSite.name + ? defaultMessage(depSite) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, msg, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var output = format.call(this, msg, caller, stack.slice(i)) + process.stderr.write(output + '\n', 'utf8') +} + +/** + * Get call site location as array. + */ + +function callSiteLocation (callSite) { + var file = callSite.getFileName() || '' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage (site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain (msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + stack[i].toString() + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor (msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan + ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + stack[i].toString() + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation (callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace (obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + // eslint-disable-next-line no-new-func + var deprecatedfn = new Function('fn', 'log', 'deprecate', 'message', 'site', + '"use strict"\n' + + 'return function (' + args + ') {' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '}')(fn, log, this, message, site) + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter () { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter () { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError (namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return (stackString = createStackString.call(this, stack)) + }, + set: function setter (val) { + stackString = val + } + }) + + return error +} diff --git a/server/node_modules/depd/lib/browser/index.js b/server/node_modules/depd/lib/browser/index.js new file mode 100644 index 000000000..6be45cc20 --- /dev/null +++ b/server/node_modules/depd/lib/browser/index.js @@ -0,0 +1,77 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate (message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } +} diff --git a/server/node_modules/depd/package.json b/server/node_modules/depd/package.json new file mode 100644 index 000000000..3857e1991 --- /dev/null +++ b/server/node_modules/depd/package.json @@ -0,0 +1,45 @@ +{ + "name": "depd", + "description": "Deprecate all the things", + "version": "2.0.0", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "deprecate", + "deprecated" + ], + "repository": "dougwilson/nodejs-depd", + "browser": "lib/browser/index.js", + "devDependencies": { + "benchmark": "2.1.4", + "beautify-benchmark": "0.2.4", + "eslint": "5.7.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-markdown": "1.0.0-beta.7", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "5.2.0", + "safe-buffer": "5.1.2", + "uid-safe": "2.1.5" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter spec test/ && istanbul report lcovonly text-summary", + "test-cov": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter dot test/ && istanbul report lcov text-summary" + } +} diff --git a/server/node_modules/destroy/LICENSE b/server/node_modules/destroy/LICENSE new file mode 100644 index 000000000..0e2c35f0e --- /dev/null +++ b/server/node_modules/destroy/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2015-2022 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/server/node_modules/destroy/README.md b/server/node_modules/destroy/README.md new file mode 100644 index 000000000..e7701aee7 --- /dev/null +++ b/server/node_modules/destroy/README.md @@ -0,0 +1,63 @@ +# destroy + +[![NPM version][npm-image]][npm-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +Destroy a stream. + +This module is meant to ensure a stream gets destroyed, handling different APIs +and Node.js bugs. + +## API + +```js +var destroy = require('destroy') +``` + +### destroy(stream [, suppress]) + +Destroy the given stream, and optionally suppress any future `error` events. + +In most cases, this is identical to a simple `stream.destroy()` call. The rules +are as follows for a given stream: + + 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()` + and add a listener to the `open` event to call `stream.close()` if it is + fired. This is for a Node.js bug that will leak a file descriptor if + `.destroy()` is called before `open`. + 2. If the `stream` is an instance of a zlib stream, then call `stream.destroy()` + and close the underlying zlib handle if open, otherwise call `stream.close()`. + This is for consistency across Node.js versions and a Node.js bug that will + leak a native zlib handle. + 3. If the `stream` is not an instance of `Stream`, then nothing happens. + 4. If the `stream` has a `.destroy()` method, then call it. + +The function returns the `stream` passed in as the argument. + +## Example + +```js +var destroy = require('destroy') + +var fs = require('fs') +var stream = fs.createReadStream('package.json') + +// ... and later +destroy(stream) +``` + +[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square +[npm-url]: https://npmjs.org/package/destroy +[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square +[github-url]: https://github.com/stream-utils/destroy/tags +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master +[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/destroy +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/stream-utils/destroy/ci/master?label=ci&style=flat-square +[github-actions-ci-url]: https://github.com/stream-utils/destroy/actions/workflows/ci.yml diff --git a/server/node_modules/destroy/index.js b/server/node_modules/destroy/index.js new file mode 100644 index 000000000..7fd5c0936 --- /dev/null +++ b/server/node_modules/destroy/index.js @@ -0,0 +1,209 @@ +/*! + * destroy + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015-2022 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var EventEmitter = require('events').EventEmitter +var ReadStream = require('fs').ReadStream +var Stream = require('stream') +var Zlib = require('zlib') + +/** + * Module exports. + * @public + */ + +module.exports = destroy + +/** + * Destroy the given stream, and optionally suppress any future `error` events. + * + * @param {object} stream + * @param {boolean} suppress + * @public + */ + +function destroy (stream, suppress) { + if (isFsReadStream(stream)) { + destroyReadStream(stream) + } else if (isZlibStream(stream)) { + destroyZlibStream(stream) + } else if (hasDestroy(stream)) { + stream.destroy() + } + + if (isEventEmitter(stream) && suppress) { + stream.removeAllListeners('error') + stream.addListener('error', noop) + } + + return stream +} + +/** + * Destroy a ReadStream. + * + * @param {object} stream + * @private + */ + +function destroyReadStream (stream) { + stream.destroy() + + if (typeof stream.close === 'function') { + // node.js core bug work-around + stream.on('open', onOpenClose) + } +} + +/** + * Close a Zlib stream. + * + * Zlib streams below Node.js 4.5.5 have a buggy implementation + * of .close() when zlib encountered an error. + * + * @param {object} stream + * @private + */ + +function closeZlibStream (stream) { + if (stream._hadError === true) { + var prop = stream._binding === null + ? '_binding' + : '_handle' + + stream[prop] = { + close: function () { this[prop] = null } + } + } + + stream.close() +} + +/** + * Destroy a Zlib stream. + * + * Zlib streams don't have a destroy function in Node.js 6. On top of that + * simply calling destroy on a zlib stream in Node.js 8+ will result in a + * memory leak. So until that is fixed, we need to call both close AND destroy. + * + * PR to fix