diff --git a/client/.eslintrc.cjs b/client/.eslintrc.cjs
new file mode 100644
index 000000000..4dcb43901
--- /dev/null
+++ b/client/.eslintrc.cjs
@@ -0,0 +1,20 @@
+module.exports = {
+ root: true,
+ env: { browser: true, es2020: true },
+ extends: [
+ 'eslint:recommended',
+ 'plugin:react/recommended',
+ 'plugin:react/jsx-runtime',
+ 'plugin:react-hooks/recommended',
+ ],
+ ignorePatterns: ['dist', '.eslintrc.cjs'],
+ parserOptions: { ecmaVersion: 'latest', sourceType: 'module' },
+ settings: { react: { version: '18.2' } },
+ plugins: ['react-refresh'],
+ rules: {
+ 'react-refresh/only-export-components': [
+ 'warn',
+ { allowConstantExport: true },
+ ],
+ },
+}
diff --git a/client/.gitignore b/client/.gitignore
new file mode 100644
index 000000000..a547bf36d
--- /dev/null
+++ b/client/.gitignore
@@ -0,0 +1,24 @@
+# Logs
+logs
+*.log
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+pnpm-debug.log*
+lerna-debug.log*
+
+node_modules
+dist
+dist-ssr
+*.local
+
+# Editor directories and files
+.vscode/*
+!.vscode/extensions.json
+.idea
+.DS_Store
+*.suo
+*.ntvs*
+*.njsproj
+*.sln
+*.sw?
diff --git a/client/README.md b/client/README.md
new file mode 100644
index 000000000..f768e33fc
--- /dev/null
+++ b/client/README.md
@@ -0,0 +1,8 @@
+# React + Vite
+
+This template provides a minimal setup to get React working in Vite with HMR and some ESLint rules.
+
+Currently, two official plugins are available:
+
+- [@vitejs/plugin-react](https://github.com/vitejs/vite-plugin-react/blob/main/packages/plugin-react/README.md) uses [Babel](https://babeljs.io/) for Fast Refresh
+- [@vitejs/plugin-react-swc](https://github.com/vitejs/vite-plugin-react-swc) uses [SWC](https://swc.rs/) for Fast Refresh
diff --git a/client/index.html b/client/index.html
new file mode 100644
index 000000000..0c589eccd
--- /dev/null
+++ b/client/index.html
@@ -0,0 +1,13 @@
+
+
+
+
+
+
+ Vite + React
+
+
+
+
+
+
diff --git a/client/package-lock.json b/client/package-lock.json
new file mode 100644
index 000000000..9b0bd0e31
--- /dev/null
+++ b/client/package-lock.json
@@ -0,0 +1,4185 @@
+{
+ "name": "client",
+ "version": "0.0.0",
+ "lockfileVersion": 3,
+ "requires": true,
+ "packages": {
+ "": {
+ "name": "client",
+ "version": "0.0.0",
+ "dependencies": {
+ "axios": "^1.6.2",
+ "bootstrap": "^5.3.0",
+ "react": "^18.2.0",
+ "react-dom": "^18.2.0",
+ "react-router-dom": "^6.21.1"
+ },
+ "devDependencies": {
+ "@types/react": "^18.2.43",
+ "@types/react-dom": "^18.2.17",
+ "@vitejs/plugin-react": "^4.2.1",
+ "eslint": "^8.55.0",
+ "eslint-plugin-react": "^7.33.2",
+ "eslint-plugin-react-hooks": "^4.6.0",
+ "eslint-plugin-react-refresh": "^0.4.5",
+ "vite": "^5.0.8"
+ }
+ },
+ "node_modules/@aashutoshrathi/word-wrap": {
+ "version": "1.2.6",
+ "resolved": "https://registry.npmjs.org/@aashutoshrathi/word-wrap/-/word-wrap-1.2.6.tgz",
+ "integrity": "sha512-1Yjs2SvM8TflER/OD3cOjhWWOZb58A2t7wpE2S9XfBYTiIl+XFhQG2bjy4Pu1I+EAlCNUzRDYDdFwFYUKvXcIA==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/@ampproject/remapping": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/@ampproject/remapping/-/remapping-2.2.1.tgz",
+ "integrity": "sha512-lFMjJTrFL3j7L9yBxwYfCq2k6qqwHyzuUl/XBnif78PWTJYyL/dfowQHWE3sp6U6ZzqWiiIZnpTMO96zhkjwtg==",
+ "dev": true,
+ "dependencies": {
+ "@jridgewell/gen-mapping": "^0.3.0",
+ "@jridgewell/trace-mapping": "^0.3.9"
+ },
+ "engines": {
+ "node": ">=6.0.0"
+ }
+ },
+ "node_modules/@babel/code-frame": {
+ "version": "7.23.5",
+ "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.23.5.tgz",
+ "integrity": "sha512-CgH3s1a96LipHCmSUmYFPwY7MNx8C3avkq7i4Wl3cfa662ldtUe4VM1TPXX70pfmrlWTb6jLqTYrZyT2ZTJBgA==",
+ "dev": true,
+ "dependencies": {
+ "@babel/highlight": "^7.23.4",
+ "chalk": "^2.4.2"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/compat-data": {
+ "version": "7.23.5",
+ "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.23.5.tgz",
+ "integrity": "sha512-uU27kfDRlhfKl+w1U6vp16IuvSLtjAxdArVXPa9BvLkrr7CYIsxH5adpHObeAGY/41+syctUWOZ140a2Rvkgjw==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/core": {
+ "version": "7.23.6",
+ "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.23.6.tgz",
+ "integrity": "sha512-FxpRyGjrMJXh7X3wGLGhNDCRiwpWEF74sKjTLDJSG5Kyvow3QZaG0Adbqzi9ZrVjTWpsX+2cxWXD71NMg93kdw==",
+ "dev": true,
+ "dependencies": {
+ "@ampproject/remapping": "^2.2.0",
+ "@babel/code-frame": "^7.23.5",
+ "@babel/generator": "^7.23.6",
+ "@babel/helper-compilation-targets": "^7.23.6",
+ "@babel/helper-module-transforms": "^7.23.3",
+ "@babel/helpers": "^7.23.6",
+ "@babel/parser": "^7.23.6",
+ "@babel/template": "^7.22.15",
+ "@babel/traverse": "^7.23.6",
+ "@babel/types": "^7.23.6",
+ "convert-source-map": "^2.0.0",
+ "debug": "^4.1.0",
+ "gensync": "^1.0.0-beta.2",
+ "json5": "^2.2.3",
+ "semver": "^6.3.1"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/babel"
+ }
+ },
+ "node_modules/@babel/generator": {
+ "version": "7.23.6",
+ "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.23.6.tgz",
+ "integrity": "sha512-qrSfCYxYQB5owCmGLbl8XRpX1ytXlpueOb0N0UmQwA073KZxejgQTzAmJezxvpwQD9uGtK2shHdi55QT+MbjIw==",
+ "dev": true,
+ "dependencies": {
+ "@babel/types": "^7.23.6",
+ "@jridgewell/gen-mapping": "^0.3.2",
+ "@jridgewell/trace-mapping": "^0.3.17",
+ "jsesc": "^2.5.1"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-compilation-targets": {
+ "version": "7.23.6",
+ "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.23.6.tgz",
+ "integrity": "sha512-9JB548GZoQVmzrFgp8o7KxdgkTGm6xs9DW0o/Pim72UDjzr5ObUQ6ZzYPqA+g9OTS2bBQoctLJrky0RDCAWRgQ==",
+ "dev": true,
+ "dependencies": {
+ "@babel/compat-data": "^7.23.5",
+ "@babel/helper-validator-option": "^7.23.5",
+ "browserslist": "^4.22.2",
+ "lru-cache": "^5.1.1",
+ "semver": "^6.3.1"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-environment-visitor": {
+ "version": "7.22.20",
+ "resolved": "https://registry.npmjs.org/@babel/helper-environment-visitor/-/helper-environment-visitor-7.22.20.tgz",
+ "integrity": "sha512-zfedSIzFhat/gFhWfHtgWvlec0nqB9YEIVrpuwjruLlXfUSnA8cJB0miHKwqDnQ7d32aKo2xt88/xZptwxbfhA==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-function-name": {
+ "version": "7.23.0",
+ "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.23.0.tgz",
+ "integrity": "sha512-OErEqsrxjZTJciZ4Oo+eoZqeW9UIiOcuYKRJA4ZAgV9myA+pOXhhmpfNCKjEH/auVfEYVFJ6y1Tc4r0eIApqiw==",
+ "dev": true,
+ "dependencies": {
+ "@babel/template": "^7.22.15",
+ "@babel/types": "^7.23.0"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-hoist-variables": {
+ "version": "7.22.5",
+ "resolved": "https://registry.npmjs.org/@babel/helper-hoist-variables/-/helper-hoist-variables-7.22.5.tgz",
+ "integrity": "sha512-wGjk9QZVzvknA6yKIUURb8zY3grXCcOZt+/7Wcy8O2uctxhplmUPkOdlgoNhmdVee2c92JXbf1xpMtVNbfoxRw==",
+ "dev": true,
+ "dependencies": {
+ "@babel/types": "^7.22.5"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-module-imports": {
+ "version": "7.22.15",
+ "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.22.15.tgz",
+ "integrity": "sha512-0pYVBnDKZO2fnSPCrgM/6WMc7eS20Fbok+0r88fp+YtWVLZrp4CkafFGIp+W0VKw4a22sgebPT99y+FDNMdP4w==",
+ "dev": true,
+ "dependencies": {
+ "@babel/types": "^7.22.15"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-module-transforms": {
+ "version": "7.23.3",
+ "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.23.3.tgz",
+ "integrity": "sha512-7bBs4ED9OmswdfDzpz4MpWgSrV7FXlc3zIagvLFjS5H+Mk7Snr21vQ6QwrsoCGMfNC4e4LQPdoULEt4ykz0SRQ==",
+ "dev": true,
+ "dependencies": {
+ "@babel/helper-environment-visitor": "^7.22.20",
+ "@babel/helper-module-imports": "^7.22.15",
+ "@babel/helper-simple-access": "^7.22.5",
+ "@babel/helper-split-export-declaration": "^7.22.6",
+ "@babel/helper-validator-identifier": "^7.22.20"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ },
+ "peerDependencies": {
+ "@babel/core": "^7.0.0"
+ }
+ },
+ "node_modules/@babel/helper-plugin-utils": {
+ "version": "7.22.5",
+ "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.22.5.tgz",
+ "integrity": "sha512-uLls06UVKgFG9QD4OeFYLEGteMIAa5kpTPcFL28yuCIIzsf6ZyKZMllKVOCZFhiZ5ptnwX4mtKdWCBE/uT4amg==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-simple-access": {
+ "version": "7.22.5",
+ "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.22.5.tgz",
+ "integrity": "sha512-n0H99E/K+Bika3++WNL17POvo4rKWZ7lZEp1Q+fStVbUi8nxPQEBOlTmCOxW/0JsS56SKKQ+ojAe2pHKJHN35w==",
+ "dev": true,
+ "dependencies": {
+ "@babel/types": "^7.22.5"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-split-export-declaration": {
+ "version": "7.22.6",
+ "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.22.6.tgz",
+ "integrity": "sha512-AsUnxuLhRYsisFiaJwvp1QF+I3KjD5FOxut14q/GzovUe6orHLesW2C7d754kRm53h5gqrz6sFl6sxc4BVtE/g==",
+ "dev": true,
+ "dependencies": {
+ "@babel/types": "^7.22.5"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-string-parser": {
+ "version": "7.23.4",
+ "resolved": "https://registry.npmjs.org/@babel/helper-string-parser/-/helper-string-parser-7.23.4.tgz",
+ "integrity": "sha512-803gmbQdqwdf4olxrX4AJyFBV/RTr3rSmOj0rKwesmzlfhYNDEs+/iOcznzpNWlJlIlTJC2QfPFcHB6DlzdVLQ==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-validator-identifier": {
+ "version": "7.22.20",
+ "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.22.20.tgz",
+ "integrity": "sha512-Y4OZ+ytlatR8AI+8KZfKuL5urKp7qey08ha31L8b3BwewJAoJamTzyvxPR/5D+KkdJCGPq/+8TukHBlY10FX9A==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helper-validator-option": {
+ "version": "7.23.5",
+ "resolved": "https://registry.npmjs.org/@babel/helper-validator-option/-/helper-validator-option-7.23.5.tgz",
+ "integrity": "sha512-85ttAOMLsr53VgXkTbkx8oA6YTfT4q7/HzXSLEYmjcSTJPMPQtvq1BD79Byep5xMUYbGRzEpDsjUf3dyp54IKw==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/helpers": {
+ "version": "7.23.6",
+ "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.23.6.tgz",
+ "integrity": "sha512-wCfsbN4nBidDRhpDhvcKlzHWCTlgJYUUdSJfzXb2NuBssDSIjc3xcb+znA7l+zYsFljAcGM0aFkN40cR3lXiGA==",
+ "dev": true,
+ "dependencies": {
+ "@babel/template": "^7.22.15",
+ "@babel/traverse": "^7.23.6",
+ "@babel/types": "^7.23.6"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/highlight": {
+ "version": "7.23.4",
+ "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.23.4.tgz",
+ "integrity": "sha512-acGdbYSfp2WheJoJm/EBBBLh/ID8KDc64ISZ9DYtBmC8/Q204PZJLHyzeB5qMzJ5trcOkybd78M4x2KWsUq++A==",
+ "dev": true,
+ "dependencies": {
+ "@babel/helper-validator-identifier": "^7.22.20",
+ "chalk": "^2.4.2",
+ "js-tokens": "^4.0.0"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/parser": {
+ "version": "7.23.6",
+ "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.23.6.tgz",
+ "integrity": "sha512-Z2uID7YJ7oNvAI20O9X0bblw7Qqs8Q2hFy0R9tAfnfLkp5MW0UH9eUvnDSnFwKZ0AvgS1ucqR4KzvVHgnke1VQ==",
+ "dev": true,
+ "bin": {
+ "parser": "bin/babel-parser.js"
+ },
+ "engines": {
+ "node": ">=6.0.0"
+ }
+ },
+ "node_modules/@babel/plugin-transform-react-jsx-self": {
+ "version": "7.23.3",
+ "resolved": "https://registry.npmjs.org/@babel/plugin-transform-react-jsx-self/-/plugin-transform-react-jsx-self-7.23.3.tgz",
+ "integrity": "sha512-qXRvbeKDSfwnlJnanVRp0SfuWE5DQhwQr5xtLBzp56Wabyo+4CMosF6Kfp+eOD/4FYpql64XVJ2W0pVLlJZxOQ==",
+ "dev": true,
+ "dependencies": {
+ "@babel/helper-plugin-utils": "^7.22.5"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ },
+ "peerDependencies": {
+ "@babel/core": "^7.0.0-0"
+ }
+ },
+ "node_modules/@babel/plugin-transform-react-jsx-source": {
+ "version": "7.23.3",
+ "resolved": "https://registry.npmjs.org/@babel/plugin-transform-react-jsx-source/-/plugin-transform-react-jsx-source-7.23.3.tgz",
+ "integrity": "sha512-91RS0MDnAWDNvGC6Wio5XYkyWI39FMFO+JK9+4AlgaTH+yWwVTsw7/sn6LK0lH7c5F+TFkpv/3LfCJ1Ydwof/g==",
+ "dev": true,
+ "dependencies": {
+ "@babel/helper-plugin-utils": "^7.22.5"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ },
+ "peerDependencies": {
+ "@babel/core": "^7.0.0-0"
+ }
+ },
+ "node_modules/@babel/template": {
+ "version": "7.22.15",
+ "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.22.15.tgz",
+ "integrity": "sha512-QPErUVm4uyJa60rkI73qneDacvdvzxshT3kksGqlGWYdOTIUOwJ7RDUL8sGqslY1uXWSL6xMFKEXDS3ox2uF0w==",
+ "dev": true,
+ "dependencies": {
+ "@babel/code-frame": "^7.22.13",
+ "@babel/parser": "^7.22.15",
+ "@babel/types": "^7.22.15"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/traverse": {
+ "version": "7.23.6",
+ "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.23.6.tgz",
+ "integrity": "sha512-czastdK1e8YByZqezMPFiZ8ahwVMh/ESl9vPgvgdB9AmFMGP5jfpFax74AQgl5zj4XHzqeYAg2l8PuUeRS1MgQ==",
+ "dev": true,
+ "dependencies": {
+ "@babel/code-frame": "^7.23.5",
+ "@babel/generator": "^7.23.6",
+ "@babel/helper-environment-visitor": "^7.22.20",
+ "@babel/helper-function-name": "^7.23.0",
+ "@babel/helper-hoist-variables": "^7.22.5",
+ "@babel/helper-split-export-declaration": "^7.22.6",
+ "@babel/parser": "^7.23.6",
+ "@babel/types": "^7.23.6",
+ "debug": "^4.3.1",
+ "globals": "^11.1.0"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@babel/types": {
+ "version": "7.23.6",
+ "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.23.6.tgz",
+ "integrity": "sha512-+uarb83brBzPKN38NX1MkB6vb6+mwvR6amUulqAE7ccQw1pEl+bCia9TbdG1lsnFP7lZySvUn37CHyXQdfTwzg==",
+ "dev": true,
+ "dependencies": {
+ "@babel/helper-string-parser": "^7.23.4",
+ "@babel/helper-validator-identifier": "^7.22.20",
+ "to-fast-properties": "^2.0.0"
+ },
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/@esbuild/aix-ppc64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.19.10.tgz",
+ "integrity": "sha512-Q+mk96KJ+FZ30h9fsJl+67IjNJm3x2eX+GBWGmocAKgzp27cowCOOqSdscX80s0SpdFXZnIv/+1xD1EctFx96Q==",
+ "cpu": [
+ "ppc64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "aix"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/android-arm": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.19.10.tgz",
+ "integrity": "sha512-7W0bK7qfkw1fc2viBfrtAEkDKHatYfHzr/jKAHNr9BvkYDXPcC6bodtm8AyLJNNuqClLNaeTLuwURt4PRT9d7w==",
+ "cpu": [
+ "arm"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "android"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/android-arm64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.19.10.tgz",
+ "integrity": "sha512-1X4CClKhDgC3by7k8aOWZeBXQX8dHT5QAMCAQDArCLaYfkppoARvh0fit3X2Qs+MXDngKcHv6XXyQCpY0hkK1Q==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "android"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/android-x64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.19.10.tgz",
+ "integrity": "sha512-O/nO/g+/7NlitUxETkUv/IvADKuZXyH4BHf/g/7laqKC4i/7whLpB0gvpPc2zpF0q9Q6FXS3TS75QHac9MvVWw==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "android"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/darwin-arm64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.19.10.tgz",
+ "integrity": "sha512-YSRRs2zOpwypck+6GL3wGXx2gNP7DXzetmo5pHXLrY/VIMsS59yKfjPizQ4lLt5vEI80M41gjm2BxrGZ5U+VMA==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "darwin"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/darwin-x64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.19.10.tgz",
+ "integrity": "sha512-alfGtT+IEICKtNE54hbvPg13xGBe4GkVxyGWtzr+yHO7HIiRJppPDhOKq3zstTcVf8msXb/t4eavW3jCDpMSmA==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "darwin"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/freebsd-arm64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.19.10.tgz",
+ "integrity": "sha512-dMtk1wc7FSH8CCkE854GyGuNKCewlh+7heYP/sclpOG6Cectzk14qdUIY5CrKDbkA/OczXq9WesqnPl09mj5dg==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "freebsd"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/freebsd-x64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.19.10.tgz",
+ "integrity": "sha512-G5UPPspryHu1T3uX8WiOEUa6q6OlQh6gNl4CO4Iw5PS+Kg5bVggVFehzXBJY6X6RSOMS8iXDv2330VzaObm4Ag==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "freebsd"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-arm": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.19.10.tgz",
+ "integrity": "sha512-j6gUW5aAaPgD416Hk9FHxn27On28H4eVI9rJ4az7oCGTFW48+LcgNDBN+9f8rKZz7EEowo889CPKyeaD0iw9Kg==",
+ "cpu": [
+ "arm"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-arm64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.19.10.tgz",
+ "integrity": "sha512-QxaouHWZ+2KWEj7cGJmvTIHVALfhpGxo3WLmlYfJ+dA5fJB6lDEIg+oe/0//FuyVHuS3l79/wyBxbHr0NgtxJQ==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-ia32": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.19.10.tgz",
+ "integrity": "sha512-4ub1YwXxYjj9h1UIZs2hYbnTZBtenPw5NfXCRgEkGb0b6OJ2gpkMvDqRDYIDRjRdWSe/TBiZltm3Y3Q8SN1xNg==",
+ "cpu": [
+ "ia32"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-loong64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.19.10.tgz",
+ "integrity": "sha512-lo3I9k+mbEKoxtoIbM0yC/MZ1i2wM0cIeOejlVdZ3D86LAcFXFRdeuZmh91QJvUTW51bOK5W2BznGNIl4+mDaA==",
+ "cpu": [
+ "loong64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-mips64el": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.19.10.tgz",
+ "integrity": "sha512-J4gH3zhHNbdZN0Bcr1QUGVNkHTdpijgx5VMxeetSk6ntdt+vR1DqGmHxQYHRmNb77tP6GVvD+K0NyO4xjd7y4A==",
+ "cpu": [
+ "mips64el"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-ppc64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.19.10.tgz",
+ "integrity": "sha512-tgT/7u+QhV6ge8wFMzaklOY7KqiyitgT1AUHMApau32ZlvTB/+efeCtMk4eXS+uEymYK249JsoiklZN64xt6oQ==",
+ "cpu": [
+ "ppc64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-riscv64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.19.10.tgz",
+ "integrity": "sha512-0f/spw0PfBMZBNqtKe5FLzBDGo0SKZKvMl5PHYQr3+eiSscfJ96XEknCe+JoOayybWUFQbcJTrk946i3j9uYZA==",
+ "cpu": [
+ "riscv64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-s390x": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.19.10.tgz",
+ "integrity": "sha512-pZFe0OeskMHzHa9U38g+z8Yx5FNCLFtUnJtQMpwhS+r4S566aK2ci3t4NCP4tjt6d5j5uo4h7tExZMjeKoehAA==",
+ "cpu": [
+ "s390x"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-x64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.19.10.tgz",
+ "integrity": "sha512-SpYNEqg/6pZYoc+1zLCjVOYvxfZVZj6w0KROZ3Fje/QrM3nfvT2llI+wmKSrWuX6wmZeTapbarvuNNK/qepSgA==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/netbsd-x64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.19.10.tgz",
+ "integrity": "sha512-ACbZ0vXy9zksNArWlk2c38NdKg25+L9pr/mVaj9SUq6lHZu/35nx2xnQVRGLrC1KKQqJKRIB0q8GspiHI3J80Q==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "netbsd"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/openbsd-x64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.19.10.tgz",
+ "integrity": "sha512-PxcgvjdSjtgPMiPQrM3pwSaG4kGphP+bLSb+cihuP0LYdZv1epbAIecHVl5sD3npkfYBZ0ZnOjR878I7MdJDFg==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "openbsd"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/sunos-x64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.19.10.tgz",
+ "integrity": "sha512-ZkIOtrRL8SEJjr+VHjmW0znkPs+oJXhlJbNwfI37rvgeMtk3sxOQevXPXjmAPZPigVTncvFqLMd+uV0IBSEzqA==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "sunos"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/win32-arm64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.19.10.tgz",
+ "integrity": "sha512-+Sa4oTDbpBfGpl3Hn3XiUe4f8TU2JF7aX8cOfqFYMMjXp6ma6NJDztl5FDG8Ezx0OjwGikIHw+iA54YLDNNVfw==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/win32-ia32": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.19.10.tgz",
+ "integrity": "sha512-EOGVLK1oWMBXgfttJdPHDTiivYSjX6jDNaATeNOaCOFEVcfMjtbx7WVQwPSE1eIfCp/CaSF2nSrDtzc4I9f8TQ==",
+ "cpu": [
+ "ia32"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/win32-x64": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.19.10.tgz",
+ "integrity": "sha512-whqLG6Sc70AbU73fFYvuYzaE4MNMBIlR1Y/IrUeOXFrWHxBEjjbZaQ3IXIQS8wJdAzue2GwYZCjOrgrU1oUHoA==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@eslint-community/eslint-utils": {
+ "version": "4.4.0",
+ "resolved": "https://registry.npmjs.org/@eslint-community/eslint-utils/-/eslint-utils-4.4.0.tgz",
+ "integrity": "sha512-1/sA4dwrzBAyeUoQ6oxahHKmrZvsnLCg4RfxW3ZFGGmQkSNQPFNLV9CUEFQP1x9EYXHTo5p6xdhZM1Ne9p/AfA==",
+ "dev": true,
+ "dependencies": {
+ "eslint-visitor-keys": "^3.3.0"
+ },
+ "engines": {
+ "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+ },
+ "peerDependencies": {
+ "eslint": "^6.0.0 || ^7.0.0 || >=8.0.0"
+ }
+ },
+ "node_modules/@eslint-community/regexpp": {
+ "version": "4.10.0",
+ "resolved": "https://registry.npmjs.org/@eslint-community/regexpp/-/regexpp-4.10.0.tgz",
+ "integrity": "sha512-Cu96Sd2By9mCNTx2iyKOmq10v22jUVQv0lQnlGNy16oE9589yE+QADPbrMGCkA51cKZSg3Pu/aTJVTGfL/qjUA==",
+ "dev": true,
+ "engines": {
+ "node": "^12.0.0 || ^14.0.0 || >=16.0.0"
+ }
+ },
+ "node_modules/@eslint/eslintrc": {
+ "version": "2.1.4",
+ "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-2.1.4.tgz",
+ "integrity": "sha512-269Z39MS6wVJtsoUl10L60WdkhJVdPG24Q4eZTH3nnF6lpvSShEK3wQjDX9JRWAUPvPh7COouPpU9IrqaZFvtQ==",
+ "dev": true,
+ "dependencies": {
+ "ajv": "^6.12.4",
+ "debug": "^4.3.2",
+ "espree": "^9.6.0",
+ "globals": "^13.19.0",
+ "ignore": "^5.2.0",
+ "import-fresh": "^3.2.1",
+ "js-yaml": "^4.1.0",
+ "minimatch": "^3.1.2",
+ "strip-json-comments": "^3.1.1"
+ },
+ "engines": {
+ "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+ },
+ "funding": {
+ "url": "https://opencollective.com/eslint"
+ }
+ },
+ "node_modules/@eslint/eslintrc/node_modules/globals": {
+ "version": "13.24.0",
+ "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz",
+ "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==",
+ "dev": true,
+ "dependencies": {
+ "type-fest": "^0.20.2"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/@eslint/js": {
+ "version": "8.56.0",
+ "resolved": "https://registry.npmjs.org/@eslint/js/-/js-8.56.0.tgz",
+ "integrity": "sha512-gMsVel9D7f2HLkBma9VbtzZRehRogVRfbr++f06nL2vnCGCNlzOD+/MUov/F4p8myyAHspEhVobgjpX64q5m6A==",
+ "dev": true,
+ "engines": {
+ "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+ }
+ },
+ "node_modules/@humanwhocodes/config-array": {
+ "version": "0.11.13",
+ "resolved": "https://registry.npmjs.org/@humanwhocodes/config-array/-/config-array-0.11.13.tgz",
+ "integrity": "sha512-JSBDMiDKSzQVngfRjOdFXgFfklaXI4K9nLF49Auh21lmBWRLIK3+xTErTWD4KU54pb6coM6ESE7Awz/FNU3zgQ==",
+ "dev": true,
+ "dependencies": {
+ "@humanwhocodes/object-schema": "^2.0.1",
+ "debug": "^4.1.1",
+ "minimatch": "^3.0.5"
+ },
+ "engines": {
+ "node": ">=10.10.0"
+ }
+ },
+ "node_modules/@humanwhocodes/module-importer": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz",
+ "integrity": "sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==",
+ "dev": true,
+ "engines": {
+ "node": ">=12.22"
+ },
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/nzakas"
+ }
+ },
+ "node_modules/@humanwhocodes/object-schema": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/@humanwhocodes/object-schema/-/object-schema-2.0.1.tgz",
+ "integrity": "sha512-dvuCeX5fC9dXgJn9t+X5atfmgQAzUOWqS1254Gh0m6i8wKd10ebXkfNKiRK+1GWi/yTvvLDHpoxLr0xxxeslWw==",
+ "dev": true
+ },
+ "node_modules/@jridgewell/gen-mapping": {
+ "version": "0.3.3",
+ "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.3.tgz",
+ "integrity": "sha512-HLhSWOLRi875zjjMG/r+Nv0oCW8umGb0BgEhyX3dDX3egwZtB8PqLnjz3yedt8R5StBrzcg4aBpnh8UA9D1BoQ==",
+ "dev": true,
+ "dependencies": {
+ "@jridgewell/set-array": "^1.0.1",
+ "@jridgewell/sourcemap-codec": "^1.4.10",
+ "@jridgewell/trace-mapping": "^0.3.9"
+ },
+ "engines": {
+ "node": ">=6.0.0"
+ }
+ },
+ "node_modules/@jridgewell/resolve-uri": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.1.tgz",
+ "integrity": "sha512-dSYZh7HhCDtCKm4QakX0xFpsRDqjjtZf/kjI/v3T3Nwt5r8/qz/M19F9ySyOqU94SXBmeG9ttTul+YnR4LOxFA==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.0.0"
+ }
+ },
+ "node_modules/@jridgewell/set-array": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/@jridgewell/set-array/-/set-array-1.1.2.tgz",
+ "integrity": "sha512-xnkseuNADM0gt2bs+BvhO0p78Mk762YnZdsuzFV018NoG1Sj1SCQvpSqa7XUaTam5vAGasABV9qXASMKnFMwMw==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.0.0"
+ }
+ },
+ "node_modules/@jridgewell/sourcemap-codec": {
+ "version": "1.4.15",
+ "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz",
+ "integrity": "sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==",
+ "dev": true
+ },
+ "node_modules/@jridgewell/trace-mapping": {
+ "version": "0.3.20",
+ "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.20.tgz",
+ "integrity": "sha512-R8LcPeWZol2zR8mmH3JeKQ6QRCFb7XgUhV9ZlGhHLGyg4wpPiPZNQOOWhFZhxKw8u//yTbNGI42Bx/3paXEQ+Q==",
+ "dev": true,
+ "dependencies": {
+ "@jridgewell/resolve-uri": "^3.1.0",
+ "@jridgewell/sourcemap-codec": "^1.4.14"
+ }
+ },
+ "node_modules/@nodelib/fs.scandir": {
+ "version": "2.1.5",
+ "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz",
+ "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==",
+ "dev": true,
+ "dependencies": {
+ "@nodelib/fs.stat": "2.0.5",
+ "run-parallel": "^1.1.9"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/@nodelib/fs.stat": {
+ "version": "2.0.5",
+ "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz",
+ "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==",
+ "dev": true,
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/@nodelib/fs.walk": {
+ "version": "1.2.8",
+ "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz",
+ "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==",
+ "dev": true,
+ "dependencies": {
+ "@nodelib/fs.scandir": "2.1.5",
+ "fastq": "^1.6.0"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/@popperjs/core": {
+ "version": "2.11.8",
+ "resolved": "https://registry.npmjs.org/@popperjs/core/-/core-2.11.8.tgz",
+ "integrity": "sha512-P1st0aksCrn9sGZhp8GMYwBnQsbvAWsZAX44oXNNvLHGqAOcoVxmjZiohstwQ7SqKnbR47akdNi+uleWD8+g6A==",
+ "peer": true,
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/popperjs"
+ }
+ },
+ "node_modules/@remix-run/router": {
+ "version": "1.14.1",
+ "resolved": "https://registry.npmjs.org/@remix-run/router/-/router-1.14.1.tgz",
+ "integrity": "sha512-Qg4DMQsfPNAs88rb2xkdk03N3bjK4jgX5fR24eHCTR9q6PrhZQZ4UJBPzCHJkIpTRN1UKxx2DzjZmnC+7Lj0Ow==",
+ "engines": {
+ "node": ">=14.0.0"
+ }
+ },
+ "node_modules/@rollup/rollup-android-arm-eabi": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.9.1.tgz",
+ "integrity": "sha512-6vMdBZqtq1dVQ4CWdhFwhKZL6E4L1dV6jUjuBvsavvNJSppzi6dLBbuV+3+IyUREaj9ZFvQefnQm28v4OCXlig==",
+ "cpu": [
+ "arm"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "android"
+ ]
+ },
+ "node_modules/@rollup/rollup-android-arm64": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.9.1.tgz",
+ "integrity": "sha512-Jto9Fl3YQ9OLsTDWtLFPtaIMSL2kwGyGoVCmPC8Gxvym9TCZm4Sie+cVeblPO66YZsYH8MhBKDMGZ2NDxuk/XQ==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "android"
+ ]
+ },
+ "node_modules/@rollup/rollup-darwin-arm64": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.9.1.tgz",
+ "integrity": "sha512-LtYcLNM+bhsaKAIGwVkh5IOWhaZhjTfNOkGzGqdHvhiCUVuJDalvDxEdSnhFzAn+g23wgsycmZk1vbnaibZwwA==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "darwin"
+ ]
+ },
+ "node_modules/@rollup/rollup-darwin-x64": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.9.1.tgz",
+ "integrity": "sha512-KyP/byeXu9V+etKO6Lw3E4tW4QdcnzDG/ake031mg42lob5tN+5qfr+lkcT/SGZaH2PdW4Z1NX9GHEkZ8xV7og==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "darwin"
+ ]
+ },
+ "node_modules/@rollup/rollup-linux-arm-gnueabihf": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.9.1.tgz",
+ "integrity": "sha512-Yqz/Doumf3QTKplwGNrCHe/B2p9xqDghBZSlAY0/hU6ikuDVQuOUIpDP/YcmoT+447tsZTmirmjgG3znvSCR0Q==",
+ "cpu": [
+ "arm"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ]
+ },
+ "node_modules/@rollup/rollup-linux-arm64-gnu": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.9.1.tgz",
+ "integrity": "sha512-u3XkZVvxcvlAOlQJ3UsD1rFvLWqu4Ef/Ggl40WAVCuogf4S1nJPHh5RTgqYFpCOvuGJ7H5yGHabjFKEZGExk5Q==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ]
+ },
+ "node_modules/@rollup/rollup-linux-arm64-musl": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.9.1.tgz",
+ "integrity": "sha512-0XSYN/rfWShW+i+qjZ0phc6vZ7UWI8XWNz4E/l+6edFt+FxoEghrJHjX1EY/kcUGCnZzYYRCl31SNdfOi450Aw==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ]
+ },
+ "node_modules/@rollup/rollup-linux-riscv64-gnu": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.9.1.tgz",
+ "integrity": "sha512-LmYIO65oZVfFt9t6cpYkbC4d5lKHLYv5B4CSHRpnANq0VZUQXGcCPXHzbCXCz4RQnx7jvlYB1ISVNCE/omz5cw==",
+ "cpu": [
+ "riscv64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ]
+ },
+ "node_modules/@rollup/rollup-linux-x64-gnu": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.9.1.tgz",
+ "integrity": "sha512-kr8rEPQ6ns/Lmr/hiw8sEVj9aa07gh1/tQF2Y5HrNCCEPiCBGnBUt9tVusrcBBiJfIt1yNaXN6r1CCmpbFEDpg==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ]
+ },
+ "node_modules/@rollup/rollup-linux-x64-musl": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.9.1.tgz",
+ "integrity": "sha512-t4QSR7gN+OEZLG0MiCgPqMWZGwmeHhsM4AkegJ0Kiy6TnJ9vZ8dEIwHw1LcZKhbHxTY32hp9eVCMdR3/I8MGRw==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ]
+ },
+ "node_modules/@rollup/rollup-win32-arm64-msvc": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.9.1.tgz",
+ "integrity": "sha512-7XI4ZCBN34cb+BH557FJPmh0kmNz2c25SCQeT9OiFWEgf8+dL6ZwJ8f9RnUIit+j01u07Yvrsuu1rZGxJCc51g==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ]
+ },
+ "node_modules/@rollup/rollup-win32-ia32-msvc": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.9.1.tgz",
+ "integrity": "sha512-yE5c2j1lSWOH5jp+Q0qNL3Mdhr8WuqCNVjc6BxbVfS5cAS6zRmdiw7ktb8GNpDCEUJphILY6KACoFoRtKoqNQg==",
+ "cpu": [
+ "ia32"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ]
+ },
+ "node_modules/@rollup/rollup-win32-x64-msvc": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.9.1.tgz",
+ "integrity": "sha512-PyJsSsafjmIhVgaI1Zdj7m8BB8mMckFah/xbpplObyHfiXzKcI5UOUXRyOdHW7nz4DpMCuzLnF7v5IWHenCwYA==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ]
+ },
+ "node_modules/@types/babel__core": {
+ "version": "7.20.5",
+ "resolved": "https://registry.npmjs.org/@types/babel__core/-/babel__core-7.20.5.tgz",
+ "integrity": "sha512-qoQprZvz5wQFJwMDqeseRXWv3rqMvhgpbXFfVyWhbx9X47POIA6i/+dXefEmZKoAgOaTdaIgNSMqMIU61yRyzA==",
+ "dev": true,
+ "dependencies": {
+ "@babel/parser": "^7.20.7",
+ "@babel/types": "^7.20.7",
+ "@types/babel__generator": "*",
+ "@types/babel__template": "*",
+ "@types/babel__traverse": "*"
+ }
+ },
+ "node_modules/@types/babel__generator": {
+ "version": "7.6.8",
+ "resolved": "https://registry.npmjs.org/@types/babel__generator/-/babel__generator-7.6.8.tgz",
+ "integrity": "sha512-ASsj+tpEDsEiFr1arWrlN6V3mdfjRMZt6LtK/Vp/kreFLnr5QH5+DhvD5nINYZXzwJvXeGq+05iUXcAzVrqWtw==",
+ "dev": true,
+ "dependencies": {
+ "@babel/types": "^7.0.0"
+ }
+ },
+ "node_modules/@types/babel__template": {
+ "version": "7.4.4",
+ "resolved": "https://registry.npmjs.org/@types/babel__template/-/babel__template-7.4.4.tgz",
+ "integrity": "sha512-h/NUaSyG5EyxBIp8YRxo4RMe2/qQgvyowRwVMzhYhBCONbW8PUsg4lkFMrhgZhUe5z3L3MiLDuvyJ/CaPa2A8A==",
+ "dev": true,
+ "dependencies": {
+ "@babel/parser": "^7.1.0",
+ "@babel/types": "^7.0.0"
+ }
+ },
+ "node_modules/@types/babel__traverse": {
+ "version": "7.20.4",
+ "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.20.4.tgz",
+ "integrity": "sha512-mSM/iKUk5fDDrEV/e83qY+Cr3I1+Q3qqTuEn++HAWYjEa1+NxZr6CNrcJGf2ZTnq4HoFGC3zaTPZTobCzCFukA==",
+ "dev": true,
+ "dependencies": {
+ "@babel/types": "^7.20.7"
+ }
+ },
+ "node_modules/@types/prop-types": {
+ "version": "15.7.11",
+ "resolved": "https://registry.npmjs.org/@types/prop-types/-/prop-types-15.7.11.tgz",
+ "integrity": "sha512-ga8y9v9uyeiLdpKddhxYQkxNDrfvuPrlFb0N1qnZZByvcElJaXthF1UhvCh9TLWJBEHeNtdnbysW7Y6Uq8CVng==",
+ "dev": true
+ },
+ "node_modules/@types/react": {
+ "version": "18.2.45",
+ "resolved": "https://registry.npmjs.org/@types/react/-/react-18.2.45.tgz",
+ "integrity": "sha512-TtAxCNrlrBp8GoeEp1npd5g+d/OejJHFxS3OWmrPBMFaVQMSN0OFySozJio5BHxTuTeug00AVXVAjfDSfk+lUg==",
+ "dev": true,
+ "dependencies": {
+ "@types/prop-types": "*",
+ "@types/scheduler": "*",
+ "csstype": "^3.0.2"
+ }
+ },
+ "node_modules/@types/react-dom": {
+ "version": "18.2.18",
+ "resolved": "https://registry.npmjs.org/@types/react-dom/-/react-dom-18.2.18.tgz",
+ "integrity": "sha512-TJxDm6OfAX2KJWJdMEVTwWke5Sc/E/RlnPGvGfS0W7+6ocy2xhDVQVh/KvC2Uf7kACs+gDytdusDSdWfWkaNzw==",
+ "dev": true,
+ "dependencies": {
+ "@types/react": "*"
+ }
+ },
+ "node_modules/@types/scheduler": {
+ "version": "0.16.8",
+ "resolved": "https://registry.npmjs.org/@types/scheduler/-/scheduler-0.16.8.tgz",
+ "integrity": "sha512-WZLiwShhwLRmeV6zH+GkbOFT6Z6VklCItrDioxUnv+u4Ll+8vKeFySoFyK/0ctcRpOmwAicELfmys1sDc/Rw+A==",
+ "dev": true
+ },
+ "node_modules/@ungap/structured-clone": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/@ungap/structured-clone/-/structured-clone-1.2.0.tgz",
+ "integrity": "sha512-zuVdFrMJiuCDQUMCzQaD6KL28MjnqqN8XnAqiEq9PNm/hCPTSGfrXCOfwj1ow4LFb/tNymJPwsNbVePc1xFqrQ==",
+ "dev": true
+ },
+ "node_modules/@vitejs/plugin-react": {
+ "version": "4.2.1",
+ "resolved": "https://registry.npmjs.org/@vitejs/plugin-react/-/plugin-react-4.2.1.tgz",
+ "integrity": "sha512-oojO9IDc4nCUUi8qIR11KoQm0XFFLIwsRBwHRR4d/88IWghn1y6ckz/bJ8GHDCsYEJee8mDzqtJxh15/cisJNQ==",
+ "dev": true,
+ "dependencies": {
+ "@babel/core": "^7.23.5",
+ "@babel/plugin-transform-react-jsx-self": "^7.23.3",
+ "@babel/plugin-transform-react-jsx-source": "^7.23.3",
+ "@types/babel__core": "^7.20.5",
+ "react-refresh": "^0.14.0"
+ },
+ "engines": {
+ "node": "^14.18.0 || >=16.0.0"
+ },
+ "peerDependencies": {
+ "vite": "^4.2.0 || ^5.0.0"
+ }
+ },
+ "node_modules/acorn": {
+ "version": "8.11.2",
+ "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.11.2.tgz",
+ "integrity": "sha512-nc0Axzp/0FILLEVsm4fNwLCwMttvhEI263QtVPQcbpfZZ3ts0hLsZGOpE6czNlid7CJ9MlyH8reXkpsf3YUY4w==",
+ "dev": true,
+ "bin": {
+ "acorn": "bin/acorn"
+ },
+ "engines": {
+ "node": ">=0.4.0"
+ }
+ },
+ "node_modules/acorn-jsx": {
+ "version": "5.3.2",
+ "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.3.2.tgz",
+ "integrity": "sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==",
+ "dev": true,
+ "peerDependencies": {
+ "acorn": "^6.0.0 || ^7.0.0 || ^8.0.0"
+ }
+ },
+ "node_modules/ajv": {
+ "version": "6.12.6",
+ "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz",
+ "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==",
+ "dev": true,
+ "dependencies": {
+ "fast-deep-equal": "^3.1.1",
+ "fast-json-stable-stringify": "^2.0.0",
+ "json-schema-traverse": "^0.4.1",
+ "uri-js": "^4.2.2"
+ },
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/epoberezkin"
+ }
+ },
+ "node_modules/ansi-regex": {
+ "version": "5.0.1",
+ "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz",
+ "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==",
+ "dev": true,
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/ansi-styles": {
+ "version": "3.2.1",
+ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
+ "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
+ "dev": true,
+ "dependencies": {
+ "color-convert": "^1.9.0"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/argparse": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz",
+ "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==",
+ "dev": true
+ },
+ "node_modules/array-buffer-byte-length": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/array-buffer-byte-length/-/array-buffer-byte-length-1.0.0.tgz",
+ "integrity": "sha512-LPuwb2P+NrQw3XhxGc36+XSvuBPopovXYTR9Ew++Du9Yb/bx5AzBfrIsBoj0EZUifjQU+sHL21sseZ3jerWO/A==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "is-array-buffer": "^3.0.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/array-includes": {
+ "version": "3.1.7",
+ "resolved": "https://registry.npmjs.org/array-includes/-/array-includes-3.1.7.tgz",
+ "integrity": "sha512-dlcsNBIiWhPkHdOEEKnehA+RNUWDc4UqFtnIXU4uuYDPtA4LDkr7qip2p0VvFAEXNDr0yWZ9PJyIRiGjRLQzwQ==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1",
+ "get-intrinsic": "^1.2.1",
+ "is-string": "^1.0.7"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/array.prototype.flat": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/array.prototype.flat/-/array.prototype.flat-1.3.2.tgz",
+ "integrity": "sha512-djYB+Zx2vLewY8RWlNCUdHjDXs2XOgm602S9E7P/UpHgfeHL00cRiIF+IN/G/aUJ7kGPb6yO/ErDI5V2s8iycA==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1",
+ "es-shim-unscopables": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/array.prototype.flatmap": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/array.prototype.flatmap/-/array.prototype.flatmap-1.3.2.tgz",
+ "integrity": "sha512-Ewyx0c9PmpcsByhSW4r+9zDU7sGjFc86qf/kKtuSCRdhfbk0SNLLkaT5qvcHnRGgc5NP/ly/y+qkXkqONX54CQ==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1",
+ "es-shim-unscopables": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/array.prototype.tosorted": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/array.prototype.tosorted/-/array.prototype.tosorted-1.1.2.tgz",
+ "integrity": "sha512-HuQCHOlk1Weat5jzStICBCd83NxiIMwqDg/dHEsoefabn/hJRj5pVdWcPUSpRrwhwxZOsQassMpgN/xRYFBMIg==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1",
+ "es-shim-unscopables": "^1.0.0",
+ "get-intrinsic": "^1.2.1"
+ }
+ },
+ "node_modules/arraybuffer.prototype.slice": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/arraybuffer.prototype.slice/-/arraybuffer.prototype.slice-1.0.2.tgz",
+ "integrity": "sha512-yMBKppFur/fbHu9/6USUe03bZ4knMYiwFBcyiaXB8Go0qNehwX6inYPzK9U0NeQvGxKthcmHcaR8P5MStSRBAw==",
+ "dev": true,
+ "dependencies": {
+ "array-buffer-byte-length": "^1.0.0",
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1",
+ "get-intrinsic": "^1.2.1",
+ "is-array-buffer": "^3.0.2",
+ "is-shared-array-buffer": "^1.0.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/asynciterator.prototype": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/asynciterator.prototype/-/asynciterator.prototype-1.0.0.tgz",
+ "integrity": "sha512-wwHYEIS0Q80f5mosx3L/dfG5t5rjEa9Ft51GTaNt862EnpyGHpgz2RkZvLPp1oF5TnAiTohkEKVEu8pQPJI7Vg==",
+ "dev": true,
+ "dependencies": {
+ "has-symbols": "^1.0.3"
+ }
+ },
+ "node_modules/asynckit": {
+ "version": "0.4.0",
+ "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz",
+ "integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q=="
+ },
+ "node_modules/available-typed-arrays": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/available-typed-arrays/-/available-typed-arrays-1.0.5.tgz",
+ "integrity": "sha512-DMD0KiN46eipeziST1LPP/STfDU0sufISXmjSgvVsoU2tqxctQeASejWcfNtxYKqETM1UxQ8sp2OrSBWpHY6sw==",
+ "dev": true,
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/axios": {
+ "version": "1.6.2",
+ "resolved": "https://registry.npmjs.org/axios/-/axios-1.6.2.tgz",
+ "integrity": "sha512-7i24Ri4pmDRfJTR7LDBhsOTtcm+9kjX5WiY1X3wIisx6G9So3pfMkEiU7emUBe46oceVImccTEM3k6C5dbVW8A==",
+ "dependencies": {
+ "follow-redirects": "^1.15.0",
+ "form-data": "^4.0.0",
+ "proxy-from-env": "^1.1.0"
+ }
+ },
+ "node_modules/balanced-match": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz",
+ "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==",
+ "dev": true
+ },
+ "node_modules/bootstrap": {
+ "version": "5.3.0",
+ "resolved": "https://registry.npmjs.org/bootstrap/-/bootstrap-5.3.0.tgz",
+ "integrity": "sha512-UnBV3E3v4STVNQdms6jSGO2CvOkjUMdDAVR2V5N4uCMdaIkaQjbcEAMqRimDHIs4uqBYzDAKCQwCB+97tJgHQw==",
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/twbs"
+ },
+ {
+ "type": "opencollective",
+ "url": "https://opencollective.com/bootstrap"
+ }
+ ],
+ "peerDependencies": {
+ "@popperjs/core": "^2.11.7"
+ }
+ },
+ "node_modules/brace-expansion": {
+ "version": "1.1.11",
+ "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
+ "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
+ "dev": true,
+ "dependencies": {
+ "balanced-match": "^1.0.0",
+ "concat-map": "0.0.1"
+ }
+ },
+ "node_modules/browserslist": {
+ "version": "4.22.2",
+ "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.22.2.tgz",
+ "integrity": "sha512-0UgcrvQmBDvZHFGdYUehrCNIazki7/lUP3kkoi/r3YB2amZbFM9J43ZRkJTXBUZK4gmx56+Sqk9+Vs9mwZx9+A==",
+ "dev": true,
+ "funding": [
+ {
+ "type": "opencollective",
+ "url": "https://opencollective.com/browserslist"
+ },
+ {
+ "type": "tidelift",
+ "url": "https://tidelift.com/funding/github/npm/browserslist"
+ },
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/ai"
+ }
+ ],
+ "dependencies": {
+ "caniuse-lite": "^1.0.30001565",
+ "electron-to-chromium": "^1.4.601",
+ "node-releases": "^2.0.14",
+ "update-browserslist-db": "^1.0.13"
+ },
+ "bin": {
+ "browserslist": "cli.js"
+ },
+ "engines": {
+ "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7"
+ }
+ },
+ "node_modules/call-bind": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.5.tgz",
+ "integrity": "sha512-C3nQxfFZxFRVoJoGKKI8y3MOEo129NQ+FgQ08iye+Mk4zNZZGdjfs06bVTr+DBSlA66Q2VEcMki/cUCP4SercQ==",
+ "dev": true,
+ "dependencies": {
+ "function-bind": "^1.1.2",
+ "get-intrinsic": "^1.2.1",
+ "set-function-length": "^1.1.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/callsites": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz",
+ "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==",
+ "dev": true,
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/caniuse-lite": {
+ "version": "1.0.30001571",
+ "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001571.tgz",
+ "integrity": "sha512-tYq/6MoXhdezDLFZuCO/TKboTzuQ/xR5cFdgXPfDtM7/kchBO3b4VWghE/OAi/DV7tTdhmLjZiZBZi1fA/GheQ==",
+ "dev": true,
+ "funding": [
+ {
+ "type": "opencollective",
+ "url": "https://opencollective.com/browserslist"
+ },
+ {
+ "type": "tidelift",
+ "url": "https://tidelift.com/funding/github/npm/caniuse-lite"
+ },
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/ai"
+ }
+ ]
+ },
+ "node_modules/chalk": {
+ "version": "2.4.2",
+ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz",
+ "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==",
+ "dev": true,
+ "dependencies": {
+ "ansi-styles": "^3.2.1",
+ "escape-string-regexp": "^1.0.5",
+ "supports-color": "^5.3.0"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/color-convert": {
+ "version": "1.9.3",
+ "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz",
+ "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==",
+ "dev": true,
+ "dependencies": {
+ "color-name": "1.1.3"
+ }
+ },
+ "node_modules/color-name": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz",
+ "integrity": "sha512-72fSenhMw2HZMTVHeCA9KCmpEIbzWiQsjN+BHcBbS9vr1mtt+vJjPdksIBNUmKAW8TFUDPJK5SUU3QhE9NEXDw==",
+ "dev": true
+ },
+ "node_modules/combined-stream": {
+ "version": "1.0.8",
+ "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz",
+ "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==",
+ "dependencies": {
+ "delayed-stream": "~1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/concat-map": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
+ "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==",
+ "dev": true
+ },
+ "node_modules/convert-source-map": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-2.0.0.tgz",
+ "integrity": "sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg==",
+ "dev": true
+ },
+ "node_modules/cross-spawn": {
+ "version": "7.0.3",
+ "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.3.tgz",
+ "integrity": "sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==",
+ "dev": true,
+ "dependencies": {
+ "path-key": "^3.1.0",
+ "shebang-command": "^2.0.0",
+ "which": "^2.0.1"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/csstype": {
+ "version": "3.1.3",
+ "resolved": "https://registry.npmjs.org/csstype/-/csstype-3.1.3.tgz",
+ "integrity": "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw==",
+ "dev": true
+ },
+ "node_modules/debug": {
+ "version": "4.3.4",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz",
+ "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==",
+ "dev": true,
+ "dependencies": {
+ "ms": "2.1.2"
+ },
+ "engines": {
+ "node": ">=6.0"
+ },
+ "peerDependenciesMeta": {
+ "supports-color": {
+ "optional": true
+ }
+ }
+ },
+ "node_modules/deep-is": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.4.tgz",
+ "integrity": "sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==",
+ "dev": true
+ },
+ "node_modules/define-data-property": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.1.tgz",
+ "integrity": "sha512-E7uGkTzkk1d0ByLeSc6ZsFS79Axg+m1P/VsgYsxHgiuc3tFSj+MjMIwe90FC4lOAZzNBdY7kkO2P2wKdsQ1vgQ==",
+ "dev": true,
+ "dependencies": {
+ "get-intrinsic": "^1.2.1",
+ "gopd": "^1.0.1",
+ "has-property-descriptors": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/define-properties": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.2.1.tgz",
+ "integrity": "sha512-8QmQKqEASLd5nx0U1B1okLElbUuuttJ/AnYmRXbbbGDWh6uS208EjD4Xqq/I9wK7u0v6O08XhTWnt5XtEbR6Dg==",
+ "dev": true,
+ "dependencies": {
+ "define-data-property": "^1.0.1",
+ "has-property-descriptors": "^1.0.0",
+ "object-keys": "^1.1.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/delayed-stream": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz",
+ "integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==",
+ "engines": {
+ "node": ">=0.4.0"
+ }
+ },
+ "node_modules/doctrine": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-3.0.0.tgz",
+ "integrity": "sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==",
+ "dev": true,
+ "dependencies": {
+ "esutils": "^2.0.2"
+ },
+ "engines": {
+ "node": ">=6.0.0"
+ }
+ },
+ "node_modules/electron-to-chromium": {
+ "version": "1.4.616",
+ "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.4.616.tgz",
+ "integrity": "sha512-1n7zWYh8eS0L9Uy+GskE0lkBUNK83cXTVJI0pU3mGprFsbfSdAc15VTFbo+A+Bq4pwstmL30AVcEU3Fo463lNg==",
+ "dev": true
+ },
+ "node_modules/es-abstract": {
+ "version": "1.22.3",
+ "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.22.3.tgz",
+ "integrity": "sha512-eiiY8HQeYfYH2Con2berK+To6GrK2RxbPawDkGq4UiCQQfZHb6wX9qQqkbpPqaxQFcl8d9QzZqo0tGE0VcrdwA==",
+ "dev": true,
+ "dependencies": {
+ "array-buffer-byte-length": "^1.0.0",
+ "arraybuffer.prototype.slice": "^1.0.2",
+ "available-typed-arrays": "^1.0.5",
+ "call-bind": "^1.0.5",
+ "es-set-tostringtag": "^2.0.1",
+ "es-to-primitive": "^1.2.1",
+ "function.prototype.name": "^1.1.6",
+ "get-intrinsic": "^1.2.2",
+ "get-symbol-description": "^1.0.0",
+ "globalthis": "^1.0.3",
+ "gopd": "^1.0.1",
+ "has-property-descriptors": "^1.0.0",
+ "has-proto": "^1.0.1",
+ "has-symbols": "^1.0.3",
+ "hasown": "^2.0.0",
+ "internal-slot": "^1.0.5",
+ "is-array-buffer": "^3.0.2",
+ "is-callable": "^1.2.7",
+ "is-negative-zero": "^2.0.2",
+ "is-regex": "^1.1.4",
+ "is-shared-array-buffer": "^1.0.2",
+ "is-string": "^1.0.7",
+ "is-typed-array": "^1.1.12",
+ "is-weakref": "^1.0.2",
+ "object-inspect": "^1.13.1",
+ "object-keys": "^1.1.1",
+ "object.assign": "^4.1.4",
+ "regexp.prototype.flags": "^1.5.1",
+ "safe-array-concat": "^1.0.1",
+ "safe-regex-test": "^1.0.0",
+ "string.prototype.trim": "^1.2.8",
+ "string.prototype.trimend": "^1.0.7",
+ "string.prototype.trimstart": "^1.0.7",
+ "typed-array-buffer": "^1.0.0",
+ "typed-array-byte-length": "^1.0.0",
+ "typed-array-byte-offset": "^1.0.0",
+ "typed-array-length": "^1.0.4",
+ "unbox-primitive": "^1.0.2",
+ "which-typed-array": "^1.1.13"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/es-iterator-helpers": {
+ "version": "1.0.15",
+ "resolved": "https://registry.npmjs.org/es-iterator-helpers/-/es-iterator-helpers-1.0.15.tgz",
+ "integrity": "sha512-GhoY8uYqd6iwUl2kgjTm4CZAf6oo5mHK7BPqx3rKgx893YSsy0LGHV6gfqqQvZt/8xM8xeOnfXBCfqclMKkJ5g==",
+ "dev": true,
+ "dependencies": {
+ "asynciterator.prototype": "^1.0.0",
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.1",
+ "es-abstract": "^1.22.1",
+ "es-set-tostringtag": "^2.0.1",
+ "function-bind": "^1.1.1",
+ "get-intrinsic": "^1.2.1",
+ "globalthis": "^1.0.3",
+ "has-property-descriptors": "^1.0.0",
+ "has-proto": "^1.0.1",
+ "has-symbols": "^1.0.3",
+ "internal-slot": "^1.0.5",
+ "iterator.prototype": "^1.1.2",
+ "safe-array-concat": "^1.0.1"
+ }
+ },
+ "node_modules/es-set-tostringtag": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/es-set-tostringtag/-/es-set-tostringtag-2.0.2.tgz",
+ "integrity": "sha512-BuDyupZt65P9D2D2vA/zqcI3G5xRsklm5N3xCwuiy+/vKy8i0ifdsQP1sLgO4tZDSCaQUSnmC48khknGMV3D2Q==",
+ "dev": true,
+ "dependencies": {
+ "get-intrinsic": "^1.2.2",
+ "has-tostringtag": "^1.0.0",
+ "hasown": "^2.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/es-shim-unscopables": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/es-shim-unscopables/-/es-shim-unscopables-1.0.2.tgz",
+ "integrity": "sha512-J3yBRXCzDu4ULnQwxyToo/OjdMx6akgVC7K6few0a7F/0wLtmKKN7I73AH5T2836UuXRqN7Qg+IIUw/+YJksRw==",
+ "dev": true,
+ "dependencies": {
+ "hasown": "^2.0.0"
+ }
+ },
+ "node_modules/es-to-primitive": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz",
+ "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==",
+ "dev": true,
+ "dependencies": {
+ "is-callable": "^1.1.4",
+ "is-date-object": "^1.0.1",
+ "is-symbol": "^1.0.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/esbuild": {
+ "version": "0.19.10",
+ "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.19.10.tgz",
+ "integrity": "sha512-S1Y27QGt/snkNYrRcswgRFqZjaTG5a5xM3EQo97uNBnH505pdzSNe/HLBq1v0RO7iK/ngdbhJB6mDAp0OK+iUA==",
+ "dev": true,
+ "hasInstallScript": true,
+ "bin": {
+ "esbuild": "bin/esbuild"
+ },
+ "engines": {
+ "node": ">=12"
+ },
+ "optionalDependencies": {
+ "@esbuild/aix-ppc64": "0.19.10",
+ "@esbuild/android-arm": "0.19.10",
+ "@esbuild/android-arm64": "0.19.10",
+ "@esbuild/android-x64": "0.19.10",
+ "@esbuild/darwin-arm64": "0.19.10",
+ "@esbuild/darwin-x64": "0.19.10",
+ "@esbuild/freebsd-arm64": "0.19.10",
+ "@esbuild/freebsd-x64": "0.19.10",
+ "@esbuild/linux-arm": "0.19.10",
+ "@esbuild/linux-arm64": "0.19.10",
+ "@esbuild/linux-ia32": "0.19.10",
+ "@esbuild/linux-loong64": "0.19.10",
+ "@esbuild/linux-mips64el": "0.19.10",
+ "@esbuild/linux-ppc64": "0.19.10",
+ "@esbuild/linux-riscv64": "0.19.10",
+ "@esbuild/linux-s390x": "0.19.10",
+ "@esbuild/linux-x64": "0.19.10",
+ "@esbuild/netbsd-x64": "0.19.10",
+ "@esbuild/openbsd-x64": "0.19.10",
+ "@esbuild/sunos-x64": "0.19.10",
+ "@esbuild/win32-arm64": "0.19.10",
+ "@esbuild/win32-ia32": "0.19.10",
+ "@esbuild/win32-x64": "0.19.10"
+ }
+ },
+ "node_modules/escalade": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.1.tgz",
+ "integrity": "sha512-k0er2gUkLf8O0zKJiAhmkTnJlTvINGv7ygDNPbeIsX/TJjGJZHuh9B2UxbsaEkmlEo9MfhrSzmhIlhRlI2GXnw==",
+ "dev": true,
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/escape-string-regexp": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz",
+ "integrity": "sha512-vbRorB5FUQWvla16U8R/qgaFIya2qGzwDrNmCZuYKrbdSUMG6I1ZCGQRefkRVhuOkIGVne7BQ35DSfo1qvJqFg==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.8.0"
+ }
+ },
+ "node_modules/eslint": {
+ "version": "8.56.0",
+ "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.56.0.tgz",
+ "integrity": "sha512-Go19xM6T9puCOWntie1/P997aXxFsOi37JIHRWI514Hc6ZnaHGKY9xFhrU65RT6CcBEzZoGG1e6Nq+DT04ZtZQ==",
+ "dev": true,
+ "dependencies": {
+ "@eslint-community/eslint-utils": "^4.2.0",
+ "@eslint-community/regexpp": "^4.6.1",
+ "@eslint/eslintrc": "^2.1.4",
+ "@eslint/js": "8.56.0",
+ "@humanwhocodes/config-array": "^0.11.13",
+ "@humanwhocodes/module-importer": "^1.0.1",
+ "@nodelib/fs.walk": "^1.2.8",
+ "@ungap/structured-clone": "^1.2.0",
+ "ajv": "^6.12.4",
+ "chalk": "^4.0.0",
+ "cross-spawn": "^7.0.2",
+ "debug": "^4.3.2",
+ "doctrine": "^3.0.0",
+ "escape-string-regexp": "^4.0.0",
+ "eslint-scope": "^7.2.2",
+ "eslint-visitor-keys": "^3.4.3",
+ "espree": "^9.6.1",
+ "esquery": "^1.4.2",
+ "esutils": "^2.0.2",
+ "fast-deep-equal": "^3.1.3",
+ "file-entry-cache": "^6.0.1",
+ "find-up": "^5.0.0",
+ "glob-parent": "^6.0.2",
+ "globals": "^13.19.0",
+ "graphemer": "^1.4.0",
+ "ignore": "^5.2.0",
+ "imurmurhash": "^0.1.4",
+ "is-glob": "^4.0.0",
+ "is-path-inside": "^3.0.3",
+ "js-yaml": "^4.1.0",
+ "json-stable-stringify-without-jsonify": "^1.0.1",
+ "levn": "^0.4.1",
+ "lodash.merge": "^4.6.2",
+ "minimatch": "^3.1.2",
+ "natural-compare": "^1.4.0",
+ "optionator": "^0.9.3",
+ "strip-ansi": "^6.0.1",
+ "text-table": "^0.2.0"
+ },
+ "bin": {
+ "eslint": "bin/eslint.js"
+ },
+ "engines": {
+ "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+ },
+ "funding": {
+ "url": "https://opencollective.com/eslint"
+ }
+ },
+ "node_modules/eslint-plugin-react": {
+ "version": "7.33.2",
+ "resolved": "https://registry.npmjs.org/eslint-plugin-react/-/eslint-plugin-react-7.33.2.tgz",
+ "integrity": "sha512-73QQMKALArI8/7xGLNI/3LylrEYrlKZSb5C9+q3OtOewTnMQi5cT+aE9E41sLCmli3I9PGGmD1yiZydyo4FEPw==",
+ "dev": true,
+ "dependencies": {
+ "array-includes": "^3.1.6",
+ "array.prototype.flatmap": "^1.3.1",
+ "array.prototype.tosorted": "^1.1.1",
+ "doctrine": "^2.1.0",
+ "es-iterator-helpers": "^1.0.12",
+ "estraverse": "^5.3.0",
+ "jsx-ast-utils": "^2.4.1 || ^3.0.0",
+ "minimatch": "^3.1.2",
+ "object.entries": "^1.1.6",
+ "object.fromentries": "^2.0.6",
+ "object.hasown": "^1.1.2",
+ "object.values": "^1.1.6",
+ "prop-types": "^15.8.1",
+ "resolve": "^2.0.0-next.4",
+ "semver": "^6.3.1",
+ "string.prototype.matchall": "^4.0.8"
+ },
+ "engines": {
+ "node": ">=4"
+ },
+ "peerDependencies": {
+ "eslint": "^3 || ^4 || ^5 || ^6 || ^7 || ^8"
+ }
+ },
+ "node_modules/eslint-plugin-react-hooks": {
+ "version": "4.6.0",
+ "resolved": "https://registry.npmjs.org/eslint-plugin-react-hooks/-/eslint-plugin-react-hooks-4.6.0.tgz",
+ "integrity": "sha512-oFc7Itz9Qxh2x4gNHStv3BqJq54ExXmfC+a1NjAta66IAN87Wu0R/QArgIS9qKzX3dXKPI9H5crl9QchNMY9+g==",
+ "dev": true,
+ "engines": {
+ "node": ">=10"
+ },
+ "peerDependencies": {
+ "eslint": "^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0 || ^7.0.0 || ^8.0.0-0"
+ }
+ },
+ "node_modules/eslint-plugin-react-refresh": {
+ "version": "0.4.5",
+ "resolved": "https://registry.npmjs.org/eslint-plugin-react-refresh/-/eslint-plugin-react-refresh-0.4.5.tgz",
+ "integrity": "sha512-D53FYKJa+fDmZMtriODxvhwrO+IOqrxoEo21gMA0sjHdU6dPVH4OhyFip9ypl8HOF5RV5KdTo+rBQLvnY2cO8w==",
+ "dev": true,
+ "peerDependencies": {
+ "eslint": ">=7"
+ }
+ },
+ "node_modules/eslint-plugin-react/node_modules/doctrine": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-2.1.0.tgz",
+ "integrity": "sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==",
+ "dev": true,
+ "dependencies": {
+ "esutils": "^2.0.2"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/eslint-scope": {
+ "version": "7.2.2",
+ "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.2.tgz",
+ "integrity": "sha512-dOt21O7lTMhDM+X9mB4GX+DZrZtCUJPL/wlcTqxyrx5IvO0IYtILdtrQGQp+8n5S0gwSVmOf9NQrjMOgfQZlIg==",
+ "dev": true,
+ "dependencies": {
+ "esrecurse": "^4.3.0",
+ "estraverse": "^5.2.0"
+ },
+ "engines": {
+ "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+ },
+ "funding": {
+ "url": "https://opencollective.com/eslint"
+ }
+ },
+ "node_modules/eslint-visitor-keys": {
+ "version": "3.4.3",
+ "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz",
+ "integrity": "sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==",
+ "dev": true,
+ "engines": {
+ "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+ },
+ "funding": {
+ "url": "https://opencollective.com/eslint"
+ }
+ },
+ "node_modules/eslint/node_modules/ansi-styles": {
+ "version": "4.3.0",
+ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz",
+ "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==",
+ "dev": true,
+ "dependencies": {
+ "color-convert": "^2.0.1"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "funding": {
+ "url": "https://github.com/chalk/ansi-styles?sponsor=1"
+ }
+ },
+ "node_modules/eslint/node_modules/chalk": {
+ "version": "4.1.2",
+ "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz",
+ "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==",
+ "dev": true,
+ "dependencies": {
+ "ansi-styles": "^4.1.0",
+ "supports-color": "^7.1.0"
+ },
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/chalk/chalk?sponsor=1"
+ }
+ },
+ "node_modules/eslint/node_modules/color-convert": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz",
+ "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==",
+ "dev": true,
+ "dependencies": {
+ "color-name": "~1.1.4"
+ },
+ "engines": {
+ "node": ">=7.0.0"
+ }
+ },
+ "node_modules/eslint/node_modules/color-name": {
+ "version": "1.1.4",
+ "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz",
+ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==",
+ "dev": true
+ },
+ "node_modules/eslint/node_modules/escape-string-regexp": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz",
+ "integrity": "sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==",
+ "dev": true,
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/eslint/node_modules/globals": {
+ "version": "13.24.0",
+ "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz",
+ "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==",
+ "dev": true,
+ "dependencies": {
+ "type-fest": "^0.20.2"
+ },
+ "engines": {
+ "node": ">=8"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/eslint/node_modules/has-flag": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz",
+ "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==",
+ "dev": true,
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/eslint/node_modules/supports-color": {
