diff --git a/.DS_Store b/.DS_Store
new file mode 100644
index 00000000..e0f8a828
Binary files /dev/null and b/.DS_Store differ
diff --git a/.idea/community.iml b/.idea/community.iml
new file mode 100644
index 00000000..03a0af05
--- /dev/null
+++ b/.idea/community.iml
@@ -0,0 +1,25 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/.idea/inspectionProfiles/profiles_settings.xml b/.idea/inspectionProfiles/profiles_settings.xml
new file mode 100644
index 00000000..c23ecacb
--- /dev/null
+++ b/.idea/inspectionProfiles/profiles_settings.xml
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/.idea/misc.xml b/.idea/misc.xml
new file mode 100644
index 00000000..0ed3b438
--- /dev/null
+++ b/.idea/misc.xml
@@ -0,0 +1,4 @@
+
+
+
+
\ No newline at end of file
diff --git a/.idea/modules.xml b/.idea/modules.xml
new file mode 100644
index 00000000..28646426
--- /dev/null
+++ b/.idea/modules.xml
@@ -0,0 +1,8 @@
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/.idea/vcs.xml b/.idea/vcs.xml
new file mode 100644
index 00000000..94a25f7f
--- /dev/null
+++ b/.idea/vcs.xml
@@ -0,0 +1,6 @@
+
+
+
+
+
+
\ No newline at end of file
diff --git a/.idea/workspace.xml b/.idea/workspace.xml
new file mode 100644
index 00000000..249d7286
--- /dev/null
+++ b/.idea/workspace.xml
@@ -0,0 +1,772 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ true
+ DEFINITION_ORDER
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ 1512998410386
+
+
+ 1512998410386
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/community/urls.py b/community/urls.py
index 6e65f3c5..542e9615 100644
--- a/community/urls.py
+++ b/community/urls.py
@@ -24,7 +24,7 @@ def get_index():
distill_file='index.html',
),
distill_url(
- r'activity/', TemplateView.as_view(template_name='activity.html'),
+ r'activity/', TemplateView.as_view(template_name='index.html'),
name='activity',
distill_func=get_index,
distill_file='activity/index.html',
diff --git a/static/.DS_Store b/static/.DS_Store
new file mode 100644
index 00000000..7ea8cc18
Binary files /dev/null and b/static/.DS_Store differ
diff --git a/static/main.css b/static/css/main.css
similarity index 100%
rename from static/main.css
rename to static/css/main.css
diff --git a/static/css/materialize.css b/static/css/materialize.css
new file mode 100644
index 00000000..5d19b13d
--- /dev/null
+++ b/static/css/materialize.css
@@ -0,0 +1,9389 @@
+/*!
+ * Materialize v0.100.2 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+.materialize-red {
+ background-color: #e51c23 !important;
+}
+
+.materialize-red-text {
+ color: #e51c23 !important;
+}
+
+.materialize-red.lighten-5 {
+ background-color: #fdeaeb !important;
+}
+
+.materialize-red-text.text-lighten-5 {
+ color: #fdeaeb !important;
+}
+
+.materialize-red.lighten-4 {
+ background-color: #f8c1c3 !important;
+}
+
+.materialize-red-text.text-lighten-4 {
+ color: #f8c1c3 !important;
+}
+
+.materialize-red.lighten-3 {
+ background-color: #f3989b !important;
+}
+
+.materialize-red-text.text-lighten-3 {
+ color: #f3989b !important;
+}
+
+.materialize-red.lighten-2 {
+ background-color: #ee6e73 !important;
+}
+
+.materialize-red-text.text-lighten-2 {
+ color: #ee6e73 !important;
+}
+
+.materialize-red.lighten-1 {
+ background-color: #ea454b !important;
+}
+
+.materialize-red-text.text-lighten-1 {
+ color: #ea454b !important;
+}
+
+.materialize-red.darken-1 {
+ background-color: #d0181e !important;
+}
+
+.materialize-red-text.text-darken-1 {
+ color: #d0181e !important;
+}
+
+.materialize-red.darken-2 {
+ background-color: #b9151b !important;
+}
+
+.materialize-red-text.text-darken-2 {
+ color: #b9151b !important;
+}
+
+.materialize-red.darken-3 {
+ background-color: #a21318 !important;
+}
+
+.materialize-red-text.text-darken-3 {
+ color: #a21318 !important;
+}
+
+.materialize-red.darken-4 {
+ background-color: #8b1014 !important;
+}
+
+.materialize-red-text.text-darken-4 {
+ color: #8b1014 !important;
+}
+
+.red {
+ background-color: #F44336 !important;
+}
+
+.red-text {
+ color: #F44336 !important;
+}
+
+.red.lighten-5 {
+ background-color: #FFEBEE !important;
+}
+
+.red-text.text-lighten-5 {
+ color: #FFEBEE !important;
+}
+
+.red.lighten-4 {
+ background-color: #FFCDD2 !important;
+}
+
+.red-text.text-lighten-4 {
+ color: #FFCDD2 !important;
+}
+
+.red.lighten-3 {
+ background-color: #EF9A9A !important;
+}
+
+.red-text.text-lighten-3 {
+ color: #EF9A9A !important;
+}
+
+.red.lighten-2 {
+ background-color: #E57373 !important;
+}
+
+.red-text.text-lighten-2 {
+ color: #E57373 !important;
+}
+
+.red.lighten-1 {
+ background-color: #EF5350 !important;
+}
+
+.red-text.text-lighten-1 {
+ color: #EF5350 !important;
+}
+
+.red.darken-1 {
+ background-color: #E53935 !important;
+}
+
+.red-text.text-darken-1 {
+ color: #E53935 !important;
+}
+
+.red.darken-2 {
+ background-color: #D32F2F !important;
+}
+
+.red-text.text-darken-2 {
+ color: #D32F2F !important;
+}
+
+.red.darken-3 {
+ background-color: #C62828 !important;
+}
+
+.red-text.text-darken-3 {
+ color: #C62828 !important;
+}
+
+.red.darken-4 {
+ background-color: #B71C1C !important;
+}
+
+.red-text.text-darken-4 {
+ color: #B71C1C !important;
+}
+
+.red.accent-1 {
+ background-color: #FF8A80 !important;
+}
+
+.red-text.text-accent-1 {
+ color: #FF8A80 !important;
+}
+
+.red.accent-2 {
+ background-color: #FF5252 !important;
+}
+
+.red-text.text-accent-2 {
+ color: #FF5252 !important;
+}
+
+.red.accent-3 {
+ background-color: #FF1744 !important;
+}
+
+.red-text.text-accent-3 {
+ color: #FF1744 !important;
+}
+
+.red.accent-4 {
+ background-color: #D50000 !important;
+}
+
+.red-text.text-accent-4 {
+ color: #D50000 !important;
+}
+
+.pink {
+ background-color: #e91e63 !important;
+}
+
+.pink-text {
+ color: #e91e63 !important;
+}
+
+.pink.lighten-5 {
+ background-color: #fce4ec !important;
+}
+
+.pink-text.text-lighten-5 {
+ color: #fce4ec !important;
+}
+
+.pink.lighten-4 {
+ background-color: #f8bbd0 !important;
+}
+
+.pink-text.text-lighten-4 {
+ color: #f8bbd0 !important;
+}
+
+.pink.lighten-3 {
+ background-color: #f48fb1 !important;
+}
+
+.pink-text.text-lighten-3 {
+ color: #f48fb1 !important;
+}
+
+.pink.lighten-2 {
+ background-color: #f06292 !important;
+}
+
+.pink-text.text-lighten-2 {
+ color: #f06292 !important;
+}
+
+.pink.lighten-1 {
+ background-color: #ec407a !important;
+}
+
+.pink-text.text-lighten-1 {
+ color: #ec407a !important;
+}
+
+.pink.darken-1 {
+ background-color: #d81b60 !important;
+}
+
+.pink-text.text-darken-1 {
+ color: #d81b60 !important;
+}
+
+.pink.darken-2 {
+ background-color: #c2185b !important;
+}
+
+.pink-text.text-darken-2 {
+ color: #c2185b !important;
+}
+
+.pink.darken-3 {
+ background-color: #ad1457 !important;
+}
+
+.pink-text.text-darken-3 {
+ color: #ad1457 !important;
+}
+
+.pink.darken-4 {
+ background-color: #880e4f !important;
+}
+
+.pink-text.text-darken-4 {
+ color: #880e4f !important;
+}
+
+.pink.accent-1 {
+ background-color: #ff80ab !important;
+}
+
+.pink-text.text-accent-1 {
+ color: #ff80ab !important;
+}
+
+.pink.accent-2 {
+ background-color: #ff4081 !important;
+}
+
+.pink-text.text-accent-2 {
+ color: #ff4081 !important;
+}
+
+.pink.accent-3 {
+ background-color: #f50057 !important;
+}
+
+.pink-text.text-accent-3 {
+ color: #f50057 !important;
+}
+
+.pink.accent-4 {
+ background-color: #c51162 !important;
+}
+
+.pink-text.text-accent-4 {
+ color: #c51162 !important;
+}
+
+.purple {
+ background-color: #9c27b0 !important;
+}
+
+.purple-text {
+ color: #9c27b0 !important;
+}
+
+.purple.lighten-5 {
+ background-color: #f3e5f5 !important;
+}
+
+.purple-text.text-lighten-5 {
+ color: #f3e5f5 !important;
+}
+
+.purple.lighten-4 {
+ background-color: #e1bee7 !important;
+}
+
+.purple-text.text-lighten-4 {
+ color: #e1bee7 !important;
+}
+
+.purple.lighten-3 {
+ background-color: #ce93d8 !important;
+}
+
+.purple-text.text-lighten-3 {
+ color: #ce93d8 !important;
+}
+
+.purple.lighten-2 {
+ background-color: #ba68c8 !important;
+}
+
+.purple-text.text-lighten-2 {
+ color: #ba68c8 !important;
+}
+
+.purple.lighten-1 {
+ background-color: #ab47bc !important;
+}
+
+.purple-text.text-lighten-1 {
+ color: #ab47bc !important;
+}
+
+.purple.darken-1 {
+ background-color: #8e24aa !important;
+}
+
+.purple-text.text-darken-1 {
+ color: #8e24aa !important;
+}
+
+.purple.darken-2 {
+ background-color: #7b1fa2 !important;
+}
+
+.purple-text.text-darken-2 {
+ color: #7b1fa2 !important;
+}
+
+.purple.darken-3 {
+ background-color: #6a1b9a !important;
+}
+
+.purple-text.text-darken-3 {
+ color: #6a1b9a !important;
+}
+
+.purple.darken-4 {
+ background-color: #4a148c !important;
+}
+
+.purple-text.text-darken-4 {
+ color: #4a148c !important;
+}
+
+.purple.accent-1 {
+ background-color: #ea80fc !important;
+}
+
+.purple-text.text-accent-1 {
+ color: #ea80fc !important;
+}
+
+.purple.accent-2 {
+ background-color: #e040fb !important;
+}
+
+.purple-text.text-accent-2 {
+ color: #e040fb !important;
+}
+
+.purple.accent-3 {
+ background-color: #d500f9 !important;
+}
+
+.purple-text.text-accent-3 {
+ color: #d500f9 !important;
+}
+
+.purple.accent-4 {
+ background-color: #aa00ff !important;
+}
+
+.purple-text.text-accent-4 {
+ color: #aa00ff !important;
+}
+
+.deep-purple {
+ background-color: #673ab7 !important;
+}
+
+.deep-purple-text {
+ color: #673ab7 !important;
+}
+
+.deep-purple.lighten-5 {
+ background-color: #ede7f6 !important;
+}
+
+.deep-purple-text.text-lighten-5 {
+ color: #ede7f6 !important;
+}
+
+.deep-purple.lighten-4 {
+ background-color: #d1c4e9 !important;
+}
+
+.deep-purple-text.text-lighten-4 {
+ color: #d1c4e9 !important;
+}
+
+.deep-purple.lighten-3 {
+ background-color: #b39ddb !important;
+}
+
+.deep-purple-text.text-lighten-3 {
+ color: #b39ddb !important;
+}
+
+.deep-purple.lighten-2 {
+ background-color: #9575cd !important;
+}
+
+.deep-purple-text.text-lighten-2 {
+ color: #9575cd !important;
+}
+
+.deep-purple.lighten-1 {
+ background-color: #7e57c2 !important;
+}
+
+.deep-purple-text.text-lighten-1 {
+ color: #7e57c2 !important;
+}
+
+.deep-purple.darken-1 {
+ background-color: #5e35b1 !important;
+}
+
+.deep-purple-text.text-darken-1 {
+ color: #5e35b1 !important;
+}
+
+.deep-purple.darken-2 {
+ background-color: #512da8 !important;
+}
+
+.deep-purple-text.text-darken-2 {
+ color: #512da8 !important;
+}
+
+.deep-purple.darken-3 {
+ background-color: #4527a0 !important;
+}
+
+.deep-purple-text.text-darken-3 {
+ color: #4527a0 !important;
+}
+
+.deep-purple.darken-4 {
+ background-color: #311b92 !important;
+}
+
+.deep-purple-text.text-darken-4 {
+ color: #311b92 !important;
+}
+
+.deep-purple.accent-1 {
+ background-color: #b388ff !important;
+}
+
+.deep-purple-text.text-accent-1 {
+ color: #b388ff !important;
+}
+
+.deep-purple.accent-2 {
+ background-color: #7c4dff !important;
+}
+
+.deep-purple-text.text-accent-2 {
+ color: #7c4dff !important;
+}
+
+.deep-purple.accent-3 {
+ background-color: #651fff !important;
+}
+
+.deep-purple-text.text-accent-3 {
+ color: #651fff !important;
+}
+
+.deep-purple.accent-4 {
+ background-color: #6200ea !important;
+}
+
+.deep-purple-text.text-accent-4 {
+ color: #6200ea !important;
+}
+
+.indigo {
+ background-color: #3f51b5 !important;
+}
+
+.indigo-text {
+ color: #3f51b5 !important;
+}
+
+.indigo.lighten-5 {
+ background-color: #e8eaf6 !important;
+}
+
+.indigo-text.text-lighten-5 {
+ color: #e8eaf6 !important;
+}
+
+.indigo.lighten-4 {
+ background-color: #c5cae9 !important;
+}
+
+.indigo-text.text-lighten-4 {
+ color: #c5cae9 !important;
+}
+
+.indigo.lighten-3 {
+ background-color: #9fa8da !important;
+}
+
+.indigo-text.text-lighten-3 {
+ color: #9fa8da !important;
+}
+
+.indigo.lighten-2 {
+ background-color: #7986cb !important;
+}
+
+.indigo-text.text-lighten-2 {
+ color: #7986cb !important;
+}
+
+.indigo.lighten-1 {
+ background-color: #5c6bc0 !important;
+}
+
+.indigo-text.text-lighten-1 {
+ color: #5c6bc0 !important;
+}
+
+.indigo.darken-1 {
+ background-color: #3949ab !important;
+}
+
+.indigo-text.text-darken-1 {
+ color: #3949ab !important;
+}
+
+.indigo.darken-2 {
+ background-color: #303f9f !important;
+}
+
+.indigo-text.text-darken-2 {
+ color: #303f9f !important;
+}
+
+.indigo.darken-3 {
+ background-color: #283593 !important;
+}
+
+.indigo-text.text-darken-3 {
+ color: #283593 !important;
+}
+
+.indigo.darken-4 {
+ background-color: #1a237e !important;
+}
+
+.indigo-text.text-darken-4 {
+ color: #1a237e !important;
+}
+
+.indigo.accent-1 {
+ background-color: #8c9eff !important;
+}
+
+.indigo-text.text-accent-1 {
+ color: #8c9eff !important;
+}
+
+.indigo.accent-2 {
+ background-color: #536dfe !important;
+}
+
+.indigo-text.text-accent-2 {
+ color: #536dfe !important;
+}
+
+.indigo.accent-3 {
+ background-color: #3d5afe !important;
+}
+
+.indigo-text.text-accent-3 {
+ color: #3d5afe !important;
+}
+
+.indigo.accent-4 {
+ background-color: #304ffe !important;
+}
+
+.indigo-text.text-accent-4 {
+ color: #304ffe !important;
+}
+
+.blue {
+ background-color: #2196F3 !important;
+}
+
+.blue-text {
+ color: #2196F3 !important;
+}
+
+.blue.lighten-5 {
+ background-color: #E3F2FD !important;
+}
+
+.blue-text.text-lighten-5 {
+ color: #E3F2FD !important;
+}
+
+.blue.lighten-4 {
+ background-color: #BBDEFB !important;
+}
+
+.blue-text.text-lighten-4 {
+ color: #BBDEFB !important;
+}
+
+.blue.lighten-3 {
+ background-color: #90CAF9 !important;
+}
+
+.blue-text.text-lighten-3 {
+ color: #90CAF9 !important;
+}
+
+.blue.lighten-2 {
+ background-color: #64B5F6 !important;
+}
+
+.blue-text.text-lighten-2 {
+ color: #64B5F6 !important;
+}
+
+.blue.lighten-1 {
+ background-color: #42A5F5 !important;
+}
+
+.blue-text.text-lighten-1 {
+ color: #42A5F5 !important;
+}
+
+.blue.darken-1 {
+ background-color: #1E88E5 !important;
+}
+
+.blue-text.text-darken-1 {
+ color: #1E88E5 !important;
+}
+
+.blue.darken-2 {
+ background-color: #1976D2 !important;
+}
+
+.blue-text.text-darken-2 {
+ color: #1976D2 !important;
+}
+
+.blue.darken-3 {
+ background-color: #1565C0 !important;
+}
+
+.blue-text.text-darken-3 {
+ color: #1565C0 !important;
+}
+
+.blue.darken-4 {
+ background-color: #0D47A1 !important;
+}
+
+.blue-text.text-darken-4 {
+ color: #0D47A1 !important;
+}
+
+.blue.accent-1 {
+ background-color: #82B1FF !important;
+}
+
+.blue-text.text-accent-1 {
+ color: #82B1FF !important;
+}
+
+.blue.accent-2 {
+ background-color: #448AFF !important;
+}
+
+.blue-text.text-accent-2 {
+ color: #448AFF !important;
+}
+
+.blue.accent-3 {
+ background-color: #2979FF !important;
+}
+
+.blue-text.text-accent-3 {
+ color: #2979FF !important;
+}
+
+.blue.accent-4 {
+ background-color: #2962FF !important;
+}
+
+.blue-text.text-accent-4 {
+ color: #2962FF !important;
+}
+
+.light-blue {
+ background-color: #03a9f4 !important;
+}
+
+.light-blue-text {
+ color: #03a9f4 !important;
+}
+
+.light-blue.lighten-5 {
+ background-color: #e1f5fe !important;
+}
+
+.light-blue-text.text-lighten-5 {
+ color: #e1f5fe !important;
+}
+
+.light-blue.lighten-4 {
+ background-color: #b3e5fc !important;
+}
+
+.light-blue-text.text-lighten-4 {
+ color: #b3e5fc !important;
+}
+
+.light-blue.lighten-3 {
+ background-color: #81d4fa !important;
+}
+
+.light-blue-text.text-lighten-3 {
+ color: #81d4fa !important;
+}
+
+.light-blue.lighten-2 {
+ background-color: #4fc3f7 !important;
+}
+
+.light-blue-text.text-lighten-2 {
+ color: #4fc3f7 !important;
+}
+
+.light-blue.lighten-1 {
+ background-color: #29b6f6 !important;
+}
+
+.light-blue-text.text-lighten-1 {
+ color: #29b6f6 !important;
+}
+
+.light-blue.darken-1 {
+ background-color: #039be5 !important;
+}
+
+.light-blue-text.text-darken-1 {
+ color: #039be5 !important;
+}
+
+.light-blue.darken-2 {
+ background-color: #0288d1 !important;
+}
+
+.light-blue-text.text-darken-2 {
+ color: #0288d1 !important;
+}
+
+.light-blue.darken-3 {
+ background-color: #0277bd !important;
+}
+
+.light-blue-text.text-darken-3 {
+ color: #0277bd !important;
+}
+
+.light-blue.darken-4 {
+ background-color: #01579b !important;
+}
+
+.light-blue-text.text-darken-4 {
+ color: #01579b !important;
+}
+
+.light-blue.accent-1 {
+ background-color: #80d8ff !important;
+}
+
+.light-blue-text.text-accent-1 {
+ color: #80d8ff !important;
+}
+
+.light-blue.accent-2 {
+ background-color: #40c4ff !important;
+}
+
+.light-blue-text.text-accent-2 {
+ color: #40c4ff !important;
+}
+
+.light-blue.accent-3 {
+ background-color: #00b0ff !important;
+}
+
+.light-blue-text.text-accent-3 {
+ color: #00b0ff !important;
+}
+
+.light-blue.accent-4 {
+ background-color: #0091ea !important;
+}
+
+.light-blue-text.text-accent-4 {
+ color: #0091ea !important;
+}
+
+.cyan {
+ background-color: #00bcd4 !important;
+}
+
+.cyan-text {
+ color: #00bcd4 !important;
+}
+
+.cyan.lighten-5 {
+ background-color: #e0f7fa !important;
+}
+
+.cyan-text.text-lighten-5 {
+ color: #e0f7fa !important;
+}
+
+.cyan.lighten-4 {
+ background-color: #b2ebf2 !important;
+}
+
+.cyan-text.text-lighten-4 {
+ color: #b2ebf2 !important;
+}
+
+.cyan.lighten-3 {
+ background-color: #80deea !important;
+}
+
+.cyan-text.text-lighten-3 {
+ color: #80deea !important;
+}
+
+.cyan.lighten-2 {
+ background-color: #4dd0e1 !important;
+}
+
+.cyan-text.text-lighten-2 {
+ color: #4dd0e1 !important;
+}
+
+.cyan.lighten-1 {
+ background-color: #26c6da !important;
+}
+
+.cyan-text.text-lighten-1 {
+ color: #26c6da !important;
+}
+
+.cyan.darken-1 {
+ background-color: #00acc1 !important;
+}
+
+.cyan-text.text-darken-1 {
+ color: #00acc1 !important;
+}
+
+.cyan.darken-2 {
+ background-color: #0097a7 !important;
+}
+
+.cyan-text.text-darken-2 {
+ color: #0097a7 !important;
+}
+
+.cyan.darken-3 {
+ background-color: #00838f !important;
+}
+
+.cyan-text.text-darken-3 {
+ color: #00838f !important;
+}
+
+.cyan.darken-4 {
+ background-color: #006064 !important;
+}
+
+.cyan-text.text-darken-4 {
+ color: #006064 !important;
+}
+
+.cyan.accent-1 {
+ background-color: #84ffff !important;
+}
+
+.cyan-text.text-accent-1 {
+ color: #84ffff !important;
+}
+
+.cyan.accent-2 {
+ background-color: #18ffff !important;
+}
+
+.cyan-text.text-accent-2 {
+ color: #18ffff !important;
+}
+
+.cyan.accent-3 {
+ background-color: #00e5ff !important;
+}
+
+.cyan-text.text-accent-3 {
+ color: #00e5ff !important;
+}
+
+.cyan.accent-4 {
+ background-color: #00b8d4 !important;
+}
+
+.cyan-text.text-accent-4 {
+ color: #00b8d4 !important;
+}
+
+.teal {
+ background-color: #009688 !important;
+}
+
+.teal-text {
+ color: #009688 !important;
+}
+
+.teal.lighten-5 {
+ background-color: #e0f2f1 !important;
+}
+
+.teal-text.text-lighten-5 {
+ color: #e0f2f1 !important;
+}
+
+.teal.lighten-4 {
+ background-color: #b2dfdb !important;
+}
+
+.teal-text.text-lighten-4 {
+ color: #b2dfdb !important;
+}
+
+.teal.lighten-3 {
+ background-color: #80cbc4 !important;
+}
+
+.teal-text.text-lighten-3 {
+ color: #80cbc4 !important;
+}
+
+.teal.lighten-2 {
+ background-color: #4db6ac !important;
+}
+
+.teal-text.text-lighten-2 {
+ color: #4db6ac !important;
+}
+
+.teal.lighten-1 {
+ background-color: #26a69a !important;
+}
+
+.teal-text.text-lighten-1 {
+ color: #26a69a !important;
+}
+
+.teal.darken-1 {
+ background-color: #00897b !important;
+}
+
+.teal-text.text-darken-1 {
+ color: #00897b !important;
+}
+
+.teal.darken-2 {
+ background-color: #00796b !important;
+}
+
+.teal-text.text-darken-2 {
+ color: #00796b !important;
+}
+
+.teal.darken-3 {
+ background-color: #00695c !important;
+}
+
+.teal-text.text-darken-3 {
+ color: #00695c !important;
+}
+
+.teal.darken-4 {
+ background-color: #004d40 !important;
+}
+
+.teal-text.text-darken-4 {
+ color: #004d40 !important;
+}
+
+.teal.accent-1 {
+ background-color: #a7ffeb !important;
+}
+
+.teal-text.text-accent-1 {
+ color: #a7ffeb !important;
+}
+
+.teal.accent-2 {
+ background-color: #64ffda !important;
+}
+
+.teal-text.text-accent-2 {
+ color: #64ffda !important;
+}
+
+.teal.accent-3 {
+ background-color: #1de9b6 !important;
+}
+
+.teal-text.text-accent-3 {
+ color: #1de9b6 !important;
+}
+
+.teal.accent-4 {
+ background-color: #00bfa5 !important;
+}
+
+.teal-text.text-accent-4 {
+ color: #00bfa5 !important;
+}
+
+.green {
+ background-color: #4CAF50 !important;
+}
+
+.green-text {
+ color: #4CAF50 !important;
+}
+
+.green.lighten-5 {
+ background-color: #E8F5E9 !important;
+}
+
+.green-text.text-lighten-5 {
+ color: #E8F5E9 !important;
+}
+
+.green.lighten-4 {
+ background-color: #C8E6C9 !important;
+}
+
+.green-text.text-lighten-4 {
+ color: #C8E6C9 !important;
+}
+
+.green.lighten-3 {
+ background-color: #A5D6A7 !important;
+}
+
+.green-text.text-lighten-3 {
+ color: #A5D6A7 !important;
+}
+
+.green.lighten-2 {
+ background-color: #81C784 !important;
+}
+
+.green-text.text-lighten-2 {
+ color: #81C784 !important;
+}
+
+.green.lighten-1 {
+ background-color: #66BB6A !important;
+}
+
+.green-text.text-lighten-1 {
+ color: #66BB6A !important;
+}
+
+.green.darken-1 {
+ background-color: #43A047 !important;
+}
+
+.green-text.text-darken-1 {
+ color: #43A047 !important;
+}
+
+.green.darken-2 {
+ background-color: #388E3C !important;
+}
+
+.green-text.text-darken-2 {
+ color: #388E3C !important;
+}
+
+.green.darken-3 {
+ background-color: #2E7D32 !important;
+}
+
+.green-text.text-darken-3 {
+ color: #2E7D32 !important;
+}
+
+.green.darken-4 {
+ background-color: #1B5E20 !important;
+}
+
+.green-text.text-darken-4 {
+ color: #1B5E20 !important;
+}
+
+.green.accent-1 {
+ background-color: #B9F6CA !important;
+}
+
+.green-text.text-accent-1 {
+ color: #B9F6CA !important;
+}
+
+.green.accent-2 {
+ background-color: #69F0AE !important;
+}
+
+.green-text.text-accent-2 {
+ color: #69F0AE !important;
+}
+
+.green.accent-3 {
+ background-color: #00E676 !important;
+}
+
+.green-text.text-accent-3 {
+ color: #00E676 !important;
+}
+
+.green.accent-4 {
+ background-color: #00C853 !important;
+}
+
+.green-text.text-accent-4 {
+ color: #00C853 !important;
+}
+
+.light-green {
+ background-color: #8bc34a !important;
+}
+
+.light-green-text {
+ color: #8bc34a !important;
+}
+
+.light-green.lighten-5 {
+ background-color: #f1f8e9 !important;
+}
+
+.light-green-text.text-lighten-5 {
+ color: #f1f8e9 !important;
+}
+
+.light-green.lighten-4 {
+ background-color: #dcedc8 !important;
+}
+
+.light-green-text.text-lighten-4 {
+ color: #dcedc8 !important;
+}
+
+.light-green.lighten-3 {
+ background-color: #c5e1a5 !important;
+}
+
+.light-green-text.text-lighten-3 {
+ color: #c5e1a5 !important;
+}
+
+.light-green.lighten-2 {
+ background-color: #aed581 !important;
+}
+
+.light-green-text.text-lighten-2 {
+ color: #aed581 !important;
+}
+
+.light-green.lighten-1 {
+ background-color: #9ccc65 !important;
+}
+
+.light-green-text.text-lighten-1 {
+ color: #9ccc65 !important;
+}
+
+.light-green.darken-1 {
+ background-color: #7cb342 !important;
+}
+
+.light-green-text.text-darken-1 {
+ color: #7cb342 !important;
+}
+
+.light-green.darken-2 {
+ background-color: #689f38 !important;
+}
+
+.light-green-text.text-darken-2 {
+ color: #689f38 !important;
+}
+
+.light-green.darken-3 {
+ background-color: #558b2f !important;
+}
+
+.light-green-text.text-darken-3 {
+ color: #558b2f !important;
+}
+
+.light-green.darken-4 {
+ background-color: #33691e !important;
+}
+
+.light-green-text.text-darken-4 {
+ color: #33691e !important;
+}
+
+.light-green.accent-1 {
+ background-color: #ccff90 !important;
+}
+
+.light-green-text.text-accent-1 {
+ color: #ccff90 !important;
+}
+
+.light-green.accent-2 {
+ background-color: #b2ff59 !important;
+}
+
+.light-green-text.text-accent-2 {
+ color: #b2ff59 !important;
+}
+
+.light-green.accent-3 {
+ background-color: #76ff03 !important;
+}
+
+.light-green-text.text-accent-3 {
+ color: #76ff03 !important;
+}
+
+.light-green.accent-4 {
+ background-color: #64dd17 !important;
+}
+
+.light-green-text.text-accent-4 {
+ color: #64dd17 !important;
+}
+
+.lime {
+ background-color: #cddc39 !important;
+}
+
+.lime-text {
+ color: #cddc39 !important;
+}
+
+.lime.lighten-5 {
+ background-color: #f9fbe7 !important;
+}
+
+.lime-text.text-lighten-5 {
+ color: #f9fbe7 !important;
+}
+
+.lime.lighten-4 {
+ background-color: #f0f4c3 !important;
+}
+
+.lime-text.text-lighten-4 {
+ color: #f0f4c3 !important;
+}
+
+.lime.lighten-3 {
+ background-color: #e6ee9c !important;
+}
+
+.lime-text.text-lighten-3 {
+ color: #e6ee9c !important;
+}
+
+.lime.lighten-2 {
+ background-color: #dce775 !important;
+}
+
+.lime-text.text-lighten-2 {
+ color: #dce775 !important;
+}
+
+.lime.lighten-1 {
+ background-color: #d4e157 !important;
+}
+
+.lime-text.text-lighten-1 {
+ color: #d4e157 !important;
+}
+
+.lime.darken-1 {
+ background-color: #c0ca33 !important;
+}
+
+.lime-text.text-darken-1 {
+ color: #c0ca33 !important;
+}
+
+.lime.darken-2 {
+ background-color: #afb42b !important;
+}
+
+.lime-text.text-darken-2 {
+ color: #afb42b !important;
+}
+
+.lime.darken-3 {
+ background-color: #9e9d24 !important;
+}
+
+.lime-text.text-darken-3 {
+ color: #9e9d24 !important;
+}
+
+.lime.darken-4 {
+ background-color: #827717 !important;
+}
+
+.lime-text.text-darken-4 {
+ color: #827717 !important;
+}
+
+.lime.accent-1 {
+ background-color: #f4ff81 !important;
+}
+
+.lime-text.text-accent-1 {
+ color: #f4ff81 !important;
+}
+
+.lime.accent-2 {
+ background-color: #eeff41 !important;
+}
+
+.lime-text.text-accent-2 {
+ color: #eeff41 !important;
+}
+
+.lime.accent-3 {
+ background-color: #c6ff00 !important;
+}
+
+.lime-text.text-accent-3 {
+ color: #c6ff00 !important;
+}
+
+.lime.accent-4 {
+ background-color: #aeea00 !important;
+}
+
+.lime-text.text-accent-4 {
+ color: #aeea00 !important;
+}
+
+.yellow {
+ background-color: #ffeb3b !important;
+}
+
+.yellow-text {
+ color: #ffeb3b !important;
+}
+
+.yellow.lighten-5 {
+ background-color: #fffde7 !important;
+}
+
+.yellow-text.text-lighten-5 {
+ color: #fffde7 !important;
+}
+
+.yellow.lighten-4 {
+ background-color: #fff9c4 !important;
+}
+
+.yellow-text.text-lighten-4 {
+ color: #fff9c4 !important;
+}
+
+.yellow.lighten-3 {
+ background-color: #fff59d !important;
+}
+
+.yellow-text.text-lighten-3 {
+ color: #fff59d !important;
+}
+
+.yellow.lighten-2 {
+ background-color: #fff176 !important;
+}
+
+.yellow-text.text-lighten-2 {
+ color: #fff176 !important;
+}
+
+.yellow.lighten-1 {
+ background-color: #ffee58 !important;
+}
+
+.yellow-text.text-lighten-1 {
+ color: #ffee58 !important;
+}
+
+.yellow.darken-1 {
+ background-color: #fdd835 !important;
+}
+
+.yellow-text.text-darken-1 {
+ color: #fdd835 !important;
+}
+
+.yellow.darken-2 {
+ background-color: #fbc02d !important;
+}
+
+.yellow-text.text-darken-2 {
+ color: #fbc02d !important;
+}
+
+.yellow.darken-3 {
+ background-color: #f9a825 !important;
+}
+
+.yellow-text.text-darken-3 {
+ color: #f9a825 !important;
+}
+
+.yellow.darken-4 {
+ background-color: #f57f17 !important;
+}
+
+.yellow-text.text-darken-4 {
+ color: #f57f17 !important;
+}
+
+.yellow.accent-1 {
+ background-color: #ffff8d !important;
+}
+
+.yellow-text.text-accent-1 {
+ color: #ffff8d !important;
+}
+
+.yellow.accent-2 {
+ background-color: #ffff00 !important;
+}
+
+.yellow-text.text-accent-2 {
+ color: #ffff00 !important;
+}
+
+.yellow.accent-3 {
+ background-color: #ffea00 !important;
+}
+
+.yellow-text.text-accent-3 {
+ color: #ffea00 !important;
+}
+
+.yellow.accent-4 {
+ background-color: #ffd600 !important;
+}
+
+.yellow-text.text-accent-4 {
+ color: #ffd600 !important;
+}
+
+.amber {
+ background-color: #ffc107 !important;
+}
+
+.amber-text {
+ color: #ffc107 !important;
+}
+
+.amber.lighten-5 {
+ background-color: #fff8e1 !important;
+}
+
+.amber-text.text-lighten-5 {
+ color: #fff8e1 !important;
+}
+
+.amber.lighten-4 {
+ background-color: #ffecb3 !important;
+}
+
+.amber-text.text-lighten-4 {
+ color: #ffecb3 !important;
+}
+
+.amber.lighten-3 {
+ background-color: #ffe082 !important;
+}
+
+.amber-text.text-lighten-3 {
+ color: #ffe082 !important;
+}
+
+.amber.lighten-2 {
+ background-color: #ffd54f !important;
+}
+
+.amber-text.text-lighten-2 {
+ color: #ffd54f !important;
+}
+
+.amber.lighten-1 {
+ background-color: #ffca28 !important;
+}
+
+.amber-text.text-lighten-1 {
+ color: #ffca28 !important;
+}
+
+.amber.darken-1 {
+ background-color: #ffb300 !important;
+}
+
+.amber-text.text-darken-1 {
+ color: #ffb300 !important;
+}
+
+.amber.darken-2 {
+ background-color: #ffa000 !important;
+}
+
+.amber-text.text-darken-2 {
+ color: #ffa000 !important;
+}
+
+.amber.darken-3 {
+ background-color: #ff8f00 !important;
+}
+
+.amber-text.text-darken-3 {
+ color: #ff8f00 !important;
+}
+
+.amber.darken-4 {
+ background-color: #ff6f00 !important;
+}
+
+.amber-text.text-darken-4 {
+ color: #ff6f00 !important;
+}
+
+.amber.accent-1 {
+ background-color: #ffe57f !important;
+}
+
+.amber-text.text-accent-1 {
+ color: #ffe57f !important;
+}
+
+.amber.accent-2 {
+ background-color: #ffd740 !important;
+}
+
+.amber-text.text-accent-2 {
+ color: #ffd740 !important;
+}
+
+.amber.accent-3 {
+ background-color: #ffc400 !important;
+}
+
+.amber-text.text-accent-3 {
+ color: #ffc400 !important;
+}
+
+.amber.accent-4 {
+ background-color: #ffab00 !important;
+}
+
+.amber-text.text-accent-4 {
+ color: #ffab00 !important;
+}
+
+.orange {
+ background-color: #ff9800 !important;
+}
+
+.orange-text {
+ color: #ff9800 !important;
+}
+
+.orange.lighten-5 {
+ background-color: #fff3e0 !important;
+}
+
+.orange-text.text-lighten-5 {
+ color: #fff3e0 !important;
+}
+
+.orange.lighten-4 {
+ background-color: #ffe0b2 !important;
+}
+
+.orange-text.text-lighten-4 {
+ color: #ffe0b2 !important;
+}
+
+.orange.lighten-3 {
+ background-color: #ffcc80 !important;
+}
+
+.orange-text.text-lighten-3 {
+ color: #ffcc80 !important;
+}
+
+.orange.lighten-2 {
+ background-color: #ffb74d !important;
+}
+
+.orange-text.text-lighten-2 {
+ color: #ffb74d !important;
+}
+
+.orange.lighten-1 {
+ background-color: #ffa726 !important;
+}
+
+.orange-text.text-lighten-1 {
+ color: #ffa726 !important;
+}
+
+.orange.darken-1 {
+ background-color: #fb8c00 !important;
+}
+
+.orange-text.text-darken-1 {
+ color: #fb8c00 !important;
+}
+
+.orange.darken-2 {
+ background-color: #f57c00 !important;
+}
+
+.orange-text.text-darken-2 {
+ color: #f57c00 !important;
+}
+
+.orange.darken-3 {
+ background-color: #ef6c00 !important;
+}
+
+.orange-text.text-darken-3 {
+ color: #ef6c00 !important;
+}
+
+.orange.darken-4 {
+ background-color: #e65100 !important;
+}
+
+.orange-text.text-darken-4 {
+ color: #e65100 !important;
+}
+
+.orange.accent-1 {
+ background-color: #ffd180 !important;
+}
+
+.orange-text.text-accent-1 {
+ color: #ffd180 !important;
+}
+
+.orange.accent-2 {
+ background-color: #ffab40 !important;
+}
+
+.orange-text.text-accent-2 {
+ color: #ffab40 !important;
+}
+
+.orange.accent-3 {
+ background-color: #ff9100 !important;
+}
+
+.orange-text.text-accent-3 {
+ color: #ff9100 !important;
+}
+
+.orange.accent-4 {
+ background-color: #ff6d00 !important;
+}
+
+.orange-text.text-accent-4 {
+ color: #ff6d00 !important;
+}
+
+.deep-orange {
+ background-color: #ff5722 !important;
+}
+
+.deep-orange-text {
+ color: #ff5722 !important;
+}
+
+.deep-orange.lighten-5 {
+ background-color: #fbe9e7 !important;
+}
+
+.deep-orange-text.text-lighten-5 {
+ color: #fbe9e7 !important;
+}
+
+.deep-orange.lighten-4 {
+ background-color: #ffccbc !important;
+}
+
+.deep-orange-text.text-lighten-4 {
+ color: #ffccbc !important;
+}
+
+.deep-orange.lighten-3 {
+ background-color: #ffab91 !important;
+}
+
+.deep-orange-text.text-lighten-3 {
+ color: #ffab91 !important;
+}
+
+.deep-orange.lighten-2 {
+ background-color: #ff8a65 !important;
+}
+
+.deep-orange-text.text-lighten-2 {
+ color: #ff8a65 !important;
+}
+
+.deep-orange.lighten-1 {
+ background-color: #ff7043 !important;
+}
+
+.deep-orange-text.text-lighten-1 {
+ color: #ff7043 !important;
+}
+
+.deep-orange.darken-1 {
+ background-color: #f4511e !important;
+}
+
+.deep-orange-text.text-darken-1 {
+ color: #f4511e !important;
+}
+
+.deep-orange.darken-2 {
+ background-color: #e64a19 !important;
+}
+
+.deep-orange-text.text-darken-2 {
+ color: #e64a19 !important;
+}
+
+.deep-orange.darken-3 {
+ background-color: #d84315 !important;
+}
+
+.deep-orange-text.text-darken-3 {
+ color: #d84315 !important;
+}
+
+.deep-orange.darken-4 {
+ background-color: #bf360c !important;
+}
+
+.deep-orange-text.text-darken-4 {
+ color: #bf360c !important;
+}
+
+.deep-orange.accent-1 {
+ background-color: #ff9e80 !important;
+}
+
+.deep-orange-text.text-accent-1 {
+ color: #ff9e80 !important;
+}
+
+.deep-orange.accent-2 {
+ background-color: #ff6e40 !important;
+}
+
+.deep-orange-text.text-accent-2 {
+ color: #ff6e40 !important;
+}
+
+.deep-orange.accent-3 {
+ background-color: #ff3d00 !important;
+}
+
+.deep-orange-text.text-accent-3 {
+ color: #ff3d00 !important;
+}
+
+.deep-orange.accent-4 {
+ background-color: #dd2c00 !important;
+}
+
+.deep-orange-text.text-accent-4 {
+ color: #dd2c00 !important;
+}
+
+.brown {
+ background-color: #795548 !important;
+}
+
+.brown-text {
+ color: #795548 !important;
+}
+
+.brown.lighten-5 {
+ background-color: #efebe9 !important;
+}
+
+.brown-text.text-lighten-5 {
+ color: #efebe9 !important;
+}
+
+.brown.lighten-4 {
+ background-color: #d7ccc8 !important;
+}
+
+.brown-text.text-lighten-4 {
+ color: #d7ccc8 !important;
+}
+
+.brown.lighten-3 {
+ background-color: #bcaaa4 !important;
+}
+
+.brown-text.text-lighten-3 {
+ color: #bcaaa4 !important;
+}
+
+.brown.lighten-2 {
+ background-color: #a1887f !important;
+}
+
+.brown-text.text-lighten-2 {
+ color: #a1887f !important;
+}
+
+.brown.lighten-1 {
+ background-color: #8d6e63 !important;
+}
+
+.brown-text.text-lighten-1 {
+ color: #8d6e63 !important;
+}
+
+.brown.darken-1 {
+ background-color: #6d4c41 !important;
+}
+
+.brown-text.text-darken-1 {
+ color: #6d4c41 !important;
+}
+
+.brown.darken-2 {
+ background-color: #5d4037 !important;
+}
+
+.brown-text.text-darken-2 {
+ color: #5d4037 !important;
+}
+
+.brown.darken-3 {
+ background-color: #4e342e !important;
+}
+
+.brown-text.text-darken-3 {
+ color: #4e342e !important;
+}
+
+.brown.darken-4 {
+ background-color: #3e2723 !important;
+}
+
+.brown-text.text-darken-4 {
+ color: #3e2723 !important;
+}
+
+.blue-grey {
+ background-color: #607d8b !important;
+}
+
+.blue-grey-text {
+ color: #607d8b !important;
+}
+
+.blue-grey.lighten-5 {
+ background-color: #eceff1 !important;
+}
+
+.blue-grey-text.text-lighten-5 {
+ color: #eceff1 !important;
+}
+
+.blue-grey.lighten-4 {
+ background-color: #cfd8dc !important;
+}
+
+.blue-grey-text.text-lighten-4 {
+ color: #cfd8dc !important;
+}
+
+.blue-grey.lighten-3 {
+ background-color: #b0bec5 !important;
+}
+
+.blue-grey-text.text-lighten-3 {
+ color: #b0bec5 !important;
+}
+
+.blue-grey.lighten-2 {
+ background-color: #90a4ae !important;
+}
+
+.blue-grey-text.text-lighten-2 {
+ color: #90a4ae !important;
+}
+
+.blue-grey.lighten-1 {
+ background-color: #78909c !important;
+}
+
+.blue-grey-text.text-lighten-1 {
+ color: #78909c !important;
+}
+
+.blue-grey.darken-1 {
+ background-color: #546e7a !important;
+}
+
+.blue-grey-text.text-darken-1 {
+ color: #546e7a !important;
+}
+
+.blue-grey.darken-2 {
+ background-color: #455a64 !important;
+}
+
+.blue-grey-text.text-darken-2 {
+ color: #455a64 !important;
+}
+
+.blue-grey.darken-3 {
+ background-color: #37474f !important;
+}
+
+.blue-grey-text.text-darken-3 {
+ color: #37474f !important;
+}
+
+.blue-grey.darken-4 {
+ background-color: #263238 !important;
+}
+
+.blue-grey-text.text-darken-4 {
+ color: #263238 !important;
+}
+
+.grey {
+ background-color: #9e9e9e !important;
+}
+
+.grey-text {
+ color: #9e9e9e !important;
+}
+
+.grey.lighten-5 {
+ background-color: #fafafa !important;
+}
+
+.grey-text.text-lighten-5 {
+ color: #fafafa !important;
+}
+
+.grey.lighten-4 {
+ background-color: #f5f5f5 !important;
+}
+
+.grey-text.text-lighten-4 {
+ color: #f5f5f5 !important;
+}
+
+.grey.lighten-3 {
+ background-color: #eeeeee !important;
+}
+
+.grey-text.text-lighten-3 {
+ color: #eeeeee !important;
+}
+
+.grey.lighten-2 {
+ background-color: #e0e0e0 !important;
+}
+
+.grey-text.text-lighten-2 {
+ color: #e0e0e0 !important;
+}
+
+.grey.lighten-1 {
+ background-color: #bdbdbd !important;
+}
+
+.grey-text.text-lighten-1 {
+ color: #bdbdbd !important;
+}
+
+.grey.darken-1 {
+ background-color: #757575 !important;
+}
+
+.grey-text.text-darken-1 {
+ color: #757575 !important;
+}
+
+.grey.darken-2 {
+ background-color: #616161 !important;
+}
+
+.grey-text.text-darken-2 {
+ color: #616161 !important;
+}
+
+.grey.darken-3 {
+ background-color: #424242 !important;
+}
+
+.grey-text.text-darken-3 {
+ color: #424242 !important;
+}
+
+.grey.darken-4 {
+ background-color: #212121 !important;
+}
+
+.grey-text.text-darken-4 {
+ color: #212121 !important;
+}
+
+.black {
+ background-color: #000000 !important;
+}
+
+.black-text {
+ color: #000000 !important;
+}
+
+.white {
+ background-color: #FFFFFF !important;
+}
+
+.white-text {
+ color: #FFFFFF !important;
+}
+
+.transparent {
+ background-color: transparent !important;
+}
+
+.transparent-text {
+ color: transparent !important;
+}
+
+/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
+/**
+ * 1. Set default font family to sans-serif.
+ * 2. Prevent iOS and IE text size adjust after device orientation change,
+ * without disabling user zoom.
+ */
+html {
+ font-family: sans-serif;
+ /* 1 */
+ -ms-text-size-adjust: 100%;
+ /* 2 */
+ -webkit-text-size-adjust: 100%;
+ /* 2 */
+}
+
+/**
+ * Remove default margin.
+ */
+body {
+ margin: 0;
+}
+
+/* HTML5 display definitions
+ ========================================================================== */
+/**
+ * Correct `block` display not defined for any HTML5 element in IE 8/9.
+ * Correct `block` display not defined for `details` or `summary` in IE 10/11
+ * and Firefox.
+ * Correct `block` display not defined for `main` in IE 11.
+ */
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+main,
+menu,
+nav,
+section,
+summary {
+ display: block;
+}
+
+/**
+ * 1. Correct `inline-block` display not defined in IE 8/9.
+ * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera.
+ */
+audio,
+canvas,
+progress,
+video {
+ display: inline-block;
+ /* 1 */
+ vertical-align: baseline;
+ /* 2 */
+}
+
+/**
+ * Prevent modern browsers from displaying `audio` without controls.
+ * Remove excess height in iOS 5 devices.
+ */
+audio:not([controls]) {
+ display: none;
+ height: 0;
+}
+
+/**
+ * Address `[hidden]` styling not present in IE 8/9/10.
+ * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22.
+ */
+[hidden],
+template {
+ display: none;
+}
+
+/* Links
+ ========================================================================== */
+/**
+ * Remove the gray background color from active links in IE 10.
+ */
+a {
+ background-color: transparent;
+}
+
+/**
+ * Improve readability of focused elements when they are also in an
+ * active/hover state.
+ */
+a:active,
+a:hover {
+ outline: 0;
+}
+
+/* Text-level semantics
+ ========================================================================== */
+/**
+ * Address styling not present in IE 8/9/10/11, Safari, and Chrome.
+ */
+abbr[title] {
+ border-bottom: 1px dotted;
+}
+
+/**
+ * Address style set to `bolder` in Firefox 4+, Safari, and Chrome.
+ */
+b,
+strong {
+ font-weight: bold;
+}
+
+/**
+ * Address styling not present in Safari and Chrome.
+ */
+dfn {
+ font-style: italic;
+}
+
+/**
+ * Address variable `h1` font-size and margin within `section` and `article`
+ * contexts in Firefox 4+, Safari, and Chrome.
+ */
+h1 {
+ font-size: 2em;
+ margin: 0.67em 0;
+}
+
+/**
+ * Address styling not present in IE 8/9.
+ */
+mark {
+ background: #ff0;
+ color: #000;
+}
+
+/**
+ * Address inconsistent and variable font size in all browsers.
+ */
+small {
+ font-size: 80%;
+}
+
+/**
+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
+ */
+sub,
+sup {
+ font-size: 75%;
+ line-height: 0;
+ position: relative;
+ vertical-align: baseline;
+}
+
+sup {
+ top: -0.5em;
+}
+
+sub {
+ bottom: -0.25em;
+}
+
+/* Embedded content
+ ========================================================================== */
+/**
+ * Remove border when inside `a` element in IE 8/9/10.
+ */
+img {
+ border: 0;
+}
+
+/**
+ * Correct overflow not hidden in IE 9/10/11.
+ */
+svg:not(:root) {
+ overflow: hidden;
+}
+
+/* Grouping content
+ ========================================================================== */
+/**
+ * Address margin not present in IE 8/9 and Safari.
+ */
+figure {
+ margin: 1em 40px;
+}
+
+/**
+ * Address differences between Firefox and other browsers.
+ */
+hr {
+ -webkit-box-sizing: content-box;
+ box-sizing: content-box;
+ height: 0;
+}
+
+/**
+ * Contain overflow in all browsers.
+ */
+pre {
+ overflow: auto;
+}
+
+/**
+ * Address odd `em`-unit font size rendering in all browsers.
+ */
+code,
+kbd,
+pre,
+samp {
+ font-family: monospace, monospace;
+ font-size: 1em;
+}
+
+/* Forms
+ ========================================================================== */
+/**
+ * Known limitation: by default, Chrome and Safari on OS X allow very limited
+ * styling of `select`, unless a `border` property is set.
+ */
+/**
+ * 1. Correct color not being inherited.
+ * Known issue: affects color of disabled elements.
+ * 2. Correct font properties not being inherited.
+ * 3. Address margins set differently in Firefox 4+, Safari, and Chrome.
+ */
+button,
+input,
+optgroup,
+select,
+textarea {
+ color: inherit;
+ /* 1 */
+ font: inherit;
+ /* 2 */
+ margin: 0;
+ /* 3 */
+}
+
+/**
+ * Address `overflow` set to `hidden` in IE 8/9/10/11.
+ */
+button {
+ overflow: visible;
+}
+
+/**
+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
+ * All other form control elements do not inherit `text-transform` values.
+ * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera.
+ * Correct `select` style inheritance in Firefox.
+ */
+button,
+select {
+ text-transform: none;
+}
+
+/**
+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
+ * and `video` controls.
+ * 2. Correct inability to style clickable `input` types in iOS.
+ * 3. Improve usability and consistency of cursor style between image-type
+ * `input` and others.
+ */
+button,
+html input[type="button"],
+input[type="reset"],
+input[type="submit"] {
+ -webkit-appearance: button;
+ /* 2 */
+ cursor: pointer;
+ /* 3 */
+}
+
+/**
+ * Re-set default cursor for disabled elements.
+ */
+button[disabled],
+html input[disabled] {
+ cursor: default;
+}
+
+/**
+ * Remove inner padding and border in Firefox 4+.
+ */
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+ border: 0;
+ padding: 0;
+}
+
+/**
+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
+ * the UA stylesheet.
+ */
+input {
+ line-height: normal;
+}
+
+/**
+ * It's recommended that you don't attempt to style these elements.
+ * Firefox's implementation doesn't respect box-sizing, padding, or width.
+ *
+ * 1. Address box sizing set to `content-box` in IE 8/9/10.
+ * 2. Remove excess padding in IE 8/9/10.
+ */
+input[type="checkbox"],
+input[type="radio"] {
+ -webkit-box-sizing: border-box;
+ box-sizing: border-box;
+ /* 1 */
+ padding: 0;
+ /* 2 */
+}
+
+/**
+ * Fix the cursor style for Chrome's increment/decrement buttons. For certain
+ * `font-size` values of the `input`, it causes the cursor style of the
+ * decrement button to change from `default` to `text`.
+ */
+input[type="number"]::-webkit-inner-spin-button,
+input[type="number"]::-webkit-outer-spin-button {
+ height: auto;
+}
+
+/**
+ * 1. Address `appearance` set to `searchfield` in Safari and Chrome.
+ * 2. Address `box-sizing` set to `border-box` in Safari and Chrome.
+ */
+input[type="search"] {
+ -webkit-appearance: textfield;
+ /* 1 */
+ -webkit-box-sizing: content-box;
+ box-sizing: content-box;
+ /* 2 */
+}
+
+/**
+ * Remove inner padding and search cancel button in Safari and Chrome on OS X.
+ * Safari (but not Chrome) clips the cancel button when the search input has
+ * padding (and `textfield` appearance).
+ */
+input[type="search"]::-webkit-search-cancel-button,
+input[type="search"]::-webkit-search-decoration {
+ -webkit-appearance: none;
+}
+
+/**
+ * Define consistent border, margin, and padding.
+ */
+fieldset {
+ border: 1px solid #c0c0c0;
+ margin: 0 2px;
+ padding: 0.35em 0.625em 0.75em;
+}
+
+/**
+ * 1. Correct `color` not being inherited in IE 8/9/10/11.
+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
+ */
+legend {
+ border: 0;
+ /* 1 */
+ padding: 0;
+ /* 2 */
+}
+
+/**
+ * Remove default vertical scrollbar in IE 8/9/10/11.
+ */
+textarea {
+ overflow: auto;
+}
+
+/**
+ * Don't inherit the `font-weight` (applied by a rule above).
+ * NOTE: the default cannot safely be changed in Chrome and Safari on OS X.
+ */
+optgroup {
+ font-weight: bold;
+}
+
+/* Tables
+ ========================================================================== */
+/**
+ * Remove most spacing between table cells.