memory leak: https://github.com/nodejs/node/pull/23734 + * + * In Node.js 6+8, it's important that destroy is called before close as the + * stream would otherwise emit the error 'zlib binding closed'. + * + * @param {object} stream + * @private + */ + +function destroyZlibStream (stream) { + if (typeof stream.destroy === 'function') { + // node.js core bug work-around + // istanbul ignore if: node.js 0.8 + if (stream._binding) { + // node.js < 0.10.0 + stream.destroy() + if (stream._processing) { + stream._needDrain = true + stream.once('drain', onDrainClearBinding) + } else { + stream._binding.clear() + } + } else if (stream._destroy && stream._destroy !== Stream.Transform.prototype._destroy) { + // node.js >= 12, ^11.1.0, ^10.15.1 + stream.destroy() + } else if (stream._destroy && typeof stream.close === 'function') { + // node.js 7, 8 + stream.destroyed = true + stream.close() + } else { + // fallback + // istanbul ignore next + stream.destroy() + } + } else if (typeof stream.close === 'function') { + // node.js < 8 fallback + closeZlibStream(stream) + } +} + +/** + * Determine if stream has destroy. + * @private + */ + +function hasDestroy (stream) { + return stream instanceof Stream && + typeof stream.destroy === 'function' +} + +/** + * Determine if val is EventEmitter. + * @private + */ + +function isEventEmitter (val) { + return val instanceof EventEmitter +} + +/** + * Determine if stream is fs.ReadStream stream. + * @private + */ + +function isFsReadStream (stream) { + return stream instanceof ReadStream +} + +/** + * Determine if stream is Zlib stream. + * @private + */ + +function isZlibStream (stream) { + return stream instanceof Zlib.Gzip || + stream instanceof Zlib.Gunzip || + stream instanceof Zlib.Deflate || + stream instanceof Zlib.DeflateRaw || + stream instanceof Zlib.Inflate || + stream instanceof Zlib.InflateRaw || + stream instanceof Zlib.Unzip +} + +/** + * No-op function. + * @private + */ + +function noop () {} + +/** + * On drain handler to clear binding. + * @private + */ + +// istanbul ignore next: node.js 0.8 +function onDrainClearBinding () { + this._binding.clear() +} + +/** + * On open handler to close stream. + * @private + */ + +function onOpenClose () { + if (typeof this.fd === 'number') { + // actually close down the fd + this.close() + } +} diff --git a/server/node_modules/destroy/package.json b/server/node_modules/destroy/package.json new file mode 100644 index 000000000..c85e43837 --- /dev/null +++ b/server/node_modules/destroy/package.json @@ -0,0 +1,48 @@ +{ + "name": "destroy", + "description": "destroy a stream if possible", + "version": "1.2.0", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com", + "twitter": "https://twitter.com/jongleberry" + }, + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "repository": "stream-utils/destroy", + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.2", + "nyc": "15.1.0" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "files": [ + "index.js", + "LICENSE" + ], + "keywords": [ + "stream", + "streams", + "destroy", + "cleanup", + "leak", + "fd" + ] +} diff --git a/server/node_modules/dotenv/CHANGELOG.md b/server/node_modules/dotenv/CHANGELOG.md new file mode 100644 index 000000000..c15fd30c7 --- /dev/null +++ b/server/node_modules/dotenv/CHANGELOG.md @@ -0,0 +1,431 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +## [Unreleased](https://github.com/motdotla/dotenv/compare/v16.3.1...master) + +## [16.3.1](https://github.com/motdotla/dotenv/compare/v16.3.0...v16.3.1) (2023-06-17) + +### Added + +- Add missing type definitions for `processEnv` and `DOTENV_KEY` options. [#756](https://github.com/motdotla/dotenv/pull/756) + +## [16.3.0](https://github.com/motdotla/dotenv/compare/v16.2.0...v16.3.0) (2023-06-16) + +### Added + +- Optionally pass `DOTENV_KEY` to options rather than relying on `process.env.DOTENV_KEY`. Defaults to `process.env.DOTENV_KEY` [#754](https://github.com/motdotla/dotenv/pull/754) + +## [16.2.0](https://github.com/motdotla/dotenv/compare/v16.1.4...v16.2.0) (2023-06-15) + +### Added + +- Optionally write to your own target object rather than `process.env`. Defaults to `process.env`. [#753](https://github.com/motdotla/dotenv/pull/753) +- Add import type URL to types file [#751](https://github.com/motdotla/dotenv/pull/751) + +## [16.1.4](https://github.com/motdotla/dotenv/compare/v16.1.3...v16.1.4) (2023-06-04) + +### Added + +- Added `.github/` to `.npmignore` [#747](https://github.com/motdotla/dotenv/pull/747) + +## [16.1.3](https://github.com/motdotla/dotenv/compare/v16.1.2...v16.1.3) (2023-05-31) + +### Removed + +- Removed `browser` keys for `path`, `os`, and `crypto` in package.json. These were set to false incorrectly as of 16.1. Instead, if using dotenv on the front-end make sure to include polyfills for `path`, `os`, and `crypto`. [node-polyfill-webpack-plugin](https://github.com/Richienb/node-polyfill-webpack-plugin) provides these. + +## [16.1.2](https://github.com/motdotla/dotenv/compare/v16.1.1...v16.1.2) (2023-05-31) + +### Changed + +- Exposed private function `_configDotenv` as `configDotenv`. [#744](https://github.com/motdotla/dotenv/pull/744) + +## [16.1.1](https://github.com/motdotla/dotenv/compare/v16.1.0...v16.1.1) (2023-05-30) + +### Added + +- Added type definition for `decrypt` function + +### Changed + +- Fixed `{crypto: false}` in `packageJson.browser` + +## [16.1.0](https://github.com/motdotla/dotenv/compare/v16.0.3...v16.1.0) (2023-05-30) + +### Added + +- Add `populate` convenience method [#733](https://github.com/motdotla/dotenv/pull/733) +- Accept URL as path option [#720](https://github.com/motdotla/dotenv/pull/720) +- Add dotenv to `npm fund` command +- Spanish language README [#698](https://github.com/motdotla/dotenv/pull/698) +- Add `.env.vault` support. 🎉 ([#730](https://github.com/motdotla/dotenv/pull/730)) + +ℹ️ `.env.vault` extends the `.env` file format standard with a localized encrypted vault file. Package it securely with your production code deploys. It's cloud agnostic so that you can deploy your secrets anywhere – without [risky third-party integrations](https://techcrunch.com/2023/01/05/circleci-breach/). [read more](https://github.com/motdotla/dotenv#-deploying) + +### Changed + +- Fixed "cannot resolve 'fs'" error on tools like Replit [#693](https://github.com/motdotla/dotenv/pull/693) + +## [16.0.3](https://github.com/motdotla/dotenv/compare/v16.0.2...v16.0.3) (2022-09-29) + +### Changed + +- Added library version to debug logs ([#682](https://github.com/motdotla/dotenv/pull/682)) + +## [16.0.2](https://github.com/motdotla/dotenv/compare/v16.0.1...v16.0.2) (2022-08-30) + +### Added + +- Export `env-options.js` and `cli-options.js` in package.json for use with downstream [dotenv-expand](https://github.com/motdotla/dotenv-expand) module + +## [16.0.1](https://github.com/motdotla/dotenv/compare/v16.0.0...v16.0.1) (2022-05-10) + +### Changed + +- Minor README clarifications +- Development ONLY: updated devDependencies as recommended for development only security risks ([#658](https://github.com/motdotla/dotenv/pull/658)) + +## [16.0.0](https://github.com/motdotla/dotenv/compare/v15.0.1...v16.0.0) (2022-02-02) + +### Added + +- _Breaking:_ Backtick support 🎉 ([#615](https://github.com/motdotla/dotenv/pull/615)) + +If you had values containing the backtick character, please quote those values with either single or double quotes. + +## [15.0.1](https://github.com/motdotla/dotenv/compare/v15.0.0...v15.0.1) (2022-02-02) + +### Changed + +- Properly parse empty single or double quoted values 🐞 ([#614](https://github.com/motdotla/dotenv/pull/614)) + +## [15.0.0](https://github.com/motdotla/dotenv/compare/v14.3.2...v15.0.0) (2022-01-31) + +`v15.0.0` is a major new release with some important breaking changes. + +### Added + +- _Breaking:_ Multiline parsing support (just works. no need for the flag.) + +### Changed + +- _Breaking:_ `#` marks the beginning of a comment (UNLESS the value is wrapped in quotes. Please update your `.env` files to wrap in quotes any values containing `#`. For example: `SECRET_HASH="something-with-a-#-hash"`). + +..Understandably, (as some teams have noted) this is tedious to do across the entire team. To make it less tedious, we recommend using [dotenv cli](https://github.com/dotenv-org/cli) going forward. It's an optional plugin that will keep your `.env` files in sync between machines, environments, or team members. + +### Removed + +- _Breaking:_ Remove multiline option (just works out of the box now. no need for the flag.) + +## [14.3.2](https://github.com/motdotla/dotenv/compare/v14.3.1...v14.3.2) (2022-01-25) + +### Changed + +- Preserve backwards compatibility on values containing `#` 🐞 ([#603](https://github.com/motdotla/dotenv/pull/603)) + +## [14.3.1](https://github.com/motdotla/dotenv/compare/v14.3.0...v14.3.1) (2022-01-25) + +### Changed + +- Preserve backwards compatibility on exports by re-introducing the prior in-place exports 🐞 ([#606](https://github.com/motdotla/dotenv/pull/606)) + +## [14.3.0](https://github.com/motdotla/dotenv/compare/v14.2.0...v14.3.0) (2022-01-24) + +### Added + +- Add `multiline` option 🎉 ([#486](https://github.com/motdotla/dotenv/pull/486)) + +## [14.2.0](https://github.com/motdotla/dotenv/compare/v14.1.1...v14.2.0) (2022-01-17) + +### Added + +- Add `dotenv_config_override` cli option +- Add `DOTENV_CONFIG_OVERRIDE` command line env option + +## [14.1.1](https://github.com/motdotla/dotenv/compare/v14.1.0...v14.1.1) (2022-01-17) + +### Added + +- Add React gotcha to FAQ on README + +## [14.1.0](https://github.com/motdotla/dotenv/compare/v14.0.1...v14.1.0) (2022-01-17) + +### Added + +- Add `override` option 🎉 ([#595](https://github.com/motdotla/dotenv/pull/595)) + +## [14.0.1](https://github.com/motdotla/dotenv/compare/v14.0.0...v14.0.1) (2022-01-16) + +### Added + +- Log error on failure to load `.env` file ([#594](https://github.com/motdotla/dotenv/pull/594)) + +## [14.0.0](https://github.com/motdotla/dotenv/compare/v13.0.1...v14.0.0) (2022-01-16) + +### Added + +- _Breaking:_ Support inline comments for the parser 🎉 ([#568](https://github.com/motdotla/dotenv/pull/568)) + +## [13.0.1](https://github.com/motdotla/dotenv/compare/v13.0.0...v13.0.1) (2022-01-16) + +### Changed + +* Hide comments and newlines from debug output ([#404](https://github.com/motdotla/dotenv/pull/404)) + +## [13.0.0](https://github.com/motdotla/dotenv/compare/v12.0.4...v13.0.0) (2022-01-16) + +### Added + +* _Breaking:_ Add type file for `config.js` ([#539](https://github.com/motdotla/dotenv/pull/539)) + +## [12.0.4](https://github.com/motdotla/dotenv/compare/v12.0.3...v12.0.4) (2022-01-16) + +### Changed + +* README updates +* Minor order adjustment to package json format + +## [12.0.3](https://github.com/motdotla/dotenv/compare/v12.0.2...v12.0.3) (2022-01-15) + +### Changed + +* Simplified jsdoc for consistency across editors + +## [12.0.2](https://github.com/motdotla/dotenv/compare/v12.0.1...v12.0.2) (2022-01-15) + +### Changed + +* Improve embedded jsdoc type documentation + +## [12.0.1](https://github.com/motdotla/dotenv/compare/v12.0.0...v12.0.1) (2022-01-15) + +### Changed + +* README updates and clarifications + +## [12.0.0](https://github.com/motdotla/dotenv/compare/v11.0.0...v12.0.0) (2022-01-15) + +### Removed + +- _Breaking:_ drop support for Flow static type checker ([#584](https://github.com/motdotla/dotenv/pull/584)) + +### Changed + +- Move types/index.d.ts to lib/main.d.ts ([#585](https://github.com/motdotla/dotenv/pull/585)) +- Typescript cleanup ([#587](https://github.com/motdotla/dotenv/pull/587)) +- Explicit typescript inclusion in package.json ([#566](https://github.com/motdotla/dotenv/pull/566)) + +## [11.0.0](https://github.com/motdotla/dotenv/compare/v10.0.0...v11.0.0) (2022-01-11) + +### Changed + +- _Breaking:_ drop support for Node v10 ([#558](https://github.com/motdotla/dotenv/pull/558)) +- Patch debug option ([#550](https://github.com/motdotla/dotenv/pull/550)) + +## [10.0.0](https://github.com/motdotla/dotenv/compare/v9.0.2...v10.0.0) (2021-05-20) + +### Added + +- Add generic support to parse function +- Allow for import "dotenv/config.js" +- Add support to resolve home directory in path via ~ + +## [9.0.2](https://github.com/motdotla/dotenv/compare/v9.0.1...v9.0.2) (2021-05-10) + +### Changed + +- Support windows newlines with debug mode + +## [9.0.1](https://github.com/motdotla/dotenv/compare/v9.0.0...v9.0.1) (2021-05-08) + +### Changed + +- Updates to README + +## [9.0.0](https://github.com/motdotla/dotenv/compare/v8.6.0...v9.0.0) (2021-05-05) + +### Changed + +- _Breaking:_ drop support for Node v8 + +## [8.6.0](https://github.com/motdotla/dotenv/compare/v8.5.1...v8.6.0) (2021-05-05) + +### Added + +- define package.json in exports + +## [8.5.1](https://github.com/motdotla/dotenv/compare/v8.5.0...v8.5.1) (2021-05-05) + +### Changed + +- updated dev dependencies via npm audit + +## [8.5.0](https://github.com/motdotla/dotenv/compare/v8.4.0...v8.5.0) (2021-05-05) + +### Added + +- allow for `import "dotenv/config"` + +## [8.4.0](https://github.com/motdotla/dotenv/compare/v8.3.0...v8.4.0) (2021-05-05) + +### Changed + +- point to exact types file to work with VS Code + +## [8.3.0](https://github.com/motdotla/dotenv/compare/v8.2.0...v8.3.0) (2021-05-05) + +### Changed + +- _Breaking:_ drop support for Node v8 (mistake to be released as minor bump. later bumped to 9.0.0. see above.) + +## [8.2.0](https://github.com/motdotla/dotenv/compare/v8.1.0...v8.2.0) (2019-10-16) + +### Added + +- TypeScript types + +## [8.1.0](https://github.com/motdotla/dotenv/compare/v8.0.0...v8.1.0) (2019-08-18) + +### Changed + +- _Breaking:_ drop support for Node v6 ([#392](https://github.com/motdotla/dotenv/issues/392)) + +# [8.0.0](https://github.com/motdotla/dotenv/compare/v7.0.0...v8.0.0) (2019-05-02) + +### Changed + +- _Breaking:_ drop support for Node v6 ([#302](https://github.com/motdotla/dotenv/issues/392)) + +## [7.0.0] - 2019-03-12 + +### Fixed + +- Fix removing unbalanced quotes ([#376](https://github.com/motdotla/dotenv/pull/376)) + +### Removed + +- Removed `load` alias for `config` for consistency throughout code and documentation. + +## [6.2.0] - 2018-12-03 + +### Added + +- Support preload configuration via environment variables ([#351](https://github.com/motdotla/dotenv/issues/351)) + +## [6.1.0] - 2018-10-08 + +### Added + +- `debug` option for `config` and `parse` methods will turn on logging + +## [6.0.0] - 2018-06-02 + +### Changed + +- _Breaking:_ drop support for Node v4 ([#304](https://github.com/motdotla/dotenv/pull/304)) + +## [5.0.0] - 2018-01-29 + +### Added + +- Testing against Node v8 and v9 +- Documentation on trim behavior of values +- Documentation on how to use with `import` + +### Changed + +- _Breaking_: default `path` is now `path.resolve(process.cwd(), '.env')` +- _Breaking_: does not write over keys already in `process.env` if the key has a falsy value +- using `const` and `let` instead of `var` + +### Removed + +- Testing against Node v7 + +## [4.0.0] - 2016-12-23 + +### Changed + +- Return Object with parsed content or error instead of false ([#165](https://github.com/motdotla/dotenv/pull/165)). + +### Removed + +- `verbose` option removed in favor of returning result. + +## [3.0.0] - 2016-12-20 + +### Added + +- `verbose` option will log any error messages. Off by default. +- parses email addresses correctly +- allow importing config method directly in ES6 + +### Changed + +- Suppress error messages by default ([#154](https://github.com/motdotla/dotenv/pull/154)) +- Ignoring more files for NPM to make package download smaller + +### Fixed + +- False positive test due to case-sensitive variable ([#124](https://github.com/motdotla/dotenv/pull/124)) + +### Removed + +- `silent` option removed in favor of `verbose` + +## [2.0.0] - 2016-01-20 + +### Added + +- CHANGELOG to ["make it easier for users and contributors to see precisely what notable changes have been made between each release"](http://keepachangelog.com/). Linked to from README +- LICENSE to be more explicit about what was defined in `package.json`. Linked to from README +- Testing nodejs v4 on travis-ci +- added examples of how to use dotenv in different ways +- return parsed object on success rather than boolean true + +### Changed + +- README has shorter description not referencing ruby gem since we don't have or want feature parity + +### Removed + +- Variable expansion and escaping so environment variables are encouraged to be fully orthogonal + +## [1.2.0] - 2015-06-20 + +### Added + +- Preload hook to require dotenv without including it in your code + +### Changed + +- clarified license to be "BSD-2-Clause" in `package.json` + +### Fixed + +- retain spaces in string vars + +## [1.1.0] - 2015-03-31 + +### Added + +- Silent option to silence `console.log` when `.env` missing + +## [1.0.0] - 2015-03-13 + +### Removed + +- support for multiple `.env` files. should always use one `.env` file for the current environment + +[7.0.0]: https://github.com/motdotla/dotenv/compare/v6.2.0...v7.0.0 +[6.2.0]: https://github.com/motdotla/dotenv/compare/v6.1.0...v6.2.0 +[6.1.0]: https://github.com/motdotla/dotenv/compare/v6.0.0...v6.1.0 +[6.0.0]: https://github.com/motdotla/dotenv/compare/v5.0.0...v6.0.0 +[5.0.0]: https://github.com/motdotla/dotenv/compare/v4.0.0...v5.0.0 +[4.0.0]: https://github.com/motdotla/dotenv/compare/v3.0.0...v4.0.0 +[3.0.0]: https://github.com/motdotla/dotenv/compare/v2.0.0...v3.0.0 +[2.0.0]: https://github.com/motdotla/dotenv/compare/v1.2.0...v2.0.0 +[1.2.0]: https://github.com/motdotla/dotenv/compare/v1.1.0...v1.2.0 +[1.1.0]: https://github.com/motdotla/dotenv/compare/v1.0.0...v1.1.0 +[1.0.0]: https://github.com/motdotla/dotenv/compare/v0.4.0...v1.0.0 diff --git a/server/node_modules/dotenv/LICENSE b/server/node_modules/dotenv/LICENSE new file mode 100644 index 000000000..c430ad8bd --- /dev/null +++ b/server/node_modules/dotenv/LICENSE @@ -0,0 +1,23 @@ +Copyright (c) 2015, Scott Motte +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/server/node_modules/dotenv/README-es.md b/server/node_modules/dotenv/README-es.md new file mode 100644 index 000000000..ad8be92ba --- /dev/null +++ b/server/node_modules/dotenv/README-es.md @@ -0,0 +1,442 @@ +
+ +

+ + Dotenv es apoyado por la comunidad. + +

+Gracias espaciales a: +
+
+ +
+ Warp +
+ Warp es una rápida e impresionante terminal basada en Rust, reinventado para funcionar como una aplicación moderna. +
+ Haga más en la CLI con edición de texto real, resultado básado en bloques, y busqueda de comandos de IA. +
+
+
+ +
+ Retool +
+ Retool ayuda a los desarrolladores a crear software interno personalizado, como aplicaciones CRUD y paneles de administración, realmente rápido. +