+ "version": "7.2.0",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz",
+ "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==",
+ "dev": true,
+ "dependencies": {
+ "has-flag": "^4.0.0"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/espree": {
+ "version": "9.6.1",
+ "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.1.tgz",
+ "integrity": "sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==",
+ "dev": true,
+ "dependencies": {
+ "acorn": "^8.9.0",
+ "acorn-jsx": "^5.3.2",
+ "eslint-visitor-keys": "^3.4.1"
+ },
+ "engines": {
+ "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+ },
+ "funding": {
+ "url": "https://opencollective.com/eslint"
+ }
+ },
+ "node_modules/esquery": {
+ "version": "1.5.0",
+ "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.5.0.tgz",
+ "integrity": "sha512-YQLXUplAwJgCydQ78IMJywZCceoqk1oH01OERdSAJc/7U2AylwjhSCLDEtqwg811idIS/9fIU5GjG73IgjKMVg==",
+ "dev": true,
+ "dependencies": {
+ "estraverse": "^5.1.0"
+ },
+ "engines": {
+ "node": ">=0.10"
+ }
+ },
+ "node_modules/esrecurse": {
+ "version": "4.3.0",
+ "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz",
+ "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==",
+ "dev": true,
+ "dependencies": {
+ "estraverse": "^5.2.0"
+ },
+ "engines": {
+ "node": ">=4.0"
+ }
+ },
+ "node_modules/estraverse": {
+ "version": "5.3.0",
+ "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.3.0.tgz",
+ "integrity": "sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==",
+ "dev": true,
+ "engines": {
+ "node": ">=4.0"
+ }
+ },
+ "node_modules/esutils": {
+ "version": "2.0.3",
+ "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz",
+ "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/fast-deep-equal": {
+ "version": "3.1.3",
+ "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz",
+ "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==",
+ "dev": true
+ },
+ "node_modules/fast-json-stable-stringify": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz",
+ "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==",
+ "dev": true
+ },
+ "node_modules/fast-levenshtein": {
+ "version": "2.0.6",
+ "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz",
+ "integrity": "sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==",
+ "dev": true
+ },
+ "node_modules/fastq": {
+ "version": "1.16.0",
+ "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.16.0.tgz",
+ "integrity": "sha512-ifCoaXsDrsdkWTtiNJX5uzHDsrck5TzfKKDcuFFTIrrc/BS076qgEIfoIy1VeZqViznfKiysPYTh/QeHtnIsYA==",
+ "dev": true,
+ "dependencies": {
+ "reusify": "^1.0.4"
+ }
+ },
+ "node_modules/file-entry-cache": {
+ "version": "6.0.1",
+ "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-6.0.1.tgz",
+ "integrity": "sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==",
+ "dev": true,
+ "dependencies": {
+ "flat-cache": "^3.0.4"
+ },
+ "engines": {
+ "node": "^10.12.0 || >=12.0.0"
+ }
+ },
+ "node_modules/find-up": {
+ "version": "5.0.0",
+ "resolved": "https://registry.npmjs.org/find-up/-/find-up-5.0.0.tgz",
+ "integrity": "sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==",
+ "dev": true,
+ "dependencies": {
+ "locate-path": "^6.0.0",
+ "path-exists": "^4.0.0"
+ },
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/flat-cache": {
+ "version": "3.2.0",
+ "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-3.2.0.tgz",
+ "integrity": "sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==",
+ "dev": true,
+ "dependencies": {
+ "flatted": "^3.2.9",
+ "keyv": "^4.5.3",
+ "rimraf": "^3.0.2"
+ },
+ "engines": {
+ "node": "^10.12.0 || >=12.0.0"
+ }
+ },
+ "node_modules/flatted": {
+ "version": "3.2.9",
+ "resolved": "https://registry.npmjs.org/flatted/-/flatted-3.2.9.tgz",
+ "integrity": "sha512-36yxDn5H7OFZQla0/jFJmbIKTdZAQHngCedGxiMmpNfEZM0sdEeT+WczLQrjK6D7o2aiyLYDnkw0R3JK0Qv1RQ==",
+ "dev": true
+ },
+ "node_modules/follow-redirects": {
+ "version": "1.15.3",
+ "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.15.3.tgz",
+ "integrity": "sha512-1VzOtuEM8pC9SFU1E+8KfTjZyMztRsgEfwQl44z8A25uy13jSzTj6dyK2Df52iV0vgHCfBwLhDWevLn95w5v6Q==",
+ "funding": [
+ {
+ "type": "individual",
+ "url": "https://github.com/sponsors/RubenVerborgh"
+ }
+ ],
+ "engines": {
+ "node": ">=4.0"
+ },
+ "peerDependenciesMeta": {
+ "debug": {
+ "optional": true
+ }
+ }
+ },
+ "node_modules/for-each": {
+ "version": "0.3.3",
+ "resolved": "https://registry.npmjs.org/for-each/-/for-each-0.3.3.tgz",
+ "integrity": "sha512-jqYfLp7mo9vIyQf8ykW2v7A+2N4QjeCeI5+Dz9XraiO1ign81wjiH7Fb9vSOWvQfNtmSa4H2RoQTrrXivdUZmw==",
+ "dev": true,
+ "dependencies": {
+ "is-callable": "^1.1.3"
+ }
+ },
+ "node_modules/form-data": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/form-data/-/form-data-4.0.0.tgz",
+ "integrity": "sha512-ETEklSGi5t0QMZuiXoA/Q6vcnxcLQP5vdugSpuAyi6SVGi2clPPp+xgEhuMaHC+zGgn31Kd235W35f7Hykkaww==",
+ "dependencies": {
+ "asynckit": "^0.4.0",
+ "combined-stream": "^1.0.8",
+ "mime-types": "^2.1.12"
+ },
+ "engines": {
+ "node": ">= 6"
+ }
+ },
+ "node_modules/fs.realpath": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz",
+ "integrity": "sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw==",
+ "dev": true
+ },
+ "node_modules/fsevents": {
+ "version": "2.3.3",
+ "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz",
+ "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==",
+ "dev": true,
+ "hasInstallScript": true,
+ "optional": true,
+ "os": [
+ "darwin"
+ ],
+ "engines": {
+ "node": "^8.16.0 || ^10.6.0 || >=11.0.0"
+ }
+ },
+ "node_modules/function-bind": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz",
+ "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==",
+ "dev": true,
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/function.prototype.name": {
+ "version": "1.1.6",
+ "resolved": "https://registry.npmjs.org/function.prototype.name/-/function.prototype.name-1.1.6.tgz",
+ "integrity": "sha512-Z5kx79swU5P27WEayXM1tBi5Ze/lbIyiNgU3qyXUOf9b2rgXYyF9Dy9Cx+IQv/Lc8WCG6L82zwUPpSS9hGehIg==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1",
+ "functions-have-names": "^1.2.3"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/functions-have-names": {
+ "version": "1.2.3",
+ "resolved": "https://registry.npmjs.org/functions-have-names/-/functions-have-names-1.2.3.tgz",
+ "integrity": "sha512-xckBUXyTIqT97tq2x2AMb+g163b5JFysYk0x4qxNFwbfQkmNZoiRHb6sPzI9/QV33WeuvVYBUIiD4NzNIyqaRQ==",
+ "dev": true,
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/gensync": {
+ "version": "1.0.0-beta.2",
+ "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.2.tgz",
+ "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==",
+ "dev": true,
+ "engines": {
+ "node": ">=6.9.0"
+ }
+ },
+ "node_modules/get-intrinsic": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.2.tgz",
+ "integrity": "sha512-0gSo4ml/0j98Y3lngkFEot/zhiCeWsbYIlZ+uZOVgzLyLaUw7wxUL+nCTP0XJvJg1AXulJRI3UJi8GsbDuxdGA==",
+ "dev": true,
+ "dependencies": {
+ "function-bind": "^1.1.2",
+ "has-proto": "^1.0.1",
+ "has-symbols": "^1.0.3",
+ "hasown": "^2.0.0"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/get-symbol-description": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/get-symbol-description/-/get-symbol-description-1.0.0.tgz",
+ "integrity": "sha512-2EmdH1YvIQiZpltCNgkuiUnyukzxM/R6NDJX31Ke3BG1Nq5b0S2PhX59UKi9vZpPDQVdqn+1IcaAwnzTT5vCjw==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "get-intrinsic": "^1.1.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/glob": {
+ "version": "7.2.3",
+ "resolved": "https://registry.npmjs.org/glob/-/glob-7.2.3.tgz",
+ "integrity": "sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q==",
+ "dev": true,
+ "dependencies": {
+ "fs.realpath": "^1.0.0",
+ "inflight": "^1.0.4",
+ "inherits": "2",
+ "minimatch": "^3.1.1",
+ "once": "^1.3.0",
+ "path-is-absolute": "^1.0.0"
+ },
+ "engines": {
+ "node": "*"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/isaacs"
+ }
+ },
+ "node_modules/glob-parent": {
+ "version": "6.0.2",
+ "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz",
+ "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==",
+ "dev": true,
+ "dependencies": {
+ "is-glob": "^4.0.3"
+ },
+ "engines": {
+ "node": ">=10.13.0"
+ }
+ },
+ "node_modules/globals": {
+ "version": "11.12.0",
+ "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz",
+ "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==",
+ "dev": true,
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/globalthis": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/globalthis/-/globalthis-1.0.3.tgz",
+ "integrity": "sha512-sFdI5LyBiNTHjRd7cGPWapiHWMOXKyuBNX/cWJ3NfzrZQVa8GI/8cofCl74AOVqq9W5kNmguTIzJ/1s2gyI9wA==",
+ "dev": true,
+ "dependencies": {
+ "define-properties": "^1.1.3"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/gopd": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz",
+ "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==",
+ "dev": true,
+ "dependencies": {
+ "get-intrinsic": "^1.1.3"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/graphemer": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/graphemer/-/graphemer-1.4.0.tgz",
+ "integrity": "sha512-EtKwoO6kxCL9WO5xipiHTZlSzBm7WLT627TqC/uVRd0HKmq8NXyebnNYxDoBi7wt8eTWrUrKXCOVaFq9x1kgag==",
+ "dev": true
+ },
+ "node_modules/has-bigints": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/has-bigints/-/has-bigints-1.0.2.tgz",
+ "integrity": "sha512-tSvCKtBr9lkF0Ex0aQiP9N+OpV4zi2r/Nee5VkRDbaqv35RLYMzbwQfFSZZH0kR+Rd6302UJZ2p/bJCEoR3VoQ==",
+ "dev": true,
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-flag": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz",
+ "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==",
+ "dev": true,
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/has-property-descriptors": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.1.tgz",
+ "integrity": "sha512-VsX8eaIewvas0xnvinAe9bw4WfIeODpGYikiWYLH+dma0Jw6KHYqWiWfhQlgOVK8D6PvjubK5Uc4P0iIhIcNVg==",
+ "dev": true,
+ "dependencies": {
+ "get-intrinsic": "^1.2.2"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-proto": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.1.tgz",
+ "integrity": "sha512-7qE+iP+O+bgF9clE5+UoBFzE65mlBiVj3tKCrlNQ0Ogwm0BjpT/gK4SlLYDMybDh5I3TCTKnPPa0oMG7JDYrhg==",
+ "dev": true,
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-symbols": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz",
+ "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==",
+ "dev": true,
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-tostringtag": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/has-tostringtag/-/has-tostringtag-1.0.0.tgz",
+ "integrity": "sha512-kFjcSNhnlGV1kyoGk7OXKSawH5JOb/LzUc5w9B02hOTO0dfFRjbHQKvg1d6cf3HbeUmtU9VbbV3qzZ2Teh97WQ==",
+ "dev": true,
+ "dependencies": {
+ "has-symbols": "^1.0.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/hasown": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.0.tgz",
+ "integrity": "sha512-vUptKVTpIJhcczKBbgnS+RtcuYMB8+oNzPK2/Hp3hanz8JmpATdmmgLgSaadVREkDm+e2giHwY3ZRkyjSIDDFA==",
+ "dev": true,
+ "dependencies": {
+ "function-bind": "^1.1.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/ignore": {
+ "version": "5.3.0",
+ "resolved": "https://registry.npmjs.org/ignore/-/ignore-5.3.0.tgz",
+ "integrity": "sha512-g7dmpshy+gD7mh88OC9NwSGTKoc3kyLAZQRU1mt53Aw/vnvfXnbC+F/7F7QoYVKbV+KNvJx8wArewKy1vXMtlg==",
+ "dev": true,
+ "engines": {
+ "node": ">= 4"
+ }
+ },
+ "node_modules/import-fresh": {
+ "version": "3.3.0",
+ "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.0.tgz",
+ "integrity": "sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw==",
+ "dev": true,
+ "dependencies": {
+ "parent-module": "^1.0.0",
+ "resolve-from": "^4.0.0"
+ },
+ "engines": {
+ "node": ">=6"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/imurmurhash": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz",
+ "integrity": "sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.8.19"
+ }
+ },
+ "node_modules/inflight": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz",
+ "integrity": "sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA==",
+ "dev": true,
+ "dependencies": {
+ "once": "^1.3.0",
+ "wrappy": "1"
+ }
+ },
+ "node_modules/inherits": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
+ "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==",
+ "dev": true
+ },
+ "node_modules/internal-slot": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/internal-slot/-/internal-slot-1.0.6.tgz",
+ "integrity": "sha512-Xj6dv+PsbtwyPpEflsejS+oIZxmMlV44zAhG479uYu89MsjcYOhCFnNyKrkJrihbsiasQyY0afoCl/9BLR65bg==",
+ "dev": true,
+ "dependencies": {
+ "get-intrinsic": "^1.2.2",
+ "hasown": "^2.0.0",
+ "side-channel": "^1.0.4"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/is-array-buffer": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/is-array-buffer/-/is-array-buffer-3.0.2.tgz",
+ "integrity": "sha512-y+FyyR/w8vfIRq4eQcM1EYgSTnmHXPqaF+IgzgraytCFq5Xh8lllDVmAZolPJiZttZLeFSINPYMaEJ7/vWUa1w==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "get-intrinsic": "^1.2.0",
+ "is-typed-array": "^1.1.10"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-async-function": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/is-async-function/-/is-async-function-2.0.0.tgz",
+ "integrity": "sha512-Y1JXKrfykRJGdlDwdKlLpLyMIiWqWvuSd17TvZk68PLAOGOoF4Xyav1z0Xhoi+gCYjZVeC5SI+hYFOfvXmGRCA==",
+ "dev": true,
+ "dependencies": {
+ "has-tostringtag": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-bigint": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/is-bigint/-/is-bigint-1.0.4.tgz",
+ "integrity": "sha512-zB9CruMamjym81i2JZ3UMn54PKGsQzsJeo6xvN3HJJ4CAsQNB6iRutp2To77OfCNuoxspsIhzaPoO1zyCEhFOg==",
+ "dev": true,
+ "dependencies": {
+ "has-bigints": "^1.0.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-boolean-object": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/is-boolean-object/-/is-boolean-object-1.1.2.tgz",
+ "integrity": "sha512-gDYaKHJmnj4aWxyj6YHyXVpdQawtVLHU5cb+eztPGczf6cjuTdwve5ZIEfgXqH4e57An1D1AKf8CZ3kYrQRqYA==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "has-tostringtag": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-callable": {
+ "version": "1.2.7",
+ "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.2.7.tgz",
+ "integrity": "sha512-1BC0BVFhS/p0qtw6enp8e+8OD0UrK0oFLztSjNzhcKA3WDuJxxAPXzPuPtKkjEY9UUoEWlX/8fgKeu2S8i9JTA==",
+ "dev": true,
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-core-module": {
+ "version": "2.13.1",
+ "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.13.1.tgz",
+ "integrity": "sha512-hHrIjvZsftOsvKSn2TRYl63zvxsgE0K+0mYMoH6gD4omR5IWB2KynivBQczo3+wF1cCkjzvptnI9Q0sPU66ilw==",
+ "dev": true,
+ "dependencies": {
+ "hasown": "^2.0.0"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-date-object": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.5.tgz",
+ "integrity": "sha512-9YQaSxsAiSwcvS33MBk3wTCVnWK+HhF8VZR2jRxehM16QcVOdHqPn4VPHmRK4lSr38n9JriurInLcP90xsYNfQ==",
+ "dev": true,
+ "dependencies": {
+ "has-tostringtag": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-extglob": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz",
+ "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/is-finalizationregistry": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-finalizationregistry/-/is-finalizationregistry-1.0.2.tgz",
+ "integrity": "sha512-0by5vtUJs8iFQb5TYUHHPudOR+qXYIMKtiUzvLIZITZUjknFmziyBJuLhVRc+Ds0dREFlskDNJKYIdIzu/9pfw==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-generator-function": {
+ "version": "1.0.10",
+ "resolved": "https://registry.npmjs.org/is-generator-function/-/is-generator-function-1.0.10.tgz",
+ "integrity": "sha512-jsEjy9l3yiXEQ+PsXdmBwEPcOxaXWLspKdplFUVI9vq1iZgIekeC0L167qeu86czQaxed3q/Uzuw0swL0irL8A==",
+ "dev": true,
+ "dependencies": {
+ "has-tostringtag": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-glob": {
+ "version": "4.0.3",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz",
+ "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==",
+ "dev": true,
+ "dependencies": {
+ "is-extglob": "^2.1.1"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/is-map": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/is-map/-/is-map-2.0.2.tgz",
+ "integrity": "sha512-cOZFQQozTha1f4MxLFzlgKYPTyj26picdZTx82hbc/Xf4K/tZOOXSCkMvU4pKioRXGDLJRn0GM7Upe7kR721yg==",
+ "dev": true,
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-negative-zero": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.2.tgz",
+ "integrity": "sha512-dqJvarLawXsFbNDeJW7zAz8ItJ9cd28YufuuFzh0G8pNHjJMnY08Dv7sYX2uF5UpQOwieAeOExEYAWWfu7ZZUA==",
+ "dev": true,
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-number-object": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/is-number-object/-/is-number-object-1.0.7.tgz",
+ "integrity": "sha512-k1U0IRzLMo7ZlYIfzRu23Oh6MiIFasgpb9X76eqfFZAqwH44UI4KTBvBYIZ1dSL9ZzChTB9ShHfLkR4pdW5krQ==",
+ "dev": true,
+ "dependencies": {
+ "has-tostringtag": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-path-inside": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-3.0.3.tgz",
+ "integrity": "sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==",
+ "dev": true,
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/is-regex": {
+ "version": "1.1.4",
+ "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.4.tgz",
+ "integrity": "sha512-kvRdxDsxZjhzUX07ZnLydzS1TU/TJlTUHHY4YLL87e37oUA49DfkLqgy+VjFocowy29cKvcSiu+kIv728jTTVg==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "has-tostringtag": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-set": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/is-set/-/is-set-2.0.2.tgz",
+ "integrity": "sha512-+2cnTEZeY5z/iXGbLhPrOAaK/Mau5k5eXq9j14CpRTftq0pAJu2MwVRSZhyZWBzx3o6X795Lz6Bpb6R0GKf37g==",
+ "dev": true,
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-shared-array-buffer": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-shared-array-buffer/-/is-shared-array-buffer-1.0.2.tgz",
+ "integrity": "sha512-sqN2UDu1/0y6uvXyStCOzyhAjCSlHceFoMKJW8W9EU9cvic/QdsZ0kEU93HEy3IUEFZIiH/3w+AH/UQbPHNdhA==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-string": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/is-string/-/is-string-1.0.7.tgz",
+ "integrity": "sha512-tE2UXzivje6ofPW7l23cjDOMa09gb7xlAqG6jG5ej6uPV32TlWP3NKPigtaGeHNu9fohccRYvIiZMfOOnOYUtg==",
+ "dev": true,
+ "dependencies": {
+ "has-tostringtag": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-symbol": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.4.tgz",
+ "integrity": "sha512-C/CPBqKWnvdcxqIARxyOh4v1UUEOCHpgDa0WYgpKDFMszcrPcffg5uhwSgPCLD2WWxmq6isisz87tzT01tuGhg==",
+ "dev": true,
+ "dependencies": {
+ "has-symbols": "^1.0.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-typed-array": {
+ "version": "1.1.12",
+ "resolved": "https://registry.npmjs.org/is-typed-array/-/is-typed-array-1.1.12.tgz",
+ "integrity": "sha512-Z14TF2JNG8Lss5/HMqt0//T9JeHXttXy5pH/DBU4vi98ozO2btxzq9MwYDZYnKwU8nRsz/+GVFVRDq3DkVuSPg==",
+ "dev": true,
+ "dependencies": {
+ "which-typed-array": "^1.1.11"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-weakmap": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/is-weakmap/-/is-weakmap-2.0.1.tgz",
+ "integrity": "sha512-NSBR4kH5oVj1Uwvv970ruUkCV7O1mzgVFO4/rev2cLRda9Tm9HrL70ZPut4rOHgY0FNrUu9BCbXA2sdQ+x0chA==",
+ "dev": true,
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-weakref": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-weakref/-/is-weakref-1.0.2.tgz",
+ "integrity": "sha512-qctsuLZmIQ0+vSSMfoVvyFe2+GSEvnmZ2ezTup1SBse9+twCCeial6EEi3Nc2KFcf6+qz2FBPnjXsk8xhKSaPQ==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/is-weakset": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/is-weakset/-/is-weakset-2.0.2.tgz",
+ "integrity": "sha512-t2yVvttHkQktwnNNmBQ98AhENLdPUTDTE21uPqAQ0ARwQfGeQKRVS0NNurH7bTf7RrvcVn1OOge45CnBeHCSmg==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "get-intrinsic": "^1.1.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/isarray": {
+ "version": "2.0.5",
+ "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.5.tgz",
+ "integrity": "sha512-xHjhDr3cNBK0BzdUJSPXZntQUx/mwMS5Rw4A7lPJ90XGAO6ISP/ePDNuo0vhqOZU+UD5JoodwCAAoZQd3FeAKw==",
+ "dev": true
+ },
+ "node_modules/isexe": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
+ "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==",
+ "dev": true
+ },
+ "node_modules/iterator.prototype": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/iterator.prototype/-/iterator.prototype-1.1.2.tgz",
+ "integrity": "sha512-DR33HMMr8EzwuRL8Y9D3u2BMj8+RqSE850jfGu59kS7tbmPLzGkZmVSfyCFSDxuZiEY6Rzt3T2NA/qU+NwVj1w==",
+ "dev": true,
+ "dependencies": {
+ "define-properties": "^1.2.1",
+ "get-intrinsic": "^1.2.1",
+ "has-symbols": "^1.0.3",
+ "reflect.getprototypeof": "^1.0.4",
+ "set-function-name": "^2.0.1"
+ }
+ },
+ "node_modules/js-tokens": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
+ "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ=="
+ },
+ "node_modules/js-yaml": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.0.tgz",
+ "integrity": "sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==",
+ "dev": true,
+ "dependencies": {
+ "argparse": "^2.0.1"
+ },
+ "bin": {
+ "js-yaml": "bin/js-yaml.js"
+ }
+ },
+ "node_modules/jsesc": {
+ "version": "2.5.2",
+ "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz",
+ "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==",
+ "dev": true,
+ "bin": {
+ "jsesc": "bin/jsesc"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/json-buffer": {
+ "version": "3.0.1",
+ "resolved": "https://registry.npmjs.org/json-buffer/-/json-buffer-3.0.1.tgz",
+ "integrity": "sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==",
+ "dev": true
+ },
+ "node_modules/json-schema-traverse": {
+ "version": "0.4.1",
+ "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz",
+ "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==",
+ "dev": true
+ },
+ "node_modules/json-stable-stringify-without-jsonify": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz",
+ "integrity": "sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==",
+ "dev": true
+ },
+ "node_modules/json5": {
+ "version": "2.2.3",
+ "resolved": "https://registry.npmjs.org/json5/-/json5-2.2.3.tgz",
+ "integrity": "sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg==",
+ "dev": true,
+ "bin": {
+ "json5": "lib/cli.js"
+ },
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/jsx-ast-utils": {
+ "version": "3.3.5",
+ "resolved": "https://registry.npmjs.org/jsx-ast-utils/-/jsx-ast-utils-3.3.5.tgz",
+ "integrity": "sha512-ZZow9HBI5O6EPgSJLUb8n2NKgmVWTwCvHGwFuJlMjvLFqlGG6pjirPhtdsseaLZjSibD8eegzmYpUZwoIlj2cQ==",
+ "dev": true,
+ "dependencies": {
+ "array-includes": "^3.1.6",
+ "array.prototype.flat": "^1.3.1",
+ "object.assign": "^4.1.4",
+ "object.values": "^1.1.6"
+ },
+ "engines": {
+ "node": ">=4.0"
+ }
+ },
+ "node_modules/keyv": {
+ "version": "4.5.4",
+ "resolved": "https://registry.npmjs.org/keyv/-/keyv-4.5.4.tgz",
+ "integrity": "sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==",
+ "dev": true,
+ "dependencies": {
+ "json-buffer": "3.0.1"
+ }
+ },
+ "node_modules/levn": {
+ "version": "0.4.1",
+ "resolved": "https://registry.npmjs.org/levn/-/levn-0.4.1.tgz",
+ "integrity": "sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==",
+ "dev": true,
+ "dependencies": {
+ "prelude-ls": "^1.2.1",
+ "type-check": "~0.4.0"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/locate-path": {
+ "version": "6.0.0",
+ "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-6.0.0.tgz",
+ "integrity": "sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==",
+ "dev": true,
+ "dependencies": {
+ "p-locate": "^5.0.0"
+ },
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/lodash.merge": {
+ "version": "4.6.2",
+ "resolved": "https://registry.npmjs.org/lodash.merge/-/lodash.merge-4.6.2.tgz",
+ "integrity": "sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==",
+ "dev": true
+ },
+ "node_modules/loose-envify": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz",
+ "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==",
+ "dependencies": {
+ "js-tokens": "^3.0.0 || ^4.0.0"
+ },
+ "bin": {
+ "loose-envify": "cli.js"
+ }
+ },
+ "node_modules/lru-cache": {
+ "version": "5.1.1",
+ "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz",
+ "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==",
+ "dev": true,
+ "dependencies": {
+ "yallist": "^3.0.2"
+ }
+ },
+ "node_modules/mime-db": {
+ "version": "1.52.0",
+ "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz",
+ "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mime-types": {
+ "version": "2.1.35",
+ "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz",
+ "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==",
+ "dependencies": {
+ "mime-db": "1.52.0"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/minimatch": {
+ "version": "3.1.2",
+ "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz",
+ "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==",
+ "dev": true,
+ "dependencies": {
+ "brace-expansion": "^1.1.7"
+ },
+ "engines": {
+ "node": "*"
+ }
+ },
+ "node_modules/ms": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
+ "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==",
+ "dev": true
+ },
+ "node_modules/nanoid": {
+ "version": "3.3.7",
+ "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.7.tgz",
+ "integrity": "sha512-eSRppjcPIatRIMC1U6UngP8XFcz8MQWGQdt1MTBQ7NaAmvXDfvNxbvWV3x2y6CdEUciCSsDHDQZbhYaB8QEo2g==",
+ "dev": true,
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/ai"
+ }
+ ],
+ "bin": {
+ "nanoid": "bin/nanoid.cjs"
+ },
+ "engines": {
+ "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1"
+ }
+ },
+ "node_modules/natural-compare": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/natural-compare/-/natural-compare-1.4.0.tgz",
+ "integrity": "sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==",
+ "dev": true
+ },
+ "node_modules/node-releases": {
+ "version": "2.0.14",
+ "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.14.tgz",
+ "integrity": "sha512-y10wOWt8yZpqXmOgRo77WaHEmhYQYGNA6y421PKsKYWEK8aW+cqAphborZDhqfyKrbZEN92CN1X2KbafY2s7Yw==",
+ "dev": true
+ },
+ "node_modules/object-assign": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+ "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/object-inspect": {
+ "version": "1.13.1",
+ "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.1.tgz",
+ "integrity": "sha512-5qoj1RUiKOMsCCNLV1CBiPYE10sziTsnmNxkAI/rZhiD63CF7IqdFGC/XzjWjpSgLf0LxXX3bDFIh0E18f6UhQ==",
+ "dev": true,
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/object-keys": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz",
+ "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==",
+ "dev": true,
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/object.assign": {
+ "version": "4.1.5",
+ "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.5.tgz",
+ "integrity": "sha512-byy+U7gp+FVwmyzKPYhW2h5l3crpmGsxl7X2s8y43IgxvG4g3QZ6CffDtsNQy1WsmZpQbO+ybo0AlW7TY6DcBQ==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.5",
+ "define-properties": "^1.2.1",
+ "has-symbols": "^1.0.3",
+ "object-keys": "^1.1.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/object.entries": {
+ "version": "1.1.7",
+ "resolved": "https://registry.npmjs.org/object.entries/-/object.entries-1.1.7.tgz",
+ "integrity": "sha512-jCBs/0plmPsOnrKAfFQXRG2NFjlhZgjjcBLSmTnEhU8U6vVTsVe8ANeQJCHTl3gSsI4J+0emOoCgoKlmQPMgmA==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/object.fromentries": {
+ "version": "2.0.7",
+ "resolved": "https://registry.npmjs.org/object.fromentries/-/object.fromentries-2.0.7.tgz",
+ "integrity": "sha512-UPbPHML6sL8PI/mOqPwsH4G6iyXcCGzLin8KvEPenOZN5lpCNBZZQ+V62vdjB1mQHrmqGQt5/OJzemUA+KJmEA==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/object.hasown": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/object.hasown/-/object.hasown-1.1.3.tgz",
+ "integrity": "sha512-fFI4VcYpRHvSLXxP7yiZOMAd331cPfd2p7PFDVbgUsYOfCT3tICVqXWngbjr4m49OvsBwUBQ6O2uQoJvy3RexA==",
+ "dev": true,
+ "dependencies": {
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/object.values": {
+ "version": "1.1.7",
+ "resolved": "https://registry.npmjs.org/object.values/-/object.values-1.1.7.tgz",
+ "integrity": "sha512-aU6xnDFYT3x17e/f0IiiwlGPTy2jzMySGfUB4fq6z7CV8l85CWHDk5ErhyhpfDHhrOMwGFhSQkhMGHaIotA6Ng==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/once": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz",
+ "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==",
+ "dev": true,
+ "dependencies": {
+ "wrappy": "1"
+ }
+ },
+ "node_modules/optionator": {
+ "version": "0.9.3",
+ "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.3.tgz",
+ "integrity": "sha512-JjCoypp+jKn1ttEFExxhetCKeJt9zhAgAve5FXHixTvFDW/5aEktX9bufBKLRRMdU7bNtpLfcGu94B3cdEJgjg==",
+ "dev": true,
+ "dependencies": {
+ "@aashutoshrathi/word-wrap": "^1.2.3",
+ "deep-is": "^0.1.3",
+ "fast-levenshtein": "^2.0.6",
+ "levn": "^0.4.1",
+ "prelude-ls": "^1.2.1",
+ "type-check": "^0.4.0"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/p-limit": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-3.1.0.tgz",
+ "integrity": "sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==",
+ "dev": true,
+ "dependencies": {
+ "yocto-queue": "^0.1.0"
+ },
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/p-locate": {
+ "version": "5.0.0",
+ "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-5.0.0.tgz",
+ "integrity": "sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==",
+ "dev": true,
+ "dependencies": {
+ "p-limit": "^3.0.2"
+ },
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/parent-module": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/parent-module/-/parent-module-1.0.1.tgz",
+ "integrity": "sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==",
+ "dev": true,
+ "dependencies": {
+ "callsites": "^3.0.0"
+ },
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/path-exists": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz",
+ "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==",
+ "dev": true,
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/path-is-absolute": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz",
+ "integrity": "sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/path-key": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz",
+ "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==",
+ "dev": true,
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/path-parse": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz",
+ "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==",
+ "dev": true
+ },
+ "node_modules/picocolors": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.0.0.tgz",
+ "integrity": "sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==",
+ "dev": true
+ },
+ "node_modules/postcss": {
+ "version": "8.4.32",
+ "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.32.tgz",
+ "integrity": "sha512-D/kj5JNu6oo2EIy+XL/26JEDTlIbB8hw85G8StOE6L74RQAVVP5rej6wxCNqyMbR4RkPfqvezVbPw81Ngd6Kcw==",
+ "dev": true,
+ "funding": [
+ {
+ "type": "opencollective",
+ "url": "https://opencollective.com/postcss/"
+ },
+ {
+ "type": "tidelift",
+ "url": "https://tidelift.com/funding/github/npm/postcss"
+ },
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/ai"
+ }
+ ],
+ "dependencies": {
+ "nanoid": "^3.3.7",
+ "picocolors": "^1.0.0",
+ "source-map-js": "^1.0.2"
+ },
+ "engines": {
+ "node": "^10 || ^12 || >=14"
+ }
+ },
+ "node_modules/prelude-ls": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.2.1.tgz",
+ "integrity": "sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==",
+ "dev": true,
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/prop-types": {
+ "version": "15.8.1",
+ "resolved": "https://registry.npmjs.org/prop-types/-/prop-types-15.8.1.tgz",
+ "integrity": "sha512-oj87CgZICdulUohogVAR7AjlC0327U4el4L6eAvOqCeudMDVU0NThNaV+b9Df4dXgSP1gXMTnPdhfe/2qDH5cg==",
+ "dev": true,
+ "dependencies": {
+ "loose-envify": "^1.4.0",
+ "object-assign": "^4.1.1",
+ "react-is": "^16.13.1"
+ }
+ },
+ "node_modules/proxy-from-env": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz",
+ "integrity": "sha512-D+zkORCbA9f1tdWRK0RaCR3GPv50cMxcrz4X8k5LTSUD1Dkw47mKJEZQNunItRTkWwgtaUSo1RVFRIG9ZXiFYg=="
+ },
+ "node_modules/punycode": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.3.1.tgz",
+ "integrity": "sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==",
+ "dev": true,
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/queue-microtask": {
+ "version": "1.2.3",
+ "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz",
+ "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==",
+ "dev": true,
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/feross"
+ },
+ {
+ "type": "patreon",
+ "url": "https://www.patreon.com/feross"
+ },
+ {
+ "type": "consulting",
+ "url": "https://feross.org/support"
+ }
+ ]
+ },
+ "node_modules/react": {
+ "version": "18.2.0",
+ "resolved": "https://registry.npmjs.org/react/-/react-18.2.0.tgz",
+ "integrity": "sha512-/3IjMdb2L9QbBdWiW5e3P2/npwMBaU9mHCSCUzNln0ZCYbcfTsGbTJrU/kGemdH2IWmB2ioZ+zkxtmq6g09fGQ==",
+ "dependencies": {
+ "loose-envify": "^1.1.0"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/react-dom": {
+ "version": "18.2.0",
+ "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-18.2.0.tgz",
+ "integrity": "sha512-6IMTriUmvsjHUjNtEDudZfuDQUoWXVxKHhlEGSk81n4YFS+r/Kl99wXiwlVXtPBtJenozv2P+hxDsw9eA7Xo6g==",
+ "dependencies": {
+ "loose-envify": "^1.1.0",
+ "scheduler": "^0.23.0"
+ },
+ "peerDependencies": {
+ "react": "^18.2.0"
+ }
+ },
+ "node_modules/react-is": {
+ "version": "16.13.1",
+ "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.1.tgz",
+ "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==",
+ "dev": true
+ },
+ "node_modules/react-refresh": {
+ "version": "0.14.0",
+ "resolved": "https://registry.npmjs.org/react-refresh/-/react-refresh-0.14.0.tgz",
+ "integrity": "sha512-wViHqhAd8OHeLS/IRMJjTSDHF3U9eWi62F/MledQGPdJGDhodXJ9PBLNGr6WWL7qlH12Mt3TyTpbS+hGXMjCzQ==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/react-router": {
+ "version": "6.21.1",
+ "resolved": "https://registry.npmjs.org/react-router/-/react-router-6.21.1.tgz",
+ "integrity": "sha512-W0l13YlMTm1YrpVIOpjCADJqEUpz1vm+CMo47RuFX4Ftegwm6KOYsL5G3eiE52jnJpKvzm6uB/vTKTPKM8dmkA==",
+ "dependencies": {
+ "@remix-run/router": "1.14.1"
+ },
+ "engines": {
+ "node": ">=14.0.0"
+ },
+ "peerDependencies": {
+ "react": ">=16.8"
+ }
+ },
+ "node_modules/react-router-dom": {
+ "version": "6.21.1",
+ "resolved": "https://registry.npmjs.org/react-router-dom/-/react-router-dom-6.21.1.tgz",
+ "integrity": "sha512-QCNrtjtDPwHDO+AO21MJd7yIcr41UetYt5jzaB9Y1UYaPTCnVuJq6S748g1dE11OQlCFIQg+RtAA1SEZIyiBeA==",
+ "dependencies": {
+ "@remix-run/router": "1.14.1",
+ "react-router": "6.21.1"
+ },
+ "engines": {
+ "node": ">=14.0.0"
+ },
+ "peerDependencies": {
+ "react": ">=16.8",
+ "react-dom": ">=16.8"
+ }
+ },
+ "node_modules/reflect.getprototypeof": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/reflect.getprototypeof/-/reflect.getprototypeof-1.0.4.tgz",
+ "integrity": "sha512-ECkTw8TmJwW60lOTR+ZkODISW6RQ8+2CL3COqtiJKLd6MmB45hN51HprHFziKLGkAuTGQhBb91V8cy+KHlaCjw==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1",
+ "get-intrinsic": "^1.2.1",
+ "globalthis": "^1.0.3",
+ "which-builtin-type": "^1.1.3"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/regexp.prototype.flags": {
+ "version": "1.5.1",
+ "resolved": "https://registry.npmjs.org/regexp.prototype.flags/-/regexp.prototype.flags-1.5.1.tgz",
+ "integrity": "sha512-sy6TXMN+hnP/wMy+ISxg3krXx7BAtWVO4UouuCN/ziM9UEne0euamVNafDfvC83bRNr95y0V5iijeDQFUNpvrg==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "set-function-name": "^2.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/resolve": {
+ "version": "2.0.0-next.5",
+ "resolved": "https://registry.npmjs.org/resolve/-/resolve-2.0.0-next.5.tgz",
+ "integrity": "sha512-U7WjGVG9sH8tvjW5SmGbQuui75FiyjAX72HX15DwBBwF9dNiQZRQAg9nnPhYy+TUnE0+VcrttuvNI8oSxZcocA==",
+ "dev": true,
+ "dependencies": {
+ "is-core-module": "^2.13.0",
+ "path-parse": "^1.0.7",
+ "supports-preserve-symlinks-flag": "^1.0.0"
+ },
+ "bin": {
+ "resolve": "bin/resolve"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/resolve-from": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-4.0.0.tgz",
+ "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==",
+ "dev": true,
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/reusify": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz",
+ "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==",
+ "dev": true,
+ "engines": {
+ "iojs": ">=1.0.0",
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/rimraf": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz",
+ "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==",
+ "dev": true,
+ "dependencies": {
+ "glob": "^7.1.3"
+ },
+ "bin": {
+ "rimraf": "bin.js"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/isaacs"
+ }
+ },
+ "node_modules/rollup": {
+ "version": "4.9.1",
+ "resolved": "https://registry.npmjs.org/rollup/-/rollup-4.9.1.tgz",
+ "integrity": "sha512-pgPO9DWzLoW/vIhlSoDByCzcpX92bKEorbgXuZrqxByte3JFk2xSW2JEeAcyLc9Ru9pqcNNW+Ob7ntsk2oT/Xw==",
+ "dev": true,
+ "bin": {
+ "rollup": "dist/bin/rollup"
+ },
+ "engines": {
+ "node": ">=18.0.0",
+ "npm": ">=8.0.0"
+ },
+ "optionalDependencies": {
+ "@rollup/rollup-android-arm-eabi": "4.9.1",
+ "@rollup/rollup-android-arm64": "4.9.1",
+ "@rollup/rollup-darwin-arm64": "4.9.1",
+ "@rollup/rollup-darwin-x64": "4.9.1",
+ "@rollup/rollup-linux-arm-gnueabihf": "4.9.1",
+ "@rollup/rollup-linux-arm64-gnu": "4.9.1",
+ "@rollup/rollup-linux-arm64-musl": "4.9.1",
+ "@rollup/rollup-linux-riscv64-gnu": "4.9.1",
+ "@rollup/rollup-linux-x64-gnu": "4.9.1",
+ "@rollup/rollup-linux-x64-musl": "4.9.1",
+ "@rollup/rollup-win32-arm64-msvc": "4.9.1",
+ "@rollup/rollup-win32-ia32-msvc": "4.9.1",
+ "@rollup/rollup-win32-x64-msvc": "4.9.1",
+ "fsevents": "~2.3.2"
+ }
+ },
+ "node_modules/run-parallel": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz",
+ "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==",
+ "dev": true,
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/feross"
+ },
+ {
+ "type": "patreon",
+ "url": "https://www.patreon.com/feross"
+ },
+ {
+ "type": "consulting",
+ "url": "https://feross.org/support"
+ }
+ ],
+ "dependencies": {
+ "queue-microtask": "^1.2.2"
+ }
+ },
+ "node_modules/safe-array-concat": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/safe-array-concat/-/safe-array-concat-1.0.1.tgz",
+ "integrity": "sha512-6XbUAseYE2KtOuGueyeobCySj9L4+66Tn6KQMOPQJrAJEowYKW/YR/MGJZl7FdydUdaFu4LYyDZjxf4/Nmo23Q==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "get-intrinsic": "^1.2.1",
+ "has-symbols": "^1.0.3",
+ "isarray": "^2.0.5"
+ },
+ "engines": {
+ "node": ">=0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/safe-regex-test": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/safe-regex-test/-/safe-regex-test-1.0.0.tgz",
+ "integrity": "sha512-JBUUzyOgEwXQY1NuPtvcj/qcBDbDmEvWufhlnXZIm75DEHp+afM1r1ujJpJsV/gSM4t59tpDyPi1sd6ZaPFfsA==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "get-intrinsic": "^1.1.3",
+ "is-regex": "^1.1.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/scheduler": {
+ "version": "0.23.0",
+ "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.23.0.tgz",
+ "integrity": "sha512-CtuThmgHNg7zIZWAXi3AsyIzA3n4xx7aNyjwC2VJldO2LMVDhFK+63xGqq6CsJH4rTAt6/M+N4GhZiDYPx9eUw==",
+ "dependencies": {
+ "loose-envify": "^1.1.0"
+ }
+ },
+ "node_modules/semver": {
+ "version": "6.3.1",
+ "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+ "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
+ "dev": true,
+ "bin": {
+ "semver": "bin/semver.js"
+ }
+ },
+ "node_modules/set-function-length": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.1.1.tgz",
+ "integrity": "sha512-VoaqjbBJKiWtg4yRcKBQ7g7wnGnLV3M8oLvVWwOk2PdYY6PEFegR1vezXR0tw6fZGF9csVakIRjrJiy2veSBFQ==",
+ "dev": true,
+ "dependencies": {
+ "define-data-property": "^1.1.1",
+ "get-intrinsic": "^1.2.1",
+ "gopd": "^1.0.1",
+ "has-property-descriptors": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/set-function-name": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/set-function-name/-/set-function-name-2.0.1.tgz",
+ "integrity": "sha512-tMNCiqYVkXIZgc2Hnoy2IvC/f8ezc5koaRFkCjrpWzGpCd3qbZXPzVy9MAZzK1ch/X0jvSkojys3oqJN0qCmdA==",
+ "dev": true,
+ "dependencies": {
+ "define-data-property": "^1.0.1",
+ "functions-have-names": "^1.2.3",
+ "has-property-descriptors": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/shebang-command": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz",
+ "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==",
+ "dev": true,
+ "dependencies": {
+ "shebang-regex": "^3.0.0"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/shebang-regex": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz",
+ "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==",
+ "dev": true,
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/side-channel": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.4.tgz",
+ "integrity": "sha512-q5XPytqFEIKHkGdiMIrY10mvLRvnQh42/+GoBlFW3b2LXLE2xxJpZFdm94we0BaoV3RwJyGqg5wS7epxTv0Zvw==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.0",
+ "get-intrinsic": "^1.0.2",
+ "object-inspect": "^1.9.0"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/source-map-js": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.0.2.tgz",
+ "integrity": "sha512-R0XvVJ9WusLiqTCEiGCmICCMplcCkIwwR11mOSD9CR5u+IXYdiseeEuXCVAjS54zqwkLcPNnmU4OeJ6tUrWhDw==",
+ "dev": true,
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/string.prototype.matchall": {
+ "version": "4.0.10",
+ "resolved": "https://registry.npmjs.org/string.prototype.matchall/-/string.prototype.matchall-4.0.10.tgz",
+ "integrity": "sha512-rGXbGmOEosIQi6Qva94HUjgPs9vKW+dkG7Y8Q5O2OYkWL6wFaTRZO8zM4mhP94uX55wgyrXzfS2aGtGzUL7EJQ==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1",
+ "get-intrinsic": "^1.2.1",
+ "has-symbols": "^1.0.3",
+ "internal-slot": "^1.0.5",
+ "regexp.prototype.flags": "^1.5.0",
+ "set-function-name": "^2.0.0",
+ "side-channel": "^1.0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/string.prototype.trim": {
+ "version": "1.2.8",
+ "resolved": "https://registry.npmjs.org/string.prototype.trim/-/string.prototype.trim-1.2.8.tgz",
+ "integrity": "sha512-lfjY4HcixfQXOfaqCvcBuOIapyaroTXhbkfJN3gcB1OtyupngWK4sEET9Knd0cXd28kTUqu/kHoV4HKSJdnjiQ==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/string.prototype.trimend": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.7.tgz",
+ "integrity": "sha512-Ni79DqeB72ZFq1uH/L6zJ+DKZTkOtPIHovb3YZHQViE+HDouuU4mBrLOLDn5Dde3RF8qw5qVETEjhu9locMLvA==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/string.prototype.trimstart": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.7.tgz",
+ "integrity": "sha512-NGhtDFu3jCEm7B4Fy0DpLewdJQOZcQ0rGbwQ/+stjnrp2i+rlKeCvos9hOIeCmqwratM47OBxY7uFZzjxHXmrg==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "define-properties": "^1.2.0",
+ "es-abstract": "^1.22.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/strip-ansi": {
+ "version": "6.0.1",
+ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz",
+ "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==",
+ "dev": true,
+ "dependencies": {
+ "ansi-regex": "^5.0.1"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/strip-json-comments": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.1.1.tgz",
+ "integrity": "sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==",
+ "dev": true,
+ "engines": {
+ "node": ">=8"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/supports-color": {
+ "version": "5.5.0",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
+ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
+ "dev": true,
+ "dependencies": {
+ "has-flag": "^3.0.0"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/supports-preserve-symlinks-flag": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz",
+ "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==",
+ "dev": true,
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/text-table": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/text-table/-/text-table-0.2.0.tgz",
+ "integrity": "sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==",
+ "dev": true
+ },
+ "node_modules/to-fast-properties": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz",
+ "integrity": "sha512-/OaKK0xYrs3DmxRYqL/yDc+FxFUVYhDlXMhRmv3z915w2HF1tnN1omB354j8VUGO/hbRzyD6Y3sA7v7GS/ceog==",
+ "dev": true,
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/type-check": {
+ "version": "0.4.0",
+ "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.4.0.tgz",
+ "integrity": "sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==",
+ "dev": true,
+ "dependencies": {
+ "prelude-ls": "^1.2.1"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/type-fest": {
+ "version": "0.20.2",
+ "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.20.2.tgz",
+ "integrity": "sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==",
+ "dev": true,
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/typed-array-buffer": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/typed-array-buffer/-/typed-array-buffer-1.0.0.tgz",
+ "integrity": "sha512-Y8KTSIglk9OZEr8zywiIHG/kmQ7KWyjseXs1CbSo8vC42w7hg2HgYTxSWwP0+is7bWDc1H+Fo026CpHFwm8tkw==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "get-intrinsic": "^1.2.1",
+ "is-typed-array": "^1.1.10"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/typed-array-byte-length": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/typed-array-byte-length/-/typed-array-byte-length-1.0.0.tgz",
+ "integrity": "sha512-Or/+kvLxNpeQ9DtSydonMxCx+9ZXOswtwJn17SNLvhptaXYDJvkFFP5zbfU/uLmvnBJlI4yrnXRxpdWH/M5tNA==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "for-each": "^0.3.3",
+ "has-proto": "^1.0.1",
+ "is-typed-array": "^1.1.10"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/typed-array-byte-offset": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/typed-array-byte-offset/-/typed-array-byte-offset-1.0.0.tgz",
+ "integrity": "sha512-RD97prjEt9EL8YgAgpOkf3O4IF9lhJFr9g0htQkm0rchFp/Vx7LW5Q8fSXXub7BXAODyUQohRMyOc3faCPd0hg==",
+ "dev": true,
+ "dependencies": {
+ "available-typed-arrays": "^1.0.5",
+ "call-bind": "^1.0.2",
+ "for-each": "^0.3.3",
+ "has-proto": "^1.0.1",
+ "is-typed-array": "^1.1.10"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/typed-array-length": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/typed-array-length/-/typed-array-length-1.0.4.tgz",
+ "integrity": "sha512-KjZypGq+I/H7HI5HlOoGHkWUUGq+Q0TPhQurLbyrVrvnKTBgzLhIJ7j6J/XTQOi0d1RjyZ0wdas8bKs2p0x3Ng==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "for-each": "^0.3.3",
+ "is-typed-array": "^1.1.9"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/unbox-primitive": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/unbox-primitive/-/unbox-primitive-1.0.2.tgz",
+ "integrity": "sha512-61pPlCD9h51VoreyJ0BReideM3MDKMKnh6+V9L08331ipq6Q8OFXZYiqP6n/tbHx4s5I9uRhcye6BrbkizkBDw==",
+ "dev": true,
+ "dependencies": {
+ "call-bind": "^1.0.2",
+ "has-bigints": "^1.0.2",
+ "has-symbols": "^1.0.3",
+ "which-boxed-primitive": "^1.0.2"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/update-browserslist-db": {
+ "version": "1.0.13",
+ "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.0.13.tgz",
+ "integrity": "sha512-xebP81SNcPuNpPP3uzeW1NYXxI3rxyJzF3pD6sH4jE7o/IX+WtSpwnVU+qIsDPyk0d3hmFQ7mjqc6AtV604hbg==",
+ "dev": true,
+ "funding": [
+ {
+ "type": "opencollective",
+ "url": "https://opencollective.com/browserslist"
+ },
+ {
+ "type": "tidelift",
+ "url": "https://tidelift.com/funding/github/npm/browserslist"
+ },
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/ai"
+ }
+ ],
+ "dependencies": {
+ "escalade": "^3.1.1",
+ "picocolors": "^1.0.0"
+ },
+ "bin": {
+ "update-browserslist-db": "cli.js"
+ },
+ "peerDependencies": {
+ "browserslist": ">= 4.21.0"
+ }
+ },
+ "node_modules/uri-js": {
+ "version": "4.4.1",
+ "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.1.tgz",
+ "integrity": "sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==",
+ "dev": true,
+ "dependencies": {
+ "punycode": "^2.1.0"
+ }
+ },
+ "node_modules/vite": {
+ "version": "5.0.10",
+ "resolved": "https://registry.npmjs.org/vite/-/vite-5.0.10.tgz",
+ "integrity": "sha512-2P8J7WWgmc355HUMlFrwofacvr98DAjoE52BfdbwQtyLH06XKwaL/FMnmKM2crF0iX4MpmMKoDlNCB1ok7zHCw==",
+ "dev": true,
+ "dependencies": {
+ "esbuild": "^0.19.3",
+ "postcss": "^8.4.32",
+ "rollup": "^4.2.0"
+ },
+ "bin": {
+ "vite": "bin/vite.js"
+ },
+ "engines": {
+ "node": "^18.0.0 || >=20.0.0"
+ },
+ "funding": {
+ "url": "https://github.com/vitejs/vite?sponsor=1"
+ },
+ "optionalDependencies": {
+ "fsevents": "~2.3.3"
+ },
+ "peerDependencies": {
+ "@types/node": "^18.0.0 || >=20.0.0",
+ "less": "*",
+ "lightningcss": "^1.21.0",
+ "sass": "*",
+ "stylus": "*",
+ "sugarss": "*",
+ "terser": "^5.4.0"
+ },
+ "peerDependenciesMeta": {
+ "@types/node": {
+ "optional": true
+ },
+ "less": {
+ "optional": true
+ },
+ "lightningcss": {
+ "optional": true
+ },
+ "sass": {
+ "optional": true
+ },
+ "stylus": {
+ "optional": true
+ },
+ "sugarss": {
+ "optional": true
+ },
+ "terser": {
+ "optional": true
+ }
+ }
+ },
+ "node_modules/which": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz",
+ "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==",
+ "dev": true,
+ "dependencies": {
+ "isexe": "^2.0.0"
+ },
+ "bin": {
+ "node-which": "bin/node-which"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/which-boxed-primitive": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/which-boxed-primitive/-/which-boxed-primitive-1.0.2.tgz",
+ "integrity": "sha512-bwZdv0AKLpplFY2KZRX6TvyuN7ojjr7lwkg6ml0roIy9YeuSr7JS372qlNW18UQYzgYK9ziGcerWqZOmEn9VNg==",
+ "dev": true,
+ "dependencies": {
+ "is-bigint": "^1.0.1",
+ "is-boolean-object": "^1.1.0",
+ "is-number-object": "^1.0.4",
+ "is-string": "^1.0.5",
+ "is-symbol": "^1.0.3"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/which-builtin-type": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/which-builtin-type/-/which-builtin-type-1.1.3.tgz",
+ "integrity": "sha512-YmjsSMDBYsM1CaFiayOVT06+KJeXf0o5M/CAd4o1lTadFAtacTUM49zoYxr/oroopFDfhvN6iEcBxUyc3gvKmw==",
+ "dev": true,
+ "dependencies": {
+ "function.prototype.name": "^1.1.5",
+ "has-tostringtag": "^1.0.0",
+ "is-async-function": "^2.0.0",
+ "is-date-object": "^1.0.5",
+ "is-finalizationregistry": "^1.0.2",
+ "is-generator-function": "^1.0.10",
+ "is-regex": "^1.1.4",
+ "is-weakref": "^1.0.2",
+ "isarray": "^2.0.5",
+ "which-boxed-primitive": "^1.0.2",
+ "which-collection": "^1.0.1",
+ "which-typed-array": "^1.1.9"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/which-collection": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/which-collection/-/which-collection-1.0.1.tgz",
+ "integrity": "sha512-W8xeTUwaln8i3K/cY1nGXzdnVZlidBcagyNFtBdD5kxnb4TvGKR7FfSIS3mYpwWS1QUCutfKz8IY8RjftB0+1A==",
+ "dev": true,
+ "dependencies": {
+ "is-map": "^2.0.1",
+ "is-set": "^2.0.1",
+ "is-weakmap": "^2.0.1",
+ "is-weakset": "^2.0.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/which-typed-array": {
+ "version": "1.1.13",
+ "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.13.tgz",
+ "integrity": "sha512-P5Nra0qjSncduVPEAr7xhoF5guty49ArDTwzJ/yNuPIbZppyRxFQsRCWrocxIY+CnMVG+qfbU2FmDKyvSGClow==",
+ "dev": true,
+ "dependencies": {
+ "available-typed-arrays": "^1.0.5",
+ "call-bind": "^1.0.4",
+ "for-each": "^0.3.3",
+ "gopd": "^1.0.1",
+ "has-tostringtag": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/wrappy": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
+ "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==",
+ "dev": true
+ },
+ "node_modules/yallist": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz",
+ "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==",
+ "dev": true
+ },
+ "node_modules/yocto-queue": {
+ "version": "0.1.0",
+ "resolved": "https://registry.npmjs.org/yocto-queue/-/yocto-queue-0.1.0.tgz",
+ "integrity": "sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==",
+ "dev": true,
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ }
+ }
+}
diff --git a/client/package.json b/client/package.json
new file mode 100644
index 000000000..1037f4906
--- /dev/null
+++ b/client/package.json
@@ -0,0 +1,29 @@
+{
+ "name": "client",
+ "private": true,
+ "version": "0.0.0",
+ "type": "module",
+ "scripts": {
+ "dev": "vite",
+ "build": "vite build",
+ "lint": "eslint . --ext js,jsx --report-unused-disable-directives --max-warnings 0",
+ "preview": "vite preview"
+ },
+ "dependencies": {
+ "axios": "^1.6.2",
+ "bootstrap": "^5.3.0",
+ "react": "^18.2.0",
+ "react-dom": "^18.2.0",
+ "react-router-dom": "^6.21.1"
+ },
+ "devDependencies": {
+ "@types/react": "^18.2.43",
+ "@types/react-dom": "^18.2.17",
+ "@vitejs/plugin-react": "^4.2.1",
+ "eslint": "^8.55.0",
+ "eslint-plugin-react": "^7.33.2",
+ "eslint-plugin-react-hooks": "^4.6.0",
+ "eslint-plugin-react-refresh": "^0.4.5",
+ "vite": "^5.0.8"
+ }
+}
diff --git a/assets/images/Galaxy_S7.png b/client/public/images/Galaxy_S7.png
similarity index 100%
rename from assets/images/Galaxy_S7.png
rename to client/public/images/Galaxy_S7.png
diff --git a/assets/images/Honor_10.png b/client/public/images/Honor_10.png
similarity index 100%
rename from assets/images/Honor_10.png
rename to client/public/images/Honor_10.png
diff --git a/assets/images/IPhone_7.png b/client/public/images/IPhone_7.png
similarity index 100%
rename from assets/images/IPhone_7.png
rename to client/public/images/IPhone_7.png
diff --git a/assets/images/Moto_G6.png b/client/public/images/Moto_G6.png
similarity index 100%
rename from assets/images/Moto_G6.png
rename to client/public/images/Moto_G6.png
diff --git a/assets/images/Nokia_7.1.jpg b/client/public/images/Nokia_7.1.jpg
similarity index 100%
rename from assets/images/Nokia_7.1.jpg
rename to client/public/images/Nokia_7.1.jpg
diff --git a/assets/images/P10_Lite.jpg b/client/public/images/P10_Lite.jpg
similarity index 100%
rename from assets/images/P10_Lite.jpg
rename to client/public/images/P10_Lite.jpg
diff --git a/assets/images/Xiaomi_MI_A2.jpeg b/client/public/images/Xiaomi_MI_A2.jpeg
similarity index 100%
rename from assets/images/Xiaomi_MI_A2.jpeg
rename to client/public/images/Xiaomi_MI_A2.jpeg
diff --git a/assets/images/ZenPhone_5.jpg b/client/public/images/ZenPhone_5.jpg
similarity index 100%
rename from assets/images/ZenPhone_5.jpg
rename to client/public/images/ZenPhone_5.jpg
diff --git a/client/public/vite.svg b/client/public/vite.svg
new file mode 100644
index 000000000..e7b8dfb1b
--- /dev/null
+++ b/client/public/vite.svg
@@ -0,0 +1 @@
+
\ No newline at end of file
diff --git a/client/src/App.css b/client/src/App.css
new file mode 100644
index 000000000..b9d355df2
--- /dev/null
+++ b/client/src/App.css
@@ -0,0 +1,42 @@
+#root {
+ max-width: 1280px;
+ margin: 0 auto;
+ padding: 2rem;
+ text-align: center;
+}
+
+.logo {
+ height: 6em;
+ padding: 1.5em;
+ will-change: filter;
+ transition: filter 300ms;
+}
+.logo:hover {
+ filter: drop-shadow(0 0 2em #646cffaa);
+}
+.logo.react:hover {
+ filter: drop-shadow(0 0 2em #61dafbaa);
+}
+
+@keyframes logo-spin {
+ from {
+ transform: rotate(0deg);
+ }
+ to {
+ transform: rotate(360deg);
+ }
+}
+
+@media (prefers-reduced-motion: no-preference) {
+ a:nth-of-type(2) .logo {
+ animation: logo-spin infinite 20s linear;
+ }
+}
+
+.card {
+ padding: 2em;
+}
+
+.read-the-docs {
+ color: #888;
+}
diff --git a/client/src/App.jsx b/client/src/App.jsx
new file mode 100644
index 000000000..a6ff14abf
--- /dev/null
+++ b/client/src/App.jsx
@@ -0,0 +1,18 @@
+import './App.css'
+import React from 'react'
+import { Route, Routes } from 'react-router-dom'
+import HomePage from "./Pages/HomePage/index.jsx"
+import 'bootstrap/dist/css/bootstrap.min.css';
+
+
+function App() {
+ return(
+
+
+ }/>
+
+
+ )
+}
+
+export default App
diff --git a/client/src/Pages/HomePage/index.jsx b/client/src/Pages/HomePage/index.jsx
new file mode 100644
index 000000000..6cdc3a74d
--- /dev/null
+++ b/client/src/Pages/HomePage/index.jsx
@@ -0,0 +1,81 @@
+import axios from "axios";
+import { useState, useEffect } from 'react';
+import 'bootstrap/dist/css/bootstrap.min.css';
+
+
+export default function HomePage() {
+ const API = "http://localhost:3000/phones";
+
+ const [phoneList, setPhoneList] = useState([]);
+ const [loadingPage, setLoadingPage] = useState(true);
+ const [loadingPhoneSimulation, setLoadingPhoneSimulation] = useState(true);
+ const [phone, setPhone] = useState(null);
+
+ useEffect(() => {
+ getAllPhones();
+ }, [])
+
+ const getAllPhones = async () => {
+ try {
+ const response = await axios.get(API);
+ console.log(response.data);
+ setPhoneList(response.data);
+ } catch (error) {
+ console.error(error);
+ } finally {
+ setTimeout(() => {
+ setLoadingPage(false);
+ }, 1000);
+ }
+ }
+
+ const getPhone = async (id) => {
+ try {
+ const response = await axios.get(`${API}/${id}`);
+ setPhone(response.data[0]);
+ } catch (error) {
+ console.error(error);
+ } finally {
+ setTimeout(() => {
+ setLoadingPhoneSimulation(false);
+ }, 1000);
+ }
+ }
+
+ return (
+
+
All Phones
+
+
+
+ {phoneList.map((phone, index) => (
+
+ {phone.name}
+