+ */
+table {
+ border-collapse: collapse;
+ border-spacing: 0;
+}
+
+td,
+th {
+ padding: 0;
+}
+
+html {
+ -webkit-box-sizing: border-box;
+ box-sizing: border-box;
+}
+
+*, *:before, *:after {
+ -webkit-box-sizing: inherit;
+ box-sizing: inherit;
+}
+
+ul:not(.browser-default) {
+ padding-left: 0;
+ list-style-type: none;
+}
+
+ul:not(.browser-default) > li {
+ list-style-type: none;
+}
+
+a {
+ color: #039be5;
+ text-decoration: none;
+ -webkit-tap-highlight-color: transparent;
+}
+
+.valign-wrapper {
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -webkit-align-items: center;
+ -ms-flex-align: center;
+ align-items: center;
+}
+
+.clearfix {
+ clear: both;
+}
+
+.z-depth-0 {
+ -webkit-box-shadow: none !important;
+ box-shadow: none !important;
+}
+
+.z-depth-1, nav, .card-panel, .card, .toast, .btn, .btn-large, .btn-floating, .dropdown-content, .collapsible, .side-nav {
+ -webkit-box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+ box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+}
+
+.z-depth-1-half, .btn:hover, .btn-large:hover, .btn-floating:hover {
+ -webkit-box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2);
+ box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2);
+}
+
+.z-depth-2 {
+ -webkit-box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3);
+ box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-3 {
+ -webkit-box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3);
+ box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-4, .modal {
+ -webkit-box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3);
+ box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-5 {
+ -webkit-box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3);
+ box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3);
+}
+
+.hoverable {
+ -webkit-transition: -webkit-box-shadow .25s;
+ transition: -webkit-box-shadow .25s;
+ transition: box-shadow .25s;
+ transition: box-shadow .25s, -webkit-box-shadow .25s;
+}
+
+.hoverable:hover {
+ -webkit-box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+ box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+}
+
+.divider {
+ height: 1px;
+ overflow: hidden;
+ background-color: #e0e0e0;
+}
+
+blockquote {
+ margin: 20px 0;
+ padding-left: 1.5rem;
+ border-left: 5px solid #ee6e73;
+}
+
+i {
+ line-height: inherit;
+}
+
+i.left {
+ float: left;
+ margin-right: 15px;
+}
+
+i.right {
+ float: right;
+ margin-left: 15px;
+}
+
+i.tiny {
+ font-size: 1rem;
+}
+
+i.small {
+ font-size: 2rem;
+}
+
+i.medium {
+ font-size: 4rem;
+}
+
+i.large {
+ font-size: 6rem;
+}
+
+img.responsive-img,
+video.responsive-video {
+ max-width: 100%;
+ height: auto;
+}
+
+.pagination li {
+ display: inline-block;
+ border-radius: 2px;
+ text-align: center;
+ vertical-align: top;
+ height: 30px;
+}
+
+.pagination li a {
+ color: #444;
+ display: inline-block;
+ font-size: 1.2rem;
+ padding: 0 10px;
+ line-height: 30px;
+}
+
+.pagination li.active a {
+ color: #fff;
+}
+
+.pagination li.active {
+ background-color: #ee6e73;
+}
+
+.pagination li.disabled a {
+ cursor: default;
+ color: #999;
+}
+
+.pagination li i {
+ font-size: 2rem;
+}
+
+.pagination li.pages ul li {
+ display: inline-block;
+ float: none;
+}
+
+@media only screen and (max-width: 992px) {
+ .pagination {
+ width: 100%;
+ }
+ .pagination li.prev,
+ .pagination li.next {
+ width: 10%;
+ }
+ .pagination li.pages {
+ width: 80%;
+ overflow: hidden;
+ white-space: nowrap;
+ }
+}
+
+.breadcrumb {
+ font-size: 18px;
+ color: rgba(255, 255, 255, 0.7);
+}
+
+.breadcrumb i,
+.breadcrumb [class^="mdi-"], .breadcrumb [class*="mdi-"],
+.breadcrumb i.material-icons {
+ display: inline-block;
+ float: left;
+ font-size: 24px;
+}
+
+.breadcrumb:before {
+ content: '\E5CC';
+ color: rgba(255, 255, 255, 0.7);
+ vertical-align: top;
+ display: inline-block;
+ font-family: 'Material Icons';
+ font-weight: normal;
+ font-style: normal;
+ font-size: 25px;
+ margin: 0 10px 0 8px;
+ -webkit-font-smoothing: antialiased;
+}
+
+.breadcrumb:first-child:before {
+ display: none;
+}
+
+.breadcrumb:last-child {
+ color: #fff;
+}
+
+.parallax-container {
+ position: relative;
+ overflow: hidden;
+ height: 500px;
+}
+
+.parallax-container .parallax {
+ position: absolute;
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ z-index: -1;
+}
+
+.parallax-container .parallax img {
+ display: none;
+ position: absolute;
+ left: 50%;
+ bottom: 0;
+ min-width: 100%;
+ min-height: 100%;
+ -webkit-transform: translate3d(0, 0, 0);
+ transform: translate3d(0, 0, 0);
+ -webkit-transform: translateX(-50%);
+ transform: translateX(-50%);
+}
+
+.pin-top, .pin-bottom {
+ position: relative;
+}
+
+.pinned {
+ position: fixed !important;
+}
+
+/*********************
+ Transition Classes
+**********************/
+ul.staggered-list li {
+ opacity: 0;
+}
+
+.fade-in {
+ opacity: 0;
+ -webkit-transform-origin: 0 50%;
+ transform-origin: 0 50%;
+}
+
+/*********************
+ Media Query Classes
+**********************/
+@media only screen and (max-width: 600px) {
+ .hide-on-small-only, .hide-on-small-and-down {
+ display: none !important;
+ }
+}
+
+@media only screen and (max-width: 992px) {
+ .hide-on-med-and-down {
+ display: none !important;
+ }
+}
+
+@media only screen and (min-width: 601px) {
+ .hide-on-med-and-up {
+ display: none !important;
+ }
+}
+
+@media only screen and (min-width: 600px) and (max-width: 992px) {
+ .hide-on-med-only {
+ display: none !important;
+ }
+}
+
+@media only screen and (min-width: 993px) {
+ .hide-on-large-only {
+ display: none !important;
+ }
+}
+
+@media only screen and (min-width: 993px) {
+ .show-on-large {
+ display: block !important;
+ }
+}
+
+@media only screen and (min-width: 600px) and (max-width: 992px) {
+ .show-on-medium {
+ display: block !important;
+ }
+}
+
+@media only screen and (max-width: 600px) {
+ .show-on-small {
+ display: block !important;
+ }
+}
+
+@media only screen and (min-width: 601px) {
+ .show-on-medium-and-up {
+ display: block !important;
+ }
+}
+
+@media only screen and (max-width: 992px) {
+ .show-on-medium-and-down {
+ display: block !important;
+ }
+}
+
+@media only screen and (max-width: 600px) {
+ .center-on-small-only {
+ text-align: center;
+ }
+}
+
+.page-footer {
+ padding-top: 20px;
+ color: #fff;
+ background-color: #ee6e73;
+}
+
+.page-footer .footer-copyright {
+ overflow: hidden;
+ min-height: 50px;
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -webkit-align-items: center;
+ -ms-flex-align: center;
+ align-items: center;
+ padding: 10px 0px;
+ color: rgba(255, 255, 255, 0.8);
+ background-color: rgba(51, 51, 51, 0.08);
+}
+
+table, th, td {
+ border: none;
+}
+
+table {
+ width: 100%;
+ display: table;
+}
+
+table.bordered > thead > tr,
+table.bordered > tbody > tr {
+ border-bottom: 1px solid #d0d0d0;
+}
+
+table.striped > tbody > tr:nth-child(odd) {
+ background-color: #f2f2f2;
+}
+
+table.striped > tbody > tr > td {
+ border-radius: 0;
+}
+
+table.highlight > tbody > tr {
+ -webkit-transition: background-color .25s ease;
+ transition: background-color .25s ease;
+}
+
+table.highlight > tbody > tr:hover {
+ background-color: #f2f2f2;
+}
+
+table.centered thead tr th, table.centered tbody tr td {
+ text-align: center;
+}
+
+thead {
+ border-bottom: 1px solid #d0d0d0;
+}
+
+td, th {
+ padding: 15px 5px;
+ display: table-cell;
+ text-align: left;
+ vertical-align: middle;
+ border-radius: 2px;
+}
+
+@media only screen and (max-width: 992px) {
+ table.responsive-table {
+ width: 100%;
+ border-collapse: collapse;
+ border-spacing: 0;
+ display: block;
+ position: relative;
+ /* sort out borders */
+ }
+ table.responsive-table td:empty:before {
+ content: '\00a0';
+ }
+ table.responsive-table th,
+ table.responsive-table td {
+ margin: 0;
+ vertical-align: top;
+ }
+ table.responsive-table th {
+ text-align: left;
+ }
+ table.responsive-table thead {
+ display: block;
+ float: left;
+ }
+ table.responsive-table thead tr {
+ display: block;
+ padding: 0 10px 0 0;
+ }
+ table.responsive-table thead tr th::before {
+ content: "\00a0";
+ }
+ table.responsive-table tbody {
+ display: block;
+ width: auto;
+ position: relative;
+ overflow-x: auto;
+ white-space: nowrap;
+ }
+ table.responsive-table tbody tr {
+ display: inline-block;
+ vertical-align: top;
+ }
+ table.responsive-table th {
+ display: block;
+ text-align: right;
+ }
+ table.responsive-table td {
+ display: block;
+ min-height: 1.25em;
+ text-align: left;
+ }
+ table.responsive-table tr {
+ padding: 0 10px;
+ }
+ table.responsive-table thead {
+ border: 0;
+ border-right: 1px solid #d0d0d0;
+ }
+ table.responsive-table.bordered th {
+ border-bottom: 0;
+ border-left: 0;
+ }
+ table.responsive-table.bordered td {
+ border-left: 0;
+ border-right: 0;
+ border-bottom: 0;
+ }
+ table.responsive-table.bordered tr {
+ border: 0;
+ }
+ table.responsive-table.bordered tbody tr {
+ border-right: 1px solid #d0d0d0;
+ }
+}
+
+.collection {
+ margin: 0.5rem 0 1rem 0;
+ border: 1px solid #e0e0e0;
+ border-radius: 2px;
+ overflow: hidden;
+ position: relative;
+}
+
+.collection .collection-item {
+ background-color: #fff;
+ line-height: 1.5rem;
+ padding: 10px 20px;
+ margin: 0;
+ border-bottom: 1px solid #e0e0e0;
+}
+
+.collection .collection-item.avatar {
+ min-height: 84px;
+ padding-left: 72px;
+ position: relative;
+}
+
+.collection .collection-item.avatar:not(.circle-clipper) > .circle,
+.collection .collection-item.avatar :not(.circle-clipper) > .circle {
+ position: absolute;
+ width: 42px;
+ height: 42px;
+ overflow: hidden;
+ left: 15px;
+ display: inline-block;
+ vertical-align: middle;
+}
+
+.collection .collection-item.avatar i.circle {
+ font-size: 18px;
+ line-height: 42px;
+ color: #fff;
+ background-color: #999;
+ text-align: center;
+}
+
+.collection .collection-item.avatar .title {
+ font-size: 16px;
+}
+
+.collection .collection-item.avatar p {
+ margin: 0;
+}
+
+.collection .collection-item.avatar .secondary-content {
+ position: absolute;
+ top: 16px;
+ right: 16px;
+}
+
+.collection .collection-item:last-child {
+ border-bottom: none;
+}
+
+.collection .collection-item.active {
+ background-color: #26a69a;
+ color: #eafaf9;
+}
+
+.collection .collection-item.active .secondary-content {
+ color: #fff;
+}
+
+.collection a.collection-item {
+ display: block;
+ -webkit-transition: .25s;
+ transition: .25s;
+ color: #26a69a;
+}
+
+.collection a.collection-item:not(.active):hover {
+ background-color: #ddd;
+}
+
+.collection.with-header .collection-header {
+ background-color: #fff;
+ border-bottom: 1px solid #e0e0e0;
+ padding: 10px 20px;
+}
+
+.collection.with-header .collection-item {
+ padding-left: 30px;
+}
+
+.collection.with-header .collection-item.avatar {
+ padding-left: 72px;
+}
+
+.secondary-content {
+ float: right;
+ color: #26a69a;
+}
+
+.collapsible .collection {
+ margin: 0;
+ border: none;
+}
+
+.video-container {
+ position: relative;
+ padding-bottom: 56.25%;
+ height: 0;
+ overflow: hidden;
+}
+
+.video-container iframe, .video-container object, .video-container embed {
+ position: absolute;
+ top: 0;
+ left: 0;
+ width: 100%;
+ height: 100%;
+}
+
+.progress {
+ position: relative;
+ height: 4px;
+ display: block;
+ width: 100%;
+ background-color: #acece6;
+ border-radius: 2px;
+ margin: 0.5rem 0 1rem 0;
+ overflow: hidden;
+}
+
+.progress .determinate {
+ position: absolute;
+ top: 0;
+ left: 0;
+ bottom: 0;
+ background-color: #26a69a;
+ -webkit-transition: width .3s linear;
+ transition: width .3s linear;
+}
+
+.progress .indeterminate {
+ background-color: #26a69a;
+}
+
+.progress .indeterminate:before {
+ content: '';
+ position: absolute;
+ background-color: inherit;
+ top: 0;
+ left: 0;
+ bottom: 0;
+ will-change: left, right;
+ -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
+ animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
+}
+
+.progress .indeterminate:after {
+ content: '';
+ position: absolute;
+ background-color: inherit;
+ top: 0;
+ left: 0;
+ bottom: 0;
+ will-change: left, right;
+ -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
+ animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
+ -webkit-animation-delay: 1.15s;
+ animation-delay: 1.15s;
+}
+
+@-webkit-keyframes indeterminate {
+ 0% {
+ left: -35%;
+ right: 100%;
+ }
+ 60% {
+ left: 100%;
+ right: -90%;
+ }
+ 100% {
+ left: 100%;
+ right: -90%;
+ }
+}
+
+@keyframes indeterminate {
+ 0% {
+ left: -35%;
+ right: 100%;
+ }
+ 60% {
+ left: 100%;
+ right: -90%;
+ }
+ 100% {
+ left: 100%;
+ right: -90%;
+ }
+}
+
+@-webkit-keyframes indeterminate-short {
+ 0% {
+ left: -200%;
+ right: 100%;
+ }
+ 60% {
+ left: 107%;
+ right: -8%;
+ }
+ 100% {
+ left: 107%;
+ right: -8%;
+ }
+}
+
+@keyframes indeterminate-short {
+ 0% {
+ left: -200%;
+ right: 100%;
+ }
+ 60% {
+ left: 107%;
+ right: -8%;
+ }
+ 100% {
+ left: 107%;
+ right: -8%;
+ }
+}
+
+/*******************
+ Utility Classes
+*******************/
+.hide {
+ display: none !important;
+}
+
+.left-align {
+ text-align: left;
+}
+
+.right-align {
+ text-align: right;
+}
+
+.center, .center-align {
+ text-align: center;
+}
+
+.left {
+ float: left !important;
+}
+
+.right {
+ float: right !important;
+}
+
+.no-select, input[type=range],
+input[type=range] + .thumb {
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+}
+
+.circle {
+ border-radius: 50%;
+}
+
+.center-block {
+ display: block;
+ margin-left: auto;
+ margin-right: auto;
+}
+
+.truncate {
+ display: block;
+ white-space: nowrap;
+ overflow: hidden;
+ text-overflow: ellipsis;
+}
+
+.no-padding {
+ padding: 0 !important;
+}
+
+span.badge {
+ min-width: 3rem;
+ padding: 0 6px;
+ margin-left: 14px;
+ text-align: center;
+ font-size: 1rem;
+ line-height: 22px;
+ height: 22px;
+ color: #757575;
+ float: right;
+ -webkit-box-sizing: border-box;
+ box-sizing: border-box;
+}
+
+span.badge.new {
+ font-weight: 300;
+ font-size: 0.8rem;
+ color: #fff;
+ background-color: #26a69a;
+ border-radius: 2px;
+}
+
+span.badge.new:after {
+ content: " new";
+}
+
+span.badge[data-badge-caption]::after {
+ content: " " attr(data-badge-caption);
+}
+
+nav ul a span.badge {
+ display: inline-block;
+ float: none;
+ margin-left: 4px;
+ line-height: 22px;
+ height: 22px;
+ -webkit-font-smoothing: auto;
+}
+
+.collection-item span.badge {
+ margin-top: calc(0.75rem - 11px);
+}
+
+.collapsible span.badge {
+ margin-left: auto;
+}
+
+.side-nav span.badge {
+ margin-top: calc(24px - 11px);
+}
+
+/* This is needed for some mobile phones to display the Google Icon font properly */
+.material-icons {
+ text-rendering: optimizeLegibility;
+ -webkit-font-feature-settings: 'liga';
+ -moz-font-feature-settings: 'liga';
+ font-feature-settings: 'liga';
+}
+
+.container {
+ margin: 0 auto;
+ max-width: 1280px;
+ width: 90%;
+}
+
+@media only screen and (min-width: 601px) {
+ .container {
+ width: 85%;
+ }
+}
+
+@media only screen and (min-width: 993px) {
+ .container {
+ width: 70%;
+ }
+}
+
+.container .row {
+ margin-left: -0.75rem;
+ margin-right: -0.75rem;
+}
+
+.section {
+ padding-top: 1rem;
+ padding-bottom: 1rem;
+}
+
+.section.no-pad {
+ padding: 0;
+}
+
+.section.no-pad-bot {
+ padding-bottom: 0;
+}
+
+.section.no-pad-top {
+ padding-top: 0;
+}
+
+.row {
+ margin-left: auto;
+ margin-right: auto;
+ margin-bottom: 20px;
+}
+
+.row:after {
+ content: "";
+ display: table;
+ clear: both;
+}
+
+.row .col {
+ float: left;
+ -webkit-box-sizing: border-box;
+ box-sizing: border-box;
+ padding: 0 0.75rem;
+ min-height: 1px;
+}
+
+.row .col[class*="push-"], .row .col[class*="pull-"] {
+ position: relative;
+}
+
+.row .col.s1 {
+ width: 8.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s2 {
+ width: 16.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s3 {
+ width: 25%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s4 {
+ width: 33.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s5 {
+ width: 41.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s6 {
+ width: 50%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s7 {
+ width: 58.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s8 {
+ width: 66.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s9 {
+ width: 75%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s10 {
+ width: 83.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s11 {
+ width: 91.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.s12 {
+ width: 100%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+
+.row .col.offset-s1 {
+ margin-left: 8.3333333333%;
+}
+
+.row .col.pull-s1 {
+ right: 8.3333333333%;
+}
+
+.row .col.push-s1 {
+ left: 8.3333333333%;
+}
+
+.row .col.offset-s2 {
+ margin-left: 16.6666666667%;
+}
+
+.row .col.pull-s2 {
+ right: 16.6666666667%;
+}
+
+.row .col.push-s2 {
+ left: 16.6666666667%;
+}
+
+.row .col.offset-s3 {
+ margin-left: 25%;
+}
+
+.row .col.pull-s3 {
+ right: 25%;
+}
+
+.row .col.push-s3 {
+ left: 25%;
+}
+
+.row .col.offset-s4 {
+ margin-left: 33.3333333333%;
+}
+
+.row .col.pull-s4 {
+ right: 33.3333333333%;
+}
+
+.row .col.push-s4 {
+ left: 33.3333333333%;
+}
+
+.row .col.offset-s5 {
+ margin-left: 41.6666666667%;
+}
+
+.row .col.pull-s5 {
+ right: 41.6666666667%;
+}
+
+.row .col.push-s5 {
+ left: 41.6666666667%;
+}
+
+.row .col.offset-s6 {
+ margin-left: 50%;
+}
+
+.row .col.pull-s6 {
+ right: 50%;
+}
+
+.row .col.push-s6 {
+ left: 50%;
+}
+
+.row .col.offset-s7 {
+ margin-left: 58.3333333333%;
+}
+
+.row .col.pull-s7 {
+ right: 58.3333333333%;
+}
+
+.row .col.push-s7 {
+ left: 58.3333333333%;
+}
+
+.row .col.offset-s8 {
+ margin-left: 66.6666666667%;
+}
+
+.row .col.pull-s8 {
+ right: 66.6666666667%;
+}
+
+.row .col.push-s8 {
+ left: 66.6666666667%;
+}
+
+.row .col.offset-s9 {
+ margin-left: 75%;
+}
+
+.row .col.pull-s9 {
+ right: 75%;
+}
+
+.row .col.push-s9 {
+ left: 75%;
+}
+
+.row .col.offset-s10 {
+ margin-left: 83.3333333333%;
+}
+
+.row .col.pull-s10 {
+ right: 83.3333333333%;
+}
+
+.row .col.push-s10 {
+ left: 83.3333333333%;
+}
+
+.row .col.offset-s11 {
+ margin-left: 91.6666666667%;
+}
+
+.row .col.pull-s11 {
+ right: 91.6666666667%;
+}
+
+.row .col.push-s11 {
+ left: 91.6666666667%;
+}
+
+.row .col.offset-s12 {
+ margin-left: 100%;
+}
+
+.row .col.pull-s12 {
+ right: 100%;
+}
+
+.row .col.push-s12 {
+ left: 100%;
+}
+
+@media only screen and (min-width: 601px) {
+ .row .col.m1 {
+ width: 8.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m2 {
+ width: 16.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m3 {
+ width: 25%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m4 {
+ width: 33.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m5 {
+ width: 41.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m6 {
+ width: 50%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m7 {
+ width: 58.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m8 {
+ width: 66.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m9 {
+ width: 75%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m10 {
+ width: 83.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m11 {
+ width: 91.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.m12 {
+ width: 100%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.offset-m1 {
+ margin-left: 8.3333333333%;
+ }
+ .row .col.pull-m1 {
+ right: 8.3333333333%;
+ }
+ .row .col.push-m1 {
+ left: 8.3333333333%;
+ }
+ .row .col.offset-m2 {
+ margin-left: 16.6666666667%;
+ }
+ .row .col.pull-m2 {
+ right: 16.6666666667%;
+ }
+ .row .col.push-m2 {
+ left: 16.6666666667%;
+ }
+ .row .col.offset-m3 {
+ margin-left: 25%;
+ }
+ .row .col.pull-m3 {
+ right: 25%;
+ }
+ .row .col.push-m3 {
+ left: 25%;
+ }
+ .row .col.offset-m4 {
+ margin-left: 33.3333333333%;
+ }
+ .row .col.pull-m4 {
+ right: 33.3333333333%;
+ }
+ .row .col.push-m4 {
+ left: 33.3333333333%;
+ }
+ .row .col.offset-m5 {
+ margin-left: 41.6666666667%;
+ }
+ .row .col.pull-m5 {
+ right: 41.6666666667%;
+ }
+ .row .col.push-m5 {
+ left: 41.6666666667%;
+ }
+ .row .col.offset-m6 {
+ margin-left: 50%;
+ }
+ .row .col.pull-m6 {
+ right: 50%;
+ }
+ .row .col.push-m6 {
+ left: 50%;
+ }
+ .row .col.offset-m7 {
+ margin-left: 58.3333333333%;
+ }
+ .row .col.pull-m7 {
+ right: 58.3333333333%;
+ }
+ .row .col.push-m7 {
+ left: 58.3333333333%;
+ }
+ .row .col.offset-m8 {
+ margin-left: 66.6666666667%;
+ }
+ .row .col.pull-m8 {
+ right: 66.6666666667%;
+ }
+ .row .col.push-m8 {
+ left: 66.6666666667%;
+ }
+ .row .col.offset-m9 {
+ margin-left: 75%;
+ }
+ .row .col.pull-m9 {
+ right: 75%;
+ }
+ .row .col.push-m9 {
+ left: 75%;
+ }
+ .row .col.offset-m10 {
+ margin-left: 83.3333333333%;
+ }
+ .row .col.pull-m10 {
+ right: 83.3333333333%;
+ }
+ .row .col.push-m10 {
+ left: 83.3333333333%;
+ }
+ .row .col.offset-m11 {
+ margin-left: 91.6666666667%;
+ }
+ .row .col.pull-m11 {
+ right: 91.6666666667%;
+ }
+ .row .col.push-m11 {
+ left: 91.6666666667%;
+ }
+ .row .col.offset-m12 {
+ margin-left: 100%;
+ }
+ .row .col.pull-m12 {
+ right: 100%;
+ }
+ .row .col.push-m12 {
+ left: 100%;
+ }
+}
+
+@media only screen and (min-width: 993px) {
+ .row .col.l1 {
+ width: 8.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l2 {
+ width: 16.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l3 {
+ width: 25%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l4 {
+ width: 33.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l5 {
+ width: 41.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l6 {
+ width: 50%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l7 {
+ width: 58.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l8 {
+ width: 66.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l9 {
+ width: 75%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l10 {
+ width: 83.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l11 {
+ width: 91.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.l12 {
+ width: 100%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.offset-l1 {
+ margin-left: 8.3333333333%;
+ }
+ .row .col.pull-l1 {
+ right: 8.3333333333%;
+ }
+ .row .col.push-l1 {
+ left: 8.3333333333%;
+ }
+ .row .col.offset-l2 {
+ margin-left: 16.6666666667%;
+ }
+ .row .col.pull-l2 {
+ right: 16.6666666667%;
+ }
+ .row .col.push-l2 {
+ left: 16.6666666667%;
+ }
+ .row .col.offset-l3 {
+ margin-left: 25%;
+ }
+ .row .col.pull-l3 {
+ right: 25%;
+ }
+ .row .col.push-l3 {
+ left: 25%;
+ }
+ .row .col.offset-l4 {
+ margin-left: 33.3333333333%;
+ }
+ .row .col.pull-l4 {
+ right: 33.3333333333%;
+ }
+ .row .col.push-l4 {
+ left: 33.3333333333%;
+ }
+ .row .col.offset-l5 {
+ margin-left: 41.6666666667%;
+ }
+ .row .col.pull-l5 {
+ right: 41.6666666667%;
+ }
+ .row .col.push-l5 {
+ left: 41.6666666667%;
+ }
+ .row .col.offset-l6 {
+ margin-left: 50%;
+ }
+ .row .col.pull-l6 {
+ right: 50%;
+ }
+ .row .col.push-l6 {
+ left: 50%;
+ }
+ .row .col.offset-l7 {
+ margin-left: 58.3333333333%;
+ }
+ .row .col.pull-l7 {
+ right: 58.3333333333%;
+ }
+ .row .col.push-l7 {
+ left: 58.3333333333%;
+ }
+ .row .col.offset-l8 {
+ margin-left: 66.6666666667%;
+ }
+ .row .col.pull-l8 {
+ right: 66.6666666667%;
+ }
+ .row .col.push-l8 {
+ left: 66.6666666667%;
+ }
+ .row .col.offset-l9 {
+ margin-left: 75%;
+ }
+ .row .col.pull-l9 {
+ right: 75%;
+ }
+ .row .col.push-l9 {
+ left: 75%;
+ }
+ .row .col.offset-l10 {
+ margin-left: 83.3333333333%;
+ }
+ .row .col.pull-l10 {
+ right: 83.3333333333%;
+ }
+ .row .col.push-l10 {
+ left: 83.3333333333%;
+ }
+ .row .col.offset-l11 {
+ margin-left: 91.6666666667%;
+ }
+ .row .col.pull-l11 {
+ right: 91.6666666667%;
+ }
+ .row .col.push-l11 {
+ left: 91.6666666667%;
+ }
+ .row .col.offset-l12 {
+ margin-left: 100%;
+ }
+ .row .col.pull-l12 {
+ right: 100%;
+ }
+ .row .col.push-l12 {
+ left: 100%;
+ }
+}
+
+@media only screen and (min-width: 1201px) {
+ .row .col.xl1 {
+ width: 8.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl2 {
+ width: 16.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl3 {
+ width: 25%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl4 {
+ width: 33.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl5 {
+ width: 41.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl6 {
+ width: 50%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl7 {
+ width: 58.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl8 {
+ width: 66.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl9 {
+ width: 75%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl10 {
+ width: 83.3333333333%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl11 {
+ width: 91.6666666667%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.xl12 {
+ width: 100%;
+ margin-left: auto;
+ left: auto;
+ right: auto;
+ }
+ .row .col.offset-xl1 {
+ margin-left: 8.3333333333%;
+ }
+ .row .col.pull-xl1 {
+ right: 8.3333333333%;
+ }
+ .row .col.push-xl1 {
+ left: 8.3333333333%;
+ }
+ .row .col.offset-xl2 {
+ margin-left: 16.6666666667%;
+ }
+ .row .col.pull-xl2 {
+ right: 16.6666666667%;
+ }
+ .row .col.push-xl2 {
+ left: 16.6666666667%;
+ }
+ .row .col.offset-xl3 {
+ margin-left: 25%;
+ }
+ .row .col.pull-xl3 {
+ right: 25%;
+ }
+ .row .col.push-xl3 {
+ left: 25%;
+ }
+ .row .col.offset-xl4 {
+ margin-left: 33.3333333333%;
+ }
+ .row .col.pull-xl4 {
+ right: 33.3333333333%;
+ }
+ .row .col.push-xl4 {
+ left: 33.3333333333%;
+ }
+ .row .col.offset-xl5 {
+ margin-left: 41.6666666667%;
+ }
+ .row .col.pull-xl5 {
+ right: 41.6666666667%;
+ }
+ .row .col.push-xl5 {
+ left: 41.6666666667%;
+ }
+ .row .col.offset-xl6 {
+ margin-left: 50%;
+ }
+ .row .col.pull-xl6 {
+ right: 50%;
+ }
+ .row .col.push-xl6 {
+ left: 50%;
+ }
+ .row .col.offset-xl7 {
+ margin-left: 58.3333333333%;
+ }
+ .row .col.pull-xl7 {
+ right: 58.3333333333%;
+ }
+ .row .col.push-xl7 {
+ left: 58.3333333333%;
+ }
+ .row .col.offset-xl8 {
+ margin-left: 66.6666666667%;
+ }
+ .row .col.pull-xl8 {
+ right: 66.6666666667%;
+ }
+ .row .col.push-xl8 {
+ left: 66.6666666667%;
+ }
+ .row .col.offset-xl9 {
+ margin-left: 75%;
+ }
+ .row .col.pull-xl9 {
+ right: 75%;
+ }
+ .row .col.push-xl9 {
+ left: 75%;
+ }
+ .row .col.offset-xl10 {
+ margin-left: 83.3333333333%;
+ }
+ .row .col.pull-xl10 {
+ right: 83.3333333333%;
+ }
+ .row .col.push-xl10 {
+ left: 83.3333333333%;
+ }
+ .row .col.offset-xl11 {
+ margin-left: 91.6666666667%;
+ }
+ .row .col.pull-xl11 {
+ right: 91.6666666667%;
+ }
+ .row .col.push-xl11 {
+ left: 91.6666666667%;
+ }
+ .row .col.offset-xl12 {
+ margin-left: 100%;
+ }
+ .row .col.pull-xl12 {
+ right: 100%;
+ }
+ .row .col.push-xl12 {
+ left: 100%;
+ }
+}
+
+nav {
+ color: #fff;
+ background-color: #ee6e73;
+ width: 100%;
+ height: 56px;
+ line-height: 56px;
+}
+
+nav.nav-extended {
+ height: auto;
+}
+
+nav.nav-extended .nav-wrapper {
+ min-height: 56px;
+ height: auto;
+}
+
+nav.nav-extended .nav-content {
+ position: relative;
+ line-height: normal;
+}
+
+nav a {
+ color: #fff;
+}
+
+nav i,
+nav [class^="mdi-"], nav [class*="mdi-"],
+nav i.material-icons {
+ display: block;
+ font-size: 24px;
+ height: 56px;
+ line-height: 56px;
+}
+
+nav .nav-wrapper {
+ position: relative;
+ height: 100%;
+}
+
+@media only screen and (min-width: 993px) {
+ nav a.button-collapse {
+ display: none;
+ }
+}
+
+nav .button-collapse {
+ float: left;
+ position: relative;
+ z-index: 1;
+ height: 56px;
+ margin: 0 18px;
+}
+
+nav .button-collapse i {
+ height: 56px;
+ line-height: 56px;
+}
+
+nav .brand-logo {
+ position: absolute;
+ color: #fff;
+ display: inline-block;
+ font-size: 2.1rem;
+ padding: 0;
+}
+
+nav .brand-logo.center {
+ left: 50%;
+ -webkit-transform: translateX(-50%);
+ transform: translateX(-50%);
+}
+
+@media only screen and (max-width: 992px) {
+ nav .brand-logo {
+ left: 50%;
+ -webkit-transform: translateX(-50%);
+ transform: translateX(-50%);
+ }
+ nav .brand-logo.left, nav .brand-logo.right {
+ padding: 0;
+ -webkit-transform: none;
+ transform: none;
+ }
+ nav .brand-logo.left {
+ left: 0.5rem;
+ }
+ nav .brand-logo.right {
+ right: 0.5rem;
+ left: auto;
+ }
+}
+
+nav .brand-logo.right {
+ right: 0.5rem;
+ padding: 0;
+}
+
+nav .brand-logo i,
+nav .brand-logo [class^="mdi-"], nav .brand-logo [class*="mdi-"],
+nav .brand-logo i.material-icons {
+ float: left;
+ margin-right: 15px;
+}
+
+nav .nav-title {
+ display: inline-block;
+ font-size: 32px;
+ padding: 28px 0;
+}
+
+nav ul {
+ margin: 0;
+}
+
+nav ul li {
+ -webkit-transition: background-color .3s;
+ transition: background-color .3s;
+ float: left;
+ padding: 0;
+}
+
+nav ul li.active {
+ background-color: rgba(0, 0, 0, 0.1);
+}
+
+nav ul a {
+ -webkit-transition: background-color .3s;
+ transition: background-color .3s;
+ font-size: 1rem;
+ color: #fff;
+ display: block;
+ padding: 0 15px;
+ cursor: pointer;
+}
+
+nav ul a.btn, nav ul a.btn-large, nav ul a.btn-large, nav ul a.btn-flat, nav ul a.btn-floating {
+ margin-top: -2px;
+ margin-left: 15px;
+ margin-right: 15px;
+}
+
+nav ul a.btn > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-flat > .material-icons, nav ul a.btn-floating > .material-icons {
+ height: inherit;
+ line-height: inherit;
+}
+
+nav ul a:hover {
+ background-color: rgba(0, 0, 0, 0.1);
+}
+
+nav ul.left {
+ float: left;
+}
+
+nav form {
+ height: 100%;
+}
+
+nav .input-field {
+ margin: 0;
+ height: 100%;
+}
+
+nav .input-field input {
+ height: 100%;
+ font-size: 1.2rem;
+ border: none;
+ padding-left: 2rem;
+}
+
+nav .input-field input:focus, nav .input-field input[type=text]:valid, nav .input-field input[type=password]:valid, nav .input-field input[type=email]:valid, nav .input-field input[type=url]:valid, nav .input-field input[type=date]:valid {
+ border: none;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+}
+
+nav .input-field label {
+ top: 0;
+ left: 0;
+}
+
+nav .input-field label i {
+ color: rgba(255, 255, 255, 0.7);
+ -webkit-transition: color .3s;
+ transition: color .3s;
+}
+
+nav .input-field label.active i {
+ color: #fff;
+}
+
+.navbar-fixed {
+ position: relative;
+ height: 56px;
+ z-index: 997;
+}
+
+.navbar-fixed nav {
+ position: fixed;
+}
+
+@media only screen and (min-width: 601px) {
+ nav.nav-extended .nav-wrapper {
+ min-height: 64px;
+ }
+ nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i {
+ height: 64px;
+ line-height: 64px;
+ }
+ .navbar-fixed {
+ height: 64px;
+ }
+}
+
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Thin), url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"), url("../fonts/roboto/Roboto-Thin.woff") format("woff");
+ font-weight: 100;
+}
+
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Light), url("../fonts/roboto/Roboto-Light.woff2") format("woff2"), url("../fonts/roboto/Roboto-Light.woff") format("woff");
+ font-weight: 300;
+}
+
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Regular), url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"), url("../fonts/roboto/Roboto-Regular.woff") format("woff");
+ font-weight: 400;
+}
+
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Medium), url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"), url("../fonts/roboto/Roboto-Medium.woff") format("woff");
+ font-weight: 500;
+}
+
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Bold), url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"), url("../fonts/roboto/Roboto-Bold.woff") format("woff");
+ font-weight: 700;
+}
+
+a {
+ text-decoration: none;
+}
+
+html {
+ line-height: 1.5;
+ font-family: "Roboto", sans-serif;
+ font-weight: normal;
+ color: rgba(0, 0, 0, 0.87);
+}
+
+@media only screen and (min-width: 0) {
+ html {
+ font-size: 14px;
+ }
+}
+
+@media only screen and (min-width: 992px) {
+ html {
+ font-size: 14.5px;
+ }
+}
+
+@media only screen and (min-width: 1200px) {
+ html {
+ font-size: 15px;
+ }
+}
+
+h1, h2, h3, h4, h5, h6 {
+ font-weight: 400;
+ line-height: 1.1;
+}
+
+h1 a, h2 a, h3 a, h4 a, h5 a, h6 a {
+ font-weight: inherit;
+}
+
+h1 {
+ font-size: 4.2rem;
+ line-height: 110%;
+ margin: 2.1rem 0 1.68rem 0;
+}
+
+h2 {
+ font-size: 3.56rem;
+ line-height: 110%;
+ margin: 1.78rem 0 1.424rem 0;
+}
+
+h3 {
+ font-size: 2.92rem;
+ line-height: 110%;
+ margin: 1.46rem 0 1.168rem 0;
+}
+
+h4 {
+ font-size: 2.28rem;
+ line-height: 110%;
+ margin: 1.14rem 0 0.912rem 0;
+}
+
+h5 {
+ font-size: 1.64rem;
+ line-height: 110%;
+ margin: 0.82rem 0 0.656rem 0;
+}
+
+h6 {
+ font-size: 1rem;
+ line-height: 110%;
+ margin: 0.5rem 0 0.4rem 0;
+}
+
+em {
+ font-style: italic;
+}
+
+strong {
+ font-weight: 500;
+}
+
+small {
+ font-size: 75%;
+}
+
+.light, .page-footer .footer-copyright {
+ font-weight: 300;
+}
+
+.thin {
+ font-weight: 200;
+}
+
+.flow-text {
+ font-weight: 300;
+}
+
+@media only screen and (min-width: 360px) {
+ .flow-text {
+ font-size: 1.2rem;
+ }
+}
+
+@media only screen and (min-width: 390px) {
+ .flow-text {
+ font-size: 1.224rem;
+ }
+}
+
+@media only screen and (min-width: 420px) {
+ .flow-text {
+ font-size: 1.248rem;
+ }
+}
+
+@media only screen and (min-width: 450px) {
+ .flow-text {
+ font-size: 1.272rem;
+ }
+}
+
+@media only screen and (min-width: 480px) {
+ .flow-text {
+ font-size: 1.296rem;
+ }
+}
+
+@media only screen and (min-width: 510px) {
+ .flow-text {
+ font-size: 1.32rem;
+ }
+}
+
+@media only screen and (min-width: 540px) {
+ .flow-text {
+ font-size: 1.344rem;
+ }
+}
+
+@media only screen and (min-width: 570px) {
+ .flow-text {
+ font-size: 1.368rem;
+ }
+}
+
+@media only screen and (min-width: 600px) {
+ .flow-text {
+ font-size: 1.392rem;
+ }
+}
+
+@media only screen and (min-width: 630px) {
+ .flow-text {
+ font-size: 1.416rem;
+ }
+}
+
+@media only screen and (min-width: 660px) {
+ .flow-text {
+ font-size: 1.44rem;
+ }
+}
+
+@media only screen and (min-width: 690px) {
+ .flow-text {
+ font-size: 1.464rem;
+ }
+}
+
+@media only screen and (min-width: 720px) {
+ .flow-text {
+ font-size: 1.488rem;
+ }
+}
+
+@media only screen and (min-width: 750px) {
+ .flow-text {
+ font-size: 1.512rem;
+ }
+}
+
+@media only screen and (min-width: 780px) {
+ .flow-text {
+ font-size: 1.536rem;
+ }
+}
+
+@media only screen and (min-width: 810px) {
+ .flow-text {
+ font-size: 1.56rem;
+ }
+}
+
+@media only screen and (min-width: 840px) {
+ .flow-text {
+ font-size: 1.584rem;
+ }
+}
+
+@media only screen and (min-width: 870px) {
+ .flow-text {
+ font-size: 1.608rem;
+ }
+}
+
+@media only screen and (min-width: 900px) {
+ .flow-text {
+ font-size: 1.632rem;
+ }
+}
+
+@media only screen and (min-width: 930px) {
+ .flow-text {
+ font-size: 1.656rem;
+ }
+}
+
+@media only screen and (min-width: 960px) {
+ .flow-text {
+ font-size: 1.68rem;
+ }
+}
+
+@media only screen and (max-width: 360px) {
+ .flow-text {
+ font-size: 1.2rem;
+ }
+}
+
+.scale-transition {
+ -webkit-transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+ transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+ transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+ transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+}
+
+.scale-transition.scale-out {
+ -webkit-transform: scale(0);
+ transform: scale(0);
+ -webkit-transition: -webkit-transform .2s !important;
+ transition: -webkit-transform .2s !important;
+ transition: transform .2s !important;
+ transition: transform .2s, -webkit-transform .2s !important;
+}
+
+.scale-transition.scale-in {
+ -webkit-transform: scale(1);
+ transform: scale(1);
+}
+
+.card-panel {
+ -webkit-transition: -webkit-box-shadow .25s;
+ transition: -webkit-box-shadow .25s;
+ transition: box-shadow .25s;
+ transition: box-shadow .25s, -webkit-box-shadow .25s;
+ padding: 24px;
+ margin: 0.5rem 0 1rem 0;
+ border-radius: 2px;
+ background-color: #fff;
+}
+
+.card {
+ position: relative;
+ margin: 0.5rem 0 1rem 0;
+ background-color: #fff;
+ -webkit-transition: -webkit-box-shadow .25s;
+ transition: -webkit-box-shadow .25s;
+ transition: box-shadow .25s;
+ transition: box-shadow .25s, -webkit-box-shadow .25s;
+ border-radius: 2px;
+}
+
+.card .card-title {
+ font-size: 24px;
+ font-weight: 300;
+}
+
+.card .card-title.activator {
+ cursor: pointer;
+}
+
+.card.small, .card.medium, .card.large {
+ position: relative;
+}
+
+.card.small .card-image, .card.medium .card-image, .card.large .card-image {
+ max-height: 60%;
+ overflow: hidden;
+}
+
+.card.small .card-image + .card-content, .card.medium .card-image + .card-content, .card.large .card-image + .card-content {
+ max-height: 40%;
+}
+
+.card.small .card-content, .card.medium .card-content, .card.large .card-content {
+ max-height: 100%;
+ overflow: hidden;
+}
+
+.card.small .card-action, .card.medium .card-action, .card.large .card-action {
+ position: absolute;
+ bottom: 0;
+ left: 0;
+ right: 0;
+}
+
+.card.small {
+ height: 300px;
+}
+
+.card.medium {
+ height: 400px;
+}
+
+.card.large {
+ height: 500px;
+}
+
+.card.horizontal {
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+}
+
+.card.horizontal.small .card-image, .card.horizontal.medium .card-image, .card.horizontal.large .card-image {
+ height: 100%;
+ max-height: none;
+ overflow: visible;
+}
+
+.card.horizontal.small .card-image img, .card.horizontal.medium .card-image img, .card.horizontal.large .card-image img {
+ height: 100%;
+}
+
+.card.horizontal .card-image {
+ max-width: 50%;
+}
+
+.card.horizontal .card-image img {
+ border-radius: 2px 0 0 2px;
+ max-width: 100%;
+ width: auto;
+}
+
+.card.horizontal .card-stacked {
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -webkit-flex-direction: column;
+ -ms-flex-direction: column;
+ flex-direction: column;
+ -webkit-box-flex: 1;
+ -webkit-flex: 1;
+ -ms-flex: 1;
+ flex: 1;
+ position: relative;
+}
+
+.card.horizontal .card-stacked .card-content {
+ -webkit-box-flex: 1;
+ -webkit-flex-grow: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+}
+
+.card.sticky-action .card-action {
+ z-index: 2;
+}
+
+.card.sticky-action .card-reveal {
+ z-index: 1;
+ padding-bottom: 64px;
+}
+
+.card .card-image {
+ position: relative;
+}
+
+.card .card-image img {
+ display: block;
+ border-radius: 2px 2px 0 0;
+ position: relative;
+ left: 0;
+ right: 0;
+ top: 0;
+ bottom: 0;
+ width: 100%;
+}
+
+.card .card-image .card-title {
+ color: #fff;
+ position: absolute;
+ bottom: 0;
+ left: 0;
+ max-width: 100%;
+ padding: 24px;
+}
+
+.card .card-content {
+ padding: 24px;
+ border-radius: 0 0 2px 2px;
+}
+
+.card .card-content p {
+ margin: 0;
+ color: inherit;
+}
+
+.card .card-content .card-title {
+ display: block;
+ line-height: 32px;
+ margin-bottom: 8px;
+}
+
+.card .card-content .card-title i {
+ line-height: 32px;
+}
+
+.card .card-action {
+ position: relative;
+ background-color: inherit;
+ border-top: 1px solid rgba(160, 160, 160, 0.2);
+ padding: 16px 24px;
+}
+
+.card .card-action:last-child {
+ border-radius: 0 0 2px 2px;
+}
+
+.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating) {
+ color: #ffab40;
+ margin-right: 24px;
+ -webkit-transition: color .3s ease;
+ transition: color .3s ease;
+ text-transform: uppercase;
+}
+
+.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover {
+ color: #ffd8a6;
+}
+
+.card .card-reveal {
+ padding: 24px;
+ position: absolute;
+ background-color: #fff;
+ width: 100%;
+ overflow-y: auto;
+ left: 0;
+ top: 100%;
+ height: 100%;
+ z-index: 3;
+ display: none;
+}
+
+.card .card-reveal .card-title {
+ cursor: pointer;
+ display: block;
+}
+
+#toast-container {
+ display: block;
+ position: fixed;
+ z-index: 10000;
+}
+
+@media only screen and (max-width: 600px) {
+ #toast-container {
+ min-width: 100%;
+ bottom: 0%;
+ }
+}
+
+@media only screen and (min-width: 601px) and (max-width: 992px) {
+ #toast-container {
+ left: 5%;
+ bottom: 7%;
+ max-width: 90%;
+ }
+}
+
+@media only screen and (min-width: 993px) {
+ #toast-container {
+ top: 10%;
+ right: 7%;
+ max-width: 86%;
+ }
+}
+
+.toast {
+ border-radius: 2px;
+ top: 35px;
+ width: auto;
+ margin-top: 10px;
+ position: relative;
+ max-width: 100%;
+ height: auto;
+ min-height: 48px;
+ line-height: 1.5em;
+ word-break: break-all;
+ background-color: #323232;
+ padding: 10px 25px;
+ font-size: 1.1rem;
+ font-weight: 300;
+ color: #fff;
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -webkit-align-items: center;
+ -ms-flex-align: center;
+ align-items: center;
+ -webkit-box-pack: justify;
+ -webkit-justify-content: space-between;
+ -ms-flex-pack: justify;
+ justify-content: space-between;
+ cursor: default;
+}
+
+.toast .toast-action {
+ color: #eeff41;
+ font-weight: 500;
+ margin-right: -25px;
+ margin-left: 3rem;
+}
+
+.toast.rounded {
+ border-radius: 24px;
+}
+
+@media only screen and (max-width: 600px) {
+ .toast {
+ width: 100%;
+ border-radius: 0;
+ }
+}
+
+.tabs {
+ position: relative;
+ overflow-x: auto;
+ overflow-y: hidden;
+ height: 48px;
+ width: 100%;
+ background-color: #fff;
+ margin: 0 auto;
+ white-space: nowrap;
+}
+
+.tabs.tabs-transparent {
+ background-color: transparent;
+}
+
+.tabs.tabs-transparent .tab a,
+.tabs.tabs-transparent .tab.disabled a,
+.tabs.tabs-transparent .tab.disabled a:hover {
+ color: rgba(255, 255, 255, 0.7);
+}
+
+.tabs.tabs-transparent .tab a:hover,
+.tabs.tabs-transparent .tab a.active {
+ color: #fff;
+}
+
+.tabs.tabs-transparent .indicator {
+ background-color: #fff;
+}
+
+.tabs.tabs-fixed-width {
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+}
+
+.tabs.tabs-fixed-width .tab {
+ -webkit-box-flex: 1;
+ -webkit-flex-grow: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+}
+
+.tabs .tab {
+ display: inline-block;
+ text-align: center;
+ line-height: 48px;
+ height: 48px;
+ padding: 0;
+ margin: 0;
+ text-transform: uppercase;
+}
+
+.tabs .tab a {
+ color: rgba(238, 110, 115, 0.7);
+ display: block;
+ width: 100%;
+ height: 100%;
+ padding: 0 24px;
+ font-size: 14px;
+ text-overflow: ellipsis;
+ overflow: hidden;
+ -webkit-transition: color .28s ease;
+ transition: color .28s ease;
+}
+
+.tabs .tab a:hover, .tabs .tab a.active {
+ background-color: transparent;
+ color: #ee6e73;
+}
+
+.tabs .tab.disabled a,
+.tabs .tab.disabled a:hover {
+ color: rgba(238, 110, 115, 0.7);
+ cursor: default;
+}
+
+.tabs .indicator {
+ position: absolute;
+ bottom: 0;
+ height: 2px;
+ background-color: #f6b2b5;
+ will-change: left, right;
+}
+
+@media only screen and (max-width: 992px) {
+ .tabs {
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+ }
+ .tabs .tab {
+ -webkit-box-flex: 1;
+ -webkit-flex-grow: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ }
+ .tabs .tab a {
+ padding: 0 12px;
+ }
+}
+
+.material-tooltip {
+ padding: 10px 8px;
+ font-size: 1rem;
+ z-index: 2000;
+ background-color: transparent;
+ border-radius: 2px;
+ color: #fff;
+ min-height: 36px;
+ line-height: 120%;
+ opacity: 0;
+ position: absolute;
+ text-align: center;
+ max-width: calc(100% - 4px);
+ overflow: hidden;
+ left: 0;
+ top: 0;
+ pointer-events: none;
+ visibility: hidden;
+}
+
+.backdrop {
+ position: absolute;
+ opacity: 0;
+ height: 7px;
+ width: 14px;
+ border-radius: 0 0 50% 50%;
+ background-color: #323232;
+ z-index: -1;
+ -webkit-transform-origin: 50% 0%;
+ transform-origin: 50% 0%;
+ visibility: hidden;
+}
+
+.btn, .btn-large,
+.btn-flat {
+ border: none;
+ border-radius: 2px;
+ display: inline-block;
+ height: 36px;
+ line-height: 36px;
+ padding: 0 2rem;
+ text-transform: uppercase;
+ vertical-align: middle;
+ -webkit-tap-highlight-color: transparent;
+}
+
+.btn.disabled, .disabled.btn-large,
+.btn-floating.disabled,
+.btn-large.disabled,
+.btn-flat.disabled,
+.btn:disabled,
+.btn-large:disabled,
+.btn-floating:disabled,
+.btn-large:disabled,
+.btn-flat:disabled,
+.btn[disabled],
+[disabled].btn-large,
+.btn-floating[disabled],
+.btn-large[disabled],
+.btn-flat[disabled] {
+ pointer-events: none;
+ background-color: #DFDFDF !important;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+ color: #9F9F9F !important;
+ cursor: default;
+}
+
+.btn.disabled:hover, .disabled.btn-large:hover,
+.btn-floating.disabled:hover,
+.btn-large.disabled:hover,
+.btn-flat.disabled:hover,
+.btn:disabled:hover,
+.btn-large:disabled:hover,
+.btn-floating:disabled:hover,
+.btn-large:disabled:hover,
+.btn-flat:disabled:hover,
+.btn[disabled]:hover,
+[disabled].btn-large:hover,
+.btn-floating[disabled]:hover,
+.btn-large[disabled]:hover,
+.btn-flat[disabled]:hover {
+ background-color: #DFDFDF !important;
+ color: #9F9F9F !important;
+}
+
+.btn, .btn-large,
+.btn-floating,
+.btn-large,
+.btn-flat {
+ font-size: 1rem;
+ outline: 0;
+}
+
+.btn i, .btn-large i,
+.btn-floating i,
+.btn-large i,
+.btn-flat i {
+ font-size: 1.3rem;
+ line-height: inherit;
+}
+
+.btn:focus, .btn-large:focus,
+.btn-floating:focus {
+ background-color: #1d7d74;
+}
+
+.btn, .btn-large {
+ text-decoration: none;
+ color: #fff;
+ background-color: #26a69a;
+ text-align: center;
+ letter-spacing: .5px;
+ -webkit-transition: .2s ease-out;
+ transition: .2s ease-out;
+ cursor: pointer;
+}
+
+.btn:hover, .btn-large:hover {
+ background-color: #2bbbad;
+}
+
+.btn-floating {
+ display: inline-block;
+ color: #fff;
+ position: relative;
+ overflow: hidden;
+ z-index: 1;
+ width: 40px;
+ height: 40px;
+ line-height: 40px;
+ padding: 0;
+ background-color: #26a69a;
+ border-radius: 50%;
+ -webkit-transition: .3s;
+ transition: .3s;
+ cursor: pointer;
+ vertical-align: middle;
+}
+
+.btn-floating:hover {
+ background-color: #26a69a;
+}
+
+.btn-floating:before {
+ border-radius: 0;
+}
+
+.btn-floating.btn-large {
+ width: 56px;
+ height: 56px;
+}
+
+.btn-floating.btn-large.halfway-fab {
+ bottom: -28px;
+}
+
+.btn-floating.btn-large i {
+ line-height: 56px;
+}
+
+.btn-floating.halfway-fab {
+ position: absolute;
+ right: 24px;
+ bottom: -20px;
+}
+
+.btn-floating.halfway-fab.left {
+ right: auto;
+ left: 24px;
+}
+
+.btn-floating i {
+ width: inherit;
+ display: inline-block;
+ text-align: center;
+ color: #fff;
+ font-size: 1.6rem;
+ line-height: 40px;
+}
+
+button.btn-floating {
+ border: none;
+}
+
+.fixed-action-btn {
+ position: fixed;
+ right: 23px;
+ bottom: 23px;
+ padding-top: 15px;
+ margin-bottom: 0;
+ z-index: 997;
+}
+
+.fixed-action-btn.active ul {
+ visibility: visible;
+}
+
+.fixed-action-btn.horizontal {
+ padding: 0 0 0 15px;
+}
+
+.fixed-action-btn.horizontal ul {
+ text-align: right;
+ right: 64px;
+ top: 50%;
+ -webkit-transform: translateY(-50%);
+ transform: translateY(-50%);
+ height: 100%;
+ left: auto;
+ width: 500px;
+ /*width 100% only goes to width of button container */
+}
+
+.fixed-action-btn.horizontal ul li {
+ display: inline-block;
+ margin: 15px 15px 0 0;
+}
+
+.fixed-action-btn.toolbar {
+ padding: 0;
+ height: 56px;
+}
+
+.fixed-action-btn.toolbar.active > a i {
+ opacity: 0;
+}
+
+.fixed-action-btn.toolbar ul {
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+ top: 0;
+ bottom: 0;
+ z-index: 1;
+}
+
+.fixed-action-btn.toolbar ul li {
+ -webkit-box-flex: 1;
+ -webkit-flex: 1;
+ -ms-flex: 1;
+ flex: 1;
+ display: inline-block;
+ margin: 0;
+ height: 100%;
+ -webkit-transition: none;
+ transition: none;
+}
+
+.fixed-action-btn.toolbar ul li a {
+ display: block;
+ overflow: hidden;
+ position: relative;
+ width: 100%;
+ height: 100%;
+ background-color: transparent;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+ color: #fff;
+ line-height: 56px;
+ z-index: 1;
+}
+
+.fixed-action-btn.toolbar ul li a i {
+ line-height: inherit;
+}
+
+.fixed-action-btn ul {
+ left: 0;
+ right: 0;
+ text-align: center;
+ position: absolute;
+ bottom: 64px;
+ margin: 0;
+ visibility: hidden;
+}
+
+.fixed-action-btn ul li {
+ margin-bottom: 15px;
+}
+
+.fixed-action-btn ul a.btn-floating {
+ opacity: 0;
+}
+
+.fixed-action-btn .fab-backdrop {
+ position: absolute;
+ top: 0;
+ left: 0;
+ z-index: -1;
+ width: 40px;
+ height: 40px;
+ background-color: #26a69a;
+ border-radius: 50%;
+ -webkit-transform: scale(0);
+ transform: scale(0);
+}
+
+.btn-flat {
+ -webkit-box-shadow: none;
+ box-shadow: none;
+ background-color: transparent;
+ color: #343434;
+ cursor: pointer;
+ -webkit-transition: background-color .2s;
+ transition: background-color .2s;
+}
+
+.btn-flat:focus, .btn-flat:hover {
+ -webkit-box-shadow: none;
+ box-shadow: none;
+}
+
+.btn-flat:focus {
+ background-color: rgba(0, 0, 0, 0.1);
+}
+
+.btn-flat.disabled {
+ background-color: transparent !important;
+ color: #b3b2b2 !important;
+ cursor: default;
+}
+
+.btn-large {
+ height: 54px;
+ line-height: 54px;
+}
+
+.btn-large i {
+ font-size: 1.6rem;
+}
+
+.btn-block {
+ display: block;
+}
+
+.dropdown-content {
+ background-color: #fff;
+ margin: 0;
+ display: none;
+ min-width: 100px;
+ max-height: 650px;
+ overflow-y: auto;
+ opacity: 0;
+ position: absolute;
+ z-index: 999;
+ will-change: width, height;
+}
+
+.dropdown-content li {
+ clear: both;
+ color: rgba(0, 0, 0, 0.87);
+ cursor: pointer;
+ min-height: 50px;
+ line-height: 1.5rem;
+ width: 100%;
+ text-align: left;
+ text-transform: none;
+}
+
+.dropdown-content li:hover, .dropdown-content li.active, .dropdown-content li.selected {
+ background-color: #eee;
+}
+
+.dropdown-content li.active.selected {
+ background-color: #e1e1e1;
+}
+
+.dropdown-content li.divider {
+ min-height: 0;
+ height: 1px;
+}
+
+.dropdown-content li > a, .dropdown-content li > span {
+ font-size: 16px;
+ color: #26a69a;
+ display: block;
+ line-height: 22px;
+ padding: 14px 16px;
+}
+
+.dropdown-content li > span > label {
+ top: 1px;
+ left: 0;
+ height: 18px;
+}
+
+.dropdown-content li > a > i {
+ height: inherit;
+ line-height: inherit;
+ float: left;
+ margin: 0 24px 0 0;
+ width: 24px;
+}
+
+.input-field.col .dropdown-content [type="checkbox"] + label {
+ top: 1px;
+ left: 0;
+ height: 18px;
+}
+
+/*!
+ * Waves v0.6.0
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+.waves-effect {
+ position: relative;
+ cursor: pointer;
+ display: inline-block;
+ overflow: hidden;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ -webkit-tap-highlight-color: transparent;
+ vertical-align: middle;
+ z-index: 1;
+ -webkit-transition: .3s ease-out;
+ transition: .3s ease-out;
+}
+
+.waves-effect .waves-ripple {
+ position: absolute;
+ border-radius: 50%;
+ width: 20px;
+ height: 20px;
+ margin-top: -10px;
+ margin-left: -10px;
+ opacity: 0;
+ background: rgba(0, 0, 0, 0.2);
+ -webkit-transition: all 0.7s ease-out;
+ transition: all 0.7s ease-out;
+ -webkit-transition-property: opacity, -webkit-transform;
+ transition-property: opacity, -webkit-transform;
+ transition-property: transform, opacity;
+ transition-property: transform, opacity, -webkit-transform;
+ -webkit-transform: scale(0);
+ transform: scale(0);
+ pointer-events: none;
+}
+
+.waves-effect.waves-light .waves-ripple {
+ background-color: rgba(255, 255, 255, 0.45);
+}
+
+.waves-effect.waves-red .waves-ripple {
+ background-color: rgba(244, 67, 54, 0.7);
+}
+
+.waves-effect.waves-yellow .waves-ripple {
+ background-color: rgba(255, 235, 59, 0.7);
+}
+
+.waves-effect.waves-orange .waves-ripple {
+ background-color: rgba(255, 152, 0, 0.7);
+}
+
+.waves-effect.waves-purple .waves-ripple {
+ background-color: rgba(156, 39, 176, 0.7);
+}
+
+.waves-effect.waves-green .waves-ripple {
+ background-color: rgba(76, 175, 80, 0.7);
+}
+
+.waves-effect.waves-teal .waves-ripple {
+ background-color: rgba(0, 150, 136, 0.7);
+}
+
+.waves-effect input[type="button"], .waves-effect input[type="reset"], .waves-effect input[type="submit"] {
+ border: 0;
+ font-style: normal;
+ font-size: inherit;
+ text-transform: inherit;
+ background: none;
+}
+
+.waves-effect img {
+ position: relative;
+ z-index: -1;
+}
+
+.waves-notransition {
+ -webkit-transition: none !important;
+ transition: none !important;
+}
+
+.waves-circle {
+ -webkit-transform: translateZ(0);
+ transform: translateZ(0);
+ -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%);
+}
+
+.waves-input-wrapper {
+ border-radius: 0.2em;
+ vertical-align: bottom;
+}
+
+.waves-input-wrapper .waves-button-input {
+ position: relative;
+ top: 0;
+ left: 0;
+ z-index: 1;
+}
+
+.waves-circle {
+ text-align: center;
+ width: 2.5em;
+ height: 2.5em;
+ line-height: 2.5em;
+ border-radius: 50%;
+ -webkit-mask-image: none;
+}
+
+.waves-block {
+ display: block;
+}
+
+/* Firefox Bug: link not triggered */
+.waves-effect .waves-ripple {
+ z-index: -1;
+}
+
+.modal {
+ display: none;
+ position: fixed;
+ left: 0;
+ right: 0;
+ background-color: #fafafa;
+ padding: 0;
+ max-height: 70%;
+ width: 55%;
+ margin: auto;
+ overflow-y: auto;
+ border-radius: 2px;
+ will-change: top, opacity;
+}
+
+@media only screen and (max-width: 992px) {
+ .modal {
+ width: 80%;
+ }
+}
+
+.modal h1, .modal h2, .modal h3, .modal h4 {
+ margin-top: 0;
+}
+
+.modal .modal-content {
+ padding: 24px;
+}
+
+.modal .modal-close {
+ cursor: pointer;
+}
+
+.modal .modal-footer {
+ border-radius: 0 0 2px 2px;
+ background-color: #fafafa;
+ padding: 4px 6px;
+ height: 56px;
+ width: 100%;
+ text-align: right;
+}
+
+.modal .modal-footer .btn, .modal .modal-footer .btn-large, .modal .modal-footer .btn-flat {
+ margin: 6px 0;
+}
+
+.modal-overlay {
+ position: fixed;
+ z-index: 999;
+ top: -25%;
+ left: 0;
+ bottom: 0;
+ right: 0;
+ height: 125%;
+ width: 100%;
+ background: #000;
+ display: none;
+ will-change: opacity;
+}
+
+.modal.modal-fixed-footer {
+ padding: 0;
+ height: 70%;
+}
+
+.modal.modal-fixed-footer .modal-content {
+ position: absolute;
+ height: calc(100% - 56px);
+ max-height: 100%;
+ width: 100%;
+ overflow-y: auto;
+}
+
+.modal.modal-fixed-footer .modal-footer {
+ border-top: 1px solid rgba(0, 0, 0, 0.1);
+ position: absolute;
+ bottom: 0;
+}
+
+.modal.bottom-sheet {
+ top: auto;
+ bottom: -100%;
+ margin: 0;
+ width: 100%;
+ max-height: 45%;
+ border-radius: 0;
+ will-change: bottom, opacity;
+}
+
+.collapsible {
+ border-top: 1px solid #ddd;
+ border-right: 1px solid #ddd;
+ border-left: 1px solid #ddd;
+ margin: 0.5rem 0 1rem 0;
+}
+
+.collapsible-header {
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+ cursor: pointer;
+ -webkit-tap-highlight-color: transparent;
+ line-height: 1.5;
+ padding: 1rem;
+ background-color: #fff;
+ border-bottom: 1px solid #ddd;
+}
+
+.collapsible-header i {
+ width: 2rem;
+ font-size: 1.6rem;
+ display: inline-block;
+ text-align: center;
+ margin-right: 1rem;
+}
+
+.collapsible-body {
+ display: none;
+ border-bottom: 1px solid #ddd;
+ -webkit-box-sizing: border-box;
+ box-sizing: border-box;
+ padding: 2rem;
+}
+
+.side-nav .collapsible,
+.side-nav.fixed .collapsible {
+ border: none;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+}
+
+.side-nav .collapsible li,
+.side-nav.fixed .collapsible li {
+ padding: 0;
+}
+
+.side-nav .collapsible-header,
+.side-nav.fixed .collapsible-header {
+ background-color: transparent;
+ border: none;
+ line-height: inherit;
+ height: inherit;
+ padding: 0 16px;
+}
+
+.side-nav .collapsible-header:hover,
+.side-nav.fixed .collapsible-header:hover {
+ background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav .collapsible-header i,
+.side-nav.fixed .collapsible-header i {
+ line-height: inherit;
+}
+
+.side-nav .collapsible-body,
+.side-nav.fixed .collapsible-body {
+ border: 0;
+ background-color: #fff;
+}
+
+.side-nav .collapsible-body li a,
+.side-nav.fixed .collapsible-body li a {
+ padding: 0 23.5px 0 31px;
+}
+
+.collapsible.popout {
+ border: none;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+}
+
+.collapsible.popout > li {
+ -webkit-box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
+ box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
+ margin: 0 24px;
+ -webkit-transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94);
+ transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94);
+}
+
+.collapsible.popout > li.active {
+ -webkit-box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
+ box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
+ margin: 16px 0;
+}
+
+.chip {
+ display: inline-block;
+ height: 32px;
+ font-size: 13px;
+ font-weight: 500;
+ color: rgba(0, 0, 0, 0.6);
+ line-height: 32px;
+ padding: 0 12px;
+ border-radius: 16px;
+ background-color: #e4e4e4;
+ margin-bottom: 5px;
+ margin-right: 5px;
+}
+
+.chip > img {
+ float: left;
+ margin: 0 8px 0 -12px;
+ height: 32px;
+ width: 32px;
+ border-radius: 50%;
+}
+
+.chip .close {
+ cursor: pointer;
+ float: right;
+ font-size: 16px;
+ line-height: 32px;
+ padding-left: 8px;
+}
+
+.chips {
+ border: none;
+ border-bottom: 1px solid #9e9e9e;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+ margin: 0 0 20px 0;
+ min-height: 45px;
+ outline: none;
+ -webkit-transition: all .3s;
+ transition: all .3s;
+}
+
+.chips.focus {
+ border-bottom: 1px solid #26a69a;
+ -webkit-box-shadow: 0 1px 0 0 #26a69a;
+ box-shadow: 0 1px 0 0 #26a69a;
+}
+
+.chips:hover {
+ cursor: text;
+}
+
+.chips .chip.selected {
+ background-color: #26a69a;
+ color: #fff;
+}
+
+.chips .input {
+ background: none;
+ border: 0;
+ color: rgba(0, 0, 0, 0.6);
+ display: inline-block;
+ font-size: 1rem;
+ height: 3rem;
+ line-height: 32px;
+ outline: 0;
+ margin: 0;
+ padding: 0 !important;
+ width: 120px !important;
+}
+
+.chips .input:focus {
+ border: 0 !important;
+ -webkit-box-shadow: none !important;
+ box-shadow: none !important;
+}
+
+.chips .autocomplete-content {
+ margin-top: 0;
+ margin-bottom: 0;
+}
+
+.prefix ~ .chips {
+ margin-left: 3rem;
+ width: 92%;
+ width: calc(100% - 3rem);
+}
+
+.chips:empty ~ label {
+ font-size: 0.8rem;
+ -webkit-transform: translateY(-140%);
+ transform: translateY(-140%);
+}
+
+.materialboxed {
+ display: block;
+ cursor: -webkit-zoom-in;
+ cursor: zoom-in;
+ position: relative;
+ -webkit-transition: opacity .4s;
+ transition: opacity .4s;
+ -webkit-backface-visibility: hidden;
+}
+
+.materialboxed:hover:not(.active) {
+ opacity: .8;
+}
+
+.materialboxed.active {
+ cursor: -webkit-zoom-out;
+ cursor: zoom-out;
+}
+
+#materialbox-overlay {
+ position: fixed;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ background-color: #292929;
+ z-index: 1000;
+ will-change: opacity;
+}
+
+.materialbox-caption {
+ position: fixed;
+ display: none;
+ color: #fff;
+ line-height: 50px;
+ bottom: 0;
+ left: 0;
+ width: 100%;
+ text-align: center;
+ padding: 0% 15%;
+ height: 50px;
+ z-index: 1000;
+ -webkit-font-smoothing: antialiased;
+}
+
+select:focus {
+ outline: 1px solid #c9f3ef;
+}
+
+button:focus {
+ outline: none;
+ background-color: #2ab7a9;
+}
+
+label {
+ font-size: 0.8rem;
+ color: #9e9e9e;
+}
+
+/* Text Inputs + Textarea
+ ========================================================================== */
+/* Style Placeholders */
+::-webkit-input-placeholder {
+ color: #d1d1d1;
+}
+::-moz-placeholder {
+ color: #d1d1d1;
+}
+:-ms-input-placeholder {
+ color: #d1d1d1;
+}
+::placeholder {
+ color: #d1d1d1;
+}
+
+/* Text inputs */
+input:not([type]),
+input[type=text]:not(.browser-default),
+input[type=password]:not(.browser-default),
+input[type=email]:not(.browser-default),
+input[type=url]:not(.browser-default),
+input[type=time]:not(.browser-default),
+input[type=date]:not(.browser-default),
+input[type=datetime]:not(.browser-default),
+input[type=datetime-local]:not(.browser-default),
+input[type=tel]:not(.browser-default),
+input[type=number]:not(.browser-default),
+input[type=search]:not(.browser-default),
+textarea.materialize-textarea {
+ background-color: transparent;
+ border: none;
+ border-bottom: 1px solid #9e9e9e;
+ border-radius: 0;
+ outline: none;
+ height: 3rem;
+ width: 100%;
+ font-size: 1rem;
+ margin: 0 0 20px 0;
+ padding: 0;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+ -webkit-box-sizing: content-box;
+ box-sizing: content-box;
+ -webkit-transition: all 0.3s;
+ transition: all 0.3s;
+}
+
+input:not([type]):disabled, input:not([type])[readonly="readonly"],
+input[type=text]:not(.browser-default):disabled,
+input[type=text]:not(.browser-default)[readonly="readonly"],
+input[type=password]:not(.browser-default):disabled,
+input[type=password]:not(.browser-default)[readonly="readonly"],
+input[type=email]:not(.browser-default):disabled,
+input[type=email]:not(.browser-default)[readonly="readonly"],
+input[type=url]:not(.browser-default):disabled,
+input[type=url]:not(.browser-default)[readonly="readonly"],
+input[type=time]:not(.browser-default):disabled,
+input[type=time]:not(.browser-default)[readonly="readonly"],
+input[type=date]:not(.browser-default):disabled,
+input[type=date]:not(.browser-default)[readonly="readonly"],
+input[type=datetime]:not(.browser-default):disabled,
+input[type=datetime]:not(.browser-default)[readonly="readonly"],
+input[type=datetime-local]:not(.browser-default):disabled,
+input[type=datetime-local]:not(.browser-default)[readonly="readonly"],
+input[type=tel]:not(.browser-default):disabled,
+input[type=tel]:not(.browser-default)[readonly="readonly"],
+input[type=number]:not(.browser-default):disabled,
+input[type=number]:not(.browser-default)[readonly="readonly"],
+input[type=search]:not(.browser-default):disabled,
+input[type=search]:not(.browser-default)[readonly="readonly"],
+textarea.materialize-textarea:disabled,
+textarea.materialize-textarea[readonly="readonly"] {
+ color: rgba(0, 0, 0, 0.42);
+ border-bottom: 1px dotted rgba(0, 0, 0, 0.42);
+}
+
+input:not([type]):disabled + label,
+input:not([type])[readonly="readonly"] + label,
+input[type=text]:not(.browser-default):disabled + label,
+input[type=text]:not(.browser-default)[readonly="readonly"] + label,
+input[type=password]:not(.browser-default):disabled + label,
+input[type=password]:not(.browser-default)[readonly="readonly"] + label,
+input[type=email]:not(.browser-default):disabled + label,
+input[type=email]:not(.browser-default)[readonly="readonly"] + label,
+input[type=url]:not(.browser-default):disabled + label,
+input[type=url]:not(.browser-default)[readonly="readonly"] + label,
+input[type=time]:not(.browser-default):disabled + label,
+input[type=time]:not(.browser-default)[readonly="readonly"] + label,
+input[type=date]:not(.browser-default):disabled + label,
+input[type=date]:not(.browser-default)[readonly="readonly"] + label,
+input[type=datetime]:not(.browser-default):disabled + label,
+input[type=datetime]:not(.browser-default)[readonly="readonly"] + label,
+input[type=datetime-local]:not(.browser-default):disabled + label,
+input[type=datetime-local]:not(.browser-default)[readonly="readonly"] + label,
+input[type=tel]:not(.browser-default):disabled + label,
+input[type=tel]:not(.browser-default)[readonly="readonly"] + label,
+input[type=number]:not(.browser-default):disabled + label,
+input[type=number]:not(.browser-default)[readonly="readonly"] + label,
+input[type=search]:not(.browser-default):disabled + label,
+input[type=search]:not(.browser-default)[readonly="readonly"] + label,
+textarea.materialize-textarea:disabled + label,
+textarea.materialize-textarea[readonly="readonly"] + label {
+ color: rgba(0, 0, 0, 0.42);
+}
+
+input:not([type]):focus:not([readonly]),
+input[type=text]:not(.browser-default):focus:not([readonly]),
+input[type=password]:not(.browser-default):focus:not([readonly]),
+input[type=email]:not(.browser-default):focus:not([readonly]),
+input[type=url]:not(.browser-default):focus:not([readonly]),
+input[type=time]:not(.browser-default):focus:not([readonly]),
+input[type=date]:not(.browser-default):focus:not([readonly]),
+input[type=datetime]:not(.browser-default):focus:not([readonly]),