+ Construya Interfaces de Usuario de forma visual con componentes flexibles, conéctese a cualquier fuente de datos, y escriba lógica de negocio en JavaScript. +
+
+
+ +
+ WorkOS +
+ Su Apliación, Lista para la Empresa. +
+ Agrega Inicio de Sesión Único, Autenticación Multi-Factor, y mucho más, en minutos en lugar de meses. +
+
+
+
+
+
+
+ +
+ +# dotenv [![NPM version](https://img.shields.io/npm/v/dotenv.svg?style=flat-square)](https://www.npmjs.com/package/dotenv) + +dotenv + +Dotenv es un módulo de dependencia cero que carga las variables de entorno desde un archivo `.env` en [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). El almacenamiento de la configuración del entorno separado del código está basado en la metodología [The Twelve-Factor App](http://12factor.net/config). + +[![js-standard-style](https://img.shields.io/badge/code%20style-standard-brightgreen.svg?style=flat-square)](https://github.com/feross/standard) +[![LICENSE](https://img.shields.io/github/license/motdotla/dotenv.svg)](LICENSE) + +## Instalación + +```bash +# instalación local (recomendado) +npm install dotenv --save +``` + +O installación con yarn? `yarn add dotenv` + +## Uso + +Cree un archivo `.env` en la raíz de su proyecto: + +```dosini +S3_BUCKET="YOURS3BUCKET" +SECRET_KEY="YOURSECRETKEYGOESHERE" +``` + +Tan prónto como sea posible en su aplicación, importe y configure dotenv: + +```javascript +require('dotenv').config() +console.log(process.env) // elimine esto después que haya confirmado que esta funcionando +``` + +.. o usa ES6? + +```javascript +import * as dotenv from 'dotenv' // vea en https://github.com/motdotla/dotenv#como-uso-dotenv-con-import +// REVISAR LINK DE REFERENCIA DE IMPORTACIÓN +dotenv.config() +import express from 'express' +``` + +Eso es todo. `process.env` ahora tiene las claves y los valores que definiste en tu archivo `.env`: + +```javascript +require('dotenv').config() + +... + +s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {}) +``` + +### Valores multilínea + +Si necesita variables de varias líneas, por ejemplo, claves privadas, ahora se admiten en la versión (`>= v15.0.0`) con saltos de línea: + +```dosini +PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY----- +... +Kh9NV... +... +-----END RSA PRIVATE KEY-----" +``` + +Alternativamente, puede usar comillas dobles y usar el carácter `\n`: + +```dosini +PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END RSA PRIVATE KEY-----\n" +``` + +### Comentarios + +Los comentarios pueden ser agregados en tu archivo o en la misma línea: + +```dosini +# This is a comment +SECRET_KEY=YOURSECRETKEYGOESHERE # comment +SECRET_HASH="something-with-a-#-hash" +``` + +Los comentarios comienzan donde existe un `#`, entonces, si su valor contiene un `#`, enciérrelo entre comillas. Este es un cambio importante desde la versión `>= v15.0.0` en adelante. + +### Análisis + +El motor que analiza el contenido de su archivo que contiene variables de entorno está disponible para su uso. Este Acepta una Cadena o un Búfer y devolverá un Objeto con las claves y los valores analizados. + +```javascript +const dotenv = require('dotenv') +const buf = Buffer.from('BASICO=basico') +const config = dotenv.parse(buf) // devolverá un objeto +console.log(typeof config, config) // objeto { BASICO : 'basico' } +``` + +### Precarga + +Puede usar el `--require` (`-r`) [opción de línea de comando](https://nodejs.org/api/cli.html#-r---require-module) para precargar dotenv. Al hacer esto, no necesita requerir ni cargar dotnev en el código de su aplicación. + +```bash +$ node -r dotenv/config tu_script.js +``` + +Las opciones de configuración a continuación se admiten como argumentos de línea de comandos en el formato `dotenv_config_