+ getPhone(phone.id)}>Details
+
+ ))}
+
+
+
+
+ {phone && (
+
+
+
+
{phone.name}
+
Manufacturer: {phone.manufacturer}
+
Description: {phone.description}
+
Color: {phone.color}
+
Price: ${phone.price}
+
Screen: {phone.screen}
+
Processor: {phone.processor}
+
RAM: {phone.ram} GB
+
+
+ )}
+
+
+
+ );
+}
diff --git a/client/src/assets/react.svg b/client/src/assets/react.svg
new file mode 100644
index 000000000..6c87de9bb
--- /dev/null
+++ b/client/src/assets/react.svg
@@ -0,0 +1 @@
+
\ No newline at end of file
diff --git a/client/src/index.css b/client/src/index.css
new file mode 100644
index 000000000..6119ad9a8
--- /dev/null
+++ b/client/src/index.css
@@ -0,0 +1,68 @@
+:root {
+ font-family: Inter, system-ui, Avenir, Helvetica, Arial, sans-serif;
+ line-height: 1.5;
+ font-weight: 400;
+
+ color-scheme: light dark;
+ color: rgba(255, 255, 255, 0.87);
+ background-color: #242424;
+
+ font-synthesis: none;
+ text-rendering: optimizeLegibility;
+ -webkit-font-smoothing: antialiased;
+ -moz-osx-font-smoothing: grayscale;
+}
+
+a {
+ font-weight: 500;
+ color: #646cff;
+ text-decoration: inherit;
+}
+a:hover {
+ color: #535bf2;
+}
+
+body {
+ margin: 0;
+ display: flex;
+ place-items: center;
+ min-width: 320px;
+ min-height: 100vh;
+}
+
+h1 {
+ font-size: 3.2em;
+ line-height: 1.1;
+}
+
+button {
+ border-radius: 8px;
+ border: 1px solid transparent;
+ padding: 0.6em 1.2em;
+ font-size: 1em;
+ font-weight: 500;
+ font-family: inherit;
+ background-color: #1a1a1a;
+ cursor: pointer;
+ transition: border-color 0.25s;
+}
+button:hover {
+ border-color: #646cff;
+}
+button:focus,
+button:focus-visible {
+ outline: 4px auto -webkit-focus-ring-color;
+}
+
+@media (prefers-color-scheme: light) {
+ :root {
+ color: #213547;
+ background-color: #ffffff;
+ }
+ a:hover {
+ color: #747bff;
+ }
+ button {
+ background-color: #f9f9f9;
+ }
+}
diff --git a/client/src/main.jsx b/client/src/main.jsx
new file mode 100644
index 000000000..27b95f0c5
--- /dev/null
+++ b/client/src/main.jsx
@@ -0,0 +1,13 @@
+import React from 'react'
+import ReactDOM from 'react-dom/client'
+import App from './App.jsx'
+import './index.css'
+import { BrowserRouter as Router, Route } from "react-router-dom"
+
+ReactDOM.createRoot(document.getElementById('root')).render(
+
+
+
+
+ ,
+)
diff --git a/client/vite.config.js b/client/vite.config.js
new file mode 100644
index 000000000..5a33944a9
--- /dev/null
+++ b/client/vite.config.js
@@ -0,0 +1,7 @@
+import { defineConfig } from 'vite'
+import react from '@vitejs/plugin-react'
+
+// https://vitejs.dev/config/
+export default defineConfig({
+ plugins: [react()],
+})
diff --git a/server/app.js b/server/app.js
new file mode 100644
index 000000000..ef994c39c
--- /dev/null
+++ b/server/app.js
@@ -0,0 +1,26 @@
+const cors = require('cors');
+const express = require('express');
+const app = express();
+
+const phones = require('./data/phones.json');
+app.use(express.static('./assets/images'));
+
+app.use(cors());
+
+app.get('/', (req, res) => {
+ res.send('Server is Running!');
+});
+
+app.get('/phones', (req,res) => {
+ res.send(phones)
+})
+
+app.get('/phones/:phoneId', (req,res) => {
+ const {phoneId} = req.params;
+ const foundPhone = phones.filter((phone) =>{ return phone.id == phoneId});
+ res.send(foundPhone);
+})
+
+const port = process.env.PORT || 3000;
+app.listen(port, () => { console.log(`Server is running on port ${port}`);
+});
\ No newline at end of file
diff --git a/server/assets/images/Galaxy_S7.png b/server/assets/images/Galaxy_S7.png
new file mode 100644
index 000000000..137e356f5
Binary files /dev/null and b/server/assets/images/Galaxy_S7.png differ
diff --git a/server/assets/images/Honor_10.png b/server/assets/images/Honor_10.png
new file mode 100644
index 000000000..28b752d09
Binary files /dev/null and b/server/assets/images/Honor_10.png differ
diff --git a/server/assets/images/IPhone_7.png b/server/assets/images/IPhone_7.png
new file mode 100644
index 000000000..d6647be20
Binary files /dev/null and b/server/assets/images/IPhone_7.png differ
diff --git a/server/assets/images/Moto_G6.png b/server/assets/images/Moto_G6.png
new file mode 100644
index 000000000..4f81a52fe
Binary files /dev/null and b/server/assets/images/Moto_G6.png differ
diff --git a/server/assets/images/Nokia_7.1.jpg b/server/assets/images/Nokia_7.1.jpg
new file mode 100644
index 000000000..3b0711b18
Binary files /dev/null and b/server/assets/images/Nokia_7.1.jpg differ
diff --git a/server/assets/images/P10_Lite.jpg b/server/assets/images/P10_Lite.jpg
new file mode 100644
index 000000000..02d2d52f3
Binary files /dev/null and b/server/assets/images/P10_Lite.jpg differ
diff --git a/server/assets/images/Xiaomi_MI_A2.jpeg b/server/assets/images/Xiaomi_MI_A2.jpeg
new file mode 100644
index 000000000..12d0665df
Binary files /dev/null and b/server/assets/images/Xiaomi_MI_A2.jpeg differ
diff --git a/server/assets/images/ZenPhone_5.jpg b/server/assets/images/ZenPhone_5.jpg
new file mode 100644
index 000000000..2d5512a22
Binary files /dev/null and b/server/assets/images/ZenPhone_5.jpg differ
diff --git a/data/phones.json b/server/data/phones.json
similarity index 100%
rename from data/phones.json
rename to server/data/phones.json
diff --git a/server/node_modules/.bin/mime b/server/node_modules/.bin/mime
new file mode 120000
index 000000000..fbb7ee0ee
--- /dev/null
+++ b/server/node_modules/.bin/mime
@@ -0,0 +1 @@
+../mime/cli.js
\ No newline at end of file
diff --git a/server/node_modules/.package-lock.json b/server/node_modules/.package-lock.json
new file mode 100644
index 000000000..da1880873
--- /dev/null
+++ b/server/node_modules/.package-lock.json
@@ -0,0 +1,680 @@
+{
+ "name": "server",
+ "version": "1.0.0",
+ "lockfileVersion": 3,
+ "requires": true,
+ "packages": {
+ "node_modules/accepts": {
+ "version": "1.3.8",
+ "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz",
+ "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==",
+ "dependencies": {
+ "mime-types": "~2.1.34",
+ "negotiator": "0.6.3"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/array-flatten": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz",
+ "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg=="
+ },
+ "node_modules/body-parser": {
+ "version": "1.20.1",
+ "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.1.tgz",
+ "integrity": "sha512-jWi7abTbYwajOytWCQc37VulmWiRae5RyTpaCyDcS5/lMdtwSz5lOpDE67srw/HYe35f1z3fDQw+3txg7gNtWw==",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "content-type": "~1.0.4",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "on-finished": "2.4.1",
+ "qs": "6.11.0",
+ "raw-body": "2.5.1",
+ "type-is": "~1.6.18",
+ "unpipe": "1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ }
+ },
+ "node_modules/bytes": {
+ "version": "3.1.2",
+ "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz",
+ "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/call-bind": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.5.tgz",
+ "integrity": "sha512-C3nQxfFZxFRVoJoGKKI8y3MOEo129NQ+FgQ08iye+Mk4zNZZGdjfs06bVTr+DBSlA66Q2VEcMki/cUCP4SercQ==",
+ "dependencies": {
+ "function-bind": "^1.1.2",
+ "get-intrinsic": "^1.2.1",
+ "set-function-length": "^1.1.1"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/content-disposition": {
+ "version": "0.5.4",
+ "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz",
+ "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==",
+ "dependencies": {
+ "safe-buffer": "5.2.1"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/content-type": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz",
+ "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/cookie": {
+ "version": "0.5.0",
+ "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.5.0.tgz",
+ "integrity": "sha512-YZ3GUyn/o8gfKJlnlX7g7xq4gyO6OSuhGPKaaGssGB2qgDUS0gPgtTvoyZLTt9Ab6dC4hfc9dV5arkvc/OCmrw==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/cookie-signature": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz",
+ "integrity": "sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ=="
+ },
+ "node_modules/cors": {
+ "version": "2.8.5",
+ "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.5.tgz",
+ "integrity": "sha512-KIHbLJqu73RGr/hnbrO9uBeixNGuvSQjul/jdFvS/KFSIH1hWVd1ng7zOHx+YrEfInLG7q4n6GHQ9cDtxv/P6g==",
+ "dependencies": {
+ "object-assign": "^4",
+ "vary": "^1"
+ },
+ "engines": {
+ "node": ">= 0.10"
+ }
+ },
+ "node_modules/debug": {
+ "version": "2.6.9",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+ "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+ "dependencies": {
+ "ms": "2.0.0"
+ }
+ },
+ "node_modules/define-data-property": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.1.tgz",
+ "integrity": "sha512-E7uGkTzkk1d0ByLeSc6ZsFS79Axg+m1P/VsgYsxHgiuc3tFSj+MjMIwe90FC4lOAZzNBdY7kkO2P2wKdsQ1vgQ==",
+ "dependencies": {
+ "get-intrinsic": "^1.2.1",
+ "gopd": "^1.0.1",
+ "has-property-descriptors": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/depd": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz",
+ "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/destroy": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz",
+ "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==",
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ }
+ },
+ "node_modules/dotenv": {
+ "version": "16.3.1",
+ "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-16.3.1.tgz",
+ "integrity": "sha512-IPzF4w4/Rd94bA9imS68tZBaYyBWSCE47V1RGuMrB94iyTOIEwRmVL2x/4An+6mETpLrKJ5hQkB8W4kFAadeIQ==",
+ "engines": {
+ "node": ">=12"
+ },
+ "funding": {
+ "url": "https://github.com/motdotla/dotenv?sponsor=1"
+ }
+ },
+ "node_modules/ee-first": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
+ "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow=="
+ },
+ "node_modules/encodeurl": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz",
+ "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/escape-html": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
+ "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow=="
+ },
+ "node_modules/etag": {
+ "version": "1.8.1",
+ "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
+ "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/express": {
+ "version": "4.18.2",
+ "resolved": "https://registry.npmjs.org/express/-/express-4.18.2.tgz",
+ "integrity": "sha512-5/PsL6iGPdfQ/lKM1UuielYgv3BUoJfz1aUwU9vHZ+J7gyvwdQXFEBIEIaxeGf0GIcreATNyBExtalisDbuMqQ==",
+ "dependencies": {
+ "accepts": "~1.3.8",
+ "array-flatten": "1.1.1",
+ "body-parser": "1.20.1",
+ "content-disposition": "0.5.4",
+ "content-type": "~1.0.4",
+ "cookie": "0.5.0",
+ "cookie-signature": "1.0.6",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "encodeurl": "~1.0.2",
+ "escape-html": "~1.0.3",
+ "etag": "~1.8.1",
+ "finalhandler": "1.2.0",
+ "fresh": "0.5.2",
+ "http-errors": "2.0.0",
+ "merge-descriptors": "1.0.1",
+ "methods": "~1.1.2",
+ "on-finished": "2.4.1",
+ "parseurl": "~1.3.3",
+ "path-to-regexp": "0.1.7",
+ "proxy-addr": "~2.0.7",
+ "qs": "6.11.0",
+ "range-parser": "~1.2.1",
+ "safe-buffer": "5.2.1",
+ "send": "0.18.0",
+ "serve-static": "1.15.0",
+ "setprototypeof": "1.2.0",
+ "statuses": "2.0.1",
+ "type-is": "~1.6.18",
+ "utils-merge": "1.0.1",
+ "vary": "~1.1.2"
+ },
+ "engines": {
+ "node": ">= 0.10.0"
+ }
+ },
+ "node_modules/finalhandler": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.2.0.tgz",
+ "integrity": "sha512-5uXcUVftlQMFnWC9qu/svkWv3GTd2PfUhK/3PLkYNAe7FbqJMt3515HaxE6eRL74GdsriiwujiawdaB1BpEISg==",
+ "dependencies": {
+ "debug": "2.6.9",
+ "encodeurl": "~1.0.2",
+ "escape-html": "~1.0.3",
+ "on-finished": "2.4.1",
+ "parseurl": "~1.3.3",
+ "statuses": "2.0.1",
+ "unpipe": "~1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/forwarded": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz",
+ "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/fresh": {
+ "version": "0.5.2",
+ "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz",
+ "integrity": "sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/function-bind": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz",
+ "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==",
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/get-intrinsic": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.2.tgz",
+ "integrity": "sha512-0gSo4ml/0j98Y3lngkFEot/zhiCeWsbYIlZ+uZOVgzLyLaUw7wxUL+nCTP0XJvJg1AXulJRI3UJi8GsbDuxdGA==",
+ "dependencies": {
+ "function-bind": "^1.1.2",
+ "has-proto": "^1.0.1",
+ "has-symbols": "^1.0.3",
+ "hasown": "^2.0.0"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/gopd": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz",
+ "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==",
+ "dependencies": {
+ "get-intrinsic": "^1.1.3"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-property-descriptors": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.1.tgz",
+ "integrity": "sha512-VsX8eaIewvas0xnvinAe9bw4WfIeODpGYikiWYLH+dma0Jw6KHYqWiWfhQlgOVK8D6PvjubK5Uc4P0iIhIcNVg==",
+ "dependencies": {
+ "get-intrinsic": "^1.2.2"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-proto": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.1.tgz",
+ "integrity": "sha512-7qE+iP+O+bgF9clE5+UoBFzE65mlBiVj3tKCrlNQ0Ogwm0BjpT/gK4SlLYDMybDh5I3TCTKnPPa0oMG7JDYrhg==",
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-symbols": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz",
+ "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==",
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/hasown": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.0.tgz",
+ "integrity": "sha512-vUptKVTpIJhcczKBbgnS+RtcuYMB8+oNzPK2/Hp3hanz8JmpATdmmgLgSaadVREkDm+e2giHwY3ZRkyjSIDDFA==",
+ "dependencies": {
+ "function-bind": "^1.1.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/http-errors": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz",
+ "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==",
+ "dependencies": {
+ "depd": "2.0.0",
+ "inherits": "2.0.4",
+ "setprototypeof": "1.2.0",
+ "statuses": "2.0.1",
+ "toidentifier": "1.0.1"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/iconv-lite": {
+ "version": "0.4.24",
+ "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz",
+ "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==",
+ "dependencies": {
+ "safer-buffer": ">= 2.1.2 < 3"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/inherits": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
+ "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ=="
+ },
+ "node_modules/ipaddr.js": {
+ "version": "1.9.1",
+ "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz",
+ "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==",
+ "engines": {
+ "node": ">= 0.10"
+ }
+ },
+ "node_modules/media-typer": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz",
+ "integrity": "sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/merge-descriptors": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz",
+ "integrity": "sha512-cCi6g3/Zr1iqQi6ySbseM1Xvooa98N0w31jzUYrXPX2xqObmFGHJ0tQ5u74H3mVh7wLouTseZyYIq39g8cNp1w=="
+ },
+ "node_modules/methods": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz",
+ "integrity": "sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mime": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz",
+ "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==",
+ "bin": {
+ "mime": "cli.js"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/mime-db": {
+ "version": "1.52.0",
+ "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz",
+ "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mime-types": {
+ "version": "2.1.35",
+ "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz",
+ "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==",
+ "dependencies": {
+ "mime-db": "1.52.0"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/ms": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+ "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A=="
+ },
+ "node_modules/negotiator": {
+ "version": "0.6.3",
+ "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz",
+ "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/object-assign": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+ "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==",
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/object-inspect": {
+ "version": "1.13.1",
+ "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.1.tgz",
+ "integrity": "sha512-5qoj1RUiKOMsCCNLV1CBiPYE10sziTsnmNxkAI/rZhiD63CF7IqdFGC/XzjWjpSgLf0LxXX3bDFIh0E18f6UhQ==",
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/on-finished": {
+ "version": "2.4.1",
+ "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz",
+ "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==",
+ "dependencies": {
+ "ee-first": "1.1.1"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/parseurl": {
+ "version": "1.3.3",
+ "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz",
+ "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/path-to-regexp": {
+ "version": "0.1.7",
+ "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz",
+ "integrity": "sha512-5DFkuoqlv1uYQKxy8omFBeJPQcdoE07Kv2sferDCrAq1ohOU+MSDswDIbnx3YAM60qIOnYa53wBhXW0EbMonrQ=="
+ },
+ "node_modules/proxy-addr": {
+ "version": "2.0.7",
+ "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz",
+ "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==",
+ "dependencies": {
+ "forwarded": "0.2.0",
+ "ipaddr.js": "1.9.1"
+ },
+ "engines": {
+ "node": ">= 0.10"
+ }
+ },
+ "node_modules/qs": {
+ "version": "6.11.0",
+ "resolved": "https://registry.npmjs.org/qs/-/qs-6.11.0.tgz",
+ "integrity": "sha512-MvjoMCJwEarSbUYk5O+nmoSzSutSsTwF85zcHPQ9OrlFoZOYIjaqBAJIqIXjptyD5vThxGq52Xu/MaJzRkIk4Q==",
+ "dependencies": {
+ "side-channel": "^1.0.4"
+ },
+ "engines": {
+ "node": ">=0.6"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/range-parser": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz",
+ "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/raw-body": {
+ "version": "2.5.1",
+ "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.1.tgz",
+ "integrity": "sha512-qqJBtEyVgS0ZmPGdCFPWJ3FreoqvG4MVQln/kCgF7Olq95IbOp0/BWyMwbdtn4VTvkM8Y7khCQ2Xgk/tcrCXig==",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "unpipe": "1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/safe-buffer": {
+ "version": "5.2.1",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz",
+ "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==",
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/feross"
+ },
+ {
+ "type": "patreon",
+ "url": "https://www.patreon.com/feross"
+ },
+ {
+ "type": "consulting",
+ "url": "https://feross.org/support"
+ }
+ ]
+ },
+ "node_modules/safer-buffer": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz",
+ "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg=="
+ },
+ "node_modules/send": {
+ "version": "0.18.0",
+ "resolved": "https://registry.npmjs.org/send/-/send-0.18.0.tgz",
+ "integrity": "sha512-qqWzuOjSFOuqPjFe4NOsMLafToQQwBSOEpS+FwEt3A2V3vKubTquT3vmLTQpFgMXp8AlFWFuP1qKaJZOtPpVXg==",
+ "dependencies": {
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "encodeurl": "~1.0.2",
+ "escape-html": "~1.0.3",
+ "etag": "~1.8.1",
+ "fresh": "0.5.2",
+ "http-errors": "2.0.0",
+ "mime": "1.6.0",
+ "ms": "2.1.3",
+ "on-finished": "2.4.1",
+ "range-parser": "~1.2.1",
+ "statuses": "2.0.1"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/send/node_modules/ms": {
+ "version": "2.1.3",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz",
+ "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA=="
+ },
+ "node_modules/serve-static": {
+ "version": "1.15.0",
+ "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.15.0.tgz",
+ "integrity": "sha512-XGuRDNjXUijsUL0vl6nSD7cwURuzEgglbOaFuZM9g3kwDXOWVTck0jLzjPzGD+TazWbboZYu52/9/XPdUgne9g==",
+ "dependencies": {
+ "encodeurl": "~1.0.2",
+ "escape-html": "~1.0.3",
+ "parseurl": "~1.3.3",
+ "send": "0.18.0"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/set-function-length": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.1.1.tgz",
+ "integrity": "sha512-VoaqjbBJKiWtg4yRcKBQ7g7wnGnLV3M8oLvVWwOk2PdYY6PEFegR1vezXR0tw6fZGF9csVakIRjrJiy2veSBFQ==",
+ "dependencies": {
+ "define-data-property": "^1.1.1",
+ "get-intrinsic": "^1.2.1",
+ "gopd": "^1.0.1",
+ "has-property-descriptors": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/setprototypeof": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz",
+ "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw=="
+ },
+ "node_modules/side-channel": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.4.tgz",
+ "integrity": "sha512-q5XPytqFEIKHkGdiMIrY10mvLRvnQh42/+GoBlFW3b2LXLE2xxJpZFdm94we0BaoV3RwJyGqg5wS7epxTv0Zvw==",
+ "dependencies": {
+ "call-bind": "^1.0.0",
+ "get-intrinsic": "^1.0.2",
+ "object-inspect": "^1.9.0"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/statuses": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz",
+ "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/toidentifier": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz",
+ "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==",
+ "engines": {
+ "node": ">=0.6"
+ }
+ },
+ "node_modules/type-is": {
+ "version": "1.6.18",
+ "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz",
+ "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==",
+ "dependencies": {
+ "media-typer": "0.3.0",
+ "mime-types": "~2.1.24"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/unpipe": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz",
+ "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/utils-merge": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz",
+ "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==",
+ "engines": {
+ "node": ">= 0.4.0"
+ }
+ },
+ "node_modules/vary": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz",
+ "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ }
+ }
+}
diff --git a/server/node_modules/accepts/HISTORY.md b/server/node_modules/accepts/HISTORY.md
new file mode 100644
index 000000000..cb5990c7c
--- /dev/null
+++ b/server/node_modules/accepts/HISTORY.md
@@ -0,0 +1,243 @@
+1.3.8 / 2022-02-02
+==================
+
+ * deps: mime-types@~2.1.34
+ - deps: mime-db@~1.51.0
+ * deps: negotiator@0.6.3
+
+1.3.7 / 2019-04-29
+==================
+
+ * deps: negotiator@0.6.2
+ - Fix sorting charset, encoding, and language with extra parameters
+
+1.3.6 / 2019-04-28
+==================
+
+ * deps: mime-types@~2.1.24
+ - deps: mime-db@~1.40.0
+
+1.3.5 / 2018-02-28
+==================
+
+ * deps: mime-types@~2.1.18
+ - deps: mime-db@~1.33.0
+
+1.3.4 / 2017-08-22
+==================
+
+ * deps: mime-types@~2.1.16
+ - deps: mime-db@~1.29.0
+
+1.3.3 / 2016-05-02
+==================
+
+ * deps: mime-types@~2.1.11
+ - deps: mime-db@~1.23.0
+ * deps: negotiator@0.6.1
+ - perf: improve `Accept` parsing speed
+ - perf: improve `Accept-Charset` parsing speed
+ - perf: improve `Accept-Encoding` parsing speed
+ - perf: improve `Accept-Language` parsing speed
+
+1.3.2 / 2016-03-08
+==================
+
+ * deps: mime-types@~2.1.10
+ - Fix extension of `application/dash+xml`
+ - Update primary extension for `audio/mp4`
+ - deps: mime-db@~1.22.0
+
+1.3.1 / 2016-01-19
+==================
+
+ * deps: mime-types@~2.1.9
+ - deps: mime-db@~1.21.0
+
+1.3.0 / 2015-09-29
+==================
+
+ * deps: mime-types@~2.1.7
+ - deps: mime-db@~1.19.0
+ * deps: negotiator@0.6.0
+ - Fix including type extensions in parameters in `Accept` parsing
+ - Fix parsing `Accept` parameters with quoted equals
+ - Fix parsing `Accept` parameters with quoted semicolons
+ - Lazy-load modules from main entry point
+ - perf: delay type concatenation until needed
+ - perf: enable strict mode
+ - perf: hoist regular expressions
+ - perf: remove closures getting spec properties
+ - perf: remove a closure from media type parsing
+ - perf: remove property delete from media type parsing
+
+1.2.13 / 2015-09-06
+===================
+
+ * deps: mime-types@~2.1.6
+ - deps: mime-db@~1.18.0
+
+1.2.12 / 2015-07-30
+===================
+
+ * deps: mime-types@~2.1.4
+ - deps: mime-db@~1.16.0
+
+1.2.11 / 2015-07-16
+===================
+
+ * deps: mime-types@~2.1.3
+ - deps: mime-db@~1.15.0
+
+1.2.10 / 2015-07-01
+===================
+
+ * deps: mime-types@~2.1.2
+ - deps: mime-db@~1.14.0
+
+1.2.9 / 2015-06-08
+==================
+
+ * deps: mime-types@~2.1.1
+ - perf: fix deopt during mapping
+
+1.2.8 / 2015-06-07
+==================
+
+ * deps: mime-types@~2.1.0
+ - deps: mime-db@~1.13.0
+ * perf: avoid argument reassignment & argument slice
+ * perf: avoid negotiator recursive construction
+ * perf: enable strict mode
+ * perf: remove unnecessary bitwise operator
+
+1.2.7 / 2015-05-10
+==================
+
+ * deps: negotiator@0.5.3
+ - Fix media type parameter matching to be case-insensitive
+
+1.2.6 / 2015-05-07
+==================
+
+ * deps: mime-types@~2.0.11
+ - deps: mime-db@~1.9.1
+ * deps: negotiator@0.5.2
+ - Fix comparing media types with quoted values
+ - Fix splitting media types with quoted commas
+
+1.2.5 / 2015-03-13
+==================
+
+ * deps: mime-types@~2.0.10
+ - deps: mime-db@~1.8.0
+
+1.2.4 / 2015-02-14
+==================
+
+ * Support Node.js 0.6
+ * deps: mime-types@~2.0.9
+ - deps: mime-db@~1.7.0
+ * deps: negotiator@0.5.1
+ - Fix preference sorting to be stable for long acceptable lists
+
+1.2.3 / 2015-01-31
+==================
+
+ * deps: mime-types@~2.0.8
+ - deps: mime-db@~1.6.0
+
+1.2.2 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.7
+ - deps: mime-db@~1.5.0
+
+1.2.1 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.5
+ - deps: mime-db@~1.3.1
+
+1.2.0 / 2014-12-19
+==================
+
+ * deps: negotiator@0.5.0
+ - Fix list return order when large accepted list
+ - Fix missing identity encoding when q=0 exists
+ - Remove dynamic building of Negotiator class
+
+1.1.4 / 2014-12-10
+==================
+
+ * deps: mime-types@~2.0.4
+ - deps: mime-db@~1.3.0
+
+1.1.3 / 2014-11-09
+==================
+
+ * deps: mime-types@~2.0.3
+ - deps: mime-db@~1.2.0
+
+1.1.2 / 2014-10-14
+==================
+
+ * deps: negotiator@0.4.9
+ - Fix error when media type has invalid parameter
+
+1.1.1 / 2014-09-28
+==================
+
+ * deps: mime-types@~2.0.2
+ - deps: mime-db@~1.1.0
+ * deps: negotiator@0.4.8
+ - Fix all negotiations to be case-insensitive
+ - Stable sort preferences of same quality according to client order
+
+1.1.0 / 2014-09-02
+==================
+
+ * update `mime-types`
+
+1.0.7 / 2014-07-04
+==================
+
+ * Fix wrong type returned from `type` when match after unknown extension
+
+1.0.6 / 2014-06-24
+==================
+
+ * deps: negotiator@0.4.7
+
+1.0.5 / 2014-06-20
+==================
+
+ * fix crash when unknown extension given
+
+1.0.4 / 2014-06-19
+==================
+
+ * use `mime-types`
+
+1.0.3 / 2014-06-11
+==================
+
+ * deps: negotiator@0.4.6
+ - Order by specificity when quality is the same
+
+1.0.2 / 2014-05-29
+==================
+
+ * Fix interpretation when header not in request
+ * deps: pin negotiator@0.4.5
+
+1.0.1 / 2014-01-18
+==================
+
+ * Identity encoding isn't always acceptable
+ * deps: negotiator@~0.4.0
+
+1.0.0 / 2013-12-27
+==================
+
+ * Genesis
diff --git a/server/node_modules/accepts/LICENSE b/server/node_modules/accepts/LICENSE
new file mode 100644
index 000000000..06166077b
--- /dev/null
+++ b/server/node_modules/accepts/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/accepts/README.md b/server/node_modules/accepts/README.md
new file mode 100644
index 000000000..82680c530
--- /dev/null
+++ b/server/node_modules/accepts/README.md
@@ -0,0 +1,140 @@
+# accepts
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator).
+Extracted from [koa](https://www.npmjs.com/package/koa) for general use.
+
+In addition to negotiator, it allows:
+
+- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])`
+ as well as `('text/html', 'application/json')`.
+- Allows type shorthands such as `json`.
+- Returns `false` when no types match
+- Treats non-existent headers as `*`
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install accepts
+```
+
+## API
+
+```js
+var accepts = require('accepts')
+```
+
+### accepts(req)
+
+Create a new `Accepts` object for the given `req`.
+
+#### .charset(charsets)
+
+Return the first accepted charset. If nothing in `charsets` is accepted,
+then `false` is returned.
+
+#### .charsets()
+
+Return the charsets that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .encoding(encodings)
+
+Return the first accepted encoding. If nothing in `encodings` is accepted,
+then `false` is returned.
+
+#### .encodings()
+
+Return the encodings that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .language(languages)
+
+Return the first accepted language. If nothing in `languages` is accepted,
+then `false` is returned.
+
+#### .languages()
+
+Return the languages that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .type(types)
+
+Return the first accepted type (and it is returned as the same text as what
+appears in the `types` array). If nothing in `types` is accepted, then `false`
+is returned.
+
+The `types` array can contain full MIME types or file extensions. Any value
+that is not a full MIME types is passed to `require('mime-types').lookup`.
+
+#### .types()
+
+Return the types that the request accepts, in the order of the client's
+preference (most preferred first).
+
+## Examples
+
+### Simple type negotiation
+
+This simple example shows how to use `accepts` to return a different typed
+respond body based on what the client wants to accept. The server lists it's
+preferences in order and will get back the best match between the client and
+server.
+
+```js
+var accepts = require('accepts')
+var http = require('http')
+
+function app (req, res) {
+ var accept = accepts(req)
+
+ // the order of this list is significant; should be server preferred order
+ switch (accept.type(['json', 'html'])) {
+ case 'json':
+ res.setHeader('Content-Type', 'application/json')
+ res.write('{"hello":"world!"}')
+ break
+ case 'html':
+ res.setHeader('Content-Type', 'text/html')
+ res.write('hello, world! ')
+ break
+ default:
+ // the fallback is text/plain, so no need to specify it above
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('hello, world!')
+ break
+ }
+
+ res.end()
+}
+
+http.createServer(app).listen(3000)
+```
+
+You can test this out with the cURL program:
+```sh
+curl -I -H'Accept: text/html' http://localhost:3000/
+```
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master
+[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master
+[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml
+[node-version-image]: https://badgen.net/npm/node/accepts
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/accepts
+[npm-url]: https://npmjs.org/package/accepts
+[npm-version-image]: https://badgen.net/npm/v/accepts
diff --git a/server/node_modules/accepts/index.js b/server/node_modules/accepts/index.js
new file mode 100644
index 000000000..e9b2f63fb
--- /dev/null
+++ b/server/node_modules/accepts/index.js
@@ -0,0 +1,238 @@
+/*!
+ * accepts
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var Negotiator = require('negotiator')
+var mime = require('mime-types')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = Accepts
+
+/**
+ * Create a new Accepts object for the given req.
+ *
+ * @param {object} req
+ * @public
+ */
+
+function Accepts (req) {
+ if (!(this instanceof Accepts)) {
+ return new Accepts(req)
+ }
+
+ this.headers = req.headers
+ this.negotiator = new Negotiator(req)
+}
+
+/**
+ * Check if the given `type(s)` is acceptable, returning
+ * the best match when true, otherwise `undefined`, in which
+ * case you should respond with 406 "Not Acceptable".
+ *
+ * The `type` value may be a single mime type string
+ * such as "application/json", the extension name
+ * such as "json" or an array `["json", "html", "text/plain"]`. When a list
+ * or array is given the _best_ match, if any is returned.
+ *
+ * Examples:
+ *
+ * // Accept: text/html
+ * this.types('html');
+ * // => "html"
+ *
+ * // Accept: text/*, application/json
+ * this.types('html');
+ * // => "html"
+ * this.types('text/html');
+ * // => "text/html"
+ * this.types('json', 'text');
+ * // => "json"
+ * this.types('application/json');
+ * // => "application/json"
+ *
+ * // Accept: text/*, application/json
+ * this.types('image/png');
+ * this.types('png');
+ * // => undefined
+ *
+ * // Accept: text/*;q=.5, application/json
+ * this.types(['html', 'json']);
+ * this.types('html', 'json');
+ * // => "json"
+ *
+ * @param {String|Array} types...
+ * @return {String|Array|Boolean}
+ * @public
+ */
+
+Accepts.prototype.type =
+Accepts.prototype.types = function (types_) {
+ var types = types_
+
+ // support flattened arguments
+ if (types && !Array.isArray(types)) {
+ types = new Array(arguments.length)
+ for (var i = 0; i < types.length; i++) {
+ types[i] = arguments[i]
+ }
+ }
+
+ // no types, return all requested types
+ if (!types || types.length === 0) {
+ return this.negotiator.mediaTypes()
+ }
+
+ // no accept header, return first given type
+ if (!this.headers.accept) {
+ return types[0]
+ }
+
+ var mimes = types.map(extToMime)
+ var accepts = this.negotiator.mediaTypes(mimes.filter(validMime))
+ var first = accepts[0]
+
+ return first
+ ? types[mimes.indexOf(first)]
+ : false
+}
+
+/**
+ * Return accepted encodings or best fit based on `encodings`.
+ *
+ * Given `Accept-Encoding: gzip, deflate`
+ * an array sorted by quality is returned:
+ *
+ * ['gzip', 'deflate']
+ *
+ * @param {String|Array} encodings...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.encoding =
+Accepts.prototype.encodings = function (encodings_) {
+ var encodings = encodings_
+
+ // support flattened arguments
+ if (encodings && !Array.isArray(encodings)) {
+ encodings = new Array(arguments.length)
+ for (var i = 0; i < encodings.length; i++) {
+ encodings[i] = arguments[i]
+ }
+ }
+
+ // no encodings, return all requested encodings
+ if (!encodings || encodings.length === 0) {
+ return this.negotiator.encodings()
+ }
+
+ return this.negotiator.encodings(encodings)[0] || false
+}
+
+/**
+ * Return accepted charsets or best fit based on `charsets`.
+ *
+ * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5`
+ * an array sorted by quality is returned:
+ *
+ * ['utf-8', 'utf-7', 'iso-8859-1']
+ *
+ * @param {String|Array} charsets...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.charset =
+Accepts.prototype.charsets = function (charsets_) {
+ var charsets = charsets_
+
+ // support flattened arguments
+ if (charsets && !Array.isArray(charsets)) {
+ charsets = new Array(arguments.length)
+ for (var i = 0; i < charsets.length; i++) {
+ charsets[i] = arguments[i]
+ }
+ }
+
+ // no charsets, return all requested charsets
+ if (!charsets || charsets.length === 0) {
+ return this.negotiator.charsets()
+ }
+
+ return this.negotiator.charsets(charsets)[0] || false
+}
+
+/**
+ * Return accepted languages or best fit based on `langs`.
+ *
+ * Given `Accept-Language: en;q=0.8, es, pt`
+ * an array sorted by quality is returned:
+ *
+ * ['es', 'pt', 'en']
+ *
+ * @param {String|Array} langs...
+ * @return {Array|String}
+ * @public
+ */
+
+Accepts.prototype.lang =
+Accepts.prototype.langs =
+Accepts.prototype.language =
+Accepts.prototype.languages = function (languages_) {
+ var languages = languages_
+
+ // support flattened arguments
+ if (languages && !Array.isArray(languages)) {
+ languages = new Array(arguments.length)
+ for (var i = 0; i < languages.length; i++) {
+ languages[i] = arguments[i]
+ }
+ }
+
+ // no languages, return all requested languages
+ if (!languages || languages.length === 0) {
+ return this.negotiator.languages()
+ }
+
+ return this.negotiator.languages(languages)[0] || false
+}
+
+/**
+ * Convert extnames to mime.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function extToMime (type) {
+ return type.indexOf('/') === -1
+ ? mime.lookup(type)
+ : type
+}
+
+/**
+ * Check if mime is valid.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function validMime (type) {
+ return typeof type === 'string'
+}
diff --git a/server/node_modules/accepts/package.json b/server/node_modules/accepts/package.json
new file mode 100644
index 000000000..0f2d15da9
--- /dev/null
+++ b/server/node_modules/accepts/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "accepts",
+ "description": "Higher-level content negotiation",
+ "version": "1.3.8",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "Jonathan Ong (http://jongleberry.com)"
+ ],
+ "license": "MIT",
+ "repository": "jshttp/accepts",
+ "dependencies": {
+ "mime-types": "~2.1.34",
+ "negotiator": "0.6.3"
+ },
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "7.32.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.25.4",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "4.3.1",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "keywords": [
+ "content",
+ "negotiation",
+ "accept",
+ "accepts"
+ ]
+}
diff --git a/server/node_modules/array-flatten/LICENSE b/server/node_modules/array-flatten/LICENSE
new file mode 100644
index 000000000..983fbe8ae
--- /dev/null
+++ b/server/node_modules/array-flatten/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/array-flatten/README.md b/server/node_modules/array-flatten/README.md
new file mode 100644
index 000000000..91fa5b637
--- /dev/null
+++ b/server/node_modules/array-flatten/README.md
@@ -0,0 +1,43 @@
+# Array Flatten
+
+[![NPM version][npm-image]][npm-url]
+[![NPM downloads][downloads-image]][downloads-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+
+> Flatten an array of nested arrays into a single flat array. Accepts an optional depth.
+
+## Installation
+
+```
+npm install array-flatten --save
+```
+
+## Usage
+
+```javascript
+var flatten = require('array-flatten')
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9])
+//=> [1, 2, 3, 4, 5, 6, 7, 8, 9]
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2)
+//=> [1, 2, 3, [4, [5], 6], 7, 8, 9]
+
+(function () {
+ flatten(arguments) //=> [1, 2, 3]
+})(1, [2, 3])
+```
+
+## License
+
+MIT
+
+[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat
+[npm-url]: https://npmjs.org/package/array-flatten
+[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat
+[downloads-url]: https://npmjs.org/package/array-flatten
+[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat
+[travis-url]: https://travis-ci.org/blakeembrey/array-flatten
+[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master
diff --git a/server/node_modules/array-flatten/array-flatten.js b/server/node_modules/array-flatten/array-flatten.js
new file mode 100644
index 000000000..089117b32
--- /dev/null
+++ b/server/node_modules/array-flatten/array-flatten.js
@@ -0,0 +1,64 @@
+'use strict'
+
+/**
+ * Expose `arrayFlatten`.
+ */
+module.exports = arrayFlatten
+
+/**
+ * Recursive flatten function with depth.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @param {Number} depth
+ * @return {Array}
+ */
+function flattenWithDepth (array, result, depth) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (depth > 0 && Array.isArray(value)) {
+ flattenWithDepth(value, result, depth - 1)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Recursive flatten function. Omitting depth is slightly faster.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @return {Array}
+ */
+function flattenForever (array, result) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (Array.isArray(value)) {
+ flattenForever(value, result)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Flatten an array, with the ability to define a depth.
+ *
+ * @param {Array} array
+ * @param {Number} depth
+ * @return {Array}
+ */
+function arrayFlatten (array, depth) {
+ if (depth == null) {
+ return flattenForever(array, [])
+ }
+
+ return flattenWithDepth(array, [], depth)
+}
diff --git a/server/node_modules/array-flatten/package.json b/server/node_modules/array-flatten/package.json
new file mode 100644
index 000000000..1a24e2a1a
--- /dev/null
+++ b/server/node_modules/array-flatten/package.json
@@ -0,0 +1,39 @@
+{
+ "name": "array-flatten",
+ "version": "1.1.1",
+ "description": "Flatten an array of nested arrays into a single flat array",
+ "main": "array-flatten.js",
+ "files": [
+ "array-flatten.js",
+ "LICENSE"
+ ],
+ "scripts": {
+ "test": "istanbul cover _mocha -- -R spec"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/blakeembrey/array-flatten.git"
+ },
+ "keywords": [
+ "array",
+ "flatten",
+ "arguments",
+ "depth"
+ ],
+ "author": {
+ "name": "Blake Embrey",
+ "email": "hello@blakeembrey.com",
+ "url": "http://blakeembrey.me"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/blakeembrey/array-flatten/issues"
+ },
+ "homepage": "https://github.com/blakeembrey/array-flatten",
+ "devDependencies": {
+ "istanbul": "^0.3.13",
+ "mocha": "^2.2.4",
+ "pre-commit": "^1.0.7",
+ "standard": "^3.7.3"
+ }
+}
diff --git a/server/node_modules/body-parser/HISTORY.md b/server/node_modules/body-parser/HISTORY.md
new file mode 100644
index 000000000..fb212b360
--- /dev/null
+++ b/server/node_modules/body-parser/HISTORY.md
@@ -0,0 +1,657 @@
+1.20.1 / 2022-10-06
+===================
+
+ * deps: qs@6.11.0
+ * perf: remove unnecessary object clone
+
+1.20.0 / 2022-04-02
+===================
+
+ * Fix error message for json parse whitespace in `strict`
+ * Fix internal error when inflated body exceeds limit
+ * Prevent loss of async hooks context
+ * Prevent hanging when request already read
+ * deps: depd@2.0.0
+ - Replace internal `eval` usage with `Function` constructor
+ - Use instance methods on `process` to check for listeners
+ * deps: http-errors@2.0.0
+ - deps: depd@2.0.0
+ - deps: statuses@2.0.1
+ * deps: on-finished@2.4.1
+ * deps: qs@6.10.3
+ * deps: raw-body@2.5.1
+ - deps: http-errors@2.0.0
+
+1.19.2 / 2022-02-15
+===================
+
+ * deps: bytes@3.1.2
+ * deps: qs@6.9.7
+ * Fix handling of `__proto__` keys
+ * deps: raw-body@2.4.3
+ - deps: bytes@3.1.2
+
+1.19.1 / 2021-12-10
+===================
+
+ * deps: bytes@3.1.1
+ * deps: http-errors@1.8.1
+ - deps: inherits@2.0.4
+ - deps: toidentifier@1.0.1
+ - deps: setprototypeof@1.2.0
+ * deps: qs@6.9.6
+ * deps: raw-body@2.4.2
+ - deps: bytes@3.1.1
+ - deps: http-errors@1.8.1
+ * deps: safe-buffer@5.2.1
+ * deps: type-is@~1.6.18
+
+1.19.0 / 2019-04-25
+===================
+
+ * deps: bytes@3.1.0
+ - Add petabyte (`pb`) support
+ * deps: http-errors@1.7.2
+ - Set constructor name when possible
+ - deps: setprototypeof@1.1.1
+ - deps: statuses@'>= 1.5.0 < 2'
+ * deps: iconv-lite@0.4.24
+ - Added encoding MIK
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: raw-body@2.4.0
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ * deps: type-is@~1.6.17
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+1.18.3 / 2018-05-14
+===================
+
+ * Fix stack trace for strict json parse error
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: http-errors@~1.6.3
+ - deps: depd@~1.1.2
+ - deps: setprototypeof@1.1.0
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.23
+ - Fix loading encoding with year appended
+ - Fix deprecation warnings on Node.js 10+
+ * deps: qs@6.5.2
+ * deps: raw-body@2.3.3
+ - deps: http-errors@1.6.3
+ - deps: iconv-lite@0.4.23
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+1.18.2 / 2017-09-22
+===================
+
+ * deps: debug@2.6.9
+ * perf: remove argument reassignment
+
+1.18.1 / 2017-09-12
+===================
+
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: iconv-lite@0.4.19
+ - Fix ISO-8859-1 regression
+ - Update Windows-1255
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: raw-body@2.3.2
+ - deps: iconv-lite@0.4.19
+
+1.18.0 / 2017-09-08
+===================
+
+ * Fix JSON strict violation error to match native parse error
+ * Include the `body` property on verify errors
+ * Include the `type` property on all generated errors
+ * Use `http-errors` to set status code on errors
+ * deps: bytes@3.0.0
+ * deps: debug@2.6.8
+ * deps: depd@~1.1.1
+ - Remove unnecessary `Buffer` loading
+ * deps: http-errors@~1.6.2
+ - deps: depd@1.1.1
+ * deps: iconv-lite@0.4.18
+ - Add support for React Native
+ - Add a warning if not loaded as utf-8
+ - Fix CESU-8 decoding in Node.js 8
+ - Improve speed of ISO-8859-1 encoding
+ * deps: qs@6.5.0
+ * deps: raw-body@2.3.1
+ - Use `http-errors` for standard emitted errors
+ - deps: bytes@3.0.0
+ - deps: iconv-lite@0.4.18
+ - perf: skip buffer decoding on overage chunk
+ * perf: prevent internal `throw` when missing charset
+
+1.17.2 / 2017-05-17
+===================
+
+ * deps: debug@2.6.7
+ - Fix `DEBUG_MAX_ARRAY_LENGTH`
+ - deps: ms@2.0.0
+ * deps: type-is@~1.6.15
+ - deps: mime-types@~2.1.15
+
+1.17.1 / 2017-03-06
+===================
+
+ * deps: qs@6.4.0
+ - Fix regression parsing keys starting with `[`
+
+1.17.0 / 2017-03-01
+===================
+
+ * deps: http-errors@~1.6.1
+ - Make `message` property enumerable for `HttpError`s
+ - deps: setprototypeof@1.0.3
+ * deps: qs@6.3.1
+ - Fix compacting nested arrays
+
+1.16.1 / 2017-02-10
+===================
+
+ * deps: debug@2.6.1
+ - Fix deprecation messages in WebStorm and other editors
+ - Undeprecate `DEBUG_FD` set to `1` or `2`
+
+1.16.0 / 2017-01-17
+===================
+
+ * deps: debug@2.6.0
+ - Allow colors in workers
+ - Deprecated `DEBUG_FD` environment variable
+ - Fix error when running under React Native
+ - Use same color for same namespace
+ - deps: ms@0.7.2
+ * deps: http-errors@~1.5.1
+ - deps: inherits@2.0.3
+ - deps: setprototypeof@1.0.2
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.15
+ - Added encoding MS-31J
+ - Added encoding MS-932
+ - Added encoding MS-936
+ - Added encoding MS-949
+ - Added encoding MS-950
+ - Fix GBK/GB18030 handling of Euro character
+ * deps: qs@6.2.1
+ - Fix array parsing from skipping empty values
+ * deps: raw-body@~2.2.0
+ - deps: iconv-lite@0.4.15
+ * deps: type-is@~1.6.14
+ - deps: mime-types@~2.1.13
+
+1.15.2 / 2016-06-19
+===================
+
+ * deps: bytes@2.4.0
+ * deps: content-type@~1.0.2
+ - perf: enable strict mode
+ * deps: http-errors@~1.5.0
+ - Use `setprototypeof` module to replace `__proto__` setting
+ - deps: statuses@'>= 1.3.0 < 2'
+ - perf: enable strict mode
+ * deps: qs@6.2.0
+ * deps: raw-body@~2.1.7
+ - deps: bytes@2.4.0
+ - perf: remove double-cleanup on happy path
+ * deps: type-is@~1.6.13
+ - deps: mime-types@~2.1.11
+
+1.15.1 / 2016-05-05
+===================
+
+ * deps: bytes@2.3.0
+ - Drop partial bytes on all parsed units
+ - Fix parsing byte string that looks like hex
+ * deps: raw-body@~2.1.6
+ - deps: bytes@2.3.0
+ * deps: type-is@~1.6.12
+ - deps: mime-types@~2.1.10
+
+1.15.0 / 2016-02-10
+===================
+
+ * deps: http-errors@~1.4.0
+ - Add `HttpError` export, for `err instanceof createError.HttpError`
+ - deps: inherits@2.0.1
+ - deps: statuses@'>= 1.2.1 < 2'
+ * deps: qs@6.1.0
+ * deps: type-is@~1.6.11
+ - deps: mime-types@~2.1.9
+
+1.14.2 / 2015-12-16
+===================
+
+ * deps: bytes@2.2.0
+ * deps: iconv-lite@0.4.13
+ * deps: qs@5.2.0
+ * deps: raw-body@~2.1.5
+ - deps: bytes@2.2.0
+ - deps: iconv-lite@0.4.13
+ * deps: type-is@~1.6.10
+ - deps: mime-types@~2.1.8
+
+1.14.1 / 2015-09-27
+===================
+
+ * Fix issue where invalid charset results in 400 when `verify` used
+ * deps: iconv-lite@0.4.12
+ - Fix CESU-8 decoding in Node.js 4.x
+ * deps: raw-body@~2.1.4
+ - Fix masking critical errors from `iconv-lite`
+ - deps: iconv-lite@0.4.12
+ * deps: type-is@~1.6.9
+ - deps: mime-types@~2.1.7
+
+1.14.0 / 2015-09-16
+===================
+
+ * Fix JSON strict parse error to match syntax errors
+ * Provide static `require` analysis in `urlencoded` parser
+ * deps: depd@~1.1.0
+ - Support web browser loading
+ * deps: qs@5.1.0
+ * deps: raw-body@~2.1.3
+ - Fix sync callback when attaching data listener causes sync read
+ * deps: type-is@~1.6.8
+ - Fix type error when given invalid type to match against
+ - deps: mime-types@~2.1.6
+
+1.13.3 / 2015-07-31
+===================
+
+ * deps: type-is@~1.6.6
+ - deps: mime-types@~2.1.4
+
+1.13.2 / 2015-07-05
+===================
+
+ * deps: iconv-lite@0.4.11
+ * deps: qs@4.0.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix user-visible incompatibilities from 3.1.0
+ - Fix various parsing edge cases
+ * deps: raw-body@~2.1.2
+ - Fix error stack traces to skip `makeError`
+ - deps: iconv-lite@0.4.11
+ * deps: type-is@~1.6.4
+ - deps: mime-types@~2.1.2
+ - perf: enable strict mode
+ - perf: remove argument reassignment
+
+1.13.1 / 2015-06-16
+===================
+
+ * deps: qs@2.4.2
+ - Downgraded from 3.1.0 because of user-visible incompatibilities
+
+1.13.0 / 2015-06-14
+===================
+
+ * Add `statusCode` property on `Error`s, in addition to `status`
+ * Change `type` default to `application/json` for JSON parser
+ * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser
+ * Provide static `require` analysis
+ * Use the `http-errors` module to generate errors
+ * deps: bytes@2.1.0
+ - Slight optimizations
+ * deps: iconv-lite@0.4.10
+ - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails
+ - Leading BOM is now removed when decoding
+ * deps: on-finished@~2.3.0
+ - Add defined behavior for HTTP `CONNECT` requests
+ - Add defined behavior for HTTP `Upgrade` requests
+ - deps: ee-first@1.1.1
+ * deps: qs@3.1.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix various parsing edge cases
+ - Parsed object now has `null` prototype
+ * deps: raw-body@~2.1.1
+ - Use `unpipe` module for unpiping requests
+ - deps: iconv-lite@0.4.10
+ * deps: type-is@~1.6.3
+ - deps: mime-types@~2.1.1
+ - perf: reduce try block size
+ - perf: remove bitwise operations
+ * perf: enable strict mode
+ * perf: remove argument reassignment
+ * perf: remove delete call
+
+1.12.4 / 2015-05-10
+===================
+
+ * deps: debug@~2.2.0
+ * deps: qs@2.4.2
+ - Fix allowing parameters like `constructor`
+ * deps: on-finished@~2.2.1
+ * deps: raw-body@~2.0.1
+ - Fix a false-positive when unpiping in Node.js 0.8
+ - deps: bytes@2.0.1
+ * deps: type-is@~1.6.2
+ - deps: mime-types@~2.0.11
+
+1.12.3 / 2015-04-15
+===================
+
+ * Slight efficiency improvement when not debugging
+ * deps: depd@~1.0.1
+ * deps: iconv-lite@0.4.8
+ - Add encoding alias UNICODE-1-1-UTF-7
+ * deps: raw-body@1.3.4
+ - Fix hanging callback if request aborts during read
+ - deps: iconv-lite@0.4.8
+
+1.12.2 / 2015-03-16
+===================
+
+ * deps: qs@2.4.1
+ - Fix error when parameter `hasOwnProperty` is present
+
+1.12.1 / 2015-03-15
+===================
+
+ * deps: debug@~2.1.3
+ - Fix high intensity foreground color for bold
+ - deps: ms@0.7.0
+ * deps: type-is@~1.6.1
+ - deps: mime-types@~2.0.10
+
+1.12.0 / 2015-02-13
+===================
+
+ * add `debug` messages
+ * accept a function for the `type` option
+ * use `content-type` to parse `Content-Type` headers
+ * deps: iconv-lite@0.4.7
+ - Gracefully support enumerables on `Object.prototype`
+ * deps: raw-body@1.3.3
+ - deps: iconv-lite@0.4.7
+ * deps: type-is@~1.6.0
+ - fix argument reassignment
+ - fix false-positives in `hasBody` `Transfer-Encoding` check
+ - support wildcard for both type and subtype (`*/*`)
+ - deps: mime-types@~2.0.9
+
+1.11.0 / 2015-01-30
+===================
+
+ * make internal `extended: true` depth limit infinity
+ * deps: type-is@~1.5.6
+ - deps: mime-types@~2.0.8
+
+1.10.2 / 2015-01-20
+===================
+
+ * deps: iconv-lite@0.4.6
+ - Fix rare aliases of single-byte encodings
+ * deps: raw-body@1.3.2
+ - deps: iconv-lite@0.4.6
+
+1.10.1 / 2015-01-01
+===================
+
+ * deps: on-finished@~2.2.0
+ * deps: type-is@~1.5.5
+ - deps: mime-types@~2.0.7
+
+1.10.0 / 2014-12-02
+===================
+
+ * make internal `extended: true` array limit dynamic
+
+1.9.3 / 2014-11-21
+==================
+
+ * deps: iconv-lite@0.4.5
+ - Fix Windows-31J and X-SJIS encoding support
+ * deps: qs@2.3.3
+ - Fix `arrayLimit` behavior
+ * deps: raw-body@1.3.1
+ - deps: iconv-lite@0.4.5
+ * deps: type-is@~1.5.3
+ - deps: mime-types@~2.0.3
+
+1.9.2 / 2014-10-27
+==================
+
+ * deps: qs@2.3.2
+ - Fix parsing of mixed objects and values
+
+1.9.1 / 2014-10-22
+==================
+
+ * deps: on-finished@~2.1.1
+ - Fix handling of pipelined requests
+ * deps: qs@2.3.0
+ - Fix parsing of mixed implicit and explicit arrays
+ * deps: type-is@~1.5.2
+ - deps: mime-types@~2.0.2
+
+1.9.0 / 2014-09-24
+==================
+
+ * include the charset in "unsupported charset" error message
+ * include the encoding in "unsupported content encoding" error message
+ * deps: depd@~1.0.0
+
+1.8.4 / 2014-09-23
+==================
+
+ * fix content encoding to be case-insensitive
+
+1.8.3 / 2014-09-19
+==================
+
+ * deps: qs@2.2.4
+ - Fix issue with object keys starting with numbers truncated
+
+1.8.2 / 2014-09-15
+==================
+
+ * deps: depd@0.4.5
+
+1.8.1 / 2014-09-07
+==================
+
+ * deps: media-typer@0.3.0
+ * deps: type-is@~1.5.1
+
+1.8.0 / 2014-09-05
+==================
+
+ * make empty-body-handling consistent between chunked requests
+ - empty `json` produces `{}`
+ - empty `raw` produces `new Buffer(0)`
+ - empty `text` produces `''`
+ - empty `urlencoded` produces `{}`
+ * deps: qs@2.2.3
+ - Fix issue where first empty value in array is discarded
+ * deps: type-is@~1.5.0
+ - fix `hasbody` to be true for `content-length: 0`
+
+1.7.0 / 2014-09-01
+==================
+
+ * add `parameterLimit` option to `urlencoded` parser
+ * change `urlencoded` extended array limit to 100
+ * respond with 413 when over `parameterLimit` in `urlencoded`
+
+1.6.7 / 2014-08-29
+==================
+
+ * deps: qs@2.2.2
+ - Remove unnecessary cloning
+
+1.6.6 / 2014-08-27
+==================
+
+ * deps: qs@2.2.0
+ - Array parsing fix
+ - Performance improvements
+
+1.6.5 / 2014-08-16
+==================
+
+ * deps: on-finished@2.1.0
+
+1.6.4 / 2014-08-14
+==================
+
+ * deps: qs@1.2.2
+
+1.6.3 / 2014-08-10
+==================
+
+ * deps: qs@1.2.1
+
+1.6.2 / 2014-08-07
+==================
+
+ * deps: qs@1.2.0
+ - Fix parsing array of objects
+
+1.6.1 / 2014-08-06
+==================
+
+ * deps: qs@1.1.0
+ - Accept urlencoded square brackets
+ - Accept empty values in implicit array notation
+
+1.6.0 / 2014-08-05
+==================
+
+ * deps: qs@1.0.2
+ - Complete rewrite
+ - Limits array length to 20
+ - Limits object depth to 5
+ - Limits parameters to 1,000
+
+1.5.2 / 2014-07-27
+==================
+
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+
+1.5.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+
+1.5.0 / 2014-07-20
+==================
+
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+ * deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ * deps: raw-body@1.3.0
+ - deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ - Fix `Cannot switch to old mode now` error on Node.js 0.10+
+ * deps: type-is@~1.3.2
+
+1.4.3 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.1
+ - fix global variable leak
+
+1.4.2 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.0
+ - improve type parsing
+
+1.4.1 / 2014-06-19
+==================
+
+ * fix urlencoded extended deprecation message
+
+1.4.0 / 2014-06-19
+==================
+
+ * add `text` parser
+ * add `raw` parser
+ * check accepted charset in content-type (accepts utf-8)
+ * check accepted encoding in content-encoding (accepts identity)
+ * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed
+ * deprecate `urlencoded()` without provided `extended` option
+ * lazy-load urlencoded parsers
+ * parsers split into files for reduced mem usage
+ * support gzip and deflate bodies
+ - set `inflate: false` to turn off
+ * deps: raw-body@1.2.2
+ - Support all encodings from `iconv-lite`
+
+1.3.1 / 2014-06-11
+==================
+
+ * deps: type-is@1.2.1
+ - Switch dependency from mime to mime-types@1.0.0
+
+1.3.0 / 2014-05-31
+==================
+
+ * add `extended` option to urlencoded parser
+
+1.2.2 / 2014-05-27
+==================
+
+ * deps: raw-body@1.1.6
+ - assert stream encoding on node.js 0.8
+ - assert stream encoding on node.js < 0.10.6
+ - deps: bytes@1
+
+1.2.1 / 2014-05-26
+==================
+
+ * invoke `next(err)` after request fully read
+ - prevents hung responses and socket hang ups
+
+1.2.0 / 2014-05-11
+==================
+
+ * add `verify` option
+ * deps: type-is@1.2.0
+ - support suffix matching
+
+1.1.2 / 2014-05-11
+==================
+
+ * improve json parser speed
+
+1.1.1 / 2014-05-11
+==================
+
+ * fix repeated limit parsing with every request
+
+1.1.0 / 2014-05-10
+==================
+
+ * add `type` option
+ * deps: pin for safety and consistency
+
+1.0.2 / 2014-04-14
+==================
+
+ * use `type-is` module
+
+1.0.1 / 2014-03-20
+==================
+
+ * lower default limits to 100kb
diff --git a/server/node_modules/body-parser/LICENSE b/server/node_modules/body-parser/LICENSE
new file mode 100644
index 000000000..386b7b694
--- /dev/null
+++ b/server/node_modules/body-parser/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2014-2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/body-parser/README.md b/server/node_modules/body-parser/README.md
new file mode 100644
index 000000000..c507cbb03
--- /dev/null
+++ b/server/node_modules/body-parser/README.md
@@ -0,0 +1,464 @@
+# body-parser
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Node.js body parsing middleware.