+input[type=datetime-local]:not(.browser-default):focus:not([readonly]),
+input[type=tel]:not(.browser-default):focus:not([readonly]),
+input[type=number]:not(.browser-default):focus:not([readonly]),
+input[type=search]:not(.browser-default):focus:not([readonly]),
+textarea.materialize-textarea:focus:not([readonly]) {
+ border-bottom: 1px solid #26a69a;
+ -webkit-box-shadow: 0 1px 0 0 #26a69a;
+ box-shadow: 0 1px 0 0 #26a69a;
+}
+
+input:not([type]):focus:not([readonly]) + label,
+input[type=text]:not(.browser-default):focus:not([readonly]) + label,
+input[type=password]:not(.browser-default):focus:not([readonly]) + label,
+input[type=email]:not(.browser-default):focus:not([readonly]) + label,
+input[type=url]:not(.browser-default):focus:not([readonly]) + label,
+input[type=time]:not(.browser-default):focus:not([readonly]) + label,
+input[type=date]:not(.browser-default):focus:not([readonly]) + label,
+input[type=datetime]:not(.browser-default):focus:not([readonly]) + label,
+input[type=datetime-local]:not(.browser-default):focus:not([readonly]) + label,
+input[type=tel]:not(.browser-default):focus:not([readonly]) + label,
+input[type=number]:not(.browser-default):focus:not([readonly]) + label,
+input[type=search]:not(.browser-default):focus:not([readonly]) + label,
+textarea.materialize-textarea:focus:not([readonly]) + label {
+ color: #26a69a;
+}
+
+input:not([type]).validate + label,
+input[type=text]:not(.browser-default).validate + label,
+input[type=password]:not(.browser-default).validate + label,
+input[type=email]:not(.browser-default).validate + label,
+input[type=url]:not(.browser-default).validate + label,
+input[type=time]:not(.browser-default).validate + label,
+input[type=date]:not(.browser-default).validate + label,
+input[type=datetime]:not(.browser-default).validate + label,
+input[type=datetime-local]:not(.browser-default).validate + label,
+input[type=tel]:not(.browser-default).validate + label,
+input[type=number]:not(.browser-default).validate + label,
+input[type=search]:not(.browser-default).validate + label,
+textarea.materialize-textarea.validate + label {
+ width: 100%;
+}
+
+input:not([type]).invalid + label:after,
+input:not([type]).valid + label:after,
+input[type=text]:not(.browser-default).invalid + label:after,
+input[type=text]:not(.browser-default).valid + label:after,
+input[type=password]:not(.browser-default).invalid + label:after,
+input[type=password]:not(.browser-default).valid + label:after,
+input[type=email]:not(.browser-default).invalid + label:after,
+input[type=email]:not(.browser-default).valid + label:after,
+input[type=url]:not(.browser-default).invalid + label:after,
+input[type=url]:not(.browser-default).valid + label:after,
+input[type=time]:not(.browser-default).invalid + label:after,
+input[type=time]:not(.browser-default).valid + label:after,
+input[type=date]:not(.browser-default).invalid + label:after,
+input[type=date]:not(.browser-default).valid + label:after,
+input[type=datetime]:not(.browser-default).invalid + label:after,
+input[type=datetime]:not(.browser-default).valid + label:after,
+input[type=datetime-local]:not(.browser-default).invalid + label:after,
+input[type=datetime-local]:not(.browser-default).valid + label:after,
+input[type=tel]:not(.browser-default).invalid + label:after,
+input[type=tel]:not(.browser-default).valid + label:after,
+input[type=number]:not(.browser-default).invalid + label:after,
+input[type=number]:not(.browser-default).valid + label:after,
+input[type=search]:not(.browser-default).invalid + label:after,
+input[type=search]:not(.browser-default).valid + label:after,
+textarea.materialize-textarea.invalid + label:after,
+textarea.materialize-textarea.valid + label:after {
+ display: none;
+}
+
+input:not([type]).invalid + label.active:after,
+input:not([type]).valid + label.active:after,
+input[type=text]:not(.browser-default).invalid + label.active:after,
+input[type=text]:not(.browser-default).valid + label.active:after,
+input[type=password]:not(.browser-default).invalid + label.active:after,
+input[type=password]:not(.browser-default).valid + label.active:after,
+input[type=email]:not(.browser-default).invalid + label.active:after,
+input[type=email]:not(.browser-default).valid + label.active:after,
+input[type=url]:not(.browser-default).invalid + label.active:after,
+input[type=url]:not(.browser-default).valid + label.active:after,
+input[type=time]:not(.browser-default).invalid + label.active:after,
+input[type=time]:not(.browser-default).valid + label.active:after,
+input[type=date]:not(.browser-default).invalid + label.active:after,
+input[type=date]:not(.browser-default).valid + label.active:after,
+input[type=datetime]:not(.browser-default).invalid + label.active:after,
+input[type=datetime]:not(.browser-default).valid + label.active:after,
+input[type=datetime-local]:not(.browser-default).invalid + label.active:after,
+input[type=datetime-local]:not(.browser-default).valid + label.active:after,
+input[type=tel]:not(.browser-default).invalid + label.active:after,
+input[type=tel]:not(.browser-default).valid + label.active:after,
+input[type=number]:not(.browser-default).invalid + label.active:after,
+input[type=number]:not(.browser-default).valid + label.active:after,
+input[type=search]:not(.browser-default).invalid + label.active:after,
+input[type=search]:not(.browser-default).valid + label.active:after,
+textarea.materialize-textarea.invalid + label.active:after,
+textarea.materialize-textarea.valid + label.active:after {
+ display: block;
+}
+
+/* Validation Sass Placeholders */
+input.valid:not([type]), input.valid:not([type]):focus,
+input[type=text].valid:not(.browser-default),
+input[type=text].valid:not(.browser-default):focus,
+input[type=password].valid:not(.browser-default),
+input[type=password].valid:not(.browser-default):focus,
+input[type=email].valid:not(.browser-default),
+input[type=email].valid:not(.browser-default):focus,
+input[type=url].valid:not(.browser-default),
+input[type=url].valid:not(.browser-default):focus,
+input[type=time].valid:not(.browser-default),
+input[type=time].valid:not(.browser-default):focus,
+input[type=date].valid:not(.browser-default),
+input[type=date].valid:not(.browser-default):focus,
+input[type=datetime].valid:not(.browser-default),
+input[type=datetime].valid:not(.browser-default):focus,
+input[type=datetime-local].valid:not(.browser-default),
+input[type=datetime-local].valid:not(.browser-default):focus,
+input[type=tel].valid:not(.browser-default),
+input[type=tel].valid:not(.browser-default):focus,
+input[type=number].valid:not(.browser-default),
+input[type=number].valid:not(.browser-default):focus,
+input[type=search].valid:not(.browser-default),
+input[type=search].valid:not(.browser-default):focus,
+textarea.materialize-textarea.valid,
+textarea.materialize-textarea.valid:focus, .select-wrapper.valid > input.select-dropdown {
+ border-bottom: 1px solid #4CAF50;
+ -webkit-box-shadow: 0 1px 0 0 #4CAF50;
+ box-shadow: 0 1px 0 0 #4CAF50;
+}
+
+input.invalid:not([type]), input.invalid:not([type]):focus,
+input[type=text].invalid:not(.browser-default),
+input[type=text].invalid:not(.browser-default):focus,
+input[type=password].invalid:not(.browser-default),
+input[type=password].invalid:not(.browser-default):focus,
+input[type=email].invalid:not(.browser-default),
+input[type=email].invalid:not(.browser-default):focus,
+input[type=url].invalid:not(.browser-default),
+input[type=url].invalid:not(.browser-default):focus,
+input[type=time].invalid:not(.browser-default),
+input[type=time].invalid:not(.browser-default):focus,
+input[type=date].invalid:not(.browser-default),
+input[type=date].invalid:not(.browser-default):focus,
+input[type=datetime].invalid:not(.browser-default),
+input[type=datetime].invalid:not(.browser-default):focus,
+input[type=datetime-local].invalid:not(.browser-default),
+input[type=datetime-local].invalid:not(.browser-default):focus,
+input[type=tel].invalid:not(.browser-default),
+input[type=tel].invalid:not(.browser-default):focus,
+input[type=number].invalid:not(.browser-default),
+input[type=number].invalid:not(.browser-default):focus,
+input[type=search].invalid:not(.browser-default),
+input[type=search].invalid:not(.browser-default):focus,
+textarea.materialize-textarea.invalid,
+textarea.materialize-textarea.invalid:focus, .select-wrapper.invalid > input.select-dropdown {
+ border-bottom: 1px solid #F44336;
+ -webkit-box-shadow: 0 1px 0 0 #F44336;
+ box-shadow: 0 1px 0 0 #F44336;
+}
+
+input:not([type]).valid + label:after,
+input:not([type]):focus.valid + label:after,
+input[type=text]:not(.browser-default).valid + label:after,
+input[type=text]:not(.browser-default):focus.valid + label:after,
+input[type=password]:not(.browser-default).valid + label:after,
+input[type=password]:not(.browser-default):focus.valid + label:after,
+input[type=email]:not(.browser-default).valid + label:after,
+input[type=email]:not(.browser-default):focus.valid + label:after,
+input[type=url]:not(.browser-default).valid + label:after,
+input[type=url]:not(.browser-default):focus.valid + label:after,
+input[type=time]:not(.browser-default).valid + label:after,
+input[type=time]:not(.browser-default):focus.valid + label:after,
+input[type=date]:not(.browser-default).valid + label:after,
+input[type=date]:not(.browser-default):focus.valid + label:after,
+input[type=datetime]:not(.browser-default).valid + label:after,
+input[type=datetime]:not(.browser-default):focus.valid + label:after,
+input[type=datetime-local]:not(.browser-default).valid + label:after,
+input[type=datetime-local]:not(.browser-default):focus.valid + label:after,
+input[type=tel]:not(.browser-default).valid + label:after,
+input[type=tel]:not(.browser-default):focus.valid + label:after,
+input[type=number]:not(.browser-default).valid + label:after,
+input[type=number]:not(.browser-default):focus.valid + label:after,
+input[type=search]:not(.browser-default).valid + label:after,
+input[type=search]:not(.browser-default):focus.valid + label:after,
+textarea.materialize-textarea.valid + label:after,
+textarea.materialize-textarea:focus.valid + label:after, .select-wrapper.valid + label:after {
+ content: attr(data-success);
+ color: #4CAF50;
+ opacity: 1;
+ -webkit-transform: translateY(9px);
+ transform: translateY(9px);
+}
+
+input:not([type]).invalid + label:after,
+input:not([type]):focus.invalid + label:after,
+input[type=text]:not(.browser-default).invalid + label:after,
+input[type=text]:not(.browser-default):focus.invalid + label:after,
+input[type=password]:not(.browser-default).invalid + label:after,
+input[type=password]:not(.browser-default):focus.invalid + label:after,
+input[type=email]:not(.browser-default).invalid + label:after,
+input[type=email]:not(.browser-default):focus.invalid + label:after,
+input[type=url]:not(.browser-default).invalid + label:after,
+input[type=url]:not(.browser-default):focus.invalid + label:after,
+input[type=time]:not(.browser-default).invalid + label:after,
+input[type=time]:not(.browser-default):focus.invalid + label:after,
+input[type=date]:not(.browser-default).invalid + label:after,
+input[type=date]:not(.browser-default):focus.invalid + label:after,
+input[type=datetime]:not(.browser-default).invalid + label:after,
+input[type=datetime]:not(.browser-default):focus.invalid + label:after,
+input[type=datetime-local]:not(.browser-default).invalid + label:after,
+input[type=datetime-local]:not(.browser-default):focus.invalid + label:after,
+input[type=tel]:not(.browser-default).invalid + label:after,
+input[type=tel]:not(.browser-default):focus.invalid + label:after,
+input[type=number]:not(.browser-default).invalid + label:after,
+input[type=number]:not(.browser-default):focus.invalid + label:after,
+input[type=search]:not(.browser-default).invalid + label:after,
+input[type=search]:not(.browser-default):focus.invalid + label:after,
+textarea.materialize-textarea.invalid + label:after,
+textarea.materialize-textarea:focus.invalid + label:after, .select-wrapper.invalid + label:after {
+ content: attr(data-error);
+ color: #F44336;
+ opacity: 1;
+ -webkit-transform: translateY(9px);
+ transform: translateY(9px);
+}
+
+input:not([type]) + label:after,
+input[type=text]:not(.browser-default) + label:after,
+input[type=password]:not(.browser-default) + label:after,
+input[type=email]:not(.browser-default) + label:after,
+input[type=url]:not(.browser-default) + label:after,
+input[type=time]:not(.browser-default) + label:after,
+input[type=date]:not(.browser-default) + label:after,
+input[type=datetime]:not(.browser-default) + label:after,
+input[type=datetime-local]:not(.browser-default) + label:after,
+input[type=tel]:not(.browser-default) + label:after,
+input[type=number]:not(.browser-default) + label:after,
+input[type=search]:not(.browser-default) + label:after,
+textarea.materialize-textarea + label:after, .select-wrapper + label:after {
+ display: block;
+ content: "";
+ position: absolute;
+ top: 100%;
+ left: 0;
+ opacity: 0;
+ -webkit-transition: .2s opacity ease-out, .2s color ease-out;
+ transition: .2s opacity ease-out, .2s color ease-out;
+}
+
+.input-field {
+ position: relative;
+ margin-top: 1rem;
+}
+
+.input-field.inline {
+ display: inline-block;
+ vertical-align: middle;
+ margin-left: 5px;
+}
+
+.input-field.inline input,
+.input-field.inline .select-dropdown {
+ margin-bottom: 1rem;
+}
+
+.input-field.col label {
+ left: 0.75rem;
+}
+
+.input-field.col .prefix ~ label,
+.input-field.col .prefix ~ .validate ~ label {
+ width: calc(100% - 3rem - 1.5rem);
+}
+
+.input-field label {
+ color: #9e9e9e;
+ position: absolute;
+ top: 0;
+ left: 0;
+ height: 100%;
+ font-size: 1rem;
+ cursor: text;
+ -webkit-transition: -webkit-transform .2s ease-out;
+ transition: -webkit-transform .2s ease-out;
+ transition: transform .2s ease-out;
+ transition: transform .2s ease-out, -webkit-transform .2s ease-out;
+ -webkit-transform-origin: 0% 100%;
+ transform-origin: 0% 100%;
+ text-align: initial;
+ -webkit-transform: translateY(12px);
+ transform: translateY(12px);
+ pointer-events: none;
+}
+
+.input-field label:not(.label-icon).active {
+ -webkit-transform: translateY(-14px) scale(0.8);
+ transform: translateY(-14px) scale(0.8);
+ -webkit-transform-origin: 0 0;
+ transform-origin: 0 0;
+}
+
+.input-field .prefix {
+ position: absolute;
+ width: 3rem;
+ font-size: 2rem;
+ -webkit-transition: color .2s;
+ transition: color .2s;
+}
+
+.input-field .prefix.active {
+ color: #26a69a;
+}
+
+.input-field .prefix ~ input,
+.input-field .prefix ~ textarea,
+.input-field .prefix ~ label,
+.input-field .prefix ~ .validate ~ label,
+.input-field .prefix ~ .autocomplete-content {
+ margin-left: 3rem;
+ width: 92%;
+ width: calc(100% - 3rem);
+}
+
+.input-field .prefix ~ label {
+ margin-left: 3rem;
+}
+
+@media only screen and (max-width: 992px) {
+ .input-field .prefix ~ input {
+ width: 86%;
+ width: calc(100% - 3rem);
+ }
+}
+
+@media only screen and (max-width: 600px) {
+ .input-field .prefix ~ input {
+ width: 80%;
+ width: calc(100% - 3rem);
+ }
+}
+
+/* Search Field */
+.input-field input[type=search] {
+ display: block;
+ line-height: inherit;
+}
+
+.nav-wrapper .input-field input[type=search] {
+ height: inherit;
+ padding-left: 4rem;
+ width: calc(100% - 4rem);
+ border: 0;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+}
+
+.input-field input[type=search]:focus {
+ background-color: #fff;
+ border: 0;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+ color: #444;
+}
+
+.input-field input[type=search]:focus + label i,
+.input-field input[type=search]:focus ~ .mdi-navigation-close,
+.input-field input[type=search]:focus ~ .material-icons {
+ color: #444;
+}
+
+.input-field input[type=search] + label {
+ left: 1rem;
+}
+
+.input-field input[type=search] ~ .mdi-navigation-close,
+.input-field input[type=search] ~ .material-icons {
+ position: absolute;
+ top: 0;
+ right: 1rem;
+ color: transparent;
+ cursor: pointer;
+ font-size: 2rem;
+ -webkit-transition: .3s color;
+ transition: .3s color;
+}
+
+/* Textarea */
+textarea {
+ width: 100%;
+ height: 3rem;
+ background-color: transparent;
+}
+
+textarea.materialize-textarea {
+ overflow-y: hidden;
+ /* prevents scroll bar flash */
+ padding: .8rem 0 1.6rem 0;
+ /* prevents text jump on Enter keypress */
+ resize: none;
+ min-height: 3rem;
+}
+
+textarea.materialize-textarea.validate + label {
+ height: 100%;
+}
+
+textarea.materialize-textarea.validate + label::after {
+ top: calc(100% - 12px);
+}
+
+textarea.materialize-textarea.validate + label:not(.label-icon).active {
+ -webkit-transform: translateY(-25px);
+ transform: translateY(-25px);
+}
+
+.hiddendiv {
+ display: none;
+ white-space: pre-wrap;
+ word-wrap: break-word;
+ overflow-wrap: break-word;
+ /* future version of deprecated 'word-wrap' */
+ padding-top: 1.2rem;
+ /* prevents text jump on Enter keypress */
+ position: absolute;
+ top: 0;
+}
+
+/* Autocomplete */
+.autocomplete-content {
+ margin-top: -20px;
+ margin-bottom: 20px;
+ display: block;
+ opacity: 1;
+ position: static;
+}
+
+.autocomplete-content li .highlight {
+ color: #444;
+}
+
+.autocomplete-content li img {
+ height: 40px;
+ width: 40px;
+ margin: 5px 15px;
+}
+
+/* Radio Buttons
+ ========================================================================== */
+[type="radio"]:not(:checked),
+[type="radio"]:checked {
+ position: absolute;
+ opacity: 0;
+ pointer-events: none;
+}
+
+[type="radio"]:not(:checked) + label,
+[type="radio"]:checked + label {
+ position: relative;
+ padding-left: 35px;
+ cursor: pointer;
+ display: inline-block;
+ height: 25px;
+ line-height: 25px;
+ font-size: 1rem;
+ -webkit-transition: .28s ease;
+ transition: .28s ease;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+}
+
+[type="radio"] + label:before,
+[type="radio"] + label:after {
+ content: '';
+ position: absolute;
+ left: 0;
+ top: 0;
+ margin: 4px;
+ width: 16px;
+ height: 16px;
+ z-index: 0;
+ -webkit-transition: .28s ease;
+ transition: .28s ease;
+}
+
+/* Unchecked styles */
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after,
+[type="radio"]:checked + label:before,
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+ border-radius: 50%;
+}
+
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after {
+ border: 2px solid #5a5a5a;
+}
+
+[type="radio"]:not(:checked) + label:after {
+ -webkit-transform: scale(0);
+ transform: scale(0);
+}
+
+/* Checked styles */
+[type="radio"]:checked + label:before {
+ border: 2px solid transparent;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+ border: 2px solid #26a69a;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:after {
+ background-color: #26a69a;
+}
+
+[type="radio"]:checked + label:after {
+ -webkit-transform: scale(1.02);
+ transform: scale(1.02);
+}
+
+/* Radio With gap */
+[type="radio"].with-gap:checked + label:after {
+ -webkit-transform: scale(0.5);
+ transform: scale(0.5);
+}
+
+/* Focused styles */
+[type="radio"].tabbed:focus + label:before {
+ -webkit-box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+ box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+}
+
+/* Disabled Radio With gap */
+[type="radio"].with-gap:disabled:checked + label:before {
+ border: 2px solid rgba(0, 0, 0, 0.42);
+}
+
+[type="radio"].with-gap:disabled:checked + label:after {
+ border: none;
+ background-color: rgba(0, 0, 0, 0.42);
+}
+
+/* Disabled style */
+[type="radio"]:disabled:not(:checked) + label:before,
+[type="radio"]:disabled:checked + label:before {
+ background-color: transparent;
+ border-color: rgba(0, 0, 0, 0.42);
+}
+
+[type="radio"]:disabled + label {
+ color: rgba(0, 0, 0, 0.42);
+}
+
+[type="radio"]:disabled:not(:checked) + label:before {
+ border-color: rgba(0, 0, 0, 0.42);
+}
+
+[type="radio"]:disabled:checked + label:after {
+ background-color: rgba(0, 0, 0, 0.42);
+ border-color: #949494;
+}
+
+/* Checkboxes
+ ========================================================================== */
+/* CUSTOM CSS CHECKBOXES */
+form p {
+ margin-bottom: 10px;
+ text-align: left;
+}
+
+form p:last-child {
+ margin-bottom: 0;
+}
+
+/* Remove default checkbox */
+[type="checkbox"]:not(:checked),
+[type="checkbox"]:checked {
+ position: absolute;
+ opacity: 0;
+ pointer-events: none;
+}
+
+[type="checkbox"] {
+ /* checkbox aspect */
+}
+
+[type="checkbox"] + label {
+ position: relative;
+ padding-left: 35px;
+ cursor: pointer;
+ display: inline-block;
+ height: 25px;
+ line-height: 25px;
+ font-size: 1rem;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+}
+
+[type="checkbox"] + label:before,
+[type="checkbox"]:not(.filled-in) + label:after {
+ content: '';
+ position: absolute;
+ top: 0;
+ left: 0;
+ width: 18px;
+ height: 18px;
+ z-index: 0;
+ border: 2px solid #5a5a5a;
+ border-radius: 1px;
+ margin-top: 2px;
+ -webkit-transition: .2s;
+ transition: .2s;
+}
+
+[type="checkbox"]:not(.filled-in) + label:after {
+ border: 0;
+ -webkit-transform: scale(0);
+ transform: scale(0);
+}
+
+[type="checkbox"]:not(:checked):disabled + label:before {
+ border: none;
+ background-color: rgba(0, 0, 0, 0.42);
+}
+
+[type="checkbox"].tabbed:focus + label:after {
+ -webkit-transform: scale(1);
+ transform: scale(1);
+ border: 0;
+ border-radius: 50%;
+ -webkit-box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+ box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+ background-color: rgba(0, 0, 0, 0.1);
+}
+
+[type="checkbox"]:checked + label:before {
+ top: -4px;
+ left: -5px;
+ width: 12px;
+ height: 22px;
+ border-top: 2px solid transparent;
+ border-left: 2px solid transparent;
+ border-right: 2px solid #26a69a;
+ border-bottom: 2px solid #26a69a;
+ -webkit-transform: rotate(40deg);
+ transform: rotate(40deg);
+ -webkit-backface-visibility: hidden;
+ backface-visibility: hidden;
+ -webkit-transform-origin: 100% 100%;
+ transform-origin: 100% 100%;
+}
+
+[type="checkbox"]:checked:disabled + label:before {
+ border-right: 2px solid rgba(0, 0, 0, 0.42);
+ border-bottom: 2px solid rgba(0, 0, 0, 0.42);
+}
+
+/* Indeterminate checkbox */
+[type="checkbox"]:indeterminate + label:before {
+ top: -11px;
+ left: -12px;
+ width: 10px;
+ height: 22px;
+ border-top: none;
+ border-left: none;
+ border-right: 2px solid #26a69a;
+ border-bottom: none;
+ -webkit-transform: rotate(90deg);
+ transform: rotate(90deg);
+ -webkit-backface-visibility: hidden;
+ backface-visibility: hidden;
+ -webkit-transform-origin: 100% 100%;
+ transform-origin: 100% 100%;
+}
+
+[type="checkbox"]:indeterminate:disabled + label:before {
+ border-right: 2px solid rgba(0, 0, 0, 0.42);
+ background-color: transparent;
+}
+
+[type="checkbox"].filled-in + label:after {
+ border-radius: 2px;
+}
+
+[type="checkbox"].filled-in + label:before,
+[type="checkbox"].filled-in + label:after {
+ content: '';
+ left: 0;
+ position: absolute;
+ /* .1s delay is for check animation */
+ -webkit-transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
+ transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
+ z-index: 1;
+}
+
+[type="checkbox"].filled-in:not(:checked) + label:before {
+ width: 0;
+ height: 0;
+ border: 3px solid transparent;
+ left: 6px;
+ top: 10px;
+ -webkit-transform: rotateZ(37deg);
+ transform: rotateZ(37deg);
+ -webkit-transform-origin: 100% 100%;
+ transform-origin: 100% 100%;
+}
+
+[type="checkbox"].filled-in:not(:checked) + label:after {
+ height: 20px;
+ width: 20px;
+ background-color: transparent;
+ border: 2px solid #5a5a5a;
+ top: 0px;
+ z-index: 0;
+}
+
+[type="checkbox"].filled-in:checked + label:before {
+ top: 0;
+ left: 1px;
+ width: 8px;
+ height: 13px;
+ border-top: 2px solid transparent;
+ border-left: 2px solid transparent;
+ border-right: 2px solid #fff;
+ border-bottom: 2px solid #fff;
+ -webkit-transform: rotateZ(37deg);
+ transform: rotateZ(37deg);
+ -webkit-transform-origin: 100% 100%;
+ transform-origin: 100% 100%;
+}
+
+[type="checkbox"].filled-in:checked + label:after {
+ top: 0;
+ width: 20px;
+ height: 20px;
+ border: 2px solid #26a69a;
+ background-color: #26a69a;
+ z-index: 0;
+}
+
+[type="checkbox"].filled-in.tabbed:focus + label:after {
+ border-radius: 2px;
+ border-color: #5a5a5a;
+ background-color: rgba(0, 0, 0, 0.1);
+}
+
+[type="checkbox"].filled-in.tabbed:checked:focus + label:after {
+ border-radius: 2px;
+ background-color: #26a69a;
+ border-color: #26a69a;
+}
+
+[type="checkbox"].filled-in:disabled:not(:checked) + label:before {
+ background-color: transparent;
+ border: 2px solid transparent;
+}
+
+[type="checkbox"].filled-in:disabled:not(:checked) + label:after {
+ border-color: transparent;
+ background-color: #949494;
+}
+
+[type="checkbox"].filled-in:disabled:checked + label:before {
+ background-color: transparent;
+}
+
+[type="checkbox"].filled-in:disabled:checked + label:after {
+ background-color: #949494;
+ border-color: #949494;
+}
+
+/* Switch
+ ========================================================================== */
+.switch,
+.switch * {
+ -webkit-tap-highlight-color: transparent;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+}
+
+.switch label {
+ cursor: pointer;
+}
+
+.switch label input[type=checkbox] {
+ opacity: 0;
+ width: 0;
+ height: 0;
+}
+
+.switch label input[type=checkbox]:checked + .lever {
+ background-color: #84c7c1;
+}
+
+.switch label input[type=checkbox]:checked + .lever:before, .switch label input[type=checkbox]:checked + .lever:after {
+ left: 18px;
+}
+
+.switch label input[type=checkbox]:checked + .lever:after {
+ background-color: #26a69a;
+}
+
+.switch label .lever {
+ content: "";
+ display: inline-block;
+ position: relative;
+ width: 36px;
+ height: 14px;
+ background-color: rgba(0, 0, 0, 0.38);
+ border-radius: 15px;
+ margin-right: 10px;
+ -webkit-transition: background 0.3s ease;
+ transition: background 0.3s ease;
+ vertical-align: middle;
+ margin: 0 16px;
+}
+
+.switch label .lever:before, .switch label .lever:after {
+ content: "";
+ position: absolute;
+ display: inline-block;
+ width: 20px;
+ height: 20px;
+ border-radius: 50%;
+ left: 0;
+ top: -3px;
+ -webkit-transition: left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;
+ transition: left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;
+ transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease;
+ transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;
+}
+
+.switch label .lever:before {
+ background-color: rgba(38, 166, 154, 0.15);
+}
+
+.switch label .lever:after {
+ background-color: #F1F1F1;
+ -webkit-box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12);
+ box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12);
+}
+
+input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before,
+input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before {
+ -webkit-transform: scale(2.4);
+ transform: scale(2.4);
+ background-color: rgba(38, 166, 154, 0.15);
+}
+
+input[type=checkbox]:not(:disabled) ~ .lever:active:before,
+input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before {
+ -webkit-transform: scale(2.4);
+ transform: scale(2.4);
+ background-color: rgba(0, 0, 0, 0.08);
+}
+
+.switch input[type=checkbox][disabled] + .lever {
+ cursor: default;
+ background-color: rgba(0, 0, 0, 0.12);
+}
+
+.switch label input[type=checkbox][disabled] + .lever:after,
+.switch label input[type=checkbox][disabled]:checked + .lever:after {
+ background-color: #949494;
+}
+
+/* Select Field
+ ========================================================================== */
+select {
+ display: none;
+}
+
+select.browser-default {
+ display: block;
+}
+
+select {
+ background-color: rgba(255, 255, 255, 0.9);
+ width: 100%;
+ padding: 5px;
+ border: 1px solid #f2f2f2;
+ border-radius: 2px;
+ height: 3rem;
+}
+
+.input-field > select {
+ display: block;
+ position: absolute;
+ width: 0;
+ pointer-events: none;
+ height: 0;
+ top: 0;
+ left: 0;
+ opacity: 0;
+}
+
+.select-label {
+ position: absolute;
+}
+
+.select-wrapper {
+ position: relative;
+}
+
+.select-wrapper.valid + label,
+.select-wrapper.invalid + label {
+ width: 100%;
+ pointer-events: none;
+}
+
+.select-wrapper input.select-dropdown {
+ position: relative;
+ cursor: pointer;
+ background-color: transparent;
+ border: none;
+ border-bottom: 1px solid #9e9e9e;
+ outline: none;
+ height: 3rem;
+ line-height: 3rem;
+ width: 100%;
+ font-size: 1rem;
+ margin: 0 0 20px 0;
+ padding: 0;
+ display: block;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+}
+
+.select-wrapper span.caret {
+ color: initial;
+ position: absolute;
+ right: 0;
+ top: 0;
+ bottom: 0;
+ height: 10px;
+ margin: auto 0;
+ font-size: 10px;
+ line-height: 10px;
+}
+
+.select-wrapper + label {
+ position: absolute;
+ top: -26px;
+ font-size: 0.8rem;
+}
+
+select:disabled {
+ color: rgba(0, 0, 0, 0.42);
+}
+
+.select-wrapper.disabled span.caret,
+.select-wrapper.disabled + label {
+ color: rgba(0, 0, 0, 0.42);
+}
+
+.select-wrapper input.select-dropdown:disabled {
+ color: rgba(0, 0, 0, 0.42);
+ cursor: default;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+}
+
+.select-wrapper i {
+ color: rgba(0, 0, 0, 0.3);
+}
+
+.select-dropdown li.disabled,
+.select-dropdown li.disabled > span,
+.select-dropdown li.optgroup {
+ color: rgba(0, 0, 0, 0.3);
+ background-color: transparent;
+}
+
+.select-dropdown.dropdown-content li.active {
+ background-color: transparent;
+}
+
+.select-dropdown.dropdown-content li:hover {
+ background-color: rgba(0, 0, 0, 0.06);
+}
+
+.select-dropdown.dropdown-content li.selected {
+ background-color: rgba(0, 0, 0, 0.03);
+}
+
+.prefix ~ .select-wrapper {
+ margin-left: 3rem;
+ width: 92%;
+ width: calc(100% - 3rem);
+}
+
+.prefix ~ label {
+ margin-left: 3rem;
+}
+
+.select-dropdown li img {
+ height: 40px;
+ width: 40px;
+ margin: 5px 15px;
+ float: right;
+}
+
+.select-dropdown li.optgroup {
+ border-top: 1px solid #eee;
+}
+
+.select-dropdown li.optgroup.selected > span {
+ color: rgba(0, 0, 0, 0.7);
+}
+
+.select-dropdown li.optgroup > span {
+ color: rgba(0, 0, 0, 0.4);
+}
+
+.select-dropdown li.optgroup ~ li.optgroup-option {
+ padding-left: 1rem;
+}
+
+/* File Input
+ ========================================================================== */
+.file-field {
+ position: relative;
+}
+
+.file-field .file-path-wrapper {
+ overflow: hidden;
+ padding-left: 10px;
+}
+
+.file-field input.file-path {
+ width: 100%;
+}
+
+.file-field .btn, .file-field .btn-large {
+ float: left;
+ height: 3rem;
+ line-height: 3rem;
+}
+
+.file-field span {
+ cursor: pointer;
+}
+
+.file-field input[type=file] {
+ position: absolute;
+ top: 0;
+ right: 0;
+ left: 0;
+ bottom: 0;
+ width: 100%;
+ margin: 0;
+ padding: 0;
+ font-size: 20px;
+ cursor: pointer;
+ opacity: 0;
+ filter: alpha(opacity=0);
+}
+
+.file-field input[type=file]::-webkit-file-upload-button {
+ display: none;
+}
+
+/* Range
+ ========================================================================== */
+.range-field {
+ position: relative;
+}
+
+input[type=range],
+input[type=range] + .thumb {
+ cursor: pointer;
+}
+
+input[type=range] {
+ position: relative;
+ background-color: transparent;
+ border: none;
+ outline: none;
+ width: 100%;
+ margin: 15px 0;
+ padding: 0;
+}
+
+input[type=range]:focus {
+ outline: none;
+}
+
+input[type=range] + .thumb {
+ position: absolute;
+ top: 10px;
+ left: 0;
+ border: none;
+ height: 0;
+ width: 0;
+ border-radius: 50%;
+ background-color: #26a69a;
+ margin-left: 7px;
+ -webkit-transform-origin: 50% 50%;
+ transform-origin: 50% 50%;
+ -webkit-transform: rotate(-45deg);
+ transform: rotate(-45deg);
+}
+
+input[type=range] + .thumb .value {
+ display: block;
+ width: 30px;
+ text-align: center;
+ color: #26a69a;
+ font-size: 0;
+ -webkit-transform: rotate(45deg);
+ transform: rotate(45deg);
+}
+
+input[type=range] + .thumb.active {
+ border-radius: 50% 50% 50% 0;
+}
+
+input[type=range] + .thumb.active .value {
+ color: #fff;
+ margin-left: -1px;
+ margin-top: 8px;
+ font-size: 10px;
+}
+
+input[type=range] {
+ -webkit-appearance: none;
+}
+
+input[type=range]::-webkit-slider-runnable-track {
+ height: 3px;
+ background: #c2c0c2;
+ border: none;
+}
+
+input[type=range]::-webkit-slider-thumb {
+ -webkit-appearance: none;
+ border: none;
+ height: 14px;
+ width: 14px;
+ border-radius: 50%;
+ background-color: #26a69a;
+ -webkit-transform-origin: 50% 50%;
+ transform-origin: 50% 50%;
+ margin: -5px 0 0 0;
+ -webkit-transition: .3s;
+ transition: .3s;
+}
+
+input[type=range]:focus::-webkit-slider-runnable-track {
+ background: #ccc;
+}
+
+input[type=range] {
+ /* fix for FF unable to apply focus style bug */
+ border: 1px solid white;
+ /*required for proper track sizing in FF*/
+}
+
+input[type=range]::-moz-range-track {
+ height: 3px;
+ background: #ddd;
+ border: none;
+}
+
+input[type=range]::-moz-range-thumb {
+ border: none;
+ height: 14px;
+ width: 14px;
+ border-radius: 50%;
+ background: #26a69a;
+ margin-top: -5px;
+}
+
+input[type=range]:-moz-focusring {
+ outline: 1px solid #fff;
+ outline-offset: -1px;
+}
+
+input[type=range]:focus::-moz-range-track {
+ background: #ccc;
+}
+
+input[type=range]::-ms-track {
+ height: 3px;
+ background: transparent;
+ border-color: transparent;
+ border-width: 6px 0;
+ /*remove default tick marks*/
+ color: transparent;
+}
+
+input[type=range]::-ms-fill-lower {
+ background: #777;
+}
+
+input[type=range]::-ms-fill-upper {
+ background: #ddd;
+}
+
+input[type=range]::-ms-thumb {
+ border: none;
+ height: 14px;
+ width: 14px;
+ border-radius: 50%;
+ background: #26a69a;
+}
+
+input[type=range]:focus::-ms-fill-lower {
+ background: #888;
+}
+
+input[type=range]:focus::-ms-fill-upper {
+ background: #ccc;
+}
+
+/***************
+ Nav List
+***************/
+.table-of-contents.fixed {
+ position: fixed;
+}
+
+.table-of-contents li {
+ padding: 2px 0;
+}
+
+.table-of-contents a {
+ display: inline-block;
+ font-weight: 300;
+ color: #757575;
+ padding-left: 20px;
+ height: 1.5rem;
+ line-height: 1.5rem;
+ letter-spacing: .4;
+ display: inline-block;
+}
+
+.table-of-contents a:hover {
+ color: #a8a8a8;
+ padding-left: 19px;
+ border-left: 1px solid #ee6e73;
+}
+
+.table-of-contents a.active {
+ font-weight: 500;
+ padding-left: 18px;
+ border-left: 2px solid #ee6e73;
+}
+
+.side-nav {
+ position: fixed;
+ width: 300px;
+ left: 0;
+ top: 0;
+ margin: 0;
+ -webkit-transform: translateX(-100%);
+ transform: translateX(-100%);
+ height: 100%;
+ height: calc(100% + 60px);
+ height: -moz-calc(100%);
+ padding-bottom: 60px;
+ background-color: #fff;
+ z-index: 999;
+ overflow-y: auto;
+ will-change: transform;
+ -webkit-backface-visibility: hidden;
+ backface-visibility: hidden;
+ -webkit-transform: translateX(-105%);
+ transform: translateX(-105%);
+}
+
+.side-nav.right-aligned {
+ right: 0;
+ -webkit-transform: translateX(105%);
+ transform: translateX(105%);
+ left: auto;
+ -webkit-transform: translateX(100%);
+ transform: translateX(100%);
+}
+
+.side-nav .collapsible {
+ margin: 0;
+}
+
+.side-nav li {
+ float: none;
+ line-height: 48px;
+}
+
+.side-nav li.active {
+ background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav li > a {
+ color: rgba(0, 0, 0, 0.87);
+ display: block;
+ font-size: 14px;
+ font-weight: 500;
+ height: 48px;
+ line-height: 48px;
+ padding: 0 32px;
+}
+
+.side-nav li > a:hover {
+ background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav li > a.btn, .side-nav li > a.btn-large, .side-nav li > a.btn-large, .side-nav li > a.btn-flat, .side-nav li > a.btn-floating {
+ margin: 10px 15px;
+}
+
+.side-nav li > a.btn, .side-nav li > a.btn-large, .side-nav li > a.btn-large, .side-nav li > a.btn-floating {
+ color: #fff;
+}
+
+.side-nav li > a.btn-flat {
+ color: #343434;
+}
+
+.side-nav li > a.btn:hover, .side-nav li > a.btn-large:hover, .side-nav li > a.btn-large:hover {
+ background-color: #2bbbad;
+}
+
+.side-nav li > a.btn-floating:hover {
+ background-color: #26a69a;
+}
+
+.side-nav li > a > i,
+.side-nav li > a > [class^="mdi-"], .side-nav li > a li > a > [class*="mdi-"],
+.side-nav li > a > i.material-icons {
+ float: left;
+ height: 48px;
+ line-height: 48px;
+ margin: 0 32px 0 0;
+ width: 24px;
+ color: rgba(0, 0, 0, 0.54);
+}
+
+.side-nav .divider {
+ margin: 8px 0 0 0;
+}
+
+.side-nav .subheader {
+ cursor: initial;
+ pointer-events: none;
+ color: rgba(0, 0, 0, 0.54);
+ font-size: 14px;
+ font-weight: 500;
+ line-height: 48px;
+}
+
+.side-nav .subheader:hover {
+ background-color: transparent;
+}
+
+.side-nav .user-view,
+.side-nav .userView {
+ position: relative;
+ padding: 32px 32px 0;
+ margin-bottom: 8px;
+}
+
+.side-nav .user-view > a,
+.side-nav .userView > a {
+ height: auto;
+ padding: 0;
+}
+
+.side-nav .user-view > a:hover,
+.side-nav .userView > a:hover {
+ background-color: transparent;
+}
+
+.side-nav .user-view .background,
+.side-nav .userView .background {
+ overflow: hidden;
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ z-index: -1;
+}
+
+.side-nav .user-view .circle, .side-nav .user-view .name, .side-nav .user-view .email,
+.side-nav .userView .circle,
+.side-nav .userView .name,
+.side-nav .userView .email {
+ display: block;
+}
+
+.side-nav .user-view .circle,
+.side-nav .userView .circle {
+ height: 64px;
+ width: 64px;
+}
+
+.side-nav .user-view .name,
+.side-nav .user-view .email,
+.side-nav .userView .name,
+.side-nav .userView .email {
+ font-size: 14px;
+ line-height: 24px;
+}
+
+.side-nav .user-view .name,
+.side-nav .userView .name {
+ margin-top: 16px;
+ font-weight: 500;
+}
+
+.side-nav .user-view .email,
+.side-nav .userView .email {
+ padding-bottom: 16px;
+ font-weight: 400;
+}
+
+.drag-target {
+ height: 100%;
+ width: 10px;
+ position: fixed;
+ top: 0;
+ z-index: 998;
+}
+
+.side-nav.fixed {
+ left: 0;
+ -webkit-transform: translateX(0);
+ transform: translateX(0);
+ position: fixed;
+}
+
+.side-nav.fixed.right-aligned {
+ right: 0;
+ left: auto;
+}
+
+@media only screen and (max-width: 992px) {
+ .side-nav.fixed {
+ -webkit-transform: translateX(-105%);
+ transform: translateX(-105%);
+ }
+ .side-nav.fixed.right-aligned {
+ -webkit-transform: translateX(105%);
+ transform: translateX(105%);
+ }
+ .side-nav a {
+ padding: 0 16px;
+ }
+ .side-nav .user-view,
+ .side-nav .userView {
+ padding: 16px 16px 0;
+ }
+}
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active {
+ background-color: #ee6e73;
+}
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active a,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active a {
+ color: #fff;
+}
+
+.side-nav .collapsible-body {
+ padding: 0;
+}
+
+#sidenav-overlay {
+ position: fixed;
+ top: 0;
+ left: 0;
+ right: 0;
+ height: 120vh;
+ background-color: rgba(0, 0, 0, 0.5);
+ z-index: 997;
+ will-change: opacity;
+}
+
+/*
+ @license
+ Copyright (c) 2014 The Polymer Project Authors. All rights reserved.
+ This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt
+ The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt
+ The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt
+ Code distributed by Google as part of the polymer project is also
+ subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt
+ */
+/**************************/
+/* STYLES FOR THE SPINNER */
+/**************************/
+/*
+ * Constants:
+ * STROKEWIDTH = 3px
+ * ARCSIZE = 270 degrees (amount of circle the arc takes up)
+ * ARCTIME = 1333ms (time it takes to expand and contract arc)
+ * ARCSTARTROT = 216 degrees (how much the start location of the arc
+ * should rotate each time, 216 gives us a
+ * 5 pointed star shape (it's 360/5 * 3).
+ * For a 7 pointed star, we might do
+ * 360/7 * 3 = 154.286)
+ * CONTAINERWIDTH = 28px
+ * SHRINK_TIME = 400ms
+ */
+.preloader-wrapper {
+ display: inline-block;
+ position: relative;
+ width: 50px;
+ height: 50px;
+}
+
+.preloader-wrapper.small {
+ width: 36px;
+ height: 36px;
+}
+
+.preloader-wrapper.big {
+ width: 64px;
+ height: 64px;
+}
+
+.preloader-wrapper.active {
+ /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */
+ -webkit-animation: container-rotate 1568ms linear infinite;
+ animation: container-rotate 1568ms linear infinite;
+}
+
+@-webkit-keyframes container-rotate {
+ to {
+ -webkit-transform: rotate(360deg);
+ }
+}
+
+@keyframes container-rotate {
+ to {
+ -webkit-transform: rotate(360deg);
+ transform: rotate(360deg);
+ }
+}
+
+.spinner-layer {
+ position: absolute;
+ width: 100%;
+ height: 100%;
+ opacity: 0;
+ border-color: #26a69a;
+}
+
+.spinner-blue,
+.spinner-blue-only {
+ border-color: #4285f4;
+}
+
+.spinner-red,
+.spinner-red-only {
+ border-color: #db4437;
+}
+
+.spinner-yellow,
+.spinner-yellow-only {
+ border-color: #f4b400;
+}
+
+.spinner-green,
+.spinner-green-only {
+ border-color: #0f9d58;
+}
+
+/**
+ * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee):
+ *
+ * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't
+ * guarantee that the animation will start _exactly_ after that value. So we avoid using
+ * animation-delay and instead set custom keyframes for each color (as redundant as it
+ * seems).
+ *
+ * We write out each animation in full (instead of separating animation-name,
+ * animation-duration, etc.) because under the polyfill, Safari does not recognize those
+ * specific properties properly, treats them as -webkit-animation, and overrides the
+ * other animation rules. See https://github.com/Polymer/platform/issues/53.
+ */
+.active .spinner-layer.spinner-blue {
+ /* durations: 4 * ARCTIME */
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-red {
+ /* durations: 4 * ARCTIME */
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-yellow {
+ /* durations: 4 * ARCTIME */
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-green {
+ /* durations: 4 * ARCTIME */
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer,
+.active .spinner-layer.spinner-blue-only,
+.active .spinner-layer.spinner-red-only,
+.active .spinner-layer.spinner-yellow-only,
+.active .spinner-layer.spinner-green-only {
+ /* durations: 4 * ARCTIME */
+ opacity: 1;
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes fill-unfill-rotate {
+ 12.5% {
+ -webkit-transform: rotate(135deg);
+ }
+ /* 0.5 * ARCSIZE */
+ 25% {
+ -webkit-transform: rotate(270deg);
+ }
+ /* 1 * ARCSIZE */
+ 37.5% {
+ -webkit-transform: rotate(405deg);
+ }
+ /* 1.5 * ARCSIZE */
+ 50% {
+ -webkit-transform: rotate(540deg);
+ }
+ /* 2 * ARCSIZE */
+ 62.5% {
+ -webkit-transform: rotate(675deg);
+ }
+ /* 2.5 * ARCSIZE */
+ 75% {
+ -webkit-transform: rotate(810deg);
+ }
+ /* 3 * ARCSIZE */
+ 87.5% {
+ -webkit-transform: rotate(945deg);
+ }
+ /* 3.5 * ARCSIZE */
+ to {
+ -webkit-transform: rotate(1080deg);
+ }
+ /* 4 * ARCSIZE */
+}
+
+@keyframes fill-unfill-rotate {
+ 12.5% {
+ -webkit-transform: rotate(135deg);
+ transform: rotate(135deg);
+ }
+ /* 0.5 * ARCSIZE */
+ 25% {
+ -webkit-transform: rotate(270deg);
+ transform: rotate(270deg);
+ }
+ /* 1 * ARCSIZE */
+ 37.5% {
+ -webkit-transform: rotate(405deg);
+ transform: rotate(405deg);
+ }
+ /* 1.5 * ARCSIZE */
+ 50% {
+ -webkit-transform: rotate(540deg);
+ transform: rotate(540deg);
+ }
+ /* 2 * ARCSIZE */
+ 62.5% {
+ -webkit-transform: rotate(675deg);
+ transform: rotate(675deg);
+ }
+ /* 2.5 * ARCSIZE */
+ 75% {
+ -webkit-transform: rotate(810deg);
+ transform: rotate(810deg);
+ }
+ /* 3 * ARCSIZE */
+ 87.5% {
+ -webkit-transform: rotate(945deg);
+ transform: rotate(945deg);
+ }
+ /* 3.5 * ARCSIZE */
+ to {
+ -webkit-transform: rotate(1080deg);
+ transform: rotate(1080deg);
+ }
+ /* 4 * ARCSIZE */
+}
+
+@-webkit-keyframes blue-fade-in-out {
+ from {
+ opacity: 1;
+ }
+ 25% {
+ opacity: 1;
+ }
+ 26% {
+ opacity: 0;
+ }
+ 89% {
+ opacity: 0;
+ }
+ 90% {
+ opacity: 1;
+ }
+ 100% {
+ opacity: 1;
+ }
+}
+
+@keyframes blue-fade-in-out {
+ from {
+ opacity: 1;
+ }
+ 25% {
+ opacity: 1;
+ }
+ 26% {
+ opacity: 0;
+ }
+ 89% {
+ opacity: 0;
+ }
+ 90% {
+ opacity: 1;
+ }
+ 100% {
+ opacity: 1;
+ }
+}
+
+@-webkit-keyframes red-fade-in-out {
+ from {
+ opacity: 0;
+ }
+ 15% {
+ opacity: 0;
+ }
+ 25% {
+ opacity: 1;
+ }
+ 50% {
+ opacity: 1;
+ }
+ 51% {
+ opacity: 0;
+ }
+}
+
+@keyframes red-fade-in-out {
+ from {
+ opacity: 0;
+ }
+ 15% {
+ opacity: 0;
+ }
+ 25% {
+ opacity: 1;
+ }
+ 50% {
+ opacity: 1;
+ }
+ 51% {
+ opacity: 0;
+ }
+}
+
+@-webkit-keyframes yellow-fade-in-out {
+ from {
+ opacity: 0;
+ }
+ 40% {
+ opacity: 0;
+ }
+ 50% {
+ opacity: 1;
+ }
+ 75% {
+ opacity: 1;
+ }
+ 76% {
+ opacity: 0;
+ }
+}
+
+@keyframes yellow-fade-in-out {
+ from {
+ opacity: 0;
+ }
+ 40% {
+ opacity: 0;
+ }
+ 50% {
+ opacity: 1;
+ }
+ 75% {
+ opacity: 1;
+ }
+ 76% {
+ opacity: 0;
+ }
+}
+
+@-webkit-keyframes green-fade-in-out {
+ from {
+ opacity: 0;
+ }
+ 65% {
+ opacity: 0;
+ }
+ 75% {
+ opacity: 1;
+ }
+ 90% {
+ opacity: 1;
+ }
+ 100% {
+ opacity: 0;
+ }
+}
+
+@keyframes green-fade-in-out {
+ from {
+ opacity: 0;
+ }
+ 65% {
+ opacity: 0;
+ }
+ 75% {
+ opacity: 1;
+ }
+ 90% {
+ opacity: 1;
+ }
+ 100% {
+ opacity: 0;
+ }
+}
+
+/**
+ * Patch the gap that appear between the two adjacent div.circle-clipper while the
+ * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11).
+ */
+.gap-patch {
+ position: absolute;
+ top: 0;
+ left: 45%;
+ width: 10%;
+ height: 100%;
+ overflow: hidden;
+ border-color: inherit;
+}
+
+.gap-patch .circle {
+ width: 1000%;
+ left: -450%;
+}
+
+.circle-clipper {
+ display: inline-block;
+ position: relative;
+ width: 50%;
+ height: 100%;
+ overflow: hidden;
+ border-color: inherit;
+}
+
+.circle-clipper .circle {
+ width: 200%;
+ height: 100%;
+ border-width: 3px;
+ /* STROKEWIDTH */
+ border-style: solid;
+ border-color: inherit;
+ border-bottom-color: transparent !important;
+ border-radius: 50%;
+ -webkit-animation: none;
+ animation: none;
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+}
+
+.circle-clipper.left .circle {
+ left: 0;
+ border-right-color: transparent !important;
+ -webkit-transform: rotate(129deg);
+ transform: rotate(129deg);
+}
+
+.circle-clipper.right .circle {
+ left: -100%;
+ border-left-color: transparent !important;
+ -webkit-transform: rotate(-129deg);
+ transform: rotate(-129deg);
+}
+
+.active .circle-clipper.left .circle {
+ /* duration: ARCTIME */
+ -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+ animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .circle-clipper.right .circle {
+ /* duration: ARCTIME */
+ -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+ animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes left-spin {
+ from {
+ -webkit-transform: rotate(130deg);
+ }
+ 50% {
+ -webkit-transform: rotate(-5deg);
+ }
+ to {
+ -webkit-transform: rotate(130deg);
+ }
+}
+
+@keyframes left-spin {
+ from {
+ -webkit-transform: rotate(130deg);
+ transform: rotate(130deg);
+ }
+ 50% {
+ -webkit-transform: rotate(-5deg);
+ transform: rotate(-5deg);
+ }
+ to {
+ -webkit-transform: rotate(130deg);
+ transform: rotate(130deg);
+ }
+}
+
+@-webkit-keyframes right-spin {
+ from {
+ -webkit-transform: rotate(-130deg);
+ }
+ 50% {
+ -webkit-transform: rotate(5deg);
+ }
+ to {
+ -webkit-transform: rotate(-130deg);
+ }
+}
+
+@keyframes right-spin {
+ from {
+ -webkit-transform: rotate(-130deg);
+ transform: rotate(-130deg);
+ }
+ 50% {
+ -webkit-transform: rotate(5deg);
+ transform: rotate(5deg);
+ }
+ to {
+ -webkit-transform: rotate(-130deg);
+ transform: rotate(-130deg);
+ }
+}
+
+#spinnerContainer.cooldown {
+ /* duration: SHRINK_TIME */
+ -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);
+ animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);
+}
+
+@-webkit-keyframes fade-out {
+ from {
+ opacity: 1;
+ }
+ to {
+ opacity: 0;
+ }
+}
+
+@keyframes fade-out {
+ from {
+ opacity: 1;
+ }
+ to {
+ opacity: 0;
+ }
+}
+
+.slider {
+ position: relative;
+ height: 400px;
+ width: 100%;
+}
+
+.slider.fullscreen {
+ height: 100%;
+ width: 100%;
+ position: absolute;
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0;
+}
+
+.slider.fullscreen ul.slides {
+ height: 100%;
+}
+
+.slider.fullscreen ul.indicators {
+ z-index: 2;
+ bottom: 30px;
+}
+
+.slider .slides {
+ background-color: #9e9e9e;
+ margin: 0;
+ height: 400px;
+}
+
+.slider .slides li {
+ opacity: 0;
+ position: absolute;
+ top: 0;
+ left: 0;
+ z-index: 1;
+ width: 100%;
+ height: inherit;
+ overflow: hidden;
+}
+
+.slider .slides li img {
+ height: 100%;
+ width: 100%;
+ background-size: cover;
+ background-position: center;
+}
+
+.slider .slides li .caption {
+ color: #fff;
+ position: absolute;
+ top: 15%;
+ left: 15%;
+ width: 70%;
+ opacity: 0;
+}
+
+.slider .slides li .caption p {
+ color: #e0e0e0;
+}
+
+.slider .slides li.active {
+ z-index: 2;
+}
+
+.slider .indicators {
+ position: absolute;
+ text-align: center;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ margin: 0;
+}
+
+.slider .indicators .indicator-item {
+ display: inline-block;
+ position: relative;
+ cursor: pointer;
+ height: 16px;
+ width: 16px;
+ margin: 0 12px;
+ background-color: #e0e0e0;
+ -webkit-transition: background-color .3s;
+ transition: background-color .3s;
+ border-radius: 50%;
+}
+
+.slider .indicators .indicator-item.active {
+ background-color: #4CAF50;
+}
+
+.carousel {
+ overflow: hidden;
+ position: relative;
+ width: 100%;
+ height: 400px;
+ -webkit-perspective: 500px;
+ perspective: 500px;
+ -webkit-transform-style: preserve-3d;
+ transform-style: preserve-3d;
+ -webkit-transform-origin: 0% 50%;
+ transform-origin: 0% 50%;
+}
+
+.carousel.carousel-slider {
+ top: 0;
+ left: 0;
+}
+
+.carousel.carousel-slider .carousel-fixed-item {
+ position: absolute;
+ left: 0;
+ right: 0;
+ bottom: 20px;
+ z-index: 1;
+}
+
+.carousel.carousel-slider .carousel-fixed-item.with-indicators {
+ bottom: 68px;
+}
+
+.carousel.carousel-slider .carousel-item {
+ width: 100%;
+ height: 100%;
+ min-height: 400px;
+ position: absolute;
+ top: 0;
+ left: 0;
+}
+
+.carousel.carousel-slider .carousel-item h2 {
+ font-size: 24px;
+ font-weight: 500;
+ line-height: 32px;
+}
+
+.carousel.carousel-slider .carousel-item p {
+ font-size: 15px;
+}
+
+.carousel .carousel-item {
+ display: none;
+ width: 200px;
+ height: 200px;
+ position: absolute;
+ top: 0;
+ left: 0;
+}
+
+.carousel .carousel-item > img {
+ width: 100%;
+}
+
+.carousel .indicators {
+ position: absolute;
+ text-align: center;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ margin: 0;
+}
+
+.carousel .indicators .indicator-item {
+ display: inline-block;
+ position: relative;
+ cursor: pointer;
+ height: 8px;
+ width: 8px;
+ margin: 24px 4px;
+ background-color: rgba(255, 255, 255, 0.5);
+ -webkit-transition: background-color .3s;
+ transition: background-color .3s;
+ border-radius: 50%;
+}
+
+.carousel .indicators .indicator-item.active {
+ background-color: #fff;
+}
+
+.carousel.scrolling .carousel-item .materialboxed,
+.carousel .carousel-item:not(.active) .materialboxed {
+ pointer-events: none;
+}
+
+.tap-target-wrapper {
+ width: 800px;
+ height: 800px;
+ position: fixed;
+ z-index: 1000;
+ visibility: hidden;
+ -webkit-transition: visibility 0s .3s;
+ transition: visibility 0s .3s;
+}
+
+.tap-target-wrapper.open {
+ visibility: visible;
+ -webkit-transition: visibility 0s;
+ transition: visibility 0s;
+}
+
+.tap-target-wrapper.open .tap-target {
+ -webkit-transform: scale(1);
+ transform: scale(1);
+ opacity: .95;
+ -webkit-transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+ transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+ transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+ transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+}
+
+.tap-target-wrapper.open .tap-target-wave::before {
+ -webkit-transform: scale(1);
+ transform: scale(1);
+}
+
+.tap-target-wrapper.open .tap-target-wave::after {
+ visibility: visible;
+ -webkit-animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+ animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+ -webkit-transition: opacity .3s,
visibility 0s 1s,
-webkit-transform .3s;
+ transition: opacity .3s,
visibility 0s 1s,
-webkit-transform .3s;
+ transition: opacity .3s,
transform .3s,
visibility 0s 1s;
+ transition: opacity .3s,
transform .3s,
visibility 0s 1s,
-webkit-transform .3s;
+}
+
+.tap-target {
+ position: absolute;
+ font-size: 1rem;
+ border-radius: 50%;
+ background-color: #ee6e73;
+ -webkit-box-shadow: 0 20px 20px 0 rgba(0, 0, 0, 0.14), 0 10px 50px 0 rgba(0, 0, 0, 0.12), 0 30px 10px -20px rgba(0, 0, 0, 0.2);
+ box-shadow: 0 20px 20px 0 rgba(0, 0, 0, 0.14), 0 10px 50px 0 rgba(0, 0, 0, 0.12), 0 30px 10px -20px rgba(0, 0, 0, 0.2);
+ width: 100%;
+ height: 100%;
+ opacity: 0;
+ -webkit-transform: scale(0);
+ transform: scale(0);
+ -webkit-transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+ transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+ transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+ transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+}
+
+.tap-target-content {
+ position: relative;
+ display: table-cell;
+}
+
+.tap-target-wave {
+ position: absolute;
+ border-radius: 50%;
+ z-index: 10001;
+}
+
+.tap-target-wave::before, .tap-target-wave::after {
+ content: '';
+ display: block;
+ position: absolute;
+ width: 100%;
+ height: 100%;
+ border-radius: 50%;
+ background-color: #ffffff;
+}
+
+.tap-target-wave::before {
+ -webkit-transform: scale(0);
+ transform: scale(0);
+ -webkit-transition: -webkit-transform .3s;
+ transition: -webkit-transform .3s;
+ transition: transform .3s;
+ transition: transform .3s, -webkit-transform .3s;
+}
+
+.tap-target-wave::after {
+ visibility: hidden;
+ -webkit-transition: opacity .3s,
visibility 0s,
-webkit-transform .3s;
+ transition: opacity .3s,
visibility 0s,
-webkit-transform .3s;
+ transition: opacity .3s,
transform .3s,
visibility 0s;
+ transition: opacity .3s,
transform .3s,
visibility 0s,
-webkit-transform .3s;
+ z-index: -1;
+}
+
+.tap-target-origin {
+ top: 50%;
+ left: 50%;
+ -webkit-transform: translate(-50%, -50%);
+ transform: translate(-50%, -50%);
+ z-index: 10002;
+ position: absolute !important;
+}
+
+.tap-target-origin:not(.btn):not(.btn-large), .tap-target-origin:not(.btn):not(.btn-large):hover {
+ background: none;
+}
+
+@media only screen and (max-width: 600px) {
+ .tap-target, .tap-target-wrapper {
+ width: 600px;
+ height: 600px;
+ }
+}
+
+.pulse {
+ overflow: initial;
+ position: relative;
+}
+
+.pulse::before {
+ content: '';
+ display: block;
+ position: absolute;
+ width: 100%;
+ height: 100%;
+ top: 0;
+ left: 0;
+ background-color: inherit;
+ border-radius: inherit;
+ -webkit-transition: opacity .3s, -webkit-transform .3s;
+ transition: opacity .3s, -webkit-transform .3s;
+ transition: opacity .3s, transform .3s;
+ transition: opacity .3s, transform .3s, -webkit-transform .3s;
+ -webkit-animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+ animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+ z-index: -1;
+}
+
+@-webkit-keyframes pulse-animation {
+ 0% {
+ opacity: 1;
+ -webkit-transform: scale(1);
+ transform: scale(1);
+ }
+ 50% {
+ opacity: 0;
+ -webkit-transform: scale(1.5);
+ transform: scale(1.5);
+ }
+ 100% {
+ opacity: 0;
+ -webkit-transform: scale(1.5);
+ transform: scale(1.5);
+ }
+}
+
+@keyframes pulse-animation {
+ 0% {
+ opacity: 1;
+ -webkit-transform: scale(1);
+ transform: scale(1);
+ }
+ 50% {
+ opacity: 0;
+ -webkit-transform: scale(1.5);
+ transform: scale(1.5);
+ }
+ 100% {
+ opacity: 0;
+ -webkit-transform: scale(1.5);
+ transform: scale(1.5);
+ }
+}
+
+/* ==========================================================================
+ $BASE-PICKER
+ ========================================================================== */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+.picker {
+ font-size: 16px;
+ text-align: left;
+ line-height: 1.2;
+ color: #000000;
+ position: absolute;
+ z-index: 10000;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ outline: none;
+}
+
+/**
+ * The picker input element.
+ */
+.picker__input {
+ cursor: default;
+}
+
+/**
+ * When the picker is opened, the input element is "activated".
+ */
+.picker__input.picker__input--active {
+ border-color: #0089ec;
+}
+
+/**
+ * The holder is the only "scrollable" top-level container element.
+ */
+.picker__holder {
+ width: 100%;
+ overflow-y: auto;
+ -webkit-overflow-scrolling: touch;
+}
+
+/*!
+ * Default mobile-first, responsive styling for pickadate.js
+ * Demo: http://amsul.github.io/pickadate.js
+ */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+/**
+ * Make the holder and frame fullscreen.
+ */
+.picker__holder,
+.picker__frame {
+ bottom: 0;
+ left: 0;
+ right: 0;
+ top: 100%;
+}
+
+/**
+ * The holder should overlay the entire screen.
+ */
+.picker__holder {
+ position: fixed;
+ -webkit-transition: background 0.15s ease-out, top 0s 0.15s;
+ transition: background 0.15s ease-out, top 0s 0.15s;
+ -webkit-backface-visibility: hidden;
+}
+
+/**
+ * The frame that bounds the box contents of the picker.
+ */
+.picker__frame {
+ position: absolute;
+ margin: 0 auto;
+ min-width: 256px;
+ width: 300px;
+ max-height: 350px;
+ -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";
+ filter: alpha(opacity=0);
+ -moz-opacity: 0;
+ opacity: 0;
+ -webkit-transition: all 0.15s ease-out;
+ transition: all 0.15s ease-out;
+}
+
+@media (min-height: 28.875em) {
+ .picker__frame {
+ overflow: visible;
+ top: auto;
+ bottom: -100%;
+ max-height: 80%;
+ }
+}
+
+@media (min-height: 40.125em) {
+ .picker__frame {
+ margin-bottom: 7.5%;
+ }
+}
+
+/**
+ * The wrapper sets the stage to vertically align the box contents.
+ */
+.picker__wrap {
+ display: table;
+ width: 100%;
+ height: 100%;
+}
+
+@media (min-height: 28.875em) {
+ .picker__wrap {
+ display: block;
+ }
+}
+
+/**
+ * The box contains all the picker contents.
+ */
+.picker__box {
+ background: #ffffff;
+ display: table-cell;
+ vertical-align: middle;
+}
+
+@media (min-height: 28.875em) {
+ .picker__box {
+ display: block;
+ border: 1px solid #777777;
+ border-top-color: #898989;
+ border-bottom-width: 0;
+ border-radius: 5px 5px 0 0;
+ -webkit-box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+ box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+ }
+}
+
+/**
+ * When the picker opens...
+ */
+.picker--opened .picker__holder {
+ top: 0;
+ background: transparent;
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";
+ zoom: 1;
+ background: rgba(0, 0, 0, 0.32);
+ -webkit-transition: background 0.15s ease-out;
+ transition: background 0.15s ease-out;
+}
+
+.picker--opened .picker__frame {
+ top: 0;
+ -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";
+ filter: alpha(opacity=100);
+ -moz-opacity: 1;
+ opacity: 1;
+}
+
+@media (min-height: 35.875em) {
+ .picker--opened .picker__frame {
+ top: 10%;
+ bottom: auto;
+ }
+}
+
+/**
+ * For `large` screens, transform into an inline picker.
+ */
+/* ==========================================================================
+ CUSTOM MATERIALIZE STYLES
+ ========================================================================== */
+.picker__input.picker__input--active {
+ border-color: #E3F2FD;
+}
+
+.picker__frame {
+ margin: 0 auto;
+ max-width: 325px;
+}
+
+@media (min-height: 38.875em) {
+ .picker--opened .picker__frame {
+ top: 10%;
+ bottom: auto;
+ }
+}
+
+@media only screen and (min-width: 601px) {
+ .picker__box {
+ display: -webkit-box;
+ display: -webkit-flex;
+ display: -ms-flexbox;
+ display: flex;
+ }
+ .picker__frame {
+ width: 80%;
+ max-width: 600px;
+ }
+}
+
+/* ==========================================================================
+ $BASE-DATE-PICKER
+ ========================================================================== */
+/**
+ * The picker box.
+ */
+.picker__box {
+ padding: 0;
+ border-radius: 2px;
+ overflow: hidden;
+}
+
+/**
+ * The header containing the month and year stuff.
+ */
+.picker__header {
+ text-align: center;
+ position: relative;
+ margin-top: .75em;
+}
+
+/**
+ * The month and year labels.
+ */
+.picker__month,
+.picker__year {
+ display: inline-block;
+ margin-left: .25em;
+ margin-right: .25em;
+}
+
+/**
+ * The month and year selectors.
+ */
+.picker__select--month,
+.picker__select--year {
+ height: 2em;
+ padding: 0;
+ margin-left: .25em;
+ margin-right: .25em;
+}
+
+.picker__select--month.browser-default {
+ display: inline;
+ background-color: #FFFFFF;
+ width: 40%;
+}
+
+.picker__select--year.browser-default {
+ display: inline;
+ background-color: #FFFFFF;
+ width: 26%;
+}
+
+.picker__select--month:focus,
+.picker__select--year:focus {
+ border-color: rgba(0, 0, 0, 0.05);
+}
+
+/**
+ * The month navigation buttons.
+ */
+.picker__nav--prev,
+.picker__nav--next {
+ position: absolute;
+ padding: .5em 1.25em;
+ width: 1em;
+ height: 1em;
+ -webkit-box-sizing: content-box;
+ box-sizing: content-box;
+ top: -0.25em;
+}
+
+.picker__nav--prev {
+ left: -1em;
+ padding-right: 1.25em;
+}
+
+.picker__nav--next {
+ right: -1em;
+ padding-left: 1.25em;
+}
+
+.picker__nav--disabled,
+.picker__nav--disabled:hover,
+.picker__nav--disabled:before,
+.picker__nav--disabled:before:hover {
+ cursor: default;
+ background: none;
+ border-right-color: #f5f5f5;
+ border-left-color: #f5f5f5;
+}
+
+/**
+ * The calendar table of dates
+ */
+.picker__table {
+ text-align: center;
+ border-collapse: collapse;
+ border-spacing: 0;
+ table-layout: fixed;
+ font-size: 1rem;
+ width: 100%;
+ margin-top: .75em;
+ margin-bottom: .5em;
+}
+
+.picker__table th, .picker__table td {
+ text-align: center;
+}
+
+.picker__table td {
+ margin: 0;
+ padding: 0;
+}
+
+/**
+ * The weekday labels
+ */
+.picker__weekday {
+ width: 14.285714286%;
+ font-size: .75em;
+ padding-bottom: .25em;
+ color: #999999;
+ font-weight: 500;
+ /* Increase the spacing a tad */
+}
+
+@media (min-height: 33.875em) {
+ .picker__weekday {
+ padding-bottom: .5em;
+ }
+}
+
+/**
+ * The days on the calendar
+ */
+.picker__day--today {
+ position: relative;
+ color: #595959;
+ letter-spacing: -.3;
+ padding: .75rem 0;
+ font-weight: 400;
+ border: 1px solid transparent;
+}
+
+.picker__day--disabled:before {
+ border-top-color: #aaaaaa;
+}
+
+.picker__day--infocus:hover {
+ cursor: pointer;
+ color: #000;
+ font-weight: 500;
+}
+
+.picker__day--outfocus {
+ display: none;
+ padding: .75rem 0;
+ color: #fff;
+}
+
+.picker__day--outfocus:hover {
+ cursor: pointer;
+ color: #dddddd;
+ font-weight: 500;
+}
+
+.picker__day--highlighted:hover,
+.picker--focused .picker__day--highlighted {
+ cursor: pointer;
+}
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+ border-radius: 50%;
+ -webkit-transform: scale(0.75);
+ transform: scale(0.75);
+ background: #0089ec;
+ color: #ffffff;
+}
+
+.picker__day--disabled,
+.picker__day--disabled:hover,
+.picker--focused .picker__day--disabled {
+ background: #f5f5f5;
+ border-color: #f5f5f5;
+ color: #dddddd;
+ cursor: default;
+}
+
+.picker__day--highlighted.picker__day--disabled,
+.picker__day--highlighted.picker__day--disabled:hover {
+ background: #bbbbbb;
+}
+
+/**
+ * The footer containing the "today", "clear", and "close" buttons.
+ */
+.picker__footer {
+ text-align: right;
+}
+
+.picker__button--today,
+.picker__button--clear,
+.picker__button--close {
+ border: 1px solid #ffffff;
+ background: #ffffff;
+ font-size: .8em;
+ padding: .66em 0;
+ font-weight: bold;
+ width: 33%;
+ display: inline-block;
+ vertical-align: bottom;
+}
+
+.picker__button--today:hover,
+.picker__button--clear:hover,
+.picker__button--close:hover {
+ cursor: pointer;
+ color: #000000;
+ background: #b1dcfb;
+ border-bottom-color: #b1dcfb;
+}
+
+.picker__button--today:focus,
+.picker__button--clear:focus,
+.picker__button--close:focus {
+ background: #b1dcfb;
+ border-color: rgba(0, 0, 0, 0.05);
+ outline: none;
+}
+
+.picker__button--today:before,
+.picker__button--clear:before,
+.picker__button--close:before {
+ position: relative;
+ display: inline-block;
+ height: 0;
+}
+
+.picker__button--today:before,
+.picker__button--clear:before {
+ content: " ";
+ margin-right: .45em;
+}
+
+.picker__button--today:before {
+ top: -0.05em;
+ width: 0;
+ border-top: 0.66em solid #0059bc;
+ border-left: .66em solid transparent;
+}
+
+.picker__button--clear:before {
+ top: -0.25em;
+ width: .66em;
+ border-top: 3px solid #ee2200;
+}
+
+.picker__button--close:before {
+ content: "\D7";
+ top: -0.1em;
+ vertical-align: top;
+ font-size: 1.1em;
+ margin-right: .35em;
+ color: #777777;
+}
+
+.picker__button--today[disabled],
+.picker__button--today[disabled]:hover {
+ background: #f5f5f5;
+ border-color: #f5f5f5;
+ color: #dddddd;
+ cursor: default;
+}
+
+.picker__button--today[disabled]:before {
+ border-top-color: #aaaaaa;
+}
+
+/* ==========================================================================
+ CUSTOM MATERIALIZE STYLES
+ ========================================================================== */
+/*.picker__box {
+ border-radius: 2px;
+ overflow: hidden;
+}*/
+.picker__date-display {
+ text-align: left;
+ background-color: #26a69a;
+ color: #fff;
+ padding: 18px;
+ font-weight: 300;
+}
+
+@media only screen and (min-width: 601px) {
+ .picker__date-display {
+ -webkit-box-flex: 1;
+ -webkit-flex: 1;
+ -ms-flex: 1;
+ flex: 1;
+ }
+ .picker__weekday-display {
+ display: block;
+ }
+ .picker__container__wrapper {
+ -webkit-box-flex: 2;
+ -webkit-flex: 2;
+ -ms-flex: 2;
+ flex: 2;
+ }
+}
+
+.picker__nav--prev:hover,
+.picker__nav--next:hover {
+ cursor: pointer;
+ color: #000000;
+ background: #a1ded8;
+}
+
+.picker__weekday-display {
+ font-weight: 500;
+ font-size: 2.8rem;
+ margin-right: 5px;
+ margin-top: 4px;
+}
+
+.picker__month-display {
+ font-size: 2.8rem;
+ font-weight: 500;
+}
+
+.picker__day-display {
+ font-size: 2.8rem;
+ font-weight: 500;
+ margin-right: 5px;
+}
+
+.picker__year-display {
+ font-size: 1.5rem;
+ font-weight: 500;
+ color: rgba(255, 255, 255, 0.7);
+}
+
+/*.picker__box {
+ padding: 0;
+}*/
+.picker__calendar-container {
+ padding: 0 1rem;
+}
+
+.picker__calendar-container thead {
+ border: none;
+}
+
+.picker__table {
+ margin-top: 0;
+ margin-bottom: .5em;
+}
+
+.picker__day--infocus {
+ color: rgba(0, 0, 0, 0.87);
+ letter-spacing: -.3px;
+ padding: 0.75rem 0;
+ font-weight: 400;
+ border: 1px solid transparent;
+}
+
+@media only screen and (min-width: 601px) {
+ .picker__day--infocus {
+ padding: 1.1rem 0;
+ }
+}
+
+.picker__day.picker__day--today {
+ color: #26a69a;
+}
+
+.picker__day.picker__day--today.picker__day--selected {
+ color: #fff;
+}
+
+.picker__weekday {
+ font-size: .9rem;
+}
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+ border-radius: 50%;
+ -webkit-transform: scale(0.9);
+ transform: scale(0.9);
+ background-color: #26a69a;
+ color: #ffffff;
+}
+
+.picker__day--selected.picker__day--outfocus,
+.picker__day--selected:hover.picker__day--outfocus,
+.picker--focused .picker__day--selected.picker__day--outfocus {
+ background-color: #a1ded8;
+}
+
+.picker__footer {
+ text-align: right;
+ padding: 5px 10px;
+}
+
+.picker__close, .picker__today, .picker__clear {
+ font-size: 1.1rem;
+ padding: 0 1rem;
+ color: #26a69a;
+}
+
+.picker__clear {
+ color: #f44336;
+ float: left;
+}
+
+.picker__nav--prev:before,
+.picker__nav--next:before {
+ content: " ";
+ border-top: .5em solid transparent;
+ border-bottom: .5em solid transparent;
+ border-right: 0.75em solid #676767;
+ width: 0;
+ height: 0;
+ display: block;
+ margin: 0 auto;
+}
+
+.picker__nav--next:before {
+ border-right: 0;
+ border-left: 0.75em solid #676767;
+}
+
+button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus {
+ background-color: #a1ded8;
+}
+
+/* ==========================================================================
+ $BASE-TIME-PICKER
+ ========================================================================== */
+/**
+ * The list of times.
+ */
+.picker__list {
+ list-style: none;
+ padding: 0.75em 0 4.2em;
+ margin: 0;
+}
+
+/**
+ * The times on the clock.
+ */
+.picker__list-item {
+ border-bottom: 1px solid #ddd;
+ border-top: 1px solid #ddd;
+ margin-bottom: -1px;
+ position: relative;
+ background: #fff;
+ padding: .75em 1.25em;
+}
+
+@media (min-height: 46.75em) {
+ .picker__list-item {
+ padding: .5em 1em;
+ }
+}
+
+/* Hovered time */
+.picker__list-item:hover {
+ cursor: pointer;
+ color: #000;
+ background: #b1dcfb;
+ border-color: #0089ec;
+ z-index: 10;
+}
+
+/* Highlighted and hovered/focused time */
+.picker__list-item--highlighted {
+ border-color: #0089ec;
+ z-index: 10;
+}
+
+.picker__list-item--highlighted:hover,
+.picker--focused .picker__list-item--highlighted {
+ cursor: pointer;
+ color: #000;
+ background: #b1dcfb;
+}
+
+/* Selected and hovered/focused time */
+.picker__list-item--selected,
+.picker__list-item--selected:hover,
+.picker--focused .picker__list-item--selected {
+ background: #0089ec;
+ color: #fff;
+ z-index: 10;
+}
+
+/* Disabled time */
+.picker__list-item--disabled,
+.picker__list-item--disabled:hover,
+.picker--focused .picker__list-item--disabled {
+ background: #f5f5f5;
+ border-color: #f5f5f5;
+ color: #ddd;
+ cursor: default;
+ border-color: #ddd;
+ z-index: auto;
+}
+
+/**
+ * The clear button
+ */
+.picker--time .picker__button--clear {
+ display: block;
+ width: 80%;
+ margin: 1em auto 0;
+ padding: 1em 1.25em;
+ background: none;
+ border: 0;
+ font-weight: 500;
+ font-size: .67em;
+ text-align: center;
+ text-transform: uppercase;
+ color: rgba(0, 0, 0, 0.87);
+}
+
+.picker--time .picker__button--clear:hover,
+.picker--time .picker__button--clear:focus {
+ color: #000;
+ background: #b1dcfb;
+ background: #ee2200;
+ border-color: #ee2200;
+ cursor: pointer;
+ color: #fff;
+ outline: none;
+}
+
+.picker--time .picker__button--clear:before {
+ top: -0.25em;
+ color: rgba(0, 0, 0, 0.87);
+ font-size: 1.25em;
+ font-weight: bold;
+}
+
+.picker--time .picker__button--clear:hover:before,
+.picker--time .picker__button--clear:focus:before {
+ color: #fff;
+}
+
+/* ==========================================================================
+ $DEFAULT-TIME-PICKER
+ ========================================================================== */
+/**
+ * The frame the bounds the time picker.
+ */
+.picker--time .picker__frame {
+ min-width: 256px;
+ max-width: 320px;
+}
+
+/**
+ * The picker box.
+ */
+.picker--time .picker__box {
+ font-size: 1em;
+ background: #f2f2f2;
+ padding: 0;
+}
+
+@media (min-height: 40.125em) {
+ .picker--time .picker__box {
+ margin-bottom: 5em;
+ }
+}
+
+/* ==========================================================================
+ $DEFAULT-TIME-PICKER
+ ========================================================================== */
+.clockpicker-display {
+ font-size: 4rem;
+ font-weight: bold;
+ text-align: center;
+ color: rgba(255, 255, 255, 0.6);
+ font-weight: 400;
+ clear: both;
+ position: relative;
+}
+
+.clockpicker-span-am-pm {
+ font-size: 1.3rem;
+ position: absolute;
+ right: 1rem;
+ bottom: 0.3rem;
+ line-height: 2rem;
+ font-weight: 500;
+}
+
+@media only screen and (min-width: 601px) {
+ .clockpicker-display {
+ top: 32%;
+ }
+ .clockpicker-span-am-pm {
+ position: relative;
+ right: auto;
+ bottom: auto;
+ text-align: center;
+ margin-top: 1.2rem;
+ }
+}
+
+.text-primary {
+ color: white;
+}
+
+.clockpicker-span-hours {
+ margin-right: 3px;
+}
+
+.clockpicker-span-minutes {
+ margin-left: 3px;
+}
+
+.clockpicker-span-hours,
+.clockpicker-span-minutes,
+.clockpicker-span-am-pm div {
+ cursor: pointer;
+}
+
+.clockpicker-moving {
+ cursor: move;
+}
+
+.clockpicker-plate {
+ background-color: #eee;
+ border-radius: 50%;
+ width: 270px;
+ height: 270px;
+ overflow: visible;
+ position: relative;
+ margin: auto;
+ margin-top: 25px;
+ margin-bottom: 5px;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+}
+
+.clockpicker-canvas,
+.clockpicker-dial {
+ width: 270px;
+ height: 270px;
+ position: absolute;
+ left: -1px;
+ top: -1px;
+}
+
+.clockpicker-minutes {
+ visibility: hidden;
+}
+
+.clockpicker-tick {
+ border-radius: 50%;
+ color: rgba(0, 0, 0, 0.87);
+ line-height: 40px;
+ text-align: center;
+ width: 40px;
+ height: 40px;
+ position: absolute;
+ cursor: pointer;
+}
+
+.clockpicker-tick.active,
+.clockpicker-tick:hover {
+ background-color: rgba(38, 166, 154, 0.25);
+}
+
+.clockpicker-dial {
+ -webkit-transition: -webkit-transform 350ms, opacity 350ms;
+ -webkit-transition: opacity 350ms, -webkit-transform 350ms;
+ transition: opacity 350ms, -webkit-transform 350ms;
+ transition: transform 350ms, opacity 350ms;
+ transition: transform 350ms, opacity 350ms, -webkit-transform 350ms;
+}
+
+.clockpicker-dial-out {
+ opacity: 0;
+}
+
+.clockpicker-hours.clockpicker-dial-out {
+ -webkit-transform: scale(1.2, 1.2);
+ transform: scale(1.2, 1.2);
+}
+
+.clockpicker-minutes.clockpicker-dial-out {
+ -webkit-transform: scale(0.8, 0.8);
+ transform: scale(0.8, 0.8);
+}
+
+.clockpicker-canvas {
+ -webkit-transition: opacity 175ms;
+ transition: opacity 175ms;
+}
+
+.clockpicker-canvas-out {
+ opacity: 0.25;
+}
+
+.clockpicker-canvas-bearing {
+ stroke: none;
+ fill: #26a69a;
+}
+
+.clockpicker-canvas-bg {
+ stroke: none;
+ fill: #26a69a;
+}
+
+.clockpicker-canvas-bg-trans {
+ fill: #26a69a;
+}
+
+.clockpicker-canvas line {
+ stroke: #26a69a;
+ stroke-width: 4;
+ stroke-linecap: round;
+ /*shape-rendering: crispEdges;*/
+}
diff --git a/static/css/materialize.min.css b/static/css/materialize.min.css
new file mode 100644
index 00000000..de1a4e31
--- /dev/null
+++ b/static/css/materialize.min.css
@@ -0,0 +1,16 @@
+/*!
+ * Materialize v0.100.2 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+.materialize-red{background-color:#e51c23 !important}.materialize-red-text{color:#e51c23 !important}.materialize-red.lighten-5{background-color:#fdeaeb !important}.materialize-red-text.text-lighten-5{color:#fdeaeb !important}.materialize-red.lighten-4{background-color:#f8c1c3 !important}.materialize-red-text.text-lighten-4{color:#f8c1c3 !important}.materialize-red.lighten-3{background-color:#f3989b !important}.materialize-red-text.text-lighten-3{color:#f3989b !important}.materialize-red.lighten-2{background-color:#ee6e73 !important}.materialize-red-text.text-lighten-2{color:#ee6e73 !important}.materialize-red.lighten-1{background-color:#ea454b !important}.materialize-red-text.text-lighten-1{color:#ea454b !important}.materialize-red.darken-1{background-color:#d0181e !important}.materialize-red-text.text-darken-1{color:#d0181e !important}.materialize-red.darken-2{background-color:#b9151b !important}.materialize-red-text.text-darken-2{color:#b9151b !important}.materialize-red.darken-3{background-color:#a21318 !important}.materialize-red-text.text-darken-3{color:#a21318 !important}.materialize-red.darken-4{background-color:#8b1014 !important}.materialize-red-text.text-darken-4{color:#8b1014 !important}.red{background-color:#F44336 !important}.red-text{color:#F44336 !important}.red.lighten-5{background-color:#FFEBEE !important}.red-text.text-lighten-5{color:#FFEBEE !important}.red.lighten-4{background-color:#FFCDD2 !important}.red-text.text-lighten-4{color:#FFCDD2 !important}.red.lighten-3{background-color:#EF9A9A !important}.red-text.text-lighten-3{color:#EF9A9A !important}.red.lighten-2{background-color:#E57373 !important}.red-text.text-lighten-2{color:#E57373 !important}.red.lighten-1{background-color:#EF5350 !important}.red-text.text-lighten-1{color:#EF5350 !important}.red.darken-1{background-color:#E53935 !important}.red-text.text-darken-1{color:#E53935 !important}.red.darken-2{background-color:#D32F2F !important}.red-text.text-darken-2{color:#D32F2F !important}.red.darken-3{background-color:#C62828 !important}.red-text.text-darken-3{color:#C62828 !important}.red.darken-4{background-color:#B71C1C !important}.red-text.text-darken-4{color:#B71C1C !important}.red.accent-1{background-color:#FF8A80 !important}.red-text.text-accent-1{color:#FF8A80 !important}.red.accent-2{background-color:#FF5252 !important}.red-text.text-accent-2{color:#FF5252 !important}.red.accent-3{background-color:#FF1744 !important}.red-text.text-accent-3{color:#FF1744 !important}.red.accent-4{background-color:#D50000 !important}.red-text.text-accent-4{color:#D50000 !important}.pink{background-color:#e91e63 !important}.pink-text{color:#e91e63 !important}.pink.lighten-5{background-color:#fce4ec !important}.pink-text.text-lighten-5{color:#fce4ec !important}.pink.lighten-4{background-color:#f8bbd0 !important}.pink-text.text-lighten-4{color:#f8bbd0 !important}.pink.lighten-3{background-color:#f48fb1 !important}.pink-text.text-lighten-3{color:#f48fb1 !important}.pink.lighten-2{background-color:#f06292 !important}.pink-text.text-lighten-2{color:#f06292 !important}.pink.lighten-1{background-color:#ec407a !important}.pink-text.text-lighten-1{color:#ec407a !important}.pink.darken-1{background-color:#d81b60 !important}.pink-text.text-darken-1{color:#d81b60 !important}.pink.darken-2{background-color:#c2185b !important}.pink-text.text-darken-2{color:#c2185b !important}.pink.darken-3{background-color:#ad1457 !important}.pink-text.text-darken-3{color:#ad1457 !important}.pink.darken-4{background-color:#880e4f !important}.pink-text.text-darken-4{color:#880e4f !important}.pink.accent-1{background-color:#ff80ab !important}.pink-text.text-accent-1{color:#ff80ab !important}.pink.accent-2{background-color:#ff4081 !important}.pink-text.text-accent-2{color:#ff4081 !important}.pink.accent-3{background-color:#f50057 !important}.pink-text.text-accent-3{color:#f50057 !important}.pink.accent-4{background-color:#c51162 !important}.pink-text.text-accent-4{color:#c51162 !important}.purple{background-color:#9c27b0 !important}.purple-text{color:#9c27b0 !important}.purple.lighten-5{background-color:#f3e5f5 !important}.purple-text.text-lighten-5{color:#f3e5f5 !important}.purple.lighten-4{background-color:#e1bee7 !important}.purple-text.text-lighten-4{color:#e1bee7 !important}.purple.lighten-3{background-color:#ce93d8 !important}.purple-text.text-lighten-3{color:#ce93d8 !important}.purple.lighten-2{background-color:#ba68c8 !important}.purple-text.text-lighten-2{color:#ba68c8 !important}.purple.lighten-1{background-color:#ab47bc !important}.purple-text.text-lighten-1{color:#ab47bc !important}.purple.darken-1{background-color:#8e24aa !important}.purple-text.text-darken-1{color:#8e24aa !important}.purple.darken-2{background-color:#7b1fa2 !important}.purple-text.text-darken-2{color:#7b1fa2 !important}.purple.darken-3{background-color:#6a1b9a !important}.purple-text.text-darken-3{color:#6a1b9a !important}.purple.darken-4{background-color:#4a148c !important}.purple-text.text-darken-4{color:#4a148c !important}.purple.accent-1{background-color:#ea80fc !important}.purple-text.text-accent-1{color:#ea80fc !important}.purple.accent-2{background-color:#e040fb !important}.purple-text.text-accent-2{color:#e040fb !important}.purple.accent-3{background-color:#d500f9 !important}.purple-text.text-accent-3{color:#d500f9 !important}.purple.accent-4{background-color:#a0f !important}.purple-text.text-accent-4{color:#a0f !important}.deep-purple{background-color:#673ab7 !important}.deep-purple-text{color:#673ab7 !important}.deep-purple.lighten-5{background-color:#ede7f6 !important}.deep-purple-text.text-lighten-5{color:#ede7f6 !important}.deep-purple.lighten-4{background-color:#d1c4e9 !important}.deep-purple-text.text-lighten-4{color:#d1c4e9 !important}.deep-purple.lighten-3{background-color:#b39ddb !important}.deep-purple-text.text-lighten-3{color:#b39ddb !important}.deep-purple.lighten-2{background-color:#9575cd !important}.deep-purple-text.text-lighten-2{color:#9575cd !important}.deep-purple.lighten-1{background-color:#7e57c2 !important}.deep-purple-text.text-lighten-1{color:#7e57c2 !important}.deep-purple.darken-1{background-color:#5e35b1 !important}.deep-purple-text.text-darken-1{color:#5e35b1 !important}.deep-purple.darken-2{background-color:#512da8 !important}.deep-purple-text.text-darken-2{color:#512da8 !important}.deep-purple.darken-3{background-color:#4527a0 !important}.deep-purple-text.text-darken-3{color:#4527a0 !important}.deep-purple.darken-4{background-color:#311b92 !important}.deep-purple-text.text-darken-4{color:#311b92 !important}.deep-purple.accent-1{background-color:#b388ff !important}.deep-purple-text.text-accent-1{color:#b388ff !important}.deep-purple.accent-2{background-color:#7c4dff !important}.deep-purple-text.text-accent-2{color:#7c4dff !important}.deep-purple.accent-3{background-color:#651fff !important}.deep-purple-text.text-accent-3{color:#651fff !important}.deep-purple.accent-4{background-color:#6200ea !important}.deep-purple-text.text-accent-4{color:#6200ea !important}.indigo{background-color:#3f51b5 !important}.indigo-text{color:#3f51b5 !important}.indigo.lighten-5{background-color:#e8eaf6 !important}.indigo-text.text-lighten-5{color:#e8eaf6 !important}.indigo.lighten-4{background-color:#c5cae9 !important}.indigo-text.text-lighten-4{color:#c5cae9 !important}.indigo.lighten-3{background-color:#9fa8da !important}.indigo-text.text-lighten-3{color:#9fa8da !important}.indigo.lighten-2{background-color:#7986cb !important}.indigo-text.text-lighten-2{color:#7986cb !important}.indigo.lighten-1{background-color:#5c6bc0 !important}.indigo-text.text-lighten-1{color:#5c6bc0 !important}.indigo.darken-1{background-color:#3949ab !important}.indigo-text.text-darken-1{color:#3949ab !important}.indigo.darken-2{background-color:#303f9f !important}.indigo-text.text-darken-2{color:#303f9f !important}.indigo.darken-3{background-color:#283593 !important}.indigo-text.text-darken-3{color:#283593 !important}.indigo.darken-4{background-color:#1a237e !important}.indigo-text.text-darken-4{color:#1a237e !important}.indigo.accent-1{background-color:#8c9eff !important}.indigo-text.text-accent-1{color:#8c9eff !important}.indigo.accent-2{background-color:#536dfe !important}.indigo-text.text-accent-2{color:#536dfe !important}.indigo.accent-3{background-color:#3d5afe !important}.indigo-text.text-accent-3{color:#3d5afe !important}.indigo.accent-4{background-color:#304ffe !important}.indigo-text.text-accent-4{color:#304ffe !important}.blue{background-color:#2196F3 !important}.blue-text{color:#2196F3 !important}.blue.lighten-5{background-color:#E3F2FD !important}.blue-text.text-lighten-5{color:#E3F2FD !important}.blue.lighten-4{background-color:#BBDEFB !important}.blue-text.text-lighten-4{color:#BBDEFB !important}.blue.lighten-3{background-color:#90CAF9 !important}.blue-text.text-lighten-3{color:#90CAF9 !important}.blue.lighten-2{background-color:#64B5F6 !important}.blue-text.text-lighten-2{color:#64B5F6 !important}.blue.lighten-1{background-color:#42A5F5 !important}.blue-text.text-lighten-1{color:#42A5F5 !important}.blue.darken-1{background-color:#1E88E5 !important}.blue-text.text-darken-1{color:#1E88E5 !important}.blue.darken-2{background-color:#1976D2 !important}.blue-text.text-darken-2{color:#1976D2 !important}.blue.darken-3{background-color:#1565C0 !important}.blue-text.text-darken-3{color:#1565C0 !important}.blue.darken-4{background-color:#0D47A1 !important}.blue-text.text-darken-4{color:#0D47A1 !important}.blue.accent-1{background-color:#82B1FF !important}.blue-text.text-accent-1{color:#82B1FF !important}.blue.accent-2{background-color:#448AFF !important}.blue-text.text-accent-2{color:#448AFF !important}.blue.accent-3{background-color:#2979FF !important}.blue-text.text-accent-3{color:#2979FF !important}.blue.accent-4{background-color:#2962FF !important}.blue-text.text-accent-4{color:#2962FF !important}.light-blue{background-color:#03a9f4 !important}.light-blue-text{color:#03a9f4 !important}.light-blue.lighten-5{background-color:#e1f5fe !important}.light-blue-text.text-lighten-5{color:#e1f5fe !important}.light-blue.lighten-4{background-color:#b3e5fc !important}.light-blue-text.text-lighten-4{color:#b3e5fc !important}.light-blue.lighten-3{background-color:#81d4fa !important}.light-blue-text.text-lighten-3{color:#81d4fa !important}.light-blue.lighten-2{background-color:#4fc3f7 !important}.light-blue-text.text-lighten-2{color:#4fc3f7 !important}.light-blue.lighten-1{background-color:#29b6f6 !important}.light-blue-text.text-lighten-1{color:#29b6f6 !important}.light-blue.darken-1{background-color:#039be5 !important}.light-blue-text.text-darken-1{color:#039be5 !important}.light-blue.darken-2{background-color:#0288d1 !important}.light-blue-text.text-darken-2{color:#0288d1 !important}.light-blue.darken-3{background-color:#0277bd !important}.light-blue-text.text-darken-3{color:#0277bd !important}.light-blue.darken-4{background-color:#01579b !important}.light-blue-text.text-darken-4{color:#01579b !important}.light-blue.accent-1{background-color:#80d8ff !important}.light-blue-text.text-accent-1{color:#80d8ff !important}.light-blue.accent-2{background-color:#40c4ff !important}.light-blue-text.text-accent-2{color:#40c4ff !important}.light-blue.accent-3{background-color:#00b0ff !important}.light-blue-text.text-accent-3{color:#00b0ff !important}.light-blue.accent-4{background-color:#0091ea !important}.light-blue-text.text-accent-4{color:#0091ea !important}.cyan{background-color:#00bcd4 !important}.cyan-text{color:#00bcd4 !important}.cyan.lighten-5{background-color:#e0f7fa !important}.cyan-text.text-lighten-5{color:#e0f7fa !important}.cyan.lighten-4{background-color:#b2ebf2 !important}.cyan-text.text-lighten-4{color:#b2ebf2 !important}.cyan.lighten-3{background-color:#80deea !important}.cyan-text.text-lighten-3{color:#80deea !important}.cyan.lighten-2{background-color:#4dd0e1 !important}.cyan-text.text-lighten-2{color:#4dd0e1 !important}.cyan.lighten-1{background-color:#26c6da !important}.cyan-text.text-lighten-1{color:#26c6da !important}.cyan.darken-1{background-color:#00acc1 !important}.cyan-text.text-darken-1{color:#00acc1 !important}.cyan.darken-2{background-color:#0097a7 !important}.cyan-text.text-darken-2{color:#0097a7 !important}.cyan.darken-3{background-color:#00838f !important}.cyan-text.text-darken-3{color:#00838f !important}.cyan.darken-4{background-color:#006064 !important}.cyan-text.text-darken-4{color:#006064 !important}.cyan.accent-1{background-color:#84ffff !important}.cyan-text.text-accent-1{color:#84ffff !important}.cyan.accent-2{background-color:#18ffff !important}.cyan-text.text-accent-2{color:#18ffff !important}.cyan.accent-3{background-color:#00e5ff !important}.cyan-text.text-accent-3{color:#00e5ff !important}.cyan.accent-4{background-color:#00b8d4 !important}.cyan-text.text-accent-4{color:#00b8d4 !important}.teal{background-color:#009688 !important}.teal-text{color:#009688 !important}.teal.lighten-5{background-color:#e0f2f1 !important}.teal-text.text-lighten-5{color:#e0f2f1 !important}.teal.lighten-4{background-color:#b2dfdb !important}.teal-text.text-lighten-4{color:#b2dfdb !important}.teal.lighten-3{background-color:#80cbc4 !important}.teal-text.text-lighten-3{color:#80cbc4 !important}.teal.lighten-2{background-color:#4db6ac !important}.teal-text.text-lighten-2{color:#4db6ac !important}.teal.lighten-1{background-color:#26a69a !important}.teal-text.text-lighten-1{color:#26a69a !important}.teal.darken-1{background-color:#00897b !important}.teal-text.text-darken-1{color:#00897b !important}.teal.darken-2{background-color:#00796b !important}.teal-text.text-darken-2{color:#00796b !important}.teal.darken-3{background-color:#00695c !important}.teal-text.text-darken-3{color:#00695c !important}.teal.darken-4{background-color:#004d40 !important}.teal-text.text-darken-4{color:#004d40 !important}.teal.accent-1{background-color:#a7ffeb !important}.teal-text.text-accent-1{color:#a7ffeb !important}.teal.accent-2{background-color:#64ffda !important}.teal-text.text-accent-2{color:#64ffda !important}.teal.accent-3{background-color:#1de9b6 !important}.teal-text.text-accent-3{color:#1de9b6 !important}.teal.accent-4{background-color:#00bfa5 !important}.teal-text.text-accent-4{color:#00bfa5 !important}.green{background-color:#4CAF50 !important}.green-text{color:#4CAF50 !important}.green.lighten-5{background-color:#E8F5E9 !important}.green-text.text-lighten-5{color:#E8F5E9 !important}.green.lighten-4{background-color:#C8E6C9 !important}.green-text.text-lighten-4{color:#C8E6C9 !important}.green.lighten-3{background-color:#A5D6A7 !important}.green-text.text-lighten-3{color:#A5D6A7 !important}.green.lighten-2{background-color:#81C784 !important}.green-text.text-lighten-2{color:#81C784 !important}.green.lighten-1{background-color:#66BB6A !important}.green-text.text-lighten-1{color:#66BB6A !important}.green.darken-1{background-color:#43A047 !important}.green-text.text-darken-1{color:#43A047 !important}.green.darken-2{background-color:#388E3C !important}.green-text.text-darken-2{color:#388E3C !important}.green.darken-3{background-color:#2E7D32 !important}.green-text.text-darken-3{color:#2E7D32 !important}.green.darken-4{background-color:#1B5E20 !important}.green-text.text-darken-4{color:#1B5E20 !important}.green.accent-1{background-color:#B9F6CA !important}.green-text.text-accent-1{color:#B9F6CA !important}.green.accent-2{background-color:#69F0AE !important}.green-text.text-accent-2{color:#69F0AE !important}.green.accent-3{background-color:#00E676 !important}.green-text.text-accent-3{color:#00E676 !important}.green.accent-4{background-color:#00C853 !important}.green-text.text-accent-4{color:#00C853 !important}.light-green{background-color:#8bc34a !important}.light-green-text{color:#8bc34a !important}.light-green.lighten-5{background-color:#f1f8e9 !important}.light-green-text.text-lighten-5{color:#f1f8e9 !important}.light-green.lighten-4{background-color:#dcedc8 !important}.light-green-text.text-lighten-4{color:#dcedc8 !important}.light-green.lighten-3{background-color:#c5e1a5 !important}.light-green-text.text-lighten-3{color:#c5e1a5 !important}.light-green.lighten-2{background-color:#aed581 !important}.light-green-text.text-lighten-2{color:#aed581 !important}.light-green.lighten-1{background-color:#9ccc65 !important}.light-green-text.text-lighten-1{color:#9ccc65 !important}.light-green.darken-1{background-color:#7cb342 !important}.light-green-text.text-darken-1{color:#7cb342 !important}.light-green.darken-2{background-color:#689f38 !important}.light-green-text.text-darken-2{color:#689f38 !important}.light-green.darken-3{background-color:#558b2f !important}.light-green-text.text-darken-3{color:#558b2f !important}.light-green.darken-4{background-color:#33691e !important}.light-green-text.text-darken-4{color:#33691e !important}.light-green.accent-1{background-color:#ccff90 !important}.light-green-text.text-accent-1{color:#ccff90 !important}.light-green.accent-2{background-color:#b2ff59 !important}.light-green-text.text-accent-2{color:#b2ff59 !important}.light-green.accent-3{background-color:#76ff03 !important}.light-green-text.text-accent-3{color:#76ff03 !important}.light-green.accent-4{background-color:#64dd17 !important}.light-green-text.text-accent-4{color:#64dd17 !important}.lime{background-color:#cddc39 !important}.lime-text{color:#cddc39 !important}.lime.lighten-5{background-color:#f9fbe7 !important}.lime-text.text-lighten-5{color:#f9fbe7 !important}.lime.lighten-4{background-color:#f0f4c3 !important}.lime-text.text-lighten-4{color:#f0f4c3 !important}.lime.lighten-3{background-color:#e6ee9c !important}.lime-text.text-lighten-3{color:#e6ee9c !important}.lime.lighten-2{background-color:#dce775 !important}.lime-text.text-lighten-2{color:#dce775 !important}.lime.lighten-1{background-color:#d4e157 !important}.lime-text.text-lighten-1{color:#d4e157 !important}.lime.darken-1{background-color:#c0ca33 !important}.lime-text.text-darken-1{color:#c0ca33 !important}.lime.darken-2{background-color:#afb42b !important}.lime-text.text-darken-2{color:#afb42b !important}.lime.darken-3{background-color:#9e9d24 !important}.lime-text.text-darken-3{color:#9e9d24 !important}.lime.darken-4{background-color:#827717 !important}.lime-text.text-darken-4{color:#827717 !important}.lime.accent-1{background-color:#f4ff81 !important}.lime-text.text-accent-1{color:#f4ff81 !important}.lime.accent-2{background-color:#eeff41 !important}.lime-text.text-accent-2{color:#eeff41 !important}.lime.accent-3{background-color:#c6ff00 !important}.lime-text.text-accent-3{color:#c6ff00 !important}.lime.accent-4{background-color:#aeea00 !important}.lime-text.text-accent-4{color:#aeea00 !important}.yellow{background-color:#ffeb3b !important}.yellow-text{color:#ffeb3b !important}.yellow.lighten-5{background-color:#fffde7 !important}.yellow-text.text-lighten-5{color:#fffde7 !important}.yellow.lighten-4{background-color:#fff9c4 !important}.yellow-text.text-lighten-4{color:#fff9c4 !important}.yellow.lighten-3{background-color:#fff59d !important}.yellow-text.text-lighten-3{color:#fff59d !important}.yellow.lighten-2{background-color:#fff176 !important}.yellow-text.text-lighten-2{color:#fff176 !important}.yellow.lighten-1{background-color:#ffee58 !important}.yellow-text.text-lighten-1{color:#ffee58 !important}.yellow.darken-1{background-color:#fdd835 !important}.yellow-text.text-darken-1{color:#fdd835 !important}.yellow.darken-2{background-color:#fbc02d !important}.yellow-text.text-darken-2{color:#fbc02d !important}.yellow.darken-3{background-color:#f9a825 !important}.yellow-text.text-darken-3{color:#f9a825 !important}.yellow.darken-4{background-color:#f57f17 !important}.yellow-text.text-darken-4{color:#f57f17 !important}.yellow.accent-1{background-color:#ffff8d !important}.yellow-text.text-accent-1{color:#ffff8d !important}.yellow.accent-2{background-color:#ff0 !important}.yellow-text.text-accent-2{color:#ff0 !important}.yellow.accent-3{background-color:#ffea00 !important}.yellow-text.text-accent-3{color:#ffea00 !important}.yellow.accent-4{background-color:#ffd600 !important}.yellow-text.text-accent-4{color:#ffd600 !important}.amber{background-color:#ffc107 !important}.amber-text{color:#ffc107 !important}.amber.lighten-5{background-color:#fff8e1 !important}.amber-text.text-lighten-5{color:#fff8e1 !important}.amber.lighten-4{background-color:#ffecb3 !important}.amber-text.text-lighten-4{color:#ffecb3 !important}.amber.lighten-3{background-color:#ffe082 !important}.amber-text.text-lighten-3{color:#ffe082 !important}.amber.lighten-2{background-color:#ffd54f !important}.amber-text.text-lighten-2{color:#ffd54f !important}.amber.lighten-1{background-color:#ffca28 !important}.amber-text.text-lighten-1{color:#ffca28 !important}.amber.darken-1{background-color:#ffb300 !important}.amber-text.text-darken-1{color:#ffb300 !important}.amber.darken-2{background-color:#ffa000 !important}.amber-text.text-darken-2{color:#ffa000 !important}.amber.darken-3{background-color:#ff8f00 !important}.amber-text.text-darken-3{color:#ff8f00 !important}.amber.darken-4{background-color:#ff6f00 !important}.amber-text.text-darken-4{color:#ff6f00 !important}.amber.accent-1{background-color:#ffe57f !important}.amber-text.text-accent-1{color:#ffe57f !important}.amber.accent-2{background-color:#ffd740 !important}.amber-text.text-accent-2{color:#ffd740 !important}.amber.accent-3{background-color:#ffc400 !important}.amber-text.text-accent-3{color:#ffc400 !important}.amber.accent-4{background-color:#ffab00 !important}.amber-text.text-accent-4{color:#ffab00 !important}.orange{background-color:#ff9800 !important}.orange-text{color:#ff9800 !important}.orange.lighten-5{background-color:#fff3e0 !important}.orange-text.text-lighten-5{color:#fff3e0 !important}.orange.lighten-4{background-color:#ffe0b2 !important}.orange-text.text-lighten-4{color:#ffe0b2 !important}.orange.lighten-3{background-color:#ffcc80 !important}.orange-text.text-lighten-3{color:#ffcc80 !important}.orange.lighten-2{background-color:#ffb74d !important}.orange-text.text-lighten-2{color:#ffb74d !important}.orange.lighten-1{background-color:#ffa726 !important}.orange-text.text-lighten-1{color:#ffa726 !important}.orange.darken-1{background-color:#fb8c00 !important}.orange-text.text-darken-1{color:#fb8c00 !important}.orange.darken-2{background-color:#f57c00 !important}.orange-text.text-darken-2{color:#f57c00 !important}.orange.darken-3{background-color:#ef6c00 !important}.orange-text.text-darken-3{color:#ef6c00 !important}.orange.darken-4{background-color:#e65100 !important}.orange-text.text-darken-4{color:#e65100 !important}.orange.accent-1{background-color:#ffd180 !important}.orange-text.text-accent-1{color:#ffd180 !important}.orange.accent-2{background-color:#ffab40 !important}.orange-text.text-accent-2{color:#ffab40 !important}.orange.accent-3{background-color:#ff9100 !important}.orange-text.text-accent-3{color:#ff9100 !important}.orange.accent-4{background-color:#ff6d00 !important}.orange-text.text-accent-4{color:#ff6d00 !important}.deep-orange{background-color:#ff5722 !important}.deep-orange-text{color:#ff5722 !important}.deep-orange.lighten-5{background-color:#fbe9e7 !important}.deep-orange-text.text-lighten-5{color:#fbe9e7 !important}.deep-orange.lighten-4{background-color:#ffccbc !important}.deep-orange-text.text-lighten-4{color:#ffccbc !important}.deep-orange.lighten-3{background-color:#ffab91 !important}.deep-orange-text.text-lighten-3{color:#ffab91 !important}.deep-orange.lighten-2{background-color:#ff8a65 !important}.deep-orange-text.text-lighten-2{color:#ff8a65 !important}.deep-orange.lighten-1{background-color:#ff7043 !important}.deep-orange-text.text-lighten-1{color:#ff7043 !important}.deep-orange.darken-1{background-color:#f4511e !important}.deep-orange-text.text-darken-1{color:#f4511e !important}.deep-orange.darken-2{background-color:#e64a19 !important}.deep-orange-text.text-darken-2{color:#e64a19 !important}.deep-orange.darken-3{background-color:#d84315 !important}.deep-orange-text.text-darken-3{color:#d84315 !important}.deep-orange.darken-4{background-color:#bf360c !important}.deep-orange-text.text-darken-4{color:#bf360c !important}.deep-orange.accent-1{background-color:#ff9e80 !important}.deep-orange-text.text-accent-1{color:#ff9e80 !important}.deep-orange.accent-2{background-color:#ff6e40 !important}.deep-orange-text.text-accent-2{color:#ff6e40 !important}.deep-orange.accent-3{background-color:#ff3d00 !important}.deep-orange-text.text-accent-3{color:#ff3d00 !important}.deep-orange.accent-4{background-color:#dd2c00 !important}.deep-orange-text.text-accent-4{color:#dd2c00 !important}.brown{background-color:#795548 !important}.brown-text{color:#795548 !important}.brown.lighten-5{background-color:#efebe9 !important}.brown-text.text-lighten-5{color:#efebe9 !important}.brown.lighten-4{background-color:#d7ccc8 !important}.brown-text.text-lighten-4{color:#d7ccc8 !important}.brown.lighten-3{background-color:#bcaaa4 !important}.brown-text.text-lighten-3{color:#bcaaa4 !important}.brown.lighten-2{background-color:#a1887f !important}.brown-text.text-lighten-2{color:#a1887f !important}.brown.lighten-1{background-color:#8d6e63 !important}.brown-text.text-lighten-1{color:#8d6e63 !important}.brown.darken-1{background-color:#6d4c41 !important}.brown-text.text-darken-1{color:#6d4c41 !important}.brown.darken-2{background-color:#5d4037 !important}.brown-text.text-darken-2{color:#5d4037 !important}.brown.darken-3{background-color:#4e342e !important}.brown-text.text-darken-3{color:#4e342e !important}.brown.darken-4{background-color:#3e2723 !important}.brown-text.text-darken-4{color:#3e2723 !important}.blue-grey{background-color:#607d8b !important}.blue-grey-text{color:#607d8b !important}.blue-grey.lighten-5{background-color:#eceff1 !important}.blue-grey-text.text-lighten-5{color:#eceff1 !important}.blue-grey.lighten-4{background-color:#cfd8dc !important}.blue-grey-text.text-lighten-4{color:#cfd8dc !important}.blue-grey.lighten-3{background-color:#b0bec5 !important}.blue-grey-text.text-lighten-3{color:#b0bec5 !important}.blue-grey.lighten-2{background-color:#90a4ae !important}.blue-grey-text.text-lighten-2{color:#90a4ae !important}.blue-grey.lighten-1{background-color:#78909c !important}.blue-grey-text.text-lighten-1{color:#78909c !important}.blue-grey.darken-1{background-color:#546e7a !important}.blue-grey-text.text-darken-1{color:#546e7a !important}.blue-grey.darken-2{background-color:#455a64 !important}.blue-grey-text.text-darken-2{color:#455a64 !important}.blue-grey.darken-3{background-color:#37474f !important}.blue-grey-text.text-darken-3{color:#37474f !important}.blue-grey.darken-4{background-color:#263238 !important}.blue-grey-text.text-darken-4{color:#263238 !important}.grey{background-color:#9e9e9e !important}.grey-text{color:#9e9e9e !important}.grey.lighten-5{background-color:#fafafa !important}.grey-text.text-lighten-5{color:#fafafa !important}.grey.lighten-4{background-color:#f5f5f5 !important}.grey-text.text-lighten-4{color:#f5f5f5 !important}.grey.lighten-3{background-color:#eee !important}.grey-text.text-lighten-3{color:#eee !important}.grey.lighten-2{background-color:#e0e0e0 !important}.grey-text.text-lighten-2{color:#e0e0e0 !important}.grey.lighten-1{background-color:#bdbdbd !important}.grey-text.text-lighten-1{color:#bdbdbd !important}.grey.darken-1{background-color:#757575 !important}.grey-text.text-darken-1{color:#757575 !important}.grey.darken-2{background-color:#616161 !important}.grey-text.text-darken-2{color:#616161 !important}.grey.darken-3{background-color:#424242 !important}.grey-text.text-darken-3{color:#424242 !important}.grey.darken-4{background-color:#212121 !important}.grey-text.text-darken-4{color:#212121 !important}.black{background-color:#000 !important}.black-text{color:#000 !important}.white{background-color:#fff !important}.white-text{color:#fff !important}.transparent{background-color:transparent !important}.transparent-text{color:transparent !important}/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:bold}dfn{font-style:italic}h1{font-size:2em;margin:0.67em 0}mark{background:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{-webkit-box-sizing:content-box;box-sizing:content-box;height:0}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace, monospace;font-size:1em}button,input,optgroup,select,textarea{color:inherit;font:inherit;margin:0}button{overflow:visible}button,select{text-transform:none}button,html input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}input{line-height:normal}input[type="checkbox"],input[type="radio"]{-webkit-box-sizing:border-box;box-sizing:border-box;padding:0}input[type="number"]::-webkit-inner-spin-button,input[type="number"]::-webkit-outer-spin-button{height:auto}input[type="search"]{-webkit-appearance:textfield;-webkit-box-sizing:content-box;box-sizing:content-box}input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none}fieldset{border:1px solid #c0c0c0;margin:0 2px;padding:0.35em 0.625em 0.75em}legend{border:0;padding:0}textarea{overflow:auto}optgroup{font-weight:bold}table{border-collapse:collapse;border-spacing:0}td,th{padding:0}html{-webkit-box-sizing:border-box;box-sizing:border-box}*,*:before,*:after{-webkit-box-sizing:inherit;box-sizing:inherit}ul:not(.browser-default){padding-left:0;list-style-type:none}ul:not(.browser-default)>li{list-style-type:none}a{color:#039be5;text-decoration:none;-webkit-tap-highlight-color:transparent}.valign-wrapper{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.clearfix{clear:both}.z-depth-0{-webkit-box-shadow:none !important;box-shadow:none !important}.z-depth-1,nav,.card-panel,.card,.toast,.btn,.btn-large,.btn-floating,.dropdown-content,.collapsible,.side-nav{-webkit-box-shadow:0 2px 2px 0 rgba(0,0,0,0.14),0 1px 5px 0 rgba(0,0,0,0.12),0 3px 1px -2px rgba(0,0,0,0.2);box-shadow:0 2px 2px 0 rgba(0,0,0,0.14),0 1px 5px 0 rgba(0,0,0,0.12),0 3px 1px -2px rgba(0,0,0,0.2)}.z-depth-1-half,.btn:hover,.btn-large:hover,.btn-floating:hover{-webkit-box-shadow:0 3px 3px 0 rgba(0,0,0,0.14),0 1px 7px 0 rgba(0,0,0,0.12),0 3px 1px -1px rgba(0,0,0,0.2);box-shadow:0 3px 3px 0 rgba(0,0,0,0.14),0 1px 7px 0 rgba(0,0,0,0.12),0 3px 1px -1px rgba(0,0,0,0.2)}.z-depth-2{-webkit-box-shadow:0 4px 5px 0 rgba(0,0,0,0.14),0 1px 10px 0 rgba(0,0,0,0.12),0 2px 4px -1px rgba(0,0,0,0.3);box-shadow:0 4px 5px 0 rgba(0,0,0,0.14),0 1px 10px 0 rgba(0,0,0,0.12),0 2px 4px -1px rgba(0,0,0,0.3)}.z-depth-3{-webkit-box-shadow:0 6px 10px 0 rgba(0,0,0,0.14),0 1px 18px 0 rgba(0,0,0,0.12),0 3px 5px -1px rgba(0,0,0,0.3);box-shadow:0 6px 10px 0 rgba(0,0,0,0.14),0 1px 18px 0 rgba(0,0,0,0.12),0 3px 5px -1px rgba(0,0,0,0.3)}.z-depth-4,.modal{-webkit-box-shadow:0 8px 10px 1px rgba(0,0,0,0.14),0 3px 14px 2px rgba(0,0,0,0.12),0 5px 5px -3px rgba(0,0,0,0.3);box-shadow:0 8px 10px 1px rgba(0,0,0,0.14),0 3px 14px 2px rgba(0,0,0,0.12),0 5px 5px -3px rgba(0,0,0,0.3)}.z-depth-5{-webkit-box-shadow:0 16px 24px 2px rgba(0,0,0,0.14),0 6px 30px 5px rgba(0,0,0,0.12),0 8px 10px -5px rgba(0,0,0,0.3);box-shadow:0 16px 24px 2px rgba(0,0,0,0.14),0 6px 30px 5px rgba(0,0,0,0.12),0 8px 10px -5px rgba(0,0,0,0.3)}.hoverable{-webkit-transition:-webkit-box-shadow .25s;transition:-webkit-box-shadow .25s;transition:box-shadow .25s;transition:box-shadow .25s, -webkit-box-shadow .25s}.hoverable:hover{-webkit-box-shadow:0 8px 17px 0 rgba(0,0,0,0.2),0 6px 20px 0 rgba(0,0,0,0.19);box-shadow:0 8px 17px 0 rgba(0,0,0,0.2),0 6px 20px 0 rgba(0,0,0,0.19)}.divider{height:1px;overflow:hidden;background-color:#e0e0e0}blockquote{margin:20px 0;padding-left:1.5rem;border-left:5px solid #ee6e73}i{line-height:inherit}i.left{float:left;margin-right:15px}i.right{float:right;margin-left:15px}i.tiny{font-size:1rem}i.small{font-size:2rem}i.medium{font-size:4rem}i.large{font-size:6rem}img.responsive-img,video.responsive-video{max-width:100%;height:auto}.pagination li{display:inline-block;border-radius:2px;text-align:center;vertical-align:top;height:30px}.pagination li a{color:#444;display:inline-block;font-size:1.2rem;padding:0 10px;line-height:30px}.pagination li.active a{color:#fff}.pagination li.active{background-color:#ee6e73}.pagination li.disabled a{cursor:default;color:#999}.pagination li i{font-size:2rem}.pagination li.pages ul li{display:inline-block;float:none}@media only screen and (max-width: 992px){.pagination{width:100%}.pagination li.prev,.pagination li.next{width:10%}.pagination li.pages{width:80%;overflow:hidden;white-space:nowrap}}.breadcrumb{font-size:18px;color:rgba(255,255,255,0.7)}.breadcrumb i,.breadcrumb [class^="mdi-"],.breadcrumb [class*="mdi-"],.breadcrumb i.material-icons{display:inline-block;float:left;font-size:24px}.breadcrumb:before{content:'\E5CC';color:rgba(255,255,255,0.7);vertical-align:top;display:inline-block;font-family:'Material Icons';font-weight:normal;font-style:normal;font-size:25px;margin:0 10px 0 8px;-webkit-font-smoothing:antialiased}.breadcrumb:first-child:before{display:none}.breadcrumb:last-child{color:#fff}.parallax-container{position:relative;overflow:hidden;height:500px}.parallax-container .parallax{position:absolute;top:0;left:0;right:0;bottom:0;z-index:-1}.parallax-container .parallax img{display:none;position:absolute;left:50%;bottom:0;min-width:100%;min-height:100%;-webkit-transform:translate3d(0, 0, 0);transform:translate3d(0, 0, 0);-webkit-transform:translateX(-50%);transform:translateX(-50%)}.pin-top,.pin-bottom{position:relative}.pinned{position:fixed !important}ul.staggered-list li{opacity:0}.fade-in{opacity:0;-webkit-transform-origin:0 50%;transform-origin:0 50%}@media only screen and (max-width: 600px){.hide-on-small-only,.hide-on-small-and-down{display:none !important}}@media only screen and (max-width: 992px){.hide-on-med-and-down{display:none !important}}@media only screen and (min-width: 601px){.hide-on-med-and-up{display:none !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.hide-on-med-only{display:none !important}}@media only screen and (min-width: 993px){.hide-on-large-only{display:none !important}}@media only screen and (min-width: 993px){.show-on-large{display:block !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.show-on-medium{display:block !important}}@media only screen and (max-width: 600px){.show-on-small{display:block !important}}@media only screen and (min-width: 601px){.show-on-medium-and-up{display:block !important}}@media only screen and (max-width: 992px){.show-on-medium-and-down{display:block !important}}@media only screen and (max-width: 600px){.center-on-small-only{text-align:center}}.page-footer{padding-top:20px;color:#fff;background-color:#ee6e73}.page-footer .footer-copyright{overflow:hidden;min-height:50px;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;padding:10px 0px;color:rgba(255,255,255,0.8);background-color:rgba(51,51,51,0.08)}table,th,td{border:none}table{width:100%;display:table}table.bordered>thead>tr,table.bordered>tbody>tr{border-bottom:1px solid #d0d0d0}table.striped>tbody>tr:nth-child(odd){background-color:#f2f2f2}table.striped>tbody>tr>td{border-radius:0}table.highlight>tbody>tr{-webkit-transition:background-color .25s ease;transition:background-color .25s ease}table.highlight>tbody>tr:hover{background-color:#f2f2f2}table.centered thead tr th,table.centered tbody tr td{text-align:center}thead{border-bottom:1px solid #d0d0d0}td,th{padding:15px 5px;display:table-cell;text-align:left;vertical-align:middle;border-radius:2px}@media only screen and (max-width: 992px){table.responsive-table{width:100%;border-collapse:collapse;border-spacing:0;display:block;position:relative}table.responsive-table td:empty:before{content:'\00a0'}table.responsive-table th,table.responsive-table td{margin:0;vertical-align:top}table.responsive-table th{text-align:left}table.responsive-table thead{display:block;float:left}table.responsive-table thead tr{display:block;padding:0 10px 0 0}table.responsive-table thead tr th::before{content:"\00a0"}table.responsive-table tbody{display:block;width:auto;position:relative;overflow-x:auto;white-space:nowrap}table.responsive-table tbody tr{display:inline-block;vertical-align:top}table.responsive-table th{display:block;text-align:right}table.responsive-table td{display:block;min-height:1.25em;text-align:left}table.responsive-table tr{padding:0 10px}table.responsive-table thead{border:0;border-right:1px solid #d0d0d0}table.responsive-table.bordered th{border-bottom:0;border-left:0}table.responsive-table.bordered td{border-left:0;border-right:0;border-bottom:0}table.responsive-table.bordered tr{border:0}table.responsive-table.bordered tbody tr{border-right:1px solid #d0d0d0}}.collection{margin:.5rem 0 1rem 0;border:1px solid #e0e0e0;border-radius:2px;overflow:hidden;position:relative}.collection .collection-item{background-color:#fff;line-height:1.5rem;padding:10px 20px;margin:0;border-bottom:1px solid #e0e0e0}.collection .collection-item.avatar{min-height:84px;padding-left:72px;position:relative}.collection .collection-item.avatar:not(.circle-clipper)>.circle,.collection .collection-item.avatar :not(.circle-clipper)>.circle{position:absolute;width:42px;height:42px;overflow:hidden;left:15px;display:inline-block;vertical-align:middle}.collection .collection-item.avatar i.circle{font-size:18px;line-height:42px;color:#fff;background-color:#999;text-align:center}.collection .collection-item.avatar .title{font-size:16px}.collection .collection-item.avatar p{margin:0}.collection .collection-item.avatar .secondary-content{position:absolute;top:16px;right:16px}.collection .collection-item:last-child{border-bottom:none}.collection .collection-item.active{background-color:#26a69a;color:#eafaf9}.collection .collection-item.active .secondary-content{color:#fff}.collection a.collection-item{display:block;-webkit-transition:.25s;transition:.25s;color:#26a69a}.collection a.collection-item:not(.active):hover{background-color:#ddd}.collection.with-header .collection-header{background-color:#fff;border-bottom:1px solid #e0e0e0;padding:10px 20px}.collection.with-header .collection-item{padding-left:30px}.collection.with-header .collection-item.avatar{padding-left:72px}.secondary-content{float:right;color:#26a69a}.collapsible .collection{margin:0;border:none}.video-container{position:relative;padding-bottom:56.25%;height:0;overflow:hidden}.video-container iframe,.video-container object,.video-container embed{position:absolute;top:0;left:0;width:100%;height:100%}.progress{position:relative;height:4px;display:block;width:100%;background-color:#acece6;border-radius:2px;margin:.5rem 0 1rem 0;overflow:hidden}.progress .determinate{position:absolute;top:0;left:0;bottom:0;background-color:#26a69a;-webkit-transition:width .3s linear;transition:width .3s linear}.progress .indeterminate{background-color:#26a69a}.progress .indeterminate:before{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite}.progress .indeterminate:after{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;-webkit-animation-delay:1.15s;animation-delay:1.15s}@-webkit-keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@-webkit-keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}@keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}.hide{display:none !important}.left-align{text-align:left}.right-align{text-align:right}.center,.center-align{text-align:center}.left{float:left !important}.right{float:right !important}.no-select,input[type=range],input[type=range]+.thumb{-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.circle{border-radius:50%}.center-block{display:block;margin-left:auto;margin-right:auto}.truncate{display:block;white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.no-padding{padding:0 !important}span.badge{min-width:3rem;padding:0 6px;margin-left:14px;text-align:center;font-size:1rem;line-height:22px;height:22px;color:#757575;float:right;-webkit-box-sizing:border-box;box-sizing:border-box}span.badge.new{font-weight:300;font-size:0.8rem;color:#fff;background-color:#26a69a;border-radius:2px}span.badge.new:after{content:" new"}span.badge[data-badge-caption]::after{content:" " attr(data-badge-caption)}nav ul a span.badge{display:inline-block;float:none;margin-left:4px;line-height:22px;height:22px;-webkit-font-smoothing:auto}.collection-item span.badge{margin-top:calc(.75rem - 11px)}.collapsible span.badge{margin-left:auto}.side-nav span.badge{margin-top:calc(24px - 11px)}.material-icons{text-rendering:optimizeLegibility;-webkit-font-feature-settings:'liga';-moz-font-feature-settings:'liga';font-feature-settings:'liga'}.container{margin:0 auto;max-width:1280px;width:90%}@media only screen and (min-width: 601px){.container{width:85%}}@media only screen and (min-width: 993px){.container{width:70%}}.container .row{margin-left:-.75rem;margin-right:-.75rem}.section{padding-top:1rem;padding-bottom:1rem}.section.no-pad{padding:0}.section.no-pad-bot{padding-bottom:0}.section.no-pad-top{padding-top:0}.row{margin-left:auto;margin-right:auto;margin-bottom:20px}.row:after{content:"";display:table;clear:both}.row .col{float:left;-webkit-box-sizing:border-box;box-sizing:border-box;padding:0 .75rem;min-height:1px}.row .col[class*="push-"],.row .col[class*="pull-"]{position:relative}.row .col.s1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.s4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.s7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.s10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-s1{margin-left:8.3333333333%}.row .col.pull-s1{right:8.3333333333%}.row .col.push-s1{left:8.3333333333%}.row .col.offset-s2{margin-left:16.6666666667%}.row .col.pull-s2{right:16.6666666667%}.row .col.push-s2{left:16.6666666667%}.row .col.offset-s3{margin-left:25%}.row .col.pull-s3{right:25%}.row .col.push-s3{left:25%}.row .col.offset-s4{margin-left:33.3333333333%}.row .col.pull-s4{right:33.3333333333%}.row .col.push-s4{left:33.3333333333%}.row .col.offset-s5{margin-left:41.6666666667%}.row .col.pull-s5{right:41.6666666667%}.row .col.push-s5{left:41.6666666667%}.row .col.offset-s6{margin-left:50%}.row .col.pull-s6{right:50%}.row .col.push-s6{left:50%}.row .col.offset-s7{margin-left:58.3333333333%}.row .col.pull-s7{right:58.3333333333%}.row .col.push-s7{left:58.3333333333%}.row .col.offset-s8{margin-left:66.6666666667%}.row .col.pull-s8{right:66.6666666667%}.row .col.push-s8{left:66.6666666667%}.row .col.offset-s9{margin-left:75%}.row .col.pull-s9{right:75%}.row .col.push-s9{left:75%}.row .col.offset-s10{margin-left:83.3333333333%}.row .col.pull-s10{right:83.3333333333%}.row .col.push-s10{left:83.3333333333%}.row .col.offset-s11{margin-left:91.6666666667%}.row .col.pull-s11{right:91.6666666667%}.row .col.push-s11{left:91.6666666667%}.row .col.offset-s12{margin-left:100%}.row .col.pull-s12{right:100%}.row .col.push-s12{left:100%}@media only screen and (min-width: 601px){.row .col.m1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.m4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.m7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.m10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-m1{margin-left:8.3333333333%}.row .col.pull-m1{right:8.3333333333%}.row .col.push-m1{left:8.3333333333%}.row .col.offset-m2{margin-left:16.6666666667%}.row .col.pull-m2{right:16.6666666667%}.row .col.push-m2{left:16.6666666667%}.row .col.offset-m3{margin-left:25%}.row .col.pull-m3{right:25%}.row .col.push-m3{left:25%}.row .col.offset-m4{margin-left:33.3333333333%}.row .col.pull-m4{right:33.3333333333%}.row .col.push-m4{left:33.3333333333%}.row .col.offset-m5{margin-left:41.6666666667%}.row .col.pull-m5{right:41.6666666667%}.row .col.push-m5{left:41.6666666667%}.row .col.offset-m6{margin-left:50%}.row .col.pull-m6{right:50%}.row .col.push-m6{left:50%}.row .col.offset-m7{margin-left:58.3333333333%}.row .col.pull-m7{right:58.3333333333%}.row .col.push-m7{left:58.3333333333%}.row .col.offset-m8{margin-left:66.6666666667%}.row .col.pull-m8{right:66.6666666667%}.row .col.push-m8{left:66.6666666667%}.row .col.offset-m9{margin-left:75%}.row .col.pull-m9{right:75%}.row .col.push-m9{left:75%}.row .col.offset-m10{margin-left:83.3333333333%}.row .col.pull-m10{right:83.3333333333%}.row .col.push-m10{left:83.3333333333%}.row .col.offset-m11{margin-left:91.6666666667%}.row .col.pull-m11{right:91.6666666667%}.row .col.push-m11{left:91.6666666667%}.row .col.offset-m12{margin-left:100%}.row .col.pull-m12{right:100%}.row .col.push-m12{left:100%}}@media only screen and (min-width: 993px){.row .col.l1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.l4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.l7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.l10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-l1{margin-left:8.3333333333%}.row .col.pull-l1{right:8.3333333333%}.row .col.push-l1{left:8.3333333333%}.row .col.offset-l2{margin-left:16.6666666667%}.row .col.pull-l2{right:16.6666666667%}.row .col.push-l2{left:16.6666666667%}.row .col.offset-l3{margin-left:25%}.row .col.pull-l3{right:25%}.row .col.push-l3{left:25%}.row .col.offset-l4{margin-left:33.3333333333%}.row .col.pull-l4{right:33.3333333333%}.row .col.push-l4{left:33.3333333333%}.row .col.offset-l5{margin-left:41.6666666667%}.row .col.pull-l5{right:41.6666666667%}.row .col.push-l5{left:41.6666666667%}.row .col.offset-l6{margin-left:50%}.row .col.pull-l6{right:50%}.row .col.push-l6{left:50%}.row .col.offset-l7{margin-left:58.3333333333%}.row .col.pull-l7{right:58.3333333333%}.row .col.push-l7{left:58.3333333333%}.row .col.offset-l8{margin-left:66.6666666667%}.row .col.pull-l8{right:66.6666666667%}.row .col.push-l8{left:66.6666666667%}.row .col.offset-l9{margin-left:75%}.row .col.pull-l9{right:75%}.row .col.push-l9{left:75%}.row .col.offset-l10{margin-left:83.3333333333%}.row .col.pull-l10{right:83.3333333333%}.row .col.push-l10{left:83.3333333333%}.row .col.offset-l11{margin-left:91.6666666667%}.row .col.pull-l11{right:91.6666666667%}.row .col.push-l11{left:91.6666666667%}.row .col.offset-l12{margin-left:100%}.row .col.pull-l12{right:100%}.row .col.push-l12{left:100%}}@media only screen and (min-width: 1201px){.row .col.xl1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.xl2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.xl3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.xl4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.xl5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.xl6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.xl7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.xl8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.xl9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.xl10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.xl11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.xl12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-xl1{margin-left:8.3333333333%}.row .col.pull-xl1{right:8.3333333333%}.row .col.push-xl1{left:8.3333333333%}.row .col.offset-xl2{margin-left:16.6666666667%}.row .col.pull-xl2{right:16.6666666667%}.row .col.push-xl2{left:16.6666666667%}.row .col.offset-xl3{margin-left:25%}.row .col.pull-xl3{right:25%}.row .col.push-xl3{left:25%}.row .col.offset-xl4{margin-left:33.3333333333%}.row .col.pull-xl4{right:33.3333333333%}.row .col.push-xl4{left:33.3333333333%}.row .col.offset-xl5{margin-left:41.6666666667%}.row .col.pull-xl5{right:41.6666666667%}.row .col.push-xl5{left:41.6666666667%}.row .col.offset-xl6{margin-left:50%}.row .col.pull-xl6{right:50%}.row .col.push-xl6{left:50%}.row .col.offset-xl7{margin-left:58.3333333333%}.row .col.pull-xl7{right:58.3333333333%}.row .col.push-xl7{left:58.3333333333%}.row .col.offset-xl8{margin-left:66.6666666667%}.row .col.pull-xl8{right:66.6666666667%}.row .col.push-xl8{left:66.6666666667%}.row .col.offset-xl9{margin-left:75%}.row .col.pull-xl9{right:75%}.row .col.push-xl9{left:75%}.row .col.offset-xl10{margin-left:83.3333333333%}.row .col.pull-xl10{right:83.3333333333%}.row .col.push-xl10{left:83.3333333333%}.row .col.offset-xl11{margin-left:91.6666666667%}.row .col.pull-xl11{right:91.6666666667%}.row .col.push-xl11{left:91.6666666667%}.row .col.offset-xl12{margin-left:100%}.row .col.pull-xl12{right:100%}.row .col.push-xl12{left:100%}}nav{color:#fff;background-color:#ee6e73;width:100%;height:56px;line-height:56px}nav.nav-extended{height:auto}nav.nav-extended .nav-wrapper{min-height:56px;height:auto}nav.nav-extended .nav-content{position:relative;line-height:normal}nav a{color:#fff}nav i,nav [class^="mdi-"],nav [class*="mdi-"],nav i.material-icons{display:block;font-size:24px;height:56px;line-height:56px}nav .nav-wrapper{position:relative;height:100%}@media only screen and (min-width: 993px){nav a.button-collapse{display:none}}nav .button-collapse{float:left;position:relative;z-index:1;height:56px;margin:0 18px}nav .button-collapse i{height:56px;line-height:56px}nav .brand-logo{position:absolute;color:#fff;display:inline-block;font-size:2.1rem;padding:0}nav .brand-logo.center{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}@media only screen and (max-width: 992px){nav .brand-logo{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}nav .brand-logo.left,nav .brand-logo.right{padding:0;-webkit-transform:none;transform:none}nav .brand-logo.left{left:0.5rem}nav .brand-logo.right{right:0.5rem;left:auto}}nav .brand-logo.right{right:0.5rem;padding:0}nav .brand-logo i,nav .brand-logo [class^="mdi-"],nav .brand-logo [class*="mdi-"],nav .brand-logo i.material-icons{float:left;margin-right:15px}nav .nav-title{display:inline-block;font-size:32px;padding:28px 0}nav ul{margin:0}nav ul li{-webkit-transition:background-color .3s;transition:background-color .3s;float:left;padding:0}nav ul li.active{background-color:rgba(0,0,0,0.1)}nav ul a{-webkit-transition:background-color .3s;transition:background-color .3s;font-size:1rem;color:#fff;display:block;padding:0 15px;cursor:pointer}nav ul a.btn,nav ul a.btn-large,nav ul a.btn-large,nav ul a.btn-flat,nav ul a.btn-floating{margin-top:-2px;margin-left:15px;margin-right:15px}nav ul a.btn>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-flat>.material-icons,nav ul a.btn-floating>.material-icons{height:inherit;line-height:inherit}nav ul a:hover{background-color:rgba(0,0,0,0.1)}nav ul.left{float:left}nav form{height:100%}nav .input-field{margin:0;height:100%}nav .input-field input{height:100%;font-size:1.2rem;border:none;padding-left:2rem}nav .input-field input:focus,nav .input-field input[type=text]:valid,nav .input-field input[type=password]:valid,nav .input-field input[type=email]:valid,nav .input-field input[type=url]:valid,nav .input-field input[type=date]:valid{border:none;-webkit-box-shadow:none;box-shadow:none}nav .input-field label{top:0;left:0}nav .input-field label i{color:rgba(255,255,255,0.7);-webkit-transition:color .3s;transition:color .3s}nav .input-field label.active i{color:#fff}.navbar-fixed{position:relative;height:56px;z-index:997}.navbar-fixed nav{position:fixed}@media only screen and (min-width: 601px){nav.nav-extended .nav-wrapper{min-height:64px}nav,nav .nav-wrapper i,nav a.button-collapse,nav a.button-collapse i{height:64px;line-height:64px}.navbar-fixed{height:64px}}@font-face{font-family:"Roboto";src:local(Roboto Thin),url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"),url("../fonts/roboto/Roboto-Thin.woff") format("woff");font-weight:100}@font-face{font-family:"Roboto";src:local(Roboto Light),url("../fonts/roboto/Roboto-Light.woff2") format("woff2"),url("../fonts/roboto/Roboto-Light.woff") format("woff");font-weight:300}@font-face{font-family:"Roboto";src:local(Roboto Regular),url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"),url("../fonts/roboto/Roboto-Regular.woff") format("woff");font-weight:400}@font-face{font-family:"Roboto";src:local(Roboto Medium),url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"),url("../fonts/roboto/Roboto-Medium.woff") format("woff");font-weight:500}@font-face{font-family:"Roboto";src:local(Roboto Bold),url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"),url("../fonts/roboto/Roboto-Bold.woff") format("woff");font-weight:700}a{text-decoration:none}html{line-height:1.5;font-family:"Roboto", sans-serif;font-weight:normal;color:rgba(0,0,0,0.87)}@media only screen and (min-width: 0){html{font-size:14px}}@media only screen and (min-width: 992px){html{font-size:14.5px}}@media only screen and (min-width: 1200px){html{font-size:15px}}h1,h2,h3,h4,h5,h6{font-weight:400;line-height:1.1}h1 a,h2 a,h3 a,h4 a,h5 a,h6 a{font-weight:inherit}h1{font-size:4.2rem;line-height:110%;margin:2.1rem 0 1.68rem 0}h2{font-size:3.56rem;line-height:110%;margin:1.78rem 0 1.424rem 0}h3{font-size:2.92rem;line-height:110%;margin:1.46rem 0 1.168rem 0}h4{font-size:2.28rem;line-height:110%;margin:1.14rem 0 .912rem 0}h5{font-size:1.64rem;line-height:110%;margin:.82rem 0 .656rem 0}h6{font-size:1rem;line-height:110%;margin:.5rem 0 .4rem 0}em{font-style:italic}strong{font-weight:500}small{font-size:75%}.light,.page-footer .footer-copyright{font-weight:300}.thin{font-weight:200}.flow-text{font-weight:300}@media only screen and (min-width: 360px){.flow-text{font-size:1.2rem}}@media only screen and (min-width: 390px){.flow-text{font-size:1.224rem}}@media only screen and (min-width: 420px){.flow-text{font-size:1.248rem}}@media only screen and (min-width: 450px){.flow-text{font-size:1.272rem}}@media only screen and (min-width: 480px){.flow-text{font-size:1.296rem}}@media only screen and (min-width: 510px){.flow-text{font-size:1.32rem}}@media only screen and (min-width: 540px){.flow-text{font-size:1.344rem}}@media only screen and (min-width: 570px){.flow-text{font-size:1.368rem}}@media only screen and (min-width: 600px){.flow-text{font-size:1.392rem}}@media only screen and (min-width: 630px){.flow-text{font-size:1.416rem}}@media only screen and (min-width: 660px){.flow-text{font-size:1.44rem}}@media only screen and (min-width: 690px){.flow-text{font-size:1.464rem}}@media only screen and (min-width: 720px){.flow-text{font-size:1.488rem}}@media only screen and (min-width: 750px){.flow-text{font-size:1.512rem}}@media only screen and (min-width: 780px){.flow-text{font-size:1.536rem}}@media only screen and (min-width: 810px){.flow-text{font-size:1.56rem}}@media only screen and (min-width: 840px){.flow-text{font-size:1.584rem}}@media only screen and (min-width: 870px){.flow-text{font-size:1.608rem}}@media only screen and (min-width: 900px){.flow-text{font-size:1.632rem}}@media only screen and (min-width: 930px){.flow-text{font-size:1.656rem}}@media only screen and (min-width: 960px){.flow-text{font-size:1.68rem}}@media only screen and (max-width: 360px){.flow-text{font-size:1.2rem}}.scale-transition{-webkit-transition:-webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:-webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important}.scale-transition.scale-out{-webkit-transform:scale(0);transform:scale(0);-webkit-transition:-webkit-transform .2s !important;transition:-webkit-transform .2s !important;transition:transform .2s !important;transition:transform .2s, -webkit-transform .2s !important}.scale-transition.scale-in{-webkit-transform:scale(1);transform:scale(1)}.card-panel{-webkit-transition:-webkit-box-shadow .25s;transition:-webkit-box-shadow .25s;transition:box-shadow .25s;transition:box-shadow .25s, -webkit-box-shadow .25s;padding:24px;margin:.5rem 0 1rem 0;border-radius:2px;background-color:#fff}.card{position:relative;margin:.5rem 0 1rem 0;background-color:#fff;-webkit-transition:-webkit-box-shadow .25s;transition:-webkit-box-shadow .25s;transition:box-shadow .25s;transition:box-shadow .25s, -webkit-box-shadow .25s;border-radius:2px}.card .card-title{font-size:24px;font-weight:300}.card .card-title.activator{cursor:pointer}.card.small,.card.medium,.card.large{position:relative}.card.small .card-image,.card.medium .card-image,.card.large .card-image{max-height:60%;overflow:hidden}.card.small .card-image+.card-content,.card.medium .card-image+.card-content,.card.large .card-image+.card-content{max-height:40%}.card.small .card-content,.card.medium .card-content,.card.large .card-content{max-height:100%;overflow:hidden}.card.small .card-action,.card.medium .card-action,.card.large .card-action{position:absolute;bottom:0;left:0;right:0}.card.small{height:300px}.card.medium{height:400px}.card.large{height:500px}.card.horizontal{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.card.horizontal.small .card-image,.card.horizontal.medium .card-image,.card.horizontal.large .card-image{height:100%;max-height:none;overflow:visible}.card.horizontal.small .card-image img,.card.horizontal.medium .card-image img,.card.horizontal.large .card-image img{height:100%}.card.horizontal .card-image{max-width:50%}.card.horizontal .card-image img{border-radius:2px 0 0 2px;max-width:100%;width:auto}.card.horizontal .card-stacked{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1;position:relative}.card.horizontal .card-stacked .card-content{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.card.sticky-action .card-action{z-index:2}.card.sticky-action .card-reveal{z-index:1;padding-bottom:64px}.card .card-image{position:relative}.card .card-image img{display:block;border-radius:2px 2px 0 0;position:relative;left:0;right:0;top:0;bottom:0;width:100%}.card .card-image .card-title{color:#fff;position:absolute;bottom:0;left:0;max-width:100%;padding:24px}.card .card-content{padding:24px;border-radius:0 0 2px 2px}.card .card-content p{margin:0;color:inherit}.card .card-content .card-title{display:block;line-height:32px;margin-bottom:8px}.card .card-content .card-title i{line-height:32px}.card .card-action{position:relative;background-color:inherit;border-top:1px solid rgba(160,160,160,0.2);padding:16px 24px}.card .card-action:last-child{border-radius:0 0 2px 2px}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating){color:#ffab40;margin-right:24px;-webkit-transition:color .3s ease;transition:color .3s ease;text-transform:uppercase}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover{color:#ffd8a6}.card .card-reveal{padding:24px;position:absolute;background-color:#fff;width:100%;overflow-y:auto;left:0;top:100%;height:100%;z-index:3;display:none}.card .card-reveal .card-title{cursor:pointer;display:block}#toast-container{display:block;position:fixed;z-index:10000}@media only screen and (max-width: 600px){#toast-container{min-width:100%;bottom:0%}}@media only screen and (min-width: 601px) and (max-width: 992px){#toast-container{left:5%;bottom:7%;max-width:90%}}@media only screen and (min-width: 993px){#toast-container{top:10%;right:7%;max-width:86%}}.toast{border-radius:2px;top:35px;width:auto;margin-top:10px;position:relative;max-width:100%;height:auto;min-height:48px;line-height:1.5em;word-break:break-all;background-color:#323232;padding:10px 25px;font-size:1.1rem;font-weight:300;color:#fff;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;cursor:default}.toast .toast-action{color:#eeff41;font-weight:500;margin-right:-25px;margin-left:3rem}.toast.rounded{border-radius:24px}@media only screen and (max-width: 600px){.toast{width:100%;border-radius:0}}.tabs{position:relative;overflow-x:auto;overflow-y:hidden;height:48px;width:100%;background-color:#fff;margin:0 auto;white-space:nowrap}.tabs.tabs-transparent{background-color:transparent}.tabs.tabs-transparent .tab a,.tabs.tabs-transparent .tab.disabled a,.tabs.tabs-transparent .tab.disabled a:hover{color:rgba(255,255,255,0.7)}.tabs.tabs-transparent .tab a:hover,.tabs.tabs-transparent .tab a.active{color:#fff}.tabs.tabs-transparent .indicator{background-color:#fff}.tabs.tabs-fixed-width{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs.tabs-fixed-width .tab{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab{display:inline-block;text-align:center;line-height:48px;height:48px;padding:0;margin:0;text-transform:uppercase}.tabs .tab a{color:rgba(238,110,115,0.7);display:block;width:100%;height:100%;padding:0 24px;font-size:14px;text-overflow:ellipsis;overflow:hidden;-webkit-transition:color .28s ease;transition:color .28s ease}.tabs .tab a:hover,.tabs .tab a.active{background-color:transparent;color:#ee6e73}.tabs .tab.disabled a,.tabs .tab.disabled a:hover{color:rgba(238,110,115,0.7);cursor:default}.tabs .indicator{position:absolute;bottom:0;height:2px;background-color:#f6b2b5;will-change:left, right}@media only screen and (max-width: 992px){.tabs{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs .tab{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab a{padding:0 12px}}.material-tooltip{padding:10px 8px;font-size:1rem;z-index:2000;background-color:transparent;border-radius:2px;color:#fff;min-height:36px;line-height:120%;opacity:0;position:absolute;text-align:center;max-width:calc(100% - 4px);overflow:hidden;left:0;top:0;pointer-events:none;visibility:hidden}.backdrop{position:absolute;opacity:0;height:7px;width:14px;border-radius:0 0 50% 50%;background-color:#323232;z-index:-1;-webkit-transform-origin:50% 0%;transform-origin:50% 0%;visibility:hidden}.btn,.btn-large,.btn-flat{border:none;border-radius:2px;display:inline-block;height:36px;line-height:36px;padding:0 2rem;text-transform:uppercase;vertical-align:middle;-webkit-tap-highlight-color:transparent}.btn.disabled,.disabled.btn-large,.btn-floating.disabled,.btn-large.disabled,.btn-flat.disabled,.btn:disabled,.btn-large:disabled,.btn-floating:disabled,.btn-large:disabled,.btn-flat:disabled,.btn[disabled],[disabled].btn-large,.btn-floating[disabled],.btn-large[disabled],.btn-flat[disabled]{pointer-events:none;background-color:#DFDFDF !important;-webkit-box-shadow:none;box-shadow:none;color:#9F9F9F !important;cursor:default}.btn.disabled:hover,.disabled.btn-large:hover,.btn-floating.disabled:hover,.btn-large.disabled:hover,.btn-flat.disabled:hover,.btn:disabled:hover,.btn-large:disabled:hover,.btn-floating:disabled:hover,.btn-large:disabled:hover,.btn-flat:disabled:hover,.btn[disabled]:hover,[disabled].btn-large:hover,.btn-floating[disabled]:hover,.btn-large[disabled]:hover,.btn-flat[disabled]:hover{background-color:#DFDFDF !important;color:#9F9F9F !important}.btn,.btn-large,.btn-floating,.btn-large,.btn-flat{font-size:1rem;outline:0}.btn i,.btn-large i,.btn-floating i,.btn-large i,.btn-flat i{font-size:1.3rem;line-height:inherit}.btn:focus,.btn-large:focus,.btn-floating:focus{background-color:#1d7d74}.btn,.btn-large{text-decoration:none;color:#fff;background-color:#26a69a;text-align:center;letter-spacing:.5px;-webkit-transition:.2s ease-out;transition:.2s ease-out;cursor:pointer}.btn:hover,.btn-large:hover{background-color:#2bbbad}.btn-floating{display:inline-block;color:#fff;position:relative;overflow:hidden;z-index:1;width:40px;height:40px;line-height:40px;padding:0;background-color:#26a69a;border-radius:50%;-webkit-transition:.3s;transition:.3s;cursor:pointer;vertical-align:middle}.btn-floating:hover{background-color:#26a69a}.btn-floating:before{border-radius:0}.btn-floating.btn-large{width:56px;height:56px}.btn-floating.btn-large.halfway-fab{bottom:-28px}.btn-floating.btn-large i{line-height:56px}.btn-floating.halfway-fab{position:absolute;right:24px;bottom:-20px}.btn-floating.halfway-fab.left{right:auto;left:24px}.btn-floating i{width:inherit;display:inline-block;text-align:center;color:#fff;font-size:1.6rem;line-height:40px}button.btn-floating{border:none}.fixed-action-btn{position:fixed;right:23px;bottom:23px;padding-top:15px;margin-bottom:0;z-index:997}.fixed-action-btn.active ul{visibility:visible}.fixed-action-btn.horizontal{padding:0 0 0 15px}.fixed-action-btn.horizontal ul{text-align:right;right:64px;top:50%;-webkit-transform:translateY(-50%);transform:translateY(-50%);height:100%;left:auto;width:500px}.fixed-action-btn.horizontal ul li{display:inline-block;margin:15px 15px 0 0}.fixed-action-btn.toolbar{padding:0;height:56px}.fixed-action-btn.toolbar.active>a i{opacity:0}.fixed-action-btn.toolbar ul{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;top:0;bottom:0;z-index:1}.fixed-action-btn.toolbar ul li{-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1;display:inline-block;margin:0;height:100%;-webkit-transition:none;transition:none}.fixed-action-btn.toolbar ul li a{display:block;overflow:hidden;position:relative;width:100%;height:100%;background-color:transparent;-webkit-box-shadow:none;box-shadow:none;color:#fff;line-height:56px;z-index:1}.fixed-action-btn.toolbar ul li a i{line-height:inherit}.fixed-action-btn ul{left:0;right:0;text-align:center;position:absolute;bottom:64px;margin:0;visibility:hidden}.fixed-action-btn ul li{margin-bottom:15px}.fixed-action-btn ul a.btn-floating{opacity:0}.fixed-action-btn .fab-backdrop{position:absolute;top:0;left:0;z-index:-1;width:40px;height:40px;background-color:#26a69a;border-radius:50%;-webkit-transform:scale(0);transform:scale(0)}.btn-flat{-webkit-box-shadow:none;box-shadow:none;background-color:transparent;color:#343434;cursor:pointer;-webkit-transition:background-color .2s;transition:background-color .2s}.btn-flat:focus,.btn-flat:hover{-webkit-box-shadow:none;box-shadow:none}.btn-flat:focus{background-color:rgba(0,0,0,0.1)}.btn-flat.disabled{background-color:transparent !important;color:#b3b2b2 !important;cursor:default}.btn-large{height:54px;line-height:54px}.btn-large i{font-size:1.6rem}.btn-block{display:block}.dropdown-content{background-color:#fff;margin:0;display:none;min-width:100px;max-height:650px;overflow-y:auto;opacity:0;position:absolute;z-index:999;will-change:width, height}.dropdown-content li{clear:both;color:rgba(0,0,0,0.87);cursor:pointer;min-height:50px;line-height:1.5rem;width:100%;text-align:left;text-transform:none}.dropdown-content li:hover,.dropdown-content li.active,.dropdown-content li.selected{background-color:#eee}.dropdown-content li.active.selected{background-color:#e1e1e1}.dropdown-content li.divider{min-height:0;height:1px}.dropdown-content li>a,.dropdown-content li>span{font-size:16px;color:#26a69a;display:block;line-height:22px;padding:14px 16px}.dropdown-content li>span>label{top:1px;left:0;height:18px}.dropdown-content li>a>i{height:inherit;line-height:inherit;float:left;margin:0 24px 0 0;width:24px}.input-field.col .dropdown-content [type="checkbox"]+label{top:1px;left:0;height:18px}/*!