+
+Parse incoming request bodies in a middleware before your handlers, available
+under the `req.body` property.
+
+**Note** As `req.body`'s shape is based on user-controlled input, all
+properties and values in this object are untrusted and should be validated
+before trusting. For example, `req.body.foo.toString()` may fail in multiple
+ways, for example the `foo` property may not be there or may not be a string,
+and `toString` may not be a function and instead a string or other user input.
+
+[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/).
+
+_This does not handle multipart bodies_, due to their complex and typically
+large nature. For multipart bodies, you may be interested in the following
+modules:
+
+ * [busboy](https://www.npmjs.org/package/busboy#readme) and
+ [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme)
+ * [multiparty](https://www.npmjs.org/package/multiparty#readme) and
+ [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme)
+ * [formidable](https://www.npmjs.org/package/formidable#readme)
+ * [multer](https://www.npmjs.org/package/multer#readme)
+
+This module provides the following parsers:
+
+ * [JSON body parser](#bodyparserjsonoptions)
+ * [Raw body parser](#bodyparserrawoptions)
+ * [Text body parser](#bodyparsertextoptions)
+ * [URL-encoded form body parser](#bodyparserurlencodedoptions)
+
+Other body parsers you might be interested in:
+
+- [body](https://www.npmjs.org/package/body#readme)
+- [co-body](https://www.npmjs.org/package/co-body#readme)
+
+## Installation
+
+```sh
+$ npm install body-parser
+```
+
+## API
+
+```js
+var bodyParser = require('body-parser')
+```
+
+The `bodyParser` object exposes various factories to create middlewares. All
+middlewares will populate the `req.body` property with the parsed body when
+the `Content-Type` request header matches the `type` option, or an empty
+object (`{}`) if there was no body to parse, the `Content-Type` was not matched,
+or an error occurred.
+
+The various errors returned by this module are described in the
+[errors section](#errors).
+
+### bodyParser.json([options])
+
+Returns middleware that only parses `json` and only looks at requests where
+the `Content-Type` header matches the `type` option. This parser accepts any
+Unicode encoding of the body and supports automatic inflation of `gzip` and
+`deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`).
+
+#### Options
+
+The `json` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### reviver
+
+The `reviver` option is passed directly to `JSON.parse` as the second
+argument. You can find more information on this argument
+[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter).
+
+##### strict
+
+When set to `true`, will only accept arrays and objects; when `false` will
+accept anything `JSON.parse` accepts. Defaults to `true`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not a
+function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `json`), a mime type (like `application/json`), or
+a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a truthy
+value. Defaults to `application/json`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.raw([options])
+
+Returns middleware that parses all bodies as a `Buffer` and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a `Buffer` object
+of the body.
+
+#### Options
+
+The `raw` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function.
+If not a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this
+can be an extension name (like `bin`), a mime type (like
+`application/octet-stream`), or a mime type with a wildcard (like `*/*` or
+`application/*`). If a function, the `type` option is called as `fn(req)`
+and the request is parsed if it returns a truthy value. Defaults to
+`application/octet-stream`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.text([options])
+
+Returns middleware that parses all bodies as a string and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` string containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a string of the
+body.
+
+#### Options
+
+The `text` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### defaultCharset
+
+Specify the default character set for the text content if the charset is not
+specified in the `Content-Type` header of the request. Defaults to `utf-8`.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `txt`), a mime type (like `text/plain`), or a mime
+type with a wildcard (like `*/*` or `text/*`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a
+truthy value. Defaults to `text/plain`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.urlencoded([options])
+
+Returns middleware that only parses `urlencoded` bodies and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser accepts only UTF-8 encoding of the body and supports automatic
+inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This object will contain
+key-value pairs, where the value can be a string or array (when `extended` is
+`false`), or any type (when `extended` is `true`).
+
+#### Options
+
+The `urlencoded` function takes an optional `options` object that may contain
+any of the following keys:
+
+##### extended
+
+The `extended` option allows to choose between parsing the URL-encoded data
+with the `querystring` library (when `false`) or the `qs` library (when
+`true`). The "extended" syntax allows for rich objects and arrays to be
+encoded into the URL-encoded format, allowing for a JSON-like experience
+with URL-encoded. For more information, please
+[see the qs library](https://www.npmjs.org/package/qs#readme).
+
+Defaults to `true`, but using the default has been deprecated. Please
+research into the difference between `qs` and `querystring` and choose the
+appropriate setting.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### parameterLimit
+
+The `parameterLimit` option controls the maximum number of parameters that
+are allowed in the URL-encoded data. If a request contains more parameters
+than this value, a 413 will be returned to the client. Defaults to `1000`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `urlencoded`), a mime type (like
+`application/x-www-form-urlencoded`), or a mime type with a wildcard (like
+`*/x-www-form-urlencoded`). If a function, the `type` option is called as
+`fn(req)` and the request is parsed if it returns a truthy value. Defaults
+to `application/x-www-form-urlencoded`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+## Errors
+
+The middlewares provided by this module create errors using the
+[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors
+will typically have a `status`/`statusCode` property that contains the suggested
+HTTP response code, an `expose` property to determine if the `message` property
+should be displayed to the client, a `type` property to determine the type of
+error without matching against the `message`, and a `body` property containing
+the read body, if available.
+
+The following are the common errors created, though any error can come through
+for various reasons.
+
+### content encoding unsupported
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an encoding but the "inflation" option was set to `false`. The
+`status` property is set to `415`, the `type` property is set to
+`'encoding.unsupported'`, and the `charset` property will be set to the
+encoding that is unsupported.
+
+### entity parse failed
+
+This error will occur when the request contained an entity that could not be
+parsed by the middleware. The `status` property is set to `400`, the `type`
+property is set to `'entity.parse.failed'`, and the `body` property is set to
+the entity value that failed parsing.
+
+### entity verify failed
+
+This error will occur when the request contained an entity that could not be
+failed verification by the defined `verify` option. The `status` property is
+set to `403`, the `type` property is set to `'entity.verify.failed'`, and the
+`body` property is set to the entity value that failed verification.
+
+### request aborted
+
+This error will occur when the request is aborted by the client before reading
+the body has finished. The `received` property will be set to the number of
+bytes received before the request was aborted and the `expected` property is
+set to the number of expected bytes. The `status` property is set to `400`
+and `type` property is set to `'request.aborted'`.
+
+### request entity too large
+
+This error will occur when the request body's size is larger than the "limit"
+option. The `limit` property will be set to the byte limit and the `length`
+property will be set to the request body's length. The `status` property is
+set to `413` and the `type` property is set to `'entity.too.large'`.
+
+### request size did not match content length
+
+This error will occur when the request's length did not match the length from
+the `Content-Length` header. This typically occurs when the request is malformed,
+typically when the `Content-Length` header was calculated based on characters
+instead of bytes. The `status` property is set to `400` and the `type` property
+is set to `'request.size.invalid'`.
+
+### stream encoding should not be set
+
+This error will occur when something called the `req.setEncoding` method prior
+to this middleware. This module operates directly on bytes only and you cannot
+call `req.setEncoding` when using this module. The `status` property is set to
+`500` and the `type` property is set to `'stream.encoding.set'`.
+
+### stream is not readable
+
+This error will occur when the request is no longer readable when this middleware
+attempts to read it. This typically means something other than a middleware from
+this module read the request body already and the middleware was also configured to
+read the same request. The `status` property is set to `500` and the `type`
+property is set to `'stream.not.readable'`.
+
+### too many parameters
+
+This error will occur when the content of the request exceeds the configured
+`parameterLimit` for the `urlencoded` parser. The `status` property is set to
+`413` and the `type` property is set to `'parameters.too.many'`.
+
+### unsupported charset "BOGUS"
+
+This error will occur when the request had a charset parameter in the
+`Content-Type` header, but the `iconv-lite` module does not support it OR the
+parser does not support it. The charset is contained in the message as well
+as in the `charset` property. The `status` property is set to `415`, the
+`type` property is set to `'charset.unsupported'`, and the `charset` property
+is set to the charset that is unsupported.
+
+### unsupported content encoding "bogus"
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an unsupported encoding. The encoding is contained in the message
+as well as in the `encoding` property. The `status` property is set to `415`,
+the `type` property is set to `'encoding.unsupported'`, and the `encoding`
+property is set to the encoding that is unsupported.
+
+## Examples
+
+### Express/Connect top-level generic
+
+This example demonstrates adding a generic JSON and URL-encoded parser as a
+top-level middleware, which will parse the bodies of all incoming requests.
+This is the simplest setup.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse application/x-www-form-urlencoded
+app.use(bodyParser.urlencoded({ extended: false }))
+
+// parse application/json
+app.use(bodyParser.json())
+
+app.use(function (req, res) {
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('you posted:\n')
+ res.end(JSON.stringify(req.body, null, 2))
+})
+```
+
+### Express route-specific
+
+This example demonstrates adding body parsers specifically to the routes that
+need them. In general, this is the most recommended way to use body-parser with
+Express.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// create application/json parser
+var jsonParser = bodyParser.json()
+
+// create application/x-www-form-urlencoded parser
+var urlencodedParser = bodyParser.urlencoded({ extended: false })
+
+// POST /login gets urlencoded bodies
+app.post('/login', urlencodedParser, function (req, res) {
+ res.send('welcome, ' + req.body.username)
+})
+
+// POST /api/users gets JSON bodies
+app.post('/api/users', jsonParser, function (req, res) {
+ // create user in req.body
+})
+```
+
+### Change accepted type for parsers
+
+All the parsers accept a `type` option which allows you to change the
+`Content-Type` that the middleware will parse.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse various different custom JSON types as JSON
+app.use(bodyParser.json({ type: 'application/*+json' }))
+
+// parse some custom thing into a Buffer
+app.use(bodyParser.raw({ type: 'application/vnd.custom-type' }))
+
+// parse an HTML body into a string
+app.use(bodyParser.text({ type: 'text/html' }))
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/body-parser.svg
+[npm-url]: https://npmjs.org/package/body-parser
+[coveralls-image]: https://img.shields.io/coveralls/expressjs/body-parser/master.svg
+[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/body-parser.svg
+[downloads-url]: https://npmjs.org/package/body-parser
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/expressjs/body-parser/ci/master?label=ci
+[github-actions-ci-url]: https://github.com/expressjs/body-parser/actions/workflows/ci.yml
diff --git a/server/node_modules/body-parser/SECURITY.md b/server/node_modules/body-parser/SECURITY.md
new file mode 100644
index 000000000..9694d4296
--- /dev/null
+++ b/server/node_modules/body-parser/SECURITY.md
@@ -0,0 +1,25 @@
+# Security Policies and Procedures
+
+## Reporting a Bug
+
+The Express team and community take all security bugs seriously. Thank you
+for improving the security of Express. We appreciate your efforts and
+responsible disclosure and will make every effort to acknowledge your
+contributions.
+
+Report security bugs by emailing the current owner(s) of `body-parser`. This
+information can be found in the npm registry using the command
+`npm owner ls body-parser`.
+If unsure or unable to get the information from the above, open an issue
+in the [project issue tracker](https://github.com/expressjs/body-parser/issues)
+asking for the current contact information.
+
+To ensure the timely response to your report, please ensure that the entirety
+of the report is contained within the email body and not solely behind a web
+link or an attachment.
+
+At least one owner will acknowledge your email within 48 hours, and will send a
+more detailed response within 48 hours indicating the next steps in handling
+your report. After the initial reply to your report, the owners will
+endeavor to keep you informed of the progress towards a fix and full
+announcement, and may ask for additional information or guidance.
diff --git a/server/node_modules/body-parser/index.js b/server/node_modules/body-parser/index.js
new file mode 100644
index 000000000..bb24d739d
--- /dev/null
+++ b/server/node_modules/body-parser/index.js
@@ -0,0 +1,156 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var deprecate = require('depd')('body-parser')
+
+/**
+ * Cache of loaded parsers.
+ * @private
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * @typedef Parsers
+ * @type {function}
+ * @property {function} json
+ * @property {function} raw
+ * @property {function} text
+ * @property {function} urlencoded
+ */
+
+/**
+ * Module exports.
+ * @type {Parsers}
+ */
+
+exports = module.exports = deprecate.function(bodyParser,
+ 'bodyParser: use individual json/urlencoded middlewares')
+
+/**
+ * JSON parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'json', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('json')
+})
+
+/**
+ * Raw parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'raw', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('raw')
+})
+
+/**
+ * Text parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'text', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('text')
+})
+
+/**
+ * URL-encoded parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'urlencoded', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('urlencoded')
+})
+
+/**
+ * Create a middleware to parse json and urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @deprecated
+ * @public
+ */
+
+function bodyParser (options) {
+ // use default type for parsers
+ var opts = Object.create(options || null, {
+ type: {
+ configurable: true,
+ enumerable: true,
+ value: undefined,
+ writable: true
+ }
+ })
+
+ var _urlencoded = exports.urlencoded(opts)
+ var _json = exports.json(opts)
+
+ return function bodyParser (req, res, next) {
+ _json(req, res, function (err) {
+ if (err) return next(err)
+ _urlencoded(req, res, next)
+ })
+ }
+}
+
+/**
+ * Create a getter for loading a parser.
+ * @private
+ */
+
+function createParserGetter (name) {
+ return function get () {
+ return loadParser(name)
+ }
+}
+
+/**
+ * Load a parser module.
+ * @private
+ */
+
+function loadParser (parserName) {
+ var parser = parsers[parserName]
+
+ if (parser !== undefined) {
+ return parser
+ }
+
+ // this uses a switch for static require analysis
+ switch (parserName) {
+ case 'json':
+ parser = require('./lib/types/json')
+ break
+ case 'raw':
+ parser = require('./lib/types/raw')
+ break
+ case 'text':
+ parser = require('./lib/types/text')
+ break
+ case 'urlencoded':
+ parser = require('./lib/types/urlencoded')
+ break
+ }
+
+ // store to prevent invoking require()
+ return (parsers[parserName] = parser)
+}
diff --git a/server/node_modules/body-parser/lib/read.js b/server/node_modules/body-parser/lib/read.js
new file mode 100644
index 000000000..fce6283f5
--- /dev/null
+++ b/server/node_modules/body-parser/lib/read.js
@@ -0,0 +1,205 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var createError = require('http-errors')
+var destroy = require('destroy')
+var getBody = require('raw-body')
+var iconv = require('iconv-lite')
+var onFinished = require('on-finished')
+var unpipe = require('unpipe')
+var zlib = require('zlib')
+
+/**
+ * Module exports.
+ */
+
+module.exports = read
+
+/**
+ * Read a request into a buffer and parse.
+ *
+ * @param {object} req
+ * @param {object} res
+ * @param {function} next
+ * @param {function} parse
+ * @param {function} debug
+ * @param {object} options
+ * @private
+ */
+
+function read (req, res, next, parse, debug, options) {
+ var length
+ var opts = options
+ var stream
+
+ // flag as parsed
+ req._body = true
+
+ // read options
+ var encoding = opts.encoding !== null
+ ? opts.encoding
+ : null
+ var verify = opts.verify
+
+ try {
+ // get the content stream
+ stream = contentstream(req, debug, opts.inflate)
+ length = stream.length
+ stream.length = undefined
+ } catch (err) {
+ return next(err)
+ }
+
+ // set raw-body options
+ opts.length = length
+ opts.encoding = verify
+ ? null
+ : encoding
+
+ // assert charset is supported
+ if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) {
+ return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ }))
+ }
+
+ // read body
+ debug('read body')
+ getBody(stream, opts, function (error, body) {
+ if (error) {
+ var _error
+
+ if (error.type === 'encoding.unsupported') {
+ // echo back charset
+ _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ })
+ } else {
+ // set status code on error
+ _error = createError(400, error)
+ }
+
+ // unpipe from stream and destroy
+ if (stream !== req) {
+ unpipe(req)
+ destroy(stream, true)
+ }
+
+ // read off entire request
+ dump(req, function onfinished () {
+ next(createError(400, _error))
+ })
+ return
+ }
+
+ // verify
+ if (verify) {
+ try {
+ debug('verify body')
+ verify(req, res, body, encoding)
+ } catch (err) {
+ next(createError(403, err, {
+ body: body,
+ type: err.type || 'entity.verify.failed'
+ }))
+ return
+ }
+ }
+
+ // parse
+ var str = body
+ try {
+ debug('parse body')
+ str = typeof body !== 'string' && encoding !== null
+ ? iconv.decode(body, encoding)
+ : body
+ req.body = parse(str)
+ } catch (err) {
+ next(createError(400, err, {
+ body: str,
+ type: err.type || 'entity.parse.failed'
+ }))
+ return
+ }
+
+ next()
+ })
+}
+
+/**
+ * Get the content stream of the request.
+ *
+ * @param {object} req
+ * @param {function} debug
+ * @param {boolean} [inflate=true]
+ * @return {object}
+ * @api private
+ */
+
+function contentstream (req, debug, inflate) {
+ var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase()
+ var length = req.headers['content-length']
+ var stream
+
+ debug('content-encoding "%s"', encoding)
+
+ if (inflate === false && encoding !== 'identity') {
+ throw createError(415, 'content encoding unsupported', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ switch (encoding) {
+ case 'deflate':
+ stream = zlib.createInflate()
+ debug('inflate body')
+ req.pipe(stream)
+ break
+ case 'gzip':
+ stream = zlib.createGunzip()
+ debug('gunzip body')
+ req.pipe(stream)
+ break
+ case 'identity':
+ stream = req
+ stream.length = length
+ break
+ default:
+ throw createError(415, 'unsupported content encoding "' + encoding + '"', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ return stream
+}
+
+/**
+ * Dump the contents of a request.
+ *
+ * @param {object} req
+ * @param {function} callback
+ * @api private
+ */
+
+function dump (req, callback) {
+ if (onFinished.isFinished(req)) {
+ callback(null)
+ } else {
+ onFinished(req, callback)
+ req.resume()
+ }
+}
diff --git a/server/node_modules/body-parser/lib/types/json.js b/server/node_modules/body-parser/lib/types/json.js
new file mode 100644
index 000000000..c2745be3a
--- /dev/null
+++ b/server/node_modules/body-parser/lib/types/json.js
@@ -0,0 +1,236 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:json')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = json
+
+/**
+ * RegExp to match the first non-space in a string.
+ *
+ * Allowed whitespace is defined in RFC 7159:
+ *
+ * ws = *(
+ * %x20 / ; Space
+ * %x09 / ; Horizontal tab
+ * %x0A / ; Line feed or New line
+ * %x0D ) ; Carriage return
+ */
+
+var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*([^\x20\x09\x0a\x0d])/ // eslint-disable-line no-control-regex
+
+/**
+ * Create a middleware to parse JSON bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function json (options) {
+ var opts = options || {}
+
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var inflate = opts.inflate !== false
+ var reviver = opts.reviver
+ var strict = opts.strict !== false
+ var type = opts.type || 'application/json'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ if (body.length === 0) {
+ // special-case empty json body, as it's a common client-side mistake
+ // TODO: maybe make this configurable or part of "strict" option
+ return {}
+ }
+
+ if (strict) {
+ var first = firstchar(body)
+
+ if (first !== '{' && first !== '[') {
+ debug('strict violation')
+ throw createStrictSyntaxError(body, first)
+ }
+ }
+
+ try {
+ debug('parse json')
+ return JSON.parse(body, reviver)
+ } catch (e) {
+ throw normalizeJsonSyntaxError(e, {
+ message: e.message,
+ stack: e.stack
+ })
+ }
+ }
+
+ return function jsonParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset per RFC 7159 sec 8.1
+ var charset = getCharset(req) || 'utf-8'
+ if (charset.slice(0, 4) !== 'utf-') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Create strict violation syntax error matching native error.
+ *
+ * @param {string} str
+ * @param {string} char
+ * @return {Error}
+ * @private
+ */
+
+function createStrictSyntaxError (str, char) {
+ var index = str.indexOf(char)
+ var partial = index !== -1
+ ? str.substring(0, index) + '#'
+ : ''
+
+ try {
+ JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation')
+ } catch (e) {
+ return normalizeJsonSyntaxError(e, {
+ message: e.message.replace('#', char),
+ stack: e.stack
+ })
+ }
+}
+
+/**
+ * Get the first non-whitespace character in a string.
+ *
+ * @param {string} str
+ * @return {function}
+ * @private
+ */
+
+function firstchar (str) {
+ var match = FIRST_CHAR_REGEXP.exec(str)
+
+ return match
+ ? match[1]
+ : undefined
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Normalize a SyntaxError for JSON.parse.
+ *
+ * @param {SyntaxError} error
+ * @param {object} obj
+ * @return {SyntaxError}
+ */
+
+function normalizeJsonSyntaxError (error, obj) {
+ var keys = Object.getOwnPropertyNames(error)
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i]
+ if (key !== 'stack' && key !== 'message') {
+ delete error[key]
+ }
+ }
+
+ // replace stack before message for Node.js 0.10 and below
+ error.stack = obj.stack.replace(error.message, obj.message)
+ error.message = obj.message
+
+ return error
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/server/node_modules/body-parser/lib/types/raw.js b/server/node_modules/body-parser/lib/types/raw.js
new file mode 100644
index 000000000..f5d1b6747
--- /dev/null
+++ b/server/node_modules/body-parser/lib/types/raw.js
@@ -0,0 +1,101 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var debug = require('debug')('body-parser:raw')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = raw
+
+/**
+ * Create a middleware to parse raw bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function raw (options) {
+ var opts = options || {}
+
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/octet-stream'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function rawParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: null,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/server/node_modules/body-parser/lib/types/text.js b/server/node_modules/body-parser/lib/types/text.js
new file mode 100644
index 000000000..083a00908
--- /dev/null
+++ b/server/node_modules/body-parser/lib/types/text.js
@@ -0,0 +1,121 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var debug = require('debug')('body-parser:text')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = text
+
+/**
+ * Create a middleware to parse text bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function text (options) {
+ var opts = options || {}
+
+ var defaultCharset = opts.defaultCharset || 'utf-8'
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'text/plain'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function textParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // get charset
+ var charset = getCharset(req) || defaultCharset
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/server/node_modules/body-parser/lib/types/urlencoded.js b/server/node_modules/body-parser/lib/types/urlencoded.js
new file mode 100644
index 000000000..b2ca8f16d
--- /dev/null
+++ b/server/node_modules/body-parser/lib/types/urlencoded.js
@@ -0,0 +1,284 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:urlencoded')
+var deprecate = require('depd')('body-parser')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = urlencoded
+
+/**
+ * Cache of parser modules.
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * Create a middleware to parse urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function urlencoded (options) {
+ var opts = options || {}
+
+ // notice because option default will flip in next major
+ if (opts.extended === undefined) {
+ deprecate('undefined extended: provide extended option')
+ }
+
+ var extended = opts.extended !== false
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/x-www-form-urlencoded'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate query parser
+ var queryparse = extended
+ ? extendedparser(opts)
+ : simpleparser(opts)
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ return body.length
+ ? queryparse(body)
+ : {}
+ }
+
+ return function urlencodedParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset
+ var charset = getCharset(req) || 'utf-8'
+ if (charset !== 'utf-8') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ debug: debug,
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the extended query parser.
+ *
+ * @param {object} options
+ */
+
+function extendedparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+ var parse = parser('qs')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ var arrayLimit = Math.max(100, paramCount)
+
+ debug('parse extended urlencoding')
+ return parse(body, {
+ allowPrototypes: true,
+ arrayLimit: arrayLimit,
+ depth: Infinity,
+ parameterLimit: parameterLimit
+ })
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Count the number of parameters, stopping once limit reached
+ *
+ * @param {string} body
+ * @param {number} limit
+ * @api private
+ */
+
+function parameterCount (body, limit) {
+ var count = 0
+ var index = 0
+
+ while ((index = body.indexOf('&', index)) !== -1) {
+ count++
+ index++
+
+ if (count === limit) {
+ return undefined
+ }
+ }
+
+ return count
+}
+
+/**
+ * Get parser for module name dynamically.
+ *
+ * @param {string} name
+ * @return {function}
+ * @api private
+ */
+
+function parser (name) {
+ var mod = parsers[name]
+
+ if (mod !== undefined) {
+ return mod.parse
+ }
+
+ // this uses a switch for static require analysis
+ switch (name) {
+ case 'qs':
+ mod = require('qs')
+ break
+ case 'querystring':
+ mod = require('querystring')
+ break
+ }
+
+ // store to prevent invoking require()
+ parsers[name] = mod
+
+ return mod.parse
+}
+
+/**
+ * Get the simple query parser.
+ *
+ * @param {object} options
+ */
+
+function simpleparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+ var parse = parser('querystring')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ debug('parse urlencoding')
+ return parse(body, undefined, undefined, { maxKeys: parameterLimit })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/server/node_modules/body-parser/package.json b/server/node_modules/body-parser/package.json
new file mode 100644
index 000000000..9cd2ccbba
--- /dev/null
+++ b/server/node_modules/body-parser/package.json
@@ -0,0 +1,56 @@
+{
+ "name": "body-parser",
+ "description": "Node.js body parsing middleware",
+ "version": "1.20.1",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "Jonathan Ong (http://jongleberry.com)"
+ ],
+ "license": "MIT",
+ "repository": "expressjs/body-parser",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "content-type": "~1.0.4",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "on-finished": "2.4.1",
+ "qs": "6.11.0",
+ "raw-body": "2.5.1",
+ "type-is": "~1.6.18",
+ "unpipe": "1.0.0"
+ },
+ "devDependencies": {
+ "eslint": "8.24.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.26.0",
+ "eslint-plugin-markdown": "3.0.0",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "6.0.1",
+ "eslint-plugin-standard": "4.1.0",
+ "methods": "1.1.2",
+ "mocha": "10.0.0",
+ "nyc": "15.1.0",
+ "safe-buffer": "5.2.1",
+ "supertest": "6.3.0"
+ },
+ "files": [
+ "lib/",
+ "LICENSE",
+ "HISTORY.md",
+ "SECURITY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ }
+}
diff --git a/server/node_modules/bytes/History.md b/server/node_modules/bytes/History.md
new file mode 100644
index 000000000..d60ce0e6d
--- /dev/null
+++ b/server/node_modules/bytes/History.md
@@ -0,0 +1,97 @@
+3.1.2 / 2022-01-27
+==================
+
+ * Fix return value for un-parsable strings
+
+3.1.1 / 2021-11-15
+==================
+
+ * Fix "thousandsSeparator" incorrecting formatting fractional part
+
+3.1.0 / 2019-01-22
+==================
+
+ * Add petabyte (`pb`) support
+
+3.0.0 / 2017-08-31
+==================
+
+ * Change "kB" to "KB" in format output
+ * Remove support for Node.js 0.6
+ * Remove support for ComponentJS
+
+2.5.0 / 2017-03-24
+==================
+
+ * Add option "unit"
+
+2.4.0 / 2016-06-01
+==================
+
+ * Add option "unitSeparator"
+
+2.3.0 / 2016-02-15
+==================
+
+ * Drop partial bytes on all parsed units
+ * Fix non-finite numbers to `.format` to return `null`
+ * Fix parsing byte string that looks like hex
+ * perf: hoist regular expressions
+
+2.2.0 / 2015-11-13
+==================
+
+ * add option "decimalPlaces"
+ * add option "fixedDecimals"
+
+2.1.0 / 2015-05-21
+==================
+
+ * add `.format` export
+ * add `.parse` export
+
+2.0.2 / 2015-05-20
+==================
+
+ * remove map recreation
+ * remove unnecessary object construction
+
+2.0.1 / 2015-05-07
+==================
+
+ * fix browserify require
+ * remove node.extend dependency
+
+2.0.0 / 2015-04-12
+==================
+
+ * add option "case"
+ * add option "thousandsSeparator"
+ * return "null" on invalid parse input
+ * support proper round-trip: bytes(bytes(num)) === num
+ * units no longer case sensitive when parsing
+
+1.0.0 / 2014-05-05
+==================
+
+ * add negative support. fixes #6
+
+0.3.0 / 2014-03-19
+==================
+
+ * added terabyte support
+
+0.2.1 / 2013-04-01
+==================
+
+ * add .component
+
+0.2.0 / 2012-10-28
+==================
+
+ * bytes(200).should.eql('200b')
+
+0.1.0 / 2012-07-04
+==================
+
+ * add bytes to string conversion [yields]
diff --git a/server/node_modules/bytes/LICENSE b/server/node_modules/bytes/LICENSE
new file mode 100644
index 000000000..63e95a963
--- /dev/null
+++ b/server/node_modules/bytes/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 TJ Holowaychuk
+Copyright (c) 2015 Jed Watson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/bytes/Readme.md b/server/node_modules/bytes/Readme.md
new file mode 100644
index 000000000..5790e23e3
--- /dev/null
+++ b/server/node_modules/bytes/Readme.md
@@ -0,0 +1,152 @@
+# Bytes utility
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][ci-image]][ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```bash
+$ npm install bytes
+```
+
+## Usage
+
+```js
+var bytes = require('bytes');
+```
+
+#### bytes(number|string value, [options]): number|string|null
+
+Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number`|`string` | Number value to format or string value to parse |
+| options | `Object` | Conversion options for `format` |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`|`number`|`null` | Return null upon error. Numeric value in bytes, or string value otherwise. |
+
+**Example**
+
+```js
+bytes(1024);
+// output: '1KB'
+
+bytes('1KB');
+// output: 1024
+```
+
+#### bytes.format(number value, [options]): string|null
+
+Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is
+ rounded.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number` | Value in bytes |
+| options | `Object` | Conversion options |
+
+**Options**
+
+| Property | Type | Description |
+|-------------------|--------|-----------------------------------------------------------------------------------------|
+| decimalPlaces | `number`|`null` | Maximum number of decimal places to include in output. Default value to `2`. |
+| fixedDecimals | `boolean`|`null` | Whether to always display the maximum number of decimal places. Default value to `false` |
+| thousandsSeparator | `string`|`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. |
+| unit | `string`|`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). |
+| unitSeparator | `string`|`null` | Separator to use between number and unit. Default value to `''`. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`|`null` | Return null upon error. String value otherwise. |
+
+**Example**
+
+```js
+bytes.format(1024);
+// output: '1KB'
+
+bytes.format(1000);
+// output: '1000B'
+
+bytes.format(1000, {thousandsSeparator: ' '});
+// output: '1 000B'
+
+bytes.format(1024 * 1.7, {decimalPlaces: 0});
+// output: '2KB'
+
+bytes.format(1024, {unitSeparator: ' '});
+// output: '1 KB'
+```
+
+#### bytes.parse(string|number value): number|null
+
+Parse the string value into an integer in bytes. If no unit is given, or `value`
+is a number, it is assumed the value is in bytes.
+
+Supported units and abbreviations are as follows and are case-insensitive:
+
+ * `b` for bytes
+ * `kb` for kilobytes
+ * `mb` for megabytes
+ * `gb` for gigabytes
+ * `tb` for terabytes
+ * `pb` for petabytes
+
+The units are in powers of two, not ten. This means 1kb = 1024b according to this parser.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------------|--------|--------------------|
+| value | `string`|`number` | String to parse, or number in bytes. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|-------------|-------------------------|
+| results | `number`|`null` | Return null upon error. Value in bytes otherwise. |
+
+**Example**
+
+```js
+bytes.parse('1KB');
+// output: 1024
+
+bytes.parse('1024');
+// output: 1024
+
+bytes.parse(1024);
+// output: 1024
+```
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci
+[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci
+[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master
+[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master
+[downloads-image]: https://badgen.net/npm/dm/bytes
+[downloads-url]: https://npmjs.org/package/bytes
+[npm-image]: https://badgen.net/npm/v/bytes
+[npm-url]: https://npmjs.org/package/bytes
diff --git a/server/node_modules/bytes/index.js b/server/node_modules/bytes/index.js
new file mode 100644
index 000000000..6f2d0f89e
--- /dev/null
+++ b/server/node_modules/bytes/index.js
@@ -0,0 +1,170 @@
+/*!
+ * bytes
+ * Copyright(c) 2012-2014 TJ Holowaychuk
+ * Copyright(c) 2015 Jed Watson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = bytes;
+module.exports.format = format;
+module.exports.parse = parse;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g;
+
+var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/;
+
+var map = {
+ b: 1,
+ kb: 1 << 10,
+ mb: 1 << 20,
+ gb: 1 << 30,
+ tb: Math.pow(1024, 4),
+ pb: Math.pow(1024, 5),
+};
+
+var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i;
+
+/**
+ * Convert the given value in bytes into a string or parse to string to an integer in bytes.
+ *
+ * @param {string|number} value
+ * @param {{
+ * case: [string],
+ * decimalPlaces: [number]
+ * fixedDecimals: [boolean]
+ * thousandsSeparator: [string]
+ * unitSeparator: [string]
+ * }} [options] bytes options.
+ *
+ * @returns {string|number|null}
+ */
+
+function bytes(value, options) {
+ if (typeof value === 'string') {
+ return parse(value);
+ }
+
+ if (typeof value === 'number') {
+ return format(value, options);
+ }
+
+ return null;
+}
+
+/**
+ * Format the given value in bytes into a string.
+ *
+ * If the value is negative, it is kept as such. If it is a float,
+ * it is rounded.
+ *
+ * @param {number} value
+ * @param {object} [options]
+ * @param {number} [options.decimalPlaces=2]
+ * @param {number} [options.fixedDecimals=false]
+ * @param {string} [options.thousandsSeparator=]
+ * @param {string} [options.unit=]
+ * @param {string} [options.unitSeparator=]
+ *
+ * @returns {string|null}
+ * @public
+ */
+
+function format(value, options) {
+ if (!Number.isFinite(value)) {
+ return null;
+ }
+
+ var mag = Math.abs(value);
+ var thousandsSeparator = (options && options.thousandsSeparator) || '';
+ var unitSeparator = (options && options.unitSeparator) || '';
+ var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2;
+ var fixedDecimals = Boolean(options && options.fixedDecimals);
+ var unit = (options && options.unit) || '';
+
+ if (!unit || !map[unit.toLowerCase()]) {
+ if (mag >= map.pb) {
+ unit = 'PB';
+ } else if (mag >= map.tb) {
+ unit = 'TB';
+ } else if (mag >= map.gb) {
+ unit = 'GB';
+ } else if (mag >= map.mb) {
+ unit = 'MB';
+ } else if (mag >= map.kb) {
+ unit = 'KB';
+ } else {
+ unit = 'B';
+ }
+ }
+
+ var val = value / map[unit.toLowerCase()];
+ var str = val.toFixed(decimalPlaces);
+
+ if (!fixedDecimals) {
+ str = str.replace(formatDecimalsRegExp, '$1');
+ }
+
+ if (thousandsSeparator) {
+ str = str.split('.').map(function (s, i) {
+ return i === 0
+ ? s.replace(formatThousandsRegExp, thousandsSeparator)
+ : s
+ }).join('.');
+ }
+
+ return str + unitSeparator + unit;
+}
+
+/**
+ * Parse the string value into an integer in bytes.
+ *
+ * If no unit is given, it is assumed the value is in bytes.
+ *
+ * @param {number|string} val
+ *
+ * @returns {number|null}
+ * @public
+ */
+
+function parse(val) {
+ if (typeof val === 'number' && !isNaN(val)) {
+ return val;
+ }
+
+ if (typeof val !== 'string') {
+ return null;
+ }
+
+ // Test if the string passed is valid
+ var results = parseRegExp.exec(val);
+ var floatValue;
+ var unit = 'b';
+
+ if (!results) {
+ // Nothing could be extracted from the given string
+ floatValue = parseInt(val, 10);
+ unit = 'b'
+ } else {
+ // Retrieve the value and the unit
+ floatValue = parseFloat(results[1]);
+ unit = results[4].toLowerCase();
+ }
+
+ if (isNaN(floatValue)) {
+ return null;
+ }
+
+ return Math.floor(map[unit] * floatValue);
+}
diff --git a/server/node_modules/bytes/package.json b/server/node_modules/bytes/package.json
new file mode 100644
index 000000000..f2b6a8b0e
--- /dev/null
+++ b/server/node_modules/bytes/package.json
@@ -0,0 +1,42 @@
+{
+ "name": "bytes",
+ "description": "Utility to parse a string bytes to bytes and vice-versa",
+ "version": "3.1.2",
+ "author": "TJ Holowaychuk (http://tjholowaychuk.com)",
+ "contributors": [
+ "Jed Watson ",
+ "Théo FIDRY "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "byte",
+ "bytes",
+ "utility",
+ "parse",
+ "parser",
+ "convert",
+ "converter"
+ ],
+ "repository": "visionmedia/bytes.js",
+ "devDependencies": {
+ "eslint": "7.32.0",
+ "eslint-plugin-markdown": "2.2.1",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "History.md",
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --check-leaks --reporter spec",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ }
+}
diff --git a/server/node_modules/call-bind/.eslintignore b/server/node_modules/call-bind/.eslintignore
new file mode 100644
index 000000000..404abb221
--- /dev/null
+++ b/server/node_modules/call-bind/.eslintignore
@@ -0,0 +1 @@
+coverage/
diff --git a/server/node_modules/call-bind/.eslintrc b/server/node_modules/call-bind/.eslintrc
new file mode 100644
index 000000000..dfa9a6cdc
--- /dev/null
+++ b/server/node_modules/call-bind/.eslintrc
@@ -0,0 +1,16 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "func-name-matching": 0,
+ "id-length": 0,
+ "new-cap": [2, {
+ "capIsNewExceptions": [
+ "GetIntrinsic",
+ ],
+ }],
+ "no-magic-numbers": 0,
+ },
+}
diff --git a/server/node_modules/call-bind/.github/FUNDING.yml b/server/node_modules/call-bind/.github/FUNDING.yml
new file mode 100644
index 000000000..c70c2ecdb
--- /dev/null
+++ b/server/node_modules/call-bind/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/call-bind
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']
diff --git a/server/node_modules/call-bind/.nycrc b/server/node_modules/call-bind/.nycrc
new file mode 100644
index 000000000..bdd626ce9
--- /dev/null
+++ b/server/node_modules/call-bind/.nycrc
@@ -0,0 +1,9 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/server/node_modules/call-bind/CHANGELOG.md b/server/node_modules/call-bind/CHANGELOG.md
new file mode 100644
index 000000000..717bcc3e9
--- /dev/null
+++ b/server/node_modules/call-bind/CHANGELOG.md
@@ -0,0 +1,77 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.0.5](https://github.com/ljharb/call-bind/compare/v1.0.4...v1.0.5) - 2023-10-19
+
+### Commits
+
+- [Fix] throw an error on non-functions as early as possible [`f262408`](https://github.com/ljharb/call-bind/commit/f262408f822c840fbc268080f3ad7c429611066d)
+- [Deps] update `set-function-length` [`3fff271`](https://github.com/ljharb/call-bind/commit/3fff27145a1e3a76a5b74f1d7c3c43d0fa3b9871)
+
+## [v1.0.4](https://github.com/ljharb/call-bind/compare/v1.0.3...v1.0.4) - 2023-10-19
+
+## [v1.0.3](https://github.com/ljharb/call-bind/compare/v1.0.2...v1.0.3) - 2023-10-19
+
+### Commits
+
+- [actions] reuse common workflows [`a994df6`](https://github.com/ljharb/call-bind/commit/a994df69f401f4bf735a4ccd77029b85d1549453)
+- [meta] use `npmignore` to autogenerate an npmignore file [`eef3ef2`](https://github.com/ljharb/call-bind/commit/eef3ef21e1f002790837fedb8af2679c761fbdf5)
+- [readme] flesh out content [`1845ccf`](https://github.com/ljharb/call-bind/commit/1845ccfd9976a607884cfc7157c93192cc16cf22)
+- [actions] use `node/install` instead of `node/run`; use `codecov` action [`5b47d53`](https://github.com/ljharb/call-bind/commit/5b47d53d2fd74af5ea0a44f1d51e503cd42f7a90)
+- [Refactor] use `set-function-length` [`a0e165c`](https://github.com/ljharb/call-bind/commit/a0e165c5dc61db781cbc919b586b1c2b8da0b150)
+- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`9c50103`](https://github.com/ljharb/call-bind/commit/9c50103f44137279a817317cf6cc421a658f85b4)
+- [meta] simplify "exports" [`019c6d0`](https://github.com/ljharb/call-bind/commit/019c6d06b0e1246ceed8e579f57e44441cbbf6d9)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `safe-publish-latest`, `tape` [`23bd718`](https://github.com/ljharb/call-bind/commit/23bd718a288d3b03042062b4ef5153b3cea83f11)
+- [actions] update codecov uploader [`62552d7`](https://github.com/ljharb/call-bind/commit/62552d79cc79e05825e99aaba134ae5b37f33da5)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `tape` [`ec81665`](https://github.com/ljharb/call-bind/commit/ec81665b300f87eabff597afdc8b8092adfa7afd)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `safe-publish-latest`, `tape` [`35d67fc`](https://github.com/ljharb/call-bind/commit/35d67fcea883e686650f736f61da5ddca2592de8)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`0266d8d`](https://github.com/ljharb/call-bind/commit/0266d8d2a45086a922db366d0c2932fa463662ff)
+- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`43a5b28`](https://github.com/ljharb/call-bind/commit/43a5b28a444e710e1bbf92adb8afb5cf7523a223)
+- [Deps] update `define-data-property`, `function-bind`, `get-intrinsic` [`780eb36`](https://github.com/ljharb/call-bind/commit/780eb36552514f8cc99c70821ce698697c2726a5)
+- [Dev Deps] update `aud`, `tape` [`90d50ad`](https://github.com/ljharb/call-bind/commit/90d50ad03b061e0268b3380b0065fcaec183dc05)
+- [meta] use `prepublishOnly` script for npm 7+ [`44c5433`](https://github.com/ljharb/call-bind/commit/44c5433b7980e02b4870007046407cf6fc543329)
+- [Deps] update `get-intrinsic` [`86bfbfc`](https://github.com/ljharb/call-bind/commit/86bfbfcf34afdc6eabc93ce3d408548d0e27d958)
+- [Deps] update `get-intrinsic` [`5c53354`](https://github.com/ljharb/call-bind/commit/5c5335489be0294c18cd7a8bb6e08226ee019ff5)
+- [actions] update checkout action [`4c393a8`](https://github.com/ljharb/call-bind/commit/4c393a8173b3c8e5b30d5b3297b3b94d48bf87f3)
+- [Deps] update `get-intrinsic` [`4e70bde`](https://github.com/ljharb/call-bind/commit/4e70bdec0626acb11616d66250fc14565e716e91)
+- [Deps] update `get-intrinsic` [`55ae803`](https://github.com/ljharb/call-bind/commit/55ae803a920bd93c369cd798c20de31f91e9fc60)
+
+## [v1.0.2](https://github.com/ljharb/call-bind/compare/v1.0.1...v1.0.2) - 2021-01-11
+
+### Commits
+
+- [Fix] properly include the receiver in the bound length [`dbae7bc`](https://github.com/ljharb/call-bind/commit/dbae7bc676c079a0d33c0a43e9ef92cb7b01345d)
+
+## [v1.0.1](https://github.com/ljharb/call-bind/compare/v1.0.0...v1.0.1) - 2021-01-08
+
+### Commits
+
+- [Tests] migrate tests to Github Actions [`b6db284`](https://github.com/ljharb/call-bind/commit/b6db284c36f8ccd195b88a6764fe84b7223a0da1)
+- [meta] do not publish github action workflow files [`ec7fe46`](https://github.com/ljharb/call-bind/commit/ec7fe46e60cfa4764ee943d2755f5e5a366e578e)
+- [Fix] preserve original function’s length when possible [`adbceaa`](https://github.com/ljharb/call-bind/commit/adbceaa3cac4b41ea78bb19d7ccdbaaf7e0bdadb)
+- [Tests] gather coverage data on every job [`d69e23c`](https://github.com/ljharb/call-bind/commit/d69e23cc65f101ba1d4c19bb07fa8eb0ec624be8)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`2fd3586`](https://github.com/ljharb/call-bind/commit/2fd3586c5d47b335364c14293114c6b625ae1f71)
+- [Deps] update `get-intrinsic` [`f23e931`](https://github.com/ljharb/call-bind/commit/f23e9318cc271c2add8bb38cfded85ee7baf8eee)
+- [Deps] update `get-intrinsic` [`72d9f44`](https://github.com/ljharb/call-bind/commit/72d9f44e184465ba8dd3fb48260bbcff234985f2)
+- [meta] fix FUNDING.yml [`e723573`](https://github.com/ljharb/call-bind/commit/e723573438c5a68dcec31fb5d96ea6b7e4a93be8)
+- [eslint] ignore coverage output [`15e76d2`](https://github.com/ljharb/call-bind/commit/15e76d28a5f43e504696401e5b31ebb78ee1b532)
+- [meta] add Automatic Rebase and Require Allow Edits workflows [`8fa4dab`](https://github.com/ljharb/call-bind/commit/8fa4dabb23ba3dd7bb92c9571c1241c08b56e4b6)
+
+## v1.0.0 - 2020-10-30
+
+### Commits
+
+- Initial commit [`306cf98`](https://github.com/ljharb/call-bind/commit/306cf98c7ec9e7ef66b653ec152277ac1381eb50)
+- Tests [`e10d0bb`](https://github.com/ljharb/call-bind/commit/e10d0bbdadc7a10ecedc9a1c035112d3e368b8df)
+- Implementation [`43852ed`](https://github.com/ljharb/call-bind/commit/43852eda0f187327b7fad2423ca972149a52bd65)
+- npm init [`408f860`](https://github.com/ljharb/call-bind/commit/408f860b773a2f610805fd3613d0d71bac1b6249)
+- [meta] add Automatic Rebase and Require Allow Edits workflows [`fb349b2`](https://github.com/ljharb/call-bind/commit/fb349b2e48defbec8b5ec8a8395cc8f69f220b13)
+- [meta] add `auto-changelog` [`c4001fc`](https://github.com/ljharb/call-bind/commit/c4001fc43031799ef908211c98d3b0fb2b60fde4)
+- [meta] add "funding"; create `FUNDING.yml` [`d4d6d29`](https://github.com/ljharb/call-bind/commit/d4d6d2974a14bc2e98830468eda7fe6d6a776717)
+- [Tests] add `npm run lint` [`dedfb98`](https://github.com/ljharb/call-bind/commit/dedfb98bd0ecefb08ddb9a94061bd10cde4332af)
+- Only apps should have lockfiles [`54ac776`](https://github.com/ljharb/call-bind/commit/54ac77653db45a7361dc153d2f478e743f110650)
+- [meta] add `safe-publish-latest` [`9ea8e43`](https://github.com/ljharb/call-bind/commit/9ea8e435b950ce9b705559cd651039f9bf40140f)
diff --git a/server/node_modules/call-bind/LICENSE b/server/node_modules/call-bind/LICENSE
new file mode 100644
index 000000000..48f05d01d
--- /dev/null
+++ b/server/node_modules/call-bind/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2020 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/server/node_modules/call-bind/README.md b/server/node_modules/call-bind/README.md
new file mode 100644
index 000000000..48e9047f0
--- /dev/null
+++ b/server/node_modules/call-bind/README.md
@@ -0,0 +1,64 @@
+# call-bind [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![dependency status][deps-svg]][deps-url]
+[![dev dependency status][dev-deps-svg]][dev-deps-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+Robustly `.call.bind()` a function.
+
+## Getting started
+
+```sh
+npm install --save call-bind
+```
+
+## Usage/Examples
+
+```js
+const assert = require('assert');
+const callBind = require('call-bind');
+const callBound = require('call-bind/callBound');
+
+function f(a, b) {
+ assert.equal(this, 1);
+ assert.equal(a, 2);
+ assert.equal(b, 3);
+ assert.equal(arguments.length, 2);
+}
+
+const fBound = callBind(f);
+
+const slice = callBound('Array.prototype.slice');
+
+delete Function.prototype.call;
+delete Function.prototype.bind;
+
+fBound(1, 2, 3);
+
+assert.deepEqual(slice([1, 2, 3, 4], 1, -1), [2, 3]);
+```
+
+## Tests
+
+Clone the repo, `npm install`, and run `npm test`
+
+[package-url]: https://npmjs.org/package/call-bind
+[npm-version-svg]: https://versionbadg.es/ljharb/call-bind.svg
+[deps-svg]: https://david-dm.org/ljharb/call-bind.svg
+[deps-url]: https://david-dm.org/ljharb/call-bind
+[dev-deps-svg]: https://david-dm.org/ljharb/call-bind/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/call-bind#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/call-bind.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/call-bind.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/call-bind.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=call-bind
+[codecov-image]: https://codecov.io/gh/ljharb/call-bind/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/call-bind/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bind
+[actions-url]: https://github.com/ljharb/call-bind/actions
diff --git a/server/node_modules/call-bind/callBound.js b/server/node_modules/call-bind/callBound.js
new file mode 100644
index 000000000..8374adfd0
--- /dev/null
+++ b/server/node_modules/call-bind/callBound.js
@@ -0,0 +1,15 @@
+'use strict';
+
+var GetIntrinsic = require('get-intrinsic');
+
+var callBind = require('./');
+
+var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf'));
+
+module.exports = function callBoundIntrinsic(name, allowMissing) {
+ var intrinsic = GetIntrinsic(name, !!allowMissing);
+ if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.') > -1) {
+ return callBind(intrinsic);
+ }
+ return intrinsic;
+};
diff --git a/server/node_modules/call-bind/index.js b/server/node_modules/call-bind/index.js
new file mode 100644
index 000000000..184ee2be3
--- /dev/null
+++ b/server/node_modules/call-bind/index.js
@@ -0,0 +1,44 @@
+'use strict';
+
+var bind = require('function-bind');
+var GetIntrinsic = require('get-intrinsic');
+var setFunctionLength = require('set-function-length');
+
+var $TypeError = GetIntrinsic('%TypeError%');
+var $apply = GetIntrinsic('%Function.prototype.apply%');
+var $call = GetIntrinsic('%Function.prototype.call%');
+var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply);
+
+var $defineProperty = GetIntrinsic('%Object.defineProperty%', true);
+var $max = GetIntrinsic('%Math.max%');
+
+if ($defineProperty) {
+ try {
+ $defineProperty({}, 'a', { value: 1 });
+ } catch (e) {
+ // IE 8 has a broken defineProperty
+ $defineProperty = null;
+ }
+}
+
+module.exports = function callBind(originalFunction) {
+ if (typeof originalFunction !== 'function') {
+ throw new $TypeError('a function is required');
+ }
+ var func = $reflectApply(bind, $call, arguments);
+ return setFunctionLength(
+ func,
+ 1 + $max(0, originalFunction.length - (arguments.length - 1)),
+ true
+ );
+};
+
+var applyBind = function applyBind() {
+ return $reflectApply(bind, $apply, arguments);
+};
+
+if ($defineProperty) {
+ $defineProperty(module.exports, 'apply', { value: applyBind });
+} else {
+ module.exports.apply = applyBind;
+}
diff --git a/server/node_modules/call-bind/package.json b/server/node_modules/call-bind/package.json
new file mode 100644
index 000000000..f946e1a91
--- /dev/null
+++ b/server/node_modules/call-bind/package.json
@@ -0,0 +1,90 @@
+{
+ "name": "call-bind",
+ "version": "1.0.5",
+ "description": "Robustly `.call.bind()` a function",
+ "main": "index.js",
+ "exports": {
+ ".": "./index.js",
+ "./callBound": "./callBound.js",
+ "./package.json": "./package.json"
+ },
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=auto",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "lint": "eslint --ext=.js,.mjs .",
+ "postlint": "evalmd README.md",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "aud --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/call-bind.git"
+ },
+ "keywords": [
+ "javascript",
+ "ecmascript",
+ "es",
+ "js",
+ "callbind",
+ "callbound",
+ "call",
+ "bind",
+ "bound",
+ "call-bind",
+ "call-bound",
+ "function",
+ "es-abstract"
+ ],
+ "author": "Jordan Harband ",
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/call-bind/issues"
+ },
+ "homepage": "https://github.com/ljharb/call-bind#readme",
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.0",
+ "aud": "^2.0.3",
+ "auto-changelog": "^2.4.0",
+ "es-value-fixtures": "^1.4.2",
+ "eslint": "=8.8.0",
+ "evalmd": "^0.0.19",
+ "for-each": "^0.3.3",
+ "gopd": "^1.0.1",
+ "has-strict-mode": "^1.0.1",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.0",
+ "nyc": "^10.3.2",
+ "object-inspect": "^1.13.1",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.7.1"
+ },
+ "dependencies": {
+ "function-bind": "^1.1.2",
+ "get-intrinsic": "^1.2.1",
+ "set-function-length": "^1.1.1"
+ },
+ "testling": {
+ "files": "test/index.js"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ }
+}
diff --git a/server/node_modules/call-bind/test/callBound.js b/server/node_modules/call-bind/test/callBound.js
new file mode 100644
index 000000000..c32319d70
--- /dev/null
+++ b/server/node_modules/call-bind/test/callBound.js
@@ -0,0 +1,54 @@
+'use strict';
+
+var test = require('tape');
+
+var callBound = require('../callBound');
+
+test('callBound', function (t) {
+ // static primitive
+ t.equal(callBound('Array.length'), Array.length, 'Array.length yields itself');
+ t.equal(callBound('%Array.length%'), Array.length, '%Array.length% yields itself');
+
+ // static non-function object
+ t.equal(callBound('Array.prototype'), Array.prototype, 'Array.prototype yields itself');
+ t.equal(callBound('%Array.prototype%'), Array.prototype, '%Array.prototype% yields itself');
+ t.equal(callBound('Array.constructor'), Array.constructor, 'Array.constructor yields itself');
+ t.equal(callBound('%Array.constructor%'), Array.constructor, '%Array.constructor% yields itself');
+
+ // static function
+ t.equal(callBound('Date.parse'), Date.parse, 'Date.parse yields itself');
+ t.equal(callBound('%Date.parse%'), Date.parse, '%Date.parse% yields itself');
+
+ // prototype primitive
+ t.equal(callBound('Error.prototype.message'), Error.prototype.message, 'Error.prototype.message yields itself');
+ t.equal(callBound('%Error.prototype.message%'), Error.prototype.message, '%Error.prototype.message% yields itself');
+
+ // prototype function
+ t.notEqual(callBound('Object.prototype.toString'), Object.prototype.toString, 'Object.prototype.toString does not yield itself');
+ t.notEqual(callBound('%Object.prototype.toString%'), Object.prototype.toString, '%Object.prototype.toString% does not yield itself');
+ t.equal(callBound('Object.prototype.toString')(true), Object.prototype.toString.call(true), 'call-bound Object.prototype.toString calls into the original');
+ t.equal(callBound('%Object.prototype.toString%')(true), Object.prototype.toString.call(true), 'call-bound %Object.prototype.toString% calls into the original');
+
+ t['throws'](
+ function () { callBound('does not exist'); },
+ SyntaxError,
+ 'nonexistent intrinsic throws'
+ );
+ t['throws'](
+ function () { callBound('does not exist', true); },
+ SyntaxError,
+ 'allowMissing arg still throws for unknown intrinsic'
+ );
+
+ t.test('real but absent intrinsic', { skip: typeof WeakRef !== 'undefined' }, function (st) {
+ st['throws'](
+ function () { callBound('WeakRef'); },
+ TypeError,
+ 'real but absent intrinsic throws'
+ );
+ st.equal(callBound('WeakRef', true), undefined, 'allowMissing arg avoids exception');
+ st.end();
+ });
+
+ t.end();
+});
diff --git a/server/node_modules/call-bind/test/index.js b/server/node_modules/call-bind/test/index.js
new file mode 100644
index 000000000..1fd46689e
--- /dev/null
+++ b/server/node_modules/call-bind/test/index.js
@@ -0,0 +1,80 @@
+'use strict';
+
+var callBind = require('../');
+var bind = require('function-bind');
+var gOPD = require('gopd');
+var hasStrictMode = require('has-strict-mode')();
+var forEach = require('for-each');
+var inspect = require('object-inspect');
+var v = require('es-value-fixtures');
+
+var test = require('tape');
+
+/*
+ * older engines have length nonconfigurable
+ * in io.js v3, it is configurable except on bound functions, hence the .bind()
+ */
+var functionsHaveConfigurableLengths = !!(
+ gOPD
+ && Object.getOwnPropertyDescriptor
+ && Object.getOwnPropertyDescriptor(bind.call(function () {}), 'length').configurable
+);
+
+test('callBind', function (t) {
+ forEach(v.nonFunctions, function (nonFunction) {
+ t['throws'](
+ function () { callBind(nonFunction); },
+ TypeError,
+ inspect(nonFunction) + ' is not a function'
+ );
+ });
+
+ var sentinel = { sentinel: true };
+ var func = function (a, b) {
+ // eslint-disable-next-line no-invalid-this
+ return [!hasStrictMode && this === global ? undefined : this, a, b];
+ };
+ t.equal(func.length, 2, 'original function length is 2');
+ t.deepEqual(func(), [undefined, undefined, undefined], 'unbound func with too few args');
+ t.deepEqual(func(1, 2), [undefined, 1, 2], 'unbound func with right args');
+ t.deepEqual(func(1, 2, 3), [undefined, 1, 2], 'unbound func with too many args');
+
+ var bound = callBind(func);
+ t.equal(bound.length, func.length + 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths });
+ t.deepEqual(bound(), [undefined, undefined, undefined], 'bound func with too few args');
+ t.deepEqual(bound(1, 2), [hasStrictMode ? 1 : Object(1), 2, undefined], 'bound func with right args');
+ t.deepEqual(bound(1, 2, 3), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with too many args');
+
+ var boundR = callBind(func, sentinel);
+ t.equal(boundR.length, func.length, 'function length is preserved', { skip: !functionsHaveConfigurableLengths });
+ t.deepEqual(boundR(), [sentinel, undefined, undefined], 'bound func with receiver, with too few args');
+ t.deepEqual(boundR(1, 2), [sentinel, 1, 2], 'bound func with receiver, with right args');
+ t.deepEqual(boundR(1, 2, 3), [sentinel, 1, 2], 'bound func with receiver, with too many args');
+
+ var boundArg = callBind(func, sentinel, 1);
+ t.equal(boundArg.length, func.length - 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths });
+ t.deepEqual(boundArg(), [sentinel, 1, undefined], 'bound func with receiver and arg, with too few args');
+ t.deepEqual(boundArg(2), [sentinel, 1, 2], 'bound func with receiver and arg, with right arg');
+ t.deepEqual(boundArg(2, 3), [sentinel, 1, 2], 'bound func with receiver and arg, with too many args');
+
+ t.test('callBind.apply', function (st) {
+ var aBound = callBind.apply(func);
+ st.deepEqual(aBound(sentinel), [sentinel, undefined, undefined], 'apply-bound func with no args');
+ st.deepEqual(aBound(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args');
+ st.deepEqual(aBound(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args');
+
+ var aBoundArg = callBind.apply(func);
+ st.deepEqual(aBoundArg(sentinel, [1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with too many args');
+ st.deepEqual(aBoundArg(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args');
+ st.deepEqual(aBoundArg(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args');
+
+ var aBoundR = callBind.apply(func, sentinel);
+ st.deepEqual(aBoundR([1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with receiver and too many args');
+ st.deepEqual(aBoundR([1, 2], 4), [sentinel, 1, 2], 'apply-bound func with receiver and right args');
+ st.deepEqual(aBoundR([1], 4), [sentinel, 1, undefined], 'apply-bound func with receiver and too few args');
+
+ st.end();
+ });
+
+ t.end();
+});
diff --git a/server/node_modules/content-disposition/HISTORY.md b/server/node_modules/content-disposition/HISTORY.md
new file mode 100644
index 000000000..488effa0c
--- /dev/null
+++ b/server/node_modules/content-disposition/HISTORY.md
@@ -0,0 +1,60 @@
+0.5.4 / 2021-12-10
+==================
+
+ * deps: safe-buffer@5.2.1
+
+0.5.3 / 2018-12-17
+==================
+
+ * Use `safe-buffer` for improved Buffer API
+
+0.5.2 / 2016-12-08
+==================
+
+ * Fix `parse` to accept any linear whitespace character
+
+0.5.1 / 2016-01-17
+==================
+
+ * perf: enable strict mode
+
+0.5.0 / 2014-10-11
+==================
+
+ * Add `parse` function
+
+0.4.0 / 2014-09-21
+==================
+
+ * Expand non-Unicode `filename` to the full ISO-8859-1 charset
+
+0.3.0 / 2014-09-20
+==================
+
+ * Add `fallback` option
+ * Add `type` option
+
+0.2.0 / 2014-09-19
+==================
+
+ * Reduce ambiguity of file names with hex escape in buggy browsers
+
+0.1.2 / 2014-09-19
+==================
+
+ * Fix periodic invalid Unicode filename header
+
+0.1.1 / 2014-09-19
+==================
+
+ * Fix invalid characters appearing in `filename*` parameter
+
+0.1.0 / 2014-09-18
+==================
+
+ * Make the `filename` argument optional
+
+0.0.0 / 2014-09-18
+==================
+
+ * Initial release
diff --git a/server/node_modules/content-disposition/LICENSE b/server/node_modules/content-disposition/LICENSE
new file mode 100644
index 000000000..84441fbb5
--- /dev/null
+++ b/server/node_modules/content-disposition/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/content-disposition/README.md b/server/node_modules/content-disposition/README.md
new file mode 100644
index 000000000..3a0bb0559
--- /dev/null
+++ b/server/node_modules/content-disposition/README.md
@@ -0,0 +1,142 @@
+# content-disposition
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create and parse HTTP `Content-Disposition` header
+
+## Installation
+
+```sh
+$ npm install content-disposition
+```
+
+## API
+
+```js
+var contentDisposition = require('content-disposition')
+```
+
+### contentDisposition(filename, options)
+
+Create an attachment `Content-Disposition` header value using the given file name,
+if supplied. The `filename` is optional and if no file name is desired, but you
+want to specify `options`, set `filename` to `undefined`.