+ * Waves v0.6.0
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */.waves-effect{position:relative;cursor:pointer;display:inline-block;overflow:hidden;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-tap-highlight-color:transparent;vertical-align:middle;z-index:1;-webkit-transition:.3s ease-out;transition:.3s ease-out}.waves-effect .waves-ripple{position:absolute;border-radius:50%;width:20px;height:20px;margin-top:-10px;margin-left:-10px;opacity:0;background:rgba(0,0,0,0.2);-webkit-transition:all 0.7s ease-out;transition:all 0.7s ease-out;-webkit-transition-property:opacity, -webkit-transform;transition-property:opacity, -webkit-transform;transition-property:transform, opacity;transition-property:transform, opacity, -webkit-transform;-webkit-transform:scale(0);transform:scale(0);pointer-events:none}.waves-effect.waves-light .waves-ripple{background-color:rgba(255,255,255,0.45)}.waves-effect.waves-red .waves-ripple{background-color:rgba(244,67,54,0.7)}.waves-effect.waves-yellow .waves-ripple{background-color:rgba(255,235,59,0.7)}.waves-effect.waves-orange .waves-ripple{background-color:rgba(255,152,0,0.7)}.waves-effect.waves-purple .waves-ripple{background-color:rgba(156,39,176,0.7)}.waves-effect.waves-green .waves-ripple{background-color:rgba(76,175,80,0.7)}.waves-effect.waves-teal .waves-ripple{background-color:rgba(0,150,136,0.7)}.waves-effect input[type="button"],.waves-effect input[type="reset"],.waves-effect input[type="submit"]{border:0;font-style:normal;font-size:inherit;text-transform:inherit;background:none}.waves-effect img{position:relative;z-index:-1}.waves-notransition{-webkit-transition:none !important;transition:none !important}.waves-circle{-webkit-transform:translateZ(0);transform:translateZ(0);-webkit-mask-image:-webkit-radial-gradient(circle, white 100%, black 100%)}.waves-input-wrapper{border-radius:0.2em;vertical-align:bottom}.waves-input-wrapper .waves-button-input{position:relative;top:0;left:0;z-index:1}.waves-circle{text-align:center;width:2.5em;height:2.5em;line-height:2.5em;border-radius:50%;-webkit-mask-image:none}.waves-block{display:block}.waves-effect .waves-ripple{z-index:-1}.modal{display:none;position:fixed;left:0;right:0;background-color:#fafafa;padding:0;max-height:70%;width:55%;margin:auto;overflow-y:auto;border-radius:2px;will-change:top, opacity}@media only screen and (max-width: 992px){.modal{width:80%}}.modal h1,.modal h2,.modal h3,.modal h4{margin-top:0}.modal .modal-content{padding:24px}.modal .modal-close{cursor:pointer}.modal .modal-footer{border-radius:0 0 2px 2px;background-color:#fafafa;padding:4px 6px;height:56px;width:100%;text-align:right}.modal .modal-footer .btn,.modal .modal-footer .btn-large,.modal .modal-footer .btn-flat{margin:6px 0}.modal-overlay{position:fixed;z-index:999;top:-25%;left:0;bottom:0;right:0;height:125%;width:100%;background:#000;display:none;will-change:opacity}.modal.modal-fixed-footer{padding:0;height:70%}.modal.modal-fixed-footer .modal-content{position:absolute;height:calc(100% - 56px);max-height:100%;width:100%;overflow-y:auto}.modal.modal-fixed-footer .modal-footer{border-top:1px solid rgba(0,0,0,0.1);position:absolute;bottom:0}.modal.bottom-sheet{top:auto;bottom:-100%;margin:0;width:100%;max-height:45%;border-radius:0;will-change:bottom, opacity}.collapsible{border-top:1px solid #ddd;border-right:1px solid #ddd;border-left:1px solid #ddd;margin:.5rem 0 1rem 0}.collapsible-header{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;cursor:pointer;-webkit-tap-highlight-color:transparent;line-height:1.5;padding:1rem;background-color:#fff;border-bottom:1px solid #ddd}.collapsible-header i{width:2rem;font-size:1.6rem;display:inline-block;text-align:center;margin-right:1rem}.collapsible-body{display:none;border-bottom:1px solid #ddd;-webkit-box-sizing:border-box;box-sizing:border-box;padding:2rem}.side-nav .collapsible,.side-nav.fixed .collapsible{border:none;-webkit-box-shadow:none;box-shadow:none}.side-nav .collapsible li,.side-nav.fixed .collapsible li{padding:0}.side-nav .collapsible-header,.side-nav.fixed .collapsible-header{background-color:transparent;border:none;line-height:inherit;height:inherit;padding:0 16px}.side-nav .collapsible-header:hover,.side-nav.fixed .collapsible-header:hover{background-color:rgba(0,0,0,0.05)}.side-nav .collapsible-header i,.side-nav.fixed .collapsible-header i{line-height:inherit}.side-nav .collapsible-body,.side-nav.fixed .collapsible-body{border:0;background-color:#fff}.side-nav .collapsible-body li a,.side-nav.fixed .collapsible-body li a{padding:0 23.5px 0 31px}.collapsible.popout{border:none;-webkit-box-shadow:none;box-shadow:none}.collapsible.popout>li{-webkit-box-shadow:0 2px 5px 0 rgba(0,0,0,0.16),0 2px 10px 0 rgba(0,0,0,0.12);box-shadow:0 2px 5px 0 rgba(0,0,0,0.16),0 2px 10px 0 rgba(0,0,0,0.12);margin:0 24px;-webkit-transition:margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94);transition:margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94)}.collapsible.popout>li.active{-webkit-box-shadow:0 5px 11px 0 rgba(0,0,0,0.18),0 4px 15px 0 rgba(0,0,0,0.15);box-shadow:0 5px 11px 0 rgba(0,0,0,0.18),0 4px 15px 0 rgba(0,0,0,0.15);margin:16px 0}.chip{display:inline-block;height:32px;font-size:13px;font-weight:500;color:rgba(0,0,0,0.6);line-height:32px;padding:0 12px;border-radius:16px;background-color:#e4e4e4;margin-bottom:5px;margin-right:5px}.chip>img{float:left;margin:0 8px 0 -12px;height:32px;width:32px;border-radius:50%}.chip .close{cursor:pointer;float:right;font-size:16px;line-height:32px;padding-left:8px}.chips{border:none;border-bottom:1px solid #9e9e9e;-webkit-box-shadow:none;box-shadow:none;margin:0 0 20px 0;min-height:45px;outline:none;-webkit-transition:all .3s;transition:all .3s}.chips.focus{border-bottom:1px solid #26a69a;-webkit-box-shadow:0 1px 0 0 #26a69a;box-shadow:0 1px 0 0 #26a69a}.chips:hover{cursor:text}.chips .chip.selected{background-color:#26a69a;color:#fff}.chips .input{background:none;border:0;color:rgba(0,0,0,0.6);display:inline-block;font-size:1rem;height:3rem;line-height:32px;outline:0;margin:0;padding:0 !important;width:120px !important}.chips .input:focus{border:0 !important;-webkit-box-shadow:none !important;box-shadow:none !important}.chips .autocomplete-content{margin-top:0;margin-bottom:0}.prefix ~ .chips{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.chips:empty ~ label{font-size:0.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.materialboxed{display:block;cursor:-webkit-zoom-in;cursor:zoom-in;position:relative;-webkit-transition:opacity .4s;transition:opacity .4s;-webkit-backface-visibility:hidden}.materialboxed:hover:not(.active){opacity:.8}.materialboxed.active{cursor:-webkit-zoom-out;cursor:zoom-out}#materialbox-overlay{position:fixed;top:0;right:0;bottom:0;left:0;background-color:#292929;z-index:1000;will-change:opacity}.materialbox-caption{position:fixed;display:none;color:#fff;line-height:50px;bottom:0;left:0;width:100%;text-align:center;padding:0% 15%;height:50px;z-index:1000;-webkit-font-smoothing:antialiased}select:focus{outline:1px solid #c9f3ef}button:focus{outline:none;background-color:#2ab7a9}label{font-size:.8rem;color:#9e9e9e}::-webkit-input-placeholder{color:#d1d1d1}::-moz-placeholder{color:#d1d1d1}:-ms-input-placeholder{color:#d1d1d1}::placeholder{color:#d1d1d1}input:not([type]),input[type=text]:not(.browser-default),input[type=password]:not(.browser-default),input[type=email]:not(.browser-default),input[type=url]:not(.browser-default),input[type=time]:not(.browser-default),input[type=date]:not(.browser-default),input[type=datetime]:not(.browser-default),input[type=datetime-local]:not(.browser-default),input[type=tel]:not(.browser-default),input[type=number]:not(.browser-default),input[type=search]:not(.browser-default),textarea.materialize-textarea{background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;border-radius:0;outline:none;height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;-webkit-box-shadow:none;box-shadow:none;-webkit-box-sizing:content-box;box-sizing:content-box;-webkit-transition:all 0.3s;transition:all 0.3s}input:not([type]):disabled,input:not([type])[readonly="readonly"],input[type=text]:not(.browser-default):disabled,input[type=text]:not(.browser-default)[readonly="readonly"],input[type=password]:not(.browser-default):disabled,input[type=password]:not(.browser-default)[readonly="readonly"],input[type=email]:not(.browser-default):disabled,input[type=email]:not(.browser-default)[readonly="readonly"],input[type=url]:not(.browser-default):disabled,input[type=url]:not(.browser-default)[readonly="readonly"],input[type=time]:not(.browser-default):disabled,input[type=time]:not(.browser-default)[readonly="readonly"],input[type=date]:not(.browser-default):disabled,input[type=date]:not(.browser-default)[readonly="readonly"],input[type=datetime]:not(.browser-default):disabled,input[type=datetime]:not(.browser-default)[readonly="readonly"],input[type=datetime-local]:not(.browser-default):disabled,input[type=datetime-local]:not(.browser-default)[readonly="readonly"],input[type=tel]:not(.browser-default):disabled,input[type=tel]:not(.browser-default)[readonly="readonly"],input[type=number]:not(.browser-default):disabled,input[type=number]:not(.browser-default)[readonly="readonly"],input[type=search]:not(.browser-default):disabled,input[type=search]:not(.browser-default)[readonly="readonly"],textarea.materialize-textarea:disabled,textarea.materialize-textarea[readonly="readonly"]{color:rgba(0,0,0,0.42);border-bottom:1px dotted rgba(0,0,0,0.42)}input:not([type]):disabled+label,input:not([type])[readonly="readonly"]+label,input[type=text]:not(.browser-default):disabled+label,input[type=text]:not(.browser-default)[readonly="readonly"]+label,input[type=password]:not(.browser-default):disabled+label,input[type=password]:not(.browser-default)[readonly="readonly"]+label,input[type=email]:not(.browser-default):disabled+label,input[type=email]:not(.browser-default)[readonly="readonly"]+label,input[type=url]:not(.browser-default):disabled+label,input[type=url]:not(.browser-default)[readonly="readonly"]+label,input[type=time]:not(.browser-default):disabled+label,input[type=time]:not(.browser-default)[readonly="readonly"]+label,input[type=date]:not(.browser-default):disabled+label,input[type=date]:not(.browser-default)[readonly="readonly"]+label,input[type=datetime]:not(.browser-default):disabled+label,input[type=datetime]:not(.browser-default)[readonly="readonly"]+label,input[type=datetime-local]:not(.browser-default):disabled+label,input[type=datetime-local]:not(.browser-default)[readonly="readonly"]+label,input[type=tel]:not(.browser-default):disabled+label,input[type=tel]:not(.browser-default)[readonly="readonly"]+label,input[type=number]:not(.browser-default):disabled+label,input[type=number]:not(.browser-default)[readonly="readonly"]+label,input[type=search]:not(.browser-default):disabled+label,input[type=search]:not(.browser-default)[readonly="readonly"]+label,textarea.materialize-textarea:disabled+label,textarea.materialize-textarea[readonly="readonly"]+label{color:rgba(0,0,0,0.42)}input:not([type]):focus:not([readonly]),input[type=text]:not(.browser-default):focus:not([readonly]),input[type=password]:not(.browser-default):focus:not([readonly]),input[type=email]:not(.browser-default):focus:not([readonly]),input[type=url]:not(.browser-default):focus:not([readonly]),input[type=time]:not(.browser-default):focus:not([readonly]),input[type=date]:not(.browser-default):focus:not([readonly]),input[type=datetime]:not(.browser-default):focus:not([readonly]),input[type=datetime-local]:not(.browser-default):focus:not([readonly]),input[type=tel]:not(.browser-default):focus:not([readonly]),input[type=number]:not(.browser-default):focus:not([readonly]),input[type=search]:not(.browser-default):focus:not([readonly]),textarea.materialize-textarea:focus:not([readonly]){border-bottom:1px solid #26a69a;-webkit-box-shadow:0 1px 0 0 #26a69a;box-shadow:0 1px 0 0 #26a69a}input:not([type]):focus:not([readonly])+label,input[type=text]:not(.browser-default):focus:not([readonly])+label,input[type=password]:not(.browser-default):focus:not([readonly])+label,input[type=email]:not(.browser-default):focus:not([readonly])+label,input[type=url]:not(.browser-default):focus:not([readonly])+label,input[type=time]:not(.browser-default):focus:not([readonly])+label,input[type=date]:not(.browser-default):focus:not([readonly])+label,input[type=datetime]:not(.browser-default):focus:not([readonly])+label,input[type=datetime-local]:not(.browser-default):focus:not([readonly])+label,input[type=tel]:not(.browser-default):focus:not([readonly])+label,input[type=number]:not(.browser-default):focus:not([readonly])+label,input[type=search]:not(.browser-default):focus:not([readonly])+label,textarea.materialize-textarea:focus:not([readonly])+label{color:#26a69a}input:not([type]).validate+label,input[type=text]:not(.browser-default).validate+label,input[type=password]:not(.browser-default).validate+label,input[type=email]:not(.browser-default).validate+label,input[type=url]:not(.browser-default).validate+label,input[type=time]:not(.browser-default).validate+label,input[type=date]:not(.browser-default).validate+label,input[type=datetime]:not(.browser-default).validate+label,input[type=datetime-local]:not(.browser-default).validate+label,input[type=tel]:not(.browser-default).validate+label,input[type=number]:not(.browser-default).validate+label,input[type=search]:not(.browser-default).validate+label,textarea.materialize-textarea.validate+label{width:100%}input:not([type]).invalid+label:after,input:not([type]).valid+label:after,input[type=text]:not(.browser-default).invalid+label:after,input[type=text]:not(.browser-default).valid+label:after,input[type=password]:not(.browser-default).invalid+label:after,input[type=password]:not(.browser-default).valid+label:after,input[type=email]:not(.browser-default).invalid+label:after,input[type=email]:not(.browser-default).valid+label:after,input[type=url]:not(.browser-default).invalid+label:after,input[type=url]:not(.browser-default).valid+label:after,input[type=time]:not(.browser-default).invalid+label:after,input[type=time]:not(.browser-default).valid+label:after,input[type=date]:not(.browser-default).invalid+label:after,input[type=date]:not(.browser-default).valid+label:after,input[type=datetime]:not(.browser-default).invalid+label:after,input[type=datetime]:not(.browser-default).valid+label:after,input[type=datetime-local]:not(.browser-default).invalid+label:after,input[type=datetime-local]:not(.browser-default).valid+label:after,input[type=tel]:not(.browser-default).invalid+label:after,input[type=tel]:not(.browser-default).valid+label:after,input[type=number]:not(.browser-default).invalid+label:after,input[type=number]:not(.browser-default).valid+label:after,input[type=search]:not(.browser-default).invalid+label:after,input[type=search]:not(.browser-default).valid+label:after,textarea.materialize-textarea.invalid+label:after,textarea.materialize-textarea.valid+label:after{display:none}input:not([type]).invalid+label.active:after,input:not([type]).valid+label.active:after,input[type=text]:not(.browser-default).invalid+label.active:after,input[type=text]:not(.browser-default).valid+label.active:after,input[type=password]:not(.browser-default).invalid+label.active:after,input[type=password]:not(.browser-default).valid+label.active:after,input[type=email]:not(.browser-default).invalid+label.active:after,input[type=email]:not(.browser-default).valid+label.active:after,input[type=url]:not(.browser-default).invalid+label.active:after,input[type=url]:not(.browser-default).valid+label.active:after,input[type=time]:not(.browser-default).invalid+label.active:after,input[type=time]:not(.browser-default).valid+label.active:after,input[type=date]:not(.browser-default).invalid+label.active:after,input[type=date]:not(.browser-default).valid+label.active:after,input[type=datetime]:not(.browser-default).invalid+label.active:after,input[type=datetime]:not(.browser-default).valid+label.active:after,input[type=datetime-local]:not(.browser-default).invalid+label.active:after,input[type=datetime-local]:not(.browser-default).valid+label.active:after,input[type=tel]:not(.browser-default).invalid+label.active:after,input[type=tel]:not(.browser-default).valid+label.active:after,input[type=number]:not(.browser-default).invalid+label.active:after,input[type=number]:not(.browser-default).valid+label.active:after,input[type=search]:not(.browser-default).invalid+label.active:after,input[type=search]:not(.browser-default).valid+label.active:after,textarea.materialize-textarea.invalid+label.active:after,textarea.materialize-textarea.valid+label.active:after{display:block}input.valid:not([type]),input.valid:not([type]):focus,input[type=text].valid:not(.browser-default),input[type=text].valid:not(.browser-default):focus,input[type=password].valid:not(.browser-default),input[type=password].valid:not(.browser-default):focus,input[type=email].valid:not(.browser-default),input[type=email].valid:not(.browser-default):focus,input[type=url].valid:not(.browser-default),input[type=url].valid:not(.browser-default):focus,input[type=time].valid:not(.browser-default),input[type=time].valid:not(.browser-default):focus,input[type=date].valid:not(.browser-default),input[type=date].valid:not(.browser-default):focus,input[type=datetime].valid:not(.browser-default),input[type=datetime].valid:not(.browser-default):focus,input[type=datetime-local].valid:not(.browser-default),input[type=datetime-local].valid:not(.browser-default):focus,input[type=tel].valid:not(.browser-default),input[type=tel].valid:not(.browser-default):focus,input[type=number].valid:not(.browser-default),input[type=number].valid:not(.browser-default):focus,input[type=search].valid:not(.browser-default),input[type=search].valid:not(.browser-default):focus,textarea.materialize-textarea.valid,textarea.materialize-textarea.valid:focus,.select-wrapper.valid>input.select-dropdown{border-bottom:1px solid #4CAF50;-webkit-box-shadow:0 1px 0 0 #4CAF50;box-shadow:0 1px 0 0 #4CAF50}input.invalid:not([type]),input.invalid:not([type]):focus,input[type=text].invalid:not(.browser-default),input[type=text].invalid:not(.browser-default):focus,input[type=password].invalid:not(.browser-default),input[type=password].invalid:not(.browser-default):focus,input[type=email].invalid:not(.browser-default),input[type=email].invalid:not(.browser-default):focus,input[type=url].invalid:not(.browser-default),input[type=url].invalid:not(.browser-default):focus,input[type=time].invalid:not(.browser-default),input[type=time].invalid:not(.browser-default):focus,input[type=date].invalid:not(.browser-default),input[type=date].invalid:not(.browser-default):focus,input[type=datetime].invalid:not(.browser-default),input[type=datetime].invalid:not(.browser-default):focus,input[type=datetime-local].invalid:not(.browser-default),input[type=datetime-local].invalid:not(.browser-default):focus,input[type=tel].invalid:not(.browser-default),input[type=tel].invalid:not(.browser-default):focus,input[type=number].invalid:not(.browser-default),input[type=number].invalid:not(.browser-default):focus,input[type=search].invalid:not(.browser-default),input[type=search].invalid:not(.browser-default):focus,textarea.materialize-textarea.invalid,textarea.materialize-textarea.invalid:focus,.select-wrapper.invalid>input.select-dropdown{border-bottom:1px solid #F44336;-webkit-box-shadow:0 1px 0 0 #F44336;box-shadow:0 1px 0 0 #F44336}input:not([type]).valid+label:after,input:not([type]):focus.valid+label:after,input[type=text]:not(.browser-default).valid+label:after,input[type=text]:not(.browser-default):focus.valid+label:after,input[type=password]:not(.browser-default).valid+label:after,input[type=password]:not(.browser-default):focus.valid+label:after,input[type=email]:not(.browser-default).valid+label:after,input[type=email]:not(.browser-default):focus.valid+label:after,input[type=url]:not(.browser-default).valid+label:after,input[type=url]:not(.browser-default):focus.valid+label:after,input[type=time]:not(.browser-default).valid+label:after,input[type=time]:not(.browser-default):focus.valid+label:after,input[type=date]:not(.browser-default).valid+label:after,input[type=date]:not(.browser-default):focus.valid+label:after,input[type=datetime]:not(.browser-default).valid+label:after,input[type=datetime]:not(.browser-default):focus.valid+label:after,input[type=datetime-local]:not(.browser-default).valid+label:after,input[type=datetime-local]:not(.browser-default):focus.valid+label:after,input[type=tel]:not(.browser-default).valid+label:after,input[type=tel]:not(.browser-default):focus.valid+label:after,input[type=number]:not(.browser-default).valid+label:after,input[type=number]:not(.browser-default):focus.valid+label:after,input[type=search]:not(.browser-default).valid+label:after,input[type=search]:not(.browser-default):focus.valid+label:after,textarea.materialize-textarea.valid+label:after,textarea.materialize-textarea:focus.valid+label:after,.select-wrapper.valid+label:after{content:attr(data-success);color:#4CAF50;opacity:1;-webkit-transform:translateY(9px);transform:translateY(9px)}input:not([type]).invalid+label:after,input:not([type]):focus.invalid+label:after,input[type=text]:not(.browser-default).invalid+label:after,input[type=text]:not(.browser-default):focus.invalid+label:after,input[type=password]:not(.browser-default).invalid+label:after,input[type=password]:not(.browser-default):focus.invalid+label:after,input[type=email]:not(.browser-default).invalid+label:after,input[type=email]:not(.browser-default):focus.invalid+label:after,input[type=url]:not(.browser-default).invalid+label:after,input[type=url]:not(.browser-default):focus.invalid+label:after,input[type=time]:not(.browser-default).invalid+label:after,input[type=time]:not(.browser-default):focus.invalid+label:after,input[type=date]:not(.browser-default).invalid+label:after,input[type=date]:not(.browser-default):focus.invalid+label:after,input[type=datetime]:not(.browser-default).invalid+label:after,input[type=datetime]:not(.browser-default):focus.invalid+label:after,input[type=datetime-local]:not(.browser-default).invalid+label:after,input[type=datetime-local]:not(.browser-default):focus.invalid+label:after,input[type=tel]:not(.browser-default).invalid+label:after,input[type=tel]:not(.browser-default):focus.invalid+label:after,input[type=number]:not(.browser-default).invalid+label:after,input[type=number]:not(.browser-default):focus.invalid+label:after,input[type=search]:not(.browser-default).invalid+label:after,input[type=search]:not(.browser-default):focus.invalid+label:after,textarea.materialize-textarea.invalid+label:after,textarea.materialize-textarea:focus.invalid+label:after,.select-wrapper.invalid+label:after{content:attr(data-error);color:#F44336;opacity:1;-webkit-transform:translateY(9px);transform:translateY(9px)}input:not([type])+label:after,input[type=text]:not(.browser-default)+label:after,input[type=password]:not(.browser-default)+label:after,input[type=email]:not(.browser-default)+label:after,input[type=url]:not(.browser-default)+label:after,input[type=time]:not(.browser-default)+label:after,input[type=date]:not(.browser-default)+label:after,input[type=datetime]:not(.browser-default)+label:after,input[type=datetime-local]:not(.browser-default)+label:after,input[type=tel]:not(.browser-default)+label:after,input[type=number]:not(.browser-default)+label:after,input[type=search]:not(.browser-default)+label:after,textarea.materialize-textarea+label:after,.select-wrapper+label:after{display:block;content:"";position:absolute;top:100%;left:0;opacity:0;-webkit-transition:.2s opacity ease-out, .2s color ease-out;transition:.2s opacity ease-out, .2s color ease-out}.input-field{position:relative;margin-top:1rem}.input-field.inline{display:inline-block;vertical-align:middle;margin-left:5px}.input-field.inline input,.input-field.inline .select-dropdown{margin-bottom:1rem}.input-field.col label{left:.75rem}.input-field.col .prefix ~ label,.input-field.col .prefix ~ .validate ~ label{width:calc(100% - 3rem - 1.5rem)}.input-field label{color:#9e9e9e;position:absolute;top:0;left:0;height:100%;font-size:1rem;cursor:text;-webkit-transition:-webkit-transform .2s ease-out;transition:-webkit-transform .2s ease-out;transition:transform .2s ease-out;transition:transform .2s ease-out, -webkit-transform .2s ease-out;-webkit-transform-origin:0% 100%;transform-origin:0% 100%;text-align:initial;-webkit-transform:translateY(12px);transform:translateY(12px);pointer-events:none}.input-field label:not(.label-icon).active{-webkit-transform:translateY(-14px) scale(0.8);transform:translateY(-14px) scale(0.8);-webkit-transform-origin:0 0;transform-origin:0 0}.input-field .prefix{position:absolute;width:3rem;font-size:2rem;-webkit-transition:color .2s;transition:color .2s}.input-field .prefix.active{color:#26a69a}.input-field .prefix ~ input,.input-field .prefix ~ textarea,.input-field .prefix ~ label,.input-field .prefix ~ .validate ~ label,.input-field .prefix ~ .autocomplete-content{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.input-field .prefix ~ label{margin-left:3rem}@media only screen and (max-width: 992px){.input-field .prefix ~ input{width:86%;width:calc(100% - 3rem)}}@media only screen and (max-width: 600px){.input-field .prefix ~ input{width:80%;width:calc(100% - 3rem)}}.input-field input[type=search]{display:block;line-height:inherit}.nav-wrapper .input-field input[type=search]{height:inherit;padding-left:4rem;width:calc(100% - 4rem);border:0;-webkit-box-shadow:none;box-shadow:none}.input-field input[type=search]:focus{background-color:#fff;border:0;-webkit-box-shadow:none;box-shadow:none;color:#444}.input-field input[type=search]:focus+label i,.input-field input[type=search]:focus ~ .mdi-navigation-close,.input-field input[type=search]:focus ~ .material-icons{color:#444}.input-field input[type=search]+label{left:1rem}.input-field input[type=search] ~ .mdi-navigation-close,.input-field input[type=search] ~ .material-icons{position:absolute;top:0;right:1rem;color:transparent;cursor:pointer;font-size:2rem;-webkit-transition:.3s color;transition:.3s color}textarea{width:100%;height:3rem;background-color:transparent}textarea.materialize-textarea{overflow-y:hidden;padding:.8rem 0 1.6rem 0;resize:none;min-height:3rem}textarea.materialize-textarea.validate+label{height:100%}textarea.materialize-textarea.validate+label::after{top:calc(100% - 12px)}textarea.materialize-textarea.validate+label:not(.label-icon).active{-webkit-transform:translateY(-25px);transform:translateY(-25px)}.hiddendiv{display:none;white-space:pre-wrap;word-wrap:break-word;overflow-wrap:break-word;padding-top:1.2rem;position:absolute;top:0}.autocomplete-content{margin-top:-20px;margin-bottom:20px;display:block;opacity:1;position:static}.autocomplete-content li .highlight{color:#444}.autocomplete-content li img{height:40px;width:40px;margin:5px 15px}[type="radio"]:not(:checked),[type="radio"]:checked{position:absolute;opacity:0;pointer-events:none}[type="radio"]:not(:checked)+label,[type="radio"]:checked+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;-webkit-transition:.28s ease;transition:.28s ease;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}[type="radio"]+label:before,[type="radio"]+label:after{content:'';position:absolute;left:0;top:0;margin:4px;width:16px;height:16px;z-index:0;-webkit-transition:.28s ease;transition:.28s ease}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after,[type="radio"]:checked+label:before,[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border-radius:50%}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after{border:2px solid #5a5a5a}[type="radio"]:not(:checked)+label:after{-webkit-transform:scale(0);transform:scale(0)}[type="radio"]:checked+label:before{border:2px solid transparent}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border:2px solid #26a69a}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:after{background-color:#26a69a}[type="radio"]:checked+label:after{-webkit-transform:scale(1.02);transform:scale(1.02)}[type="radio"].with-gap:checked+label:after{-webkit-transform:scale(0.5);transform:scale(0.5)}[type="radio"].tabbed:focus+label:before{-webkit-box-shadow:0 0 0 10px rgba(0,0,0,0.1);box-shadow:0 0 0 10px rgba(0,0,0,0.1)}[type="radio"].with-gap:disabled:checked+label:before{border:2px solid rgba(0,0,0,0.42)}[type="radio"].with-gap:disabled:checked+label:after{border:none;background-color:rgba(0,0,0,0.42)}[type="radio"]:disabled:not(:checked)+label:before,[type="radio"]:disabled:checked+label:before{background-color:transparent;border-color:rgba(0,0,0,0.42)}[type="radio"]:disabled+label{color:rgba(0,0,0,0.42)}[type="radio"]:disabled:not(:checked)+label:before{border-color:rgba(0,0,0,0.42)}[type="radio"]:disabled:checked+label:after{background-color:rgba(0,0,0,0.42);border-color:#949494}form p{margin-bottom:10px;text-align:left}form p:last-child{margin-bottom:0}[type="checkbox"]:not(:checked),[type="checkbox"]:checked{position:absolute;opacity:0;pointer-events:none}[type="checkbox"]+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}[type="checkbox"]+label:before,[type="checkbox"]:not(.filled-in)+label:after{content:'';position:absolute;top:0;left:0;width:18px;height:18px;z-index:0;border:2px solid #5a5a5a;border-radius:1px;margin-top:2px;-webkit-transition:.2s;transition:.2s}[type="checkbox"]:not(.filled-in)+label:after{border:0;-webkit-transform:scale(0);transform:scale(0)}[type="checkbox"]:not(:checked):disabled+label:before{border:none;background-color:rgba(0,0,0,0.42)}[type="checkbox"].tabbed:focus+label:after{-webkit-transform:scale(1);transform:scale(1);border:0;border-radius:50%;-webkit-box-shadow:0 0 0 10px rgba(0,0,0,0.1);box-shadow:0 0 0 10px rgba(0,0,0,0.1);background-color:rgba(0,0,0,0.1)}[type="checkbox"]:checked+label:before{top:-4px;left:-5px;width:12px;height:22px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #26a69a;border-bottom:2px solid #26a69a;-webkit-transform:rotate(40deg);transform:rotate(40deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:checked:disabled+label:before{border-right:2px solid rgba(0,0,0,0.42);border-bottom:2px solid rgba(0,0,0,0.42)}[type="checkbox"]:indeterminate+label:before{top:-11px;left:-12px;width:10px;height:22px;border-top:none;border-left:none;border-right:2px solid #26a69a;border-bottom:none;-webkit-transform:rotate(90deg);transform:rotate(90deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:indeterminate:disabled+label:before{border-right:2px solid rgba(0,0,0,0.42);background-color:transparent}[type="checkbox"].filled-in+label:after{border-radius:2px}[type="checkbox"].filled-in+label:before,[type="checkbox"].filled-in+label:after{content:'';left:0;position:absolute;-webkit-transition:border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;transition:border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;z-index:1}[type="checkbox"].filled-in:not(:checked)+label:before{width:0;height:0;border:3px solid transparent;left:6px;top:10px;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"].filled-in:not(:checked)+label:after{height:20px;width:20px;background-color:transparent;border:2px solid #5a5a5a;top:0px;z-index:0}[type="checkbox"].filled-in:checked+label:before{top:0;left:1px;width:8px;height:13px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #fff;border-bottom:2px solid #fff;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"].filled-in:checked+label:after{top:0;width:20px;height:20px;border:2px solid #26a69a;background-color:#26a69a;z-index:0}[type="checkbox"].filled-in.tabbed:focus+label:after{border-radius:2px;border-color:#5a5a5a;background-color:rgba(0,0,0,0.1)}[type="checkbox"].filled-in.tabbed:checked:focus+label:after{border-radius:2px;background-color:#26a69a;border-color:#26a69a}[type="checkbox"].filled-in:disabled:not(:checked)+label:before{background-color:transparent;border:2px solid transparent}[type="checkbox"].filled-in:disabled:not(:checked)+label:after{border-color:transparent;background-color:#949494}[type="checkbox"].filled-in:disabled:checked+label:before{background-color:transparent}[type="checkbox"].filled-in:disabled:checked+label:after{background-color:#949494;border-color:#949494}.switch,.switch *{-webkit-tap-highlight-color:transparent;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.switch label{cursor:pointer}.switch label input[type=checkbox]{opacity:0;width:0;height:0}.switch label input[type=checkbox]:checked+.lever{background-color:#84c7c1}.switch label input[type=checkbox]:checked+.lever:before,.switch label input[type=checkbox]:checked+.lever:after{left:18px}.switch label input[type=checkbox]:checked+.lever:after{background-color:#26a69a}.switch label .lever{content:"";display:inline-block;position:relative;width:36px;height:14px;background-color:rgba(0,0,0,0.38);border-radius:15px;margin-right:10px;-webkit-transition:background 0.3s ease;transition:background 0.3s ease;vertical-align:middle;margin:0 16px}.switch label .lever:before,.switch label .lever:after{content:"";position:absolute;display:inline-block;width:20px;height:20px;border-radius:50%;left:0;top:-3px;-webkit-transition:left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;transition:left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;transition:left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease;transition:left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease}.switch label .lever:before{background-color:rgba(38,166,154,0.15)}.switch label .lever:after{background-color:#F1F1F1;-webkit-box-shadow:0px 3px 1px -2px rgba(0,0,0,0.2),0px 2px 2px 0px rgba(0,0,0,0.14),0px 1px 5px 0px rgba(0,0,0,0.12);box-shadow:0px 3px 1px -2px rgba(0,0,0,0.2),0px 2px 2px 0px rgba(0,0,0,0.14),0px 1px 5px 0px rgba(0,0,0,0.12)}input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before,input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before{-webkit-transform:scale(2.4);transform:scale(2.4);background-color:rgba(38,166,154,0.15)}input[type=checkbox]:not(:disabled) ~ .lever:active:before,input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before{-webkit-transform:scale(2.4);transform:scale(2.4);background-color:rgba(0,0,0,0.08)}.switch input[type=checkbox][disabled]+.lever{cursor:default;background-color:rgba(0,0,0,0.12)}.switch label input[type=checkbox][disabled]+.lever:after,.switch label input[type=checkbox][disabled]:checked+.lever:after{background-color:#949494}select{display:none}select.browser-default{display:block}select{background-color:rgba(255,255,255,0.9);width:100%;padding:5px;border:1px solid #f2f2f2;border-radius:2px;height:3rem}.input-field>select{display:block;position:absolute;width:0;pointer-events:none;height:0;top:0;left:0;opacity:0}.select-label{position:absolute}.select-wrapper{position:relative}.select-wrapper.valid+label,.select-wrapper.invalid+label{width:100%;pointer-events:none}.select-wrapper input.select-dropdown{position:relative;cursor:pointer;background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;outline:none;height:3rem;line-height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;display:block;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.select-wrapper span.caret{color:initial;position:absolute;right:0;top:0;bottom:0;height:10px;margin:auto 0;font-size:10px;line-height:10px}.select-wrapper+label{position:absolute;top:-26px;font-size:.8rem}select:disabled{color:rgba(0,0,0,0.42)}.select-wrapper.disabled span.caret,.select-wrapper.disabled+label{color:rgba(0,0,0,0.42)}.select-wrapper input.select-dropdown:disabled{color:rgba(0,0,0,0.42);cursor:default;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.select-wrapper i{color:rgba(0,0,0,0.3)}.select-dropdown li.disabled,.select-dropdown li.disabled>span,.select-dropdown li.optgroup{color:rgba(0,0,0,0.3);background-color:transparent}.select-dropdown.dropdown-content li.active{background-color:transparent}.select-dropdown.dropdown-content li:hover{background-color:rgba(0,0,0,0.06)}.select-dropdown.dropdown-content li.selected{background-color:rgba(0,0,0,0.03)}.prefix ~ .select-wrapper{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.prefix ~ label{margin-left:3rem}.select-dropdown li img{height:40px;width:40px;margin:5px 15px;float:right}.select-dropdown li.optgroup{border-top:1px solid #eee}.select-dropdown li.optgroup.selected>span{color:rgba(0,0,0,0.7)}.select-dropdown li.optgroup>span{color:rgba(0,0,0,0.4)}.select-dropdown li.optgroup ~ li.optgroup-option{padding-left:1rem}.file-field{position:relative}.file-field .file-path-wrapper{overflow:hidden;padding-left:10px}.file-field input.file-path{width:100%}.file-field .btn,.file-field .btn-large{float:left;height:3rem;line-height:3rem}.file-field span{cursor:pointer}.file-field input[type=file]{position:absolute;top:0;right:0;left:0;bottom:0;width:100%;margin:0;padding:0;font-size:20px;cursor:pointer;opacity:0;filter:alpha(opacity=0)}.file-field input[type=file]::-webkit-file-upload-button{display:none}.range-field{position:relative}input[type=range],input[type=range]+.thumb{cursor:pointer}input[type=range]{position:relative;background-color:transparent;border:none;outline:none;width:100%;margin:15px 0;padding:0}input[type=range]:focus{outline:none}input[type=range]+.thumb{position:absolute;top:10px;left:0;border:none;height:0;width:0;border-radius:50%;background-color:#26a69a;margin-left:7px;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;-webkit-transform:rotate(-45deg);transform:rotate(-45deg)}input[type=range]+.thumb .value{display:block;width:30px;text-align:center;color:#26a69a;font-size:0;-webkit-transform:rotate(45deg);transform:rotate(45deg)}input[type=range]+.thumb.active{border-radius:50% 50% 50% 0}input[type=range]+.thumb.active .value{color:#fff;margin-left:-1px;margin-top:8px;font-size:10px}input[type=range]{-webkit-appearance:none}input[type=range]::-webkit-slider-runnable-track{height:3px;background:#c2c0c2;border:none}input[type=range]::-webkit-slider-thumb{-webkit-appearance:none;border:none;height:14px;width:14px;border-radius:50%;background-color:#26a69a;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;margin:-5px 0 0 0;-webkit-transition:.3s;transition:.3s}input[type=range]:focus::-webkit-slider-runnable-track{background:#ccc}input[type=range]{border:1px solid white}input[type=range]::-moz-range-track{height:3px;background:#ddd;border:none}input[type=range]::-moz-range-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a;margin-top:-5px}input[type=range]:-moz-focusring{outline:1px solid #fff;outline-offset:-1px}input[type=range]:focus::-moz-range-track{background:#ccc}input[type=range]::-ms-track{height:3px;background:transparent;border-color:transparent;border-width:6px 0;color:transparent}input[type=range]::-ms-fill-lower{background:#777}input[type=range]::-ms-fill-upper{background:#ddd}input[type=range]::-ms-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a}input[type=range]:focus::-ms-fill-lower{background:#888}input[type=range]:focus::-ms-fill-upper{background:#ccc}.table-of-contents.fixed{position:fixed}.table-of-contents li{padding:2px 0}.table-of-contents a{display:inline-block;font-weight:300;color:#757575;padding-left:20px;height:1.5rem;line-height:1.5rem;letter-spacing:.4;display:inline-block}.table-of-contents a:hover{color:#a8a8a8;padding-left:19px;border-left:1px solid #ee6e73}.table-of-contents a.active{font-weight:500;padding-left:18px;border-left:2px solid #ee6e73}.side-nav{position:fixed;width:300px;left:0;top:0;margin:0;-webkit-transform:translateX(-100%);transform:translateX(-100%);height:100%;height:calc(100% + 60px);height:-moz-calc(100%);padding-bottom:60px;background-color:#fff;z-index:999;overflow-y:auto;will-change:transform;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.right-aligned{right:0;-webkit-transform:translateX(105%);transform:translateX(105%);left:auto;-webkit-transform:translateX(100%);transform:translateX(100%)}.side-nav .collapsible{margin:0}.side-nav li{float:none;line-height:48px}.side-nav li.active{background-color:rgba(0,0,0,0.05)}.side-nav li>a{color:rgba(0,0,0,0.87);display:block;font-size:14px;font-weight:500;height:48px;line-height:48px;padding:0 32px}.side-nav li>a:hover{background-color:rgba(0,0,0,0.05)}.side-nav li>a.btn,.side-nav li>a.btn-large,.side-nav li>a.btn-large,.side-nav li>a.btn-flat,.side-nav li>a.btn-floating{margin:10px 15px}.side-nav li>a.btn,.side-nav li>a.btn-large,.side-nav li>a.btn-large,.side-nav li>a.btn-floating{color:#fff}.side-nav li>a.btn-flat{color:#343434}.side-nav li>a.btn:hover,.side-nav li>a.btn-large:hover,.side-nav li>a.btn-large:hover{background-color:#2bbbad}.side-nav li>a.btn-floating:hover{background-color:#26a69a}.side-nav li>a>i,.side-nav li>a>[class^="mdi-"],.side-nav li>a li>a>[class*="mdi-"],.side-nav li>a>i.material-icons{float:left;height:48px;line-height:48px;margin:0 32px 0 0;width:24px;color:rgba(0,0,0,0.54)}.side-nav .divider{margin:8px 0 0 0}.side-nav .subheader{cursor:initial;pointer-events:none;color:rgba(0,0,0,0.54);font-size:14px;font-weight:500;line-height:48px}.side-nav .subheader:hover{background-color:transparent}.side-nav .user-view,.side-nav .userView{position:relative;padding:32px 32px 0;margin-bottom:8px}.side-nav .user-view>a,.side-nav .userView>a{height:auto;padding:0}.side-nav .user-view>a:hover,.side-nav .userView>a:hover{background-color:transparent}.side-nav .user-view .background,.side-nav .userView .background{overflow:hidden;position:absolute;top:0;right:0;bottom:0;left:0;z-index:-1}.side-nav .user-view .circle,.side-nav .user-view .name,.side-nav .user-view .email,.side-nav .userView .circle,.side-nav .userView .name,.side-nav .userView .email{display:block}.side-nav .user-view .circle,.side-nav .userView .circle{height:64px;width:64px}.side-nav .user-view .name,.side-nav .user-view .email,.side-nav .userView .name,.side-nav .userView .email{font-size:14px;line-height:24px}.side-nav .user-view .name,.side-nav .userView .name{margin-top:16px;font-weight:500}.side-nav .user-view .email,.side-nav .userView .email{padding-bottom:16px;font-weight:400}.drag-target{height:100%;width:10px;position:fixed;top:0;z-index:998}.side-nav.fixed{left:0;-webkit-transform:translateX(0);transform:translateX(0);position:fixed}.side-nav.fixed.right-aligned{right:0;left:auto}@media only screen and (max-width: 992px){.side-nav.fixed{-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.fixed.right-aligned{-webkit-transform:translateX(105%);transform:translateX(105%)}.side-nav a{padding:0 16px}.side-nav .user-view,.side-nav .userView{padding:16px 16px 0}}.side-nav .collapsible-body>ul:not(.collapsible)>li.active,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active{background-color:#ee6e73}.side-nav .collapsible-body>ul:not(.collapsible)>li.active a,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active a{color:#fff}.side-nav .collapsible-body{padding:0}#sidenav-overlay{position:fixed;top:0;left:0;right:0;height:120vh;background-color:rgba(0,0,0,0.5);z-index:997;will-change:opacity}.preloader-wrapper{display:inline-block;position:relative;width:50px;height:50px}.preloader-wrapper.small{width:36px;height:36px}.preloader-wrapper.big{width:64px;height:64px}.preloader-wrapper.active{-webkit-animation:container-rotate 1568ms linear infinite;animation:container-rotate 1568ms linear infinite}@-webkit-keyframes container-rotate{to{-webkit-transform:rotate(360deg)}}@keyframes container-rotate{to{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}.spinner-layer{position:absolute;width:100%;height:100%;opacity:0;border-color:#26a69a}.spinner-blue,.spinner-blue-only{border-color:#4285f4}.spinner-red,.spinner-red-only{border-color:#db4437}.spinner-yellow,.spinner-yellow-only{border-color:#f4b400}.spinner-green,.spinner-green-only{border-color:#0f9d58}.active .spinner-layer.spinner-blue{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-red{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-yellow{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-green{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer,.active .spinner-layer.spinner-blue-only,.active .spinner-layer.spinner-red-only,.active .spinner-layer.spinner-yellow-only,.active .spinner-layer.spinner-green-only{opacity:1;-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg)}}@keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg);transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg);transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg);transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg);transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg);transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg);transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg);transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg);transform:rotate(1080deg)}}@-webkit-keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@-webkit-keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@-webkit-keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@-webkit-keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}@keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}.gap-patch{position:absolute;top:0;left:45%;width:10%;height:100%;overflow:hidden;border-color:inherit}.gap-patch .circle{width:1000%;left:-450%}.circle-clipper{display:inline-block;position:relative;width:50%;height:100%;overflow:hidden;border-color:inherit}.circle-clipper .circle{width:200%;height:100%;border-width:3px;border-style:solid;border-color:inherit;border-bottom-color:transparent !important;border-radius:50%;-webkit-animation:none;animation:none;position:absolute;top:0;right:0;bottom:0}.circle-clipper.left .circle{left:0;border-right-color:transparent !important;-webkit-transform:rotate(129deg);transform:rotate(129deg)}.circle-clipper.right .circle{left:-100%;border-left-color:transparent !important;-webkit-transform:rotate(-129deg);transform:rotate(-129deg)}.active .circle-clipper.left .circle{-webkit-animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .circle-clipper.right .circle{-webkit-animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes left-spin{from{-webkit-transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg)}}@keyframes left-spin{from{-webkit-transform:rotate(130deg);transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg);transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg);transform:rotate(130deg)}}@-webkit-keyframes right-spin{from{-webkit-transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg)}}@keyframes right-spin{from{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg);transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}}#spinnerContainer.cooldown{-webkit-animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1)}@-webkit-keyframes fade-out{from{opacity:1}to{opacity:0}}@keyframes fade-out{from{opacity:1}to{opacity:0}}.slider{position:relative;height:400px;width:100%}.slider.fullscreen{height:100%;width:100%;position:absolute;top:0;left:0;right:0;bottom:0}.slider.fullscreen ul.slides{height:100%}.slider.fullscreen ul.indicators{z-index:2;bottom:30px}.slider .slides{background-color:#9e9e9e;margin:0;height:400px}.slider .slides li{opacity:0;position:absolute;top:0;left:0;z-index:1;width:100%;height:inherit;overflow:hidden}.slider .slides li img{height:100%;width:100%;background-size:cover;background-position:center}.slider .slides li .caption{color:#fff;position:absolute;top:15%;left:15%;width:70%;opacity:0}.slider .slides li .caption p{color:#e0e0e0}.slider .slides li.active{z-index:2}.slider .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.slider .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:16px;width:16px;margin:0 12px;background-color:#e0e0e0;-webkit-transition:background-color .3s;transition:background-color .3s;border-radius:50%}.slider .indicators .indicator-item.active{background-color:#4CAF50}.carousel{overflow:hidden;position:relative;width:100%;height:400px;-webkit-perspective:500px;perspective:500px;-webkit-transform-style:preserve-3d;transform-style:preserve-3d;-webkit-transform-origin:0% 50%;transform-origin:0% 50%}.carousel.carousel-slider{top:0;left:0}.carousel.carousel-slider .carousel-fixed-item{position:absolute;left:0;right:0;bottom:20px;z-index:1}.carousel.carousel-slider .carousel-fixed-item.with-indicators{bottom:68px}.carousel.carousel-slider .carousel-item{width:100%;height:100%;min-height:400px;position:absolute;top:0;left:0}.carousel.carousel-slider .carousel-item h2{font-size:24px;font-weight:500;line-height:32px}.carousel.carousel-slider .carousel-item p{font-size:15px}.carousel .carousel-item{display:none;width:200px;height:200px;position:absolute;top:0;left:0}.carousel .carousel-item>img{width:100%}.carousel .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.carousel .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:8px;width:8px;margin:24px 4px;background-color:rgba(255,255,255,0.5);-webkit-transition:background-color .3s;transition:background-color .3s;border-radius:50%}.carousel .indicators .indicator-item.active{background-color:#fff}.carousel.scrolling .carousel-item .materialboxed,.carousel .carousel-item:not(.active) .materialboxed{pointer-events:none}.tap-target-wrapper{width:800px;height:800px;position:fixed;z-index:1000;visibility:hidden;-webkit-transition:visibility 0s .3s;transition:visibility 0s .3s}.tap-target-wrapper.open{visibility:visible;-webkit-transition:visibility 0s;transition:visibility 0s}.tap-target-wrapper.open .tap-target{-webkit-transform:scale(1);transform:scale(1);opacity:.95;-webkit-transition:opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:transform 0.3s cubic-bezier(0.42, 0, 0.58, 1),opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:transform 0.3s cubic-bezier(0.42, 0, 0.58, 1),opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1)}.tap-target-wrapper.open .tap-target-wave::before{-webkit-transform:scale(1);transform:scale(1)}.tap-target-wrapper.open .tap-target-wave::after{visibility:visible;-webkit-animation:pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;animation:pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;-webkit-transition:opacity .3s,
visibility 0s 1s,
-webkit-transform .3s;transition:opacity .3s,
visibility 0s 1s,
-webkit-transform .3s;transition:opacity .3s,
transform .3s,
visibility 0s 1s;transition:opacity .3s,
transform .3s,
visibility 0s 1s,
-webkit-transform .3s}.tap-target{position:absolute;font-size:1rem;border-radius:50%;background-color:#ee6e73;-webkit-box-shadow:0 20px 20px 0 rgba(0,0,0,0.14),0 10px 50px 0 rgba(0,0,0,0.12),0 30px 10px -20px rgba(0,0,0,0.2);box-shadow:0 20px 20px 0 rgba(0,0,0,0.14),0 10px 50px 0 rgba(0,0,0,0.12),0 30px 10px -20px rgba(0,0,0,0.2);width:100%;height:100%;opacity:0;-webkit-transform:scale(0);transform:scale(0);-webkit-transition:opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:transform 0.3s cubic-bezier(0.42, 0, 0.58, 1),opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:transform 0.3s cubic-bezier(0.42, 0, 0.58, 1),opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1)}.tap-target-content{position:relative;display:table-cell}.tap-target-wave{position:absolute;border-radius:50%;z-index:10001}.tap-target-wave::before,.tap-target-wave::after{content:'';display:block;position:absolute;width:100%;height:100%;border-radius:50%;background-color:#ffffff}.tap-target-wave::before{-webkit-transform:scale(0);transform:scale(0);-webkit-transition:-webkit-transform .3s;transition:-webkit-transform .3s;transition:transform .3s;transition:transform .3s, -webkit-transform .3s}.tap-target-wave::after{visibility:hidden;-webkit-transition:opacity .3s,
visibility 0s,
-webkit-transform .3s;transition:opacity .3s,
visibility 0s,
-webkit-transform .3s;transition:opacity .3s,
transform .3s,
visibility 0s;transition:opacity .3s,
transform .3s,
visibility 0s,
-webkit-transform .3s;z-index:-1}.tap-target-origin{top:50%;left:50%;-webkit-transform:translate(-50%, -50%);transform:translate(-50%, -50%);z-index:10002;position:absolute !important}.tap-target-origin:not(.btn):not(.btn-large),.tap-target-origin:not(.btn):not(.btn-large):hover{background:none}@media only screen and (max-width: 600px){.tap-target,.tap-target-wrapper{width:600px;height:600px}}.pulse{overflow:initial;position:relative}.pulse::before{content:'';display:block;position:absolute;width:100%;height:100%;top:0;left:0;background-color:inherit;border-radius:inherit;-webkit-transition:opacity .3s, -webkit-transform .3s;transition:opacity .3s, -webkit-transform .3s;transition:opacity .3s, transform .3s;transition:opacity .3s, transform .3s, -webkit-transform .3s;-webkit-animation:pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;animation:pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;z-index:-1}@-webkit-keyframes pulse-animation{0%{opacity:1;-webkit-transform:scale(1);transform:scale(1)}50%{opacity:0;-webkit-transform:scale(1.5);transform:scale(1.5)}100%{opacity:0;-webkit-transform:scale(1.5);transform:scale(1.5)}}@keyframes pulse-animation{0%{opacity:1;-webkit-transform:scale(1);transform:scale(1)}50%{opacity:0;-webkit-transform:scale(1.5);transform:scale(1.5)}100%{opacity:0;-webkit-transform:scale(1.5);transform:scale(1.5)}}.picker{font-size:16px;text-align:left;line-height:1.2;color:#000000;position:absolute;z-index:10000;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;outline:none}.picker__input{cursor:default}.picker__input.picker__input--active{border-color:#0089ec}.picker__holder{width:100%;overflow-y:auto;-webkit-overflow-scrolling:touch}/*!
+ * Default mobile-first, responsive styling for pickadate.js
+ * Demo: http://amsul.github.io/pickadate.js
+ */.picker__holder,.picker__frame{bottom:0;left:0;right:0;top:100%}.picker__holder{position:fixed;-webkit-transition:background 0.15s ease-out, top 0s 0.15s;transition:background 0.15s ease-out, top 0s 0.15s;-webkit-backface-visibility:hidden}.picker__frame{position:absolute;margin:0 auto;min-width:256px;width:300px;max-height:350px;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";filter:alpha(opacity=0);-moz-opacity:0;opacity:0;-webkit-transition:all 0.15s ease-out;transition:all 0.15s ease-out}@media (min-height: 28.875em){.picker__frame{overflow:visible;top:auto;bottom:-100%;max-height:80%}}@media (min-height: 40.125em){.picker__frame{margin-bottom:7.5%}}.picker__wrap{display:table;width:100%;height:100%}@media (min-height: 28.875em){.picker__wrap{display:block}}.picker__box{background:#ffffff;display:table-cell;vertical-align:middle}@media (min-height: 28.875em){.picker__box{display:block;border:1px solid #777777;border-top-color:#898989;border-bottom-width:0;border-radius:5px 5px 0 0;-webkit-box-shadow:0 12px 36px 16px rgba(0,0,0,0.24);box-shadow:0 12px 36px 16px rgba(0,0,0,0.24)}}.picker--opened .picker__holder{top:0;background:transparent;-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";zoom:1;background:rgba(0,0,0,0.32);-webkit-transition:background 0.15s ease-out;transition:background 0.15s ease-out}.picker--opened .picker__frame{top:0;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter:alpha(opacity=100);-moz-opacity:1;opacity:1}@media (min-height: 35.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__input.picker__input--active{border-color:#E3F2FD}.picker__frame{margin:0 auto;max-width:325px}@media (min-height: 38.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}@media only screen and (min-width: 601px){.picker__box{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.picker__frame{width:80%;max-width:600px}}.picker__box{padding:0;border-radius:2px;overflow:hidden}.picker__header{text-align:center;position:relative;margin-top:.75em}.picker__month,.picker__year{display:inline-block;margin-left:.25em;margin-right:.25em}.picker__select--month,.picker__select--year{height:2em;padding:0;margin-left:.25em;margin-right:.25em}.picker__select--month.browser-default{display:inline;background-color:#FFFFFF;width:40%}.picker__select--year.browser-default{display:inline;background-color:#FFFFFF;width:26%}.picker__select--month:focus,.picker__select--year:focus{border-color:rgba(0,0,0,0.05)}.picker__nav--prev,.picker__nav--next{position:absolute;padding:.5em 1.25em;width:1em;height:1em;-webkit-box-sizing:content-box;box-sizing:content-box;top:-0.25em}.picker__nav--prev{left:-1em;padding-right:1.25em}.picker__nav--next{right:-1em;padding-left:1.25em}.picker__nav--disabled,.picker__nav--disabled:hover,.picker__nav--disabled:before,.picker__nav--disabled:before:hover{cursor:default;background:none;border-right-color:#f5f5f5;border-left-color:#f5f5f5}.picker__table{text-align:center;border-collapse:collapse;border-spacing:0;table-layout:fixed;font-size:1rem;width:100%;margin-top:.75em;margin-bottom:.5em}.picker__table th,.picker__table td{text-align:center}.picker__table td{margin:0;padding:0}.picker__weekday{width:14.285714286%;font-size:.75em;padding-bottom:.25em;color:#999999;font-weight:500}@media (min-height: 33.875em){.picker__weekday{padding-bottom:.5em}}.picker__day--today{position:relative;color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day--disabled:before{border-top-color:#aaaaaa}.picker__day--infocus:hover{cursor:pointer;color:#000;font-weight:500}.picker__day--outfocus{display:none;padding:.75rem 0;color:#fff}.picker__day--outfocus:hover{cursor:pointer;color:#dddddd;font-weight:500}.picker__day--highlighted:hover,.picker--focused .picker__day--highlighted{cursor:pointer}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.75);transform:scale(0.75);background:#0089ec;color:#ffffff}.picker__day--disabled,.picker__day--disabled:hover,.picker--focused .picker__day--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__day--highlighted.picker__day--disabled,.picker__day--highlighted.picker__day--disabled:hover{background:#bbbbbb}.picker__footer{text-align:right}.picker__button--today,.picker__button--clear,.picker__button--close{border:1px solid #ffffff;background:#ffffff;font-size:.8em;padding:.66em 0;font-weight:bold;width:33%;display:inline-block;vertical-align:bottom}.picker__button--today:hover,.picker__button--clear:hover,.picker__button--close:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-bottom-color:#b1dcfb}.picker__button--today:focus,.picker__button--clear:focus,.picker__button--close:focus{background:#b1dcfb;border-color:rgba(0,0,0,0.05);outline:none}.picker__button--today:before,.picker__button--clear:before,.picker__button--close:before{position:relative;display:inline-block;height:0}.picker__button--today:before,.picker__button--clear:before{content:" ";margin-right:.45em}.picker__button--today:before{top:-0.05em;width:0;border-top:0.66em solid #0059bc;border-left:.66em solid transparent}.picker__button--clear:before{top:-0.25em;width:.66em;border-top:3px solid #ee2200}.picker__button--close:before{content:"\D7";top:-0.1em;vertical-align:top;font-size:1.1em;margin-right:.35em;color:#777777}.picker__button--today[disabled],.picker__button--today[disabled]:hover{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__button--today[disabled]:before{border-top-color:#aaaaaa}.picker__date-display{text-align:left;background-color:#26a69a;color:#fff;padding:18px;font-weight:300}@media only screen and (min-width: 601px){.picker__date-display{-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1}.picker__weekday-display{display:block}.picker__container__wrapper{-webkit-box-flex:2;-webkit-flex:2;-ms-flex:2;flex:2}}.picker__nav--prev:hover,.picker__nav--next:hover{cursor:pointer;color:#000000;background:#a1ded8}.picker__weekday-display{font-weight:500;font-size:2.8rem;margin-right:5px;margin-top:4px}.picker__month-display{font-size:2.8rem;font-weight:500}.picker__day-display{font-size:2.8rem;font-weight:500;margin-right:5px}.picker__year-display{font-size:1.5rem;font-weight:500;color:rgba(255,255,255,0.7)}.picker__calendar-container{padding:0 1rem}.picker__calendar-container thead{border:none}.picker__table{margin-top:0;margin-bottom:.5em}.picker__day--infocus{color:rgba(0,0,0,0.87);letter-spacing:-.3px;padding:0.75rem 0;font-weight:400;border:1px solid transparent}@media only screen and (min-width: 601px){.picker__day--infocus{padding:1.1rem 0}}.picker__day.picker__day--today{color:#26a69a}.picker__day.picker__day--today.picker__day--selected{color:#fff}.picker__weekday{font-size:.9rem}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.9);transform:scale(0.9);background-color:#26a69a;color:#ffffff}.picker__day--selected.picker__day--outfocus,.picker__day--selected:hover.picker__day--outfocus,.picker--focused .picker__day--selected.picker__day--outfocus{background-color:#a1ded8}.picker__footer{text-align:right;padding:5px 10px}.picker__close,.picker__today,.picker__clear{font-size:1.1rem;padding:0 1rem;color:#26a69a}.picker__clear{color:#f44336;float:left}.picker__nav--prev:before,.picker__nav--next:before{content:" ";border-top:.5em solid transparent;border-bottom:.5em solid transparent;border-right:0.75em solid #676767;width:0;height:0;display:block;margin:0 auto}.picker__nav--next:before{border-right:0;border-left:0.75em solid #676767}button.picker__today:focus,button.picker__clear:focus,button.picker__close:focus{background-color:#a1ded8}.picker__list{list-style:none;padding:0.75em 0 4.2em;margin:0}.picker__list-item{border-bottom:1px solid #ddd;border-top:1px solid #ddd;margin-bottom:-1px;position:relative;background:#fff;padding:.75em 1.25em}@media (min-height: 46.75em){.picker__list-item{padding:.5em 1em}}.picker__list-item:hover{cursor:pointer;color:#000;background:#b1dcfb;border-color:#0089ec;z-index:10}.picker__list-item--highlighted{border-color:#0089ec;z-index:10}.picker__list-item--highlighted:hover,.picker--focused .picker__list-item--highlighted{cursor:pointer;color:#000;background:#b1dcfb}.picker__list-item--selected,.picker__list-item--selected:hover,.picker--focused .picker__list-item--selected{background:#0089ec;color:#fff;z-index:10}.picker__list-item--disabled,.picker__list-item--disabled:hover,.picker--focused .picker__list-item--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#ddd;cursor:default;border-color:#ddd;z-index:auto}.picker--time .picker__button--clear{display:block;width:80%;margin:1em auto 0;padding:1em 1.25em;background:none;border:0;font-weight:500;font-size:.67em;text-align:center;text-transform:uppercase;color:rgba(0,0,0,0.87)}.picker--time .picker__button--clear:hover,.picker--time .picker__button--clear:focus{color:#000;background:#b1dcfb;background:#ee2200;border-color:#ee2200;cursor:pointer;color:#fff;outline:none}.picker--time .picker__button--clear:before{top:-0.25em;color:rgba(0,0,0,0.87);font-size:1.25em;font-weight:bold}.picker--time .picker__button--clear:hover:before,.picker--time .picker__button--clear:focus:before{color:#fff}.picker--time .picker__frame{min-width:256px;max-width:320px}.picker--time .picker__box{font-size:1em;background:#f2f2f2;padding:0}@media (min-height: 40.125em){.picker--time .picker__box{margin-bottom:5em}}.clockpicker-display{font-size:4rem;font-weight:bold;text-align:center;color:rgba(255,255,255,0.6);font-weight:400;clear:both;position:relative}.clockpicker-span-am-pm{font-size:1.3rem;position:absolute;right:1rem;bottom:0.3rem;line-height:2rem;font-weight:500}@media only screen and (min-width: 601px){.clockpicker-display{top:32%}.clockpicker-span-am-pm{position:relative;right:auto;bottom:auto;text-align:center;margin-top:1.2rem}}.text-primary{color:#fff}.clockpicker-span-hours{margin-right:3px}.clockpicker-span-minutes{margin-left:3px}.clockpicker-span-hours,.clockpicker-span-minutes,.clockpicker-span-am-pm div{cursor:pointer}.clockpicker-moving{cursor:move}.clockpicker-plate{background-color:#eee;border-radius:50%;width:270px;height:270px;overflow:visible;position:relative;margin:auto;margin-top:25px;margin-bottom:5px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.clockpicker-canvas,.clockpicker-dial{width:270px;height:270px;position:absolute;left:-1px;top:-1px}.clockpicker-minutes{visibility:hidden}.clockpicker-tick{border-radius:50%;color:rgba(0,0,0,0.87);line-height:40px;text-align:center;width:40px;height:40px;position:absolute;cursor:pointer}.clockpicker-tick.active,.clockpicker-tick:hover{background-color:rgba(38,166,154,0.25)}.clockpicker-dial{-webkit-transition:-webkit-transform 350ms, opacity 350ms;-webkit-transition:opacity 350ms, -webkit-transform 350ms;transition:opacity 350ms, -webkit-transform 350ms;transition:transform 350ms, opacity 350ms;transition:transform 350ms, opacity 350ms, -webkit-transform 350ms}.clockpicker-dial-out{opacity:0}.clockpicker-hours.clockpicker-dial-out{-webkit-transform:scale(1.2, 1.2);transform:scale(1.2, 1.2)}.clockpicker-minutes.clockpicker-dial-out{-webkit-transform:scale(0.8, 0.8);transform:scale(0.8, 0.8)}.clockpicker-canvas{-webkit-transition:opacity 175ms;transition:opacity 175ms}.clockpicker-canvas-out{opacity:0.25}.clockpicker-canvas-bearing{stroke:none;fill:#26a69a}.clockpicker-canvas-bg{stroke:none;fill:#26a69a}.clockpicker-canvas-bg-trans{fill:#26a69a}.clockpicker-canvas line{stroke:#26a69a;stroke-width:4;stroke-linecap:round}
diff --git a/static/fonts/roboto/Roboto-Bold.woff b/static/fonts/roboto/Roboto-Bold.woff
new file mode 100644
index 00000000..c55d1e72
Binary files /dev/null and b/static/fonts/roboto/Roboto-Bold.woff differ
diff --git a/static/fonts/roboto/Roboto-Bold.woff2 b/static/fonts/roboto/Roboto-Bold.woff2
new file mode 100644
index 00000000..ab121974
Binary files /dev/null and b/static/fonts/roboto/Roboto-Bold.woff2 differ
diff --git a/static/fonts/roboto/Roboto-Light.woff b/static/fonts/roboto/Roboto-Light.woff
new file mode 100644
index 00000000..3f9e8c5e
Binary files /dev/null and b/static/fonts/roboto/Roboto-Light.woff differ
diff --git a/static/fonts/roboto/Roboto-Light.woff2 b/static/fonts/roboto/Roboto-Light.woff2
new file mode 100644
index 00000000..0707d9ab
Binary files /dev/null and b/static/fonts/roboto/Roboto-Light.woff2 differ
diff --git a/static/fonts/roboto/Roboto-Medium.woff b/static/fonts/roboto/Roboto-Medium.woff
new file mode 100644
index 00000000..ced7907e
Binary files /dev/null and b/static/fonts/roboto/Roboto-Medium.woff differ
diff --git a/static/fonts/roboto/Roboto-Medium.woff2 b/static/fonts/roboto/Roboto-Medium.woff2
new file mode 100644
index 00000000..723a3234
Binary files /dev/null and b/static/fonts/roboto/Roboto-Medium.woff2 differ
diff --git a/static/fonts/roboto/Roboto-Regular.woff b/static/fonts/roboto/Roboto-Regular.woff
new file mode 100644
index 00000000..e401bcf5
Binary files /dev/null and b/static/fonts/roboto/Roboto-Regular.woff differ
diff --git a/static/fonts/roboto/Roboto-Regular.woff2 b/static/fonts/roboto/Roboto-Regular.woff2
new file mode 100644
index 00000000..5bd7bd65
Binary files /dev/null and b/static/fonts/roboto/Roboto-Regular.woff2 differ
diff --git a/static/fonts/roboto/Roboto-Thin.woff b/static/fonts/roboto/Roboto-Thin.woff
new file mode 100644
index 00000000..175d0765
Binary files /dev/null and b/static/fonts/roboto/Roboto-Thin.woff differ
diff --git a/static/fonts/roboto/Roboto-Thin.woff2 b/static/fonts/roboto/Roboto-Thin.woff2
new file mode 100644
index 00000000..29172398
Binary files /dev/null and b/static/fonts/roboto/Roboto-Thin.woff2 differ
diff --git a/static/charts.js b/static/js/charts.js
similarity index 100%
rename from static/charts.js
rename to static/js/charts.js
diff --git a/static/js/materialize.js b/static/js/materialize.js
new file mode 100644
index 00000000..3d06957e
--- /dev/null
+++ b/static/js/materialize.js
@@ -0,0 +1,10021 @@
+/*!
+ * Materialize v0.100.2 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
+
+function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
+
+// Check for jQuery.
+if (typeof jQuery === 'undefined') {
+ // Check if require is a defined function.
+ if (typeof require === 'function') {
+ jQuery = $ = require('jquery');
+ // Else use the dollar sign alias.
+ } else {
+ jQuery = $;
+ }
+}
+; /*
+ * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
+ * Open source under the BSD License.
+ * Copyright © 2008 George McGinley Smith
+ * All rights reserved.
+ * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
+ */
+
+(function (factory) {
+ if (typeof define === "function" && define.amd) {
+ define(['jquery'], function ($) {
+ return factory($);
+ });
+ } else if (typeof module === "object" && typeof module.exports === "object") {
+ exports = factory(require('jquery'));
+ } else {
+ factory(jQuery);
+ }
+})(function ($) {
+
+ // Preserve the original jQuery "swing" easing as "jswing"
+ $.easing['jswing'] = $.easing['swing'];
+
+ var pow = Math.pow,
+ sqrt = Math.sqrt,
+ sin = Math.sin,
+ cos = Math.cos,
+ PI = Math.PI,
+ c1 = 1.70158,
+ c2 = c1 * 1.525,
+ c3 = c1 + 1,
+ c4 = 2 * PI / 3,
+ c5 = 2 * PI / 4.5;
+
+ // x is the fraction of animation progress, in the range 0..1
+ function bounceOut(x) {
+ var n1 = 7.5625,
+ d1 = 2.75;
+ if (x < 1 / d1) {
+ return n1 * x * x;
+ } else if (x < 2 / d1) {
+ return n1 * (x -= 1.5 / d1) * x + .75;
+ } else if (x < 2.5 / d1) {
+ return n1 * (x -= 2.25 / d1) * x + .9375;
+ } else {
+ return n1 * (x -= 2.625 / d1) * x + .984375;
+ }
+ }
+
+ $.extend($.easing, {
+ def: 'easeOutQuad',
+ swing: function (x) {
+ return $.easing[$.easing.def](x);
+ },
+ easeInQuad: function (x) {
+ return x * x;
+ },
+ easeOutQuad: function (x) {
+ return 1 - (1 - x) * (1 - x);
+ },
+ easeInOutQuad: function (x) {
+ return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
+ },
+ easeInCubic: function (x) {
+ return x * x * x;
+ },
+ easeOutCubic: function (x) {
+ return 1 - pow(1 - x, 3);
+ },
+ easeInOutCubic: function (x) {
+ return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
+ },
+ easeInQuart: function (x) {
+ return x * x * x * x;
+ },
+ easeOutQuart: function (x) {
+ return 1 - pow(1 - x, 4);
+ },
+ easeInOutQuart: function (x) {
+ return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
+ },
+ easeInQuint: function (x) {
+ return x * x * x * x * x;
+ },
+ easeOutQuint: function (x) {
+ return 1 - pow(1 - x, 5);
+ },
+ easeInOutQuint: function (x) {
+ return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
+ },
+ easeInSine: function (x) {
+ return 1 - cos(x * PI / 2);
+ },
+ easeOutSine: function (x) {
+ return sin(x * PI / 2);
+ },
+ easeInOutSine: function (x) {
+ return -(cos(PI * x) - 1) / 2;
+ },
+ easeInExpo: function (x) {
+ return x === 0 ? 0 : pow(2, 10 * x - 10);
+ },
+ easeOutExpo: function (x) {
+ return x === 1 ? 1 : 1 - pow(2, -10 * x);
+ },
+ easeInOutExpo: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
+ },
+ easeInCirc: function (x) {
+ return 1 - sqrt(1 - pow(x, 2));
+ },
+ easeOutCirc: function (x) {
+ return sqrt(1 - pow(x - 1, 2));
+ },
+ easeInOutCirc: function (x) {
+ return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
+ },
+ easeInElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
+ },
+ easeOutElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
+ },
+ easeInOutElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
+ },
+ easeInBack: function (x) {
+ return c3 * x * x * x - c1 * x * x;
+ },
+ easeOutBack: function (x) {
+ return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
+ },
+ easeInOutBack: function (x) {
+ return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
+ },
+ easeInBounce: function (x) {
+ return 1 - bounceOut(1 - x);
+ },
+ easeOutBounce: bounceOut,
+ easeInOutBounce: function (x) {
+ return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
+ }
+ });
+});; // Custom Easing
+jQuery.extend(jQuery.easing, {
+ easeInOutMaterial: function (x, t, b, c, d) {
+ if ((t /= d / 2) < 1) return c / 2 * t * t + b;
+ return c / 4 * ((t -= 2) * t * t + 2) + b;
+ }
+});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
+/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
+/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
+jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) {
+ function t(e) {
+ var t = e.length,
+ a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e;
+ }if (!e.jQuery) {
+ var r = function (e, t) {
+ return new r.fn.init(e, t);
+ };r.isWindow = function (e) {
+ return null != e && e == e.window;
+ }, r.type = function (e) {
+ return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e;
+ }, r.isArray = Array.isArray || function (e) {
+ return "array" === r.type(e);
+ }, r.isPlainObject = function (e) {
+ var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try {
+ if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
+ } catch (a) {
+ return !1;
+ }for (t in e) {}return void 0 === t || o.call(e, t);
+ }, r.each = function (e, r, a) {
+ var n,
+ o = 0,
+ i = e.length,
+ s = t(e);if (a) {
+ if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
+ if (n = r.apply(e[o], a), n === !1) break;
+ }
+ } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
+ if (n = r.call(e[o], o, e[o]), n === !1) break;
+ }return e;
+ }, r.data = function (e, t, n) {
+ if (void 0 === n) {
+ var o = e[r.expando],
+ i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
+ } else if (void 0 !== t) {
+ var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n;
+ }
+ }, r.removeData = function (e, t) {
+ var n = e[r.expando],
+ o = n && a[n];o && r.each(t, function (e, t) {
+ delete o[t];
+ });
+ }, r.extend = function () {
+ var e,
+ t,
+ a,
+ n,
+ o,
+ i,
+ s = arguments[0] || {},
+ l = 1,
+ u = arguments.length,
+ c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
+ if (null != (o = arguments[l])) for (n in o) {
+ e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
+ }
+ }return s;
+ }, r.queue = function (e, a, n) {
+ function o(e, r) {
+ var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) {
+ for (var r = +t.length, a = 0, n = e.length; r > a;) {
+ e[n++] = t[a++];
+ }if (r !== r) for (; void 0 !== t[a];) {
+ e[n++] = t[a++];
+ }return e.length = n, e;
+ }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
+ }if (e) {
+ a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [];
+ }
+ }, r.dequeue = function (e, t) {
+ r.each(e.nodeType ? [e] : e, function (e, a) {
+ t = t || "fx";var n = r.queue(a, t),
+ o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
+ r.dequeue(a, t);
+ }));
+ });
+ }, r.fn = r.prototype = { init: function (e) {
+ if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
+ }, offset: function () {
+ var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) };
+ }, position: function () {
+ function e() {
+ for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
+ e = e.offsetParent;
+ }return e || document;
+ }var t = this[0],
+ e = e.apply(t),
+ a = this.offset(),
+ n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left };
+ } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
+ n["[object " + s[l] + "]"] = s[l].toLowerCase();
+ }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
+ }
+}(window), function (e) {
+ "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e();
+}(function () {
+ return function (e, t, r, a) {
+ function n(e) {
+ for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
+ var n = e[t];n && a.push(n);
+ }return a;
+ }function o(e) {
+ return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
+ }function i(e) {
+ var t = f.data(e, "velocity");return null === t ? a : t;
+ }function s(e) {
+ return function (t) {
+ return Math.round(t * e) * (1 / e);
+ };
+ }function l(e, r, a, n) {
+ function o(e, t) {
+ return 1 - 3 * t + 3 * e;
+ }function i(e, t) {
+ return 3 * t - 6 * e;
+ }function s(e) {
+ return 3 * e;
+ }function l(e, t, r) {
+ return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
+ }function u(e, t, r) {
+ return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
+ }function c(t, r) {
+ for (var n = 0; m > n; ++n) {
+ var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
+ }return r;
+ }function p() {
+ for (var t = 0; b > t; ++t) {
+ w[t] = l(t * x, e, a);
+ }
+ }function f(t, r, n) {
+ var o,
+ i,
+ s = 0;do {
+ i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
+ } while (Math.abs(o) > h && ++s < v);return i;
+ }function d(t) {
+ for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
+ r += x;
+ }--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
+ s = r + i * x,
+ l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
+ }function g() {
+ V = !0, (e != r || a != n) && p();
+ }var m = 4,
+ y = .001,
+ h = 1e-7,
+ v = 10,
+ b = 11,
+ x = 1 / (b - 1),
+ S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
+ if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
+ }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
+ V = !1,
+ C = function (t) {
+ return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
+ };C.getControlPoints = function () {
+ return [{ x: e, y: r }, { x: a, y: n }];
+ };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
+ return T;
+ }, C;
+ }function u(e, t) {
+ var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
+ }function c(e) {
+ if (e) {
+ var t = new Date().getTime(),
+ r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
+ if (b.State.calls[o]) {
+ var s = b.State.calls[o],
+ l = s[0],
+ u = s[2],
+ d = s[3],
+ g = !!d,
+ y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
+ var P = l[v],
+ V = P.element;if (i(V)) {
+ var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
+ if ("flex" === u.display) {
+ var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
+ S.setPropertyValue(V, "display", t);
+ });
+ }S.setPropertyValue(V, "display", u.display);
+ }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
+ if ("element" !== k) {
+ var A,
+ F = P[k],
+ j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
+ var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
+ }if (F.currentValue = A, "tween" === k) y = A;else {
+ if (S.Hooks.registered[k]) {
+ var H = S.Hooks.getRoot(k),
+ N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
+ }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
+ }
+ }
+ }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
+ }
+ }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
+ }
+ }
+ }b.State.isTicking && w(c);
+ }function p(e, t) {
+ if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
+ var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
+ i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
+ var r = /^scale/.test(t) ? 1 : 0,
+ n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
+ }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
+ }if (!t && o.complete && !o.loop && u === c - 1) try {
+ o.complete.call(n, n);
+ } catch (g) {
+ setTimeout(function () {
+ throw g;
+ }, 1);
+ }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
+ /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
+ }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
+ }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
+ if (b.State.calls[m] !== !1) {
+ l = !0;break;
+ }
+ }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
+ }var f,
+ d = function () {
+ if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
+ var t = r.createElement("div");if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e;
+ }return a;
+ }(),
+ g = function () {
+ var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
+ var r,
+ a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
+ t(a + r);
+ }, r);
+ };
+ }(),
+ m = { isString: function (e) {
+ return "string" == typeof e;
+ }, isArray: Array.isArray || function (e) {
+ return "[object Array]" === Object.prototype.toString.call(e);
+ }, isFunction: function (e) {
+ return "[object Function]" === Object.prototype.toString.call(e);
+ }, isNode: function (e) {
+ return e && e.nodeType;
+ }, isNodeList: function (e) {
+ return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0);
+ }, isWrapped: function (e) {
+ return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e));
+ }, isSVG: function (e) {
+ return t.SVGElement && e instanceof t.SVGElement;
+ }, isEmptyObject: function (e) {
+ for (var t in e) {
+ return !1;
+ }return !0;
+ } },
+ y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
+ v = "swing",
+ b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
+ f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
+ }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
+ function e(e) {
+ return -e.tension * e.x - e.friction * e.v;
+ }function t(t, r, a) {
+ var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
+ }function r(r, a) {
+ var n = { dx: r.v, dv: e(r) },
+ o = t(r, .5 * a, n),
+ i = t(r, .5 * a, o),
+ s = t(r, a, i),
+ l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
+ u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
+ }return function a(e, t, n) {
+ var o,
+ i,
+ s,
+ l = { x: -1, v: 0, tension: null, friction: null },
+ u = [0],
+ c = 0,
+ p = 1e-4,
+ f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
+ return u[e * (u.length - 1) | 0];
+ } : c;
+ };
+ }();b.Easings = { linear: function (e) {
+ return e;
+ }, swing: function (e) {
+ return .5 - Math.cos(e * Math.PI) / 2;
+ }, spring: function (e) {
+ return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
+ } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
+ b.Easings[t[0]] = l.apply(null, t[1]);
+ });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
+ for (var e = 0; e < S.Lists.colors.length; e++) {
+ var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
+ }var r, a, n;if (d) for (r in S.Hooks.templates) {
+ a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
+ }for (r in S.Hooks.templates) {
+ a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
+ var i = r + n[e],
+ s = e;S.Hooks.registered[i] = [r, s];
+ }
+ }
+ }, getRoot: function (e) {
+ var t = S.Hooks.registered[e];return t ? t[0] : e;
+ }, cleanRootPropertyValue: function (e, t) {
+ return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
+ }, extractValue: function (e, t) {
+ var r = S.Hooks.registered[e];if (r) {
+ var a = r[0],
+ n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
+ }return t;
+ }, injectValue: function (e, t, r) {
+ var a = S.Hooks.registered[e];if (a) {
+ var n,
+ o,
+ i = a[0],
+ s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
+ }return r;
+ } }, Normalizations: { registered: { clip: function (e, t, r) {
+ switch (e) {case "name":
+ return "clip";case "extract":
+ var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
+ return "rect(" + r + ")";}
+ }, blur: function (e, t, r) {
+ switch (e) {case "name":
+ return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
+ var a = parseFloat(r);if (!a && 0 !== a) {
+ var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0;
+ }return a;case "inject":
+ return parseFloat(r) ? "blur(" + r + ")" : "none";}
+ }, opacity: function (e, t, r) {
+ if (8 >= d) switch (e) {case "name":
+ return "filter";case "extract":
+ var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject":
+ return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
+ return "opacity";case "extract":
+ return r;case "inject":
+ return r;}
+ } }, register: function () {
+ 9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
+ !function () {
+ var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
+ switch (e) {case "name":
+ return "transform";case "extract":
+ return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
+ var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
+ o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale":
+ b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
+ o = !/(deg|\d)$/i.test(n);break;case "rotate":
+ o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
+ };
+ }();
+ }for (var e = 0; e < S.Lists.colors.length; e++) {
+ !function () {
+ var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
+ switch (e) {case "name":
+ return t;case "extract":
+ var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
+ var i,
+ s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
+ }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject":
+ return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
+ };
+ }();
+ }
+ } }, Names: { camelCase: function (e) {
+ return e.replace(/-(\w)/g, function (e, t) {
+ return t.toUpperCase();
+ });
+ }, SVGAttribute: function (e) {
+ var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e);
+ }, prefixCheck: function (e) {
+ if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
+ var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
+ return e.toUpperCase();
+ }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
+ }return [e, !1];
+ } }, Values: { hexToRgb: function (e) {
+ var t,
+ r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
+ a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
+ return t + t + r + r + a + a;
+ }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
+ }, isCSSNullValue: function (e) {
+ return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e);
+ }, getUnitType: function (e) {
+ return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
+ );
+ }, getDisplayType: function (e) {
+ var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
+ );
+ }, addClass: function (e, t) {
+ e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
+ }, removeClass: function (e, t) {
+ e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ");
+ } }, getPropertyValue: function (e, r, n, o) {
+ function s(e, r) {
+ function n() {
+ u && S.setPropertyValue(e, "display", "none");
+ }var l = 0;if (8 >= d) l = f.css(e, r);else {
+ var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
+ if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
+ var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c;
+ }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
+ var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p;
+ }
+ }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n();
+ }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
+ var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px");
+ }return l;
+ }var l;if (S.Hooks.registered[r]) {
+ var u = r,
+ c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
+ } else if (S.Normalizations.registered[r]) {
+ var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
+ }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
+ if (/^(height|width)$/i.test(r)) try {
+ l = e.getBBox()[r];
+ } catch (m) {
+ l = 0;
+ } else l = e.getAttribute(r);
+ } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
+ }, setPropertyValue: function (e, r, a, n, o) {
+ var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
+ if (S.Hooks.registered[r]) {
+ var l = r,
+ u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
+ }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
+ e.style[s] = a;
+ } catch (c) {
+ b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
+ } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
+ }return [s, a];
+ }, flushTransformCache: function (e) {
+ function t(t) {
+ return parseFloat(S.getPropertyValue(e, t));
+ }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
+ var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
+ /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
+ });
+ } else {
+ var n, o;f.each(i(e).transformCache, function (t) {
+ return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
+ }), o && (r = "perspective" + o + " " + r);
+ }S.setPropertyValue(e, "transform", r);
+ } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
+ var n = a;return e = o(e), f.each(e, function (e, o) {
+ if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
+ var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
+ }
+ }), n;
+ };var P = function () {
+ function e() {
+ return s ? k.promise || null : l;
+ }function n() {
+ function e(e) {
+ function p(e, t) {
+ var r = a,
+ n = a,
+ i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i];
+ }function d(e, t) {
+ var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
+ return r = e, "";
+ }), r || (r = S.Values.getUnitType(e)), [a, r];
+ }function h() {
+ var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
+ a = e.position === L.lastPosition && e.myParent === L.lastParent,
+ n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
+ l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
+ var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
+ b.CSS.setPropertyValue(u, t, "hidden");
+ }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
+ b.CSS.setPropertyValue(u, t, s + "%");
+ }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u);
+ }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
+ }if (s.begin && 0 === V) try {
+ s.begin.call(g, g);
+ } catch (x) {
+ setTimeout(function () {
+ throw x;
+ }, 1);
+ }if ("scroll" === A) {
+ var P,
+ C,
+ T,
+ F = /^x$/i.test(s.axis) ? "Left" : "Top",
+ j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
+ } else if ("reverse" === A) {
+ if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
+ if ("element" !== H) {
+ var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
+ }
+ }l = E;
+ } else if ("start" === A) {
+ var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
+ if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
+ var r = p(t, !0),
+ n = r[0],
+ o = r[1],
+ i = r[2];if (S.RegEx.isHex.test(n)) {
+ for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
+ var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
+ }delete y[e];
+ }
+ }
+ });for (var z in y) {
+ var O = p(y[z]),
+ q = O[0],
+ $ = O[1],
+ M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
+ B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
+ (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
+ G,
+ Y,
+ D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
+ return D = t, "";
+ }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
+ n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%":
+ M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
+ break;default:
+ M *= n[Y + "ToPx"];}switch (G) {case "%":
+ M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
+ break;default:
+ M *= 1 / n[G + "ToPx"];}
+ }switch (D) {case "+":
+ q = M + q;break;case "-":
+ q = M - q;break;case "*":
+ q = M * q;break;case "/":
+ q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
+ } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
+ }l.element = o;
+ }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
+ }var n,
+ o = this,
+ s = f.extend({}, b.defaults, v),
+ l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
+ b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
+ }), s.duration.toString().toLowerCase()) {case "fast":
+ s.duration = 200;break;case "normal":
+ s.duration = h;break;case "slow":
+ s.duration = 600;break;default:
+ s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
+ return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
+ }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o);
+ }var s,
+ l,
+ d,
+ g,
+ y,
+ v,
+ x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
+ x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
+ V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
+ var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
+ m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
+ }
+ }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
+ k.resolver = e, k.rejecter = t;
+ }));var A;switch (y) {case "scroll":
+ A = "scroll";break;case "reverse":
+ A = "reverse";break;case "finish":case "stop":
+ f.each(g, function (e, t) {
+ i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
+ });var F = [];return f.each(b.State.calls, function (e, t) {
+ t && f.each(t[1], function (r, n) {
+ var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
+ a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
+ m.isFunction(t) && t(null, !0);
+ }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
+ t.endValue = t.currentValue;
+ }), F.push(e)) : "finish" === y && (t[2].duration = 1));
+ }) : !0;
+ });
+ }), "stop" === y && (f.each(F, function (e, t) {
+ p(t, !0);
+ }), k.promise && k.resolver(g)), e();default:
+ if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
+ if (m.isString(y) && b.Redirects[y]) {
+ var j = f.extend({}, v),
+ E = j.duration,
+ H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
+ parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a);
+ }), e();
+ }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
+ }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
+ R = [];f.each(g, function (e, t) {
+ m.isNode(t) && n.call(t);
+ });var z,
+ j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
+ var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
+ }return e();
+ }
+ };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
+ r.hidden ? (w = function (e) {
+ return setTimeout(function () {
+ e(!0);
+ }, 16);
+ }, c()) : w = t.requestAnimationFrame || g;
+ }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
+ b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
+ var l = f.extend({}, r),
+ u = l.begin,
+ c = l.complete,
+ p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
+ d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
+ u && u.call(i, i);for (var r in p) {
+ d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
+ }d.overflow = e.style.overflow, e.style.overflow = "hidden";
+ }, l.complete = function () {
+ for (var t in d) {
+ e.style[t] = d[t];
+ }c && c.call(i, i), s && s.resolver(i);
+ }, b(e, p, l);
+ };
+ }), f.each(["In", "Out"], function (e, t) {
+ b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
+ var l = f.extend({}, r),
+ u = { opacity: "In" === t ? 1 : 0 },
+ c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
+ c && c.call(i, i), s && s.resolver(i);
+ }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
+ };
+ }), b;
+ }(window.jQuery || window.Zepto || window, window, document);
+}));
+;!function (a, b, c, d) {
+ "use strict";
+ function k(a, b, c) {
+ return setTimeout(q(a, c), b);
+ }function l(a, b, c) {
+ return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
+ }function m(a, b, c) {
+ var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
+ b.call(c, a[e], e, a), e++;
+ } else for (e in a) {
+ a.hasOwnProperty(e) && b.call(c, a[e], e, a);
+ }
+ }function n(a, b, c) {
+ for (var e = Object.keys(b), f = 0; f < e.length;) {
+ (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
+ }return a;
+ }function o(a, b) {
+ return n(a, b, !0);
+ }function p(a, b, c) {
+ var e,
+ d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
+ }function q(a, b) {
+ return function () {
+ return a.apply(b, arguments);
+ };
+ }function r(a, b) {
+ return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a;
+ }function s(a, b) {
+ return a === d ? b : a;
+ }function t(a, b, c) {
+ m(x(b), function (b) {
+ a.addEventListener(b, c, !1);
+ });
+ }function u(a, b, c) {
+ m(x(b), function (b) {
+ a.removeEventListener(b, c, !1);
+ });
+ }function v(a, b) {
+ for (; a;) {
+ if (a == b) return !0;a = a.parentNode;
+ }return !1;
+ }function w(a, b) {
+ return a.indexOf(b) > -1;
+ }function x(a) {
+ return a.trim().split(/\s+/g);
+ }function y(a, b, c) {
+ if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
+ if (c && a[d][c] == b || !c && a[d] === b) return d;d++;
+ }return -1;
+ }function z(a) {
+ return Array.prototype.slice.call(a, 0);
+ }function A(a, b, c) {
+ for (var d = [], e = [], f = 0; f < a.length;) {
+ var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
+ }return c && (d = b ? d.sort(function (a, c) {
+ return a[b] > c[b];
+ }) : d.sort()), d;
+ }function B(a, b) {
+ for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
+ if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
+ }return d;
+ }function D() {
+ return C++;
+ }function E(a) {
+ var b = a.ownerDocument;return b.defaultView || b.parentWindow;
+ }function ab(a, b) {
+ var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
+ r(a.options.enable, [a]) && c.handler(b);
+ }, this.init();
+ }function bb(a) {
+ var b,
+ c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
+ }function cb(a, b, c) {
+ var d = c.pointers.length,
+ e = c.changedPointers.length,
+ f = b & O && 0 === d - e,
+ g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
+ }function db(a, b) {
+ var c = a.session,
+ d = b.pointers,
+ e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
+ g = c.firstMultiple,
+ h = g ? g.center : f.center,
+ i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
+ }function eb(a, b) {
+ var c = b.center,
+ d = a.offsetDelta || {},
+ e = a.prevDelta || {},
+ f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
+ }function fb(a, b) {
+ var f,
+ g,
+ h,
+ j,
+ c = a.lastInterval || b,
+ e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) {
+ var k = c.deltaX - b.deltaX,
+ l = c.deltaY - b.deltaY,
+ m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
+ } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
+ }function gb(a) {
+ for (var b = [], c = 0; c < a.pointers.length;) {
+ b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
+ }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
+ }function hb(a) {
+ var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
+ c += a[e].clientX, d += a[e].clientY, e++;
+ }return { x: h(c / b), y: h(d / b) };
+ }function ib(a, b, c) {
+ return { x: b / a || 0, y: c / a || 0 };
+ }function jb(a, b) {
+ return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
+ }function kb(a, b, c) {
+ c || (c = $);var d = b[c[0]] - a[c[0]],
+ e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
+ }function lb(a, b, c) {
+ c || (c = $);var d = b[c[0]] - a[c[0]],
+ e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
+ }function mb(a, b) {
+ return lb(b[1], b[0], _) - lb(a[1], a[0], _);
+ }function nb(a, b) {
+ return kb(b[0], b[1], _) / kb(a[0], a[1], _);
+ }function rb() {
+ this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
+ }function wb() {
+ this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
+ }function Ab() {
+ this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
+ }function Bb(a, b) {
+ var c = z(a.touches),
+ d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
+ }function Eb() {
+ this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
+ }function Fb(a, b) {
+ var c = z(a.touches),
+ d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
+ f,
+ g = z(a.changedTouches),
+ h = [],
+ i = this.target;if (f = c.filter(function (a) {
+ return v(a.target, i);
+ }), b === O) for (e = 0; e < f.length;) {
+ d[f[e].identifier] = !0, e++;
+ }for (e = 0; e < g.length;) {
+ d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
+ }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
+ }function Gb() {
+ ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
+ }function Pb(a, b) {
+ this.manager = a, this.set(b);
+ }function Qb(a) {
+ if (w(a, Mb)) return Mb;var b = w(a, Nb),
+ c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
+ }function Yb(a) {
+ this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
+ }function Zb(a) {
+ return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
+ }function $b(a) {
+ return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
+ }function _b(a, b) {
+ var c = b.manager;return c ? c.get(a) : a;
+ }function ac() {
+ Yb.apply(this, arguments);
+ }function bc() {
+ ac.apply(this, arguments), this.pX = null, this.pY = null;
+ }function cc() {
+ ac.apply(this, arguments);
+ }function dc() {
+ Yb.apply(this, arguments), this._timer = null, this._input = null;
+ }function ec() {
+ ac.apply(this, arguments);
+ }function fc() {
+ ac.apply(this, arguments);
+ }function gc() {
+ Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
+ }function hc(a, b) {
+ return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
+ }function kc(a, b) {
+ b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
+ var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
+ }, this);
+ }function lc(a, b) {
+ var c = a.element;m(a.options.cssProps, function (a, d) {
+ c.style[B(c.style, d)] = b ? a : "";
+ });
+ }function mc(a, c) {
+ var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
+ }var e = ["", "webkit", "moz", "MS", "ms", "o"],
+ f = b.createElement("div"),
+ g = "function",
+ h = Math.round,
+ i = Math.abs,
+ j = Date.now,
+ C = 1,
+ F = /mobile|tablet|ip(ad|hone|od)|android/i,
+ G = "ontouchstart" in a,
+ H = B(a, "PointerEvent") !== d,
+ I = G && F.test(navigator.userAgent),
+ J = "touch",
+ K = "pen",
+ L = "mouse",
+ M = "kinect",
+ N = 25,
+ O = 1,
+ P = 2,
+ Q = 4,
+ R = 8,
+ S = 1,
+ T = 2,
+ U = 4,
+ V = 8,
+ W = 16,
+ X = T | U,
+ Y = V | W,
+ Z = X | Y,
+ $ = ["x", "y"],
+ _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
+ this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
+ }, destroy: function () {
+ this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
+ } };var ob = { mousedown: O, mousemove: P, mouseup: Q },
+ pb = "mousedown",
+ qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
+ var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
+ } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
+ tb = { 2: J, 3: K, 4: L, 5: M },
+ ub = "pointerdown",
+ vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
+ var b = this.store,
+ c = !1,
+ d = a.type.toLowerCase().replace("ms", ""),
+ e = sb[d],
+ f = tb[a.pointerType] || a.pointerType,
+ g = f == J,
+ h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
+ } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
+ yb = "touchstart",
+ zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
+ var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
+ var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
+ }
+ } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
+ Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
+ var b = Cb[a.type],
+ c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
+ } }), p(Gb, ab, { handler: function (a, b, c) {
+ var d = c.pointerType == J,
+ e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c);
+ }, destroy: function () {
+ this.touch.destroy(), this.mouse.destroy();
+ } });var Hb = B(f.style, "touchAction"),
+ Ib = Hb !== d,
+ Jb = "compute",
+ Kb = "auto",
+ Lb = "manipulation",
+ Mb = "none",
+ Nb = "pan-x",
+ Ob = "pan-y";Pb.prototype = { set: function (a) {
+ a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
+ }, update: function () {
+ this.set(this.manager.options.touchAction);
+ }, compute: function () {
+ var a = [];return m(this.manager.recognizers, function (b) {
+ r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
+ }), Qb(a.join(" "));
+ }, preventDefaults: function (a) {
+ if (!Ib) {
+ var b = a.srcEvent,
+ c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
+ e = w(d, Mb),
+ f = w(d, Ob),
+ g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0;
+ }
+ }, preventSrc: function (a) {
+ this.manager.session.prevented = !0, a.preventDefault();
+ } };var Rb = 1,
+ Sb = 2,
+ Tb = 4,
+ Ub = 8,
+ Vb = Ub,
+ Wb = 16,
+ Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
+ return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
+ }, recognizeWith: function (a) {
+ if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this;
+ }, dropRecognizeWith: function (a) {
+ return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
+ }, requireFailure: function (a) {
+ if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
+ }, dropRequireFailure: function (a) {
+ if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
+ }, hasRequireFailures: function () {
+ return this.requireFail.length > 0;
+ }, canRecognizeWith: function (a) {
+ return !!this.simultaneous[a.id];
+ }, emit: function (a) {
+ function d(d) {
+ b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
+ }var b = this,
+ c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
+ }, tryEmit: function (a) {
+ return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
+ }, canEmit: function () {
+ for (var a = 0; a < this.requireFail.length;) {
+ if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++;
+ }return !0;
+ }, recognize: function (a) {
+ var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
+ }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
+ var b = this.options.pointers;return 0 === b || a.pointers.length === b;
+ }, process: function (a) {
+ var b = this.state,
+ c = a.eventType,
+ d = b & (Sb | Tb),
+ e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb;
+ } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
+ var a = this.options.direction,
+ b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
+ }, directionTest: function (a) {
+ var b = this.options,
+ c = !0,
+ d = a.distance,
+ e = a.direction,
+ f = a.deltaX,
+ g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
+ }, attrTest: function (a) {
+ return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a));
+ }, emit: function (a) {
+ this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
+ } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
+ return [Mb];
+ }, attrTest: function (a) {
+ return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb);
+ }, emit: function (a) {
+ if (this._super.emit.call(this, a), 1 !== a.scale) {
+ var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
+ }
+ } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
+ return [Kb];
+ }, process: function (a) {
+ var b = this.options,
+ c = a.pointers.length === b.pointers,
+ d = a.distance < b.threshold,
+ e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
+ this.state = Vb, this.tryEmit();
+ }, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
+ }, reset: function () {
+ clearTimeout(this._timer);
+ }, emit: function (a) {
+ this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
+ } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
+ return [Mb];
+ }, attrTest: function (a) {
+ return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb);
+ } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () {
+ return bc.prototype.getTouchAction.call(this);
+ }, attrTest: function (a) {
+ var c,
+ b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
+ }, emit: function (a) {
+ var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
+ } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
+ return [Lb];
+ }, process: function (a) {
+ var b = this.options,
+ c = a.pointers.length === b.pointers,
+ d = a.distance < b.threshold,
+ e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
+ if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
+ g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
+ this.state = Vb, this.tryEmit();
+ }, b.interval, this), Sb) : Vb;
+ }return Xb;
+ }, failTimeout: function () {
+ return this._timer = k(function () {
+ this.state = Xb;
+ }, this.options.interval, this), Xb;
+ }, reset: function () {
+ clearTimeout(this._timer);
+ }, emit: function () {
+ this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
+ } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
+ jc = 2;kc.prototype = { set: function (a) {
+ return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
+ }, stop: function (a) {
+ this.session.stopped = a ? jc : ic;
+ }, recognize: function (a) {
+ var b = this.session;if (!b.stopped) {
+ this.touchAction.preventDefaults(a);var c,
+ d = this.recognizers,
+ e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
+ c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++;
+ }
+ }
+ }, get: function (a) {
+ if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
+ if (b[c].options.event == a) return b[c];
+ }return null;
+ }, add: function (a) {
+ if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
+ }, remove: function (a) {
+ if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
+ }, on: function (a, b) {
+ var c = this.handlers;return m(x(a), function (a) {
+ c[a] = c[a] || [], c[a].push(b);
+ }), this;
+ }, off: function (a, b) {
+ var c = this.handlers;return m(x(a), function (a) {
+ b ? c[a].splice(y(c[a], b), 1) : delete c[a];
+ }), this;
+ }, emit: function (a, b) {
+ this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
+ b.type = a, b.preventDefault = function () {
+ b.srcEvent.preventDefault();
+ };for (var d = 0; d < c.length;) {
+ c[d](b), d++;
+ }
+ }
+ }, destroy: function () {
+ this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
+ } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () {
+ return hc;
+ }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;
+}(window, document, "Hammer");;(function (factory) {
+ if (typeof define === 'function' && define.amd) {
+ define(['jquery', 'hammerjs'], factory);
+ } else if (typeof exports === 'object') {
+ factory(require('jquery'), require('hammerjs'));
+ } else {
+ factory(jQuery, Hammer);
+ }
+})(function ($, Hammer) {
+ function hammerify(el, options) {
+ var $el = $(el);
+ if (!$el.data("hammer")) {
+ $el.data("hammer", new Hammer($el[0], options));
+ }
+ }
+
+ $.fn.hammer = function (options) {
+ return this.each(function () {
+ hammerify(this, options);
+ });
+ };
+
+ // extend the emit method to also trigger jQuery events
+ Hammer.Manager.prototype.emit = function (originalEmit) {
+ return function (type, data) {
+ originalEmit.call(this, type, data);
+ $(this.element).trigger({
+ type: type,
+ gesture: data
+ });
+ };
+ }(Hammer.Manager.prototype.emit);
+});
+; // Required for Meteor package, the use of window prevents export by Meteor
+(function (window) {
+ if (window.Package) {
+ Materialize = {};
+ } else {
+ window.Materialize = {};
+ }
+})(window);
+
+if (typeof exports !== 'undefined' && !exports.nodeType) {
+ if (typeof module !== 'undefined' && !module.nodeType && module.exports) {
+ exports = module.exports = Materialize;
+ }
+ exports.default = Materialize;
+}
+
+/*
+ * raf.js
+ * https://github.com/ngryman/raf.js
+ *
+ * original requestAnimationFrame polyfill by Erik Möller
+ * inspired from paul_irish gist and post
+ *
+ * Copyright (c) 2013 ngryman
+ * Licensed under the MIT license.
+ */
+(function (window) {
+ var lastTime = 0,
+ vendors = ['webkit', 'moz'],
+ requestAnimationFrame = window.requestAnimationFrame,
+ cancelAnimationFrame = window.cancelAnimationFrame,
+ i = vendors.length;
+
+ // try to un-prefix existing raf
+ while (--i >= 0 && !requestAnimationFrame) {
+ requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
+ cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
+ }
+
+ // polyfill with setTimeout fallback
+ // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
+ if (!requestAnimationFrame || !cancelAnimationFrame) {
+ requestAnimationFrame = function (callback) {
+ var now = +Date.now(),
+ nextTime = Math.max(lastTime + 16, now);
+ return setTimeout(function () {
+ callback(lastTime = nextTime);
+ }, nextTime - now);
+ };
+
+ cancelAnimationFrame = clearTimeout;
+ }
+
+ // export to window
+ window.requestAnimationFrame = requestAnimationFrame;
+ window.cancelAnimationFrame = cancelAnimationFrame;
+})(window);
+
+/**
+ * Generate approximated selector string for a jQuery object
+ * @param {jQuery} obj jQuery object to be parsed
+ * @returns {string}
+ */
+Materialize.objectSelectorString = function (obj) {
+ var tagStr = obj.prop('tagName') || '';
+ var idStr = obj.attr('id') || '';
+ var classStr = obj.attr('class') || '';
+ return (tagStr + idStr + classStr).replace(/\s/g, '');
+};
+
+// Unique Random ID
+Materialize.guid = function () {
+ function s4() {
+ return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
+ }
+ return function () {
+ return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
+ };
+}();
+
+/**
+ * Escapes hash from special characters
+ * @param {string} hash String returned from this.hash
+ * @returns {string}
+ */
+Materialize.escapeHash = function (hash) {
+ return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
+};
+
+Materialize.elementOrParentIsFixed = function (element) {
+ var $element = $(element);
+ var $checkElements = $element.add($element.parents());
+ var isFixed = false;
+ $checkElements.each(function () {
+ if ($(this).css("position") === "fixed") {
+ isFixed = true;
+ return false;
+ }
+ });
+ return isFixed;
+};
+
+/**
+ * Get time in ms
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @type {function}
+ * @return {number}
+ */
+var getTime = Date.now || function () {
+ return new Date().getTime();
+};
+
+/**
+ * Returns a function, that, when invoked, will only be triggered at most once
+ * during a given window of time. Normally, the throttled function will run
+ * as much as it can, without ever going more than once per `wait` duration;
+ * but if you'd like to disable the execution on the leading edge, pass
+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @param {function} func
+ * @param {number} wait
+ * @param {Object=} options
+ * @returns {Function}
+ */
+Materialize.throttle = function (func, wait, options) {
+ var context, args, result;
+ var timeout = null;
+ var previous = 0;
+ options || (options = {});
+ var later = function () {
+ previous = options.leading === false ? 0 : getTime();
+ timeout = null;
+ result = func.apply(context, args);
+ context = args = null;
+ };
+ return function () {
+ var now = getTime();
+ if (!previous && options.leading === false) previous = now;
+ var remaining = wait - (now - previous);
+ context = this;
+ args = arguments;
+ if (remaining <= 0) {
+ clearTimeout(timeout);
+ timeout = null;
+ previous = now;
+ result = func.apply(context, args);
+ context = args = null;
+ } else if (!timeout && options.trailing !== false) {
+ timeout = setTimeout(later, remaining);
+ }
+ return result;
+ };
+};
+
+// Velocity has conflicts when loaded with jQuery, this will check for it
+// First, check if in noConflict mode
+var Vel;
+if (jQuery) {
+ Vel = jQuery.Velocity;
+} else if ($) {
+ Vel = $.Velocity;
+} else {
+ Vel = Velocity;
+}
+
+if (Vel) {
+ Materialize.Vel = Vel;
+} else {
+ Materialize.Vel = Velocity;
+}
+;(function ($) {
+ $.fn.collapsible = function (options, methodParam) {
+ var defaults = {
+ accordion: undefined,
+ onOpen: undefined,
+ onClose: undefined
+ };
+
+ var methodName = options;
+ options = $.extend(defaults, options);
+
+ return this.each(function () {
+
+ var $this = $(this);
+
+ var $panel_headers = $(this).find('> li > .collapsible-header');
+
+ var collapsible_type = $this.data("collapsible");
+
+ /****************
+ Helper Functions
+ ****************/
+
+ // Accordion Open
+ function accordionOpen(object) {
+ $panel_headers = $this.find('> li > .collapsible-header');
+ if (object.hasClass('active')) {
+ object.parent().addClass('active');
+ } else {
+ object.parent().removeClass('active');
+ }
+ if (object.parent().hasClass('active')) {
+ object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
+ $(this).css('height', '');
+ } });
+ } else {
+ object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
+ $(this).css('height', '');
+ } });
+ }
+
+ $panel_headers.not(object).removeClass('active').parent().removeClass('active');
+
+ // Close previously open accordion elements.
+ $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
+ if ($(this).is(':visible')) {
+ $(this).slideUp({
+ duration: 350,
+ easing: "easeOutQuart",
+ queue: false,
+ complete: function () {
+ $(this).css('height', '');
+ execCallbacks($(this).siblings('.collapsible-header'));
+ }
+ });
+ }
+ });
+ }
+
+ // Expandable Open
+ function expandableOpen(object) {
+ if (object.hasClass('active')) {
+ object.parent().addClass('active');
+ } else {
+ object.parent().removeClass('active');
+ }
+ if (object.parent().hasClass('active')) {
+ object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
+ $(this).css('height', '');
+ } });
+ } else {
+ object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
+ $(this).css('height', '');
+ } });
+ }
+ }
+
+ // Open collapsible. object: .collapsible-header
+ function collapsibleOpen(object, noToggle) {
+ if (!noToggle) {
+ object.toggleClass('active');
+ }
+
+ if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
+ // Handle Accordion
+ accordionOpen(object);
+ } else {
+ // Handle Expandables
+ expandableOpen(object);
+ }
+
+ execCallbacks(object);
+ }
+
+ // Handle callbacks
+ function execCallbacks(object) {
+ if (object.hasClass('active')) {
+ if (typeof options.onOpen === "function") {
+ options.onOpen.call(this, object.parent());
+ }
+ } else {
+ if (typeof options.onClose === "function") {
+ options.onClose.call(this, object.parent());
+ }
+ }
+ }
+
+ /**
+ * Check if object is children of panel header
+ * @param {Object} object Jquery object
+ * @return {Boolean} true if it is children
+ */
+ function isChildrenOfPanelHeader(object) {
+
+ var panelHeader = getPanelHeader(object);
+
+ return panelHeader.length > 0;
+ }
+
+ /**
+ * Get panel header from a children element
+ * @param {Object} object Jquery object
+ * @return {Object} panel header object
+ */
+ function getPanelHeader(object) {
+
+ return object.closest('li > .collapsible-header');
+ }
+
+ // Turn off any existing event handlers
+ function removeEventHandlers() {
+ $this.off('click.collapse', '> li > .collapsible-header');
+ }
+
+ /***** End Helper Functions *****/
+
+ // Methods
+ if (methodName === 'destroy') {
+ removeEventHandlers();
+ return;
+ } else if (methodParam >= 0 && methodParam < $panel_headers.length) {
+ var $curr_header = $panel_headers.eq(methodParam);
+ if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) {
+ collapsibleOpen($curr_header);
+ }
+ return;
+ }
+
+ removeEventHandlers();
+
+ // Add click handler to only direct collapsible header children
+ $this.on('click.collapse', '> li > .collapsible-header', function (e) {
+ var element = $(e.target);
+
+ if (isChildrenOfPanelHeader(element)) {
+ element = getPanelHeader(element);
+ }
+
+ collapsibleOpen(element);
+ });
+
+ // Open first active
+ if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
+ // Handle Accordion
+ collapsibleOpen($panel_headers.filter('.active').first(), true);
+ } else {
+ // Handle Expandables
+ $panel_headers.filter('.active').each(function () {
+ collapsibleOpen($(this), true);
+ });
+ }
+ });
+ };
+
+ $(document).ready(function () {
+ $('.collapsible').collapsible();
+ });
+})(jQuery);;(function ($) {
+
+ // Add posibility to scroll to selected option
+ // usefull for select for example
+ $.fn.scrollTo = function (elem) {
+ $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
+ return this;
+ };
+
+ $.fn.dropdown = function (options) {
+ var defaults = {
+ inDuration: 300,
+ outDuration: 225,
+ constrainWidth: true, // Constrains width of dropdown to the activator
+ hover: false,
+ gutter: 0, // Spacing from edge
+ belowOrigin: false,
+ alignment: 'left',
+ stopPropagation: false
+ };
+
+ // Open dropdown.
+ if (options === "open") {
+ this.each(function () {
+ $(this).trigger('open');
+ });
+ return false;
+ }
+
+ // Close dropdown.
+ if (options === "close") {
+ this.each(function () {
+ $(this).trigger('close');
+ });
+ return false;
+ }
+
+ this.each(function () {
+ var origin = $(this);
+ var curr_options = $.extend({}, defaults, options);
+ var isFocused = false;
+
+ // Dropdown menu
+ var activates = $("#" + origin.attr('data-activates'));
+
+ function updateOptions() {
+ if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
+ if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
+ if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
+ if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
+ if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
+ if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
+ if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
+ if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
+ }
+
+ updateOptions();
+
+ // Attach dropdown to its activator
+ origin.after(activates);
+
+ /*
+ Helper function to position and resize dropdown.
+ Used in hover and click handler.
+ */
+ function placeDropdown(eventType) {
+ // Check for simultaneous focus and click events.
+ if (eventType === 'focus') {
+ isFocused = true;
+ }
+
+ // Check html data attributes
+ updateOptions();
+
+ // Set Dropdown state
+ activates.addClass('active');
+ origin.addClass('active');
+
+ var originWidth = origin[0].getBoundingClientRect().width;
+
+ // Constrain width
+ if (curr_options.constrainWidth === true) {
+ activates.css('width', originWidth);
+ } else {
+ activates.css('white-space', 'nowrap');
+ }
+
+ // Offscreen detection
+ var windowHeight = window.innerHeight;
+ var originHeight = origin.innerHeight();
+ var offsetLeft = origin.offset().left;
+ var offsetTop = origin.offset().top - $(window).scrollTop();
+ var currAlignment = curr_options.alignment;
+ var gutterSpacing = 0;
+ var leftPosition = 0;
+
+ // Below Origin
+ var verticalOffset = 0;
+ if (curr_options.belowOrigin === true) {
+ verticalOffset = originHeight;
+ }
+
+ // Check for scrolling positioned container.
+ var scrollYOffset = 0;
+ var scrollXOffset = 0;
+ var wrapper = origin.parent();
+ if (!wrapper.is('body')) {
+ if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
+ scrollYOffset = wrapper[0].scrollTop;
+ }
+ if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
+ scrollXOffset = wrapper[0].scrollLeft;
+ }
+ }
+
+ if (offsetLeft + activates.innerWidth() > $(window).width()) {
+ // Dropdown goes past screen on right, force right alignment
+ currAlignment = 'right';
+ } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
+ // Dropdown goes past screen on left, force left alignment
+ currAlignment = 'left';
+ }
+ // Vertical bottom offscreen detection
+ if (offsetTop + activates.innerHeight() > windowHeight) {
+ // If going upwards still goes offscreen, just crop height of dropdown.
+ if (offsetTop + originHeight - activates.innerHeight() < 0) {
+ var adjustedHeight = windowHeight - offsetTop - verticalOffset;
+ activates.css('max-height', adjustedHeight);
+ } else {
+ // Flow upwards.
+ if (!verticalOffset) {
+ verticalOffset += originHeight;
+ }
+ verticalOffset -= activates.innerHeight();
+ }
+ }
+
+ // Handle edge alignment
+ if (currAlignment === 'left') {
+ gutterSpacing = curr_options.gutter;
+ leftPosition = origin.position().left + gutterSpacing;
+ } else if (currAlignment === 'right') {
+ // Material icons fix
+ activates.stop(true, true).css({
+ opacity: 0,
+ left: 0
+ });
+
+ var offsetRight = origin.position().left + originWidth - activates.width();
+ gutterSpacing = -curr_options.gutter;
+ leftPosition = offsetRight + gutterSpacing;
+ }
+
+ // Position dropdown
+ activates.css({
+ position: 'absolute',
+ top: origin.position().top + verticalOffset + scrollYOffset,
+ left: leftPosition + scrollXOffset
+ });
+
+ // Show dropdown
+ activates.slideDown({
+ queue: false,
+ duration: curr_options.inDuration,
+ easing: 'easeOutCubic',
+ complete: function () {
+ $(this).css('height', '');
+ }
+ }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
+
+ // Add click close handler to document
+ setTimeout(function () {
+ $(document).on('click.' + activates.attr('id'), function (e) {
+ hideDropdown();
+ $(document).off('click.' + activates.attr('id'));
+ });
+ }, 0);
+ }
+
+ function hideDropdown() {
+ // Check for simultaneous focus and click events.
+ isFocused = false;
+ activates.fadeOut(curr_options.outDuration);
+ activates.removeClass('active');
+ origin.removeClass('active');
+ $(document).off('click.' + activates.attr('id'));
+ setTimeout(function () {
+ activates.css('max-height', '');
+ }, curr_options.outDuration);
+ }
+
+ // Hover
+ if (curr_options.hover) {
+ var open = false;
+ origin.off('click.' + origin.attr('id'));
+ // Hover handler to show dropdown
+ origin.on('mouseenter', function (e) {
+ // Mouse over
+ if (open === false) {
+ placeDropdown();
+ open = true;
+ }
+ });
+ origin.on('mouseleave', function (e) {
+ // If hover on origin then to something other than dropdown content, then close
+ var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
+ if (!$(toEl).closest('.dropdown-content').is(activates)) {
+ activates.stop(true, true);
+ hideDropdown();
+ open = false;
+ }
+ });
+
+ activates.on('mouseleave', function (e) {
+ // Mouse out
+ var toEl = e.toElement || e.relatedTarget;
+ if (!$(toEl).closest('.dropdown-button').is(origin)) {
+ activates.stop(true, true);
+ hideDropdown();
+ open = false;
+ }
+ });
+
+ // Click
+ } else {
+ // Click handler to show dropdown
+ origin.off('click.' + origin.attr('id'));
+ origin.on('click.' + origin.attr('id'), function (e) {
+ if (!isFocused) {
+ if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
+ e.preventDefault(); // Prevents button click from moving window
+ if (curr_options.stopPropagation) {
+ e.stopPropagation();
+ }
+ placeDropdown('click');
+ }
+ // If origin is clicked and menu is open, close menu
+ else if (origin.hasClass('active')) {
+ hideDropdown();
+ $(document).off('click.' + activates.attr('id'));
+ }
+ }
+ });
+ } // End else
+
+ // Listen to open and close event - useful for select component
+ origin.on('open', function (e, eventType) {
+ placeDropdown(eventType);
+ });
+ origin.on('close', hideDropdown);
+ });
+ }; // End dropdown plugin
+
+ $(document).ready(function () {
+ $('.dropdown-button').dropdown();
+ });
+})(jQuery);
+;(function ($, Vel) {
+ 'use strict';
+
+ var _defaults = {
+ opacity: 0.5,
+ inDuration: 250,
+ outDuration: 250,
+ ready: undefined,
+ complete: undefined,
+ dismissible: true,
+ startingTop: '4%',
+ endingTop: '10%'
+ };
+
+ /**
+ * @class
+ *
+ */
+
+ var Modal = function () {
+ /**
+ * Construct Modal instance and set up overlay
+ * @constructor
+ * @param {jQuery} $el
+ * @param {Object} options
+ */
+ function Modal($el, options) {
+ _classCallCheck(this, Modal);
+
+ // If exists, destroy and reinitialize
+ if (!!$el[0].M_Modal) {
+ $el[0].M_Modal.destroy();
+ }
+
+ /**
+ * The jQuery element
+ * @type {jQuery}
+ */
+ this.$el = $el;
+
+ /**
+ * Options for the modal
+ * @member Modal#options
+ * @prop {Number} [opacity=0.5] - Opacity of the modal overlay
+ * @prop {Number} [inDuration=250] - Length in ms of enter transition
+ * @prop {Number} [outDuration=250] - Length in ms of exit transition
+ * @prop {Function} ready - Callback function called when modal is finished entering
+ * @prop {Function} complete - Callback function called when modal is finished exiting
+ * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
+ * @prop {String} [startingTop='4%'] - startingTop
+ * @prop {String} [endingTop='10%'] - endingTop
+ */
+ this.options = $.extend({}, Modal.defaults, options);
+
+ /**
+ * Describes open/close state of modal
+ * @type {Boolean}
+ */
+ this.isOpen = false;
+
+ this.$el[0].M_Modal = this;
+ this.id = $el.attr('id');
+ this.openingTrigger = undefined;
+ this.$overlay = $('
');
+
+ Modal._increment++;
+ Modal._count++;
+ this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
+ this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
+ this.setupEventHandlers();
+ }
+
+ _createClass(Modal, [{
+ key: 'getInstance',
+
+
+ /**
+ * Get Instance
+ */
+ value: function getInstance() {
+ return this;
+ }
+
+ /**
+ * Teardown component
+ */
+
+ }, {
+ key: 'destroy',
+ value: function destroy() {
+ this.removeEventHandlers();
+ this.$el[0].removeAttribute('style');
+ if (!!this.$overlay[0].parentNode) {
+ this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
+ }
+ this.$el[0].M_Modal = undefined;
+ Modal._count--;
+ }
+
+ /**
+ * Setup Event Handlers
+ */
+
+ }, {
+ key: 'setupEventHandlers',
+ value: function setupEventHandlers() {
+ this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
+ this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
+
+ if (Modal._count === 1) {
+ document.body.addEventListener('click', this.handleTriggerClick);
+ }
+ this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
+ this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
+ }
+
+ /**
+ * Remove Event Handlers
+ */
+
+ }, {
+ key: 'removeEventHandlers',
+ value: function removeEventHandlers() {
+ if (Modal._count === 0) {
+ document.body.removeEventListener('click', this.handleTriggerClick);
+ }
+ this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
+ this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
+ }
+
+ /**
+ * Handle Trigger Click
+ * @param {Event} e
+ */
+
+ }, {
+ key: 'handleTriggerClick',
+ value: function handleTriggerClick(e) {
+ var $trigger = $(e.target).closest('.modal-trigger');
+ if (e.target && $trigger.length) {
+ var modalId = $trigger[0].getAttribute('href');
+ if (modalId) {
+ modalId = modalId.slice(1);
+ } else {
+ modalId = $trigger[0].getAttribute('data-target');
+ }
+ var modalInstance = document.getElementById(modalId).M_Modal;
+ if (modalInstance) {
+ modalInstance.open($trigger);
+ }
+ e.preventDefault();
+ }
+ }
+
+ /**
+ * Handle Overlay Click
+ */
+
+ }, {
+ key: 'handleOverlayClick',
+ value: function handleOverlayClick() {
+ if (this.options.dismissible) {
+ this.close();
+ }
+ }
+
+ /**
+ * Handle Modal Close Click
+ * @param {Event} e
+ */
+
+ }, {
+ key: 'handleModalCloseClick',
+ value: function handleModalCloseClick(e) {
+ var $closeTrigger = $(e.target).closest('.modal-close');
+ if (e.target && $closeTrigger.length) {
+ this.close();
+ }
+ }
+
+ /**
+ * Handle Keydown
+ * @param {Event} e
+ */
+
+ }, {
+ key: 'handleKeydown',
+ value: function handleKeydown(e) {
+ // ESC key
+ if (e.keyCode === 27 && this.options.dismissible) {
+ this.close();
+ }
+ }
+
+ /**
+ * Animate in modal
+ */
+
+ }, {
+ key: 'animateIn',
+ value: function animateIn() {
+ var _this = this;
+
+ // Set initial styles
+ $.extend(this.$el[0].style, {
+ display: 'block',
+ opacity: 0
+ });
+ $.extend(this.$overlay[0].style, {
+ display: 'block',
+ opacity: 0
+ });
+
+ // Animate overlay
+ Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
+
+ // Define modal animation options
+ var enterVelocityOptions = {
+ duration: this.options.inDuration,
+ queue: false,
+ ease: 'easeOutCubic',
+ // Handle modal ready callback
+ complete: function () {
+ if (typeof _this.options.ready === 'function') {
+ _this.options.ready.call(_this, _this.$el, _this.openingTrigger);
+ }
+ }
+ };
+
+ // Bottom sheet animation
+ if (this.$el[0].classList.contains('bottom-sheet')) {
+ Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
+
+ // Normal modal animation
+ } else {
+ Vel.hook(this.$el[0], 'scaleX', 0.7);
+ this.$el[0].style.top = this.options.startingTop;
+ Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
+ }
+ }
+
+ /**
+ * Animate out modal
+ */
+
+ }, {
+ key: 'animateOut',
+ value: function animateOut() {
+ var _this2 = this;
+
+ // Animate overlay
+ Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
+
+ // Define modal animation options
+ var exitVelocityOptions = {
+ duration: this.options.outDuration,
+ queue: false,
+ ease: 'easeOutCubic',
+ // Handle modal ready callback
+ complete: function () {
+ _this2.$el[0].style.display = 'none';
+ // Call complete callback
+ if (typeof _this2.options.complete === 'function') {
+ _this2.options.complete.call(_this2, _this2.$el);
+ }
+ _this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]);
+ }
+ };
+
+ // Bottom sheet animation
+ if (this.$el[0].classList.contains('bottom-sheet')) {
+ Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
+
+ // Normal modal animation
+ } else {
+ Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
+ }
+ }
+
+ /**
+ * Open Modal
+ * @param {jQuery} [$trigger]
+ */
+
+ }, {
+ key: 'open',
+ value: function open($trigger) {
+ if (this.isOpen) {
+ return;
+ }
+
+ this.isOpen = true;
+ var body = document.body;
+ body.style.overflow = 'hidden';
+ this.$el[0].classList.add('open');
+ body.appendChild(this.$overlay[0]);
+
+ // Set opening trigger, undefined indicates modal was opened by javascript
+ this.openingTrigger = !!$trigger ? $trigger : undefined;
+
+ if (this.options.dismissible) {
+ this.handleKeydownBound = this.handleKeydown.bind(this);
+ document.addEventListener('keydown', this.handleKeydownBound);
+ }
+
+ this.animateIn();
+
+ return this;
+ }
+
+ /**
+ * Close Modal
+ */
+
+ }, {
+ key: 'close',
+ value: function close() {
+ if (!this.isOpen) {
+ return;
+ }
+
+ this.isOpen = false;
+ this.$el[0].classList.remove('open');
+ document.body.style.overflow = '';
+
+ if (this.options.dismissible) {
+ document.removeEventListener('keydown', this.handleKeydownBound);
+ }
+
+ this.animateOut();
+
+ return this;
+ }
+ }], [{
+ key: 'init',
+ value: function init($els, options) {
+ var arr = [];
+ $els.each(function () {
+ arr.push(new Modal($(this), options));
+ });
+ return arr;
+ }
+ }, {
+ key: 'defaults',
+ get: function () {
+ return _defaults;
+ }
+ }]);
+
+ return Modal;
+ }();
+
+ /**
+ * @static
+ * @memberof Modal
+ */
+
+
+ Modal._increment = 0;
+
+ /**
+ * @static
+ * @memberof Modal
+ */
+ Modal._count = 0;
+
+ Materialize.Modal = Modal;
+
+ $.fn.modal = function (methodOrOptions) {
+ // Call plugin method if valid method name is passed in
+ if (Modal.prototype[methodOrOptions]) {
+ // Getter methods
+ if (methodOrOptions.slice(0, 3) === 'get') {
+ return this.first()[0].M_Modal[methodOrOptions]();
+
+ // Void methods
+ } else {
+ return this.each(function () {
+ this.M_Modal[methodOrOptions]();
+ });
+ }
+
+ // Initialize plugin if options or no argument is passed in
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+ Modal.init(this, arguments[0]);
+ return this;
+
+ // Return error if an unrecognized method name is passed in
+ } else {
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
+ }
+ };
+})(jQuery, Materialize.Vel);
+;(function ($) {
+
+ $.fn.materialbox = function () {
+
+ return this.each(function () {
+
+ if ($(this).hasClass('initialized')) {
+ return;
+ }
+
+ $(this).addClass('initialized');
+
+ var overlayActive = false;
+ var doneAnimating = true;
+ var inDuration = 275;
+ var outDuration = 200;
+ var origin = $(this);
+ var placeholder = $('').addClass('material-placeholder');
+ var originalWidth = 0;
+ var originalHeight = 0;
+ var ancestorsChanged;
+ var ancestor;
+ var originInlineStyles = origin.attr('style');
+ origin.wrap(placeholder);
+
+ // Start click handler
+ origin.on('click', function () {
+ var placeholder = origin.parent('.material-placeholder');
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var originalWidth = origin.width();
+ var originalHeight = origin.height();
+
+ // If already modal, return to original
+ if (doneAnimating === false) {
+ returnToOriginal();
+ return false;
+ } else if (overlayActive && doneAnimating === true) {
+ returnToOriginal();
+ return false;
+ }
+
+ // Set states
+ doneAnimating = false;
+ origin.addClass('active');
+ overlayActive = true;
+
+ // Set positioning for placeholder
+ placeholder.css({
+ width: placeholder[0].getBoundingClientRect().width,
+ height: placeholder[0].getBoundingClientRect().height,
+ position: 'relative',
+ top: 0,
+ left: 0
+ });
+
+ // Find ancestor with overflow: hidden; and remove it
+ ancestorsChanged = undefined;
+ ancestor = placeholder[0].parentNode;
+ var count = 0;
+ while (ancestor !== null && !$(ancestor).is(document)) {
+ var curr = $(ancestor);
+ if (curr.css('overflow') !== 'visible') {
+ curr.css('overflow', 'visible');
+ if (ancestorsChanged === undefined) {
+ ancestorsChanged = curr;
+ } else {
+ ancestorsChanged = ancestorsChanged.add(curr);
+ }
+ }
+ ancestor = ancestor.parentNode;
+ }
+
+ // Set css on origin
+ origin.css({
+ position: 'absolute',
+ 'z-index': 1000,
+ 'will-change': 'left, top, width, height'
+ }).data('width', originalWidth).data('height', originalHeight);
+
+ // Add overlay
+ var overlay = $('').css({
+ opacity: 0
+ }).click(function () {
+ if (doneAnimating === true) returnToOriginal();
+ });
+
+ // Put before in origin image to preserve z-index layering.