+
+```js
+res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf'))
+```
+
+**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this
+header through a means different from `setHeader` in Node.js, you'll want to specify
+the `'binary'` encoding in Node.js.
+
+#### Options
+
+`contentDisposition` accepts these properties in the options object.
+
+##### fallback
+
+If the `filename` option is outside ISO-8859-1, then the file name is actually
+stored in a supplemental field for clients that support Unicode file names and
+a ISO-8859-1 version of the file name is automatically generated.
+
+This specifies the ISO-8859-1 file name to override the automatic generation or
+disables the generation all together, defaults to `true`.
+
+ - A string will specify the ISO-8859-1 file name to use in place of automatic
+ generation.
+ - `false` will disable including a ISO-8859-1 file name and only include the
+ Unicode version (unless the file name is already ISO-8859-1).
+ - `true` will enable automatic generation if the file name is outside ISO-8859-1.
+
+If the `filename` option is ISO-8859-1 and this option is specified and has a
+different value, then the `filename` option is encoded in the extended field
+and this set as the fallback field, even though they are both ISO-8859-1.
+
+##### type
+
+Specifies the disposition type, defaults to `"attachment"`. This can also be
+`"inline"`, or any other value (all values except inline are treated like
+`attachment`, but can convey additional information if both parties agree to
+it). The type is normalized to lower-case.
+
+### contentDisposition.parse(string)
+
+```js
+var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt')
+```
+
+Parse a `Content-Disposition` header string. This automatically handles extended
+("Unicode") parameters by decoding them and providing them under the standard
+parameter name. This will return an object with the following properties (examples
+are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`):
+
+ - `type`: The disposition type (always lower case). Example: `'attachment'`
+
+ - `parameters`: An object of the parameters in the disposition (name of parameter
+ always lower case and extended versions replace non-extended versions). Example:
+ `{filename: "€ rates.txt"}`
+
+## Examples
+
+### Send a file for download
+
+```js
+var contentDisposition = require('content-disposition')
+var destroy = require('destroy')
+var fs = require('fs')
+var http = require('http')
+var onFinished = require('on-finished')
+
+var filePath = '/path/to/public/plans.pdf'
+
+http.createServer(function onRequest (req, res) {
+ // set headers
+ res.setHeader('Content-Type', 'application/pdf')
+ res.setHeader('Content-Disposition', contentDisposition(filePath))
+
+ // send file
+ var stream = fs.createReadStream(filePath)
+ stream.pipe(res)
+ onFinished(res, function () {
+ destroy(stream)
+ })
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## References
+
+- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616]
+- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987]
+- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266]
+- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231]
+
+[rfc-2616]: https://tools.ietf.org/html/rfc2616
+[rfc-5987]: https://tools.ietf.org/html/rfc5987
+[rfc-6266]: https://tools.ietf.org/html/rfc6266
+[tc-2231]: http://greenbytes.de/tech/tc2231/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/content-disposition.svg
+[npm-url]: https://npmjs.org/package/content-disposition
+[node-version-image]: https://img.shields.io/node/v/content-disposition.svg
+[node-version-url]: https://nodejs.org/en/download
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg
+[downloads-url]: https://npmjs.org/package/content-disposition
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/content-disposition/ci/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/content-disposition?query=workflow%3Aci
diff --git a/server/node_modules/content-disposition/index.js b/server/node_modules/content-disposition/index.js
new file mode 100644
index 000000000..ecec899a9
--- /dev/null
+++ b/server/node_modules/content-disposition/index.js
@@ -0,0 +1,458 @@
+/*!
+ * content-disposition
+ * Copyright(c) 2014-2017 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = contentDisposition
+module.exports.parse = parse
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var basename = require('path').basename
+var Buffer = require('safe-buffer').Buffer
+
+/**
+ * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%")
+ * @private
+ */
+
+var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match percent encoding escape.
+ * @private
+ */
+
+var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/
+var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g
+
+/**
+ * RegExp to match non-latin1 characters.
+ * @private
+ */
+
+var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g
+
+/**
+ * RegExp to match quoted-pair in RFC 2616
+ *
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * @private
+ */
+
+var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 2616
+ * @private
+ */
+
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp for various RFC 2616 grammar
+ *
+ * parameter = token "=" ( token | quoted-string )
+ * token = 1*
+ * separators = "(" | ")" | "<" | ">" | "@"
+ * | "," | ";" | ":" | "\" | <">
+ * | "/" | "[" | "]" | "?" | "="
+ * | "{" | "}" | SP | HT
+ * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
+ * qdtext = >
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * TEXT =
+ * LWS = [CRLF] 1*( SP | HT )
+ * CRLF = CR LF
+ * CR =
+ * LF =
+ * SP =
+ * HT =
+ * CTL =
+ * OCTET =
+ * @private
+ */
+
+var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex
+var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/
+var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/
+
+/**
+ * RegExp for various RFC 5987 grammar
+ *
+ * ext-value = charset "'" [ language ] "'" value-chars
+ * charset = "UTF-8" / "ISO-8859-1" / mime-charset
+ * mime-charset = 1*mime-charsetc
+ * mime-charsetc = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "%" / "&"
+ * / "+" / "-" / "^" / "_" / "`"
+ * / "{" / "}" / "~"
+ * language = ( 2*3ALPHA [ extlang ] )
+ * / 4ALPHA
+ * / 5*8ALPHA
+ * extlang = *3( "-" 3ALPHA )
+ * value-chars = *( pct-encoded / attr-char )
+ * pct-encoded = "%" HEXDIG HEXDIG
+ * attr-char = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "&" / "+" / "-" / "."
+ * / "^" / "_" / "`" / "|" / "~"
+ * @private
+ */
+
+var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/
+
+/**
+ * RegExp for various RFC 6266 grammar
+ *
+ * disposition-type = "inline" | "attachment" | disp-ext-type
+ * disp-ext-type = token
+ * disposition-parm = filename-parm | disp-ext-parm
+ * filename-parm = "filename" "=" value
+ * | "filename*" "=" ext-value
+ * disp-ext-parm = token "=" value
+ * | ext-token "=" ext-value
+ * ext-token =
+ * @private
+ */
+
+var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex
+
+/**
+ * Create an attachment Content-Disposition header.
+ *
+ * @param {string} [filename]
+ * @param {object} [options]
+ * @param {string} [options.type=attachment]
+ * @param {string|boolean} [options.fallback=true]
+ * @return {string}
+ * @public
+ */
+
+function contentDisposition (filename, options) {
+ var opts = options || {}
+
+ // get type
+ var type = opts.type || 'attachment'
+
+ // get parameters
+ var params = createparams(filename, opts.fallback)
+
+ // format into string
+ return format(new ContentDisposition(type, params))
+}
+
+/**
+ * Create parameters object from filename and fallback.
+ *
+ * @param {string} [filename]
+ * @param {string|boolean} [fallback=true]
+ * @return {object}
+ * @private
+ */
+
+function createparams (filename, fallback) {
+ if (filename === undefined) {
+ return
+ }
+
+ var params = {}
+
+ if (typeof filename !== 'string') {
+ throw new TypeError('filename must be a string')
+ }
+
+ // fallback defaults to true
+ if (fallback === undefined) {
+ fallback = true
+ }
+
+ if (typeof fallback !== 'string' && typeof fallback !== 'boolean') {
+ throw new TypeError('fallback must be a string or boolean')
+ }
+
+ if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) {
+ throw new TypeError('fallback must be ISO-8859-1 string')
+ }
+
+ // restrict to file base name
+ var name = basename(filename)
+
+ // determine if name is suitable for quoted string
+ var isQuotedString = TEXT_REGEXP.test(name)
+
+ // generate fallback name
+ var fallbackName = typeof fallback !== 'string'
+ ? fallback && getlatin1(name)
+ : basename(fallback)
+ var hasFallback = typeof fallbackName === 'string' && fallbackName !== name
+
+ // set extended filename parameter
+ if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) {
+ params['filename*'] = name
+ }
+
+ // set filename parameter
+ if (isQuotedString || hasFallback) {
+ params.filename = hasFallback
+ ? fallbackName
+ : name
+ }
+
+ return params
+}
+
+/**
+ * Format object to Content-Disposition header.
+ *
+ * @param {object} obj
+ * @param {string} obj.type
+ * @param {object} [obj.parameters]
+ * @return {string}
+ * @private
+ */
+
+function format (obj) {
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ // start with normalized type
+ var string = String(type).toLowerCase()
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ var val = param.substr(-1) === '*'
+ ? ustring(parameters[param])
+ : qstring(parameters[param])
+
+ string += '; ' + param + '=' + val
+ }
+ }
+
+ return string
+}
+
+/**
+ * Decode a RFC 5987 field value (gracefully).
+ *
+ * @param {string} str
+ * @return {string}
+ * @private
+ */
+
+function decodefield (str) {
+ var match = EXT_VALUE_REGEXP.exec(str)
+
+ if (!match) {
+ throw new TypeError('invalid extended field value')
+ }
+
+ var charset = match[1].toLowerCase()
+ var encoded = match[2]
+ var value
+
+ // to binary string
+ var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode)
+
+ switch (charset) {
+ case 'iso-8859-1':
+ value = getlatin1(binary)
+ break
+ case 'utf-8':
+ value = Buffer.from(binary, 'binary').toString('utf8')
+ break
+ default:
+ throw new TypeError('unsupported charset in extended field')
+ }
+
+ return value
+}
+
+/**
+ * Get ISO-8859-1 version of string.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function getlatin1 (val) {
+ // simple Unicode -> ISO-8859-1 transformation
+ return String(val).replace(NON_LATIN1_REGEXP, '?')
+}
+
+/**
+ * Parse Content-Disposition header string.
+ *
+ * @param {string} string
+ * @return {object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string || typeof string !== 'string') {
+ throw new TypeError('argument string is required')
+ }
+
+ var match = DISPOSITION_TYPE_REGEXP.exec(string)
+
+ if (!match) {
+ throw new TypeError('invalid type format')
+ }
+
+ // normalize type
+ var index = match[0].length
+ var type = match[1].toLowerCase()
+
+ var key
+ var names = []
+ var params = {}
+ var value
+
+ // calculate index to start at
+ index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';'
+ ? index - 1
+ : index
+
+ // match parameters
+ while ((match = PARAM_REGEXP.exec(string))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (names.indexOf(key) !== -1) {
+ throw new TypeError('invalid duplicate parameter')
+ }
+
+ names.push(key)
+
+ if (key.indexOf('*') + 1 === key.length) {
+ // decode extended value
+ key = key.slice(0, -1)
+ value = decodefield(value)
+
+ // overwrite existing value
+ params[key] = value
+ continue
+ }
+
+ if (typeof params[key] === 'string') {
+ continue
+ }
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(QESC_REGEXP, '$1')
+ }
+
+ params[key] = value
+ }
+
+ if (index !== -1 && index !== string.length) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ return new ContentDisposition(type, params)
+}
+
+/**
+ * Percent decode a single character.
+ *
+ * @param {string} str
+ * @param {string} hex
+ * @return {string}
+ * @private
+ */
+
+function pdecode (str, hex) {
+ return String.fromCharCode(parseInt(hex, 16))
+}
+
+/**
+ * Percent encode a single character.
+ *
+ * @param {string} char
+ * @return {string}
+ * @private
+ */
+
+function pencode (char) {
+ return '%' + String(char)
+ .charCodeAt(0)
+ .toString(16)
+ .toUpperCase()
+}
+
+/**
+ * Quote a string for HTTP.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Encode a Unicode string for HTTP (RFC 5987).
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function ustring (val) {
+ var str = String(val)
+
+ // percent encode as UTF-8
+ var encoded = encodeURIComponent(str)
+ .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode)
+
+ return 'UTF-8\'\'' + encoded
+}
+
+/**
+ * Class for parsed Content-Disposition header for v8 optimization
+ *
+ * @public
+ * @param {string} type
+ * @param {object} parameters
+ * @constructor
+ */
+
+function ContentDisposition (type, parameters) {
+ this.type = type
+ this.parameters = parameters
+}
diff --git a/server/node_modules/content-disposition/package.json b/server/node_modules/content-disposition/package.json
new file mode 100644
index 000000000..43c70ce24
--- /dev/null
+++ b/server/node_modules/content-disposition/package.json
@@ -0,0 +1,44 @@
+{
+ "name": "content-disposition",
+ "description": "Create and parse Content-Disposition header",
+ "version": "0.5.4",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "content-disposition",
+ "http",
+ "rfc6266",
+ "res"
+ ],
+ "repository": "jshttp/content-disposition",
+ "dependencies": {
+ "safe-buffer": "5.2.1"
+ },
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "7.32.0",
+ "eslint-config-standard": "13.0.1",
+ "eslint-plugin-import": "2.25.3",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "5.2.0",
+ "eslint-plugin-standard": "4.1.0",
+ "istanbul": "0.4.5",
+ "mocha": "9.1.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/"
+ }
+}
diff --git a/server/node_modules/content-type/HISTORY.md b/server/node_modules/content-type/HISTORY.md
new file mode 100644
index 000000000..458367139
--- /dev/null
+++ b/server/node_modules/content-type/HISTORY.md
@@ -0,0 +1,29 @@
+1.0.5 / 2023-01-29
+==================
+
+ * perf: skip value escaping when unnecessary
+
+1.0.4 / 2017-09-11
+==================
+
+ * perf: skip parameter parsing when no parameters
+
+1.0.3 / 2017-09-10
+==================
+
+ * perf: remove argument reassignment
+
+1.0.2 / 2016-05-09
+==================
+
+ * perf: enable strict mode
+
+1.0.1 / 2015-02-13
+==================
+
+ * Improve missing `Content-Type` header error message
+
+1.0.0 / 2015-02-01
+==================
+
+ * Initial implementation, derived from `media-typer@0.3.0`
diff --git a/server/node_modules/content-type/LICENSE b/server/node_modules/content-type/LICENSE
new file mode 100644
index 000000000..34b1a2de3
--- /dev/null
+++ b/server/node_modules/content-type/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/content-type/README.md b/server/node_modules/content-type/README.md
new file mode 100644
index 000000000..c1a922a9a
--- /dev/null
+++ b/server/node_modules/content-type/README.md
@@ -0,0 +1,94 @@
+# content-type
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][ci-image]][ci-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Create and parse HTTP Content-Type header according to RFC 7231
+
+## Installation
+
+```sh
+$ npm install content-type
+```
+
+## API
+
+```js
+var contentType = require('content-type')
+```
+
+### contentType.parse(string)
+
+```js
+var obj = contentType.parse('image/svg+xml; charset=utf-8')
+```
+
+Parse a `Content-Type` header. This will return an object with the following
+properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (the type and subtype, always lower case).
+ Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of parameter
+ always lower case). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the string is missing or invalid.
+
+### contentType.parse(req)
+
+```js
+var obj = contentType.parse(req)
+```
+
+Parse the `Content-Type` header from the given `req`. Short-cut for
+`contentType.parse(req.headers['content-type'])`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.parse(res)
+
+```js
+var obj = contentType.parse(res)
+```
+
+Parse the `Content-Type` header set on the given `res`. Short-cut for
+`contentType.parse(res.getHeader('content-type'))`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.format(obj)
+
+```js
+var str = contentType.format({
+ type: 'image/svg+xml',
+ parameters: { charset: 'utf-8' }
+})
+```
+
+Format an object into a `Content-Type` header. This will return a string of the
+content type for the given object with the following properties (examples are
+shown that produce the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of the
+ parameter will be lower-cased). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the object contains an invalid type or parameter names.
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/jshttp/content-type/master?label=ci
+[ci-url]: https://github.com/jshttp/content-type/actions/workflows/ci.yml
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/content-type/master
+[coveralls-url]: https://coveralls.io/r/jshttp/content-type?branch=master
+[node-image]: https://badgen.net/npm/node/content-type
+[node-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/content-type
+[npm-url]: https://npmjs.org/package/content-type
+[npm-version-image]: https://badgen.net/npm/v/content-type
diff --git a/server/node_modules/content-type/index.js b/server/node_modules/content-type/index.js
new file mode 100644
index 000000000..41840e7bc
--- /dev/null
+++ b/server/node_modules/content-type/index.js
@@ -0,0 +1,225 @@
+/*!
+ * content-type
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1
+ *
+ * parameter = token "=" ( token / quoted-string )
+ * token = 1*tchar
+ * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*"
+ * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~"
+ * / DIGIT / ALPHA
+ * ; any VCHAR, except delimiters
+ * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE
+ * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text
+ * obs-text = %x80-FF
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ */
+var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g // eslint-disable-line no-control-regex
+var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ // eslint-disable-line no-control-regex
+var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * RegExp to match quoted-pair in RFC 7230 sec 3.2.6
+ *
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ * obs-text = %x80-FF
+ */
+var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6
+ */
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp to match type in RFC 7231 sec 3.1.1.1
+ *
+ * media-type = type "/" subtype
+ * type = token
+ * subtype = token
+ */
+var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.format = format
+exports.parse = parse
+
+/**
+ * Format object to media type.
+ *
+ * @param {object} obj
+ * @return {string}
+ * @public
+ */
+
+function format (obj) {
+ if (!obj || typeof obj !== 'object') {
+ throw new TypeError('argument obj is required')
+ }
+
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || !TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ var string = type
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ if (!TOKEN_REGEXP.test(param)) {
+ throw new TypeError('invalid parameter name')
+ }
+
+ string += '; ' + param + '=' + qstring(parameters[param])
+ }
+ }
+
+ return string
+}
+
+/**
+ * Parse media type to object.
+ *
+ * @param {string|object} string
+ * @return {Object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string) {
+ throw new TypeError('argument string is required')
+ }
+
+ // support req/res-like objects as argument
+ var header = typeof string === 'object'
+ ? getcontenttype(string)
+ : string
+
+ if (typeof header !== 'string') {
+ throw new TypeError('argument string is required to be a string')
+ }
+
+ var index = header.indexOf(';')
+ var type = index !== -1
+ ? header.slice(0, index).trim()
+ : header.trim()
+
+ if (!TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid media type')
+ }
+
+ var obj = new ContentType(type.toLowerCase())
+
+ // parse parameters
+ if (index !== -1) {
+ var key
+ var match
+ var value
+
+ PARAM_REGEXP.lastIndex = index
+
+ while ((match = PARAM_REGEXP.exec(header))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (value.charCodeAt(0) === 0x22 /* " */) {
+ // remove quotes
+ value = value.slice(1, -1)
+
+ // remove escapes
+ if (value.indexOf('\\') !== -1) {
+ value = value.replace(QESC_REGEXP, '$1')
+ }
+ }
+
+ obj.parameters[key] = value
+ }
+
+ if (index !== header.length) {
+ throw new TypeError('invalid parameter format')
+ }
+ }
+
+ return obj
+}
+
+/**
+ * Get content-type from req/res objects.
+ *
+ * @param {object}
+ * @return {Object}
+ * @private
+ */
+
+function getcontenttype (obj) {
+ var header
+
+ if (typeof obj.getHeader === 'function') {
+ // res-like
+ header = obj.getHeader('content-type')
+ } else if (typeof obj.headers === 'object') {
+ // req-like
+ header = obj.headers && obj.headers['content-type']
+ }
+
+ if (typeof header !== 'string') {
+ throw new TypeError('content-type header is missing from object')
+ }
+
+ return header
+}
+
+/**
+ * Quote a string if necessary.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ // no need to quote tokens
+ if (TOKEN_REGEXP.test(str)) {
+ return str
+ }
+
+ if (str.length > 0 && !TEXT_REGEXP.test(str)) {
+ throw new TypeError('invalid parameter value')
+ }
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Class to represent a content type.
+ * @private
+ */
+function ContentType (type) {
+ this.parameters = Object.create(null)
+ this.type = type
+}
diff --git a/server/node_modules/content-type/package.json b/server/node_modules/content-type/package.json
new file mode 100644
index 000000000..9db19f63f
--- /dev/null
+++ b/server/node_modules/content-type/package.json
@@ -0,0 +1,42 @@
+{
+ "name": "content-type",
+ "description": "Create and parse HTTP Content-Type header",
+ "version": "1.0.5",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "content-type",
+ "http",
+ "req",
+ "res",
+ "rfc7231"
+ ],
+ "repository": "jshttp/content-type",
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "8.32.0",
+ "eslint-config-standard": "15.0.1",
+ "eslint-plugin-import": "2.27.5",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "6.1.1",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcovonly --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "version": "node scripts/version-history.js && git add HISTORY.md"
+ }
+}
diff --git a/server/node_modules/cookie-signature/.npmignore b/server/node_modules/cookie-signature/.npmignore
new file mode 100644
index 000000000..f1250e584
--- /dev/null
+++ b/server/node_modules/cookie-signature/.npmignore
@@ -0,0 +1,4 @@
+support
+test
+examples
+*.sock
diff --git a/server/node_modules/cookie-signature/History.md b/server/node_modules/cookie-signature/History.md
new file mode 100644
index 000000000..78513cc3d
--- /dev/null
+++ b/server/node_modules/cookie-signature/History.md
@@ -0,0 +1,38 @@
+1.0.6 / 2015-02-03
+==================
+
+* use `npm test` instead of `make test` to run tests
+* clearer assertion messages when checking input
+
+
+1.0.5 / 2014-09-05
+==================
+
+* add license to package.json
+
+1.0.4 / 2014-06-25
+==================
+
+ * corrected avoidance of timing attacks (thanks @tenbits!)
+
+1.0.3 / 2014-01-28
+==================
+
+ * [incorrect] fix for timing attacks
+
+1.0.2 / 2014-01-28
+==================
+
+ * fix missing repository warning
+ * fix typo in test
+
+1.0.1 / 2013-04-15
+==================
+
+ * Revert "Changed underlying HMAC algo. to sha512."
+ * Revert "Fix for timing attacks on MAC verification."
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/server/node_modules/cookie-signature/Readme.md b/server/node_modules/cookie-signature/Readme.md
new file mode 100644
index 000000000..2559e841b
--- /dev/null
+++ b/server/node_modules/cookie-signature/Readme.md
@@ -0,0 +1,42 @@
+
+# cookie-signature
+
+ Sign and unsign cookies.
+
+## Example
+
+```js
+var cookie = require('cookie-signature');
+
+var val = cookie.sign('hello', 'tobiiscool');
+val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI');
+
+var val = cookie.sign('hello', 'tobiiscool');
+cookie.unsign(val, 'tobiiscool').should.equal('hello');
+cookie.unsign(val, 'luna').should.be.false;
+```
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2012 LearnBoost <tj@learnboost.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/server/node_modules/cookie-signature/index.js b/server/node_modules/cookie-signature/index.js
new file mode 100644
index 000000000..b8c9463a2
--- /dev/null
+++ b/server/node_modules/cookie-signature/index.js
@@ -0,0 +1,51 @@
+/**
+ * Module dependencies.
+ */
+
+var crypto = require('crypto');
+
+/**
+ * Sign the given `val` with `secret`.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String}
+ * @api private
+ */
+
+exports.sign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ return val + '.' + crypto
+ .createHmac('sha256', secret)
+ .update(val)
+ .digest('base64')
+ .replace(/\=+$/, '');
+};
+
+/**
+ * Unsign and decode the given `val` with `secret`,
+ * returning `false` if the signature is invalid.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String|Boolean}
+ * @api private
+ */
+
+exports.unsign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ var str = val.slice(0, val.lastIndexOf('.'))
+ , mac = exports.sign(str, secret);
+
+ return sha1(mac) == sha1(val) ? str : false;
+};
+
+/**
+ * Private
+ */
+
+function sha1(str){
+ return crypto.createHash('sha1').update(str).digest('hex');
+}
diff --git a/server/node_modules/cookie-signature/package.json b/server/node_modules/cookie-signature/package.json
new file mode 100644
index 000000000..29c4498e0
--- /dev/null
+++ b/server/node_modules/cookie-signature/package.json
@@ -0,0 +1,18 @@
+{
+ "name": "cookie-signature",
+ "version": "1.0.6",
+ "description": "Sign and unsign cookies",
+ "keywords": ["cookie", "sign", "unsign"],
+ "author": "TJ Holowaychuk ",
+ "license": "MIT",
+ "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"},
+ "dependencies": {},
+ "devDependencies": {
+ "mocha": "*",
+ "should": "*"
+ },
+ "scripts": {
+ "test": "mocha --require should --reporter spec"
+ },
+ "main": "index"
+}
diff --git a/server/node_modules/cookie/HISTORY.md b/server/node_modules/cookie/HISTORY.md
new file mode 100644
index 000000000..ae9b995b4
--- /dev/null
+++ b/server/node_modules/cookie/HISTORY.md
@@ -0,0 +1,142 @@
+0.5.0 / 2022-04-11
+==================
+
+ * Add `priority` option
+ * Fix `expires` option to reject invalid dates
+ * pref: improve default decode speed
+ * pref: remove slow string split in parse
+
+0.4.2 / 2022-02-02
+==================
+
+ * pref: read value only when assigning in parse
+ * pref: remove unnecessary regexp in parse
+
+0.4.1 / 2020-04-21
+==================
+
+ * Fix `maxAge` option to reject invalid values
+
+0.4.0 / 2019-05-15
+==================
+
+ * Add `SameSite=None` support
+
+0.3.1 / 2016-05-26
+==================
+
+ * Fix `sameSite: true` to work with draft-7 clients
+ - `true` now sends `SameSite=Strict` instead of `SameSite`
+
+0.3.0 / 2016-05-26
+==================
+
+ * Add `sameSite` option
+ - Replaces `firstPartyOnly` option, never implemented by browsers
+ * Improve error message when `encode` is not a function
+ * Improve error message when `expires` is not a `Date`
+
+0.2.4 / 2016-05-20
+==================
+
+ * perf: enable strict mode
+ * perf: use for loop in parse
+ * perf: use string concatination for serialization
+
+0.2.3 / 2015-10-25
+==================
+
+ * Fix cookie `Max-Age` to never be a floating point number
+
+0.2.2 / 2015-09-17
+==================
+
+ * Fix regression when setting empty cookie value
+ - Ease the new restriction, which is just basic header-level validation
+ * Fix typo in invalid value errors
+
+0.2.1 / 2015-09-17
+==================
+
+ * Throw on invalid values provided to `serialize`
+ - Ensures the resulting string is a valid HTTP header value
+
+0.2.0 / 2015-08-13
+==================
+
+ * Add `firstPartyOnly` option
+ * Throw better error for invalid argument to parse
+ * perf: hoist regular expression
+
+0.1.5 / 2015-09-17
+==================
+
+ * Fix regression when setting empty cookie value
+ - Ease the new restriction, which is just basic header-level validation
+ * Fix typo in invalid value errors
+
+0.1.4 / 2015-09-17
+==================
+
+ * Throw better error for invalid argument to parse
+ * Throw on invalid values provided to `serialize`
+ - Ensures the resulting string is a valid HTTP header value
+
+0.1.3 / 2015-05-19
+==================
+
+ * Reduce the scope of try-catch deopt
+ * Remove argument reassignments
+
+0.1.2 / 2014-04-16
+==================
+
+ * Remove unnecessary files from npm package
+
+0.1.1 / 2014-02-23
+==================
+
+ * Fix bad parse when cookie value contained a comma
+ * Fix support for `maxAge` of `0`
+
+0.1.0 / 2013-05-01
+==================
+
+ * Add `decode` option
+ * Add `encode` option
+
+0.0.6 / 2013-04-08
+==================
+
+ * Ignore cookie parts missing `=`
+
+0.0.5 / 2012-10-29
+==================
+
+ * Return raw cookie value if value unescape errors
+
+0.0.4 / 2012-06-21
+==================
+
+ * Use encode/decodeURIComponent for cookie encoding/decoding
+ - Improve server/client interoperability
+
+0.0.3 / 2012-06-06
+==================
+
+ * Only escape special characters per the cookie RFC
+
+0.0.2 / 2012-06-01
+==================
+
+ * Fix `maxAge` option to not throw error
+
+0.0.1 / 2012-05-28
+==================
+
+ * Add more tests
+
+0.0.0 / 2012-05-28
+==================
+
+ * Initial release
diff --git a/server/node_modules/cookie/LICENSE b/server/node_modules/cookie/LICENSE
new file mode 100644
index 000000000..058b6b4ef
--- /dev/null
+++ b/server/node_modules/cookie/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 Roman Shtylman
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/server/node_modules/cookie/README.md b/server/node_modules/cookie/README.md
new file mode 100644
index 000000000..5449c3a25
--- /dev/null
+++ b/server/node_modules/cookie/README.md
@@ -0,0 +1,302 @@
+# cookie
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Basic HTTP cookie parser and serializer for HTTP servers.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install cookie
+```
+
+## API
+
+```js
+var cookie = require('cookie');
+```
+
+### cookie.parse(str, options)
+
+Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs.
+The `str` argument is the string representing a `Cookie` header value and `options` is an
+optional object containing additional parsing options.
+
+```js
+var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2');
+// { foo: 'bar', equation: 'E=mc^2' }
+```
+
+#### Options
+
+`cookie.parse` accepts these properties in the options object.
+
+##### decode
+
+Specifies a function that will be used to decode a cookie's value. Since the value of a cookie
+has a limited character set (and must be a simple string), this function can be used to decode
+a previously-encoded cookie value into a JavaScript string or other object.
+
+The default function is the global `decodeURIComponent`, which will decode any URL-encoded
+sequences into their byte representations.
+
+**note** if an error is thrown from this function, the original, non-decoded cookie value will
+be returned as the cookie's value.
+
+### cookie.serialize(name, value, options)
+
+Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the
+name for the cookie, the `value` argument is the value to set the cookie to, and the `options`
+argument is an optional object containing additional serialization options.
+
+```js
+var setCookie = cookie.serialize('foo', 'bar');
+// foo=bar
+```
+
+#### Options
+
+`cookie.serialize` accepts these properties in the options object.
+
+##### domain
+
+Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no
+domain is set, and most clients will consider the cookie to apply to only the current domain.
+
+##### encode
+
+Specifies a function that will be used to encode a cookie's value. Since value of a cookie
+has a limited character set (and must be a simple string), this function can be used to encode
+a value into a string suited for a cookie's value.
+
+The default function is the global `encodeURIComponent`, which will encode a JavaScript string
+into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range.
+
+##### expires
+
+Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1].
+By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and
+will delete it on a condition like exiting a web browser application.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### httpOnly
+
+Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy,
+the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not allow client-side
+JavaScript to see the cookie in `document.cookie`.
+
+##### maxAge
+
+Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2].
+The given number will be converted to an integer by rounding down. By default, no maximum age is set.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### path
+
+Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path
+is considered the ["default path"][rfc-6265-5.1.4].
+
+##### priority
+
+Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1].
+
+ - `'low'` will set the `Priority` attribute to `Low`.
+ - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set.
+ - `'high'` will set the `Priority` attribute to `High`.
+
+More information about the different priority levels can be found in
+[the specification][rfc-west-cookie-priority-00-4.1].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### sameSite
+
+Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-09-5.4.7].
+
+ - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+ - `false` will not set the `SameSite` attribute.
+ - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement.
+ - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie.
+ - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+
+More information about the different enforcement levels can be found in
+[the specification][rfc-6265bis-09-5.4.7].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### secure
+
+Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy,
+the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to
+the server in the future if the browser does not have an HTTPS connection.
+
+## Example
+
+The following example uses this module in conjunction with the Node.js core HTTP server
+to prompt a user for their name and display it back on future visits.
+
+```js
+var cookie = require('cookie');
+var escapeHtml = require('escape-html');
+var http = require('http');
+var url = require('url');
+
+function onRequest(req, res) {
+ // Parse the query string
+ var query = url.parse(req.url, true, true).query;
+
+ if (query && query.name) {
+ // Set a new cookie with the name
+ res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), {
+ httpOnly: true,
+ maxAge: 60 * 60 * 24 * 7 // 1 week
+ }));
+
+ // Redirect back after setting cookie
+ res.statusCode = 302;
+ res.setHeader('Location', req.headers.referer || '/');
+ res.end();
+ return;
+ }
+
+ // Parse the cookies on the request
+ var cookies = cookie.parse(req.headers.cookie || '');
+
+ // Get the visitor name set in the cookie
+ var name = cookies.name;
+
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8');
+
+ if (name) {
+ res.write('Welcome back, ' + escapeHtml(name) + ' !
');
+ } else {
+ res.write('Hello, new visitor!
');
+ }
+
+ res.write('');
+}
+
+http.createServer(onRequest).listen(3000);
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```
+$ npm run bench
+
+> cookie@0.4.2 bench
+> node benchmark/index.js
+
+ node@16.14.0
+ v8@9.4.146.24-node.20
+ uv@1.43.0
+ zlib@1.2.11
+ brotli@1.0.9
+ ares@1.18.1
+ modules@93
+ nghttp2@1.45.1
+ napi@8
+ llhttp@6.0.4
+ openssl@1.1.1m+quic
+ cldr@40.0
+ icu@70.1
+ tz@2021a3
+ unicode@14.0
+ ngtcp2@0.1.0-DEV
+ nghttp3@0.1.0-DEV
+
+> node benchmark/parse-top.js
+
+ cookie.parse - top sites
+
+ 15 tests completed.
+
+ parse accounts.google.com x 2,421,245 ops/sec ±0.80% (188 runs sampled)
+ parse apple.com x 2,684,710 ops/sec ±0.59% (189 runs sampled)
+ parse cloudflare.com x 2,231,418 ops/sec ±0.76% (186 runs sampled)
+ parse docs.google.com x 2,316,357 ops/sec ±1.28% (187 runs sampled)
+ parse drive.google.com x 2,363,543 ops/sec ±0.49% (189 runs sampled)
+ parse en.wikipedia.org x 839,414 ops/sec ±0.53% (189 runs sampled)
+ parse linkedin.com x 553,797 ops/sec ±0.63% (190 runs sampled)
+ parse maps.google.com x 1,314,779 ops/sec ±0.72% (189 runs sampled)
+ parse microsoft.com x 153,783 ops/sec ±0.53% (190 runs sampled)
+ parse play.google.com x 2,249,574 ops/sec ±0.59% (187 runs sampled)
+ parse plus.google.com x 2,258,682 ops/sec ±0.60% (188 runs sampled)
+ parse sites.google.com x 2,247,069 ops/sec ±0.68% (189 runs sampled)
+ parse support.google.com x 1,456,840 ops/sec ±0.70% (187 runs sampled)
+ parse www.google.com x 1,046,028 ops/sec ±0.58% (188 runs sampled)
+ parse youtu.be x 937,428 ops/sec ±1.47% (190 runs sampled)
+ parse youtube.com x 963,878 ops/sec ±0.59% (190 runs sampled)
+
+> node benchmark/parse.js
+
+ cookie.parse - generic
+
+ 6 tests completed.
+
+ simple x 2,745,604 ops/sec ±0.77% (185 runs sampled)
+ decode x 557,287 ops/sec ±0.60% (188 runs sampled)
+ unquote x 2,498,475 ops/sec ±0.55% (189 runs sampled)
+ duplicates x 868,591 ops/sec ±0.89% (187 runs sampled)
+ 10 cookies x 306,745 ops/sec ±0.49% (190 runs sampled)
+ 100 cookies x 22,414 ops/sec ±2.38% (182 runs sampled)
+```
+
+## References
+
+- [RFC 6265: HTTP State Management Mechanism][rfc-6265]
+- [Same-site Cookies][rfc-6265bis-09-5.4.7]
+
+[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1
+[rfc-6265bis-09-5.4.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-09#section-5.4.7
+[rfc-6265]: https://tools.ietf.org/html/rfc6265
+[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4
+[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1
+[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2
+[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3
+[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4
+[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5
+[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6
+[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master
+[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/cookie/ci/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml
+[node-version-image]: https://badgen.net/npm/node/cookie
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/cookie
+[npm-url]: https://npmjs.org/package/cookie
+[npm-version-image]: https://badgen.net/npm/v/cookie
diff --git a/server/node_modules/cookie/SECURITY.md b/server/node_modules/cookie/SECURITY.md
new file mode 100644
index 000000000..fd4a6c53a
--- /dev/null
+++ b/server/node_modules/cookie/SECURITY.md
@@ -0,0 +1,25 @@
+# Security Policies and Procedures
+
+## Reporting a Bug
+
+The `cookie` team and community take all security bugs seriously. Thank
+you for improving the security of the project. We appreciate your efforts and
+responsible disclosure and will make every effort to acknowledge your
+contributions.
+
+Report security bugs by emailing the current owner(s) of `cookie`. This
+information can be found in the npm registry using the command
+`npm owner ls cookie`.
+If unsure or unable to get the information from the above, open an issue
+in the [project issue tracker](https://github.com/jshttp/cookie/issues)
+asking for the current contact information.
+
+To ensure the timely response to your report, please ensure that the entirety
+of the report is contained within the email body and not solely behind a web
+link or an attachment.
+
+At least one owner will acknowledge your email within 48 hours, and will send a
+more detailed response within 48 hours indicating the next steps in handling
+your report. After the initial reply to your report, the owners will
+endeavor to keep you informed of the progress towards a fix and full
+announcement, and may ask for additional information or guidance.
diff --git a/server/node_modules/cookie/index.js b/server/node_modules/cookie/index.js
new file mode 100644
index 000000000..9c3d07d89
--- /dev/null
+++ b/server/node_modules/cookie/index.js
@@ -0,0 +1,270 @@
+/*!
+ * cookie
+ * Copyright(c) 2012-2014 Roman Shtylman
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.parse = parse;
+exports.serialize = serialize;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var __toString = Object.prototype.toString
+
+/**
+ * RegExp to match field-content in RFC 7230 sec 3.2
+ *
+ * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ]
+ * field-vchar = VCHAR / obs-text
+ * obs-text = %x80-FF
+ */
+
+var fieldContentRegExp = /^[\u0009\u0020-\u007e\u0080-\u00ff]+$/;
+
+/**
+ * Parse a cookie header.
+ *
+ * Parse the given cookie header string into an object
+ * The object has the various cookies as keys(names) => values
+ *
+ * @param {string} str
+ * @param {object} [options]
+ * @return {object}
+ * @public
+ */
+
+function parse(str, options) {
+ if (typeof str !== 'string') {
+ throw new TypeError('argument str must be a string');
+ }
+
+ var obj = {}
+ var opt = options || {};
+ var dec = opt.decode || decode;
+
+ var index = 0
+ while (index < str.length) {
+ var eqIdx = str.indexOf('=', index)
+
+ // no more cookie pairs
+ if (eqIdx === -1) {
+ break
+ }
+
+ var endIdx = str.indexOf(';', index)
+
+ if (endIdx === -1) {
+ endIdx = str.length
+ } else if (endIdx < eqIdx) {
+ // backtrack on prior semicolon
+ index = str.lastIndexOf(';', eqIdx - 1) + 1
+ continue
+ }
+
+ var key = str.slice(index, eqIdx).trim()
+
+ // only assign once
+ if (undefined === obj[key]) {
+ var val = str.slice(eqIdx + 1, endIdx).trim()
+
+ // quoted values
+ if (val.charCodeAt(0) === 0x22) {
+ val = val.slice(1, -1)
+ }
+
+ obj[key] = tryDecode(val, dec);
+ }
+
+ index = endIdx + 1
+ }
+
+ return obj;
+}
+
+/**
+ * Serialize data into a cookie header.
+ *
+ * Serialize the a name value pair into a cookie string suitable for
+ * http headers. An optional options object specified cookie parameters.
+ *
+ * serialize('foo', 'bar', { httpOnly: true })
+ * => "foo=bar; httpOnly"
+ *
+ * @param {string} name
+ * @param {string} val
+ * @param {object} [options]
+ * @return {string}
+ * @public
+ */
+
+function serialize(name, val, options) {
+ var opt = options || {};
+ var enc = opt.encode || encode;
+
+ if (typeof enc !== 'function') {
+ throw new TypeError('option encode is invalid');
+ }
+
+ if (!fieldContentRegExp.test(name)) {
+ throw new TypeError('argument name is invalid');
+ }
+
+ var value = enc(val);
+
+ if (value && !fieldContentRegExp.test(value)) {
+ throw new TypeError('argument val is invalid');
+ }
+
+ var str = name + '=' + value;
+
+ if (null != opt.maxAge) {
+ var maxAge = opt.maxAge - 0;
+
+ if (isNaN(maxAge) || !isFinite(maxAge)) {
+ throw new TypeError('option maxAge is invalid')
+ }
+
+ str += '; Max-Age=' + Math.floor(maxAge);
+ }
+
+ if (opt.domain) {
+ if (!fieldContentRegExp.test(opt.domain)) {
+ throw new TypeError('option domain is invalid');
+ }
+
+ str += '; Domain=' + opt.domain;
+ }
+
+ if (opt.path) {
+ if (!fieldContentRegExp.test(opt.path)) {
+ throw new TypeError('option path is invalid');
+ }
+
+ str += '; Path=' + opt.path;
+ }
+
+ if (opt.expires) {
+ var expires = opt.expires
+
+ if (!isDate(expires) || isNaN(expires.valueOf())) {
+ throw new TypeError('option expires is invalid');
+ }
+
+ str += '; Expires=' + expires.toUTCString()
+ }
+
+ if (opt.httpOnly) {
+ str += '; HttpOnly';
+ }
+
+ if (opt.secure) {
+ str += '; Secure';
+ }
+
+ if (opt.priority) {
+ var priority = typeof opt.priority === 'string'
+ ? opt.priority.toLowerCase()
+ : opt.priority
+
+ switch (priority) {
+ case 'low':
+ str += '; Priority=Low'
+ break
+ case 'medium':
+ str += '; Priority=Medium'
+ break
+ case 'high':
+ str += '; Priority=High'
+ break
+ default:
+ throw new TypeError('option priority is invalid')
+ }
+ }
+
+ if (opt.sameSite) {
+ var sameSite = typeof opt.sameSite === 'string'
+ ? opt.sameSite.toLowerCase() : opt.sameSite;
+
+ switch (sameSite) {
+ case true:
+ str += '; SameSite=Strict';
+ break;
+ case 'lax':
+ str += '; SameSite=Lax';
+ break;
+ case 'strict':
+ str += '; SameSite=Strict';
+ break;
+ case 'none':
+ str += '; SameSite=None';
+ break;
+ default:
+ throw new TypeError('option sameSite is invalid');
+ }
+ }
+
+ return str;
+}
+
+/**
+ * URL-decode string value. Optimized to skip native call when no %.
+ *
+ * @param {string} str
+ * @returns {string}
+ */
+
+function decode (str) {
+ return str.indexOf('%') !== -1
+ ? decodeURIComponent(str)
+ : str
+}
+
+/**
+ * URL-encode value.
+ *
+ * @param {string} str
+ * @returns {string}
+ */
+
+function encode (val) {
+ return encodeURIComponent(val)
+}
+
+/**
+ * Determine if value is a Date.
+ *
+ * @param {*} val
+ * @private
+ */
+
+function isDate (val) {
+ return __toString.call(val) === '[object Date]' ||
+ val instanceof Date
+}
+
+/**
+ * Try decoding a string using a decoding function.
+ *
+ * @param {string} str
+ * @param {function} decode
+ * @private
+ */
+
+function tryDecode(str, decode) {
+ try {
+ return decode(str);
+ } catch (e) {
+ return str;
+ }
+}
diff --git a/server/node_modules/cookie/package.json b/server/node_modules/cookie/package.json
new file mode 100644
index 000000000..ed5606a98
--- /dev/null
+++ b/server/node_modules/cookie/package.json
@@ -0,0 +1,44 @@
+{
+ "name": "cookie",
+ "description": "HTTP server cookie parsing and serialization",
+ "version": "0.5.0",
+ "author": "Roman Shtylman ",
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "cookie",
+ "cookies"
+ ],
+ "repository": "jshttp/cookie",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "7.32.0",
+ "eslint-plugin-markdown": "2.2.1",
+ "mocha": "9.2.2",
+ "nyc": "15.1.0",
+ "safe-buffer": "5.2.1",
+ "top-sites": "1.1.97"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "README.md",
+ "SECURITY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "update-bench": "node scripts/update-benchmark.js",
+ "version": "node scripts/version-history.js && git add HISTORY.md"
+ }
+}
diff --git a/server/node_modules/cors/CONTRIBUTING.md b/server/node_modules/cors/CONTRIBUTING.md
new file mode 100644
index 000000000..591b09a13
--- /dev/null
+++ b/server/node_modules/cors/CONTRIBUTING.md
@@ -0,0 +1,33 @@
+# contributing to `cors`
+
+CORS is a node.js package for providing a [connect](http://www.senchalabs.org/connect/)/[express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options. Learn more about the project in [the README](README.md).
+
+## The CORS Spec
+
+[http://www.w3.org/TR/cors/](http://www.w3.org/TR/cors/)
+
+## Pull Requests Welcome
+
+* Include `'use strict';` in every javascript file.
+* 2 space indentation.
+* Please run the testing steps below before submitting.
+
+## Testing
+
+```bash
+$ npm install
+$ npm test
+```
+
+## Interactive Testing Harness
+
+[http://node-cors-client.herokuapp.com](http://node-cors-client.herokuapp.com)
+
+Related git repositories:
+
+* [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server)
+* [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client)
+
+## License
+
+[MIT License](http://www.opensource.org/licenses/mit-license.php)
diff --git a/server/node_modules/cors/HISTORY.md b/server/node_modules/cors/HISTORY.md
new file mode 100644
index 000000000..5762bce92
--- /dev/null
+++ b/server/node_modules/cors/HISTORY.md
@@ -0,0 +1,58 @@
+2.8.5 / 2018-11-04
+==================
+
+ * Fix setting `maxAge` option to `0`
+
+2.8.4 / 2017-07-12
+==================
+
+ * Work-around Safari bug in default pre-flight response
+
+2.8.3 / 2017-03-29
+==================
+
+ * Fix error when options delegate missing `methods` option
+
+2.8.2 / 2017-03-28
+==================
+
+ * Fix error when frozen options are passed
+ * Send "Vary: Origin" when using regular expressions
+ * Send "Vary: Access-Control-Request-Headers" when dynamic `allowedHeaders`
+
+2.8.1 / 2016-09-08
+==================
+
+This release only changed documentation.
+
+2.8.0 / 2016-08-23
+==================
+
+ * Add `optionsSuccessStatus` option
+
+2.7.2 / 2016-08-23
+==================
+
+ * Fix error when Node.js running in strict mode
+
+2.7.1 / 2015-05-28
+==================
+
+ * Move module into expressjs organization
+
+2.7.0 / 2015-05-28
+==================
+
+ * Allow array of matching condition as `origin` option
+ * Allow regular expression as `origin` option
+
+2.6.1 / 2015-05-28
+==================
+
+ * Update `license` in package.json
+
+2.6.0 / 2015-04-27
+==================
+
+ * Add `preflightContinue` option
+ * Fix "Vary: Origin" header added for "*"
diff --git a/server/node_modules/cors/LICENSE b/server/node_modules/cors/LICENSE
new file mode 100644
index 000000000..fd10c843f
--- /dev/null
+++ b/server/node_modules/cors/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2013 Troy Goode
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/cors/README.md b/server/node_modules/cors/README.md
new file mode 100644
index 000000000..732b847ed
--- /dev/null
+++ b/server/node_modules/cors/README.md
@@ -0,0 +1,243 @@
+# cors
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+CORS is a node.js package for providing a [Connect](http://www.senchalabs.org/connect/)/[Express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options.
+
+**[Follow me (@troygoode) on Twitter!](https://twitter.com/intent/user?screen_name=troygoode)**
+
+* [Installation](#installation)
+* [Usage](#usage)
+ * [Simple Usage](#simple-usage-enable-all-cors-requests)
+ * [Enable CORS for a Single Route](#enable-cors-for-a-single-route)
+ * [Configuring CORS](#configuring-cors)
+ * [Configuring CORS Asynchronously](#configuring-cors-asynchronously)
+ * [Enabling CORS Pre-Flight](#enabling-cors-pre-flight)
+* [Configuration Options](#configuration-options)
+* [Demo](#demo)
+* [License](#license)
+* [Author](#author)
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install cors
+```
+
+## Usage
+
+### Simple Usage (Enable *All* CORS Requests)
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+app.use(cors())
+
+app.get('/products/:id', function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for all origins!'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+### Enable CORS for a Single Route
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+app.get('/products/:id', cors(), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for a Single Route'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+### Configuring CORS
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+var corsOptions = {
+ origin: 'http://example.com',
+ optionsSuccessStatus: 200 // some legacy browsers (IE11, various SmartTVs) choke on 204
+}
+
+app.get('/products/:id', cors(corsOptions), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for only example.com.'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+### Configuring CORS w/ Dynamic Origin
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+var whitelist = ['http://example1.com', 'http://example2.com']
+var corsOptions = {
+ origin: function (origin, callback) {
+ if (whitelist.indexOf(origin) !== -1) {
+ callback(null, true)
+ } else {
+ callback(new Error('Not allowed by CORS'))
+ }
+ }
+}
+
+app.get('/products/:id', cors(corsOptions), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for a whitelisted domain.'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+If you do not want to block REST tools or server-to-server requests,
+add a `!origin` check in the origin function like so:
+
+```javascript
+var corsOptions = {
+ origin: function (origin, callback) {
+ if (whitelist.indexOf(origin) !== -1 || !origin) {
+ callback(null, true)
+ } else {
+ callback(new Error('Not allowed by CORS'))
+ }
+ }
+}
+```
+
+### Enabling CORS Pre-Flight
+
+Certain CORS requests are considered 'complex' and require an initial
+`OPTIONS` request (called the "pre-flight request"). An example of a
+'complex' CORS request is one that uses an HTTP verb other than
+GET/HEAD/POST (such as DELETE) or that uses custom headers. To enable
+pre-flighting, you must add a new OPTIONS handler for the route you want
+to support:
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+app.options('/products/:id', cors()) // enable pre-flight request for DELETE request
+app.del('/products/:id', cors(), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for all origins!'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+You can also enable pre-flight across-the-board like so:
+
+```javascript
+app.options('*', cors()) // include before other routes
+```
+
+### Configuring CORS Asynchronously
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+var whitelist = ['http://example1.com', 'http://example2.com']
+var corsOptionsDelegate = function (req, callback) {
+ var corsOptions;
+ if (whitelist.indexOf(req.header('Origin')) !== -1) {
+ corsOptions = { origin: true } // reflect (enable) the requested origin in the CORS response
+ } else {
+ corsOptions = { origin: false } // disable CORS for this request
+ }
+ callback(null, corsOptions) // callback expects two parameters: error and options
+}
+
+app.get('/products/:id', cors(corsOptionsDelegate), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for a whitelisted domain.'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+## Configuration Options
+
+* `origin`: Configures the **Access-Control-Allow-Origin** CORS header. Possible values:
+ - `Boolean` - set `origin` to `true` to reflect the [request origin](http://tools.ietf.org/html/draft-abarth-origin-09), as defined by `req.header('Origin')`, or set it to `false` to disable CORS.
+ - `String` - set `origin` to a specific origin. For example if you set it to `"http://example.com"` only requests from "http://example.com" will be allowed.
+ - `RegExp` - set `origin` to a regular expression pattern which will be used to test the request origin. If it's a match, the request origin will be reflected. For example the pattern `/example\.com$/` will reflect any request that is coming from an origin ending with "example.com".
+ - `Array` - set `origin` to an array of valid origins. Each origin can be a `String` or a `RegExp`. For example `["http://example1.com", /\.example2\.com$/]` will accept any request from "http://example1.com" or from a subdomain of "example2.com".
+ - `Function` - set `origin` to a function implementing some custom logic. The function takes the request origin as the first parameter and a callback (which expects the signature `err [object], allow [bool]`) as the second.
+* `methods`: Configures the **Access-Control-Allow-Methods** CORS header. Expects a comma-delimited string (ex: 'GET,PUT,POST') or an array (ex: `['GET', 'PUT', 'POST']`).
+* `allowedHeaders`: Configures the **Access-Control-Allow-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Type,Authorization') or an array (ex: `['Content-Type', 'Authorization']`). If not specified, defaults to reflecting the headers specified in the request's **Access-Control-Request-Headers** header.
+* `exposedHeaders`: Configures the **Access-Control-Expose-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Range,X-Content-Range') or an array (ex: `['Content-Range', 'X-Content-Range']`). If not specified, no custom headers are exposed.
+* `credentials`: Configures the **Access-Control-Allow-Credentials** CORS header. Set to `true` to pass the header, otherwise it is omitted.
+* `maxAge`: Configures the **Access-Control-Max-Age** CORS header. Set to an integer to pass the header, otherwise it is omitted.
+* `preflightContinue`: Pass the CORS preflight response to the next handler.
+* `optionsSuccessStatus`: Provides a status code to use for successful `OPTIONS` requests, since some legacy browsers (IE11, various SmartTVs) choke on `204`.
+
+The default configuration is the equivalent of:
+
+```json
+{
+ "origin": "*",
+ "methods": "GET,HEAD,PUT,PATCH,POST,DELETE",
+ "preflightContinue": false,
+ "optionsSuccessStatus": 204
+}
+```
+
+For details on the effect of each CORS header, read [this](http://www.html5rocks.com/en/tutorials/cors/) article on HTML5 Rocks.
+
+## Demo
+
+A demo that illustrates CORS working (and not working) using jQuery is available here: [http://node-cors-client.herokuapp.com/](http://node-cors-client.herokuapp.com/)
+
+Code for that demo can be found here:
+
+* Client: [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client)
+* Server: [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server)
+
+## License
+
+[MIT License](http://www.opensource.org/licenses/mit-license.php)
+
+## Author
+
+[Troy Goode](https://github.com/TroyGoode) ([troygoode@gmail.com](mailto:troygoode@gmail.com))
+
+[coveralls-image]: https://img.shields.io/coveralls/expressjs/cors/master.svg
+[coveralls-url]: https://coveralls.io/r/expressjs/cors?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/cors.svg
+[downloads-url]: https://npmjs.org/package/cors
+[npm-image]: https://img.shields.io/npm/v/cors.svg
+[npm-url]: https://npmjs.org/package/cors
+[travis-image]: https://img.shields.io/travis/expressjs/cors/master.svg
+[travis-url]: https://travis-ci.org/expressjs/cors
diff --git a/server/node_modules/cors/lib/index.js b/server/node_modules/cors/lib/index.js
new file mode 100644
index 000000000..5475aecd6
--- /dev/null
+++ b/server/node_modules/cors/lib/index.js
@@ -0,0 +1,238 @@
+(function () {
+
+ 'use strict';
+
+ var assign = require('object-assign');
+ var vary = require('vary');
+
+ var defaults = {
+ origin: '*',
+ methods: 'GET,HEAD,PUT,PATCH,POST,DELETE',
+ preflightContinue: false,
+ optionsSuccessStatus: 204
+ };
+
+ function isString(s) {
+ return typeof s === 'string' || s instanceof String;
+ }
+
+ function isOriginAllowed(origin, allowedOrigin) {
+ if (Array.isArray(allowedOrigin)) {
+ for (var i = 0; i < allowedOrigin.length; ++i) {
+ if (isOriginAllowed(origin, allowedOrigin[i])) {
+ return true;
+ }
+ }
+ return false;
+ } else if (isString(allowedOrigin)) {
+ return origin === allowedOrigin;
+ } else if (allowedOrigin instanceof RegExp) {
+ return allowedOrigin.test(origin);
+ } else {
+ return !!allowedOrigin;
+ }
+ }
+
+ function configureOrigin(options, req) {
+ var requestOrigin = req.headers.origin,
+ headers = [],
+ isAllowed;
+
+ if (!options.origin || options.origin === '*') {
+ // allow any origin
+ headers.push([{
+ key: 'Access-Control-Allow-Origin',
+ value: '*'
+ }]);
+ } else if (isString(options.origin)) {
+ // fixed origin
+ headers.push([{
+ key: 'Access-Control-Allow-Origin',
+ value: options.origin
+ }]);
+ headers.push([{
+ key: 'Vary',
+ value: 'Origin'
+ }]);
+ } else {
+ isAllowed = isOriginAllowed(requestOrigin, options.origin);
+ // reflect origin
+ headers.push([{
+ key: 'Access-Control-Allow-Origin',
+ value: isAllowed ? requestOrigin : false
+ }]);
+ headers.push([{
+ key: 'Vary',
+ value: 'Origin'
+ }]);
+ }
+
+ return headers;
+ }
+
+ function configureMethods(options) {
+ var methods = options.methods;
+ if (methods.join) {
+ methods = options.methods.join(','); // .methods is an array, so turn it into a string
+ }
+ return {
+ key: 'Access-Control-Allow-Methods',
+ value: methods
+ };
+ }
+
+ function configureCredentials(options) {
+ if (options.credentials === true) {
+ return {
+ key: 'Access-Control-Allow-Credentials',
+ value: 'true'
+ };
+ }
+ return null;
+ }
+
+ function configureAllowedHeaders(options, req) {
+ var allowedHeaders = options.allowedHeaders || options.headers;
+ var headers = [];
+
+ if (!allowedHeaders) {
+ allowedHeaders = req.headers['access-control-request-headers']; // .headers wasn't specified, so reflect the request headers
+ headers.push([{
+ key: 'Vary',
+ value: 'Access-Control-Request-Headers'
+ }]);
+ } else if (allowedHeaders.join) {
+ allowedHeaders = allowedHeaders.join(','); // .headers is an array, so turn it into a string
+ }
+ if (allowedHeaders && allowedHeaders.length) {
+ headers.push([{
+ key: 'Access-Control-Allow-Headers',
+ value: allowedHeaders
+ }]);
+ }
+
+ return headers;
+ }
+
+ function configureExposedHeaders(options) {
+ var headers = options.exposedHeaders;
+ if (!headers) {
+ return null;
+ } else if (headers.join) {
+ headers = headers.join(','); // .headers is an array, so turn it into a string
+ }
+ if (headers && headers.length) {
+ return {
+ key: 'Access-Control-Expose-Headers',
+ value: headers
+ };
+ }
+ return null;
+ }
+
+ function configureMaxAge(options) {
+ var maxAge = (typeof options.maxAge === 'number' || options.maxAge) && options.maxAge.toString()
+ if (maxAge && maxAge.length) {
+ return {
+ key: 'Access-Control-Max-Age',
+ value: maxAge
+ };
+ }
+ return null;
+ }
+
+ function applyHeaders(headers, res) {
+ for (var i = 0, n = headers.length; i < n; i++) {
+ var header = headers[i];
+ if (header) {
+ if (Array.isArray(header)) {
+ applyHeaders(header, res);
+ } else if (header.key === 'Vary' && header.value) {
+ vary(res, header.value);
+ } else if (header.value) {
+ res.setHeader(header.key, header.value);
+ }
+ }
+ }
+ }
+
+ function cors(options, req, res, next) {
+ var headers = [],
+ method = req.method && req.method.toUpperCase && req.method.toUpperCase();
+
+ if (method === 'OPTIONS') {
+ // preflight
+ headers.push(configureOrigin(options, req));
+ headers.push(configureCredentials(options, req));
+ headers.push(configureMethods(options, req));
+ headers.push(configureAllowedHeaders(options, req));
+ headers.push(configureMaxAge(options, req));
+ headers.push(configureExposedHeaders(options, req));
+ applyHeaders(headers, res);
+
+ if (options.preflightContinue) {
+ next();
+ } else {
+ // Safari (and potentially other browsers) need content-length 0,
+ // for 204 or they just hang waiting for a body
+ res.statusCode = options.optionsSuccessStatus;
+ res.setHeader('Content-Length', '0');
+ res.end();
+ }
+ } else {
+ // actual response
+ headers.push(configureOrigin(options, req));
+ headers.push(configureCredentials(options, req));
+ headers.push(configureExposedHeaders(options, req));
+ applyHeaders(headers, res);
+ next();
+ }
+ }
+
+ function middlewareWrapper(o) {
+ // if options are static (either via defaults or custom options passed in), wrap in a function
+ var optionsCallback = null;
+ if (typeof o === 'function') {
+ optionsCallback = o;
+ } else {
+ optionsCallback = function (req, cb) {
+ cb(null, o);
+ };
+ }
+
+ return function corsMiddleware(req, res, next) {
+ optionsCallback(req, function (err, options) {
+ if (err) {
+ next(err);
+ } else {
+ var corsOptions = assign({}, defaults, options);
+ var originCallback = null;
+ if (corsOptions.origin && typeof corsOptions.origin === 'function') {
+ originCallback = corsOptions.origin;
+ } else if (corsOptions.origin) {
+ originCallback = function (origin, cb) {
+ cb(null, corsOptions.origin);
+ };
+ }
+
+ if (originCallback) {
+ originCallback(req.headers.origin, function (err2, origin) {
+ if (err2 || !origin) {
+ next(err2);
+ } else {
+ corsOptions.origin = origin;
+ cors(corsOptions, req, res, next);
+ }
+ });
+ } else {
+ next();
+ }
+ }
+ });
+ };
+ }
+
+ // can pass either an options hash, an options delegate, or nothing
+ module.exports = middlewareWrapper;
+
+}());
diff --git a/server/node_modules/cors/package.json b/server/node_modules/cors/package.json
new file mode 100644
index 000000000..ff37d9843
--- /dev/null
+++ b/server/node_modules/cors/package.json
@@ -0,0 +1,41 @@
+{
+ "name": "cors",
+ "description": "Node.js CORS middleware",
+ "version": "2.8.5",
+ "author": "Troy Goode (https://github.com/troygoode/)",
+ "license": "MIT",
+ "keywords": [
+ "cors",
+ "express",
+ "connect",
+ "middleware"
+ ],
+ "repository": "expressjs/cors",
+ "main": "./lib/index.js",
+ "dependencies": {
+ "object-assign": "^4",
+ "vary": "^1"
+ },
+ "devDependencies": {
+ "after": "0.8.2",
+ "eslint": "2.13.1",
+ "express": "4.16.3",
+ "mocha": "5.2.0",
+ "nyc": "13.1.0",
+ "supertest": "3.3.0"
+ },
+ "files": [
+ "lib/index.js",
+ "CONTRIBUTING.md",
+ "HISTORY.md",
+ "LICENSE",
+ "README.md"
+ ],
+ "engines": {
+ "node": ">= 0.10"
+ },
+ "scripts": {
+ "test": "npm run lint && nyc --reporter=html --reporter=text mocha --require test/support/env",
+ "lint": "eslint lib test"
+ }
+}
diff --git a/server/node_modules/debug/.coveralls.yml b/server/node_modules/debug/.coveralls.yml
new file mode 100644
index 000000000..20a706858
--- /dev/null
+++ b/server/node_modules/debug/.coveralls.yml
@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve
diff --git a/server/node_modules/debug/.eslintrc b/server/node_modules/debug/.eslintrc
new file mode 100644
index 000000000..8a37ae2c2
--- /dev/null
+++ b/server/node_modules/debug/.eslintrc
@@ -0,0 +1,11 @@
+{
+ "env": {
+ "browser": true,
+ "node": true
+ },
+ "rules": {
+ "no-console": 0,
+ "no-empty": [1, { "allowEmptyCatch": true }]
+ },
+ "extends": "eslint:recommended"
+}
diff --git a/server/node_modules/debug/.npmignore b/server/node_modules/debug/.npmignore
new file mode 100644
index 000000000..5f60eecc8
--- /dev/null
+++ b/server/node_modules/debug/.npmignore
@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json
diff --git a/server/node_modules/debug/.travis.yml b/server/node_modules/debug/.travis.yml
new file mode 100644
index 000000000..6c6090c3b
--- /dev/null
+++ b/server/node_modules/debug/.travis.yml
@@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+ - "6"
+ - "5"
+ - "4"
+
+install:
+ - make node_modules
+
+script:
+ - make lint
+ - make test
+ - make coveralls
diff --git a/server/node_modules/debug/CHANGELOG.md b/server/node_modules/debug/CHANGELOG.md
new file mode 100644
index 000000000..eadaa1895
--- /dev/null
+++ b/server/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+ * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+ * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+ * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+ * Fix: Inline extend function in node implementation (#452, @dougwilson)
+ * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+
+ * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+ * Misc: clean up browser reference checks (#447, @thebigredgeek)
+ * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+ * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+ * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+ * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+ * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+ * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+ * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+ * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+ * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+ * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+ * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+ * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+ * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+ * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+ * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+ * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+ * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+ * Docs: fixed README typo (#391, @lurch)
+ * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+ * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+ * Fix: wrong reference in bower file (@thebigredgeek)
+ * Fix: webworker compatibility (@thebigredgeek)
+ * Fix: output formatting issue (#388, @kribblo)
+ * Fix: babel-loader compatibility (#383, @escwald)
+ * Misc: removed built asset from repo and publications (@thebigredgeek)
+ * Misc: moved source files to /src (#378, @yamikuronue)
+ * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+ * Test: coveralls integration (#378, @yamikuronue)
+ * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+ * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+ * Fix: custom log function (#379, @hsiliev)
+ * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+ * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+ * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+ * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+ * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+ * Fix: browser colors (#367, @tootallnate)
+ * Misc: travis ci integration (@thebigredgeek)
+ * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+ * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+ * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+ * Fix: revert "handle regex special characters" (@tootallnate)
+ * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+ * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+ * Improvement: allow colors in workers (#335, @botverse)
+ * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+ * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+ * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+ * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+ * Fix: be super-safe in index.js as well (@TooTallNate)
+ * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+ * Fix: Added electron compatibility (#324, @paulcbetts)
+ * Improvement: Added performance optimizations (@tootallnate)
+ * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+ * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+ * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+ * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+ * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+ * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+ * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+ * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+ * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+ * Readme: fix USE_COLORS to DEBUG_COLORS
+ * Readme: Doc fixes for format string sugar (#269, @mlucool)
+ * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+ * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+ * Readme: better docs for browser support (#224, @matthewmueller)
+ * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+ * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+ * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+ * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+ * package: update "ms" to v0.7.1 (#202, @dougwilson)
+ * README: add logging to file example (#193, @DanielOchoa)
+ * README: fixed a typo (#191, @amir-s)
+ * browser: expose `storage` (#190, @stephenmathieson)
+ * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+ * Updated stdout/stderr example (#186)
+ * Updated example/stdout.js to match debug current behaviour
+ * Renamed example/stderr.js to stdout.js
+ * Update Readme.md (#184)
+ * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+ * dist: recompile
+ * update "ms" to v0.7.0
+ * package: update "browserify" to v9.0.3
+ * component: fix "ms.js" repo location
+ * changed bower package name
+ * updated documentation about using debug in a browser
+ * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+ * browser: use `typeof` to check for `console` existence
+ * browser: check for `console.log` truthiness (fix IE 8/9)
+ * browser: add support for Chrome apps
+ * Readme: added Windows usage remarks
+ * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+ * node: implement `DEBUG_FD` env variable support
+ * package: update "browserify" to v6.1.0
+ * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+ * package: update "browserify" to v5.11.0
+ * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+ * dist: recompile
+ * example: remove `console.info()` log usage
+ * example: add "Content-Type" UTF-8 header to browser example
+ * browser: place %c marker after the space character
+ * browser: reset the "content" color via `color: inherit`
+ * browser: add colors support for Firefox >= v31
+ * debug: prefer an instance `log()` function over the global one (#119)
+ * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+ * Add support for multiple wildcards in namespaces (#122, @seegno)
+ * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+ * browser: update color palette (#113, @gscottolson)
+ * common: make console logging function configurable (#108, @timoxley)
+ * node: fix %o colors on old node <= 0.8.x
+ * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+ * browser: use `removeItem()` to clear localStorage
+ * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+ * package: add "contributors" section
+ * node: fix comment typo
+ * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+ * make ms diff be global, not be scope
+ * debug: ignore empty strings in enable()
+ * node: make DEBUG_COLORS able to disable coloring
+ * *: export the `colors` array
+ * npmignore: don't publish the `dist` dir
+ * Makefile: refactor to use browserify
+ * package: add "browserify" as a dev dependency
+ * Readme: add Web Inspector Colors section
+ * node: reset terminal color for the debug content
+ * node: map "%o" to `util.inspect()`
+ * browser: map "%j" to `JSON.stringify()`
+ * debug: add custom "formatters"
+ * debug: use "ms" module for humanizing the diff
+ * Readme: add "bash" syntax highlighting
+ * browser: add Firebug color support
+ * browser: add colors for WebKit browsers
+ * node: apply log to `console`
+ * rewrite: abstract common logic for Node & browsers
+ * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+ * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+ * add `enable()` method for nodejs. Closes #27
+ * change from stderr to stdout
+ * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+ * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+ * fix: catch localStorage security error when cookies are blocked (Chrome)
+ * add debug(err) support. Closes #46
+ * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+ * fix package.json
+ * fix: Mobile Safari (private mode) is broken with debug
+ * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+ * add repository URL to package.json
+ * add DEBUG_COLORED to force colored output
+ * add browserify support
+ * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+ * Added .component to package.json
+ * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+ * Added support for "-" prefix in DEBUG [Vinay Pulim]
+ * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+ * Added: humanize diffs. Closes #8
+ * Added `debug.disable()` to the CS variant
+ * Removed padding. Closes #10
+ * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+ * Added browser variant support for older browsers [TooTallNate]
+ * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+ * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+ * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+ * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+ * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/server/node_modules/debug/LICENSE b/server/node_modules/debug/LICENSE
new file mode 100644
index 000000000..658c933d2
--- /dev/null
+++ b/server/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/server/node_modules/debug/Makefile b/server/node_modules/debug/Makefile
new file mode 100644
index 000000000..584da8bf9
--- /dev/null
+++ b/server/node_modules/debug/Makefile
@@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+ @NODE_ENV= $(PKG) install
+ @touch node_modules
+
+lint: .FORCE
+ eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+ istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+ mkdir -p dist
+
+ @$(BROWSERIFY) \
+ --standalone debug \
+ . > dist/debug.js
+
+ karma start --single-run
+ rimraf dist
+
+test: .FORCE
+ concurrently \
+ "make test-node" \
+ "make test-browser"
+
+coveralls:
+ cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean
diff --git a/server/node_modules/debug/README.md b/server/node_modules/debug/README.md
new file mode 100644
index 000000000..f67be6b31
--- /dev/null
+++ b/server/node_modules/debug/README.md
@@ -0,0 +1,312 @@
+# debug
+[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers)
+[](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+ debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+ 
+
+ 
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+ When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+ 
+
+ When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+ 
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+ The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+ You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+ When running through Node.js, you can set a few environment variables that will
+ change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+ __Note:__ The environment variables beginning with `DEBUG_` end up being
+ converted into an Options object that gets used with `%o`/`%O` formatters.