+ origin.before(overlay);
+
+ // Set dimensions if needed
+ var overlayOffset = overlay[0].getBoundingClientRect();
+ overlay.css({
+ width: windowWidth,
+ height: windowHeight,
+ left: -1 * overlayOffset.left,
+ top: -1 * overlayOffset.top
+ });
+
+ // Animate Overlay
+ overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
+
+ // Add and animate caption if it exists
+ if (origin.data('caption') !== "") {
+ var $photo_caption = $('');
+ $photo_caption.text(origin.data('caption'));
+ $('body').append($photo_caption);
+ $photo_caption.css({ "display": "inline" });
+ $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
+ }
+
+ // Resize Image
+ var ratio = 0;
+ var widthPercent = originalWidth / windowWidth;
+ var heightPercent = originalHeight / windowHeight;
+ var newWidth = 0;
+ var newHeight = 0;
+
+ if (widthPercent > heightPercent) {
+ ratio = originalHeight / originalWidth;
+ newWidth = windowWidth * 0.9;
+ newHeight = windowWidth * 0.9 * ratio;
+ } else {
+ ratio = originalWidth / originalHeight;
+ newWidth = windowHeight * 0.9 * ratio;
+ newHeight = windowHeight * 0.9;
+ }
+
+ // Animate image + set z-index
+ if (origin.hasClass('responsive-img')) {
+ origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
+ complete: function () {
+ origin.css({ left: 0, top: 0 }).velocity({
+ height: newHeight,
+ width: newWidth,
+ left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
+ top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
+ }, {
+ duration: inDuration,
+ queue: false,
+ easing: 'easeOutQuad',
+ complete: function () {
+ doneAnimating = true;
+ }
+ });
+ } // End Complete
+ }); // End Velocity
+ } else {
+ origin.css('left', 0).css('top', 0).velocity({
+ height: newHeight,
+ width: newWidth,
+ left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
+ top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
+ }, {
+ duration: inDuration,
+ queue: false,
+ easing: 'easeOutQuad',
+ complete: function () {
+ doneAnimating = true;
+ }
+ }); // End Velocity
+ }
+
+ // Handle Exit triggers
+ $(window).on('scroll.materialbox', function () {
+ if (overlayActive) {
+ returnToOriginal();
+ }
+ });
+
+ $(window).on('resize.materialbox', function () {
+ if (overlayActive) {
+ returnToOriginal();
+ }
+ });
+
+ $(document).on('keyup.materialbox', function (e) {
+ // ESC key
+ if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
+ returnToOriginal();
+ }
+ });
+ }); // End click handler
+
+
+ // This function returns the modaled image to the original spot
+ function returnToOriginal() {
+
+ doneAnimating = false;
+
+ var placeholder = origin.parent('.material-placeholder');
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var originalWidth = origin.data('width');
+ var originalHeight = origin.data('height');
+
+ origin.velocity("stop", true);
+ $('#materialbox-overlay').velocity("stop", true);
+ $('.materialbox-caption').velocity("stop", true);
+
+ // disable exit handlers
+ $(window).off('scroll.materialbox');
+ $(document).off('keyup.materialbox');
+ $(window).off('resize.materialbox');
+
+ $('#materialbox-overlay').velocity({ opacity: 0 }, {
+ duration: outDuration, // Delay prevents animation overlapping
+ queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ // Remove Overlay
+ overlayActive = false;
+ $(this).remove();
+ }
+ });
+
+ // Resize Image
+ origin.velocity({
+ width: originalWidth,
+ height: originalHeight,
+ left: 0,
+ top: 0
+ }, {
+ duration: outDuration,
+ queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ placeholder.css({
+ height: '',
+ width: '',
+ position: '',
+ top: '',
+ left: ''
+ });
+
+ origin.removeAttr('style');
+ origin.attr('style', originInlineStyles);
+
+ // Remove class
+ origin.removeClass('active');
+ doneAnimating = true;
+
+ // Remove overflow overrides on ancestors
+ if (ancestorsChanged) {
+ ancestorsChanged.css('overflow', '');
+ }
+ }
+ });
+
+ // Remove Caption + reset css settings on image
+ $('.materialbox-caption').velocity({ opacity: 0 }, {
+ duration: outDuration, // Delay prevents animation overlapping
+ queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ $(this).remove();
+ }
+ });
+ }
+ });
+ };
+
+ $(document).ready(function () {
+ $('.materialboxed').materialbox();
+ });
+})(jQuery);
+;(function ($) {
+
+ $.fn.parallax = function () {
+ var window_width = $(window).width();
+ // Parallax Scripts
+ return this.each(function (i) {
+ var $this = $(this);
+ $this.addClass('parallax');
+
+ function updateParallax(initial) {
+ var container_height;
+ if (window_width < 601) {
+ container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
+ } else {
+ container_height = $this.height() > 0 ? $this.height() : 500;
+ }
+ var $img = $this.children("img").first();
+ var img_height = $img.height();
+ var parallax_dist = img_height - container_height;
+ var bottom = $this.offset().top + container_height;
+ var top = $this.offset().top;
+ var scrollTop = $(window).scrollTop();
+ var windowHeight = window.innerHeight;
+ var windowBottom = scrollTop + windowHeight;
+ var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
+ var parallax = Math.round(parallax_dist * percentScrolled);
+
+ if (initial) {
+ $img.css('display', 'block');
+ }
+ if (bottom > scrollTop && top < scrollTop + windowHeight) {
+ $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
+ }
+ }
+
+ // Wait for image load
+ $this.children("img").one("load", function () {
+ updateParallax(true);
+ }).each(function () {
+ if (this.complete) $(this).trigger("load");
+ });
+
+ $(window).scroll(function () {
+ window_width = $(window).width();
+ updateParallax(false);
+ });
+
+ $(window).resize(function () {
+ window_width = $(window).width();
+ updateParallax(false);
+ });
+ });
+ };
+})(jQuery);
+;(function ($) {
+
+ var methods = {
+ init: function (options) {
+ var defaults = {
+ onShow: null,
+ swipeable: false,
+ responsiveThreshold: Infinity // breakpoint for swipeable
+ };
+ options = $.extend(defaults, options);
+ var namespace = Materialize.objectSelectorString($(this));
+
+ return this.each(function (i) {
+
+ var uniqueNamespace = namespace + i;
+
+ // For each set of tabs, we want to keep track of
+ // which tab is active and its associated content
+ var $this = $(this),
+ window_width = $(window).width();
+
+ var $active,
+ $content,
+ $links = $this.find('li.tab a'),
+ $tabs_width = $this.width(),
+ $tabs_content = $(),
+ $tabs_wrapper,
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
+ $indicator,
+ index = 0,
+ prev_index = 0,
+ clicked = false,
+ clickedTimeout,
+ transition = 300;
+
+ // Finds right attribute for indicator based on active tab.
+ // el: jQuery Object
+ var calcRightPos = function (el) {
+ return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
+ };
+
+ // Finds left attribute for indicator based on active tab.
+ // el: jQuery Object
+ var calcLeftPos = function (el) {
+ return Math.floor(el.position().left + $this.scrollLeft());
+ };
+
+ // Animates Indicator to active tab.
+ // prev_index: Number
+ var animateIndicator = function (prev_index) {
+ if (index - prev_index >= 0) {
+ $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
+ $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
+ } else {
+ $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
+ $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
+ }
+ };
+
+ // Change swipeable according to responsive threshold
+ if (options.swipeable) {
+ if (window_width > options.responsiveThreshold) {
+ options.swipeable = false;
+ }
+ }
+
+ // If the location.hash matches one of the links, use that as the active tab.
+ $active = $($links.filter('[href="' + location.hash + '"]'));
+
+ // If no match is found, use the first link or any with class 'active' as the initial active tab.
+ if ($active.length === 0) {
+ $active = $(this).find('li.tab a.active').first();
+ }
+ if ($active.length === 0) {
+ $active = $(this).find('li.tab a').first();
+ }
+
+ $active.addClass('active');
+ index = $links.index($active);
+ if (index < 0) {
+ index = 0;
+ }
+
+ if ($active[0] !== undefined) {
+ $content = $($active[0].hash);
+ $content.addClass('active');
+ }
+
+ // append indicator then set indicator width to tab width
+ if (!$this.find('.indicator').length) {
+ $this.append('');
+ }
+ $indicator = $this.find('.indicator');
+
+ // we make sure that the indicator is at the end of the tabs
+ $this.append($indicator);
+
+ if ($this.is(":visible")) {
+ // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
+ // $indicator.css({"left": index * $tab_width});
+ setTimeout(function () {
+ $indicator.css({ "right": calcRightPos($active) });
+ $indicator.css({ "left": calcLeftPos($active) });
+ }, 0);
+ }
+ $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
+ $tabs_width = $this.width();
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+ if (index < 0) {
+ index = 0;
+ }
+ if ($tab_width !== 0 && $tabs_width !== 0) {
+ $indicator.css({ "right": calcRightPos($active) });
+ $indicator.css({ "left": calcLeftPos($active) });
+ }
+ });
+
+ // Initialize Tabs Content.
+ if (options.swipeable) {
+ // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
+ $links.each(function () {
+ var $curr_content = $(Materialize.escapeHash(this.hash));
+ $curr_content.addClass('carousel-item');
+ $tabs_content = $tabs_content.add($curr_content);
+ });
+ $tabs_wrapper = $tabs_content.wrapAll('');
+ $tabs_content.css('display', '');
+ $('.tabs-content.carousel').carousel({
+ fullWidth: true,
+ noWrap: true,
+ onCycleTo: function (item) {
+ if (!clicked) {
+ var prev_index = index;
+ index = $tabs_wrapper.index(item);
+ $active.removeClass('active');
+ $active = $links.eq(index);
+ $active.addClass('active');
+ animateIndicator(prev_index);
+ if (typeof options.onShow === "function") {
+ options.onShow.call($this[0], $content);
+ }
+ }
+ }
+ });
+ } else {
+ // Hide the remaining content
+ $links.not($active).each(function () {
+ $(Materialize.escapeHash(this.hash)).hide();
+ });
+ }
+
+ // Bind the click event handler
+ $this.off('click.tabs').on('click.tabs', 'a', function (e) {
+ if ($(this).parent().hasClass('disabled')) {
+ e.preventDefault();
+ return;
+ }
+
+ // Act as regular link if target attribute is specified.
+ if (!!$(this).attr("target")) {
+ return;
+ }
+
+ clicked = true;
+ $tabs_width = $this.width();
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+
+ // Make the old tab inactive.
+ $active.removeClass('active');
+ var $oldContent = $content;
+
+ // Update the variables with the new link and content
+ $active = $(this);
+ $content = $(Materialize.escapeHash(this.hash));
+ $links = $this.find('li.tab a');
+ var activeRect = $active.position();
+
+ // Make the tab active.
+ $active.addClass('active');
+ prev_index = index;
+ index = $links.index($(this));
+ if (index < 0) {
+ index = 0;
+ }
+ // Change url to current tab
+ // window.location.hash = $active.attr('href');
+
+ // Swap content
+ if (options.swipeable) {
+ if ($tabs_content.length) {
+ $tabs_content.carousel('set', index, function () {
+ if (typeof options.onShow === "function") {
+ options.onShow.call($this[0], $content);
+ }
+ });
+ }
+ } else {
+ if ($content !== undefined) {
+ $content.show();
+ $content.addClass('active');
+ if (typeof options.onShow === "function") {
+ options.onShow.call(this, $content);
+ }
+ }
+
+ if ($oldContent !== undefined && !$oldContent.is($content)) {
+ $oldContent.hide();
+ $oldContent.removeClass('active');
+ }
+ }
+
+ // Reset clicked state
+ clickedTimeout = setTimeout(function () {
+ clicked = false;
+ }, transition);
+
+ // Update indicator
+ animateIndicator(prev_index);
+
+ // Prevent the anchor's default click action
+ e.preventDefault();
+ });
+ });
+ },
+ select_tab: function (id) {
+ this.find('a[href="#' + id + '"]').trigger('click');
+ }
+ };
+
+ $.fn.tabs = function (methodOrOptions) {
+ if (methods[methodOrOptions]) {
+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+ // Default to "init"
+ return methods.init.apply(this, arguments);
+ } else {
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
+ }
+ };
+
+ $(document).ready(function () {
+ $('ul.tabs').tabs();
+ });
+})(jQuery);
+;(function ($) {
+ $.fn.tooltip = function (options) {
+ var timeout = null,
+ margin = 5;
+
+ // Defaults
+ var defaults = {
+ delay: 350,
+ tooltip: '',
+ position: 'bottom',
+ html: false
+ };
+
+ // Remove tooltip from the activator
+ if (options === "remove") {
+ this.each(function () {
+ $('#' + $(this).attr('data-tooltip-id')).remove();
+ $(this).removeAttr('data-tooltip-id');
+ $(this).off('mouseenter.tooltip mouseleave.tooltip');
+ });
+ return false;
+ }
+
+ options = $.extend(defaults, options);
+
+ return this.each(function () {
+ var tooltipId = Materialize.guid();
+ var origin = $(this);
+
+ // Destroy old tooltip
+ if (origin.attr('data-tooltip-id')) {
+ $('#' + origin.attr('data-tooltip-id')).remove();
+ }
+
+ origin.attr('data-tooltip-id', tooltipId);
+
+ // Get attributes.
+ var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
+ var setAttributes = function () {
+ allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
+ tooltipDelay = origin.attr('data-delay');
+ tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay;
+ tooltipPosition = origin.attr('data-position');
+ tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition;
+ tooltipText = origin.attr('data-tooltip');
+ tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText;
+ };
+ setAttributes();
+
+ var renderTooltipEl = function () {
+ var tooltip = $('');
+
+ // Create Text span
+ if (allowHtml) {
+ tooltipText = $('').html(tooltipText);
+ } else {
+ tooltipText = $('').text(tooltipText);
+ }
+
+ // Create tooltip
+ tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
+
+ // Create backdrop
+ backdrop = $('');
+ backdrop.appendTo(tooltip);
+ return tooltip;
+ };
+ tooltipEl = renderTooltipEl();
+
+ // Destroy previously binded events
+ origin.off('mouseenter.tooltip mouseleave.tooltip');
+ // Mouse In
+ var started = false,
+ timeoutRef;
+ origin.on({ 'mouseenter.tooltip': function (e) {
+ var showTooltip = function () {
+ setAttributes();
+ started = true;
+ tooltipEl.velocity('stop');
+ backdrop.velocity('stop');
+ tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
+
+ // Tooltip positioning
+ var originWidth = origin.outerWidth();
+ var originHeight = origin.outerHeight();
+ var tooltipHeight = tooltipEl.outerHeight();
+ var tooltipWidth = tooltipEl.outerWidth();
+ var tooltipVerticalMovement = '0px';
+ var tooltipHorizontalMovement = '0px';
+ var backdropOffsetWidth = backdrop[0].offsetWidth;
+ var backdropOffsetHeight = backdrop[0].offsetHeight;
+ var scaleXFactor = 8;
+ var scaleYFactor = 8;
+ var scaleFactor = 0;
+ var targetTop, targetLeft, newCoordinates;
+
+ if (tooltipPosition === "top") {
+ // Top Position
+ targetTop = origin.offset().top - tooltipHeight - margin;
+ targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+ tooltipVerticalMovement = '-10px';
+ backdrop.css({
+ bottom: 0,
+ left: 0,
+ borderRadius: '14px 14px 0 0',
+ transformOrigin: '50% 100%',
+ marginTop: tooltipHeight,
+ marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
+ });
+ }
+ // Left Position
+ else if (tooltipPosition === "left") {
+ targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
+ targetLeft = origin.offset().left - tooltipWidth - margin;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+ tooltipHorizontalMovement = '-10px';
+ backdrop.css({
+ top: '-7px',
+ right: 0,
+ width: '14px',
+ height: '14px',
+ borderRadius: '14px 0 0 14px',
+ transformOrigin: '95% 50%',
+ marginTop: tooltipHeight / 2,
+ marginLeft: tooltipWidth
+ });
+ }
+ // Right Position
+ else if (tooltipPosition === "right") {
+ targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
+ targetLeft = origin.offset().left + originWidth + margin;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+ tooltipHorizontalMovement = '+10px';
+ backdrop.css({
+ top: '-7px',
+ left: 0,
+ width: '14px',
+ height: '14px',
+ borderRadius: '0 14px 14px 0',
+ transformOrigin: '5% 50%',
+ marginTop: tooltipHeight / 2,
+ marginLeft: '0px'
+ });
+ } else {
+ // Bottom Position
+ targetTop = origin.offset().top + origin.outerHeight() + margin;
+ targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+ tooltipVerticalMovement = '+10px';
+ backdrop.css({
+ top: 0,
+ left: 0,
+ marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
+ });
+ }
+
+ // Set tooptip css placement
+ tooltipEl.css({
+ top: newCoordinates.y,
+ left: newCoordinates.x
+ });
+
+ // Calculate Scale to fill
+ scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
+ scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
+ scaleFactor = Math.max(scaleXFactor, scaleYFactor);
+
+ tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
+ backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
+ };
+
+ timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
+
+ // Mouse Out
+ },
+ 'mouseleave.tooltip': function () {
+ // Reset State
+ started = false;
+ clearTimeout(timeoutRef);
+
+ // Animate back
+ setTimeout(function () {
+ if (started !== true) {
+ tooltipEl.velocity({
+ opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
+ backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
+ duration: 225,
+ queue: false,
+ complete: function () {
+ backdrop.css({ visibility: 'hidden' });
+ tooltipEl.css({ visibility: 'hidden' });
+ started = false;
+ }
+ });
+ }
+ }, 225);
+ }
+ });
+ });
+ };
+
+ var repositionWithinScreen = function (x, y, width, height) {
+ var newX = x;
+ var newY = y;
+
+ if (newX < 0) {
+ newX = 4;
+ } else if (newX + width > window.innerWidth) {
+ newX -= newX + width - window.innerWidth;
+ }
+
+ if (newY < 0) {
+ newY = 4;
+ } else if (newY + height > window.innerHeight + $(window).scrollTop) {
+ newY -= newY + height - window.innerHeight;
+ }
+
+ return { x: newX, y: newY };
+ };
+
+ $(document).ready(function () {
+ $('.tooltipped').tooltip();
+ });
+})(jQuery);
+; /*!
+ * Waves v0.6.4
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+
+;(function (window) {
+ 'use strict';
+
+ var Waves = Waves || {};
+ var $$ = document.querySelectorAll.bind(document);
+
+ // Find exact position of element
+ function isWindow(obj) {
+ return obj !== null && obj === obj.window;
+ }
+
+ function getWindow(elem) {
+ return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
+ }
+
+ function offset(elem) {
+ var docElem,
+ win,
+ box = { top: 0, left: 0 },
+ doc = elem && elem.ownerDocument;
+
+ docElem = doc.documentElement;
+
+ if (typeof elem.getBoundingClientRect !== typeof undefined) {
+ box = elem.getBoundingClientRect();
+ }
+ win = getWindow(doc);
+ return {
+ top: box.top + win.pageYOffset - docElem.clientTop,
+ left: box.left + win.pageXOffset - docElem.clientLeft
+ };
+ }
+
+ function convertStyle(obj) {
+ var style = '';
+
+ for (var a in obj) {
+ if (obj.hasOwnProperty(a)) {
+ style += a + ':' + obj[a] + ';';
+ }
+ }
+
+ return style;
+ }
+
+ var Effect = {
+
+ // Effect delay
+ duration: 750,
+
+ show: function (e, element) {
+
+ // Disable right click
+ if (e.button === 2) {
+ return false;
+ }
+
+ var el = element || this;
+
+ // Create ripple
+ var ripple = document.createElement('div');
+ ripple.className = 'waves-ripple';
+ el.appendChild(ripple);
+
+ // Get click coordinate and element witdh
+ var pos = offset(el);
+ var relativeY = e.pageY - pos.top;
+ var relativeX = e.pageX - pos.left;
+ var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
+
+ // Support for touch devices
+ if ('touches' in e) {
+ relativeY = e.touches[0].pageY - pos.top;
+ relativeX = e.touches[0].pageX - pos.left;
+ }
+
+ // Attach data to element
+ ripple.setAttribute('data-hold', Date.now());
+ ripple.setAttribute('data-scale', scale);
+ ripple.setAttribute('data-x', relativeX);
+ ripple.setAttribute('data-y', relativeY);
+
+ // Set ripple position
+ var rippleStyle = {
+ 'top': relativeY + 'px',
+ 'left': relativeX + 'px'
+ };
+
+ ripple.className = ripple.className + ' waves-notransition';
+ ripple.setAttribute('style', convertStyle(rippleStyle));
+ ripple.className = ripple.className.replace('waves-notransition', '');
+
+ // Scale the ripple
+ rippleStyle['-webkit-transform'] = scale;
+ rippleStyle['-moz-transform'] = scale;
+ rippleStyle['-ms-transform'] = scale;
+ rippleStyle['-o-transform'] = scale;
+ rippleStyle.transform = scale;
+ rippleStyle.opacity = '1';
+
+ rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['transition-duration'] = Effect.duration + 'ms';
+
+ rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+
+ ripple.setAttribute('style', convertStyle(rippleStyle));
+ },
+
+ hide: function (e) {
+ TouchHandler.touchup(e);
+
+ var el = this;
+ var width = el.clientWidth * 1.4;
+
+ // Get first ripple
+ var ripple = null;
+ var ripples = el.getElementsByClassName('waves-ripple');
+ if (ripples.length > 0) {
+ ripple = ripples[ripples.length - 1];
+ } else {
+ return false;
+ }
+
+ var relativeX = ripple.getAttribute('data-x');
+ var relativeY = ripple.getAttribute('data-y');
+ var scale = ripple.getAttribute('data-scale');
+
+ // Get delay beetween mousedown and mouse leave
+ var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
+ var delay = 350 - diff;
+
+ if (delay < 0) {
+ delay = 0;
+ }
+
+ // Fade out ripple after delay
+ setTimeout(function () {
+ var style = {
+ 'top': relativeY + 'px',
+ 'left': relativeX + 'px',
+ 'opacity': '0',
+
+ // Duration
+ '-webkit-transition-duration': Effect.duration + 'ms',
+ '-moz-transition-duration': Effect.duration + 'ms',
+ '-o-transition-duration': Effect.duration + 'ms',
+ 'transition-duration': Effect.duration + 'ms',
+ '-webkit-transform': scale,
+ '-moz-transform': scale,
+ '-ms-transform': scale,
+ '-o-transform': scale,
+ 'transform': scale
+ };
+
+ ripple.setAttribute('style', convertStyle(style));
+
+ setTimeout(function () {
+ try {
+ el.removeChild(ripple);
+ } catch (e) {
+ return false;
+ }
+ }, Effect.duration);
+ }, delay);
+ },
+
+ // Little hack to make can perform waves effect
+ wrapInput: function (elements) {
+ for (var a = 0; a < elements.length; a++) {
+ var el = elements[a];
+
+ if (el.tagName.toLowerCase() === 'input') {
+ var parent = el.parentNode;
+
+ // If input already have parent just pass through
+ if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
+ continue;
+ }
+
+ // Put element class and style to the specified parent
+ var wrapper = document.createElement('i');
+ wrapper.className = el.className + ' waves-input-wrapper';
+
+ var elementStyle = el.getAttribute('style');
+
+ if (!elementStyle) {
+ elementStyle = '';
+ }
+
+ wrapper.setAttribute('style', elementStyle);
+
+ el.className = 'waves-button-input';
+ el.removeAttribute('style');
+
+ // Put element as child
+ parent.replaceChild(wrapper, el);
+ wrapper.appendChild(el);
+ }
+ }
+ }
+ };
+
+ /**
+ * Disable mousedown event for 500ms during and after touch
+ */
+ var TouchHandler = {
+ /* uses an integer rather than bool so there's no issues with
+ * needing to clear timeouts if another touch event occurred
+ * within the 500ms. Cannot mouseup between touchstart and
+ * touchend, nor in the 500ms after touchend. */
+ touches: 0,
+ allowEvent: function (e) {
+ var allow = true;
+
+ if (e.type === 'touchstart') {
+ TouchHandler.touches += 1; //push
+ } else if (e.type === 'touchend' || e.type === 'touchcancel') {
+ setTimeout(function () {
+ if (TouchHandler.touches > 0) {
+ TouchHandler.touches -= 1; //pop after 500ms
+ }
+ }, 500);
+ } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
+ allow = false;
+ }
+
+ return allow;
+ },
+ touchup: function (e) {
+ TouchHandler.allowEvent(e);
+ }
+ };
+
+ /**
+ * Delegated click handler for .waves-effect element.
+ * returns null when .waves-effect element not in "click tree"
+ */
+ function getWavesEffectElement(e) {
+ if (TouchHandler.allowEvent(e) === false) {
+ return null;
+ }
+
+ var element = null;
+ var target = e.target || e.srcElement;
+
+ while (target.parentNode !== null) {
+ if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
+ element = target;
+ break;
+ }
+ target = target.parentNode;
+ }
+ return element;
+ }
+
+ /**
+ * Bubble the click and show effect if .waves-effect elem was found
+ */
+ function showEffect(e) {
+ var element = getWavesEffectElement(e);
+
+ if (element !== null) {
+ Effect.show(e, element);
+
+ if ('ontouchstart' in window) {
+ element.addEventListener('touchend', Effect.hide, false);
+ element.addEventListener('touchcancel', Effect.hide, false);
+ }
+
+ element.addEventListener('mouseup', Effect.hide, false);
+ element.addEventListener('mouseleave', Effect.hide, false);
+ element.addEventListener('dragend', Effect.hide, false);
+ }
+ }
+
+ Waves.displayEffect = function (options) {
+ options = options || {};
+
+ if ('duration' in options) {
+ Effect.duration = options.duration;
+ }
+
+ //Wrap input inside tag
+ Effect.wrapInput($$('.waves-effect'));
+
+ if ('ontouchstart' in window) {
+ document.body.addEventListener('touchstart', showEffect, false);
+ }
+
+ document.body.addEventListener('mousedown', showEffect, false);
+ };
+
+ /**
+ * Attach Waves to an input element (or any element which doesn't
+ * bubble mouseup/mousedown events).
+ * Intended to be used with dynamically loaded forms/inputs, or
+ * where the user doesn't want a delegated click handler.
+ */
+ Waves.attach = function (element) {
+ //FUTURE: automatically add waves classes and allow users
+ // to specify them with an options param? Eg. light/classic/button
+ if (element.tagName.toLowerCase() === 'input') {
+ Effect.wrapInput([element]);
+ element = element.parentNode;
+ }
+
+ if ('ontouchstart' in window) {
+ element.addEventListener('touchstart', showEffect, false);
+ }
+
+ element.addEventListener('mousedown', showEffect, false);
+ };
+
+ window.Waves = Waves;
+
+ document.addEventListener('DOMContentLoaded', function () {
+ Waves.displayEffect();
+ }, false);
+})(window);
+;(function ($, Vel) {
+ 'use strict';
+
+ var _defaults = {
+ displayLength: Infinity,
+ inDuration: 300,
+ outDuration: 375,
+ className: undefined,
+ completeCallback: undefined,
+ activationPercent: 0.8
+ };
+
+ var Toast = function () {
+ function Toast(message, displayLength, className, completeCallback) {
+ _classCallCheck(this, Toast);
+
+ if (!message) {
+ return;
+ }
+
+ /**
+ * Options for the toast
+ * @member Toast#options
+ */
+ this.options = {
+ displayLength: displayLength,
+ className: className,
+ completeCallback: completeCallback
+ };
+
+ this.options = $.extend({}, Toast.defaults, this.options);
+ this.message = message;
+
+ /**
+ * Describes current pan state toast
+ * @type {Boolean}
+ */
+ this.panning = false;
+
+ /**
+ * Time remaining until toast is removed
+ */
+ this.timeRemaining = this.options.displayLength;
+
+ if (Toast._toasts.length === 0) {
+ Toast._createContainer();
+ }
+
+ // Create new toast
+ Toast._toasts.push(this);
+ var toastElement = this.createToast();
+ toastElement.M_Toast = this;
+ this.el = toastElement;
+ this._animateIn();
+ this.setTimer();
+ }
+
+ _createClass(Toast, [{
+ key: 'createToast',
+
+
+ /**
+ * Create toast and append it to toast container
+ */
+ value: function createToast() {
+ var toast = document.createElement('div');
+ toast.classList.add('toast');
+
+ // Add custom classes onto toast
+ if (this.options.className) {
+ var classes = this.options.className.split(' ');
+ var i = void 0,
+ count = void 0;
+ for (i = 0, count = classes.length; i < count; i++) {
+ toast.classList.add(classes[i]);
+ }
+ }
+
+ // Set content
+ if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
+ toast.appendChild(this.message);
+
+ // Check if it is jQuery object
+ } else if (this.message instanceof jQuery) {
+ $(toast).append(this.message);
+
+ // Insert as text;
+ } else {
+ toast.innerHTML = this.message;
+ }
+
+ // Append toasft
+ Toast._container.appendChild(toast);
+ return toast;
+ }
+
+ /**
+ * Animate in toast
+ */
+
+ }, {
+ key: '_animateIn',
+ value: function _animateIn() {
+ // Animate toast in
+ Vel(this.el, { top: 0, opacity: 1 }, {
+ duration: 300,
+ easing: 'easeOutCubic',
+ queue: false
+ });
+ }
+
+ /**
+ * Create setInterval which automatically removes toast when timeRemaining >= 0
+ * has been reached
+ */
+
+ }, {
+ key: 'setTimer',
+ value: function setTimer() {
+ var _this3 = this;
+
+ if (this.timeRemaining !== Infinity) {
+ this.counterInterval = setInterval(function () {
+ // If toast is not being dragged, decrease its time remaining
+ if (!_this3.panning) {
+ _this3.timeRemaining -= 20;
+ }
+
+ // Animate toast out
+ if (_this3.timeRemaining <= 0) {
+ _this3.remove();
+ }
+ }, 20);
+ }
+ }
+
+ /**
+ * Dismiss toast with animation
+ */
+
+ }, {
+ key: 'remove',
+ value: function remove() {
+ var _this4 = this;
+
+ window.clearInterval(this.counterInterval);
+ var activationDistance = this.el.offsetWidth * this.options.activationPercent;
+
+ if (this.wasSwiped) {
+ this.el.style.transition = 'transform .05s, opacity .05s';
+ this.el.style.transform = 'translateX(' + activationDistance + 'px)';
+ this.el.style.opacity = 0;
+ }
+
+ Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
+ duration: this.options.outDuration,
+ easing: 'easeOutExpo',
+ queue: false,
+ complete: function () {
+ // Call the optional callback
+ if (typeof _this4.options.completeCallback === 'function') {
+ _this4.options.completeCallback();
+ }
+ // Remove toast from DOM
+ _this4.el.parentNode.removeChild(_this4.el);
+ Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
+ if (Toast._toasts.length === 0) {
+ Toast._removeContainer();
+ }
+ }
+ });
+ }
+ }], [{
+ key: '_createContainer',
+
+
+ /**
+ * Append toast container and add event handlers
+ */
+ value: function _createContainer() {
+ var container = document.createElement('div');
+ container.setAttribute('id', 'toast-container');
+
+ // Add event handler
+ container.addEventListener('touchstart', Toast._onDragStart);
+ container.addEventListener('touchmove', Toast._onDragMove);
+ container.addEventListener('touchend', Toast._onDragEnd);
+
+ container.addEventListener('mousedown', Toast._onDragStart);
+ document.addEventListener('mousemove', Toast._onDragMove);
+ document.addEventListener('mouseup', Toast._onDragEnd);
+
+ document.body.appendChild(container);
+ Toast._container = container;
+ }
+
+ /**
+ * Remove toast container and event handlers
+ */
+
+ }, {
+ key: '_removeContainer',
+ value: function _removeContainer() {
+ // Add event handler
+ document.removeEventListener('mousemove', Toast._onDragMove);
+ document.removeEventListener('mouseup', Toast._onDragEnd);
+
+ Toast._container.parentNode.removeChild(Toast._container);
+ Toast._container = null;
+ }
+
+ /**
+ * Begin drag handler
+ * @param {Event} e
+ */
+
+ }, {
+ key: '_onDragStart',
+ value: function _onDragStart(e) {
+ if (e.target && $(e.target).closest('.toast').length) {
+ var $toast = $(e.target).closest('.toast');
+ var toast = $toast[0].M_Toast;
+ toast.panning = true;
+ Toast._draggedToast = toast;
+ toast.el.classList.add('panning');
+ toast.el.style.transition = '';
+ toast.startingXPos = Toast._xPos(e);
+ toast.time = Date.now();
+ toast.xPos = Toast._xPos(e);
+ }
+ }
+
+ /**
+ * Drag move handler
+ * @param {Event} e
+ */
+
+ }, {
+ key: '_onDragMove',
+ value: function _onDragMove(e) {
+ if (!!Toast._draggedToast) {
+ e.preventDefault();
+ var toast = Toast._draggedToast;
+ toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
+ toast.xPos = Toast._xPos(e);
+ toast.velocityX = toast.deltaX / (Date.now() - toast.time);
+ toast.time = Date.now();
+
+ var totalDeltaX = toast.xPos - toast.startingXPos;
+ var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
+ toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
+ toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
+ }
+ }
+
+ /**
+ * End drag handler
+ * @param {Event} e
+ */
+
+ }, {
+ key: '_onDragEnd',
+ value: function _onDragEnd(e) {
+ if (!!Toast._draggedToast) {
+ var toast = Toast._draggedToast;
+ toast.panning = false;
+ toast.el.classList.remove('panning');
+
+ var totalDeltaX = toast.xPos - toast.startingXPos;
+ var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
+ var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;
+
+ // Remove toast
+ if (shouldBeDismissed) {
+ toast.wasSwiped = true;
+ toast.remove();
+
+ // Animate toast back to original position
+ } else {
+ toast.el.style.transition = 'transform .2s, opacity .2s';
+ toast.el.style.transform = '';
+ toast.el.style.opacity = '';
+ }
+ Toast._draggedToast = null;
+ }
+ }
+
+ /**
+ * Get x position of mouse or touch event
+ * @param {Event} e
+ */
+
+ }, {
+ key: '_xPos',
+ value: function _xPos(e) {
+ if (e.targetTouches && e.targetTouches.length >= 1) {
+ return e.targetTouches[0].clientX;
+ }
+ // mouse event
+ return e.clientX;
+ }
+
+ /**
+ * Remove all toasts
+ */
+
+ }, {
+ key: 'removeAll',
+ value: function removeAll() {
+ for (var toastIndex in Toast._toasts) {
+ Toast._toasts[toastIndex].remove();
+ }
+ }
+ }, {
+ key: 'defaults',
+ get: function () {
+ return _defaults;
+ }
+ }]);
+
+ return Toast;
+ }();
+
+ /**
+ * @static
+ * @memberof Toast
+ * @type {Array.}
+ */
+
+
+ Toast._toasts = [];
+
+ /**
+ * @static
+ * @memberof Toast
+ */
+ Toast._container = null;
+
+ /**
+ * @static
+ * @memberof Toast
+ * @type {Toast}
+ */
+ Toast._draggedToast = null;
+
+ Materialize.Toast = Toast;
+ Materialize.toast = function (message, displayLength, className, completeCallback) {
+ return new Toast(message, displayLength, className, completeCallback);
+ };
+})(jQuery, Materialize.Vel);
+;(function ($) {
+
+ var methods = {
+ init: function (options) {
+ var defaults = {
+ menuWidth: 300,
+ edge: 'left',
+ closeOnClick: false,
+ draggable: true,
+ onOpen: null,
+ onClose: null
+ };
+ options = $.extend(defaults, options);
+
+ $(this).each(function () {
+ var $this = $(this);
+ var menuId = $this.attr('data-activates');
+ var menu = $("#" + menuId);
+
+ // Set to width
+ if (options.menuWidth != 300) {
+ menu.css('width', options.menuWidth);
+ }
+
+ // Add Touch Area
+ var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
+ if (options.draggable) {
+ // Regenerate dragTarget
+ if ($dragTarget.length) {
+ $dragTarget.remove();
+ }
+
+ $dragTarget = $('').attr('data-sidenav', menuId);
+ $('body').append($dragTarget);
+ } else {
+ $dragTarget = $();
+ }
+
+ if (options.edge == 'left') {
+ menu.css('transform', 'translateX(-100%)');
+ $dragTarget.css({ 'left': 0 }); // Add Touch Area
+ } else {
+ menu.addClass('right-aligned') // Change text-alignment to right
+ .css('transform', 'translateX(100%)');
+ $dragTarget.css({ 'right': 0 }); // Add Touch Area
+ }
+
+ // If fixed sidenav, bring menu out
+ if (menu.hasClass('fixed')) {
+ if (window.innerWidth > 992) {
+ menu.css('transform', 'translateX(0)');
+ }
+ }
+
+ // Window resize to reset on large screens fixed
+ if (menu.hasClass('fixed')) {
+ $(window).resize(function () {
+ if (window.innerWidth > 992) {
+ // Close menu if window is resized bigger than 992 and user has fixed sidenav
+ if ($('#sidenav-overlay').length !== 0 && menuOut) {
+ removeMenu(true);
+ } else {
+ // menu.removeAttr('style');
+ menu.css('transform', 'translateX(0%)');
+ // menu.css('width', options.menuWidth);
+ }
+ } else if (menuOut === false) {
+ if (options.edge === 'left') {
+ menu.css('transform', 'translateX(-100%)');
+ } else {
+ menu.css('transform', 'translateX(100%)');
+ }
+ }
+ });
+ }
+
+ // if closeOnClick, then add close event for all a tags in side sideNav
+ if (options.closeOnClick === true) {
+ menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
+ if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
+ removeMenu();
+ }
+ });
+ }
+
+ var removeMenu = function (restoreNav) {
+ panning = false;
+ menuOut = false;
+ // Reenable scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+
+ $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
+ queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ $(this).remove();
+ } });
+ if (options.edge === 'left') {
+ // Reset phantom div
+ $dragTarget.css({ width: '', right: '', left: '0' });
+ menu.velocity({ 'translateX': '-100%' }, { duration: 200,
+ queue: false,
+ easing: 'easeOutCubic',
+ complete: function () {
+ if (restoreNav === true) {
+ // Restore Fixed sidenav
+ menu.removeAttr('style');
+ menu.css('width', options.menuWidth);
+ }
+ }
+
+ });
+ } else {
+ // Reset phantom div
+ $dragTarget.css({ width: '', right: '0', left: '' });
+ menu.velocity({ 'translateX': '100%' }, { duration: 200,
+ queue: false,
+ easing: 'easeOutCubic',
+ complete: function () {
+ if (restoreNav === true) {
+ // Restore Fixed sidenav
+ menu.removeAttr('style');
+ menu.css('width', options.menuWidth);
+ }
+ }
+ });
+ }
+
+ // Callback
+ if (typeof options.onClose === 'function') {
+ options.onClose.call(this, menu);
+ }
+ };
+
+ // Touch Event
+ var panning = false;
+ var menuOut = false;
+
+ if (options.draggable) {
+ $dragTarget.on('click', function () {
+ if (menuOut) {
+ removeMenu();
+ }
+ });
+
+ $dragTarget.hammer({
+ prevent_default: false
+ }).on('pan', function (e) {
+
+ if (e.gesture.pointerType == "touch") {
+
+ var direction = e.gesture.direction;
+ var x = e.gesture.center.x;
+ var y = e.gesture.center.y;
+ var velocityX = e.gesture.velocityX;
+
+ // Vertical scroll bugfix
+ if (x === 0 && y === 0) {
+ return;
+ }
+
+ // Disable Scrolling
+ var $body = $('body');
+ var $overlay = $('#sidenav-overlay');
+ var oldWidth = $body.innerWidth();
+ $body.css('overflow', 'hidden');
+ $body.width(oldWidth);
+
+ // If overlay does not exist, create one and if it is clicked, close menu
+ if ($overlay.length === 0) {
+ $overlay = $('');
+ $overlay.css('opacity', 0).click(function () {
+ removeMenu();
+ });
+
+ // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
+ if (typeof options.onOpen === 'function') {
+ options.onOpen.call(this, menu);
+ }
+
+ $('body').append($overlay);
+ }
+
+ // Keep within boundaries
+ if (options.edge === 'left') {
+ if (x > options.menuWidth) {
+ x = options.menuWidth;
+ } else if (x < 0) {
+ x = 0;
+ }
+ }
+
+ if (options.edge === 'left') {
+ // Left Direction
+ if (x < options.menuWidth / 2) {
+ menuOut = false;
+ }
+ // Right Direction
+ else if (x >= options.menuWidth / 2) {
+ menuOut = true;
+ }
+ menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
+ } else {
+ // Left Direction
+ if (x < window.innerWidth - options.menuWidth / 2) {
+ menuOut = true;
+ }
+ // Right Direction
+ else if (x >= window.innerWidth - options.menuWidth / 2) {
+ menuOut = false;
+ }
+ var rightPos = x - options.menuWidth / 2;
+ if (rightPos < 0) {
+ rightPos = 0;
+ }
+
+ menu.css('transform', 'translateX(' + rightPos + 'px)');
+ }
+
+ // Percentage overlay
+ var overlayPerc;
+ if (options.edge === 'left') {
+ overlayPerc = x / options.menuWidth;
+ $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
+ } else {
+ overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
+ $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
+ }
+ }
+ }).on('panend', function (e) {
+
+ if (e.gesture.pointerType == "touch") {
+ var $overlay = $('#sidenav-overlay');
+ var velocityX = e.gesture.velocityX;
+ var x = e.gesture.center.x;
+ var leftPos = x - options.menuWidth;
+ var rightPos = x - options.menuWidth / 2;
+ if (leftPos > 0) {
+ leftPos = 0;
+ }
+ if (rightPos < 0) {
+ rightPos = 0;
+ }
+ panning = false;
+
+ if (options.edge === 'left') {
+ // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
+ if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
+ // Return menu to open
+ if (leftPos !== 0) {
+ menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+ }
+
+ $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
+ $dragTarget.css({ width: '50%', right: 0, left: '' });
+ menuOut = true;
+ } else if (!menuOut || velocityX > 0.3) {
+ // Enable Scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+ // Slide menu closed
+ menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
+ $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
+ if (typeof options.onClose === 'function') {
+ options.onClose.call(this, menu);
+ }
+
+ $(this).remove();
+ } });
+ $dragTarget.css({ width: '10px', right: '', left: 0 });
+ }
+ } else {
+ if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
+ // Return menu to open
+ if (rightPos !== 0) {
+ menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+ }
+
+ $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
+ $dragTarget.css({ width: '50%', right: '', left: 0 });
+ menuOut = true;
+ } else if (!menuOut || velocityX < -0.3) {
+ // Enable Scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+
+ // Slide menu closed
+ menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
+ $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
+ if (typeof options.onClose === 'function') {
+ options.onClose.call(this, menu);
+ }
+
+ $(this).remove();
+ } });
+ $dragTarget.css({ width: '10px', right: 0, left: '' });
+ }
+ }
+ }
+ });
+ }
+
+ $this.off('click.sidenav').on('click.sidenav', function () {
+ if (menuOut === true) {
+ menuOut = false;
+ panning = false;
+ removeMenu();
+ } else {
+
+ // Disable Scrolling
+ var $body = $('body');
+ var $overlay = $('');
+ var oldWidth = $body.innerWidth();
+ $body.css('overflow', 'hidden');
+ $body.width(oldWidth);
+
+ // Push current drag target on top of DOM tree
+ $('body').append($dragTarget);
+
+ if (options.edge === 'left') {
+ $dragTarget.css({ width: '50%', right: 0, left: '' });
+ menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+ } else {
+ $dragTarget.css({ width: '50%', right: '', left: 0 });
+ menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+ }
+
+ // Overlay close on click
+ $overlay.css('opacity', 0).click(function () {
+ menuOut = false;
+ panning = false;
+ removeMenu();
+ $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ $(this).remove();
+ }
+ });
+ });
+
+ // Append body
+ $('body').append($overlay);
+ $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ menuOut = true;
+ panning = false;
+ }
+ });
+
+ // Callback
+ if (typeof options.onOpen === 'function') {
+ options.onOpen.call(this, menu);
+ }
+ }
+
+ return false;
+ });
+ });
+ },
+ destroy: function () {
+ var $overlay = $('#sidenav-overlay');
+ var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
+ $overlay.trigger('click');
+ $dragTarget.remove();
+ $(this).off('click');
+ $overlay.remove();
+ },
+ show: function () {
+ this.trigger('click');
+ },
+ hide: function () {
+ $('#sidenav-overlay').trigger('click');
+ }
+ };
+
+ $.fn.sideNav = function (methodOrOptions) {
+ if (methods[methodOrOptions]) {
+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+ // Default to "init"
+ return methods.init.apply(this, arguments);
+ } else {
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
+ }
+ }; // Plugin end
+})(jQuery);
+; /**
+ * Extend jquery with a scrollspy plugin.
+ * This watches the window scroll and fires events when elements are scrolled into viewport.
+ *
+ * throttle() and getTime() taken from Underscore.js
+ * https://github.com/jashkenas/underscore
+ *
+ * @author Copyright 2013 John Smart
+ * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
+ * @see https://github.com/thesmart
+ * @version 0.1.2
+ */
+(function ($) {
+
+ var jWindow = $(window);
+ var elements = [];
+ var elementsInView = [];
+ var isSpying = false;
+ var ticks = 0;
+ var unique_id = 1;
+ var offset = {
+ top: 0,
+ right: 0,
+ bottom: 0,
+ left: 0
+
+ /**
+ * Find elements that are within the boundary
+ * @param {number} top
+ * @param {number} right
+ * @param {number} bottom
+ * @param {number} left
+ * @return {jQuery} A collection of elements
+ */
+ };function findElements(top, right, bottom, left) {
+ var hits = $();
+ $.each(elements, function (i, element) {
+ if (element.height() > 0) {
+ var elTop = element.offset().top,
+ elLeft = element.offset().left,
+ elRight = elLeft + element.width(),
+ elBottom = elTop + element.height();
+
+ var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
+
+ if (isIntersect) {
+ hits.push(element);
+ }
+ }
+ });
+
+ return hits;
+ }
+
+ /**
+ * Called when the user scrolls the window
+ */
+ function onScroll(scrollOffset) {
+ // unique tick id
+ ++ticks;
+
+ // viewport rectangle
+ var top = jWindow.scrollTop(),
+ left = jWindow.scrollLeft(),
+ right = left + jWindow.width(),
+ bottom = top + jWindow.height();
+
+ // determine which elements are in view
+ var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
+ $.each(intersections, function (i, element) {
+
+ var lastTick = element.data('scrollSpy:ticks');
+ if (typeof lastTick != 'number') {
+ // entered into view
+ element.triggerHandler('scrollSpy:enter');
+ }
+
+ // update tick id
+ element.data('scrollSpy:ticks', ticks);
+ });
+
+ // determine which elements are no longer in view
+ $.each(elementsInView, function (i, element) {
+ var lastTick = element.data('scrollSpy:ticks');
+ if (typeof lastTick == 'number' && lastTick !== ticks) {
+ // exited from view
+ element.triggerHandler('scrollSpy:exit');
+ element.data('scrollSpy:ticks', null);
+ }
+ });
+
+ // remember elements in view for next tick
+ elementsInView = intersections;
+ }
+
+ /**
+ * Called when window is resized
+ */
+ function onWinSize() {
+ jWindow.trigger('scrollSpy:winSize');
+ }
+
+ /**
+ * Enables ScrollSpy using a selector
+ * @param {jQuery|string} selector The elements collection, or a selector
+ * @param {Object=} options Optional.
+ throttle : number -> scrollspy throttling. Default: 100 ms
+ offsetTop : number -> offset from top. Default: 0
+ offsetRight : number -> offset from right. Default: 0
+ offsetBottom : number -> offset from bottom. Default: 0
+ offsetLeft : number -> offset from left. Default: 0
+ activeClass : string -> Class name to be added to the active link. Default: active
+ * @returns {jQuery}
+ */
+ $.scrollSpy = function (selector, options) {
+ var defaults = {
+ throttle: 100,
+ scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
+ activeClass: 'active',
+ getActiveElement: function (id) {
+ return 'a[href="#' + id + '"]';
+ }
+ };
+ options = $.extend(defaults, options);
+
+ var visible = [];
+ selector = $(selector);
+ selector.each(function (i, element) {
+ elements.push($(element));
+ $(element).data("scrollSpy:id", i);
+ // Smooth scroll to section
+ $('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
+ e.preventDefault();
+ var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
+ $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
+ });
+ });
+
+ offset.top = options.offsetTop || 0;
+ offset.right = options.offsetRight || 0;
+ offset.bottom = options.offsetBottom || 0;
+ offset.left = options.offsetLeft || 0;
+
+ var throttledScroll = Materialize.throttle(function () {
+ onScroll(options.scrollOffset);
+ }, options.throttle || 100);
+ var readyScroll = function () {
+ $(document).ready(throttledScroll);
+ };
+
+ if (!isSpying) {
+ jWindow.on('scroll', readyScroll);
+ jWindow.on('resize', readyScroll);
+ isSpying = true;
+ }
+
+ // perform a scan once, after current execution context, and after dom is ready
+ setTimeout(readyScroll, 0);
+
+ selector.on('scrollSpy:enter', function () {
+ visible = $.grep(visible, function (value) {
+ return value.height() != 0;
+ });
+
+ var $this = $(this);
+
+ if (visible[0]) {
+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
+ if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
+ visible.unshift($(this));
+ } else {
+ visible.push($(this));
+ }
+ } else {
+ visible.push($(this));
+ }
+
+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
+ });
+ selector.on('scrollSpy:exit', function () {
+ visible = $.grep(visible, function (value) {
+ return value.height() != 0;
+ });
+
+ if (visible[0]) {
+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
+ var $this = $(this);
+ visible = $.grep(visible, function (value) {
+ return value.attr('id') != $this.attr('id');
+ });
+ if (visible[0]) {
+ // Check if empty
+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
+ }
+ }
+ });
+
+ return selector;
+ };
+
+ /**
+ * Listen for window resize events
+ * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
+ * @returns {jQuery} $(window)
+ */
+ $.winSizeSpy = function (options) {
+ $.winSizeSpy = function () {
+ return jWindow;
+ }; // lock from multiple calls
+ options = options || {
+ throttle: 100
+ };
+ return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
+ };
+
+ /**
+ * Enables ScrollSpy on a collection of elements
+ * e.g. $('.scrollSpy').scrollSpy()
+ * @param {Object=} options Optional.
+ throttle : number -> scrollspy throttling. Default: 100 ms
+ offsetTop : number -> offset from top. Default: 0
+ offsetRight : number -> offset from right. Default: 0
+ offsetBottom : number -> offset from bottom. Default: 0
+ offsetLeft : number -> offset from left. Default: 0
+ * @returns {jQuery}
+ */
+ $.fn.scrollSpy = function (options) {
+ return $.scrollSpy($(this), options);
+ };
+})(jQuery);
+;(function ($) {
+ $(document).ready(function () {
+
+ // Function to update labels of text fields
+ Materialize.updateTextFields = function () {
+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+ $(input_selector).each(function (index, element) {
+ var $this = $(this);
+ if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
+ $this.siblings('label').addClass('active');
+ } else if ($(element)[0].validity) {
+ $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
+ } else {
+ $this.siblings('label').removeClass('active');
+ }
+ });
+ };
+
+ // Text based inputs
+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+
+ // Add active if form auto complete
+ $(document).on('change', input_selector, function () {
+ if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
+ $(this).siblings('label').addClass('active');
+ }
+ validate_field($(this));
+ });
+
+ // Add active if input element has been pre-populated on document ready
+ $(document).ready(function () {
+ Materialize.updateTextFields();
+ });
+
+ // HTML DOM FORM RESET handling
+ $(document).on('reset', function (e) {
+ var formReset = $(e.target);
+ if (formReset.is('form')) {
+ formReset.find(input_selector).removeClass('valid').removeClass('invalid');
+ formReset.find(input_selector).each(function () {
+ if ($(this).attr('value') === '') {
+ $(this).siblings('label').removeClass('active');
+ }
+ });
+
+ // Reset select
+ formReset.find('select.initialized').each(function () {
+ var reset_text = formReset.find('option[selected]').text();
+ formReset.siblings('input.select-dropdown').val(reset_text);
+ });
+ }
+ });
+
+ // Add active when element has focus
+ $(document).on('focus', input_selector, function () {
+ $(this).siblings('label, .prefix').addClass('active');
+ });
+
+ $(document).on('blur', input_selector, function () {
+ var $inputElement = $(this);
+ var selector = ".prefix";
+
+ if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
+ selector += ", label";
+ }
+
+ $inputElement.siblings(selector).removeClass('active');
+
+ validate_field($inputElement);
+ });
+
+ window.validate_field = function (object) {
+ var hasLength = object.attr('data-length') !== undefined;
+ var lenAttr = parseInt(object.attr('data-length'));
+ var len = object.val().length;
+
+ if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
+ if (object.hasClass('validate')) {
+ object.removeClass('valid');
+ object.removeClass('invalid');
+ }
+ } else {
+ if (object.hasClass('validate')) {
+ // Check for character counter attributes
+ if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
+ object.removeClass('invalid');
+ object.addClass('valid');
+ } else {
+ object.removeClass('valid');
+ object.addClass('invalid');
+ }
+ }
+ }
+ };
+
+ // Radio and Checkbox focus class
+ var radio_checkbox = 'input[type=radio], input[type=checkbox]';
+ $(document).on('keyup.radio', radio_checkbox, function (e) {
+ // TAB, check if tabbing to radio or checkbox.
+ if (e.which === 9) {
+ $(this).addClass('tabbed');
+ var $this = $(this);
+ $this.one('blur', function (e) {
+
+ $(this).removeClass('tabbed');
+ });
+ return;
+ }
+ });
+
+ // Textarea Auto Resize
+ var hiddenDiv = $('.hiddendiv').first();
+ if (!hiddenDiv.length) {
+ hiddenDiv = $('');
+ $('body').append(hiddenDiv);
+ }
+ var text_area_selector = '.materialize-textarea';
+
+ function textareaAutoResize($textarea) {
+ // Set font properties of hiddenDiv
+
+ var fontFamily = $textarea.css('font-family');
+ var fontSize = $textarea.css('font-size');
+ var lineHeight = $textarea.css('line-height');
+ var padding = $textarea.css('padding');
+
+ if (fontSize) {
+ hiddenDiv.css('font-size', fontSize);
+ }
+ if (fontFamily) {
+ hiddenDiv.css('font-family', fontFamily);
+ }
+ if (lineHeight) {
+ hiddenDiv.css('line-height', lineHeight);
+ }
+ if (padding) {
+ hiddenDiv.css('padding', padding);
+ }
+
+ // Set original-height, if none
+ if (!$textarea.data('original-height')) {
+ $textarea.data('original-height', $textarea.height());
+ }
+
+ if ($textarea.attr('wrap') === 'off') {
+ hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
+ }
+
+ hiddenDiv.text($textarea.val() + '\n');
+ var content = hiddenDiv.html().replace(/\n/g, '
');
+ hiddenDiv.html(content);
+
+ // When textarea is hidden, width goes crazy.
+ // Approximate with half of window size
+
+ if ($textarea.is(':visible')) {
+ hiddenDiv.css('width', $textarea.width());
+ } else {
+ hiddenDiv.css('width', $(window).width() / 2);
+ }
+
+ /**
+ * Resize if the new height is greater than the
+ * original height of the textarea
+ */
+ if ($textarea.data('original-height') <= hiddenDiv.height()) {
+ $textarea.css('height', hiddenDiv.height());
+ } else if ($textarea.val().length < $textarea.data('previous-length')) {
+ /**
+ * In case the new height is less than original height, it
+ * means the textarea has less text than before
+ * So we set the height to the original one
+ */
+ $textarea.css('height', $textarea.data('original-height'));
+ }
+ $textarea.data('previous-length', $textarea.val().length);
+ }
+
+ $(text_area_selector).each(function () {
+ var $textarea = $(this);
+ /**
+ * Instead of resizing textarea on document load,
+ * store the original height and the original length
+ */
+ $textarea.data('original-height', $textarea.height());
+ $textarea.data('previous-length', $textarea.val().length);
+ });
+
+ $('body').on('keyup keydown autoresize', text_area_selector, function () {
+ textareaAutoResize($(this));
+ });
+
+ // File Input Path
+ $(document).on('change', '.file-field input[type="file"]', function () {
+ var file_field = $(this).closest('.file-field');
+ var path_input = file_field.find('input.file-path');
+ var files = $(this)[0].files;
+ var file_names = [];
+ for (var i = 0; i < files.length; i++) {
+ file_names.push(files[i].name);
+ }
+ path_input.val(file_names.join(", "));
+ path_input.trigger('change');
+ });
+
+ /****************
+ * Range Input *
+ ****************/
+
+ var range_type = 'input[type=range]';
+ var range_mousedown = false;
+ var left;
+
+ $(range_type).each(function () {
+ var thumb = $('');
+ $(this).after(thumb);
+ });
+
+ var showRangeBubble = function (thumb) {
+ var paddingLeft = parseInt(thumb.parent().css('padding-left'));
+ var marginLeft = -7 + paddingLeft + 'px';
+ thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
+ };
+
+ var calcRangeOffset = function (range) {
+ var width = range.width() - 15;
+ var max = parseFloat(range.attr('max'));
+ var min = parseFloat(range.attr('min'));
+ var percent = (parseFloat(range.val()) - min) / (max - min);
+ return percent * width;
+ };
+
+ var range_wrapper = '.range-field';
+ $(document).on('change', range_type, function (e) {
+ var thumb = $(this).siblings('.thumb');
+ thumb.find('.value').html($(this).val());
+
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ var offsetLeft = calcRangeOffset($(this));
+ thumb.addClass('active').css('left', offsetLeft);
+ });
+
+ $(document).on('mousedown touchstart', range_type, function (e) {
+ var thumb = $(this).siblings('.thumb');
+
+ // If thumb indicator does not exist yet, create it
+ if (thumb.length <= 0) {
+ thumb = $('');
+ $(this).after(thumb);
+ }
+
+ // Set indicator value
+ thumb.find('.value').html($(this).val());
+
+ range_mousedown = true;
+ $(this).addClass('active');
+
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ if (e.type !== 'input') {
+ var offsetLeft = calcRangeOffset($(this));
+ thumb.addClass('active').css('left', offsetLeft);
+ }
+ });
+
+ $(document).on('mouseup touchend', range_wrapper, function () {
+ range_mousedown = false;
+ $(this).removeClass('active');
+ });
+
+ $(document).on('input mousemove touchmove', range_wrapper, function (e) {
+ var thumb = $(this).children('.thumb');
+ var left;
+ var input = $(this).find(range_type);
+
+ if (range_mousedown) {
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ var offsetLeft = calcRangeOffset(input);
+ thumb.addClass('active').css('left', offsetLeft);
+ thumb.find('.value').html(thumb.siblings(range_type).val());
+ }
+ });
+
+ $(document).on('mouseout touchleave', range_wrapper, function () {
+ if (!range_mousedown) {
+
+ var thumb = $(this).children('.thumb');
+ var paddingLeft = parseInt($(this).css('padding-left'));
+ var marginLeft = 7 + paddingLeft + 'px';
+
+ if (thumb.hasClass('active')) {
+ thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
+ }
+ thumb.removeClass('active');
+ }
+ });
+
+ /**************************
+ * Auto complete plugin *
+ *************************/
+ $.fn.autocomplete = function (options) {
+ // Defaults
+ var defaults = {
+ data: {},
+ limit: Infinity,
+ onAutocomplete: null,
+ minLength: 1
+ };
+
+ options = $.extend(defaults, options);
+
+ return this.each(function () {
+ var $input = $(this);
+ var data = options.data,
+ count = 0,
+ activeIndex = -1,
+ oldVal,
+ $inputDiv = $input.closest('.input-field'); // Div to append on
+
+ // Check if data isn't empty
+ if (!$.isEmptyObject(data)) {
+ var $autocomplete = $('');
+ var $oldAutocomplete;
+
+ // Append autocomplete element.
+ // Prevent double structure init.
+ if ($inputDiv.length) {
+ $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
+ if (!$oldAutocomplete.length) {
+ $inputDiv.append($autocomplete); // Set ul in body
+ }
+ } else {
+ $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
+ if (!$oldAutocomplete.length) {
+ $input.after($autocomplete);
+ }
+ }
+ if ($oldAutocomplete.length) {
+ $autocomplete = $oldAutocomplete;
+ }
+
+ // Highlight partial match.
+ var highlight = function (string, $el) {
+ var img = $el.find('img');
+ var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
+ matchEnd = matchStart + string.length - 1,
+ beforeMatch = $el.text().slice(0, matchStart),
+ matchText = $el.text().slice(matchStart, matchEnd + 1),
+ afterMatch = $el.text().slice(matchEnd + 1);
+ $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + "");
+ if (img.length) {
+ $el.prepend(img);
+ }
+ };
+
+ // Reset current element position
+ var resetCurrentElement = function () {
+ activeIndex = -1;
+ $autocomplete.find('.active').removeClass('active');
+ };
+
+ // Remove autocomplete elements
+ var removeAutocomplete = function () {
+ $autocomplete.empty();
+ resetCurrentElement();
+ oldVal = undefined;
+ };
+
+ $input.off('blur.autocomplete').on('blur.autocomplete', function () {
+ removeAutocomplete();
+ });
+
+ // Perform search
+ $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
+ // Reset count.