+ See the Node.js documentation for
+ [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+ for the complete list.
+
+## Formatters
+
+
+ Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+ You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+ You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+ or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+ if you don't want to build it yourself.
+
+ Debug's enable state is currently persisted by `localStorage`.
+ Consider the situation shown below where you have `worker:a` and `worker:b`,
+ and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+ Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+ option. These are WebKit web inspectors, Firefox ([since version
+ 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+ and the Firebug plugin for Firefox (any version).
+
+ Colored output looks something like:
+
+ 
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/debug/component.json b/server/node_modules/debug/component.json
new file mode 100644
index 000000000..9de26410f
--- /dev/null
+++ b/server/node_modules/debug/component.json
@@ -0,0 +1,19 @@
+{
+ "name": "debug",
+ "repo": "visionmedia/debug",
+ "description": "small debugging utility",
+ "version": "2.6.9",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "main": "src/browser.js",
+ "scripts": [
+ "src/browser.js",
+ "src/debug.js"
+ ],
+ "dependencies": {
+ "rauchg/ms.js": "0.7.1"
+ }
+}
diff --git a/server/node_modules/debug/karma.conf.js b/server/node_modules/debug/karma.conf.js
new file mode 100644
index 000000000..103a82d15
--- /dev/null
+++ b/server/node_modules/debug/karma.conf.js
@@ -0,0 +1,70 @@
+// Karma configuration
+// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
+
+module.exports = function(config) {
+ config.set({
+
+ // base path that will be used to resolve all patterns (eg. files, exclude)
+ basePath: '',
+
+
+ // frameworks to use
+ // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
+ frameworks: ['mocha', 'chai', 'sinon'],
+
+
+ // list of files / patterns to load in the browser
+ files: [
+ 'dist/debug.js',
+ 'test/*spec.js'
+ ],
+
+
+ // list of files to exclude
+ exclude: [
+ 'src/node.js'
+ ],
+
+
+ // preprocess matching files before serving them to the browser
+ // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
+ preprocessors: {
+ },
+
+ // test results reporter to use
+ // possible values: 'dots', 'progress'
+ // available reporters: https://npmjs.org/browse/keyword/karma-reporter
+ reporters: ['progress'],
+
+
+ // web server port
+ port: 9876,
+
+
+ // enable / disable colors in the output (reporters and logs)
+ colors: true,
+
+
+ // level of logging
+ // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
+ logLevel: config.LOG_INFO,
+
+
+ // enable / disable watching file and executing tests whenever any file changes
+ autoWatch: true,
+
+
+ // start these browsers
+ // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
+ browsers: ['PhantomJS'],
+
+
+ // Continuous Integration mode
+ // if true, Karma captures browsers, runs the tests and exits
+ singleRun: false,
+
+ // Concurrency level
+ // how many browser should be started simultaneous
+ concurrency: Infinity
+ })
+}
diff --git a/server/node_modules/debug/node.js b/server/node_modules/debug/node.js
new file mode 100644
index 000000000..7fc36fe6d
--- /dev/null
+++ b/server/node_modules/debug/node.js
@@ -0,0 +1 @@
+module.exports = require('./src/node');
diff --git a/server/node_modules/debug/package.json b/server/node_modules/debug/package.json
new file mode 100644
index 000000000..dc787ba76
--- /dev/null
+++ b/server/node_modules/debug/package.json
@@ -0,0 +1,49 @@
+{
+ "name": "debug",
+ "version": "2.6.9",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/visionmedia/debug.git"
+ },
+ "description": "small debugging utility",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "author": "TJ Holowaychuk ",
+ "contributors": [
+ "Nathan Rajlich (http://n8.io)",
+ "Andrew Rhyne "
+ ],
+ "license": "MIT",
+ "dependencies": {
+ "ms": "2.0.0"
+ },
+ "devDependencies": {
+ "browserify": "9.0.3",
+ "chai": "^3.5.0",
+ "concurrently": "^3.1.0",
+ "coveralls": "^2.11.15",
+ "eslint": "^3.12.1",
+ "istanbul": "^0.4.5",
+ "karma": "^1.3.0",
+ "karma-chai": "^0.1.0",
+ "karma-mocha": "^1.3.0",
+ "karma-phantomjs-launcher": "^1.0.2",
+ "karma-sinon": "^1.0.5",
+ "mocha": "^3.2.0",
+ "mocha-lcov-reporter": "^1.2.0",
+ "rimraf": "^2.5.4",
+ "sinon": "^1.17.6",
+ "sinon-chai": "^2.8.0"
+ },
+ "main": "./src/index.js",
+ "browser": "./src/browser.js",
+ "component": {
+ "scripts": {
+ "debug/index.js": "browser.js",
+ "debug/debug.js": "debug.js"
+ }
+ }
+}
diff --git a/server/node_modules/debug/src/browser.js b/server/node_modules/debug/src/browser.js
new file mode 100644
index 000000000..710692493
--- /dev/null
+++ b/server/node_modules/debug/src/browser.js
@@ -0,0 +1,185 @@
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+ && 'undefined' != typeof chrome.storage
+ ? chrome.storage.local
+ : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+ 'lightseagreen',
+ 'forestgreen',
+ 'goldenrod',
+ 'dodgerblue',
+ 'darkorchid',
+ 'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+ // NB: In an Electron preload script, document will be defined but not fully
+ // initialized. Since we know we're in Chrome, we'll just detect this case
+ // explicitly
+ if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') {
+ return true;
+ }
+
+ // is webkit? http://stackoverflow.com/a/16459606/376773
+ // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+ return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+ // is firebug? http://stackoverflow.com/a/398120/376773
+ (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+ // is firefox >= v31?
+ // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+ (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+ // double check webkit in userAgent just in case we are in a worker
+ (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+ try {
+ return JSON.stringify(v);
+ } catch (err) {
+ return '[UnexpectedJSONParseError]: ' + err.message;
+ }
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+ var useColors = this.useColors;
+
+ args[0] = (useColors ? '%c' : '')
+ + this.namespace
+ + (useColors ? ' %c' : ' ')
+ + args[0]
+ + (useColors ? '%c ' : ' ')
+ + '+' + exports.humanize(this.diff);
+
+ if (!useColors) return;
+
+ var c = 'color: ' + this.color;
+ args.splice(1, 0, c, 'color: inherit')
+
+ // the final "%c" is somewhat tricky, because there could be other
+ // arguments passed either before or after the %c, so we need to
+ // figure out the correct index to insert the CSS into
+ var index = 0;
+ var lastC = 0;
+ args[0].replace(/%[a-zA-Z%]/g, function(match) {
+ if ('%%' === match) return;
+ index++;
+ if ('%c' === match) {
+ // we only are interested in the *last* %c
+ // (the user may have provided their own)
+ lastC = index;
+ }
+ });
+
+ args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+ // this hackery is required for IE8/9, where
+ // the `console.log` function doesn't have 'apply'
+ return 'object' === typeof console
+ && console.log
+ && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ try {
+ if (null == namespaces) {
+ exports.storage.removeItem('debug');
+ } else {
+ exports.storage.debug = namespaces;
+ }
+ } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ var r;
+ try {
+ r = exports.storage.debug;
+ } catch(e) {}
+
+ // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+ if (!r && typeof process !== 'undefined' && 'env' in process) {
+ r = process.env.DEBUG;
+ }
+
+ return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+ try {
+ return window.localStorage;
+ } catch (e) {}
+}
diff --git a/server/node_modules/debug/src/debug.js b/server/node_modules/debug/src/debug.js
new file mode 100644
index 000000000..6a5e3fc94
--- /dev/null
+++ b/server/node_modules/debug/src/debug.js
@@ -0,0 +1,202 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = createDebug.debug = createDebug['default'] = createDebug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ * @param {String} namespace
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor(namespace) {
+ var hash = 0, i;
+
+ for (i in namespace) {
+ hash = ((hash << 5) - hash) + namespace.charCodeAt(i);
+ hash |= 0; // Convert to 32bit integer
+ }
+
+ return exports.colors[Math.abs(hash) % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function createDebug(namespace) {
+
+ function debug() {
+ // disabled?
+ if (!debug.enabled) return;
+
+ var self = debug;
+
+ // set `diff` timestamp
+ var curr = +new Date();
+ var ms = curr - (prevTime || curr);
+ self.diff = ms;
+ self.prev = prevTime;
+ self.curr = curr;
+ prevTime = curr;
+
+ // turn the `arguments` into a proper Array
+ var args = new Array(arguments.length);
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i];
+ }
+
+ args[0] = exports.coerce(args[0]);
+
+ if ('string' !== typeof args[0]) {
+ // anything else let's inspect with %O
+ args.unshift('%O');
+ }
+
+ // apply any `formatters` transformations
+ var index = 0;
+ args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) {
+ // if we encounter an escaped % then don't increase the array index
+ if (match === '%%') return match;
+ index++;
+ var formatter = exports.formatters[format];
+ if ('function' === typeof formatter) {
+ var val = args[index];
+ match = formatter.call(self, val);
+
+ // now we need to remove `args[index]` since it's inlined in the `format`
+ args.splice(index, 1);
+ index--;
+ }
+ return match;
+ });
+
+ // apply env-specific formatting (colors, etc.)
+ exports.formatArgs.call(self, args);
+
+ var logFn = debug.log || exports.log || console.log.bind(console);
+ logFn.apply(self, args);
+ }
+
+ debug.namespace = namespace;
+ debug.enabled = exports.enabled(namespace);
+ debug.useColors = exports.useColors();
+ debug.color = selectColor(namespace);
+
+ // env-specific initialization logic for debug instances
+ if ('function' === typeof exports.init) {
+ exports.init(debug);
+ }
+
+ return debug;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+ exports.save(namespaces);
+
+ exports.names = [];
+ exports.skips = [];
+
+ var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+ var len = split.length;
+
+ for (var i = 0; i < len; i++) {
+ if (!split[i]) continue; // ignore empty strings
+ namespaces = split[i].replace(/\*/g, '.*?');
+ if (namespaces[0] === '-') {
+ exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+ } else {
+ exports.names.push(new RegExp('^' + namespaces + '$'));
+ }
+ }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+ exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+ var i, len;
+ for (i = 0, len = exports.skips.length; i < len; i++) {
+ if (exports.skips[i].test(name)) {
+ return false;
+ }
+ }
+ for (i = 0, len = exports.names.length; i < len; i++) {
+ if (exports.names[i].test(name)) {
+ return true;
+ }
+ }
+ return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+ if (val instanceof Error) return val.stack || val.message;
+ return val;
+}
diff --git a/server/node_modules/debug/src/index.js b/server/node_modules/debug/src/index.js
new file mode 100644
index 000000000..e12cf4d58
--- /dev/null
+++ b/server/node_modules/debug/src/index.js
@@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process !== 'undefined' && process.type === 'renderer') {
+ module.exports = require('./browser.js');
+} else {
+ module.exports = require('./node.js');
+}
diff --git a/server/node_modules/debug/src/inspector-log.js b/server/node_modules/debug/src/inspector-log.js
new file mode 100644
index 000000000..60ea6c04a
--- /dev/null
+++ b/server/node_modules/debug/src/inspector-log.js
@@ -0,0 +1,15 @@
+module.exports = inspectorLog;
+
+// black hole
+const nullStream = new (require('stream').Writable)();
+nullStream._write = () => {};
+
+/**
+ * Outputs a `console.log()` to the Node.js Inspector console *only*.
+ */
+function inspectorLog() {
+ const stdout = console._stdout;
+ console._stdout = nullStream;
+ console.log.apply(console, arguments);
+ console._stdout = stdout;
+}
diff --git a/server/node_modules/debug/src/node.js b/server/node_modules/debug/src/node.js
new file mode 100644
index 000000000..b15109c90
--- /dev/null
+++ b/server/node_modules/debug/src/node.js
@@ -0,0 +1,248 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+ return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+ // camel-case
+ var prop = key
+ .substring(6)
+ .toLowerCase()
+ .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() });
+
+ // coerce string value into JS value
+ var val = process.env[key];
+ if (/^(yes|on|true|enabled)$/i.test(val)) val = true;
+ else if (/^(no|off|false|disabled)$/i.test(val)) val = false;
+ else if (val === 'null') val = null;
+ else val = Number(val);
+
+ obj[prop] = val;
+ return obj;
+}, {});
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ * $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+
+if (1 !== fd && 2 !== fd) {
+ util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')()
+}
+
+var stream = 1 === fd ? process.stdout :
+ 2 === fd ? process.stderr :
+ createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+ return 'colors' in exports.inspectOpts
+ ? Boolean(exports.inspectOpts.colors)
+ : tty.isatty(fd);
+}
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+exports.formatters.o = function(v) {
+ this.inspectOpts.colors = this.useColors;
+ return util.inspect(v, this.inspectOpts)
+ .split('\n').map(function(str) {
+ return str.trim()
+ }).join(' ');
+};
+
+/**
+ * Map %o to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+exports.formatters.O = function(v) {
+ this.inspectOpts.colors = this.useColors;
+ return util.inspect(v, this.inspectOpts);
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+ var name = this.namespace;
+ var useColors = this.useColors;
+
+ if (useColors) {
+ var c = this.color;
+ var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m';
+
+ args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+ args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m');
+ } else {
+ args[0] = new Date().toUTCString()
+ + ' ' + name + ' ' + args[0];
+ }
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to `stream`.
+ */
+
+function log() {
+ return stream.write(util.format.apply(util, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ if (null == namespaces) {
+ // If you set a process.env field to null or undefined, it gets cast to the
+ // string 'null' or 'undefined'. Just delete instead.
+ delete process.env.DEBUG;
+ } else {
+ process.env.DEBUG = namespaces;
+ }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+ var stream;
+ var tty_wrap = process.binding('tty_wrap');
+
+ // Note stream._type is used for test-module-load-list.js
+
+ switch (tty_wrap.guessHandleType(fd)) {
+ case 'TTY':
+ stream = new tty.WriteStream(fd);
+ stream._type = 'tty';
+
+ // Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ case 'FILE':
+ var fs = require('fs');
+ stream = new fs.SyncWriteStream(fd, { autoClose: false });
+ stream._type = 'fs';
+ break;
+
+ case 'PIPE':
+ case 'TCP':
+ var net = require('net');
+ stream = new net.Socket({
+ fd: fd,
+ readable: false,
+ writable: true
+ });
+
+ // FIXME Should probably have an option in net.Socket to create a
+ // stream from an existing fd which is writable only. But for now
+ // we'll just add this hack and set the `readable` member to false.
+ // Test: ./node test/fixtures/echo.js < /etc/passwd
+ stream.readable = false;
+ stream.read = null;
+ stream._type = 'pipe';
+
+ // FIXME Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ default:
+ // Probably an error on in uv_guess_handle()
+ throw new Error('Implement me. Unknown stream file type!');
+ }
+
+ // For supporting legacy API we put the FD here.
+ stream.fd = fd;
+
+ stream._isStdio = true;
+
+ return stream;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init (debug) {
+ debug.inspectOpts = {};
+
+ var keys = Object.keys(exports.inspectOpts);
+ for (var i = 0; i < keys.length; i++) {
+ debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+ }
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());
diff --git a/server/node_modules/define-data-property/.eslintrc b/server/node_modules/define-data-property/.eslintrc
new file mode 100644
index 000000000..75443e81e
--- /dev/null
+++ b/server/node_modules/define-data-property/.eslintrc
@@ -0,0 +1,24 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "complexity": 0,
+ "id-length": 0,
+ "new-cap": ["error", {
+ "capIsNewExceptions": [
+ "GetIntrinsic",
+ ],
+ }],
+ },
+
+ "overrides": [
+ {
+ "files": "test/**",
+ "rules": {
+ "max-lines-per-function": "off",
+ },
+ },
+ ],
+}
diff --git a/server/node_modules/define-data-property/.github/FUNDING.yml b/server/node_modules/define-data-property/.github/FUNDING.yml
new file mode 100644
index 000000000..3e17725dd
--- /dev/null
+++ b/server/node_modules/define-data-property/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/define-data-property
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']
diff --git a/server/node_modules/define-data-property/.nycrc b/server/node_modules/define-data-property/.nycrc
new file mode 100644
index 000000000..1826526e0
--- /dev/null
+++ b/server/node_modules/define-data-property/.nycrc
@@ -0,0 +1,13 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "lines": 86,
+ "statements": 85.93,
+ "functions": 82.43,
+ "branches": 76.06,
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/server/node_modules/define-data-property/CHANGELOG.md b/server/node_modules/define-data-property/CHANGELOG.md
new file mode 100644
index 000000000..94bad092d
--- /dev/null
+++ b/server/node_modules/define-data-property/CHANGELOG.md
@@ -0,0 +1,41 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.1.1](https://github.com/ljharb/define-data-property/compare/v1.1.0...v1.1.1) - 2023-10-12
+
+### Commits
+
+- [Tests] fix tests in ES3 engines [`5c6920e`](https://github.com/ljharb/define-data-property/commit/5c6920edd1f52f675b02f417e539c28135b43f94)
+- [Dev Deps] update `@types/es-value-fixtures`, `@types/for-each`, `@types/gopd`, `@types/has-property-descriptors`, `tape`, `typescript` [`7d82dfc`](https://github.com/ljharb/define-data-property/commit/7d82dfc20f778b4465bba06335dd53f6f431aea3)
+- [Fix] IE 8 has a broken `Object.defineProperty` [`0672e1a`](https://github.com/ljharb/define-data-property/commit/0672e1af2a9fcc787e7c23b96dea60d290df5548)
+- [meta] emit types on prepack [`73acb1f`](https://github.com/ljharb/define-data-property/commit/73acb1f903c21b314ec7156bf10f73c7910530c0)
+- [Dev Deps] update `tape`, `typescript` [`9489a77`](https://github.com/ljharb/define-data-property/commit/9489a7738bf2ecf0ac71d5b78ec4ca6ad7ba0142)
+
+## [v1.1.0](https://github.com/ljharb/define-data-property/compare/v1.0.1...v1.1.0) - 2023-09-13
+
+### Commits
+
+- [New] add `loose` arg [`155235a`](https://github.com/ljharb/define-data-property/commit/155235a4c4d7741f6de01cd87c99599a56654b72)
+- [New] allow `null` to be passed for the non* args [`7d2fa5f`](https://github.com/ljharb/define-data-property/commit/7d2fa5f06be0392736c13b126f7cd38979f34792)
+
+## [v1.0.1](https://github.com/ljharb/define-data-property/compare/v1.0.0...v1.0.1) - 2023-09-12
+
+### Commits
+
+- [meta] add TS types [`43d763c`](https://github.com/ljharb/define-data-property/commit/43d763c6c883f652de1c9c02ef6216ee507ffa69)
+- [Dev Deps] update `@types/tape`, `typescript` [`f444985`](https://github.com/ljharb/define-data-property/commit/f444985811c36f3e6448a03ad2f9b7898917f4c7)
+- [meta] add `safe-publish-latest`, [`172bb10`](https://github.com/ljharb/define-data-property/commit/172bb10890896ebb160e64398f6ee55760107bee)
+
+## v1.0.0 - 2023-09-12
+
+### Commits
+
+- Initial implementation, tests, readme [`5b43d6b`](https://github.com/ljharb/define-data-property/commit/5b43d6b44e675a904810467a7d4e0adb7efc3196)
+- Initial commit [`35e577a`](https://github.com/ljharb/define-data-property/commit/35e577a6ba59a98befa97776d70d90f3bea9009d)
+- npm init [`82a0a04`](https://github.com/ljharb/define-data-property/commit/82a0a04a321ca7de220af02d41e2745e8a9962ed)
+- Only apps should have lockfiles [`96df244`](https://github.com/ljharb/define-data-property/commit/96df244a3c6f426f9a2437be825d1c6f5dd7158e)
+- [meta] use `npmignore` to autogenerate an npmignore file [`a87ff18`](https://github.com/ljharb/define-data-property/commit/a87ff18cb79e14c2eb5720486c4759fd9a189375)
diff --git a/server/node_modules/define-data-property/LICENSE b/server/node_modules/define-data-property/LICENSE
new file mode 100644
index 000000000..b4213ac64
--- /dev/null
+++ b/server/node_modules/define-data-property/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2023 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/server/node_modules/define-data-property/README.md b/server/node_modules/define-data-property/README.md
new file mode 100644
index 000000000..f2304daef
--- /dev/null
+++ b/server/node_modules/define-data-property/README.md
@@ -0,0 +1,67 @@
+# define-data-property [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+Define a data property on an object. Will fall back to assignment in an engine without descriptors.
+
+The three `non*` argument can also be passed `null`, which will use the existing state if available.
+
+The `loose` argument will mean that if you attempt to set a non-normal data property, in an environment without descriptor support, it will fall back to normal assignment.
+
+## Usage
+
+```javascript
+var defineDataProperty = require('define-data-property');
+var assert = require('assert');
+
+var obj = {};
+defineDataProperty(obj, 'key', 'value');
+defineDataProperty(
+ obj,
+ 'key2',
+ 'value',
+ true, // nonEnumerable, optional
+ false, // nonWritable, optional
+ true, // nonConfigurable, optional
+ false // loose, optional
+);
+
+assert.deepEqual(
+ Object.getOwnPropertyDescriptors(obj),
+ {
+ key: {
+ configurable: true,
+ enumerable: true,
+ value: 'value',
+ writable: true,
+ },
+ key2: {
+ configurable: false,
+ enumerable: false,
+ value: 'value',
+ writable: true,
+ },
+ }
+);
+```
+
+[package-url]: https://npmjs.org/package/define-data-property
+[npm-version-svg]: https://versionbadg.es/ljharb/define-data-property.svg
+[deps-svg]: https://david-dm.org/ljharb/define-data-property.svg
+[deps-url]: https://david-dm.org/ljharb/define-data-property
+[dev-deps-svg]: https://david-dm.org/ljharb/define-data-property/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/define-data-property#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/define-data-property.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/define-data-property.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/define-data-property.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=define-data-property
+[codecov-image]: https://codecov.io/gh/ljharb/define-data-property/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/define-data-property/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/define-data-property
+[actions-url]: https://github.com/ljharb/define-data-property/actions
diff --git a/server/node_modules/define-data-property/index.d.ts b/server/node_modules/define-data-property/index.d.ts
new file mode 100644
index 000000000..d2e353d10
--- /dev/null
+++ b/server/node_modules/define-data-property/index.d.ts
@@ -0,0 +1,3 @@
+declare const _exports: (obj: Record, property: PropertyKey, value: unknown, nonEnumerable?: boolean | null, nonWritable?: boolean | null, nonConfigurable?: boolean | null, loose?: boolean) => void;
+export = _exports;
+//# sourceMappingURL=index.d.ts.map
\ No newline at end of file
diff --git a/server/node_modules/define-data-property/index.d.ts.map b/server/node_modules/define-data-property/index.d.ts.map
new file mode 100644
index 000000000..39aca4b8d
--- /dev/null
+++ b/server/node_modules/define-data-property/index.d.ts.map
@@ -0,0 +1 @@
+{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["index.js"],"names":[],"mappings":"8BAqBiB,OAAO,WAAW,EAAE,OAAO,CAAC,YAAY,WAAW,SAAS,OAAO,kBAAkB,OAAO,GAAG,IAAI,gBAAgB,OAAO,GAAG,IAAI,oBAAoB,OAAO,GAAG,IAAI,UAAU,OAAO,KAAK,IAAI"}
\ No newline at end of file
diff --git a/server/node_modules/define-data-property/index.js b/server/node_modules/define-data-property/index.js
new file mode 100644
index 000000000..953406519
--- /dev/null
+++ b/server/node_modules/define-data-property/index.js
@@ -0,0 +1,68 @@
+'use strict';
+
+var hasPropertyDescriptors = require('has-property-descriptors')();
+
+var GetIntrinsic = require('get-intrinsic');
+
+var $defineProperty = hasPropertyDescriptors && GetIntrinsic('%Object.defineProperty%', true);
+if ($defineProperty) {
+ try {
+ $defineProperty({}, 'a', { value: 1 });
+ } catch (e) {
+ // IE 8 has a broken defineProperty
+ $defineProperty = false;
+ }
+}
+
+var $SyntaxError = GetIntrinsic('%SyntaxError%');
+var $TypeError = GetIntrinsic('%TypeError%');
+
+var gopd = require('gopd');
+
+/** @type {(obj: Record, property: PropertyKey, value: unknown, nonEnumerable?: boolean | null, nonWritable?: boolean | null, nonConfigurable?: boolean | null, loose?: boolean) => void} */
+module.exports = function defineDataProperty(
+ obj,
+ property,
+ value
+) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new $TypeError('`obj` must be an object or a function`');
+ }
+ if (typeof property !== 'string' && typeof property !== 'symbol') {
+ throw new $TypeError('`property` must be a string or a symbol`');
+ }
+ if (arguments.length > 3 && typeof arguments[3] !== 'boolean' && arguments[3] !== null) {
+ throw new $TypeError('`nonEnumerable`, if provided, must be a boolean or null');
+ }
+ if (arguments.length > 4 && typeof arguments[4] !== 'boolean' && arguments[4] !== null) {
+ throw new $TypeError('`nonWritable`, if provided, must be a boolean or null');
+ }
+ if (arguments.length > 5 && typeof arguments[5] !== 'boolean' && arguments[5] !== null) {
+ throw new $TypeError('`nonConfigurable`, if provided, must be a boolean or null');
+ }
+ if (arguments.length > 6 && typeof arguments[6] !== 'boolean') {
+ throw new $TypeError('`loose`, if provided, must be a boolean');
+ }
+
+ var nonEnumerable = arguments.length > 3 ? arguments[3] : null;
+ var nonWritable = arguments.length > 4 ? arguments[4] : null;
+ var nonConfigurable = arguments.length > 5 ? arguments[5] : null;
+ var loose = arguments.length > 6 ? arguments[6] : false;
+
+ /* @type {false | TypedPropertyDescriptor} */
+ var desc = !!gopd && gopd(obj, property);
+
+ if ($defineProperty) {
+ $defineProperty(obj, property, {
+ configurable: nonConfigurable === null && desc ? desc.configurable : !nonConfigurable,
+ enumerable: nonEnumerable === null && desc ? desc.enumerable : !nonEnumerable,
+ value: value,
+ writable: nonWritable === null && desc ? desc.writable : !nonWritable
+ });
+ } else if (loose || (!nonEnumerable && !nonWritable && !nonConfigurable)) {
+ // must fall back to [[Set]], and was not explicitly asked to make non-enumerable, non-writable, or non-configurable
+ obj[property] = value; // eslint-disable-line no-param-reassign
+ } else {
+ throw new $SyntaxError('This environment does not support defining a property as non-configurable, non-writable, or non-enumerable.');
+ }
+};
diff --git a/server/node_modules/define-data-property/package.json b/server/node_modules/define-data-property/package.json
new file mode 100644
index 000000000..1bb5815ba
--- /dev/null
+++ b/server/node_modules/define-data-property/package.json
@@ -0,0 +1,113 @@
+{
+ "name": "define-data-property",
+ "version": "1.1.1",
+ "description": "Define a data property on an object. Will fall back to assignment in an engine without descriptors.",
+ "main": "index.js",
+ "exports": {
+ ".": [
+ {
+ "types": "./index.d.ts",
+ "default": "./index.js"
+ },
+ "./index.js"
+ ],
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "types": "./index.d.ts",
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=autogenerated && npm run emit-types",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "tsc": "tsc -p .",
+ "preemit-types": "rm -f *.ts *.ts.map test/*.ts test/*.ts.map",
+ "emit-types": "npm run tsc -- --noEmit false --emitDeclarationOnly",
+ "postemit-types": "rm test/*.ts test/*.ts.map",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=js,mjs .",
+ "postlint": "npm run tsc",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "aud --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/define-data-property.git"
+ },
+ "keywords": [
+ "define",
+ "data",
+ "property",
+ "object",
+ "accessor",
+ "javascript",
+ "ecmascript",
+ "enumerable",
+ "configurable",
+ "writable"
+ ],
+ "author": "Jordan Harband ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/define-data-property/issues"
+ },
+ "homepage": "https://github.com/ljharb/define-data-property#readme",
+ "dependencies": {
+ "get-intrinsic": "^1.2.1",
+ "gopd": "^1.0.1",
+ "has-property-descriptors": "^1.0.0"
+ },
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.0",
+ "@types/es-value-fixtures": "^1.4.1",
+ "@types/for-each": "^0.3.1",
+ "@types/get-intrinsic": "^1.2.0",
+ "@types/gopd": "^1.0.1",
+ "@types/has": "^1.0.0",
+ "@types/has-property-descriptors": "^1.0.1",
+ "@types/object-inspect": "^1.8.2",
+ "@types/object.getownpropertydescriptors": "^2.1.2",
+ "@types/tape": "^5.6.1",
+ "aud": "^2.0.3",
+ "auto-changelog": "^2.4.0",
+ "es-value-fixtures": "^1.4.2",
+ "eslint": "=8.8.0",
+ "evalmd": "^0.0.19",
+ "for-each": "^0.3.3",
+ "has": "^1.0.3",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.0",
+ "nyc": "^10.3.2",
+ "object-inspect": "^1.12.3",
+ "object.getownpropertydescriptors": "^2.1.7",
+ "reflect.ownkeys": "^1.1.4",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.7.1",
+ "typescript": "^5.3.0-dev.20231012"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "testling": {
+ "files": "test/index.js"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows",
+ "!*.ts",
+ "!*.ts.map",
+ "types/reflect.ownkeys"
+ ]
+ }
+}
diff --git a/server/node_modules/define-data-property/test/index.js b/server/node_modules/define-data-property/test/index.js
new file mode 100644
index 000000000..405508ec5
--- /dev/null
+++ b/server/node_modules/define-data-property/test/index.js
@@ -0,0 +1,392 @@
+'use strict';
+
+var test = require('tape');
+var v = require('es-value-fixtures');
+var forEach = require('for-each');
+var inspect = require('object-inspect');
+var has = require('has');
+var hasPropertyDescriptors = require('has-property-descriptors')();
+var getOwnPropertyDescriptors = require('object.getownpropertydescriptors');
+var ownKeys = require('reflect.ownkeys');
+
+var defineDataProperty = require('../');
+
+test('defineDataProperty', function (t) {
+ t.test('argument validation', function (st) {
+ forEach(v.primitives, function (nonObject) {
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty(nonObject, 'key', 'value'); },
+ TypeError,
+ 'throws on non-object input: ' + inspect(nonObject)
+ );
+ });
+
+ forEach(v.nonPropertyKeys, function (nonPropertyKey) {
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty({}, nonPropertyKey, 'value'); },
+ TypeError,
+ 'throws on non-PropertyKey input: ' + inspect(nonPropertyKey)
+ );
+ });
+
+ forEach(v.nonBooleans, function (nonBoolean) {
+ if (nonBoolean !== null) {
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty({}, 'key', 'value', nonBoolean); },
+ TypeError,
+ 'throws on non-boolean nonEnumerable: ' + inspect(nonBoolean)
+ );
+
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty({}, 'key', 'value', false, nonBoolean); },
+ TypeError,
+ 'throws on non-boolean nonWritable: ' + inspect(nonBoolean)
+ );
+
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty({}, 'key', 'value', false, false, nonBoolean); },
+ TypeError,
+ 'throws on non-boolean nonConfigurable: ' + inspect(nonBoolean)
+ );
+ }
+ });
+
+ st.end();
+ });
+
+ t.test('normal data property', function (st) {
+ /** @type {Record} */
+ var obj = { existing: 'existing property' };
+ st.ok(has(obj, 'existing'), 'has initial own property');
+ st.equal(obj.existing, 'existing property', 'has expected initial value');
+
+ var res = defineDataProperty(obj, 'added', 'added property');
+ st.equal(res, void undefined, 'returns `undefined`');
+ st.ok(has(obj, 'added'), 'has expected own property');
+ st.equal(obj.added, 'added property', 'has expected value');
+
+ defineDataProperty(obj, 'existing', 'new value');
+ st.ok(has(obj, 'existing'), 'still has expected own property');
+ st.equal(obj.existing, 'new value', 'has new expected value');
+
+ defineDataProperty(obj, 'explicit1', 'new value', false);
+ st.ok(has(obj, 'explicit1'), 'has expected own property (explicit enumerable)');
+ st.equal(obj.explicit1, 'new value', 'has new expected value (explicit enumerable)');
+
+ defineDataProperty(obj, 'explicit2', 'new value', false, false);
+ st.ok(has(obj, 'explicit2'), 'has expected own property (explicit writable)');
+ st.equal(obj.explicit2, 'new value', 'has new expected value (explicit writable)');
+
+ defineDataProperty(obj, 'explicit3', 'new value', false, false, false);
+ st.ok(has(obj, 'explicit3'), 'has expected own property (explicit configurable)');
+ st.equal(obj.explicit3, 'new value', 'has new expected value (explicit configurable)');
+
+ st.end();
+ });
+
+ t.test('loose mode', { skip: !hasPropertyDescriptors }, function (st) {
+ var obj = { existing: 'existing property' };
+
+ defineDataProperty(obj, 'added', 'added value 1', true, null, null, true);
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ existing: {
+ configurable: true,
+ enumerable: true,
+ value: 'existing property',
+ writable: true
+ },
+ added: {
+ configurable: true,
+ enumerable: !hasPropertyDescriptors,
+ value: 'added value 1',
+ writable: true
+ }
+ },
+ 'in loose mode, obj still adds property 1'
+ );
+
+ defineDataProperty(obj, 'added', 'added value 2', false, true, null, true);
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ existing: {
+ configurable: true,
+ enumerable: true,
+ value: 'existing property',
+ writable: true
+ },
+ added: {
+ configurable: true,
+ enumerable: true,
+ value: 'added value 2',
+ writable: !hasPropertyDescriptors
+ }
+ },
+ 'in loose mode, obj still adds property 2'
+ );
+
+ defineDataProperty(obj, 'added', 'added value 3', false, false, true, true);
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ existing: {
+ configurable: true,
+ enumerable: true,
+ value: 'existing property',
+ writable: true
+ },
+ added: {
+ configurable: !hasPropertyDescriptors,
+ enumerable: true,
+ value: 'added value 3',
+ writable: true
+ }
+ },
+ 'in loose mode, obj still adds property 3'
+ );
+
+ st.end();
+ });
+
+ t.test('non-normal data property, ES3', { skip: hasPropertyDescriptors }, function (st) {
+ /** @type {Record} */
+ var obj = { existing: 'existing property' };
+
+ st['throws'](
+ function () { defineDataProperty(obj, 'added', 'added value', true); },
+ SyntaxError,
+ 'nonEnumerable throws a Syntax Error'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(obj, 'added', 'added value', false, true); },
+ SyntaxError,
+ 'nonWritable throws a Syntax Error'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(obj, 'added', 'added value', false, false, true); },
+ SyntaxError,
+ 'nonWritable throws a Syntax Error'
+ );
+
+ st.deepEqual(
+ ownKeys(obj),
+ ['existing'],
+ 'obj still has expected keys'
+ );
+ st.equal(obj.existing, 'existing property', 'obj still has expected values');
+
+ st.end();
+ });
+
+ t.test('new non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ /** @type {Record} */
+ var obj = { existing: 'existing property' };
+
+ defineDataProperty(obj, 'nonEnum', null, true);
+ defineDataProperty(obj, 'nonWrit', null, false, true);
+ defineDataProperty(obj, 'nonConf', null, false, false, true);
+
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ existing: {
+ configurable: true,
+ enumerable: true,
+ value: 'existing property',
+ writable: true
+ },
+ nonEnum: {
+ configurable: true,
+ enumerable: false,
+ value: null,
+ writable: true
+ },
+ nonWrit: {
+ configurable: true,
+ enumerable: true,
+ value: null,
+ writable: false
+ },
+ nonConf: {
+ configurable: false,
+ enumerable: true,
+ value: null,
+ writable: true
+ }
+ },
+ 'obj has expected property descriptors'
+ );
+
+ st.end();
+ });
+
+ t.test('existing non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ // test case changing an existing non-normal property
+
+ /** @type {Record} */
+ var obj = {};
+ Object.defineProperty(obj, 'nonEnum', { configurable: true, enumerable: false, value: null, writable: true });
+ Object.defineProperty(obj, 'nonWrit', { configurable: true, enumerable: true, value: null, writable: false });
+ Object.defineProperty(obj, 'nonConf', { configurable: false, enumerable: true, value: null, writable: true });
+
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ nonEnum: {
+ configurable: true,
+ enumerable: false,
+ value: null,
+ writable: true
+ },
+ nonWrit: {
+ configurable: true,
+ enumerable: true,
+ value: null,
+ writable: false
+ },
+ nonConf: {
+ configurable: false,
+ enumerable: true,
+ value: null,
+ writable: true
+ }
+ },
+ 'obj initially has expected property descriptors'
+ );
+
+ defineDataProperty(obj, 'nonEnum', 'new value', false);
+ defineDataProperty(obj, 'nonWrit', 'new value', false, false);
+ st['throws'](
+ function () { defineDataProperty(obj, 'nonConf', 'new value', false, false, false); },
+ TypeError,
+ 'can not alter a nonconfigurable property'
+ );
+
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ nonEnum: {
+ configurable: true,
+ enumerable: true,
+ value: 'new value',
+ writable: true
+ },
+ nonWrit: {
+ configurable: true,
+ enumerable: true,
+ value: 'new value',
+ writable: true
+ },
+ nonConf: {
+ configurable: false,
+ enumerable: true,
+ value: null,
+ writable: true
+ }
+ },
+ 'obj ends up with expected property descriptors'
+ );
+
+ st.end();
+ });
+
+ t.test('frozen object, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ var frozen = Object.freeze({ existing: true });
+
+ st['throws'](
+ function () { defineDataProperty(frozen, 'existing', 'new value'); },
+ TypeError,
+ 'frozen object can not modify an existing property'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(frozen, 'new', 'new property'); },
+ TypeError,
+ 'frozen object can not add a new property'
+ );
+
+ st.end();
+ });
+
+ t.test('sealed object, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ var sealed = Object.seal({ existing: true });
+ st.deepEqual(
+ Object.getOwnPropertyDescriptor(sealed, 'existing'),
+ {
+ configurable: false,
+ enumerable: true,
+ value: true,
+ writable: true
+ },
+ 'existing value on sealed object has expected descriptor'
+ );
+
+ defineDataProperty(sealed, 'existing', 'new value');
+
+ st.deepEqual(
+ Object.getOwnPropertyDescriptor(sealed, 'existing'),
+ {
+ configurable: false,
+ enumerable: true,
+ value: 'new value',
+ writable: true
+ },
+ 'existing value on sealed object has changed descriptor'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(sealed, 'new', 'new property'); },
+ TypeError,
+ 'sealed object can not add a new property'
+ );
+
+ st.end();
+ });
+
+ t.test('nonextensible object, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ var nonExt = Object.preventExtensions({ existing: true });
+
+ st.deepEqual(
+ Object.getOwnPropertyDescriptor(nonExt, 'existing'),
+ {
+ configurable: true,
+ enumerable: true,
+ value: true,
+ writable: true
+ },
+ 'existing value on non-extensible object has expected descriptor'
+ );
+
+ defineDataProperty(nonExt, 'existing', 'new value', true);
+
+ st.deepEqual(
+ Object.getOwnPropertyDescriptor(nonExt, 'existing'),
+ {
+ configurable: true,
+ enumerable: false,
+ value: 'new value',
+ writable: true
+ },
+ 'existing value on non-extensible object has changed descriptor'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(nonExt, 'new', 'new property'); },
+ TypeError,
+ 'non-extensible object can not add a new property'
+ );
+
+ st.end();
+ });
+
+ t.end();
+});
diff --git a/server/node_modules/define-data-property/tsconfig.json b/server/node_modules/define-data-property/tsconfig.json
new file mode 100644
index 000000000..69f060dcc
--- /dev/null
+++ b/server/node_modules/define-data-property/tsconfig.json
@@ -0,0 +1,59 @@
+{
+ "compilerOptions": {
+ /* Visit https://aka.ms/tsconfig to read more about this file */
+
+ /* Projects */
+
+ /* Language and Environment */
+ "target": "es2022", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */
+ // "lib": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */
+ // "noLib": true, /* Disable including any library files, including the default lib.d.ts. */
+ "useDefineForClassFields": true, /* Emit ECMAScript-standard-compliant class fields. */
+ // "moduleDetection": "auto", /* Control what method is used to detect module-format JS files. */
+
+ /* Modules */
+ "module": "commonjs", /* Specify what module code is generated. */
+ // "rootDir": "./", /* Specify the root folder within your source files. */
+ // "moduleResolution": "node10", /* Specify how TypeScript looks up a file from a given module specifier. */
+ // "baseUrl": "./", /* Specify the base directory to resolve non-relative module names. */
+ // "paths": {}, /* Specify a set of entries that re-map imports to additional lookup locations. */
+ // "rootDirs": [], /* Allow multiple folders to be treated as one when resolving modules. */
+ "typeRoots": ["types"], /* Specify multiple folders that act like './node_modules/@types'. */
+ "resolveJsonModule": true, /* Enable importing .json files. */
+
+ /* JavaScript Support */
+ "allowJs": true, /* Allow JavaScript files to be a part of your program. Use the 'checkJS' option to get errors from these files. */
+ "checkJs": true, /* Enable error reporting in type-checked JavaScript files. */
+ "maxNodeModuleJsDepth": 1, /* Specify the maximum folder depth used for checking JavaScript files from 'node_modules'. Only applicable with 'allowJs'. */
+
+ /* Emit */
+ "declaration": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */
+ "declarationMap": true, /* Create sourcemaps for d.ts files. */
+ // "emitDeclarationOnly": true, /* Only output d.ts files and not JavaScript files. */
+ "noEmit": true, /* Disable emitting files from a compilation. */
+
+ /* Interop Constraints */
+ "allowSyntheticDefaultImports": true, /* Allow 'import x from y' when a module doesn't have a default export. */
+ "esModuleInterop": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables 'allowSyntheticDefaultImports' for type compatibility. */
+ "forceConsistentCasingInFileNames": true, /* Ensure that casing is correct in imports. */
+
+ /* Type Checking */
+ "strict": true, /* Enable all strict type-checking options. */
+ "noImplicitAny": true, /* Enable error reporting for expressions and declarations with an implied 'any' type. */
+ "noImplicitThis": true, /* Enable error reporting when 'this' is given the type 'any'. */
+ "useUnknownInCatchVariables": true, /* Default catch clause variables as 'unknown' instead of 'any'. */
+ "noUnusedLocals": true, /* Enable error reporting when local variables aren't read. */
+ "noUnusedParameters": true, /* Raise an error when a function parameter isn't read. */
+ "noImplicitReturns": true, /* Enable error reporting for codepaths that do not explicitly return in a function. */
+ "noFallthroughCasesInSwitch": true, /* Enable error reporting for fallthrough cases in switch statements. */
+ "noUncheckedIndexedAccess": true, /* Add 'undefined' to a type when accessed using an index. */
+ "noImplicitOverride": true, /* Ensure overriding members in derived classes are marked with an override modifier. */
+ // "noPropertyAccessFromIndexSignature": true, /* Enforces using indexed accessors for keys declared using an indexed type. */
+
+ /* Completeness */
+ // "skipLibCheck": true /* Skip type checking all .d.ts files. */
+ },
+ "exclude": [
+ "coverage"
+ ]
+}
diff --git a/server/node_modules/depd/History.md b/server/node_modules/depd/History.md
new file mode 100644
index 000000000..cd9ebaaa9
--- /dev/null
+++ b/server/node_modules/depd/History.md
@@ -0,0 +1,103 @@
+2.0.0 / 2018-10-26
+==================
+
+ * Drop support for Node.js 0.6
+ * Replace internal `eval` usage with `Function` constructor
+ * Use instance methods on `process` to check for listeners
+
+1.1.2 / 2018-01-11
+==================
+
+ * perf: remove argument reassignment
+ * Support Node.js 0.6 to 9.x
+
+1.1.1 / 2017-07-27
+==================
+
+ * Remove unnecessary `Buffer` loading
+ * Support Node.js 0.6 to 8.x
+
+1.1.0 / 2015-09-14
+==================
+
+ * Enable strict mode in more places
+ * Support io.js 3.x
+ * Support io.js 2.x
+ * Support web browser loading
+ - Requires bundler like Browserify or webpack
+
+1.0.1 / 2015-04-07
+==================
+
+ * Fix `TypeError`s when under `'use strict'` code
+ * Fix useless type name on auto-generated messages
+ * Support io.js 1.x
+ * Support Node.js 0.12
+
+1.0.0 / 2014-09-17
+==================
+
+ * No changes
+
+0.4.5 / 2014-09-09
+==================
+
+ * Improve call speed to functions using the function wrapper
+ * Support Node.js 0.6
+
+0.4.4 / 2014-07-27
+==================
+
+ * Work-around v8 generating empty stack traces
+
+0.4.3 / 2014-07-26
+==================
+
+ * Fix exception when global `Error.stackTraceLimit` is too low
+
+0.4.2 / 2014-07-19
+==================
+
+ * Correct call site for wrapped functions and properties
+
+0.4.1 / 2014-07-19
+==================
+
+ * Improve automatic message generation for function properties
+
+0.4.0 / 2014-07-19
+==================
+
+ * Add `TRACE_DEPRECATION` environment variable
+ * Remove non-standard grey color from color output
+ * Support `--no-deprecation` argument
+ * Support `--trace-deprecation` argument
+ * Support `deprecate.property(fn, prop, message)`
+
+0.3.0 / 2014-06-16
+==================
+
+ * Add `NO_DEPRECATION` environment variable
+
+0.2.0 / 2014-06-15
+==================
+
+ * Add `deprecate.property(obj, prop, message)`
+ * Remove `supports-color` dependency for node.js 0.8
+
+0.1.0 / 2014-06-15
+==================
+
+ * Add `deprecate.function(fn, message)`
+ * Add `process.on('deprecation', fn)` emitter
+ * Automatically generate message when omitted from `deprecate()`
+
+0.0.1 / 2014-06-15
+==================
+
+ * Fix warning for dynamic calls at singe call site
+
+0.0.0 / 2014-06-15
+==================
+
+ * Initial implementation
diff --git a/server/node_modules/depd/LICENSE b/server/node_modules/depd/LICENSE
new file mode 100644
index 000000000..248de7af2
--- /dev/null
+++ b/server/node_modules/depd/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2018 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/depd/Readme.md b/server/node_modules/depd/Readme.md
new file mode 100644
index 000000000..043d1ca28
--- /dev/null
+++ b/server/node_modules/depd/Readme.md
@@ -0,0 +1,280 @@
+# depd
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Linux Build][travis-image]][travis-url]
+[![Windows Build][appveyor-image]][appveyor-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Deprecate all the things
+
+> With great modules comes great responsibility; mark things deprecated!
+
+## Install
+
+This module is installed directly using `npm`:
+
+```sh
+$ npm install depd
+```
+
+This module can also be bundled with systems like
+[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/),
+though by default this module will alter it's API to no longer display or
+track deprecations.
+
+## API
+
+
+
+```js
+var deprecate = require('depd')('my-module')
+```
+
+This library allows you to display deprecation messages to your users.
+This library goes above and beyond with deprecation warnings by
+introspection of the call stack (but only the bits that it is interested
+in).
+
+Instead of just warning on the first invocation of a deprecated
+function and never again, this module will warn on the first invocation
+of a deprecated function per unique call site, making it ideal to alert
+users of all deprecated uses across the code base, rather than just
+whatever happens to execute first.
+
+The deprecation warnings from this module also include the file and line
+information for the call into the module that the deprecated function was
+in.
+
+**NOTE** this library has a similar interface to the `debug` module, and
+this module uses the calling file to get the boundary for the call stacks,
+so you should always create a new `deprecate` object in each file and not
+within some central file.
+
+### depd(namespace)
+
+Create a new deprecate function that uses the given namespace name in the
+messages and will display the call site prior to the stack entering the
+file this function was called from. It is highly suggested you use the
+name of your module as the namespace.
+
+### deprecate(message)
+
+Call this function from deprecated code to display a deprecation message.
+This message will appear once per unique caller site. Caller site is the
+first call site in the stack in a different file from the caller of this
+function.
+
+If the message is omitted, a message is generated for you based on the site
+of the `deprecate()` call and will display the name of the function called,
+similar to the name displayed in a stack trace.
+
+### deprecate.function(fn, message)
+
+Call this function to wrap a given function in a deprecation message on any
+call to the function. An optional message can be supplied to provide a custom
+message.
+
+### deprecate.property(obj, prop, message)
+
+Call this function to wrap a given property on object in a deprecation message
+on any accessing or setting of the property. An optional message can be supplied
+to provide a custom message.
+
+The method must be called on the object where the property belongs (not
+inherited from the prototype).
+
+If the property is a data descriptor, it will be converted to an accessor
+descriptor in order to display the deprecation message.
+
+### process.on('deprecation', fn)
+
+This module will allow easy capturing of deprecation errors by emitting the
+errors as the type "deprecation" on the global `process`. If there are no
+listeners for this type, the errors are written to STDERR as normal, but if
+there are any listeners, nothing will be written to STDERR and instead only
+emitted. From there, you can write the errors in a different format or to a
+logging source.
+
+The error represents the deprecation and is emitted only once with the same
+rules as writing to STDERR. The error has the following properties:
+
+ - `message` - This is the message given by the library
+ - `name` - This is always `'DeprecationError'`
+ - `namespace` - This is the namespace the deprecation came from
+ - `stack` - This is the stack of the call to the deprecated thing
+
+Example `error.stack` output:
+
+```
+DeprecationError: my-cool-module deprecated oldfunction
+ at Object. ([eval]-wrapper:6:22)
+ at Module._compile (module.js:456:26)
+ at evalScript (node.js:532:25)
+ at startup (node.js:80:7)
+ at node.js:902:3
+```
+
+### process.env.NO_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `NO_DEPRECATION`
+is provided as a quick solution to silencing deprecation warnings from being
+output. The format of this is similar to that of `DEBUG`:
+
+```sh
+$ NO_DEPRECATION=my-module,othermod node app.js
+```
+
+This will suppress deprecations from being output for "my-module" and "othermod".
+The value is a list of comma-separated namespaces. To suppress every warning
+across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--no-deprecation` to the `node` executable will suppress
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not suppress the deperecations given to any "deprecation"
+event listeners, just the output to STDERR.
+
+### process.env.TRACE_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION`
+is provided as a solution to getting more detailed location information in deprecation
+warnings by including the entire stack trace. The format of this is the same as
+`NO_DEPRECATION`:
+
+```sh
+$ TRACE_DEPRECATION=my-module,othermod node app.js
+```
+
+This will include stack traces for deprecations being output for "my-module" and
+"othermod". The value is a list of comma-separated namespaces. To trace every
+warning across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--trace-deprecation` to the `node` executable will trace
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`.
+
+## Display
+
+
+
+When a user calls a function in your library that you mark deprecated, they
+will see the following written to STDERR (in the given colors, similar colors
+and layout to the `debug` module):
+
+```
+bright cyan bright yellow
+| | reset cyan
+| | | |
+▼ ▼ ▼ ▼
+my-cool-module deprecated oldfunction [eval]-wrapper:6:22
+▲ ▲ ▲ ▲
+| | | |
+namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+If the user redirects their STDERR to a file or somewhere that does not support
+colors, they see (similar layout to the `debug` module):
+
+```
+Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22
+▲ ▲ ▲ ▲ ▲
+| | | | |
+timestamp of message namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+## Examples
+
+### Deprecating all calls to a function
+
+This will display a deprecated message about "oldfunction" being deprecated
+from "my-module" on STDERR.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+// message automatically derived from function name
+// Object.oldfunction
+exports.oldfunction = deprecate.function(function oldfunction () {
+ // all calls to function are deprecated
+})
+
+// specific message
+exports.oldfunction = deprecate.function(function () {
+ // all calls to function are deprecated
+}, 'oldfunction')
+```
+
+### Conditionally deprecating a function call
+
+This will display a deprecated message about "weirdfunction" being deprecated
+from "my-module" on STDERR when called with less than 2 arguments.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ }
+}
+```
+
+When calling `deprecate` as a function, the warning is counted per call site
+within your own module, so you can display different deprecations depending
+on different situations and the users will still get all the warnings:
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ } else if (typeof arguments[0] !== 'string') {
+ // calls with non-string first argument are deprecated
+ deprecate('weirdfunction non-string first arg')
+ }
+}
+```
+
+### Deprecating property access
+
+This will display a deprecated message about "oldprop" being deprecated
+from "my-module" on STDERR when accessed. A deprecation will be displayed
+when setting the value and when getting the value.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.oldprop = 'something'
+
+// message automatically derives from property name
+deprecate.property(exports, 'oldprop')
+
+// explicit message
+deprecate.property(exports, 'oldprop', 'oldprop >= 0.10')
+```
+
+## License
+
+[MIT](LICENSE)
+
+[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/nodejs-depd/master?label=windows
+[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd
+[coveralls-image]: https://badgen.net/coveralls/c/github/dougwilson/nodejs-depd/master
+[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master
+[node-image]: https://badgen.net/npm/node/depd
+[node-url]: https://nodejs.org/en/download/
+[npm-downloads-image]: https://badgen.net/npm/dm/depd
+[npm-url]: https://npmjs.org/package/depd
+[npm-version-image]: https://badgen.net/npm/v/depd
+[travis-image]: https://badgen.net/travis/dougwilson/nodejs-depd/master?label=linux
+[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd
diff --git a/server/node_modules/depd/index.js b/server/node_modules/depd/index.js
new file mode 100644
index 000000000..1bf2fcfde
--- /dev/null
+++ b/server/node_modules/depd/index.js
@@ -0,0 +1,538 @@
+/*!
+ * depd
+ * Copyright(c) 2014-2018 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var relative = require('path').relative
+
+/**
+ * Module exports.
+ */
+
+module.exports = depd
+
+/**
+ * Get the path to base files on.
+ */
+
+var basePath = process.cwd()
+
+/**
+ * Determine if namespace is contained in the string.
+ */
+
+function containsNamespace (str, namespace) {
+ var vals = str.split(/[ ,]+/)
+ var ns = String(namespace).toLowerCase()
+
+ for (var i = 0; i < vals.length; i++) {
+ var val = vals[i]
+
+ // namespace contained
+ if (val && (val === '*' || val.toLowerCase() === ns)) {
+ return true
+ }
+ }
+
+ return false
+}
+
+/**
+ * Convert a data descriptor to accessor descriptor.
+ */
+
+function convertDataDescriptorToAccessor (obj, prop, message) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+ var value = descriptor.value
+
+ descriptor.get = function getter () { return value }
+
+ if (descriptor.writable) {
+ descriptor.set = function setter (val) { return (value = val) }
+ }
+
+ delete descriptor.value
+ delete descriptor.writable
+
+ Object.defineProperty(obj, prop, descriptor)
+
+ return descriptor
+}
+
+/**
+ * Create arguments string to keep arity.
+ */
+
+function createArgumentsString (arity) {
+ var str = ''
+
+ for (var i = 0; i < arity; i++) {
+ str += ', arg' + i
+ }
+
+ return str.substr(2)
+}
+
+/**
+ * Create stack string from stack.
+ */
+
+function createStackString (stack) {
+ var str = this.name + ': ' + this.namespace
+
+ if (this.message) {
+ str += ' deprecated ' + this.message
+ }
+
+ for (var i = 0; i < stack.length; i++) {
+ str += '\n at ' + stack[i].toString()
+ }
+
+ return str
+}
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+ var file = site[0]
+
+ function deprecate (message) {
+ // call to self as log
+ log.call(deprecate, message)
+ }
+
+ deprecate._file = file
+ deprecate._ignored = isignored(namespace)
+ deprecate._namespace = namespace
+ deprecate._traced = istraced(namespace)
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Determine if event emitter has listeners of a given type.
+ *
+ * The way to do this check is done three different ways in Node.js >= 0.8
+ * so this consolidates them into a minimal set using instance methods.
+ *
+ * @param {EventEmitter} emitter
+ * @param {string} type
+ * @returns {boolean}
+ * @private
+ */
+
+function eehaslisteners (emitter, type) {
+ var count = typeof emitter.listenerCount !== 'function'
+ ? emitter.listeners(type).length
+ : emitter.listenerCount(type)
+
+ return count > 0
+}
+
+/**
+ * Determine if namespace is ignored.
+ */
+
+function isignored (namespace) {
+ if (process.noDeprecation) {
+ // --no-deprecation support
+ return true
+ }
+
+ var str = process.env.NO_DEPRECATION || ''
+
+ // namespace ignored
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Determine if namespace is traced.
+ */
+
+function istraced (namespace) {
+ if (process.traceDeprecation) {
+ // --trace-deprecation support
+ return true
+ }
+
+ var str = process.env.TRACE_DEPRECATION || ''
+
+ // namespace traced
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Display deprecation message.
+ */
+
+function log (message, site) {
+ var haslisteners = eehaslisteners(process, 'deprecation')
+
+ // abort early if no destination
+ if (!haslisteners && this._ignored) {
+ return
+ }
+
+ var caller
+ var callFile
+ var callSite
+ var depSite
+ var i = 0
+ var seen = false
+ var stack = getStack()
+ var file = this._file
+
+ if (site) {
+ // provided site
+ depSite = site
+ callSite = callSiteLocation(stack[1])
+ callSite.name = depSite.name
+ file = callSite[0]
+ } else {
+ // get call site
+ i = 2
+ depSite = callSiteLocation(stack[i])
+ callSite = depSite
+ }
+
+ // get caller of deprecated thing in relation to file
+ for (; i < stack.length; i++) {
+ caller = callSiteLocation(stack[i])
+ callFile = caller[0]
+
+ if (callFile === file) {
+ seen = true
+ } else if (callFile === this._file) {
+ file = this._file
+ } else if (seen) {
+ break
+ }
+ }
+
+ var key = caller
+ ? depSite.join(':') + '__' + caller.join(':')
+ : undefined
+
+ if (key !== undefined && key in this._warned) {
+ // already warned
+ return
+ }
+
+ this._warned[key] = true
+
+ // generate automatic message from call site
+ var msg = message
+ if (!msg) {
+ msg = callSite === depSite || !callSite.name
+ ? defaultMessage(depSite)
+ : defaultMessage(callSite)
+ }
+
+ // emit deprecation if listeners exist
+ if (haslisteners) {
+ var err = DeprecationError(this._namespace, msg, stack.slice(i))
+ process.emit('deprecation', err)
+ return
+ }
+
+ // format and write message
+ var format = process.stderr.isTTY
+ ? formatColor
+ : formatPlain
+ var output = format.call(this, msg, caller, stack.slice(i))
+ process.stderr.write(output + '\n', 'utf8')
+}
+
+/**
+ * Get call site location as array.
+ */
+
+function callSiteLocation (callSite) {
+ var file = callSite.getFileName() || ''
+ var line = callSite.getLineNumber()
+ var colm = callSite.getColumnNumber()
+
+ if (callSite.isEval()) {
+ file = callSite.getEvalOrigin() + ', ' + file
+ }
+
+ var site = [file, line, colm]
+
+ site.callSite = callSite
+ site.name = callSite.getFunctionName()
+
+ return site
+}
+
+/**
+ * Generate a default message from the site.
+ */
+
+function defaultMessage (site) {
+ var callSite = site.callSite
+ var funcName = site.name
+
+ // make useful anonymous name
+ if (!funcName) {
+ funcName = ''
+ }
+
+ var context = callSite.getThis()
+ var typeName = context && callSite.getTypeName()
+
+ // ignore useless type name
+ if (typeName === 'Object') {
+ typeName = undefined
+ }
+
+ // make useful type name
+ if (typeName === 'Function') {
+ typeName = context.name || typeName
+ }
+
+ return typeName && callSite.getMethodName()
+ ? typeName + '.' + funcName
+ : funcName
+}
+
+/**
+ * Format deprecation message without color.
+ */
+
+function formatPlain (msg, caller, stack) {
+ var timestamp = new Date().toUTCString()
+
+ var formatted = timestamp +
+ ' ' + this._namespace +
+ ' deprecated ' + msg
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n at ' + stack[i].toString()
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' at ' + formatLocation(caller)
+ }
+
+ return formatted
+}
+
+/**
+ * Format deprecation message with color.
+ */
+
+function formatColor (msg, caller, stack) {
+ var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan
+ ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow
+ ' \x1b[0m' + msg + '\x1b[39m' // reset
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n \x1b[36mat ' + stack[i].toString() + '\x1b[39m' // cyan
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+}
+
+/**
+ * Format call site location.
+ */
+
+function formatLocation (callSite) {
+ return relative(basePath, callSite[0]) +
+ ':' + callSite[1] +
+ ':' + callSite[2]
+}
+
+/**
+ * Get the stack as array of call sites.
+ */
+
+function getStack () {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = Math.max(10, limit)
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice this function off the top
+ var stack = obj.stack.slice(1)
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack
+}
+
+/**
+ * Capture call site stack from v8.
+ */
+
+function prepareObjectStackTrace (obj, stack) {
+ return stack
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ var args = createArgumentsString(fn.length)
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ site.name = fn.name
+
+ // eslint-disable-next-line no-new-func
+ var deprecatedfn = new Function('fn', 'log', 'deprecate', 'message', 'site',
+ '"use strict"\n' +
+ 'return function (' + args + ') {' +
+ 'log.call(deprecate, message, site)\n' +
+ 'return fn.apply(this, arguments)\n' +
+ '}')(fn, log, this, message, site)
+
+ return deprecatedfn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+
+ var deprecate = this
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ // set site name
+ site.name = prop
+
+ // convert data descriptor
+ if ('value' in descriptor) {
+ descriptor = convertDataDescriptorToAccessor(obj, prop, message)
+ }
+
+ var get = descriptor.get
+ var set = descriptor.set
+
+ // wrap getter
+ if (typeof get === 'function') {
+ descriptor.get = function getter () {
+ log.call(deprecate, message, site)
+ return get.apply(this, arguments)
+ }
+ }
+
+ // wrap setter
+ if (typeof set === 'function') {
+ descriptor.set = function setter () {
+ log.call(deprecate, message, site)
+ return set.apply(this, arguments)
+ }
+ }
+
+ Object.defineProperty(obj, prop, descriptor)
+}
+
+/**
+ * Create DeprecationError for deprecation
+ */
+
+function DeprecationError (namespace, message, stack) {
+ var error = new Error()
+ var stackString
+
+ Object.defineProperty(error, 'constructor', {
+ value: DeprecationError
+ })
+
+ Object.defineProperty(error, 'message', {
+ configurable: true,
+ enumerable: false,
+ value: message,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'name', {
+ enumerable: false,
+ configurable: true,
+ value: 'DeprecationError',
+ writable: true
+ })
+
+ Object.defineProperty(error, 'namespace', {
+ configurable: true,
+ enumerable: false,
+ value: namespace,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'stack', {
+ configurable: true,
+ enumerable: false,
+ get: function () {
+ if (stackString !== undefined) {
+ return stackString
+ }
+
+ // prepare stack trace
+ return (stackString = createStackString.call(this, stack))
+ },
+ set: function setter (val) {
+ stackString = val
+ }
+ })
+
+ return error
+}
diff --git a/server/node_modules/depd/lib/browser/index.js b/server/node_modules/depd/lib/browser/index.js
new file mode 100644
index 000000000..6be45cc20
--- /dev/null
+++ b/server/node_modules/depd/lib/browser/index.js
@@ -0,0 +1,77 @@
+/*!
+ * depd
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = depd
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ function deprecate (message) {
+ // no-op in browser
+ }
+
+ deprecate._file = undefined
+ deprecate._ignored = true
+ deprecate._namespace = namespace
+ deprecate._traced = false
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ return fn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+}
diff --git a/server/node_modules/depd/package.json b/server/node_modules/depd/package.json
new file mode 100644
index 000000000..3857e1991
--- /dev/null
+++ b/server/node_modules/depd/package.json
@@ -0,0 +1,45 @@
+{
+ "name": "depd",
+ "description": "Deprecate all the things",
+ "version": "2.0.0",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "deprecate",
+ "deprecated"
+ ],
+ "repository": "dougwilson/nodejs-depd",
+ "browser": "lib/browser/index.js",
+ "devDependencies": {
+ "benchmark": "2.1.4",
+ "beautify-benchmark": "0.2.4",
+ "eslint": "5.7.0",
+ "eslint-config-standard": "12.0.0",
+ "eslint-plugin-import": "2.14.0",
+ "eslint-plugin-markdown": "1.0.0-beta.7",
+ "eslint-plugin-node": "7.0.1",
+ "eslint-plugin-promise": "4.0.1",
+ "eslint-plugin-standard": "4.0.0",
+ "istanbul": "0.4.5",
+ "mocha": "5.2.0",
+ "safe-buffer": "5.1.2",
+ "uid-safe": "2.1.5"
+ },
+ "files": [
+ "lib/",
+ "History.md",
+ "LICENSE",
+ "index.js",
+ "Readme.md"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail test/",
+ "test-ci": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter spec test/ && istanbul report lcovonly text-summary",
+ "test-cov": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter dot test/ && istanbul report lcov text-summary"
+ }
+}
diff --git a/server/node_modules/destroy/LICENSE b/server/node_modules/destroy/LICENSE
new file mode 100644
index 000000000..0e2c35f0e
--- /dev/null
+++ b/server/node_modules/destroy/LICENSE
@@ -0,0 +1,23 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+Copyright (c) 2015-2022 Douglas Christopher Wilson doug@somethingdoug.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/destroy/README.md b/server/node_modules/destroy/README.md
new file mode 100644
index 000000000..e7701aee7
--- /dev/null
+++ b/server/node_modules/destroy/README.md
@@ -0,0 +1,63 @@
+# destroy
+
+[![NPM version][npm-image]][npm-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+Destroy a stream.
+
+This module is meant to ensure a stream gets destroyed, handling different APIs
+and Node.js bugs.
+
+## API
+
+```js
+var destroy = require('destroy')
+```
+
+### destroy(stream [, suppress])
+
+Destroy the given stream, and optionally suppress any future `error` events.
+
+In most cases, this is identical to a simple `stream.destroy()` call. The rules
+are as follows for a given stream:
+
+ 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()`
+ and add a listener to the `open` event to call `stream.close()` if it is
+ fired. This is for a Node.js bug that will leak a file descriptor if
+ `.destroy()` is called before `open`.
+ 2. If the `stream` is an instance of a zlib stream, then call `stream.destroy()`
+ and close the underlying zlib handle if open, otherwise call `stream.close()`.
+ This is for consistency across Node.js versions and a Node.js bug that will
+ leak a native zlib handle.
+ 3. If the `stream` is not an instance of `Stream`, then nothing happens.
+ 4. If the `stream` has a `.destroy()` method, then call it.
+
+The function returns the `stream` passed in as the argument.
+
+## Example
+
+```js
+var destroy = require('destroy')
+
+var fs = require('fs')
+var stream = fs.createReadStream('package.json')
+
+// ... and later
+destroy(stream)
+```
+
+[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/destroy
+[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square
+[github-url]: https://github.com/stream-utils/destroy/tags
+[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master
+[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/destroy
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/stream-utils/destroy/ci/master?label=ci&style=flat-square
+[github-actions-ci-url]: https://github.com/stream-utils/destroy/actions/workflows/ci.yml
diff --git a/server/node_modules/destroy/index.js b/server/node_modules/destroy/index.js
new file mode 100644
index 000000000..7fd5c0936
--- /dev/null
+++ b/server/node_modules/destroy/index.js
@@ -0,0 +1,209 @@
+/*!
+ * destroy
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2015-2022 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var EventEmitter = require('events').EventEmitter
+var ReadStream = require('fs').ReadStream
+var Stream = require('stream')
+var Zlib = require('zlib')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = destroy
+
+/**
+ * Destroy the given stream, and optionally suppress any future `error` events.
+ *
+ * @param {object} stream
+ * @param {boolean} suppress
+ * @public
+ */
+
+function destroy (stream, suppress) {
+ if (isFsReadStream(stream)) {
+ destroyReadStream(stream)
+ } else if (isZlibStream(stream)) {
+ destroyZlibStream(stream)
+ } else if (hasDestroy(stream)) {
+ stream.destroy()
+ }
+
+ if (isEventEmitter(stream) && suppress) {
+ stream.removeAllListeners('error')
+ stream.addListener('error', noop)
+ }
+
+ return stream
+}
+
+/**
+ * Destroy a ReadStream.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function destroyReadStream (stream) {
+ stream.destroy()
+
+ if (typeof stream.close === 'function') {
+ // node.js core bug work-around
+ stream.on('open', onOpenClose)
+ }
+}
+
+/**
+ * Close a Zlib stream.
+ *
+ * Zlib streams below Node.js 4.5.5 have a buggy implementation
+ * of .close() when zlib encountered an error.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function closeZlibStream (stream) {
+ if (stream._hadError === true) {
+ var prop = stream._binding === null
+ ? '_binding'
+ : '_handle'
+
+ stream[prop] = {
+ close: function () { this[prop] = null }
+ }
+ }
+
+ stream.close()
+}
+
+/**
+ * Destroy a Zlib stream.
+ *
+ * Zlib streams don't have a destroy function in Node.js 6. On top of that
+ * simply calling destroy on a zlib stream in Node.js 8+ will result in a
+ * memory leak. So until that is fixed, we need to call both close AND destroy.
+ *
+ * PR to fix memory leak: https://github.com/nodejs/node/pull/23734
+ *
+ * In Node.js 6+8, it's important that destroy is called before close as the
+ * stream would otherwise emit the error 'zlib binding closed'.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function destroyZlibStream (stream) {
+ if (typeof stream.destroy === 'function') {
+ // node.js core bug work-around
+ // istanbul ignore if: node.js 0.8
+ if (stream._binding) {
+ // node.js < 0.10.0
+ stream.destroy()
+ if (stream._processing) {
+ stream._needDrain = true
+ stream.once('drain', onDrainClearBinding)
+ } else {
+ stream._binding.clear()
+ }
+ } else if (stream._destroy && stream._destroy !== Stream.Transform.prototype._destroy) {
+ // node.js >= 12, ^11.1.0, ^10.15.1
+ stream.destroy()
+ } else if (stream._destroy && typeof stream.close === 'function') {
+ // node.js 7, 8
+ stream.destroyed = true
+ stream.close()
+ } else {
+ // fallback
+ // istanbul ignore next
+ stream.destroy()
+ }
+ } else if (typeof stream.close === 'function') {
+ // node.js < 8 fallback
+ closeZlibStream(stream)
+ }
+}
+
+/**
+ * Determine if stream has destroy.
+ * @private
+ */
+
+function hasDestroy (stream) {
+ return stream instanceof Stream &&
+ typeof stream.destroy === 'function'
+}
+
+/**
+ * Determine if val is EventEmitter.
+ * @private
+ */
+
+function isEventEmitter (val) {
+ return val instanceof EventEmitter
+}
+
+/**
+ * Determine if stream is fs.ReadStream stream.
+ * @private
+ */
+
+function isFsReadStream (stream) {
+ return stream instanceof ReadStream
+}
+
+/**
+ * Determine if stream is Zlib stream.
+ * @private
+ */
+
+function isZlibStream (stream) {
+ return stream instanceof Zlib.Gzip ||
+ stream instanceof Zlib.Gunzip ||
+ stream instanceof Zlib.Deflate ||
+ stream instanceof Zlib.DeflateRaw ||
+ stream instanceof Zlib.Inflate ||
+ stream instanceof Zlib.InflateRaw ||
+ stream instanceof Zlib.Unzip
+}
+
+/**
+ * No-op function.
+ * @private
+ */
+
+function noop () {}
+
+/**
+ * On drain handler to clear binding.
+ * @private
+ */
+
+// istanbul ignore next: node.js 0.8
+function onDrainClearBinding () {
+ this._binding.clear()
+}
+
+/**
+ * On open handler to close stream.
+ * @private
+ */
+
+function onOpenClose () {
+ if (typeof this.fd === 'number') {
+ // actually close down the fd
+ this.close()
+ }
+}
diff --git a/server/node_modules/destroy/package.json b/server/node_modules/destroy/package.json
new file mode 100644
index 000000000..c85e43837
--- /dev/null
+++ b/server/node_modules/destroy/package.json
@@ -0,0 +1,48 @@
+{
+ "name": "destroy",
+ "description": "destroy a stream if possible",
+ "version": "1.2.0",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com",
+ "twitter": "https://twitter.com/jongleberry"
+ },
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "repository": "stream-utils/destroy",
+ "devDependencies": {
+ "eslint": "7.32.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.25.4",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "5.2.0",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "9.2.2",
+ "nyc": "15.1.0"
+ },
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec",
+ "test-ci": "nyc --reporter=lcovonly --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "keywords": [
+ "stream",
+ "streams",
+ "destroy",
+ "cleanup",
+ "leak",
+ "fd"
+ ]
+}
diff --git a/server/node_modules/dotenv/CHANGELOG.md b/server/node_modules/dotenv/CHANGELOG.md
new file mode 100644
index 000000000..c15fd30c7
--- /dev/null
+++ b/server/node_modules/dotenv/CHANGELOG.md
@@ -0,0 +1,431 @@
+# Changelog
+
+All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines.
+
+## [Unreleased](https://github.com/motdotla/dotenv/compare/v16.3.1...master)
+
+## [16.3.1](https://github.com/motdotla/dotenv/compare/v16.3.0...v16.3.1) (2023-06-17)
+
+### Added
+
+- Add missing type definitions for `processEnv` and `DOTENV_KEY` options. [#756](https://github.com/motdotla/dotenv/pull/756)
+
+## [16.3.0](https://github.com/motdotla/dotenv/compare/v16.2.0...v16.3.0) (2023-06-16)
+
+### Added
+
+- Optionally pass `DOTENV_KEY` to options rather than relying on `process.env.DOTENV_KEY`. Defaults to `process.env.DOTENV_KEY` [#754](https://github.com/motdotla/dotenv/pull/754)
+
+## [16.2.0](https://github.com/motdotla/dotenv/compare/v16.1.4...v16.2.0) (2023-06-15)
+
+### Added
+
+- Optionally write to your own target object rather than `process.env`. Defaults to `process.env`. [#753](https://github.com/motdotla/dotenv/pull/753)
+- Add import type URL to types file [#751](https://github.com/motdotla/dotenv/pull/751)
+
+## [16.1.4](https://github.com/motdotla/dotenv/compare/v16.1.3...v16.1.4) (2023-06-04)
+
+### Added
+
+- Added `.github/` to `.npmignore` [#747](https://github.com/motdotla/dotenv/pull/747)
+
+## [16.1.3](https://github.com/motdotla/dotenv/compare/v16.1.2...v16.1.3) (2023-05-31)
+
+### Removed
+
+- Removed `browser` keys for `path`, `os`, and `crypto` in package.json. These were set to false incorrectly as of 16.1. Instead, if using dotenv on the front-end make sure to include polyfills for `path`, `os`, and `crypto`. [node-polyfill-webpack-plugin](https://github.com/Richienb/node-polyfill-webpack-plugin) provides these.
+
+## [16.1.2](https://github.com/motdotla/dotenv/compare/v16.1.1...v16.1.2) (2023-05-31)
+
+### Changed
+
+- Exposed private function `_configDotenv` as `configDotenv`. [#744](https://github.com/motdotla/dotenv/pull/744)
+
+## [16.1.1](https://github.com/motdotla/dotenv/compare/v16.1.0...v16.1.1) (2023-05-30)
+
+### Added
+
+- Added type definition for `decrypt` function
+
+### Changed
+
+- Fixed `{crypto: false}` in `packageJson.browser`
+
+## [16.1.0](https://github.com/motdotla/dotenv/compare/v16.0.3...v16.1.0) (2023-05-30)
+
+### Added
+
+- Add `populate` convenience method [#733](https://github.com/motdotla/dotenv/pull/733)
+- Accept URL as path option [#720](https://github.com/motdotla/dotenv/pull/720)
+- Add dotenv to `npm fund` command
+- Spanish language README [#698](https://github.com/motdotla/dotenv/pull/698)
+- Add `.env.vault` support. 🎉 ([#730](https://github.com/motdotla/dotenv/pull/730))
+
+ℹ️ `.env.vault` extends the `.env` file format standard with a localized encrypted vault file. Package it securely with your production code deploys. It's cloud agnostic so that you can deploy your secrets anywhere – without [risky third-party integrations](https://techcrunch.com/2023/01/05/circleci-breach/). [read more](https://github.com/motdotla/dotenv#-deploying)
+
+### Changed
+
+- Fixed "cannot resolve 'fs'" error on tools like Replit [#693](https://github.com/motdotla/dotenv/pull/693)
+
+## [16.0.3](https://github.com/motdotla/dotenv/compare/v16.0.2...v16.0.3) (2022-09-29)
+
+### Changed
+
+- Added library version to debug logs ([#682](https://github.com/motdotla/dotenv/pull/682))
+
+## [16.0.2](https://github.com/motdotla/dotenv/compare/v16.0.1...v16.0.2) (2022-08-30)
+
+### Added
+
+- Export `env-options.js` and `cli-options.js` in package.json for use with downstream [dotenv-expand](https://github.com/motdotla/dotenv-expand) module
+
+## [16.0.1](https://github.com/motdotla/dotenv/compare/v16.0.0...v16.0.1) (2022-05-10)
+
+### Changed
+
+- Minor README clarifications
+- Development ONLY: updated devDependencies as recommended for development only security risks ([#658](https://github.com/motdotla/dotenv/pull/658))
+
+## [16.0.0](https://github.com/motdotla/dotenv/compare/v15.0.1...v16.0.0) (2022-02-02)
+
+### Added
+
+- _Breaking:_ Backtick support 🎉 ([#615](https://github.com/motdotla/dotenv/pull/615))
+
+If you had values containing the backtick character, please quote those values with either single or double quotes.
+
+## [15.0.1](https://github.com/motdotla/dotenv/compare/v15.0.0...v15.0.1) (2022-02-02)
+
+### Changed
+
+- Properly parse empty single or double quoted values 🐞 ([#614](https://github.com/motdotla/dotenv/pull/614))
+
+## [15.0.0](https://github.com/motdotla/dotenv/compare/v14.3.2...v15.0.0) (2022-01-31)
+
+`v15.0.0` is a major new release with some important breaking changes.
+
+### Added
+
+- _Breaking:_ Multiline parsing support (just works. no need for the flag.)
+
+### Changed
+
+- _Breaking:_ `#` marks the beginning of a comment (UNLESS the value is wrapped in quotes. Please update your `.env` files to wrap in quotes any values containing `#`. For example: `SECRET_HASH="something-with-a-#-hash"`).
+
+..Understandably, (as some teams have noted) this is tedious to do across the entire team. To make it less tedious, we recommend using [dotenv cli](https://github.com/dotenv-org/cli) going forward. It's an optional plugin that will keep your `.env` files in sync between machines, environments, or team members.
+
+### Removed
+
+- _Breaking:_ Remove multiline option (just works out of the box now. no need for the flag.)
+
+## [14.3.2](https://github.com/motdotla/dotenv/compare/v14.3.1...v14.3.2) (2022-01-25)
+
+### Changed
+
+- Preserve backwards compatibility on values containing `#` 🐞 ([#603](https://github.com/motdotla/dotenv/pull/603))
+
+## [14.3.1](https://github.com/motdotla/dotenv/compare/v14.3.0...v14.3.1) (2022-01-25)
+
+### Changed
+
+- Preserve backwards compatibility on exports by re-introducing the prior in-place exports 🐞 ([#606](https://github.com/motdotla/dotenv/pull/606))
+
+## [14.3.0](https://github.com/motdotla/dotenv/compare/v14.2.0...v14.3.0) (2022-01-24)
+
+### Added
+
+- Add `multiline` option 🎉 ([#486](https://github.com/motdotla/dotenv/pull/486))
+
+## [14.2.0](https://github.com/motdotla/dotenv/compare/v14.1.1...v14.2.0) (2022-01-17)
+
+### Added
+
+- Add `dotenv_config_override` cli option
+- Add `DOTENV_CONFIG_OVERRIDE` command line env option
+
+## [14.1.1](https://github.com/motdotla/dotenv/compare/v14.1.0...v14.1.1) (2022-01-17)
+
+### Added
+
+- Add React gotcha to FAQ on README
+
+## [14.1.0](https://github.com/motdotla/dotenv/compare/v14.0.1...v14.1.0) (2022-01-17)
+
+### Added
+
+- Add `override` option 🎉 ([#595](https://github.com/motdotla/dotenv/pull/595))
+
+## [14.0.1](https://github.com/motdotla/dotenv/compare/v14.0.0...v14.0.1) (2022-01-16)
+
+### Added
+
+- Log error on failure to load `.env` file ([#594](https://github.com/motdotla/dotenv/pull/594))
+
+## [14.0.0](https://github.com/motdotla/dotenv/compare/v13.0.1...v14.0.0) (2022-01-16)
+
+### Added
+
+- _Breaking:_ Support inline comments for the parser 🎉 ([#568](https://github.com/motdotla/dotenv/pull/568))
+
+## [13.0.1](https://github.com/motdotla/dotenv/compare/v13.0.0...v13.0.1) (2022-01-16)
+
+### Changed
+
+* Hide comments and newlines from debug output ([#404](https://github.com/motdotla/dotenv/pull/404))
+
+## [13.0.0](https://github.com/motdotla/dotenv/compare/v12.0.4...v13.0.0) (2022-01-16)
+
+### Added
+
+* _Breaking:_ Add type file for `config.js` ([#539](https://github.com/motdotla/dotenv/pull/539))
+
+## [12.0.4](https://github.com/motdotla/dotenv/compare/v12.0.3...v12.0.4) (2022-01-16)
+
+### Changed
+
+* README updates
+* Minor order adjustment to package json format
+
+## [12.0.3](https://github.com/motdotla/dotenv/compare/v12.0.2...v12.0.3) (2022-01-15)
+
+### Changed
+
+* Simplified jsdoc for consistency across editors
+
+## [12.0.2](https://github.com/motdotla/dotenv/compare/v12.0.1...v12.0.2) (2022-01-15)
+
+### Changed
+
+* Improve embedded jsdoc type documentation
+
+## [12.0.1](https://github.com/motdotla/dotenv/compare/v12.0.0...v12.0.1) (2022-01-15)
+
+### Changed
+
+* README updates and clarifications
+
+## [12.0.0](https://github.com/motdotla/dotenv/compare/v11.0.0...v12.0.0) (2022-01-15)
+
+### Removed
+
+- _Breaking:_ drop support for Flow static type checker ([#584](https://github.com/motdotla/dotenv/pull/584))
+
+### Changed
+
+- Move types/index.d.ts to lib/main.d.ts ([#585](https://github.com/motdotla/dotenv/pull/585))
+- Typescript cleanup ([#587](https://github.com/motdotla/dotenv/pull/587))
+- Explicit typescript inclusion in package.json ([#566](https://github.com/motdotla/dotenv/pull/566))
+
+## [11.0.0](https://github.com/motdotla/dotenv/compare/v10.0.0...v11.0.0) (2022-01-11)
+
+### Changed
+
+- _Breaking:_ drop support for Node v10 ([#558](https://github.com/motdotla/dotenv/pull/558))
+- Patch debug option ([#550](https://github.com/motdotla/dotenv/pull/550))
+
+## [10.0.0](https://github.com/motdotla/dotenv/compare/v9.0.2...v10.0.0) (2021-05-20)
+
+### Added
+
+- Add generic support to parse function
+- Allow for import "dotenv/config.js"
+- Add support to resolve home directory in path via ~
+
+## [9.0.2](https://github.com/motdotla/dotenv/compare/v9.0.1...v9.0.2) (2021-05-10)
+
+### Changed
+
+- Support windows newlines with debug mode
+
+## [9.0.1](https://github.com/motdotla/dotenv/compare/v9.0.0...v9.0.1) (2021-05-08)
+
+### Changed
+
+- Updates to README
+
+## [9.0.0](https://github.com/motdotla/dotenv/compare/v8.6.0...v9.0.0) (2021-05-05)
+
+### Changed
+
+- _Breaking:_ drop support for Node v8
+
+## [8.6.0](https://github.com/motdotla/dotenv/compare/v8.5.1...v8.6.0) (2021-05-05)
+
+### Added
+
+- define package.json in exports
+
+## [8.5.1](https://github.com/motdotla/dotenv/compare/v8.5.0...v8.5.1) (2021-05-05)
+
+### Changed
+
+- updated dev dependencies via npm audit
+
+## [8.5.0](https://github.com/motdotla/dotenv/compare/v8.4.0...v8.5.0) (2021-05-05)
+
+### Added
+
+- allow for `import "dotenv/config"`
+
+## [8.4.0](https://github.com/motdotla/dotenv/compare/v8.3.0...v8.4.0) (2021-05-05)
+
+### Changed
+
+- point to exact types file to work with VS Code
+
+## [8.3.0](https://github.com/motdotla/dotenv/compare/v8.2.0...v8.3.0) (2021-05-05)
+
+### Changed
+
+- _Breaking:_ drop support for Node v8 (mistake to be released as minor bump. later bumped to 9.0.0. see above.)
+
+## [8.2.0](https://github.com/motdotla/dotenv/compare/v8.1.0...v8.2.0) (2019-10-16)
+
+### Added
+
+- TypeScript types
+
+## [8.1.0](https://github.com/motdotla/dotenv/compare/v8.0.0...v8.1.0) (2019-08-18)
+
+### Changed
+
+- _Breaking:_ drop support for Node v6 ([#392](https://github.com/motdotla/dotenv/issues/392))
+
+# [8.0.0](https://github.com/motdotla/dotenv/compare/v7.0.0...v8.0.0) (2019-05-02)
+
+### Changed
+
+- _Breaking:_ drop support for Node v6 ([#302](https://github.com/motdotla/dotenv/issues/392))
+
+## [7.0.0] - 2019-03-12
+
+### Fixed
+
+- Fix removing unbalanced quotes ([#376](https://github.com/motdotla/dotenv/pull/376))
+
+### Removed
+
+- Removed `load` alias for `config` for consistency throughout code and documentation.
+
+## [6.2.0] - 2018-12-03
+
+### Added
+
+- Support preload configuration via environment variables ([#351](https://github.com/motdotla/dotenv/issues/351))
+
+## [6.1.0] - 2018-10-08
+
+### Added
+
+- `debug` option for `config` and `parse` methods will turn on logging
+
+## [6.0.0] - 2018-06-02
+
+### Changed
+
+- _Breaking:_ drop support for Node v4 ([#304](https://github.com/motdotla/dotenv/pull/304))
+
+## [5.0.0] - 2018-01-29
+
+### Added
+
+- Testing against Node v8 and v9
+- Documentation on trim behavior of values
+- Documentation on how to use with `import`
+
+### Changed
+
+- _Breaking_: default `path` is now `path.resolve(process.cwd(), '.env')`
+- _Breaking_: does not write over keys already in `process.env` if the key has a falsy value
+- using `const` and `let` instead of `var`
+
+### Removed
+
+- Testing against Node v7
+
+## [4.0.0] - 2016-12-23
+
+### Changed
+
+- Return Object with parsed content or error instead of false ([#165](https://github.com/motdotla/dotenv/pull/165)).
+
+### Removed
+
+- `verbose` option removed in favor of returning result.
+
+## [3.0.0] - 2016-12-20
+
+### Added
+
+- `verbose` option will log any error messages. Off by default.
+- parses email addresses correctly
+- allow importing config method directly in ES6
+
+### Changed
+
+- Suppress error messages by default ([#154](https://github.com/motdotla/dotenv/pull/154))
+- Ignoring more files for NPM to make package download smaller
+
+### Fixed
+
+- False positive test due to case-sensitive variable ([#124](https://github.com/motdotla/dotenv/pull/124))
+
+### Removed
+
+- `silent` option removed in favor of `verbose`
+
+## [2.0.0] - 2016-01-20
+
+### Added
+
+- CHANGELOG to ["make it easier for users and contributors to see precisely what notable changes have been made between each release"](http://keepachangelog.com/). Linked to from README
+- LICENSE to be more explicit about what was defined in `package.json`. Linked to from README
+- Testing nodejs v4 on travis-ci
+- added examples of how to use dotenv in different ways
+- return parsed object on success rather than boolean true
+
+### Changed
+
+- README has shorter description not referencing ruby gem since we don't have or want feature parity
+
+### Removed
+
+- Variable expansion and escaping so environment variables are encouraged to be fully orthogonal
+
+## [1.2.0] - 2015-06-20
+
+### Added
+
+- Preload hook to require dotenv without including it in your code
+
+### Changed
+
+- clarified license to be "BSD-2-Clause" in `package.json`
+
+### Fixed
+
+- retain spaces in string vars
+
+## [1.1.0] - 2015-03-31
+
+### Added
+
+- Silent option to silence `console.log` when `.env` missing
+
+## [1.0.0] - 2015-03-13
+
+### Removed
+
+- support for multiple `.env` files. should always use one `.env` file for the current environment
+
+[7.0.0]: https://github.com/motdotla/dotenv/compare/v6.2.0...v7.0.0
+[6.2.0]: https://github.com/motdotla/dotenv/compare/v6.1.0...v6.2.0
+[6.1.0]: https://github.com/motdotla/dotenv/compare/v6.0.0...v6.1.0
+[6.0.0]: https://github.com/motdotla/dotenv/compare/v5.0.0...v6.0.0
+[5.0.0]: https://github.com/motdotla/dotenv/compare/v4.0.0...v5.0.0
+[4.0.0]: https://github.com/motdotla/dotenv/compare/v3.0.0...v4.0.0
+[3.0.0]: https://github.com/motdotla/dotenv/compare/v2.0.0...v3.0.0
+[2.0.0]: https://github.com/motdotla/dotenv/compare/v1.2.0...v2.0.0
+[1.2.0]: https://github.com/motdotla/dotenv/compare/v1.1.0...v1.2.0
+[1.1.0]: https://github.com/motdotla/dotenv/compare/v1.0.0...v1.1.0
+[1.0.0]: https://github.com/motdotla/dotenv/compare/v0.4.0...v1.0.0
diff --git a/server/node_modules/dotenv/LICENSE b/server/node_modules/dotenv/LICENSE
new file mode 100644
index 000000000..c430ad8bd
--- /dev/null
+++ b/server/node_modules/dotenv/LICENSE
@@ -0,0 +1,23 @@
+Copyright (c) 2015, Scott Motte
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this
+ list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice,
+ this list of conditions and the following disclaimer in the documentation
+ and/or other materials provided with the distribution.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
+OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/server/node_modules/dotenv/README-es.md b/server/node_modules/dotenv/README-es.md
new file mode 100644
index 000000000..ad8be92ba
--- /dev/null
+++ b/server/node_modules/dotenv/README-es.md
@@ -0,0 +1,442 @@
+
+
+
+
+ Dotenv es apoyado por la comunidad.
+
+
+
Gracias espaciales a:
+
+
+
+
+
+
+ Warp es una rápida e impresionante terminal basada en Rust, reinventado para funcionar como una aplicación moderna.
+
+ Haga más en la CLI con edición de texto real, resultado básado en bloques, y busqueda de comandos de IA.
+
+
+
+
+
+
+
+ Retool ayuda a los desarrolladores a crear software interno personalizado, como aplicaciones CRUD y paneles de administración, realmente rápido.
+
+ Construya Interfaces de Usuario de forma visual con componentes flexibles, conéctese a cualquier fuente de datos, y escriba lógica de negocio en JavaScript.
+
+
+
+
+
+
+
+ Su Apliación, Lista para la Empresa.
+
+ Agrega Inicio de Sesión Único, Autenticación Multi-Factor, y mucho más, en minutos en lugar de meses.
+
+
+
+
+
+
+
+
+
+
+# dotenv [](https://www.npmjs.com/package/dotenv)
+
+
+
+Dotenv es un módulo de dependencia cero que carga las variables de entorno desde un archivo `.env` en [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). El almacenamiento de la configuración del entorno separado del código está basado en la metodología [The Twelve-Factor App](http://12factor.net/config).
+
+[](https://github.com/feross/standard)
+[](LICENSE)
+
+## Instalación
+
+```bash
+# instalación local (recomendado)
+npm install dotenv --save
+```
+
+O installación con yarn? `yarn add dotenv`
+
+## Uso
+
+Cree un archivo `.env` en la raíz de su proyecto:
+
+```dosini
+S3_BUCKET="YOURS3BUCKET"
+SECRET_KEY="YOURSECRETKEYGOESHERE"
+```
+
+Tan prónto como sea posible en su aplicación, importe y configure dotenv:
+
+```javascript
+require('dotenv').config()
+console.log(process.env) // elimine esto después que haya confirmado que esta funcionando
+```
+
+.. o usa ES6?
+
+```javascript
+import * as dotenv from 'dotenv' // vea en https://github.com/motdotla/dotenv#como-uso-dotenv-con-import
+// REVISAR LINK DE REFERENCIA DE IMPORTACIÓN
+dotenv.config()
+import express from 'express'
+```
+
+Eso es todo. `process.env` ahora tiene las claves y los valores que definiste en tu archivo `.env`:
+
+```javascript
+require('dotenv').config()
+
+...
+
+s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {})
+```
+
+### Valores multilínea
+
+Si necesita variables de varias líneas, por ejemplo, claves privadas, ahora se admiten en la versión (`>= v15.0.0`) con saltos de línea:
+
+```dosini
+PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----
+...
+Kh9NV...
+...
+-----END RSA PRIVATE KEY-----"
+```
+
+Alternativamente, puede usar comillas dobles y usar el carácter `\n`:
+
+```dosini
+PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END RSA PRIVATE KEY-----\n"
+```
+
+### Comentarios
+
+Los comentarios pueden ser agregados en tu archivo o en la misma línea:
+
+```dosini
+# This is a comment
+SECRET_KEY=YOURSECRETKEYGOESHERE # comment
+SECRET_HASH="something-with-a-#-hash"
+```
+
+Los comentarios comienzan donde existe un `#`, entonces, si su valor contiene un `#`, enciérrelo entre comillas. Este es un cambio importante desde la versión `>= v15.0.0` en adelante.
+
+### Análisis
+
+El motor que analiza el contenido de su archivo que contiene variables de entorno está disponible para su uso. Este Acepta una Cadena o un Búfer y devolverá un Objeto con las claves y los valores analizados.
+
+```javascript
+const dotenv = require('dotenv')
+const buf = Buffer.from('BASICO=basico')
+const config = dotenv.parse(buf) // devolverá un objeto
+console.log(typeof config, config) // objeto { BASICO : 'basico' }
+```
+
+### Precarga
+
+Puede usar el `--require` (`-r`) [opción de línea de comando](https://nodejs.org/api/cli.html#-r---require-module) para precargar dotenv. Al hacer esto, no necesita requerir ni cargar dotnev en el código de su aplicación.
+
+```bash
+$ node -r dotenv/config tu_script.js
+```
+
+Las opciones de configuración a continuación se admiten como argumentos de línea de comandos en el formato `dotenv_config_=value`
+
+```bash
+$ node -r dotenv/config tu_script.js dotenv_config_path=/custom/path/to/.env dotenv_config_debug=true
+```
+
+Además, puede usar variables de entorno para establecer opciones de configuración. Los argumentos de línea de comandos precederán a estos.
+
+```bash
+$ DOTENV_CONFIG_ =value node -r dotenv/config tu_script.js
+```
+
+```bash
+$ DOTENV_CONFIG_ENCODING=latin1 DOTENV_CONFIG_DEBUG=true node -r dotenv/config tu_script.js dotenv_config_path=/custom/path/to/.env
+```
+
+### Expansión Variable
+
+Necesitaras agregar el valor de otro variable en una de sus variables? Usa [dotenv-expand](https://github.com/motdotla/dotenv-expand).
+
+### Sincronizando
+
+Necesitas mentener sincronizados los archivos `.env` entre maquinas, entornos, o miembros del equipo? Usa
+[dotenv-vault](https://github.com/dotenv-org/dotenv-vault).
+
+## Ejemplos
+
+Vea [ejemplos](https://github.com/dotenv-org/examples) sobre el uso de dotenv con varios frameworks, lenguajes y configuraciones.
+
+* [nodejs](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs)
+* [nodejs (depurar en)](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs-debug)
+* [nodejs (anular en)](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs-override)
+* [esm](https://github.com/dotenv-org/examples/tree/master/dotenv-esm)
+* [esm (precarga)](https://github.com/dotenv-org/examples/tree/master/dotenv-esm-preload)
+* [typescript](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript)
+* [typescript parse](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript-parse)
+* [typescript config](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript-config)
+* [webpack](https://github.com/dotenv-org/examples/tree/master/dotenv-webpack)
+* [webpack (plugin)](https://github.com/dotenv-org/examples/tree/master/dotenv-webpack2)
+* [react](https://github.com/dotenv-org/examples/tree/master/dotenv-react)
+* [react (typescript)](https://github.com/dotenv-org/examples/tree/master/dotenv-react-typescript)
+* [express](https://github.com/dotenv-org/examples/tree/master/dotenv-express)
+* [nestjs](https://github.com/dotenv-org/examples/tree/master/dotenv-nestjs)
+
+## Documentación
+
+Dotenv expone dos funciones:
+
+* `configuración`
+* `analizar`
+
+### Configuración
+
+`Configuración` leerá su archivo `.env`, analizará el contenido, lo asignará a [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env),
+y devolverá un Objeto con una clave `parsed` que contiene el contenido cargado o una clave `error` si falla.
+
+```js
+const result = dotenv.config()
+
+if (result.error) {
+ throw result.error
+}
+
+console.log(result.parsed)
+```
+
+Adicionalmente, puede pasar opciones a `configuracion`.
+
+#### Opciones
+
+##### Ruta
+
+Por defecto: `path.resolve(process.cwd(), '.env')`
+
+Especifique una ruta personalizada si el archivo que contiene las variables de entorno se encuentra localizado en otro lugar.
+
+```js
+require('dotenv').config({ path: '/personalizado/ruta/a/.env' })
+```
+
+##### Codificación
+
+Por defecto: `utf8`
+
+Especifique la codificación del archivo que contiene las variables de entorno.
+
+```js
+require('dotenv').config({ encoding: 'latin1' })
+```
+
+##### Depurar
+
+Por defecto: `false`
+
+Active el registro de ayuda para depurar por qué ciertas claves o valores no se inician como lo esperabas.
+
+```js
+require('dotenv').config({ debug: process.env.DEBUG })
+```
+
+##### Anular
+
+Por defecto: `false`
+
+Anule cualquier variable de entorno que ya se haya configurada en su maquina con los valores de su archivo .env.
+
+```js
+require('dotenv').config({ override: true })
+```
+
+### Analizar
+
+El motor que analiza el contenido del archivo que contiene las variables de entorno está disponible para su uso. Acepta una Cadena o un Búfer y retornará un objecto con los valores analizados.
+
+```js
+const dotenv = require('dotenv')
+const buf = Buffer.from('BASICO=basico')
+const config = dotenv.parse(buf) // devolverá un objeto
+console.log(typeof config, config) // objeto { BASICO : 'basico' }
+```
+
+#### Opciones
+
+##### Depurar
+
+Por defecto: `false`
+
+Active el registro de ayuda para depurar por qué ciertas claves o valores no se inician como lo esperabas.
+
+```js
+const dotenv = require('dotenv')
+const buf = Buffer.from('hola mundo')
+const opt = { debug: true }
+const config = dotenv.parse(buf, opt)
+// espere por un mensaje de depuración porque el búfer no esta listo KEY=VAL
+```
+
+## FAQ
+
+### ¿Por qué el archivo `.env` no carga mis variables de entorno correctamente?
+
+Lo más probable es que su archivo `.env` no esté en el lugar correcto. [Vea este stack overflow](https://stackoverflow.com/questions/42335016/dotenv-file-is-not-loading-environment-variables).
+
+Active el modo de depuración y vuelva a intentarlo...
+
+```js
+require('dotenv').config({ debug: true })
+```
+
+Recibirá un error apropiado en su consola.
+
+### ¿Debo confirmar mi archivo `.env`?
+
+No. Recomendamos **enfáticamente** no enviar su archivo `.env` a la versión de control. Solo debe incluir los valores especificos del entorno, como la base de datos, contraseñas o claves API.
+
+### ¿Debería tener multiples archivos `.env`?
+
+No. Recomendamos **enfáticamente** no tener un archivo `.env` "principal" y un archivo `.env` de "entorno" como `.env.test`. Su configuración debe variar entre implementaciones y no debe compartir valores entre entornos.
+
+> En una Aplicación de Doce Factores, las variables de entorno son controles diferenciados, cada uno totalmente independiente a otras variables de entorno. Nunca se agrupan como "entornos", sino que se gestionan de manera independiente para cada despliegue. Este es un modelo que se escala sin problemas a medida que la aplicación se expande de forma natural en más despliegues a lo largo de su vida.
+>
+> – [La Apliación de los Doce Factores](https://12factor.net/es/)
+
+### ¿Qué reglas sigue el motor de análisis?
+
+El motor de análisis actualmente admite las siguientes reglas:
+
+- `BASICO=basico` se convierte en `{BASICO: 'basico'}`
+- las líneas vacías se saltan
+- las líneas que comienzan con `#` se tratan como comentarios
+- `#` marca el comienzo de un comentario (a menos que el valor esté entre comillas)
+- valores vacíos se convierten en cadenas vacías (`VACIO=` se convierte en `{VACIO: ''}`)
+- las comillas internas se mantienen (piensa en JSON) (`JSON={"foo": "bar"}` se convierte en `{JSON:"{\"foo\": \"bar\"}"`)
+- los espacios en blanco se eliminan de ambos extremos de los valores no citanos (aprende más en [`trim`](https://developer.mozilla.org/es/docs/Web/JavaScript/Reference/Global_Objects/String/Trim)) (`FOO= algo ` se convierte en `{FOO: 'algo'}`)
+- los valores entre comillas simples y dobles se escapan (`CITA_SIMPLE='citado'` se convierte en `{CITA_SIMPLE: "citado"}`)
+- los valores entre comillas simples y dobles mantienen los espacios en blanco en ambos extremos (`FOO=" algo "` se convierte en `{FOO: ' algo '}`)
+- los valores entre comillas dobles expanden nuevas líneas (`MULTILINEA="nueva\nlínea"` se convierte en
+
+```
+{MULTILINEA: 'nueva
+línea'}
+```
+
+- se admite la comilla simple invertida (`` SIGNO_ACENTO=`Esto tiene comillas 'simples' y "dobles" en su interior.` ``)
+
+### ¿Qué sucede con las variables de entorno que ya estaban configuradas?
+
+Por defecto, nunca modificaremos ninguna variable de entorno que ya haya sido establecida. En particular, si hay una variable en su archivo `.env` que colisiona con una que ya existe en su entorno, entonces esa variable se omitirá.
+
+Si por el contrario, quieres anular `process.env` utiliza la opción `override`.
+
+```javascript
+require('dotenv').config({ override: true })
+```
+
+### ¿Por qué mis variables de entorno no aparecen para React?
+
+Su código React se ejecuta en Webpack, donde el módulo `fs` o incluso el propio `process` global no son accesibles fuera-de-la-caja. El módulo `process.env` sólo puede ser inyectado a través de la configuración de Webpack.
+
+Si estás usando [`react-scripts`](https://www.npmjs.com/package/react-scripts), el cual se distribuye a través de [`create-react-app`](https://create-react-app.dev/), tiene dotenv incorporado pero con una singularidad. Escriba sus variables de entorno con `REACT_APP_`. Vea [este stack overflow](https://stackoverflow.com/questions/42182577/is-it-possible-to-use-dotenv-in-a-react-project) para más detalles.
+
+Si estás utilizando otros frameworks (por ejemplo, Next.js, Gatsby...), debes consultar su documentación para saber cómo injectar variables de entorno en el cliente.
+
+### ¿Puedo personalizar/escribir plugins para dotenv?
+
+Sí! `dotenv.config()` devuelve un objeto que representa el archivo `.env` analizado. Esto te da todo lo que necesitas para poder establecer valores en `process.env`. Por ejemplo:
+
+```js
+const dotenv = require('dotenv')
+const variableExpansion = require('dotenv-expand')
+const miEnv = dotenv.config()
+variableExpansion(miEnv)
+```
+
+### Cómo uso dotnev con `import`?
+
+Simplemente..
+
+```javascript
+// index.mjs (ESM)
+import * as dotenv from 'dotenv' // vea https://github.com/motdotla/dotenv#como-uso-dotenv-con-import
+dotenv.config()
+import express from 'express'
+```
+
+Un poco de historia...
+
+> Cuando se ejecuta un módulo que contiene una sentencia `import`, los módulos que importa serán cargados primero, y luego se ejecuta cada bloque del módulo en un recorrido en profundidad del gráfico de dependencias, evitando los ciclos al saltarse todo lo que ya se ha ejecutado.
+>
+> – [ES6 en Profundidad: Módulos](https://hacks.mozilla.org/2015/08/es6-in-depth-modules/)
+
+¿Qué significa esto en lenguaje sencillo? Significa que se podrías pensar que lo siguiente funcionaría pero no lo hará.
+
+```js
+// notificarError.mjs
+import { Cliente } from 'mejor-servicio-para-notificar-error'
+
+export default new Client(process.env.CLAVE_API)
+
+// index.mjs
+import dotenv from 'dotenv'
+dotenv.config()
+
+import notificarError from './notificarError.mjs'
+notificarError.report(new Error('ejemplo documentado'))
+```
+
+`process.env.CLAVE_API` será vacio.
+
+En su lugar, el código anterior debe ser escrito como...
+
+```js
+// notificarError.mjs
+import { Cliente } from 'mejor-servicio-para-notificar-errores'
+
+export default new Client(process.env.CLAVE_API)
+
+// index.mjs
+import * as dotenv from 'dotenv'
+dotenv.config()
+
+import notificarError from './notificarError.mjs'
+notificarError.report(new Error('ejemplo documentado'))
+```
+
+¿Esto tiene algo de sentido? Esto es poco poco intuitivo, pero es como funciona la importación de módulos en ES6. Aquí hay un ejemplo [ejemplo práctico de esta trampa](https://github.com/dotenv-org/examples/tree/master/dotenv-es6-import-pitfall).
+
+Existen dos arternativas a este planteamiento:
+
+1. Precarga dotenv: `node --require dotenv/config index.js` (_Nota: no es necesario usar `import` dotenv con este método_)
+2. Cree un archivo separado que ejecutará `config` primero como se describe en [este comentario #133](https://github.com/motdotla/dotenv/issues/133#issuecomment-255298822)
+
+### ¿Qué pasa con la expansión de variable?
+
+Prueba [dotenv-expand](https://github.com/motdotla/dotenv-expand)
+
+### ¿Qué pasa con la sincronización y la seguridad de los archivos .env?
+
+Vea [dotenv-vault](https://github.com/dotenv-org/dotenv-vault)
+
+## Guía de contribución
+
+Vea [CONTRIBUTING.md](CONTRIBUTING.md)
+
+## REGISTRO DE CAMBIOS
+
+Vea [CHANGELOG.md](CHANGELOG.md)
+
+## ¿Quiénes utilizan dotenv?
+
+[Estos módulos npm dependen de él.](https://www.npmjs.com/browse/depended/dotenv)
+
+Los proyectos que lo amplían suelen utilizar la [palabra clave "dotenv" en npm](https://www.npmjs.com/search?q=keywords:dotenv).
diff --git a/server/node_modules/dotenv/README.md b/server/node_modules/dotenv/README.md
new file mode 100644
index 000000000..a419157f9
--- /dev/null
+++ b/server/node_modules/dotenv/README.md
@@ -0,0 +1,633 @@
+
+
+
+
+ Dotenv is supported by the community.
+
+
+
Special thanks to:
+
+
+
+
+
+
+ Warp is a blazingly fast, Rust-based terminal reimagined to work like a modern app.
+
+ Get more done in the CLI with real text editing, block-based output, and AI command search.
+
+
+
+
+
+
+
+ Retool helps developers build custom internal software, like CRUD apps and admin panels, really fast.
+
+ Build UIs visually with flexible components, connect to any data source, and write business logic in JavaScript.
+
+
+
+
+
+
+
+ Your App, Enterprise Ready.
+
+ Add Single Sign-On, Multi-Factor Auth, and more, in minutes instead of months.
+
+
+
+
+
+# dotenv [](https://www.npmjs.com/package/dotenv)
+
+
+
+Dotenv is a zero-dependency module that loads environment variables from a `.env` file into [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). Storing configuration in the environment separate from code is based on [The Twelve-Factor App](http://12factor.net/config) methodology.
+
+[](https://github.com/feross/standard)
+[](LICENSE)
+[](https://www.dotenv.org/r/github.com/dotenv-org/dotenv-vault?r=1)
+
+* [🌱 Install](#-install)
+* [🏗️ Usage (.env)](#%EF%B8%8F-usage)
+* [🚀 Deploying (.env.vault) 🆕](#-deploying)
+* [🌴 Multiple Environments 🆕](#-manage-multiple-environments)
+* [📚 Examples](#-examples)
+* [📖 Docs](#-documentation)
+* [❓ FAQ](#-faq)
+* [⏱️ Changelog](./CHANGELOG.md)
+
+## 🌱 Install
+
+```bash
+# install locally (recommended)
+npm install dotenv --save
+```
+
+Or installing with yarn? `yarn add dotenv`
+
+## 🏗️ Usage
+
+
+
+
+
+
+
+
+Create a `.env` file in the root of your project:
+
+```dosini
+S3_BUCKET="YOURS3BUCKET"
+SECRET_KEY="YOURSECRETKEYGOESHERE"
+```
+
+As early as possible in your application, import and configure dotenv:
+
+```javascript
+require('dotenv').config()
+console.log(process.env) // remove this after you've confirmed it is working
+```
+
+.. [or using ES6?](#how-do-i-use-dotenv-with-import)
+
+```javascript
+import 'dotenv/config'
+```
+
+That's it. `process.env` now has the keys and values you defined in your `.env` file:
+
+```javascript
+require('dotenv').config()
+
+...
+
+s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {})
+```
+
+### Multiline values
+
+If you need multiline variables, for example private keys, those are now supported (`>= v15.0.0`) with line breaks:
+
+```dosini
+PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----
+...
+Kh9NV...
+...
+-----END RSA PRIVATE KEY-----"
+```
+
+Alternatively, you can double quote strings and use the `\n` character:
+
+```dosini
+PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END RSA PRIVATE KEY-----\n"
+```
+
+### Comments
+
+Comments may be added to your file on their own line or inline:
+
+```dosini
+# This is a comment
+SECRET_KEY=YOURSECRETKEYGOESHERE # comment
+SECRET_HASH="something-with-a-#-hash"
+```
+
+Comments begin where a `#` exists, so if your value contains a `#` please wrap it in quotes. This is a breaking change from `>= v15.0.0` and on.
+
+### Parsing
+
+The engine which parses the contents of your file containing environment variables is available to use. It accepts a String or Buffer and will return an Object with the parsed keys and values.
+
+```javascript
+const dotenv = require('dotenv')
+const buf = Buffer.from('BASIC=basic')
+const config = dotenv.parse(buf) // will return an object
+console.log(typeof config, config) // object { BASIC : 'basic' }
+```
+
+### Preload
+
+You can use the `--require` (`-r`) [command line option](https://nodejs.org/api/cli.html#-r---require-module) to preload dotenv. By doing this, you do not need to require and load dotenv in your application code.
+
+```bash
+$ node -r dotenv/config your_script.js
+```
+
+The configuration options below are supported as command line arguments in the format `dotenv_config_ =value`
+
+```bash
+$ node -r dotenv/config your_script.js dotenv_config_path=/custom/path/to/.env dotenv_config_debug=true
+```
+
+Additionally, you can use environment variables to set configuration options. Command line arguments will precede these.
+
+```bash
+$ DOTENV_CONFIG_ =value node -r dotenv/config your_script.js
+```
+
+```bash
+$ DOTENV_CONFIG_ENCODING=latin1 DOTENV_CONFIG_DEBUG=true node -r dotenv/config your_script.js dotenv_config_path=/custom/path/to/.env
+```
+
+### Variable Expansion
+
+You need to add the value of another variable in one of your variables? Use [dotenv-expand](https://github.com/motdotla/dotenv-expand).
+
+### Syncing
+
+You need to keep `.env` files in sync between machines, environments, or team members? Use [dotenv-vault](https://github.com/dotenv-org/dotenv-vault).
+
+### Deploying
+
+You need to deploy your secrets in a cloud-agnostic manner? Use a `.env.vault` file.
+
+### Multiple Environments
+
+You need to manage your secrets across different environments and apply them as needed? Use a `.env.vault` file with a `DOTENV_KEY`.
+
+## 🚀 Deploying
+
+*Note: Requires dotenv >= 16.1.0*
+
+Encrypt your `.env.vault` file.
+
+```bash
+$ npx dotenv-vault build
+```
+
+Fetch your production `DOTENV_KEY`.
+
+```bash
+$ npx dotenv-vault keys production
+```
+
+Set `DOTENV_KEY` on your server.
+
+```bash
+# heroku example
+heroku config:set DOTENV_KEY=dotenv://:key_1234…@dotenv.org/vault/.env.vault?environment=production
+```
+
+That's it! On deploy, your `.env.vault` file will be decrypted and its secrets injected as environment variables – just in time.
+
+*ℹ️ A note from [Mot](https://github.com/motdotla): Until recently, we did not have an opinion on how and where to store your secrets in production. We now strongly recommend generating a `.env.vault` file. It's the best way to prevent your secrets from being scattered across multiple servers and cloud providers – protecting you from breaches like the [CircleCI breach](https://techcrunch.com/2023/01/05/circleci-breach/). Also it unlocks interoperability WITHOUT native third-party integrations. Third-party integrations are [increasingly risky](https://coderpad.io/blog/development/heroku-github-breach/) to our industry. They may be the 'du jour' of today, but we imagine a better future.*
+
+Learn more at dotenv-vault: Deploying
+
+## 🌴 Manage Multiple Environments
+
+Edit your production environment variables.
+
+```bash
+$ npx dotenv-vault open production
+```
+
+Regenerate your `.env.vault` file.
+
+```bash
+$ npx dotenv-vault build
+```
+
+*ℹ️ 🔐 Vault Managed vs 💻 Locally Managed: The above example, for brevity's sake, used the 🔐 Vault Managed solution to manage your `.env.vault` file. You can instead use the 💻 Locally Managed solution. [Read more here](https://github.com/dotenv-org/dotenv-vault#how-do-i-use--locally-managed-dotenv-vault). Our vision is that other platforms and orchestration tools adopt the `.env.vault` standard as they did the `.env` standard. We don't expect to be the only ones providing tooling to manage and generate `.env.vault` files.*
+
+Learn more at dotenv-vault: Manage Multiple Environments
+
+## 📚 Examples
+
+See [examples](https://github.com/dotenv-org/examples) of using dotenv with various frameworks, languages, and configurations.
+
+* [nodejs](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs)
+* [nodejs (debug on)](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs-debug)
+* [nodejs (override on)](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs-override)
+* [nodejs (processEnv override)](https://github.com/dotenv-org/examples/tree/master/dotenv-custom-target)
+* [nodejs (DOTENV_KEY override)](https://github.com/dotenv-org/examples/tree/master/dotenv-vault-custom-target)
+* [esm](https://github.com/dotenv-org/examples/tree/master/dotenv-esm)
+* [esm (preload)](https://github.com/dotenv-org/examples/tree/master/dotenv-esm-preload)
+* [typescript](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript)
+* [typescript parse](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript-parse)
+* [typescript config](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript-config)
+* [webpack](https://github.com/dotenv-org/examples/tree/master/dotenv-webpack)
+* [webpack (plugin)](https://github.com/dotenv-org/examples/tree/master/dotenv-webpack2)
+* [react](https://github.com/dotenv-org/examples/tree/master/dotenv-react)
+* [react (typescript)](https://github.com/dotenv-org/examples/tree/master/dotenv-react-typescript)
+* [express](https://github.com/dotenv-org/examples/tree/master/dotenv-express)
+* [nestjs](https://github.com/dotenv-org/examples/tree/master/dotenv-nestjs)
+* [fastify](https://github.com/dotenv-org/examples/tree/master/dotenv-fastify)
+
+## 📖 Documentation
+
+Dotenv exposes four functions:
+
+* `config`
+* `parse`
+* `populate`
+* `decrypt`
+
+### Config
+
+`config` will read your `.env` file, parse the contents, assign it to
+[`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env),
+and return an Object with a `parsed` key containing the loaded content or an `error` key if it failed.
+
+```js
+const result = dotenv.config()
+
+if (result.error) {
+ throw result.error
+}
+
+console.log(result.parsed)
+```
+
+You can additionally, pass options to `config`.
+
+#### Options
+
+##### path
+
+Default: `path.resolve(process.cwd(), '.env')`
+
+Specify a custom path if your file containing environment variables is located elsewhere.
+
+```js
+require('dotenv').config({ path: '/custom/path/to/.env' })
+```
+
+##### encoding
+
+Default: `utf8`
+
+Specify the encoding of your file containing environment variables.
+
+```js
+require('dotenv').config({ encoding: 'latin1' })
+```
+
+##### debug
+
+Default: `false`
+
+Turn on logging to help debug why certain keys or values are not being set as you expect.
+
+```js
+require('dotenv').config({ debug: process.env.DEBUG })
+```
+
+##### override
+
+Default: `false`
+
+Override any environment variables that have already been set on your machine with values from your .env file.
+
+```js
+require('dotenv').config({ override: true })
+```
+
+##### processEnv
+
+Default: `process.env`
+
+Specify an object to write your secrets to. Defaults to `process.env` environment variables.
+
+```js
+const myObject = {}
+require('dotenv').config({ processEnv: myObject })
+
+console.log(myObject) // values from .env or .env.vault live here now.
+console.log(process.env) // this was not changed or written to
+```
+
+##### DOTENV_KEY
+
+Default: `process.env.DOTENV_KEY`
+
+Pass the `DOTENV_KEY` directly to config options. Defaults to looking for `process.env.DOTENV_KEY` environment variable. Note this only applies to decrypting `.env.vault` files. If passed as null or undefined, or not passed at all, dotenv falls back to its traditional job of parsing a `.env` file.
+
+```js
+require('dotenv').config({ DOTENV_KEY: 'dotenv://:key_1234…@dotenv.org/vault/.env.vault?environment=production' })
+```
+
+### Parse
+
+The engine which parses the contents of your file containing environment
+variables is available to use. It accepts a String or Buffer and will return
+an Object with the parsed keys and values.
+
+```js
+const dotenv = require('dotenv')
+const buf = Buffer.from('BASIC=basic')
+const config = dotenv.parse(buf) // will return an object
+console.log(typeof config, config) // object { BASIC : 'basic' }
+```
+
+#### Options
+
+##### debug
+
+Default: `false`
+
+Turn on logging to help debug why certain keys or values are not being set as you expect.
+
+```js
+const dotenv = require('dotenv')
+const buf = Buffer.from('hello world')
+const opt = { debug: true }
+const config = dotenv.parse(buf, opt)
+// expect a debug message because the buffer is not in KEY=VAL form
+```
+
+### Populate
+
+The engine which populates the contents of your .env file to `process.env` is available for use. It accepts a target, a source, and options. This is useful for power users who want to supply their own objects.
+
+For example, customizing the source:
+
+```js
+const dotenv = require('dotenv')
+const parsed = { HELLO: 'world' }
+
+dotenv.populate(process.env, parsed)
+
+console.log(process.env.HELLO) // world
+```
+
+For example, customizing the source AND target:
+
+```js
+const dotenv = require('dotenv')
+const parsed = { HELLO: 'universe' }
+const target = { HELLO: 'world' } // empty object
+
+dotenv.populate(target, parsed, { override: true, debug: true })
+
+console.log(target) // { HELLO: 'universe' }
+```
+
+#### options
+
+##### Debug
+
+Default: `false`
+
+Turn on logging to help debug why certain keys or values are not being populated as you expect.
+
+##### override
+
+Default: `false`
+
+Override any environment variables that have already been set.
+
+### Decrypt
+
+The engine which decrypts the ciphertext contents of your .env.vault file is available for use. It accepts a ciphertext and a decryption key. It uses AES-256-GCM encryption.
+
+For example, decrypting a simple ciphertext:
+
+```js
+const dotenv = require('dotenv')
+const ciphertext = 's7NYXa809k/bVSPwIAmJhPJmEGTtU0hG58hOZy7I0ix6y5HP8LsHBsZCYC/gw5DDFy5DgOcyd18R'
+const decryptionKey = 'ddcaa26504cd70a6fef9801901c3981538563a1767c297cb8416e8a38c62fe00'
+
+const decrypted = dotenv.decrypt(ciphertext, decryptionKey)
+
+console.log(decrypted) // # development@v6\nALPHA="zeta"
+```
+
+## ❓ FAQ
+
+### Why is the `.env` file not loading my environment variables successfully?
+
+Most likely your `.env` file is not in the correct place. [See this stack overflow](https://stackoverflow.com/questions/42335016/dotenv-file-is-not-loading-environment-variables).
+
+Turn on debug mode and try again..
+
+```js
+require('dotenv').config({ debug: true })
+```
+
+You will receive a helpful error outputted to your console.
+
+### Should I commit my `.env` file?
+
+No. We **strongly** recommend against committing your `.env` file to version
+control. It should only include environment-specific values such as database
+passwords or API keys. Your production database should have a different
+password than your development database.
+
+### Should I have multiple `.env` files?
+
+No. We **strongly** recommend against having a "main" `.env` file and an "environment" `.env` file like `.env.test`. Your config should vary between deploys, and you should not be sharing values between environments.
+
+> In a twelve-factor app, env vars are granular controls, each fully orthogonal to other env vars. They are never grouped together as “environments”, but instead are independently managed for each deploy. This is a model that scales up smoothly as the app naturally expands into more deploys over its lifetime.
+>
+> – [The Twelve-Factor App](http://12factor.net/config)
+
+### What rules does the parsing engine follow?
+
+The parsing engine currently supports the following rules:
+
+- `BASIC=basic` becomes `{BASIC: 'basic'}`
+- empty lines are skipped
+- lines beginning with `#` are treated as comments
+- `#` marks the beginning of a comment (unless when the value is wrapped in quotes)
+- empty values become empty strings (`EMPTY=` becomes `{EMPTY: ''}`)
+- inner quotes are maintained (think JSON) (`JSON={"foo": "bar"}` becomes `{JSON:"{\"foo\": \"bar\"}"`)
+- whitespace is removed from both ends of unquoted values (see more on [`trim`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/String/Trim)) (`FOO= some value ` becomes `{FOO: 'some value'}`)
+- single and double quoted values are escaped (`SINGLE_QUOTE='quoted'` becomes `{SINGLE_QUOTE: "quoted"}`)
+- single and double quoted values maintain whitespace from both ends (`FOO=" some value "` becomes `{FOO: ' some value '}`)
+- double quoted values expand new lines (`MULTILINE="new\nline"` becomes
+
+```
+{MULTILINE: 'new
+line'}
+```
+
+- backticks are supported (`` BACKTICK_KEY=`This has 'single' and "double" quotes inside of it.` ``)
+
+### What happens to environment variables that were already set?
+
+By default, we will never modify any environment variables that have already been set. In particular, if there is a variable in your `.env` file which collides with one that already exists in your environment, then that variable will be skipped.
+
+If instead, you want to override `process.env` use the `override` option.
+
+```javascript
+require('dotenv').config({ override: true })
+```
+
+### How come my environment variables are not showing up for React?
+
+Your React code is run in Webpack, where the `fs` module or even the `process` global itself are not accessible out-of-the-box. `process.env` can only be injected through Webpack configuration.
+
+If you are using [`react-scripts`](https://www.npmjs.com/package/react-scripts), which is distributed through [`create-react-app`](https://create-react-app.dev/), it has dotenv built in but with a quirk. Preface your environment variables with `REACT_APP_`. See [this stack overflow](https://stackoverflow.com/questions/42182577/is-it-possible-to-use-dotenv-in-a-react-project) for more details.
+
+If you are using other frameworks (e.g. Next.js, Gatsby...), you need to consult their documentation for how to inject environment variables into the client.
+
+### Can I customize/write plugins for dotenv?
+
+Yes! `dotenv.config()` returns an object representing the parsed `.env` file. This gives you everything you need to continue setting values on `process.env`. For example:
+
+```js
+const dotenv = require('dotenv')
+const variableExpansion = require('dotenv-expand')
+const myEnv = dotenv.config()
+variableExpansion(myEnv)
+```
+
+### How do I use dotenv with `import`?
+
+Simply..
+
+```javascript
+// index.mjs (ESM)
+import 'dotenv/config' // see https://github.com/motdotla/dotenv#how-do-i-use-dotenv-with-import
+import express from 'express'
+```
+
+A little background..
+
+> When you run a module containing an `import` declaration, the modules it imports are loaded first, then each module body is executed in a depth-first traversal of the dependency graph, avoiding cycles by skipping anything already executed.
+>
+> – [ES6 In Depth: Modules](https://hacks.mozilla.org/2015/08/es6-in-depth-modules/)
+
+What does this mean in plain language? It means you would think the following would work but it won't.
+
+`errorReporter.mjs`:
+```js
+import { Client } from 'best-error-reporting-service'
+
+export default new Client(process.env.API_KEY)
+```
+`index.mjs`:
+```js
+// Note: this is INCORRECT and will not work
+import * as dotenv from 'dotenv'
+dotenv.config()
+
+import errorReporter from './errorReporter.mjs'
+errorReporter.report(new Error('documented example'))
+```
+
+`process.env.API_KEY` will be blank.
+
+Instead, `index.mjs` should be written as..
+
+```js
+import 'dotenv/config'
+
+import errorReporter from './errorReporter.mjs'
+errorReporter.report(new Error('documented example'))
+```
+
+Does that make sense? It's a bit unintuitive, but it is how importing of ES6 modules work. Here is a [working example of this pitfall](https://github.com/dotenv-org/examples/tree/master/dotenv-es6-import-pitfall).
+
+There are two alternatives to this approach:
+
+1. Preload dotenv: `node --require dotenv/config index.js` (_Note: you do not need to `import` dotenv with this approach_)
+2. Create a separate file that will execute `config` first as outlined in [this comment on #133](https://github.com/motdotla/dotenv/issues/133#issuecomment-255298822)
+
+### Why am I getting the error `Module not found: Error: Can't resolve 'crypto|os|path'`?
+
+You are using dotenv on the front-end and have not included a polyfill. Webpack < 5 used to include these for you. Do the following:
+
+```bash
+npm install node-polyfill-webpack-plugin
+```
+
+Configure your `webpack.config.js` to something like the following.
+
+```js
+require('dotenv').config()
+
+const path = require('path');
+const webpack = require('webpack')
+
+const NodePolyfillPlugin = require('node-polyfill-webpack-plugin')
+
+module.exports = {
+ mode: 'development',
+ entry: './src/index.ts',
+ output: {
+ filename: 'bundle.js',
+ path: path.resolve(__dirname, 'dist'),
+ },
+ plugins: [
+ new NodePolyfillPlugin(),
+ new webpack.DefinePlugin({
+ 'process.env': {
+ HELLO: JSON.stringify(process.env.HELLO)
+ }
+ }),
+ ]
+};
+```
+
+Alternatively, just use [dotenv-webpack](https://github.com/mrsteele/dotenv-webpack) which does this and more behind the scenes for you.
+
+### What about variable expansion?
+
+Try [dotenv-expand](https://github.com/motdotla/dotenv-expand)
+
+### What about syncing and securing .env files?
+
+Use [dotenv-vault](https://github.com/dotenv-org/dotenv-vault)
+
+### What is a `.env.vault` file?
+
+A `.env.vault` file is an encrypted version of your development (and ci, staging, production, etc) environment variables. It is paired with a `DOTENV_KEY` to deploy your secrets more securely than scattering them across multiple platforms and tools. Use [dotenv-vault](https://github.com/dotenv-org/dotenv-vault) to manage and generate them.
+
+## Contributing Guide
+
+See [CONTRIBUTING.md](CONTRIBUTING.md)
+
+## CHANGELOG
+
+See [CHANGELOG.md](CHANGELOG.md)
+
+## Who's using dotenv?
+
+[These npm modules depend on it.](https://www.npmjs.com/browse/depended/dotenv)
+
+Projects that expand it often use the [keyword "dotenv" on npm](https://www.npmjs.com/search?q=keywords:dotenv).
diff --git a/server/node_modules/dotenv/config.d.ts b/server/node_modules/dotenv/config.d.ts
new file mode 100644
index 000000000..cb0ff5c3b
--- /dev/null
+++ b/server/node_modules/dotenv/config.d.ts
@@ -0,0 +1 @@
+export {};
diff --git a/server/node_modules/dotenv/config.js b/server/node_modules/dotenv/config.js
new file mode 100644
index 000000000..b0b5576be
--- /dev/null
+++ b/server/node_modules/dotenv/config.js
@@ -0,0 +1,9 @@
+(function () {
+ require('./lib/main').config(
+ Object.assign(
+ {},
+ require('./lib/env-options'),
+ require('./lib/cli-options')(process.argv)
+ )
+ )
+})()
diff --git a/server/node_modules/dotenv/lib/cli-options.js b/server/node_modules/dotenv/lib/cli-options.js
new file mode 100644
index 000000000..09aca5bb7
--- /dev/null
+++ b/server/node_modules/dotenv/lib/cli-options.js
@@ -0,0 +1,11 @@
+const re = /^dotenv_config_(encoding|path|debug|override|DOTENV_KEY)=(.+)$/
+
+module.exports = function optionMatcher (args) {
+ return args.reduce(function (acc, cur) {
+ const matches = cur.match(re)
+ if (matches) {
+ acc[matches[1]] = matches[2]
+ }
+ return acc
+ }, {})
+}
diff --git a/server/node_modules/dotenv/lib/env-options.js b/server/node_modules/dotenv/lib/env-options.js
new file mode 100644
index 000000000..7ebae3d70
--- /dev/null
+++ b/server/node_modules/dotenv/lib/env-options.js
@@ -0,0 +1,24 @@
+// ../config.js accepts options via environment variables
+const options = {}
+
+if (process.env.DOTENV_CONFIG_ENCODING != null) {
+ options.encoding = process.env.DOTENV_CONFIG_ENCODING
+}
+
+if (process.env.DOTENV_CONFIG_PATH != null) {
+ options.path = process.env.DOTENV_CONFIG_PATH
+}
+
+if (process.env.DOTENV_CONFIG_DEBUG != null) {
+ options.debug = process.env.DOTENV_CONFIG_DEBUG
+}
+
+if (process.env.DOTENV_CONFIG_OVERRIDE != null) {
+ options.override = process.env.DOTENV_CONFIG_OVERRIDE
+}
+
+if (process.env.DOTENV_CONFIG_DOTENV_KEY != null) {
+ options.DOTENV_KEY = process.env.DOTENV_CONFIG_DOTENV_KEY
+}
+
+module.exports = options
diff --git a/server/node_modules/dotenv/lib/main.d.ts b/server/node_modules/dotenv/lib/main.d.ts
new file mode 100644
index 000000000..af84746ff
--- /dev/null
+++ b/server/node_modules/dotenv/lib/main.d.ts
@@ -0,0 +1,156 @@
+// TypeScript Version: 3.0
+///
+import type { URL } from 'node:url';
+
+export interface DotenvParseOutput {
+ [name: string]: string;
+}
+
+/**
+ * Parses a string or buffer in the .env file format into an object.
+ *
+ * See https://docs.dotenv.org
+ *
+ * @param src - contents to be parsed. example: `'DB_HOST=localhost'`
+ * @param options - additional options. example: `{ debug: true }`
+ * @returns an object with keys and values based on `src`. example: `{ DB_HOST : 'localhost' }`
+ */
+export function parse(
+ src: string | Buffer
+): T;
+
+export interface DotenvConfigOptions {
+ /**
+ * Default: `path.resolve(process.cwd(), '.env')`
+ *
+ * Specify a custom path if your file containing environment variables is located elsewhere.
+ *
+ * example: `require('dotenv').config({ path: '/custom/path/to/.env' })`
+ */
+ path?: string | URL;
+
+ /**
+ * Default: `utf8`
+ *
+ * Specify the encoding of your file containing environment variables.
+ *
+ * example: `require('dotenv').config({ encoding: 'latin1' })`
+ */
+ encoding?: string;
+
+ /**
+ * Default: `false`
+ *
+ * Turn on logging to help debug why certain keys or values are not being set as you expect.
+ *
+ * example: `require('dotenv').config({ debug: process.env.DEBUG })`
+ */
+ debug?: boolean;
+
+ /**
+ * Default: `false`
+ *
+ * Override any environment variables that have already been set on your machine with values from your .env file.
+ *
+ * example: `require('dotenv').config({ override: true })`
+ */
+ override?: boolean;
+
+ /**
+ * Default: `process.env`
+ *
+ * Specify an object to write your secrets to. Defaults to process.env environment variables.
+ *
+ * example: `const processEnv = {}; require('dotenv').config({ processEnv: processEnv })`
+ */
+ processEnv?: DotenvPopulateInput;
+
+ /**
+ * Default: `undefined`
+ *
+ * Pass the DOTENV_KEY directly to config options. Defaults to looking for process.env.DOTENV_KEY environment variable. Note this only applies to decrypting .env.vault files. If passed as null or undefined, or not passed at all, dotenv falls back to its traditional job of parsing a .env file.
+ *
+ * example: `require('dotenv').config({ DOTENV_KEY: 'dotenv://:key_1234…@dotenv.org/vault/.env.vault?environment=production' })`
+ */
+ DOTENV_KEY?: string;
+}
+
+export interface DotenvConfigOutput {
+ error?: Error;
+ parsed?: DotenvParseOutput;
+}
+
+export interface DotenvPopulateOptions {
+ /**
+ * Default: `false`
+ *
+ * Turn on logging to help debug why certain keys or values are not being set as you expect.
+ *
+ * example: `require('dotenv').config({ debug: process.env.DEBUG })`
+ */
+ debug?: boolean;
+
+ /**
+ * Default: `false`
+ *
+ * Override any environment variables that have already been set on your machine with values from your .env file.
+ *
+ * example: `require('dotenv').config({ override: true })`
+ */
+ override?: boolean;
+}
+
+export interface DotenvPopulateOutput {
+ error?: Error;
+}
+
+export interface DotenvPopulateInput {
+ [name: string]: string;
+}
+
+/**
+ * Loads `.env` file contents into process.env by default. If `DOTENV_KEY` is present, it smartly attempts to load encrypted `.env.vault` file contents into process.env.
+ *
+ * See https://docs.dotenv.org
+ *
+ * @param options - additional options. example: `{ path: './custom/path', encoding: 'latin1', debug: true, override: false }`
+ * @returns an object with a `parsed` key if successful or `error` key if an error occurred. example: { parsed: { KEY: 'value' } }
+ *
+ */
+export function config(options?: DotenvConfigOptions): DotenvConfigOutput;
+
+/**
+ * Loads `.env` file contents into process.env.
+ *
+ * See https://docs.dotenv.org
+ *
+ * @param options - additional options. example: `{ path: './custom/path', encoding: 'latin1', debug: true, override: false }`
+ * @returns an object with a `parsed` key if successful or `error` key if an error occurred. example: { parsed: { KEY: 'value' } }
+ *
+ */
+export function configDotenv(options?: DotenvConfigOptions): DotenvConfigOutput;
+
+/**
+ * Loads `source` json contents into `target` like process.env.
+ *
+ * See https://docs.dotenv.org
+ *
+ * @param processEnv - the target JSON object. in most cases use process.env but you can also pass your own JSON object
+ * @param parsed - the source JSON object
+ * @param options - additional options. example: `{ debug: true, override: false }`
+ * @returns {void}
+ *
+ */
+export function populate(processEnv: DotenvPopulateInput, parsed: DotenvPopulateInput, options?: DotenvConfigOptions): DotenvPopulateOutput;
+
+/**
+ * Decrypt ciphertext
+ *
+ * See https://docs.dotenv.org
+ *
+ * @param encrypted - the encrypted ciphertext string
+ * @param keyStr - the decryption key string
+ * @returns {string}
+ *
+ */
+export function decrypt(encrypted: string, keyStr: string): string;
diff --git a/server/node_modules/dotenv/lib/main.js b/server/node_modules/dotenv/lib/main.js
new file mode 100644
index 000000000..84f81a1e2
--- /dev/null
+++ b/server/node_modules/dotenv/lib/main.js
@@ -0,0 +1,314 @@
+const fs = require('fs')
+const path = require('path')
+const os = require('os')
+const crypto = require('crypto')
+const packageJson = require('../package.json')
+
+const version = packageJson.version
+
+const LINE = /(?:^|^)\s*(?:export\s+)?([\w.-]+)(?:\s*=\s*?|:\s+?)(\s*'(?:\\'|[^'])*'|\s*"(?:\\"|[^"])*"|\s*`(?:\\`|[^`])*`|[^#\r\n]+)?\s*(?:#.*)?(?:$|$)/mg
+
+// Parse src into an Object
+function parse (src) {
+ const obj = {}
+
+ // Convert buffer to string
+ let lines = src.toString()
+
+ // Convert line breaks to same format
+ lines = lines.replace(/\r\n?/mg, '\n')
+
+ let match
+ while ((match = LINE.exec(lines)) != null) {
+ const key = match[1]
+
+ // Default undefined or null to empty string
+ let value = (match[2] || '')
+
+ // Remove whitespace
+ value = value.trim()
+
+ // Check if double quoted
+ const maybeQuote = value[0]
+
+ // Remove surrounding quotes
+ value = value.replace(/^(['"`])([\s\S]*)\1$/mg, '$2')
+
+ // Expand newlines if double quoted
+ if (maybeQuote === '"') {
+ value = value.replace(/\\n/g, '\n')
+ value = value.replace(/\\r/g, '\r')
+ }
+
+ // Add to object
+ obj[key] = value
+ }
+
+ return obj
+}
+
+function _parseVault (options) {
+ const vaultPath = _vaultPath(options)
+
+ // Parse .env.vault
+ const result = DotenvModule.configDotenv({ path: vaultPath })
+ if (!result.parsed) {
+ throw new Error(`MISSING_DATA: Cannot parse ${vaultPath} for an unknown reason`)
+ }
+
+ // handle scenario for comma separated keys - for use with key rotation
+ // example: DOTENV_KEY="dotenv://:key_1234@dotenv.org/vault/.env.vault?environment=prod,dotenv://:key_7890@dotenv.org/vault/.env.vault?environment=prod"
+ const keys = _dotenvKey(options).split(',')
+ const length = keys.length
+
+ let decrypted
+ for (let i = 0; i < length; i++) {
+ try {
+ // Get full key
+ const key = keys[i].trim()
+
+ // Get instructions for decrypt
+ const attrs = _instructions(result, key)
+
+ // Decrypt
+ decrypted = DotenvModule.decrypt(attrs.ciphertext, attrs.key)
+
+ break
+ } catch (error) {
+ // last key
+ if (i + 1 >= length) {
+ throw error
+ }
+ // try next key
+ }
+ }
+
+ // Parse decrypted .env string
+ return DotenvModule.parse(decrypted)
+}
+
+function _log (message) {
+ console.log(`[dotenv@${version}][INFO] ${message}`)
+}
+
+function _warn (message) {
+ console.log(`[dotenv@${version}][WARN] ${message}`)
+}
+
+function _debug (message) {
+ console.log(`[dotenv@${version}][DEBUG] ${message}`)
+}
+
+function _dotenvKey (options) {
+ // prioritize developer directly setting options.DOTENV_KEY
+ if (options && options.DOTENV_KEY && options.DOTENV_KEY.length > 0) {
+ return options.DOTENV_KEY
+ }
+
+ // secondary infra already contains a DOTENV_KEY environment variable
+ if (process.env.DOTENV_KEY && process.env.DOTENV_KEY.length > 0) {
+ return process.env.DOTENV_KEY
+ }
+
+ // fallback to empty string
+ return ''
+}
+
+function _instructions (result, dotenvKey) {
+ // Parse DOTENV_KEY. Format is a URI
+ let uri
+ try {
+ uri = new URL(dotenvKey)
+ } catch (error) {
+ if (error.code === 'ERR_INVALID_URL') {
+ throw new Error('INVALID_DOTENV_KEY: Wrong format. Must be in valid uri format like dotenv://:key_1234@dotenv.org/vault/.env.vault?environment=development')
+ }
+
+ throw error
+ }
+
+ // Get decrypt key
+ const key = uri.password
+ if (!key) {
+ throw new Error('INVALID_DOTENV_KEY: Missing key part')
+ }
+
+ // Get environment
+ const environment = uri.searchParams.get('environment')
+ if (!environment) {
+ throw new Error('INVALID_DOTENV_KEY: Missing environment part')
+ }
+
+ // Get ciphertext payload
+ const environmentKey = `DOTENV_VAULT_${environment.toUpperCase()}`
+ const ciphertext = result.parsed[environmentKey] // DOTENV_VAULT_PRODUCTION
+ if (!ciphertext) {
+ throw new Error(`NOT_FOUND_DOTENV_ENVIRONMENT: Cannot locate environment ${environmentKey} in your .env.vault file.`)
+ }
+
+ return { ciphertext, key }
+}
+
+function _vaultPath (options) {
+ let dotenvPath = path.resolve(process.cwd(), '.env')
+
+ if (options && options.path && options.path.length > 0) {
+ dotenvPath = options.path
+ }
+
+ // Locate .env.vault
+ return dotenvPath.endsWith('.vault') ? dotenvPath : `${dotenvPath}.vault`
+}
+
+function _resolveHome (envPath) {
+ return envPath[0] === '~' ? path.join(os.homedir(), envPath.slice(1)) : envPath
+}
+
+function _configVault (options) {
+ _log('Loading env from encrypted .env.vault')
+
+ const parsed = DotenvModule._parseVault(options)
+
+ let processEnv = process.env
+ if (options && options.processEnv != null) {
+ processEnv = options.processEnv
+ }
+
+ DotenvModule.populate(processEnv, parsed, options)
+
+ return { parsed }
+}
+
+function configDotenv (options) {
+ let dotenvPath = path.resolve(process.cwd(), '.env')
+ let encoding = 'utf8'
+ const debug = Boolean(options && options.debug)
+
+ if (options) {
+ if (options.path != null) {
+ dotenvPath = _resolveHome(options.path)
+ }
+ if (options.encoding != null) {
+ encoding = options.encoding
+ }
+ }
+
+ try {
+ // Specifying an encoding returns a string instead of a buffer
+ const parsed = DotenvModule.parse(fs.readFileSync(dotenvPath, { encoding }))
+
+ let processEnv = process.env
+ if (options && options.processEnv != null) {
+ processEnv = options.processEnv
+ }
+
+ DotenvModule.populate(processEnv, parsed, options)
+
+ return { parsed }
+ } catch (e) {
+ if (debug) {
+ _debug(`Failed to load ${dotenvPath} ${e.message}`)
+ }
+
+ return { error: e }
+ }
+}
+
+// Populates process.env from .env file
+function config (options) {
+ const vaultPath = _vaultPath(options)
+
+ // fallback to original dotenv if DOTENV_KEY is not set
+ if (_dotenvKey(options).length === 0) {
+ return DotenvModule.configDotenv(options)
+ }
+
+ // dotenvKey exists but .env.vault file does not exist
+ if (!fs.existsSync(vaultPath)) {
+ _warn(`You set DOTENV_KEY but you are missing a .env.vault file at ${vaultPath}. Did you forget to build it?`)
+
+ return DotenvModule.configDotenv(options)
+ }
+
+ return DotenvModule._configVault(options)
+}
+
+function decrypt (encrypted, keyStr) {
+ const key = Buffer.from(keyStr.slice(-64), 'hex')
+ let ciphertext = Buffer.from(encrypted, 'base64')
+
+ const nonce = ciphertext.slice(0, 12)
+ const authTag = ciphertext.slice(-16)
+ ciphertext = ciphertext.slice(12, -16)
+
+ try {
+ const aesgcm = crypto.createDecipheriv('aes-256-gcm', key, nonce)
+ aesgcm.setAuthTag(authTag)
+ return `${aesgcm.update(ciphertext)}${aesgcm.final()}`
+ } catch (error) {
+ const isRange = error instanceof RangeError
+ const invalidKeyLength = error.message === 'Invalid key length'
+ const decryptionFailed = error.message === 'Unsupported state or unable to authenticate data'
+
+ if (isRange || invalidKeyLength) {
+ const msg = 'INVALID_DOTENV_KEY: It must be 64 characters long (or more)'
+ throw new Error(msg)
+ } else if (decryptionFailed) {
+ const msg = 'DECRYPTION_FAILED: Please check your DOTENV_KEY'
+ throw new Error(msg)
+ } else {
+ console.error('Error: ', error.code)
+ console.error('Error: ', error.message)
+ throw error
+ }
+ }
+}
+
+// Populate process.env with parsed values
+function populate (processEnv, parsed, options = {}) {
+ const debug = Boolean(options && options.debug)
+ const override = Boolean(options && options.override)
+
+ if (typeof parsed !== 'object') {
+ throw new Error('OBJECT_REQUIRED: Please check the processEnv argument being passed to populate')
+ }
+
+ // Set process.env
+ for (const key of Object.keys(parsed)) {
+ if (Object.prototype.hasOwnProperty.call(processEnv, key)) {
+ if (override === true) {
+ processEnv[key] = parsed[key]
+ }
+
+ if (debug) {
+ if (override === true) {
+ _debug(`"${key}" is already defined and WAS overwritten`)
+ } else {
+ _debug(`"${key}" is already defined and was NOT overwritten`)
+ }
+ }
+ } else {
+ processEnv[key] = parsed[key]
+ }
+ }
+}
+
+const DotenvModule = {
+ configDotenv,
+ _configVault,
+ _parseVault,
+ config,
+ decrypt,
+ parse,
+ populate
+}
+
+module.exports.configDotenv = DotenvModule.configDotenv
+module.exports._configVault = DotenvModule._configVault
+module.exports._parseVault = DotenvModule._parseVault
+module.exports.config = DotenvModule.config
+module.exports.decrypt = DotenvModule.decrypt
+module.exports.parse = DotenvModule.parse
+module.exports.populate = DotenvModule.populate
+
+module.exports = DotenvModule
diff --git a/server/node_modules/dotenv/package.json b/server/node_modules/dotenv/package.json
new file mode 100644
index 000000000..012d7896f
--- /dev/null
+++ b/server/node_modules/dotenv/package.json
@@ -0,0 +1,64 @@
+{
+ "name": "dotenv",
+ "version": "16.3.1",
+ "description": "Loads environment variables from .env file",
+ "main": "lib/main.js",
+ "types": "lib/main.d.ts",
+ "exports": {
+ ".": {
+ "types": "./lib/main.d.ts",
+ "require": "./lib/main.js",
+ "default": "./lib/main.js"
+ },
+ "./config": "./config.js",
+ "./config.js": "./config.js",
+ "./lib/env-options": "./lib/env-options.js",
+ "./lib/env-options.js": "./lib/env-options.js",
+ "./lib/cli-options": "./lib/cli-options.js",
+ "./lib/cli-options.js": "./lib/cli-options.js",
+ "./package.json": "./package.json"
+ },
+ "scripts": {
+ "dts-check": "tsc --project tests/types/tsconfig.json",
+ "lint": "standard",
+ "lint-readme": "standard-markdown",
+ "pretest": "npm run lint && npm run dts-check",
+ "test": "tap tests/*.js --100 -Rspec",
+ "prerelease": "npm test",
+ "release": "standard-version"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/motdotla/dotenv.git"
+ },
+ "funding": "https://github.com/motdotla/dotenv?sponsor=1",
+ "keywords": [
+ "dotenv",
+ "env",
+ ".env",
+ "environment",
+ "variables",
+ "config",
+ "settings"
+ ],
+ "readmeFilename": "README.md",
+ "license": "BSD-2-Clause",
+ "devDependencies": {
+ "@definitelytyped/dtslint": "^0.0.133",
+ "@types/node": "^18.11.3",
+ "decache": "^4.6.1",
+ "sinon": "^14.0.1",
+ "standard": "^17.0.0",
+ "standard-markdown": "^7.1.0",
+ "standard-version": "^9.5.0",
+ "tap": "^16.3.0",
+ "tar": "^6.1.11",
+ "typescript": "^4.8.4"
+ },
+ "engines": {
+ "node": ">=12"
+ },
+ "browser": {
+ "fs": false
+ }
+}
diff --git a/server/node_modules/ee-first/LICENSE b/server/node_modules/ee-first/LICENSE
new file mode 100644
index 000000000..a7ae8ee9b
--- /dev/null
+++ b/server/node_modules/ee-first/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/ee-first/README.md b/server/node_modules/ee-first/README.md
new file mode 100644
index 000000000..cbd2478be
--- /dev/null
+++ b/server/node_modules/ee-first/README.md
@@ -0,0 +1,80 @@
+# EE First
+
+[![NPM version][npm-image]][npm-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+[![Gittip][gittip-image]][gittip-url]
+
+Get the first event in a set of event emitters and event pairs,
+then clean up after itself.
+
+## Install
+
+```sh
+$ npm install ee-first
+```
+
+## API
+
+```js
+var first = require('ee-first')
+```
+
+### first(arr, listener)
+
+Invoke `listener` on the first event from the list specified in `arr`. `arr` is
+an array of arrays, with each array in the format `[ee, ...event]`. `listener`
+will be called only once, the first time any of the given events are emitted. If
+`error` is one of the listened events, then if that fires first, the `listener`
+will be given the `err` argument.
+
+The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the
+first argument emitted from an `error` event, if applicable; `ee` is the event
+emitter that fired; `event` is the string event name that fired; and `args` is an
+array of the arguments that were emitted on the event.
+
+```js
+var ee1 = new EventEmitter()
+var ee2 = new EventEmitter()
+
+first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+```
+
+#### .cancel()
+
+The group of listeners can be cancelled before being invoked and have all the event
+listeners removed from the underlying event emitters.
+
+```js
+var thunk = first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+
+// cancel and clean up
+thunk.cancel()
+```
+
+[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/ee-first
+[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square
+[github-url]: https://github.com/jonathanong/ee-first/tags
+[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square
+[travis-url]: https://travis-ci.org/jonathanong/ee-first
+[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master
+[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/ee-first
+[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
+[gittip-url]: https://www.gittip.com/jonathanong/
diff --git a/server/node_modules/ee-first/index.js b/server/node_modules/ee-first/index.js
new file mode 100644
index 000000000..501287cd3
--- /dev/null
+++ b/server/node_modules/ee-first/index.js
@@ -0,0 +1,95 @@
+/*!
+ * ee-first
+ * Copyright(c) 2014 Jonathan Ong
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = first
+
+/**
+ * Get the first event in a set of event emitters and event pairs.
+ *
+ * @param {array} stuff
+ * @param {function} done
+ * @public
+ */
+
+function first(stuff, done) {
+ if (!Array.isArray(stuff))
+ throw new TypeError('arg must be an array of [ee, events...] arrays')
+
+ var cleanups = []
+
+ for (var i = 0; i < stuff.length; i++) {
+ var arr = stuff[i]
+
+ if (!Array.isArray(arr) || arr.length < 2)
+ throw new TypeError('each array member must be [ee, events...]')
+
+ var ee = arr[0]
+
+ for (var j = 1; j < arr.length; j++) {
+ var event = arr[j]
+ var fn = listener(event, callback)
+
+ // listen to the event
+ ee.on(event, fn)
+ // push this listener to the list of cleanups
+ cleanups.push({
+ ee: ee,
+ event: event,
+ fn: fn,
+ })
+ }
+ }
+
+ function callback() {
+ cleanup()
+ done.apply(null, arguments)
+ }
+
+ function cleanup() {
+ var x
+ for (var i = 0; i < cleanups.length; i++) {
+ x = cleanups[i]
+ x.ee.removeListener(x.event, x.fn)
+ }
+ }
+
+ function thunk(fn) {
+ done = fn
+ }
+
+ thunk.cancel = cleanup
+
+ return thunk
+}
+
+/**
+ * Create the event listener.
+ * @private
+ */
+
+function listener(event, done) {
+ return function onevent(arg1) {
+ var args = new Array(arguments.length)
+ var ee = this
+ var err = event === 'error'
+ ? arg1
+ : null
+
+ // copy args to prevent arguments escaping scope
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i]
+ }
+
+ done(err, ee, event, args)
+ }
+}
diff --git a/server/node_modules/ee-first/package.json b/server/node_modules/ee-first/package.json
new file mode 100644
index 000000000..b6d0b7d67
--- /dev/null
+++ b/server/node_modules/ee-first/package.json
@@ -0,0 +1,29 @@
+{
+ "name": "ee-first",
+ "description": "return the first event in a set of ee/event pairs",
+ "version": "1.1.1",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com",
+ "twitter": "https://twitter.com/jongleberry"
+ },
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "repository": "jonathanong/ee-first",
+ "devDependencies": {
+ "istanbul": "0.3.9",
+ "mocha": "2.2.5"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/server/node_modules/encodeurl/HISTORY.md b/server/node_modules/encodeurl/HISTORY.md
new file mode 100644
index 000000000..41313b2b3
--- /dev/null
+++ b/server/node_modules/encodeurl/HISTORY.md
@@ -0,0 +1,14 @@
+1.0.2 / 2018-01-21
+==================
+
+ * Fix encoding `%` as last character
+
+1.0.1 / 2016-06-09
+==================
+
+ * Fix encoding unpaired surrogates at start/end of string
+
+1.0.0 / 2016-06-08
+==================
+
+ * Initial release
diff --git a/server/node_modules/encodeurl/LICENSE b/server/node_modules/encodeurl/LICENSE
new file mode 100644
index 000000000..8812229bc
--- /dev/null
+++ b/server/node_modules/encodeurl/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/encodeurl/README.md b/server/node_modules/encodeurl/README.md
new file mode 100644
index 000000000..127c5a0d4
--- /dev/null
+++ b/server/node_modules/encodeurl/README.md
@@ -0,0 +1,128 @@
+# encodeurl
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install encodeurl
+```
+
+## API
+
+```js
+var encodeUrl = require('encodeurl')
+```
+
+### encodeUrl(url)
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+
+This function will take an already-encoded URL and encode all the non-URL
+code points (as UTF-8 byte sequences). This function will not encode the
+"%" character unless it is not part of a valid sequence (`%20` will be
+left as-is, but `%foo` will be encoded as `%25foo`).
+
+This encode is meant to be "safe" and does not throw errors. It will try as
+hard as it can to properly encode the given URL, including replacing any raw,
+unpaired surrogate pairs with the Unicode replacement character prior to
+encoding.
+
+This function is _similar_ to the intrinsic function `encodeURI`, except it
+will not encode the `%` character if that is part of a valid sequence, will
+not encode `[` and `]` (for IPv6 hostnames) and will replace raw, unpaired
+surrogate pairs with the Unicode replacement character (instead of throwing).
+
+## Examples
+
+### Encode a URL containing user-controled data
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+
+http.createServer(function onRequest (req, res) {
+ // get encoded form of inbound url
+ var url = encodeUrl(req.url)
+
+ // create html message
+ var body = 'Location ' + escapeHtml(url) + ' not found
'
+
+ // send a 404
+ res.statusCode = 404
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.end(body, 'utf-8')
+})
+```
+
+### Encode a URL for use in a header field
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+var url = require('url')
+
+http.createServer(function onRequest (req, res) {
+ // parse inbound url
+ var href = url.parse(req)
+
+ // set new host for redirect
+ href.host = 'localhost'
+ href.protocol = 'https:'
+ href.slashes = true
+
+ // create location header
+ var location = encodeUrl(url.format(href))
+
+ // create html message
+ var body = 'Redirecting to new site: ' + escapeHtml(location) + '
'
+
+ // send a 301
+ res.statusCode = 301
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.setHeader('Location', location)
+ res.end(body, 'utf-8')
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+$ npm run lint
+```
+
+## References
+
+- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986]
+- [WHATWG URL Living Standard][whatwg-url]
+
+[rfc-3986]: https://tools.ietf.org/html/rfc3986
+[whatwg-url]: https://url.spec.whatwg.org/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/encodeurl.svg
+[npm-url]: https://npmjs.org/package/encodeurl
+[node-version-image]: https://img.shields.io/node/v/encodeurl.svg
+[node-version-url]: https://nodejs.org/en/download
+[travis-image]: https://img.shields.io/travis/pillarjs/encodeurl.svg
+[travis-url]: https://travis-ci.org/pillarjs/encodeurl
+[coveralls-image]: https://img.shields.io/coveralls/pillarjs/encodeurl.svg
+[coveralls-url]: https://coveralls.io/r/pillarjs/encodeurl?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/encodeurl.svg
+[downloads-url]: https://npmjs.org/package/encodeurl
diff --git a/server/node_modules/encodeurl/index.js b/server/node_modules/encodeurl/index.js
new file mode 100644
index 000000000..fc4906c6c
--- /dev/null
+++ b/server/node_modules/encodeurl/index.js
@@ -0,0 +1,60 @@
+/*!
+ * encodeurl
+ * Copyright(c) 2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = encodeUrl
+
+/**
+ * RegExp to match non-URL code points, *after* encoding (i.e. not including "%")
+ * and including invalid escape sequences.
+ * @private
+ */
+
+var ENCODE_CHARS_REGEXP = /(?:[^\x21\x25\x26-\x3B\x3D\x3F-\x5B\x5D\x5F\x61-\x7A\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g
+
+/**
+ * RegExp to match unmatched surrogate pair.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g
+
+/**
+ * String to replace unmatched surrogate pair with.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2'
+
+/**
+ * Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+ *
+ * This function will take an already-encoded URL and encode all the non-URL
+ * code points. This function will not encode the "%" character unless it is
+ * not part of a valid sequence (`%20` will be left as-is, but `%foo` will
+ * be encoded as `%25foo`).
+ *
+ * This encode is meant to be "safe" and does not throw errors. It will try as
+ * hard as it can to properly encode the given URL, including replacing any raw,
+ * unpaired surrogate pairs with the Unicode replacement character prior to
+ * encoding.
+ *
+ * @param {string} url
+ * @return {string}
+ * @public
+ */
+
+function encodeUrl (url) {
+ return String(url)
+ .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE)
+ .replace(ENCODE_CHARS_REGEXP, encodeURI)
+}
diff --git a/server/node_modules/encodeurl/package.json b/server/node_modules/encodeurl/package.json
new file mode 100644
index 000000000..b9f25ef10
--- /dev/null
+++ b/server/node_modules/encodeurl/package.json
@@ -0,0 +1,40 @@
+{
+ "name": "encodeurl",
+ "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences",
+ "version": "1.0.2",
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "encode",
+ "encodeurl",
+ "url"
+ ],
+ "repository": "pillarjs/encodeurl",
+ "devDependencies": {
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.8.0",
+ "eslint-plugin-node": "5.2.1",
+ "eslint-plugin-promise": "3.6.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "2.5.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/server/node_modules/escape-html/LICENSE b/server/node_modules/escape-html/LICENSE
new file mode 100644
index 000000000..2e70de971
--- /dev/null
+++ b/server/node_modules/escape-html/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2013 TJ Holowaychuk
+Copyright (c) 2015 Andreas Lubbe
+Copyright (c) 2015 Tiancheng "Timothy" Gu
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/escape-html/Readme.md b/server/node_modules/escape-html/Readme.md
new file mode 100644
index 000000000..653d9eaa7
--- /dev/null
+++ b/server/node_modules/escape-html/Readme.md
@@ -0,0 +1,43 @@
+
+# escape-html
+
+ Escape string for use in HTML
+
+## Example
+
+```js
+var escape = require('escape-html');
+var html = escape('foo & bar');
+// -> foo & bar
+```
+
+## Benchmark
+
+```
+$ npm run-script bench
+
+> escape-html@1.0.3 bench nodejs-escape-html
+> node benchmark/index.js
+
+
+ http_parser@1.0
+ node@0.10.33
+ v8@3.14.5.9
+ ares@1.9.0-DEV
+ uv@0.10.29
+ zlib@1.2.3
+ modules@11
+ openssl@1.0.1j
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ no special characters x 19,435,271 ops/sec ±0.85% (187 runs sampled)
+ single special character x 6,132,421 ops/sec ±0.67% (194 runs sampled)
+ many special characters x 3,175,826 ops/sec ±0.65% (193 runs sampled)
+```
+
+## License
+
+ MIT
\ No newline at end of file
diff --git a/server/node_modules/escape-html/index.js b/server/node_modules/escape-html/index.js
new file mode 100644
index 000000000..bf9e226f4
--- /dev/null
+++ b/server/node_modules/escape-html/index.js
@@ -0,0 +1,78 @@
+/*!
+ * escape-html
+ * Copyright(c) 2012-2013 TJ Holowaychuk
+ * Copyright(c) 2015 Andreas Lubbe
+ * Copyright(c) 2015 Tiancheng "Timothy" Gu
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var matchHtmlRegExp = /["'&<>]/;
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = escapeHtml;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @param {string} string The string to escape for inserting into HTML
+ * @return {string}
+ * @public
+ */
+
+function escapeHtml(string) {
+ var str = '' + string;
+ var match = matchHtmlRegExp.exec(str);
+
+ if (!match) {
+ return str;
+ }
+
+ var escape;
+ var html = '';
+ var index = 0;
+ var lastIndex = 0;
+
+ for (index = match.index; index < str.length; index++) {
+ switch (str.charCodeAt(index)) {
+ case 34: // "
+ escape = '"';
+ break;
+ case 38: // &
+ escape = '&';
+ break;
+ case 39: // '
+ escape = ''';
+ break;
+ case 60: // <
+ escape = '<';
+ break;
+ case 62: // >
+ escape = '>';
+ break;
+ default:
+ continue;
+ }
+
+ if (lastIndex !== index) {
+ html += str.substring(lastIndex, index);
+ }
+
+ lastIndex = index + 1;
+ html += escape;
+ }
+
+ return lastIndex !== index
+ ? html + str.substring(lastIndex, index)
+ : html;
+}
diff --git a/server/node_modules/escape-html/package.json b/server/node_modules/escape-html/package.json
new file mode 100644
index 000000000..57ec7bd07
--- /dev/null
+++ b/server/node_modules/escape-html/package.json
@@ -0,0 +1,24 @@
+{
+ "name": "escape-html",
+ "description": "Escape string for use in HTML",
+ "version": "1.0.3",
+ "license": "MIT",
+ "keywords": [
+ "escape",
+ "html",
+ "utility"
+ ],
+ "repository": "component/escape-html",
+ "devDependencies": {
+ "benchmark": "1.0.0",
+ "beautify-benchmark": "0.2.4"
+ },
+ "files": [
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "scripts": {
+ "bench": "node benchmark/index.js"
+ }
+}
diff --git a/server/node_modules/etag/HISTORY.md b/server/node_modules/etag/HISTORY.md
new file mode 100644
index 000000000..222b293de
--- /dev/null
+++ b/server/node_modules/etag/HISTORY.md
@@ -0,0 +1,83 @@
+1.8.1 / 2017-09-12
+==================
+
+ * perf: replace regular expression with substring
+
+1.8.0 / 2017-02-18
+==================
+
+ * Use SHA1 instead of MD5 for ETag hashing
+ - Improves performance for larger entities
+ - Works with FIPS 140-2 OpenSSL configuration
+
+1.7.0 / 2015-06-08
+==================
+
+ * Always include entity length in ETags for hash length extensions
+ * Generate non-Stats ETags using MD5 only (no longer CRC32)
+ * Improve stat performance by removing hashing
+ * Remove base64 padding in ETags to shorten
+ * Use MD5 instead of MD4 in weak ETags over 1KB
+
+1.6.0 / 2015-05-10
+==================
+
+ * Improve support for JXcore
+ * Remove requirement of `atime` in the stats object
+ * Support "fake" stats objects in environments without `fs`
+
+1.5.1 / 2014-11-19
+==================
+
+ * deps: crc@3.2.1
+ - Minor fixes
+
+1.5.0 / 2014-10-14
+==================
+
+ * Improve string performance
+ * Slightly improve speed for weak ETags over 1KB
+
+1.4.0 / 2014-09-21
+==================
+
+ * Support "fake" stats objects
+ * Support Node.js 0.6
+
+1.3.1 / 2014-09-14
+==================
+
+ * Use the (new and improved) `crc` for crc32
+
+1.3.0 / 2014-08-29
+==================
+
+ * Default strings to strong ETags
+ * Improve speed for weak ETags over 1KB
+
+1.2.1 / 2014-08-29
+==================
+
+ * Use the (much faster) `buffer-crc32` for crc32
+
+1.2.0 / 2014-08-24
+==================
+
+ * Add support for file stat objects
+
+1.1.0 / 2014-08-24
+==================
+
+ * Add fast-path for empty entity
+ * Add weak ETag generation
+ * Shrink size of generated ETags
+
+1.0.1 / 2014-08-24
+==================
+
+ * Fix behavior of string containing Unicode
+
+1.0.0 / 2014-05-18
+==================
+
+ * Initial release
diff --git a/server/node_modules/etag/LICENSE b/server/node_modules/etag/LICENSE
new file mode 100644
index 000000000..cab251c2b
--- /dev/null
+++ b/server/node_modules/etag/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/etag/README.md b/server/node_modules/etag/README.md
new file mode 100644
index 000000000..09c2169e7
--- /dev/null
+++ b/server/node_modules/etag/README.md
@@ -0,0 +1,159 @@
+# etag
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create simple HTTP ETags
+
+This module generates HTTP ETags (as defined in RFC 7232) for use in
+HTTP responses.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install etag
+```
+
+## API
+
+
+
+```js
+var etag = require('etag')
+```
+
+### etag(entity, [options])
+
+Generate a strong ETag for the given entity. This should be the complete
+body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By
+default, a strong ETag is generated except for `fs.Stats`, which will
+generate a weak ETag (this can be overwritten by `options.weak`).
+
+
+
+```js
+res.setHeader('ETag', etag(body))
+```
+
+#### Options
+
+`etag` accepts these properties in the options object.
+
+##### weak
+
+Specifies if the generated ETag will include the weak validator mark (that
+is, the leading `W/`). The actual entity tag is the same. The default value
+is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`.
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```bash
+$ npm run-script bench
+
+> etag@1.8.1 bench nodejs-etag
+> node benchmark/index.js
+
+ http_parser@2.7.0
+ node@6.11.1
+ v8@5.1.281.103
+ uv@1.11.0
+ zlib@1.2.11
+ ares@1.10.1-DEV
+ icu@58.2
+ modules@48
+ openssl@1.0.2k
+
+> node benchmark/body0-100b.js
+
+ 100B body
+
+ 4 tests completed.
+
+ buffer - strong x 258,647 ops/sec ±1.07% (180 runs sampled)
+ buffer - weak x 263,812 ops/sec ±0.61% (184 runs sampled)
+ string - strong x 259,955 ops/sec ±1.19% (185 runs sampled)
+ string - weak x 264,356 ops/sec ±1.09% (184 runs sampled)
+
+> node benchmark/body1-1kb.js
+
+ 1KB body
+
+ 4 tests completed.
+
+ buffer - strong x 189,018 ops/sec ±1.12% (182 runs sampled)
+ buffer - weak x 190,586 ops/sec ±0.81% (186 runs sampled)
+ string - strong x 144,272 ops/sec ±0.96% (188 runs sampled)
+ string - weak x 145,380 ops/sec ±1.43% (187 runs sampled)
+
+> node benchmark/body2-5kb.js
+
+ 5KB body
+
+ 4 tests completed.
+
+ buffer - strong x 92,435 ops/sec ±0.42% (188 runs sampled)
+ buffer - weak x 92,373 ops/sec ±0.58% (189 runs sampled)
+ string - strong x 48,850 ops/sec ±0.56% (186 runs sampled)
+ string - weak x 49,380 ops/sec ±0.56% (190 runs sampled)
+
+> node benchmark/body3-10kb.js
+
+ 10KB body
+
+ 4 tests completed.
+
+ buffer - strong x 55,989 ops/sec ±0.93% (188 runs sampled)
+ buffer - weak x 56,148 ops/sec ±0.55% (190 runs sampled)
+ string - strong x 27,345 ops/sec ±0.43% (188 runs sampled)
+ string - weak x 27,496 ops/sec ±0.45% (190 runs sampled)
+
+> node benchmark/body4-100kb.js
+
+ 100KB body
+
+ 4 tests completed.
+
+ buffer - strong x 7,083 ops/sec ±0.22% (190 runs sampled)
+ buffer - weak x 7,115 ops/sec ±0.26% (191 runs sampled)
+ string - strong x 3,068 ops/sec ±0.34% (190 runs sampled)
+ string - weak x 3,096 ops/sec ±0.35% (190 runs sampled)
+
+> node benchmark/stats.js
+
+ stat
+
+ 4 tests completed.
+
+ real - strong x 871,642 ops/sec ±0.34% (189 runs sampled)
+ real - weak x 867,613 ops/sec ±0.39% (190 runs sampled)
+ fake - strong x 401,051 ops/sec ±0.40% (189 runs sampled)
+ fake - weak x 400,100 ops/sec ±0.47% (188 runs sampled)
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/etag.svg
+[npm-url]: https://npmjs.org/package/etag
+[node-version-image]: https://img.shields.io/node/v/etag.svg
+[node-version-url]: https://nodejs.org/en/download/
+[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg
+[travis-url]: https://travis-ci.org/jshttp/etag
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/etag.svg
+[downloads-url]: https://npmjs.org/package/etag
diff --git a/server/node_modules/etag/index.js b/server/node_modules/etag/index.js
new file mode 100644
index 000000000..2a585c91f
--- /dev/null
+++ b/server/node_modules/etag/index.js
@@ -0,0 +1,131 @@
+/*!
+ * etag
+ * Copyright(c) 2014-2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = etag
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var crypto = require('crypto')
+var Stats = require('fs').Stats
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var toString = Object.prototype.toString
+
+/**
+ * Generate an entity tag.
+ *
+ * @param {Buffer|string} entity
+ * @return {string}
+ * @private
+ */
+
+function entitytag (entity) {
+ if (entity.length === 0) {
+ // fast-path empty
+ return '"0-2jmj7l5rSw0yVb/vlWAYkK/YBwk"'
+ }
+
+ // compute hash of entity
+ var hash = crypto
+ .createHash('sha1')
+ .update(entity, 'utf8')
+ .digest('base64')
+ .substring(0, 27)
+
+ // compute length of entity
+ var len = typeof entity === 'string'
+ ? Buffer.byteLength(entity, 'utf8')
+ : entity.length
+
+ return '"' + len.toString(16) + '-' + hash + '"'
+}
+
+/**
+ * Create a simple ETag.
+ *
+ * @param {string|Buffer|Stats} entity
+ * @param {object} [options]
+ * @param {boolean} [options.weak]
+ * @return {String}
+ * @public
+ */
+
+function etag (entity, options) {
+ if (entity == null) {
+ throw new TypeError('argument entity is required')
+ }
+
+ // support fs.Stats object
+ var isStats = isstats(entity)
+ var weak = options && typeof options.weak === 'boolean'
+ ? options.weak
+ : isStats
+
+ // validate argument
+ if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) {
+ throw new TypeError('argument entity must be string, Buffer, or fs.Stats')
+ }
+
+ // generate entity tag
+ var tag = isStats
+ ? stattag(entity)
+ : entitytag(entity)
+
+ return weak
+ ? 'W/' + tag
+ : tag
+}
+
+/**
+ * Determine if object is a Stats object.
+ *
+ * @param {object} obj
+ * @return {boolean}
+ * @api private
+ */
+
+function isstats (obj) {
+ // genuine fs.Stats
+ if (typeof Stats === 'function' && obj instanceof Stats) {
+ return true
+ }
+
+ // quack quack
+ return obj && typeof obj === 'object' &&
+ 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' &&
+ 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' &&
+ 'ino' in obj && typeof obj.ino === 'number' &&
+ 'size' in obj && typeof obj.size === 'number'
+}
+
+/**
+ * Generate a tag for a stat.
+ *
+ * @param {object} stat
+ * @return {string}
+ * @private
+ */
+
+function stattag (stat) {
+ var mtime = stat.mtime.getTime().toString(16)
+ var size = stat.size.toString(16)
+
+ return '"' + size + '-' + mtime + '"'
+}
diff --git a/server/node_modules/etag/package.json b/server/node_modules/etag/package.json
new file mode 100644
index 000000000..b06ab803c
--- /dev/null
+++ b/server/node_modules/etag/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "etag",
+ "description": "Create simple HTTP ETags",
+ "version": "1.8.1",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "David Björklund "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "etag",
+ "http",
+ "res"
+ ],
+ "repository": "jshttp/etag",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.7.0",
+ "eslint-plugin-markdown": "1.0.0-beta.6",
+ "eslint-plugin-node": "5.1.1",
+ "eslint-plugin-promise": "3.5.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "1.21.5",
+ "safe-buffer": "5.1.1",
+ "seedrandom": "2.4.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/server/node_modules/express/History.md b/server/node_modules/express/History.md
new file mode 100644
index 000000000..e49870fed
--- /dev/null
+++ b/server/node_modules/express/History.md
@@ -0,0 +1,3588 @@
+4.18.2 / 2022-10-08
+===================
+
+ * Fix regression routing a large stack in a single route
+ * deps: body-parser@1.20.1
+ - deps: qs@6.11.0
+ - perf: remove unnecessary object clone
+ * deps: qs@6.11.0
+
+4.18.1 / 2022-04-29
+===================
+
+ * Fix hanging on large stack of sync routes
+
+4.18.0 / 2022-04-25
+===================
+
+ * Add "root" option to `res.download`
+ * Allow `options` without `filename` in `res.download`
+ * Deprecate string and non-integer arguments to `res.status`
+ * Fix behavior of `null`/`undefined` as `maxAge` in `res.cookie`
+ * Fix handling very large stacks of sync middleware
+ * Ignore `Object.prototype` values in settings through `app.set`/`app.get`
+ * Invoke `default` with same arguments as types in `res.format`
+ * Support proper 205 responses using `res.send`
+ * Use `http-errors` for `res.format` error
+ * deps: body-parser@1.20.0
+ - Fix error message for json parse whitespace in `strict`
+ - Fix internal error when inflated body exceeds limit
+ - Prevent loss of async hooks context
+ - Prevent hanging when request already read
+ - deps: depd@2.0.0
+ - deps: http-errors@2.0.0
+ - deps: on-finished@2.4.1
+ - deps: qs@6.10.3
+ - deps: raw-body@2.5.1
+ * deps: cookie@0.5.0
+ - Add `priority` option
+ - Fix `expires` option to reject invalid dates
+ * deps: depd@2.0.0
+ - Replace internal `eval` usage with `Function` constructor
+ - Use instance methods on `process` to check for listeners
+ * deps: finalhandler@1.2.0
+ - Remove set content headers that break response
+ - deps: on-finished@2.4.1
+ - deps: statuses@2.0.1
+ * deps: on-finished@2.4.1
+ - Prevent loss of async hooks context
+ * deps: qs@6.10.3
+ * deps: send@0.18.0
+ - Fix emitted 416 error missing headers property
+ - Limit the headers removed for 304 response
+ - deps: depd@2.0.0
+ - deps: destroy@1.2.0
+ - deps: http-errors@2.0.0
+ - deps: on-finished@2.4.1
+ - deps: statuses@2.0.1
+ * deps: serve-static@1.15.0
+ - deps: send@0.18.0
+ * deps: statuses@2.0.1
+ - Remove code 306
+ - Rename `425 Unordered Collection` to standard `425 Too Early`
+
+4.17.3 / 2022-02-16
+===================
+
+ * deps: accepts@~1.3.8
+ - deps: mime-types@~2.1.34
+ - deps: negotiator@0.6.3
+ * deps: body-parser@1.19.2
+ - deps: bytes@3.1.2
+ - deps: qs@6.9.7
+ - deps: raw-body@2.4.3
+ * deps: cookie@0.4.2
+ * deps: qs@6.9.7
+ * Fix handling of `__proto__` keys
+ * pref: remove unnecessary regexp for trust proxy
+
+4.17.2 / 2021-12-16
+===================
+
+ * Fix handling of `undefined` in `res.jsonp`
+ * Fix handling of `undefined` when `"json escape"` is enabled
+ * Fix incorrect middleware execution with unanchored `RegExp`s
+ * Fix `res.jsonp(obj, status)` deprecation message
+ * Fix typo in `res.is` JSDoc
+ * deps: body-parser@1.19.1
+ - deps: bytes@3.1.1
+ - deps: http-errors@1.8.1
+ - deps: qs@6.9.6
+ - deps: raw-body@2.4.2
+ - deps: safe-buffer@5.2.1
+ - deps: type-is@~1.6.18
+ * deps: content-disposition@0.5.4
+ - deps: safe-buffer@5.2.1
+ * deps: cookie@0.4.1
+ - Fix `maxAge` option to reject invalid values
+ * deps: proxy-addr@~2.0.7
+ - Use `req.socket` over deprecated `req.connection`
+ - deps: forwarded@0.2.0
+ - deps: ipaddr.js@1.9.1
+ * deps: qs@6.9.6
+ * deps: safe-buffer@5.2.1
+ * deps: send@0.17.2
+ - deps: http-errors@1.8.1
+ - deps: ms@2.1.3
+ - pref: ignore empty http tokens
+ * deps: serve-static@1.14.2
+ - deps: send@0.17.2
+ * deps: setprototypeof@1.2.0
+
+4.17.1 / 2019-05-25
+===================
+
+ * Revert "Improve error message for `null`/`undefined` to `res.status`"
+
+4.17.0 / 2019-05-16
+===================
+
+ * Add `express.raw` to parse bodies into `Buffer`
+ * Add `express.text` to parse bodies into string
+ * Improve error message for non-strings to `res.sendFile`
+ * Improve error message for `null`/`undefined` to `res.status`
+ * Support multiple hosts in `X-Forwarded-Host`
+ * deps: accepts@~1.3.7
+ * deps: body-parser@1.19.0
+ - Add encoding MIK
+ - Add petabyte (`pb`) support
+ - Fix parsing array brackets after index
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ - deps: qs@6.7.0
+ - deps: raw-body@2.4.0
+ - deps: type-is@~1.6.17
+ * deps: content-disposition@0.5.3
+ * deps: cookie@0.4.0
+ - Add `SameSite=None` support
+ * deps: finalhandler@~1.1.2
+ - Set stricter `Content-Security-Policy` header
+ - deps: parseurl@~1.3.3
+ - deps: statuses@~1.5.0
+ * deps: parseurl@~1.3.3
+ * deps: proxy-addr@~2.0.5
+ - deps: ipaddr.js@1.9.0
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: range-parser@~1.2.1
+ * deps: send@0.17.1
+ - Set stricter CSP header in redirect & error responses
+ - deps: http-errors@~1.7.2
+ - deps: mime@1.6.0
+ - deps: ms@2.1.1
+ - deps: range-parser@~1.2.1
+ - deps: statuses@~1.5.0
+ - perf: remove redundant `path.normalize` call
+ * deps: serve-static@1.14.1
+ - Set stricter CSP header in redirect response
+ - deps: parseurl@~1.3.3
+ - deps: send@0.17.1
+ * deps: setprototypeof@1.1.1
+ * deps: statuses@~1.5.0
+ - Add `103 Early Hints`
+ * deps: type-is@~1.6.18
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+4.16.4 / 2018-10-10
+===================
+
+ * Fix issue where `"Request aborted"` may be logged in `res.sendfile`
+ * Fix JSDoc for `Router` constructor
+ * deps: body-parser@1.18.3
+ - Fix deprecation warnings on Node.js 10+
+ - Fix stack trace for strict json parse error
+ - deps: depd@~1.1.2
+ - deps: http-errors@~1.6.3
+ - deps: iconv-lite@0.4.23
+ - deps: qs@6.5.2
+ - deps: raw-body@2.3.3
+ - deps: type-is@~1.6.16
+ * deps: proxy-addr@~2.0.4
+ - deps: ipaddr.js@1.8.0
+ * deps: qs@6.5.2
+ * deps: safe-buffer@5.1.2
+
+4.16.3 / 2018-03-12
+===================
+
+ * deps: accepts@~1.3.5
+ - deps: mime-types@~2.1.18
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: encodeurl@~1.0.2
+ - Fix encoding `%` as last character
+ * deps: finalhandler@1.1.1
+ - Fix 404 output for bad / missing pathnames
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: proxy-addr@~2.0.3
+ - deps: ipaddr.js@1.6.0
+ * deps: send@0.16.2
+ - Fix incorrect end tag in default error & redirects
+ - deps: depd@~1.1.2
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: serve-static@1.13.2
+ - Fix incorrect end tag in redirects
+ - deps: encodeurl@~1.0.2
+ - deps: send@0.16.2
+ * deps: statuses@~1.4.0
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+4.16.2 / 2017-10-09
+===================
+
+ * Fix `TypeError` in `res.send` when given `Buffer` and `ETag` header set
+ * perf: skip parsing of entire `X-Forwarded-Proto` header
+
+4.16.1 / 2017-09-29
+===================
+
+ * deps: send@0.16.1
+ * deps: serve-static@1.13.1
+ - Fix regression when `root` is incorrectly set to a file
+ - deps: send@0.16.1
+
+4.16.0 / 2017-09-28
+===================
+
+ * Add `"json escape"` setting for `res.json` and `res.jsonp`
+ * Add `express.json` and `express.urlencoded` to parse bodies
+ * Add `options` argument to `res.download`
+ * Improve error message when autoloading invalid view engine
+ * Improve error messages when non-function provided as middleware
+ * Skip `Buffer` encoding when not generating ETag for small response
+ * Use `safe-buffer` for improved Buffer API
+ * deps: accepts@~1.3.4
+ - deps: mime-types@~2.1.16
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: etag@~1.8.1
+ - perf: replace regular expression with substring
+ * deps: finalhandler@1.1.0
+ - Use `res.headersSent` when available
+ * deps: parseurl@~1.3.2
+ - perf: reduce overhead for full URLs
+ - perf: unroll the "fast-path" `RegExp`
+ * deps: proxy-addr@~2.0.2
+ - Fix trimming leading / trailing OWS in `X-Forwarded-For`
+ - deps: forwarded@~0.1.2
+ - deps: ipaddr.js@1.5.2
+ - perf: reduce overhead when no `X-Forwarded-For` header
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: send@0.16.0
+ - Add 70 new types for file extensions
+ - Add `immutable` option
+ - Fix missing `