+ count = 0;
+ var val = $input.val().toLowerCase();
+
+ // Don't capture enter or arrow key usage.
+ if (e.which === 13 || e.which === 38 || e.which === 40) {
+ return;
+ }
+
+ // Check if the input isn't empty
+ if (oldVal !== val) {
+ removeAutocomplete();
+
+ if (val.length >= options.minLength) {
+ for (var key in data) {
+ if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
+ // Break if past limit
+ if (count >= options.limit) {
+ break;
+ }
+
+ var autocompleteOption = $('');
+ if (!!data[key]) {
+ autocompleteOption.append('
' + key + '');
+ } else {
+ autocompleteOption.append('' + key + '');
+ }
+
+ $autocomplete.append(autocompleteOption);
+ highlight(val, autocompleteOption);
+ count++;
+ }
+ }
+ }
+ }
+
+ // Update oldVal
+ oldVal = val;
+ });
+
+ $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
+ // Arrow keys and enter key usage
+ var keyCode = e.which,
+ liElement,
+ numItems = $autocomplete.children('li').length,
+ $active = $autocomplete.children('.active').first();
+
+ // select element on Enter
+ if (keyCode === 13 && activeIndex >= 0) {
+ liElement = $autocomplete.children('li').eq(activeIndex);
+ if (liElement.length) {
+ liElement.trigger('mousedown.autocomplete');
+ e.preventDefault();
+ }
+ return;
+ }
+
+ // Capture up and down key
+ if (keyCode === 38 || keyCode === 40) {
+ e.preventDefault();
+
+ if (keyCode === 38 && activeIndex > 0) {
+ activeIndex--;
+ }
+
+ if (keyCode === 40 && activeIndex < numItems - 1) {
+ activeIndex++;
+ }
+
+ $active.removeClass('active');
+ if (activeIndex >= 0) {
+ $autocomplete.children('li').eq(activeIndex).addClass('active');
+ }
+ }
+ });
+
+ // Set input value
+ $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
+ var text = $(this).text().trim();
+ $input.val(text);
+ $input.trigger('change');
+ removeAutocomplete();
+
+ // Handle onAutocomplete callback.
+ if (typeof options.onAutocomplete === "function") {
+ options.onAutocomplete.call(this, text);
+ }
+ });
+
+ // Empty data
+ } else {
+ $input.off('keyup.autocomplete focus.autocomplete');
+ }
+ });
+ };
+ }); // End of $(document).ready
+
+ /*******************
+ * Select Plugin *
+ ******************/
+ $.fn.material_select = function (callback) {
+ $(this).each(function () {
+ var $select = $(this);
+
+ if ($select.hasClass('browser-default')) {
+ return; // Continue to next (return false breaks out of entire loop)
+ }
+
+ var multiple = $select.attr('multiple') ? true : false,
+ lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
+
+ if (lastID) {
+ $select.parent().find('span.caret').remove();
+ $select.parent().find('input').remove();
+
+ $select.unwrap();
+ $('ul#select-options-' + lastID).remove();
+ }
+
+ // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
+ if (callback === 'destroy') {
+ $select.removeAttr('data-select-id').removeClass('initialized');
+ $(window).off('click.select');
+ return;
+ }
+
+ var uniqueID = Materialize.guid();
+ $select.attr('data-select-id', uniqueID);
+ var wrapper = $('');
+ wrapper.addClass($select.attr('class'));
+ if ($select.is(':disabled')) wrapper.addClass('disabled');
+ var options = $(''),
+ selectChildren = $select.children('option, optgroup'),
+ valuesSelected = [],
+ optionsHover = false;
+
+ var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
+
+ // Function that renders and appends the option taking into
+ // account type and possible image icon.
+ var appendOptionWithIcon = function (select, option, type) {
+ // Add disabled attr if disabled
+ var disabledClass = option.is(':disabled') ? 'disabled ' : '';
+ var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
+ var multipleCheckbox = multiple ? '' : '';
+
+ // add icons
+ var icon_url = option.data('icon');
+ var classes = option.attr('class');
+ if (!!icon_url) {
+ var classString = '';
+ if (!!classes) classString = ' class="' + classes + '"';
+
+ // Check for multiple type.
+ options.append($('
' + multipleCheckbox + option.html() + ''));
+ return true;
+ }
+
+ // Check for multiple type.
+ options.append($('' + multipleCheckbox + option.html() + ''));
+ };
+
+ /* Create dropdown structure. */
+ if (selectChildren.length) {
+ selectChildren.each(function () {
+ if ($(this).is('option')) {
+ // Direct descendant option.
+ if (multiple) {
+ appendOptionWithIcon($select, $(this), 'multiple');
+ } else {
+ appendOptionWithIcon($select, $(this));
+ }
+ } else if ($(this).is('optgroup')) {
+ // Optgroup.
+ var selectOptions = $(this).children('option');
+ options.append($('' + $(this).attr('label') + ''));
+
+ selectOptions.each(function () {
+ appendOptionWithIcon($select, $(this), 'optgroup-option');
+ });
+ }
+ });
+ }
+
+ options.find('li:not(.optgroup)').each(function (i) {
+ $(this).click(function (e) {
+ // Check if option element is disabled
+ if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
+ var selected = true;
+
+ if (multiple) {
+ $('input[type="checkbox"]', this).prop('checked', function (i, v) {
+ return !v;
+ });
+ selected = toggleEntryFromArray(valuesSelected, i, $select);
+ $newSelect.trigger('focus');
+ } else {
+ options.find('li').removeClass('active');
+ $(this).toggleClass('active');
+ $newSelect.val($(this).text());
+ }
+
+ activateOption(options, $(this));
+ $select.find('option').eq(i).prop('selected', selected);
+ // Trigger onchange() event
+ $select.trigger('change');
+ if (typeof callback !== 'undefined') callback();
+ }
+
+ e.stopPropagation();
+ });
+ });
+
+ // Wrap Elements
+ $select.wrap(wrapper);
+ // Add Select Display Element
+ var dropdownIcon = $('▼');
+
+ // escape double quotes
+ var sanitizedLabelHtml = label.replace(/"/g, '"');
+
+ var $newSelect = $('');
+ $select.before($newSelect);
+ $newSelect.before(dropdownIcon);
+
+ $newSelect.after(options);
+ // Check if section element is disabled
+ if (!$select.is(':disabled')) {
+ $newSelect.dropdown({ 'hover': false });
+ }
+
+ // Copy tabindex
+ if ($select.attr('tabindex')) {
+ $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
+ }
+
+ $select.addClass('initialized');
+
+ $newSelect.on({
+ 'focus': function () {
+ if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
+ $('input.select-dropdown').trigger('close');
+ $(window).off('click.select');
+ }
+ if (!options.is(':visible')) {
+ $(this).trigger('open', ['focus']);
+ var label = $(this).val();
+ if (multiple && label.indexOf(',') >= 0) {
+ label = label.split(',')[0];
+ }
+
+ var selectedOption = options.find('li').filter(function () {
+ return $(this).text().toLowerCase() === label.toLowerCase();
+ })[0];
+ activateOption(options, selectedOption, true);
+
+ $(window).off('click.select').on('click.select', function () {
+ multiple && (optionsHover || $newSelect.trigger('close'));
+ $(window).off('click.select');
+ });
+ }
+ },
+ 'click': function (e) {
+ e.stopPropagation();
+ }
+ });
+
+ $newSelect.on('blur', function () {
+ if (!multiple) {
+ $(this).trigger('close');
+ $(window).off('click.select');
+ }
+ options.find('li.selected').removeClass('selected');
+ });
+
+ options.hover(function () {
+ optionsHover = true;
+ }, function () {
+ optionsHover = false;
+ });
+
+ // Add initial multiple selections.
+ if (multiple) {
+ $select.find("option:selected:not(:disabled)").each(function () {
+ var index = this.index;
+
+ toggleEntryFromArray(valuesSelected, index, $select);
+ options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
+ });
+ }
+
+ /**
+ * Make option as selected and scroll to selected position
+ * @param {jQuery} collection Select options jQuery element
+ * @param {Element} newOption element of the new option
+ * @param {Boolean} firstActivation If on first activation of select
+ */
+ var activateOption = function (collection, newOption, firstActivation) {
+ if (newOption) {
+ collection.find('li.selected').removeClass('selected');
+ var option = $(newOption);
+ option.addClass('selected');
+ if (!multiple || !!firstActivation) {
+ options.scrollTo(option);
+ }
+ }
+ };
+
+ // Allow user to search by typing
+ // this array is cleared after 1 second
+ var filterQuery = [],
+ onKeyDown = function (e) {
+ // TAB - switch to another input
+ if (e.which == 9) {
+ $newSelect.trigger('close');
+ return;
+ }
+
+ // ARROW DOWN WHEN SELECT IS CLOSED - open select options
+ if (e.which == 40 && !options.is(':visible')) {
+ $newSelect.trigger('open');
+ return;
+ }
+
+ // ENTER WHEN SELECT IS CLOSED - submit form
+ if (e.which == 13 && !options.is(':visible')) {
+ return;
+ }
+
+ e.preventDefault();
+
+ // CASE WHEN USER TYPE LETTERS
+ var letter = String.fromCharCode(e.which).toLowerCase(),
+ nonLetters = [9, 13, 27, 38, 40];
+ if (letter && nonLetters.indexOf(e.which) === -1) {
+ filterQuery.push(letter);
+
+ var string = filterQuery.join(''),
+ newOption = options.find('li').filter(function () {
+ return $(this).text().toLowerCase().indexOf(string) === 0;
+ })[0];
+
+ if (newOption) {
+ activateOption(options, newOption);
+ }
+ }
+
+ // ENTER - select option and close when select options are opened
+ if (e.which == 13) {
+ var activeOption = options.find('li.selected:not(.disabled)')[0];
+ if (activeOption) {
+ $(activeOption).trigger('click');
+ if (!multiple) {
+ $newSelect.trigger('close');
+ }
+ }
+ }
+
+ // ARROW DOWN - move to next not disabled option
+ if (e.which == 40) {
+ if (options.find('li.selected').length) {
+ newOption = options.find('li.selected').next('li:not(.disabled)')[0];
+ } else {
+ newOption = options.find('li:not(.disabled)')[0];
+ }
+ activateOption(options, newOption);
+ }
+
+ // ESC - close options
+ if (e.which == 27) {
+ $newSelect.trigger('close');
+ }
+
+ // ARROW UP - move to previous not disabled option
+ if (e.which == 38) {
+ newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
+ if (newOption) activateOption(options, newOption);
+ }
+
+ // Automaticaly clean filter query so user can search again by starting letters
+ setTimeout(function () {
+ filterQuery = [];
+ }, 1000);
+ };
+
+ $newSelect.on('keydown', onKeyDown);
+ });
+
+ function toggleEntryFromArray(entriesArray, entryIndex, select) {
+ var index = entriesArray.indexOf(entryIndex),
+ notAdded = index === -1;
+
+ if (notAdded) {
+ entriesArray.push(entryIndex);
+ } else {
+ entriesArray.splice(index, 1);
+ }
+
+ select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
+
+ // use notAdded instead of true (to detect if the option is selected or not)
+ select.find('option').eq(entryIndex).prop('selected', notAdded);
+ setValueToInput(entriesArray, select);
+
+ return notAdded;
+ }
+
+ function setValueToInput(entriesArray, select) {
+ var value = '';
+
+ for (var i = 0, count = entriesArray.length; i < count; i++) {
+ var text = select.find('option').eq(entriesArray[i]).text();
+
+ i === 0 ? value += text : value += ', ' + text;
+ }
+
+ if (value === '') {
+ value = select.find('option:disabled').eq(0).text();
+ }
+
+ select.siblings('input.select-dropdown').val(value);
+ }
+ };
+})(jQuery);
+;(function ($) {
+
+ var methods = {
+
+ init: function (options) {
+ var defaults = {
+ indicators: true,
+ height: 400,
+ transition: 500,
+ interval: 6000
+ };
+ options = $.extend(defaults, options);
+
+ return this.each(function () {
+
+ // For each slider, we want to keep track of
+ // which slide is active and its associated content
+ var $this = $(this);
+ var $slider = $this.find('ul.slides').first();
+ var $slides = $slider.find('> li');
+ var $active_index = $slider.find('.active').index();
+ var $active, $indicators, $interval;
+ if ($active_index != -1) {
+ $active = $slides.eq($active_index);
+ }
+
+ // Transitions the caption depending on alignment
+ function captionTransition(caption, duration) {
+ if (caption.hasClass("center-align")) {
+ caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
+ } else if (caption.hasClass("right-align")) {
+ caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
+ } else if (caption.hasClass("left-align")) {
+ caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
+ }
+ }
+
+ // This function will transition the slide to any index of the next slide
+ function moveToSlide(index) {
+ // Wrap around indices.
+ if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
+
+ $active_index = $slider.find('.active').index();
+
+ // Only do if index changes
+ if ($active_index != index) {
+ $active = $slides.eq($active_index);
+ $caption = $active.find('.caption');
+
+ $active.removeClass('active');
+ $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
+ } });
+ captionTransition($caption, options.transition);
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq($active_index).removeClass('active');
+ }
+
+ $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
+ $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
+ $slides.eq(index).addClass('active');
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq(index).addClass('active');
+ }
+ }
+ }
+
+ // Set height of slider
+ // If fullscreen, do nothing
+ if (!$this.hasClass('fullscreen')) {
+ if (options.indicators) {
+ // Add height if indicators are present
+ $this.height(options.height + 40);
+ } else {
+ $this.height(options.height);
+ }
+ $slider.height(options.height);
+ }
+
+ // Set initial positions of captions
+ $slides.find('.caption').each(function () {
+ captionTransition($(this), 0);
+ });
+
+ // Move img src into background-image
+ $slides.find('img').each(function () {
+ var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
+ if ($(this).attr('src') !== placeholderBase64) {
+ $(this).css('background-image', 'url("' + $(this).attr('src') + '")');
+ $(this).attr('src', placeholderBase64);
+ }
+ });
+
+ // dynamically add indicators
+ if (options.indicators) {
+ $indicators = $('');
+ $slides.each(function (index) {
+ var $indicator = $('');
+
+ // Handle clicks on indicators
+ $indicator.click(function () {
+ var $parent = $slider.parent();
+ var curr_index = $parent.find($(this)).index();
+ moveToSlide(curr_index);
+
+ // reset interval
+ clearInterval($interval);
+ $interval = setInterval(function () {
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+ }, options.transition + options.interval);
+ });
+ $indicators.append($indicator);
+ });
+ $this.append($indicators);
+ $indicators = $this.find('ul.indicators').find('li.indicator-item');
+ }
+
+ if ($active) {
+ $active.show();
+ } else {
+ $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
+
+ $active_index = 0;
+ $active = $slides.eq($active_index);
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq($active_index).addClass('active');
+ }
+ }
+
+ // Adjust height to current slide
+ $active.find('img').each(function () {
+ $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
+ });
+
+ // auto scroll
+ $interval = setInterval(function () {
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index + 1);
+ }, options.transition + options.interval);
+
+ // HammerJS, Swipe navigation
+
+ // Touch Event
+ var panning = false;
+ var swipeLeft = false;
+ var swipeRight = false;
+
+ $this.hammer({
+ prevent_default: false
+ }).on('pan', function (e) {
+ if (e.gesture.pointerType === "touch") {
+
+ // reset interval
+ clearInterval($interval);
+
+ var direction = e.gesture.direction;
+ var x = e.gesture.deltaX;
+ var velocityX = e.gesture.velocityX;
+ var velocityY = e.gesture.velocityY;
+
+ $curr_slide = $slider.find('.active');
+ if (Math.abs(velocityX) > Math.abs(velocityY)) {
+ $curr_slide.velocity({ translateX: x
+ }, { duration: 50, queue: false, easing: 'easeOutQuad' });
+ }
+
+ // Swipe Left
+ if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
+ swipeRight = true;
+ }
+ // Swipe Right
+ else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
+ swipeLeft = true;
+ }
+
+ // Make Slide Behind active slide visible
+ var next_slide;
+ if (swipeLeft) {
+ next_slide = $curr_slide.next();
+ if (next_slide.length === 0) {
+ next_slide = $slides.first();
+ }
+ next_slide.velocity({ opacity: 1
+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+ }
+ if (swipeRight) {
+ next_slide = $curr_slide.prev();
+ if (next_slide.length === 0) {
+ next_slide = $slides.last();
+ }
+ next_slide.velocity({ opacity: 1
+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+ }
+ }
+ }).on('panend', function (e) {
+ if (e.gesture.pointerType === "touch") {
+
+ $curr_slide = $slider.find('.active');
+ panning = false;
+ curr_index = $slider.find('.active').index();
+
+ if (!swipeRight && !swipeLeft || $slides.length <= 1) {
+ // Return to original spot
+ $curr_slide.velocity({ translateX: 0
+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+ } else if (swipeLeft) {
+ moveToSlide(curr_index + 1);
+ $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
+ } });
+ } else if (swipeRight) {
+ moveToSlide(curr_index - 1);
+ $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
+ } });
+ }
+ swipeLeft = false;
+ swipeRight = false;
+
+ // Restart interval
+ clearInterval($interval);
+ $interval = setInterval(function () {
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+ }, options.transition + options.interval);
+ }
+ });
+
+ $this.on('sliderPause', function () {
+ clearInterval($interval);
+ });
+
+ $this.on('sliderStart', function () {
+ clearInterval($interval);
+ $interval = setInterval(function () {
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+ }, options.transition + options.interval);
+ });
+
+ $this.on('sliderNext', function () {
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index + 1);
+ });
+
+ $this.on('sliderPrev', function () {
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index - 1);
+ });
+ });
+ },
+ pause: function () {
+ $(this).trigger('sliderPause');
+ },
+ start: function () {
+ $(this).trigger('sliderStart');
+ },
+ next: function () {
+ $(this).trigger('sliderNext');
+ },
+ prev: function () {
+ $(this).trigger('sliderPrev');
+ }
+ };
+
+ $.fn.slider = function (methodOrOptions) {
+ if (methods[methodOrOptions]) {
+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+ // Default to "init"
+ return methods.init.apply(this, arguments);
+ } else {
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
+ }
+ }; // Plugin end
+})(jQuery);
+;(function ($) {
+ $(document).ready(function () {
+
+ $(document).on('click.card', '.card', function (e) {
+ if ($(this).find('> .card-reveal').length) {
+ var $card = $(e.target).closest('.card');
+ if ($card.data('initialOverflow') === undefined) {
+ $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
+ }
+ if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
+ // Make Reveal animate down and display none
+ $(this).find('.card-reveal').velocity({ translateY: 0 }, {
+ duration: 225,
+ queue: false,
+ easing: 'easeInOutQuad',
+ complete: function () {
+ $(this).css({ display: 'none' });
+ $card.css('overflow', $card.data('initialOverflow'));
+ }
+ });
+ } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
+ $card.css('overflow', 'hidden');
+ $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
+ }
+ }
+ });
+ });
+})(jQuery);
+;(function ($) {
+ var materialChipsDefaults = {
+ data: [],
+ placeholder: '',
+ secondaryPlaceholder: '',
+ autocompleteOptions: {}
+ };
+
+ $(document).ready(function () {
+ // Handle removal of static chips.
+ $(document).on('click', '.chip .close', function (e) {
+ var $chips = $(this).closest('.chips');
+ if ($chips.attr('data-initialized')) {
+ return;
+ }
+ $(this).closest('.chip').remove();
+ });
+ });
+
+ $.fn.material_chip = function (options) {
+ var self = this;
+ this.$el = $(this);
+ this.$document = $(document);
+ this.SELS = {
+ CHIPS: '.chips',
+ CHIP: '.chip',
+ INPUT: 'input',
+ DELETE: '.material-icons',
+ SELECTED_CHIP: '.selected'
+ };
+
+ if ('data' === options) {
+ return this.$el.data('chips');
+ }
+
+ var curr_options = $.extend({}, materialChipsDefaults, options);
+ self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
+
+ // Initialize
+ this.init = function () {
+ var i = 0;
+ var chips;
+ self.$el.each(function () {
+ var $chips = $(this);
+ var chipId = Materialize.guid();
+ self.chipId = chipId;
+
+ if (!curr_options.data || !(curr_options.data instanceof Array)) {
+ curr_options.data = [];
+ }
+ $chips.data('chips', curr_options.data);
+ $chips.attr('data-index', i);
+ $chips.attr('data-initialized', true);
+
+ if (!$chips.hasClass(self.SELS.CHIPS)) {
+ $chips.addClass('chips');
+ }
+
+ self.chips($chips, chipId);
+ i++;
+ });
+ };
+
+ this.handleEvents = function () {
+ var SELS = self.SELS;
+
+ self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
+ $(e.target).find(SELS.INPUT).focus();
+ });
+
+ self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
+ var $chip = $(e.target);
+ if ($chip.length) {
+ var wasSelected = $chip.hasClass('selected');
+ var $chips = $chip.closest(SELS.CHIPS);
+ $(SELS.CHIP).removeClass('selected');
+
+ if (!wasSelected) {
+ self.selectChip($chip.index(), $chips);
+ }
+ }
+ });
+
+ self.$document.off('keydown.chips').on('keydown.chips', function (e) {
+ if ($(e.target).is('input, textarea')) {
+ return;
+ }
+
+ // delete
+ var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
+ var $chips = $chip.closest(SELS.CHIPS);
+ var length = $chip.siblings(SELS.CHIP).length;
+ var index;
+
+ if (!$chip.length) {
+ return;
+ }
+
+ if (e.which === 8 || e.which === 46) {
+ e.preventDefault();
+
+ index = $chip.index();
+ self.deleteChip(index, $chips);
+
+ var selectIndex = null;
+ if (index + 1 < length) {
+ selectIndex = index;
+ } else if (index === length || index + 1 === length) {
+ selectIndex = length - 1;
+ }
+
+ if (selectIndex < 0) selectIndex = null;
+
+ if (null !== selectIndex) {
+ self.selectChip(selectIndex, $chips);
+ }
+ if (!length) $chips.find('input').focus();
+
+ // left
+ } else if (e.which === 37) {
+ index = $chip.index() - 1;
+ if (index < 0) {
+ return;
+ }
+ $(SELS.CHIP).removeClass('selected');
+ self.selectChip(index, $chips);
+
+ // right
+ } else if (e.which === 39) {
+ index = $chip.index() + 1;
+ $(SELS.CHIP).removeClass('selected');
+ if (index > length) {
+ $chips.find('input').focus();
+ return;
+ }
+ self.selectChip(index, $chips);
+ }
+ });
+
+ self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
+ var $currChips = $(e.target).closest(SELS.CHIPS);
+ $currChips.addClass('focus');
+ $currChips.siblings('label, .prefix').addClass('active');
+ $(SELS.CHIP).removeClass('selected');
+ });
+
+ self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
+ var $currChips = $(e.target).closest(SELS.CHIPS);
+ $currChips.removeClass('focus');
+
+ // Remove active if empty
+ if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
+ $currChips.siblings('label').removeClass('active');
+ }
+ $currChips.siblings('.prefix').removeClass('active');
+ });
+
+ self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
+ var $target = $(e.target);
+ var $chips = $target.closest(SELS.CHIPS);
+ var chipsLength = $chips.children(SELS.CHIP).length;
+
+ // enter
+ if (13 === e.which) {
+ // Override enter if autocompleting.
+ if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
+ return;
+ }
+
+ e.preventDefault();
+ self.addChip({ tag: $target.val() }, $chips);
+ $target.val('');
+ return;
+ }
+
+ // delete or left
+ if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
+ e.preventDefault();
+ self.selectChip(chipsLength - 1, $chips);
+ $target.blur();
+ return;
+ }
+ });
+
+ // Click on delete icon in chip.
+ self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
+ var $target = $(e.target);
+ var $chips = $target.closest(SELS.CHIPS);
+ var $chip = $target.closest(SELS.CHIP);
+ e.stopPropagation();
+ self.deleteChip($chip.index(), $chips);
+ $chips.find('input').focus();
+ });
+ };
+
+ this.chips = function ($chips, chipId) {
+ $chips.empty();
+ $chips.data('chips').forEach(function (elem) {
+ $chips.append(self.renderChip(elem));
+ });
+ $chips.append($(''));
+ self.setPlaceholder($chips);
+
+ // Set for attribute for label
+ var label = $chips.next('label');
+ if (label.length) {
+ label.attr('for', chipId);
+
+ if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
+ label.addClass('active');
+ }
+ }
+
+ // Setup autocomplete if needed.
+ var input = $('#' + chipId);
+ if (self.hasAutocomplete) {
+ curr_options.autocompleteOptions.onAutocomplete = function (val) {
+ self.addChip({ tag: val }, $chips);
+ input.val('');
+ input.focus();
+ };
+ input.autocomplete(curr_options.autocompleteOptions);
+ }
+ };
+
+ /**
+ * Render chip jQuery element.
+ * @param {Object} elem
+ * @return {jQuery}
+ */
+ this.renderChip = function (elem) {
+ if (!elem.tag) return;
+
+ var $renderedChip = $('');
+ $renderedChip.text(elem.tag);
+ if (elem.image) {
+ $renderedChip.prepend($('
').attr('src', elem.image));
+ }
+ $renderedChip.append($('close'));
+ return $renderedChip;
+ };
+
+ this.setPlaceholder = function ($chips) {
+ if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
+ $chips.find('input').prop('placeholder', curr_options.placeholder);
+ } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
+ $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
+ }
+ };
+
+ this.isValid = function ($chips, elem) {
+ var chips = $chips.data('chips');
+ var exists = false;
+ for (var i = 0; i < chips.length; i++) {
+ if (chips[i].tag === elem.tag) {
+ exists = true;
+ return;
+ }
+ }
+ return '' !== elem.tag && !exists;
+ };
+
+ this.addChip = function (elem, $chips) {
+ if (!self.isValid($chips, elem)) {
+ return;
+ }
+ var $renderedChip = self.renderChip(elem);
+ var newData = [];
+ var oldData = $chips.data('chips');
+ for (var i = 0; i < oldData.length; i++) {
+ newData.push(oldData[i]);
+ }
+ newData.push(elem);
+
+ $chips.data('chips', newData);
+ $renderedChip.insertBefore($chips.find('input'));
+ $chips.trigger('chip.add', elem);
+ self.setPlaceholder($chips);
+ };
+
+ this.deleteChip = function (chipIndex, $chips) {
+ var chip = $chips.data('chips')[chipIndex];
+ $chips.find('.chip').eq(chipIndex).remove();
+
+ var newData = [];
+ var oldData = $chips.data('chips');
+ for (var i = 0; i < oldData.length; i++) {
+ if (i !== chipIndex) {
+ newData.push(oldData[i]);
+ }
+ }
+
+ $chips.data('chips', newData);
+ $chips.trigger('chip.delete', chip);
+ self.setPlaceholder($chips);
+ };
+
+ this.selectChip = function (chipIndex, $chips) {
+ var $chip = $chips.find('.chip').eq(chipIndex);
+ if ($chip && false === $chip.hasClass('selected')) {
+ $chip.addClass('selected');
+ $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
+ }
+ };
+
+ this.getChipsElement = function (index, $chips) {
+ return $chips.eq(index);
+ };
+
+ // init
+ this.init();
+
+ this.handleEvents();
+ };
+})(jQuery);
+;(function ($) {
+ $.fn.pushpin = function (options) {
+ // Defaults
+ var defaults = {
+ top: 0,
+ bottom: Infinity,
+ offset: 0
+ };
+
+ // Remove pushpin event and classes
+ if (options === "remove") {
+ this.each(function () {
+ if (id = $(this).data('pushpin-id')) {
+ $(window).off('scroll.' + id);
+ $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
+ }
+ });
+ return false;
+ }
+
+ options = $.extend(defaults, options);
+
+ $index = 0;
+ return this.each(function () {
+ var $uniqueId = Materialize.guid(),
+ $this = $(this),
+ $original_offset = $(this).offset().top;
+
+ function removePinClasses(object) {
+ object.removeClass('pin-top');
+ object.removeClass('pinned');
+ object.removeClass('pin-bottom');
+ }
+
+ function updateElements(objects, scrolled) {
+ objects.each(function () {
+ // Add position fixed (because its between top and bottom)
+ if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
+ removePinClasses($(this));
+ $(this).css('top', options.offset);
+ $(this).addClass('pinned');
+ }
+
+ // Add pin-top (when scrolled position is above top)
+ if (scrolled < options.top && !$(this).hasClass('pin-top')) {
+ removePinClasses($(this));
+ $(this).css('top', 0);
+ $(this).addClass('pin-top');
+ }
+
+ // Add pin-bottom (when scrolled position is below bottom)
+ if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
+ removePinClasses($(this));
+ $(this).addClass('pin-bottom');
+ $(this).css('top', options.bottom - $original_offset);
+ }
+ });
+ }
+
+ $(this).data('pushpin-id', $uniqueId);
+ updateElements($this, $(window).scrollTop());
+ $(window).on('scroll.' + $uniqueId, function () {
+ var $scrolled = $(window).scrollTop() + options.offset;
+ updateElements($this, $scrolled);
+ });
+ });
+ };
+})(jQuery);;(function ($) {
+ $(document).ready(function () {
+
+ // jQuery reverse
+ $.fn.reverse = [].reverse;
+
+ // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
+ $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
+ var $this = $(this);
+ openFABMenu($this);
+ });
+ $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
+ var $this = $(this);
+ closeFABMenu($this);
+ });
+
+ // Toggle-on-click behaviour.
+ $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
+ var $this = $(this);
+ var $menu = $this.parent();
+ if ($menu.hasClass('active')) {
+ closeFABMenu($menu);
+ } else {
+ openFABMenu($menu);
+ }
+ });
+
+ // Toolbar transition behaviour.
+ $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
+ var $this = $(this);
+ var $menu = $this.parent();
+ FABtoToolbar($menu);
+ });
+ });
+
+ $.fn.extend({
+ openFAB: function () {
+ openFABMenu($(this));
+ },
+ closeFAB: function () {
+ closeFABMenu($(this));
+ },
+ openToolbar: function () {
+ FABtoToolbar($(this));
+ },
+ closeToolbar: function () {
+ toolbarToFAB($(this));
+ }
+ });
+
+ var openFABMenu = function (btn) {
+ var $this = btn;
+ if ($this.hasClass('active') === false) {
+
+ // Get direction option
+ var horizontal = $this.hasClass('horizontal');
+ var offsetY, offsetX;
+
+ if (horizontal === true) {
+ offsetX = 40;
+ } else {
+ offsetY = 40;
+ }
+
+ $this.addClass('active');
+ $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
+
+ var time = 0;
+ $this.find('ul .btn-floating').reverse().each(function () {
+ $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
+ time += 40;
+ });
+ }
+ };
+
+ var closeFABMenu = function (btn) {
+ var $this = btn;
+ // Get direction option
+ var horizontal = $this.hasClass('horizontal');
+ var offsetY, offsetX;
+
+ if (horizontal === true) {
+ offsetX = 40;
+ } else {
+ offsetY = 40;
+ }
+
+ $this.removeClass('active');
+ var time = 0;
+ $this.find('ul .btn-floating').velocity("stop", true);
+ $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
+ };
+
+ /**
+ * Transform FAB into toolbar
+ * @param {Object} object jQuery object
+ */
+ var FABtoToolbar = function (btn) {
+ if (btn.attr('data-open') === "true") {
+ return;
+ }
+
+ var offsetX, offsetY, scaleFactor;
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var btnRect = btn[0].getBoundingClientRect();
+ var anchor = btn.find('> a').first();
+ var menu = btn.find('> ul').first();
+ var backdrop = $('');
+ var fabColor = anchor.css('background-color');
+ anchor.append(backdrop);
+
+ offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
+ offsetY = windowHeight - btnRect.bottom;
+ scaleFactor = windowWidth / backdrop.width();
+ btn.attr('data-origin-bottom', btnRect.bottom);
+ btn.attr('data-origin-left', btnRect.left);
+ btn.attr('data-origin-width', btnRect.width);
+
+ // Set initial state
+ btn.addClass('active');
+ btn.attr('data-open', true);
+ btn.css({
+ 'text-align': 'center',
+ width: '100%',
+ bottom: 0,
+ left: 0,
+ transform: 'translateX(' + offsetX + 'px)',
+ transition: 'none'
+ });
+ anchor.css({
+ transform: 'translateY(' + -offsetY + 'px)',
+ transition: 'none'
+ });
+ backdrop.css({
+ 'background-color': fabColor
+ });
+
+ setTimeout(function () {
+ btn.css({
+ transform: '',
+ transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
+ });
+ anchor.css({
+ overflow: 'visible',
+ transform: '',
+ transition: 'transform .2s'
+ });
+
+ setTimeout(function () {
+ btn.css({
+ overflow: 'hidden',
+ 'background-color': fabColor
+ });
+ backdrop.css({
+ transform: 'scale(' + scaleFactor + ')',
+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+ });
+ menu.find('> li > a').css({
+ opacity: 1
+ });
+
+ // Scroll to close.
+ $(window).on('scroll.fabToolbarClose', function () {
+ toolbarToFAB(btn);
+ $(window).off('scroll.fabToolbarClose');
+ $(document).off('click.fabToolbarClose');
+ });
+
+ $(document).on('click.fabToolbarClose', function (e) {
+ if (!$(e.target).closest(menu).length) {
+ toolbarToFAB(btn);
+ $(window).off('scroll.fabToolbarClose');
+ $(document).off('click.fabToolbarClose');
+ }
+ });
+ }, 100);
+ }, 0);
+ };
+
+ /**
+ * Transform toolbar back into FAB
+ * @param {Object} object jQuery object
+ */
+ var toolbarToFAB = function (btn) {
+ if (btn.attr('data-open') !== "true") {
+ return;
+ }
+
+ var offsetX, offsetY, scaleFactor;
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var btnWidth = btn.attr('data-origin-width');
+ var btnBottom = btn.attr('data-origin-bottom');
+ var btnLeft = btn.attr('data-origin-left');
+ var anchor = btn.find('> .btn-floating').first();
+ var menu = btn.find('> ul').first();
+ var backdrop = btn.find('.fab-backdrop');
+ var fabColor = anchor.css('background-color');
+
+ offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
+ offsetY = windowHeight - btnBottom;
+ scaleFactor = windowWidth / backdrop.width();
+
+ // Hide backdrop
+ btn.removeClass('active');
+ btn.attr('data-open', false);
+ btn.css({
+ 'background-color': 'transparent',
+ transition: 'none'
+ });
+ anchor.css({
+ transition: 'none'
+ });
+ backdrop.css({
+ transform: 'scale(0)',
+ 'background-color': fabColor
+ });
+ menu.find('> li > a').css({
+ opacity: ''
+ });
+
+ setTimeout(function () {
+ backdrop.remove();
+
+ // Set initial state.
+ btn.css({
+ 'text-align': '',
+ width: '',
+ bottom: '',
+ left: '',
+ overflow: '',
+ 'background-color': '',
+ transform: 'translate3d(' + -offsetX + 'px,0,0)'
+ });
+ anchor.css({
+ overflow: '',
+ transform: 'translate3d(0,' + offsetY + 'px,0)'
+ });
+
+ setTimeout(function () {
+ btn.css({
+ transform: 'translate3d(0,0,0)',
+ transition: 'transform .2s'
+ });
+ anchor.css({
+ transform: 'translate3d(0,0,0)',
+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+ });
+ }, 20);
+ }, 200);
+ };
+})(jQuery);
+;(function ($) {
+ // Image transition function
+ Materialize.fadeInImage = function (selectorOrEl) {
+ var element;
+ if (typeof selectorOrEl === 'string') {
+ element = $(selectorOrEl);
+ } else if (typeof selectorOrEl === 'object') {
+ element = selectorOrEl;
+ } else {
+ return;
+ }
+ element.css({ opacity: 0 });
+ $(element).velocity({ opacity: 1 }, {
+ duration: 650,
+ queue: false,
+ easing: 'easeOutSine'
+ });
+ $(element).velocity({ opacity: 1 }, {
+ duration: 1300,
+ queue: false,
+ easing: 'swing',
+ step: function (now, fx) {
+ fx.start = 100;
+ var grayscale_setting = now / 100;
+ var brightness_setting = 150 - (100 - now) / 1.75;
+
+ if (brightness_setting < 100) {
+ brightness_setting = 100;
+ }
+ if (now >= 0) {
+ $(this).css({
+ "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
+ "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
+ });
+ }
+ }
+ });
+ };
+
+ // Horizontal staggered list
+ Materialize.showStaggeredList = function (selectorOrEl) {
+ var element;
+ if (typeof selectorOrEl === 'string') {
+ element = $(selectorOrEl);
+ } else if (typeof selectorOrEl === 'object') {
+ element = selectorOrEl;
+ } else {
+ return;
+ }
+ var time = 0;
+ element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
+
+ element.find('li').each(function () {
+ $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
+ time += 120;
+ });
+ };
+
+ $(document).ready(function () {
+ // Hardcoded .staggered-list scrollFire
+ // var staggeredListOptions = [];
+ // $('ul.staggered-list').each(function (i) {
+
+ // var label = 'scrollFire-' + i;
+ // $(this).addClass(label);
+ // staggeredListOptions.push(
+ // {selector: 'ul.staggered-list.' + label,
+ // offset: 200,
+ // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
+ // });
+ // scrollFire(staggeredListOptions);
+
+ // HammerJS, Swipe navigation
+
+ // Touch Event
+ var swipeLeft = false;
+ var swipeRight = false;
+
+ // Dismissible Collections
+ $('.dismissable').each(function () {
+ $(this).hammer({
+ prevent_default: false
+ }).on('pan', function (e) {
+ if (e.gesture.pointerType === "touch") {
+ var $this = $(this);
+ var direction = e.gesture.direction;
+ var x = e.gesture.deltaX;
+ var velocityX = e.gesture.velocityX;
+
+ $this.velocity({ translateX: x
+ }, { duration: 50, queue: false, easing: 'easeOutQuad' });
+
+ // Swipe Left
+ if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
+ swipeLeft = true;
+ }
+
+ // Swipe Right
+ if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
+ swipeRight = true;
+ }
+ }
+ }).on('panend', function (e) {
+ // Reset if collection is moved back into original position
+ if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
+ swipeRight = false;
+ swipeLeft = false;
+ }
+
+ if (e.gesture.pointerType === "touch") {
+ var $this = $(this);
+ if (swipeLeft || swipeRight) {
+ var fullWidth;
+ if (swipeLeft) {
+ fullWidth = $this.innerWidth();
+ } else {
+ fullWidth = -1 * $this.innerWidth();
+ }
+
+ $this.velocity({ translateX: fullWidth
+ }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
+ $this.css('border', 'none');
+ $this.velocity({ height: 0, padding: 0
+ }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
+ $this.remove();
+ }
+ });
+ }
+ });
+ } else {
+ $this.velocity({ translateX: 0
+ }, { duration: 100, queue: false, easing: 'easeOutQuad' });
+ }
+ swipeLeft = false;
+ swipeRight = false;
+ }
+ });
+ });
+
+ // time = 0
+ // // Vertical Staggered list
+ // $('ul.staggered-list.vertical li').velocity(
+ // { translateY: "100px"},
+ // { duration: 0 });
+
+ // $('ul.staggered-list.vertical li').each(function() {
+ // $(this).velocity(
+ // { opacity: "1", translateY: "0"},
+ // { duration: 800, delay: time, easing: [60, 25] });
+ // time += 120;
+ // });
+
+ // // Fade in and Scale
+ // $('.fade-in.scale').velocity(
+ // { scaleX: .4, scaleY: .4, translateX: -600},
+ // { duration: 0});
+ // $('.fade-in').each(function() {
+ // $(this).velocity(
+ // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
+ // { duration: 800, easing: [60, 10] });
+ // });
+ });
+})(jQuery);
+;(function ($) {
+
+ var scrollFireEventsHandled = false;
+
+ // Input: Array of JSON objects {selector, offset, callback}
+ Materialize.scrollFire = function (options) {
+ var onScroll = function () {
+ var windowScroll = window.pageYOffset + window.innerHeight;
+
+ for (var i = 0; i < options.length; i++) {
+ // Get options from each line
+ var value = options[i];
+ var selector = value.selector,
+ offset = value.offset,
+ callback = value.callback;
+
+ var currentElement = document.querySelector(selector);
+ if (currentElement !== null) {
+ var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
+
+ if (windowScroll > elementOffset + offset) {
+ if (value.done !== true) {
+ if (typeof callback === 'function') {
+ callback.call(this, currentElement);
+ } else if (typeof callback === 'string') {
+ var callbackFunc = new Function(callback);
+ callbackFunc(currentElement);
+ }
+ value.done = true;
+ }
+ }
+ }
+ }
+ };
+
+ var throttledScroll = Materialize.throttle(function () {
+ onScroll();
+ }, options.throttle || 100);
+
+ if (!scrollFireEventsHandled) {
+ window.addEventListener("scroll", throttledScroll);
+ window.addEventListener("resize", throttledScroll);
+ scrollFireEventsHandled = true;
+ }
+
+ // perform a scan once, after current execution context, and after dom is ready
+ setTimeout(throttledScroll, 0);
+ };
+})(jQuery);
+; /*!
+ * pickadate.js v3.5.0, 2014/04/13
+ * By Amsul, http://amsul.ca
+ * Hosted on http://amsul.github.io/pickadate.js
+ * Licensed under MIT
+ */
+
+(function (factory) {
+
+ Materialize.Picker = factory(jQuery);
+})(function ($) {
+
+ var $window = $(window);
+ var $document = $(document);
+ var $html = $(document.documentElement);
+
+ /**
+ * The picker constructor that creates a blank picker.
+ */
+ function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
+
+ // If there’s no element, return the picker constructor.
+ if (!ELEMENT) return PickerConstructor;
+
+ var IS_DEFAULT_THEME = false,
+
+
+ // The state of the picker.
+ STATE = {
+ id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
+ },
+
+
+ // Merge the defaults and options passed.
+ SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
+
+
+ // Merge the default classes with the settings classes.
+ CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
+
+
+ // The element node wrapper into a jQuery object.
+ $ELEMENT = $(ELEMENT),
+
+
+ // Pseudo picker constructor.
+ PickerInstance = function () {
+ return this.start();
+ },
+
+
+ // The picker prototype.
+ P = PickerInstance.prototype = {
+
+ constructor: PickerInstance,
+
+ $node: $ELEMENT,
+
+ /**
+ * Initialize everything
+ */
+ start: function () {
+
+ // If it’s already started, do nothing.
+ if (STATE && STATE.start) return P;
+
+ // Update the picker states.
+ STATE.methods = {};
+ STATE.start = true;
+ STATE.open = false;
+ STATE.type = ELEMENT.type;
+
+ // Confirm focus state, convert into text input to remove UA stylings,
+ // and set as readonly to prevent keyboard popup.
+ ELEMENT.autofocus = ELEMENT == getActiveElement();
+ ELEMENT.readOnly = !SETTINGS.editable;
+ ELEMENT.id = ELEMENT.id || STATE.id;
+ if (ELEMENT.type != 'text') {
+ ELEMENT.type = 'text';
+ }
+
+ // Create a new picker component with the settings.
+ P.component = new COMPONENT(P, SETTINGS);
+
+ // Create the picker root with a holder and then prepare it.
+ P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
+ prepareElementRoot();
+
+ // If there’s a format for the hidden input element, create the element.
+ if (SETTINGS.formatSubmit) {
+ prepareElementHidden();
+ }
+
+ // Prepare the input element.
+ prepareElement();
+
+ // Insert the root as specified in the settings.
+ if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
+
+ // Bind the default component and settings events.
+ P.on({
+ start: P.component.onStart,
+ render: P.component.onRender,
+ stop: P.component.onStop,
+ open: P.component.onOpen,
+ close: P.component.onClose,
+ set: P.component.onSet
+ }).on({
+ start: SETTINGS.onStart,
+ render: SETTINGS.onRender,
+ stop: SETTINGS.onStop,
+ open: SETTINGS.onOpen,
+ close: SETTINGS.onClose,
+ set: SETTINGS.onSet
+ });
+
+ // Once we’re all set, check the theme in use.
+ IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
+
+ // If the element has autofocus, open the picker.
+ if (ELEMENT.autofocus) {
+ P.open();
+ }
+
+ // Trigger queued the “start” and “render” events.
+ return P.trigger('start').trigger('render');
+ }, //start
+
+
+ /**
+ * Render a new picker
+ */
+ render: function (entireComponent) {
+
+ // Insert a new component holder in the root or box.
+ if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
+
+ // Trigger the queued “render” events.
+ return P.trigger('render');
+ }, //render
+
+
+ /**
+ * Destroy everything
+ */
+ stop: function () {
+
+ // If it’s already stopped, do nothing.
+ if (!STATE.start) return P;
+
+ // Then close the picker.
+ P.close();
+
+ // Remove the hidden field.
+ if (P._hidden) {
+ P._hidden.parentNode.removeChild(P._hidden);
+ }
+
+ // Remove the root.
+ P.$root.remove();
+
+ // Remove the input class, remove the stored data, and unbind
+ // the events (after a tick for IE - see `P.close`).
+ $ELEMENT.removeClass(CLASSES.input).removeData(NAME);
+ setTimeout(function () {
+ $ELEMENT.off('.' + STATE.id);
+ }, 0);
+
+ // Restore the element state
+ ELEMENT.type = STATE.type;
+ ELEMENT.readOnly = false;
+
+ // Trigger the queued “stop” events.
+ P.trigger('stop');
+
+ // Reset the picker states.
+ STATE.methods = {};
+ STATE.start = false;
+
+ return P;
+ }, //stop
+
+
+ /**
+ * Open up the picker
+ */
+ open: function (dontGiveFocus) {
+
+ // If it’s already open, do nothing.
+ if (STATE.open) return P;
+
+ // Add the “active” class.
+ $ELEMENT.addClass(CLASSES.active);
+ aria(ELEMENT, 'expanded', true);
+
+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
+ // killing transitions :(. So add the “opened” state on the next tick.
+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+ setTimeout(function () {
+
+ // Add the “opened” class to the picker root.
+ P.$root.addClass(CLASSES.opened);
+ aria(P.$root[0], 'hidden', false);
+ }, 0);
+
+ // If we have to give focus, bind the element and doc events.
+ if (dontGiveFocus !== false) {
+
+ // Set it as open.
+ STATE.open = true;
+
+ // Prevent the page from scrolling.
+ if (IS_DEFAULT_THEME) {
+ $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
+ }
+
+ // Pass focus to the root element’s jQuery object.
+ // * Workaround for iOS8 to bring the picker’s root into view.
+ P.$root.eq(0).focus();
+
+ // Bind the document events.
+ $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
+
+ var target = event.target;
+
+ // If the target of the event is not the element, close the picker picker.
+ // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
+ // Also, for Firefox, a click on an `option` element bubbles up directly
+ // to the doc. So make sure the target wasn't the doc.
+ // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
+ // which causes the picker to unexpectedly close when right-clicking it. So make
+ // sure the event wasn’t a right-click.
+ if (target != ELEMENT && target != document && event.which != 3) {
+
+ // If the target was the holder that covers the screen,
+ // keep the element focused to maintain tabindex.
+ P.close(target === P.$root.children()[0]);
+ }
+ }).on('keydown.' + STATE.id, function (event) {
+
+ var
+ // Get the keycode.
+ keycode = event.keyCode,
+
+
+ // Translate that to a selection change.
+ keycodeToMove = P.component.key[keycode],
+
+
+ // Grab the target.
+ target = event.target;
+
+ // On escape, close the picker and give focus.
+ if (keycode == 27) {
+ P.close(true);
+ }
+
+ // Check if there is a key movement or “enter” keypress on the element.
+ else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
+
+ // Prevent the default action to stop page movement.
+ event.preventDefault();
+
+ // Trigger the key movement action.
+ if (keycodeToMove) {
+ PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
+ }
+
+ // On “enter”, if the highlighted item isn’t disabled, set the value and close.
+ else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
+ P.set('select', P.component.item.highlight);
+ if (SETTINGS.closeOnSelect) {
+ P.close(true);
+ }
+ }
+ }
+
+ // If the target is within the root and “enter” is pressed,
+ // prevent the default action and trigger a click on the target instead.
+ else if ($.contains(P.$root[0], target) && keycode == 13) {
+ event.preventDefault();
+ target.click();
+ }
+ });
+ }
+
+ // Trigger the queued “open” events.
+ return P.trigger('open');
+ }, //open
+
+
+ /**
+ * Close the picker
+ */
+ close: function (giveFocus) {
+
+ // If we need to give focus, do it before changing states.
+ if (giveFocus) {
+ // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
+ // The focus is triggered *after* the close has completed - causing it
+ // to open again. So unbind and rebind the event at the next tick.
+ P.$root.off('focus.toOpen').eq(0).focus();
+ setTimeout(function () {
+ P.$root.on('focus.toOpen', handleFocusToOpenEvent);
+ }, 0);
+ }
+
+ // Remove the “active” class.
+ $ELEMENT.removeClass(CLASSES.active);
+ aria(ELEMENT, 'expanded', false);
+
+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
+ // killing transitions :(. So remove the “opened” state on the next tick.
+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+ setTimeout(function () {
+
+ // Remove the “opened” and “focused” class from the picker root.
+ P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
+ aria(P.$root[0], 'hidden', true);
+ }, 0);
+
+ // If it’s already closed, do nothing more.
+ if (!STATE.open) return P;
+
+ // Set it as closed.
+ STATE.open = false;
+
+ // Allow the page to scroll.
+ if (IS_DEFAULT_THEME) {
+ $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
+ }
+
+ // Unbind the document events.
+ $document.off('.' + STATE.id);
+
+ // Trigger the queued “close” events.
+ return P.trigger('close');
+ }, //close
+
+
+ /**
+ * Clear the values
+ */
+ clear: function (options) {
+ return P.set('clear', null, options);
+ }, //clear
+
+
+ /**
+ * Set something
+ */
+ set: function (thing, value, options) {
+
+ var thingItem,
+ thingValue,
+ thingIsObject = $.isPlainObject(thing),
+ thingObject = thingIsObject ? thing : {};
+
+ // Make sure we have usable options.
+ options = thingIsObject && $.isPlainObject(value) ? value : options || {};
+
+ if (thing) {
+
+ // If the thing isn’t an object, make it one.
+ if (!thingIsObject) {
+ thingObject[thing] = value;
+ }
+
+ // Go through the things of items to set.
+ for (thingItem in thingObject) {
+
+ // Grab the value of the thing.
+ thingValue = thingObject[thingItem];
+
+ // First, if the item exists and there’s a value, set it.
+ if (thingItem in P.component.item) {
+ if (thingValue === undefined) thingValue = null;
+ P.component.set(thingItem, thingValue, options);
+ }
+
+ // Then, check to update the element value and broadcast a change.
+ if (thingItem == 'select' || thingItem == 'clear') {
+ $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
+ }
+ }
+
+ // Render a new picker.
+ P.render();
+ }
+
+ // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
+ return options.muted ? P : P.trigger('set', thingObject);
+ }, //set
+
+
+ /**
+ * Get something
+ */
+ get: function (thing, format) {
+
+ // Make sure there’s something to get.
+ thing = thing || 'value';
+
+ // If a picker state exists, return that.
+ if (STATE[thing] != null) {
+ return STATE[thing];
+ }
+
+ // Return the submission value, if that.
+ if (thing == 'valueSubmit') {
+ if (P._hidden) {
+ return P._hidden.value;
+ }
+ thing = 'value';
+ }
+
+ // Return the value, if that.
+ if (thing == 'value') {
+ return ELEMENT.value;
+ }
+
+ // Check if a component item exists, return that.
+ if (thing in P.component.item) {
+ if (typeof format == 'string') {
+ var thingValue = P.component.get(thing);
+ return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
+ }
+ return P.component.get(thing);
+ }
+ }, //get
+
+
+ /**
+ * Bind events on the things.
+ */
+ on: function (thing, method, internal) {
+
+ var thingName,
+ thingMethod,
+ thingIsObject = $.isPlainObject(thing),
+ thingObject = thingIsObject ? thing : {};
+
+ if (thing) {
+
+ // If the thing isn’t an object, make it one.
+ if (!thingIsObject) {
+ thingObject[thing] = method;
+ }
+
+ // Go through the things to bind to.
+ for (thingName in thingObject) {
+
+ // Grab the method of the thing.
+ thingMethod = thingObject[thingName];
+
+ // If it was an internal binding, prefix it.
+ if (internal) {
+ thingName = '_' + thingName;
+ }
+
+ // Make sure the thing methods collection exists.
+ STATE.methods[thingName] = STATE.methods[thingName] || [];
+
+ // Add the method to the relative method collection.
+ STATE.methods[thingName].push(thingMethod);
+ }
+ }
+
+ return P;
+ }, //on
+
+
+ /**
+ * Unbind events on the things.
+ */
+ off: function () {
+ var i,
+ thingName,
+ names = arguments;
+ for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
+ thingName = names[i];
+ if (thingName in STATE.methods) {
+ delete STATE.methods[thingName];
+ }
+ }
+ return P;
+ },
+
+ /**
+ * Fire off method events.
+ */
+ trigger: function (name, data) {
+ var _trigger = function (name) {
+ var methodList = STATE.methods[name];
+ if (methodList) {
+ methodList.map(function (method) {
+ PickerConstructor._.trigger(method, P, [data]);
+ });
+ }
+ };
+ _trigger('_' + name);
+ _trigger(name);
+ return P;
+ } //trigger
+ //PickerInstance.prototype
+
+
+ /**
+ * Wrap the picker holder components together.
+ */
+ };function createWrappedComponent() {
+
+ // Create a picker wrapper holder
+ return PickerConstructor._.node('div',
+
+ // Create a picker wrapper node
+ PickerConstructor._.node('div',
+
+ // Create a picker frame
+ PickerConstructor._.node('div',
+
+ // Create a picker box node
+ PickerConstructor._.node('div',
+
+ // Create the components nodes.
+ P.component.nodes(STATE.open),
+
+ // The picker box class
+ CLASSES.box),
+
+ // Picker wrap class
+ CLASSES.wrap),
+
+ // Picker frame class
+ CLASSES.frame),
+
+ // Picker holder class
+ CLASSES.holder); //endreturn
+ } //createWrappedComponent
+
+
+ /**
+ * Prepare the input element with all bindings.
+ */
+ function prepareElement() {
+
+ $ELEMENT.
+
+ // Store the picker data by component name.
+ data(NAME, P).
+
+ // Add the “input” class name.
+ addClass(CLASSES.input).
+
+ // Remove the tabindex.
+ attr('tabindex', -1).
+
+ // If there’s a `data-value`, update the value of the element.
+ val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
+
+ // Only bind keydown events if the element isn’t editable.
+ if (!SETTINGS.editable) {
+
+ $ELEMENT.
+
+ // On focus/click, focus onto the root to open it up.
+ on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
+ event.preventDefault();
+ P.$root.eq(0).focus();
+ }).
+
+ // Handle keyboard event based on the picker being opened or not.
+ on('keydown.' + STATE.id, handleKeydownEvent);
+ }
+
+ // Update the aria attributes.
+ aria(ELEMENT, {
+ haspopup: true,
+ expanded: false,
+ readonly: false,
+ owns: ELEMENT.id + '_root'
+ });
+ }
+
+ /**
+ * Prepare the root picker element with all bindings.
+ */
+ function prepareElementRoot() {
+
+ P.$root.on({
+
+ // For iOS8.
+ keydown: handleKeydownEvent,
+
+ // When something within the root is focused, stop from bubbling
+ // to the doc and remove the “focused” state from the root.
+ focusin: function (event) {
+ P.$root.removeClass(CLASSES.focused);
+ event.stopPropagation();
+ },
+
+ // When something within the root holder is clicked, stop it
+ // from bubbling to the doc.
+ 'mousedown click': function (event) {
+
+ var target = event.target;
+
+ // Make sure the target isn’t the root holder so it can bubble up.
+ if (target != P.$root.children()[0]) {
+
+ event.stopPropagation();
+
+ // * For mousedown events, cancel the default action in order to
+ // prevent cases where focus is shifted onto external elements
+ // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
+ // Also, for Firefox, don’t prevent action on the `option` element.
+ if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
+
+ event.preventDefault();
+
+ // Re-focus onto the root so that users can click away
+ // from elements focused within the picker.
+ P.$root.eq(0).focus();
+ }
+ }
+ }
+ }).
+
+ // Add/remove the “target” class on focus and blur.
+ on({
+ focus: function () {
+ $ELEMENT.addClass(CLASSES.target);
+ },
+ blur: function () {
+ $ELEMENT.removeClass(CLASSES.target);
+ }
+ }).
+
+ // Open the picker and adjust the root “focused” state
+ on('focus.toOpen', handleFocusToOpenEvent).
+
+ // If there’s a click on an actionable element, carry out the actions.
+ on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
+
+ var $target = $(this),
+ targetData = $target.data(),
+ targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
+
+
+ // * For IE, non-focusable elements can be active elements as well
+ // (http://stackoverflow.com/a/2684561).
+ activeElement = getActiveElement();
+ activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement;
+
+ // If it’s disabled or nothing inside is actively focused, re-focus the element.
+ if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
+ P.$root.eq(0).focus();
+ }
+
+ // If something is superficially changed, update the `highlight` based on the `nav`.
+ if (!targetDisabled && targetData.nav) {
+ P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
+ }
+
+ // If something is picked, set `select` then close with focus.
+ else if (!targetDisabled && 'pick' in targetData) {
+ P.set('select', targetData.pick);
+ if (SETTINGS.closeOnSelect) {
+ P.close(true);
+ }
+ }
+
+ // If a “clear” button is pressed, empty the values and close with focus.
+ else if (targetData.clear) {
+ P.clear();
+ if (SETTINGS.closeOnSelect) {
+ P.close(true);
+ }
+ } else if (targetData.close) {
+ P.close(true);
+ }
+ }); //P.$root
+
+ aria(P.$root[0], 'hidden', true);
+ }
+
+ /**
+ * Prepare the hidden input element along with all bindings.
+ */
+ function prepareElementHidden() {
+
+ var name;
+
+ if (SETTINGS.hiddenName === true) {
+ name = ELEMENT.name;
+ ELEMENT.name = '';
+ } else {
+ name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
+ name = name[0] + ELEMENT.name + name[1];
+ }
+
+ P._hidden = $('')[0];
+
+ $ELEMENT.
+
+ // If the value changes, update the hidden input with the correct format.
+ on('change.' + STATE.id, function () {
+ P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
+ });
+
+ // Insert the hidden input as specified in the settings.
+ if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
+ }
+
+ // For iOS8.
+ function handleKeydownEvent(event) {
+
+ var keycode = event.keyCode,
+
+
+ // Check if one of the delete keys was pressed.
+ isKeycodeDelete = /^(8|46)$/.test(keycode);
+
+ // For some reason IE clears the input value on “escape”.
+ if (keycode == 27) {
+ P.close();
+ return false;
+ }
+
+ // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
+ if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
+
+ // Prevent it from moving the page and bubbling to doc.
+ event.preventDefault();
+ event.stopPropagation();
+
+ // If `delete` was pressed, clear the values and close the picker.
+ // Otherwise open the picker.
+ if (isKeycodeDelete) {
+ P.clear().close();
+ } else {
+ P.open();
+ }
+ }
+ }
+
+ // Separated for IE
+ function handleFocusToOpenEvent(event) {
+
+ // Stop the event from propagating to the doc.
+ event.stopPropagation();
+
+ // If it’s a focus event, add the “focused” class to the root.
+ if (event.type == 'focus') {
+ P.$root.addClass(CLASSES.focused);
+ }
+
+ // And then finally open the picker.
+ P.open();
+ }
+
+ // Return a new picker instance.
+ return new PickerInstance();
+ } //PickerConstructor
+
+
+ /**
+ * The default classes and prefix to use for the HTML classes.
+ */
+ PickerConstructor.klasses = function (prefix) {
+ prefix = prefix || 'picker';
+ return {
+
+ picker: prefix,
+ opened: prefix + '--opened',
+ focused: prefix + '--focused',
+
+ input: prefix + '__input',
+ active: prefix + '__input--active',
+ target: prefix + '__input--target',
+
+ holder: prefix + '__holder',
+
+ frame: prefix + '__frame',
+ wrap: prefix + '__wrap',
+
+ box: prefix + '__box'
+ };
+ }; //PickerConstructor.klasses
+
+
+ /**
+ * Check if the default theme is being used.
+ */
+ function isUsingDefaultTheme(element) {
+
+ var theme,
+ prop = 'position';
+
+ // For IE.
+ if (element.currentStyle) {
+ theme = element.currentStyle[prop];
+ }
+
+ // For normal browsers.
+ else if (window.getComputedStyle) {
+ theme = getComputedStyle(element)[prop];
+ }
+
+ return theme == 'fixed';
+ }
+
+ /**
+ * Get the width of the browser’s scrollbar.
+ * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
+ */
+ function getScrollbarWidth() {
+
+ if ($html.height() <= $window.height()) {
+ return 0;
+ }
+
+ var $outer = $('').appendTo('body');
+
+ // Get the width without scrollbars.
+ var widthWithoutScroll = $outer[0].offsetWidth;
+
+ // Force adding scrollbars.
+ $outer.css('overflow', 'scroll');
+
+ // Add the inner div.
+ var $inner = $('').appendTo($outer);
+
+ // Get the width with scrollbars.
+ var widthWithScroll = $inner[0].offsetWidth;
+
+ // Remove the divs.
+ $outer.remove();
+
+ // Return the difference between the widths.
+ return widthWithoutScroll - widthWithScroll;
+ }
+
+ /**
+ * PickerConstructor helper methods.
+ */
+ PickerConstructor._ = {
+
+ /**
+ * Create a group of nodes. Expects:
+ * `
+ {
+ min: {Integer},
+ max: {Integer},
+ i: {Integer},
+ node: {String},
+ item: {Function}
+ }
+ * `
+ */
+ group: function (groupObject) {
+
+ var
+ // Scope for the looped object
+ loopObjectScope,
+
+
+ // Create the nodes list
+ nodesList = '',
+
+
+ // The counter starts from the `min`
+ counter = PickerConstructor._.trigger(groupObject.min, groupObject);
+
+ // Loop from the `min` to `max`, incrementing by `i`
+ for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
+
+ // Trigger the `item` function within scope of the object
+ loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
+
+ // Splice the subgroup and create nodes out of the sub nodes
+ nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
+ loopObjectScope[1], // the classes
+ loopObjectScope[2] // the attributes
+ );
+ }
+
+ // Return the list of nodes
+ return nodesList;
+ }, //group
+
+
+ /**
+ * Create a dom node string
+ */
+ node: function (wrapper, item, klass, attribute) {
+
+ // If the item is false-y, just return an empty string
+ if (!item) return '';
+
+ // If the item is an array, do a join
+ item = $.isArray(item) ? item.join('') : item;
+
+ // Check for the class
+ klass = klass ? ' class="' + klass + '"' : '';
+
+ // Check for any attributes
+ attribute = attribute ? ' ' + attribute : '';
+
+ // Return the wrapped item
+ return '<' + wrapper + klass + attribute + '>' + item + '' + wrapper + '>';
+ }, //node
+
+
+ /**
+ * Lead numbers below 10 with a zero.
+ */
+ lead: function (number) {
+ return (number < 10 ? '0' : '') + number;
+ },
+
+ /**
+ * Trigger a function otherwise return the value.
+ */
+ trigger: function (callback, scope, args) {
+ return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
+ },
+
+ /**
+ * If the second character is a digit, length is 2 otherwise 1.
+ */
+ digits: function (string) {
+ return (/\d/.test(string[1]) ? 2 : 1
+ );
+ },
+
+ /**
+ * Tell if something is a date object.
+ */
+ isDate: function (value) {
+ return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
+ },
+
+ /**
+ * Tell if something is an integer.
+ */
+ isInteger: function (value) {
+ return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
+ },
+
+ /**
+ * Create ARIA attribute strings.
+ */
+ ariaAttr: ariaAttr //PickerConstructor._
+
+
+ /**
+ * Extend the picker with a component and defaults.
+ */
+ };PickerConstructor.extend = function (name, Component) {
+
+ // Extend jQuery.
+ $.fn[name] = function (options, action) {
+
+ // Grab the component data.
+ var componentData = this.data(name);
+
+ // If the picker is requested, return the data object.
+ if (options == 'picker') {
+ return componentData;
+ }
+
+ // If the component data exists and `options` is a string, carry out the action.
+ if (componentData && typeof options == 'string') {
+ return PickerConstructor._.trigger(componentData[options], componentData, [action]);
+ }
+
+ // Otherwise go through each matched element and if the component
+ // doesn’t exist, create a new picker using `this` element
+ // and merging the defaults and options with a deep copy.
+ return this.each(function () {
+ var $this = $(this);
+ if (!$this.data(name)) {
+ new PickerConstructor(this, name, Component, options);
+ }
+ });
+ };
+
+ // Set the defaults.
+ $.fn[name].defaults = Component.defaults;
+ }; //PickerConstructor.extend
+
+
+ function aria(element, attribute, value) {
+ if ($.isPlainObject(attribute)) {
+ for (var key in attribute) {
+ ariaSet(element, key, attribute[key]);
+ }
+ } else {
+ ariaSet(element, attribute, value);
+ }
+ }
+ function ariaSet(element, attribute, value) {
+ element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
+ }
+ function ariaAttr(attribute, data) {
+ if (!$.isPlainObject(attribute)) {
+ attribute = { attribute: data };
+ }
+ data = '';
+ for (var key in attribute) {
+ var attr = (key == 'role' ? '' : 'aria-') + key,
+ attrVal = attribute[key];
+ data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
+ }
+ return data;
+ }
+
+ // IE8 bug throws an error for activeElements within iframes.
+ function getActiveElement() {
+ try {
+ return document.activeElement;
+ } catch (err) {}
+ }
+
+ // Expose the picker constructor.
+ return PickerConstructor;
+});
+; /*!
+ * Date picker for pickadate.js v3.5.0
+ * http://amsul.github.io/pickadate.js/date.htm
+ */
+
+(function (factory) {
+ factory(Materialize.Picker, jQuery);
+})(function (Picker, $) {
+
+ /**
+ * Globals and constants
+ */
+ var DAYS_IN_WEEK = 7,
+ WEEKS_IN_CALENDAR = 6,
+ _ = Picker._;
+
+ /**
+ * The date picker constructor
+ */
+ function DatePicker(picker, settings) {
+
+ var calendar = this,
+ element = picker.$node[0],
+ elementValue = element.value,
+ elementDataValue = picker.$node.data('value'),
+ valueString = elementDataValue || elementValue,
+ formatString = elementDataValue ? settings.formatSubmit : settings.format,
+ isRTL = function () {
+
+ return element.currentStyle ?
+
+ // For IE.
+ element.currentStyle.direction == 'rtl' :
+
+ // For normal browsers.
+ getComputedStyle(picker.$root[0]).direction == 'rtl';
+ };
+
+ calendar.settings = settings;
+ calendar.$node = picker.$node;
+
+ // The queue of methods that will be used to build item objects.
+ calendar.queue = {
+ min: 'measure create',
+ max: 'measure create',
+ now: 'now create',
+ select: 'parse create validate',
+ highlight: 'parse navigate create validate',
+ view: 'parse create validate viewset',
+ disable: 'deactivate',
+ enable: 'activate'
+
+ // The component's item object.
+ };calendar.item = {};
+
+ calendar.item.clear = null;
+ calendar.item.disable = (settings.disable || []).slice(0);
+ calendar.item.enable = -function (collectionDisabled) {
+ return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
+ }(calendar.item.disable);
+
+ calendar.set('min', settings.min).set('max', settings.max).set('now');
+
+ // When there’s a value, set the `select`, which in turn
+ // also sets the `highlight` and `view`.
+ if (valueString) {
+ calendar.set('select', valueString, { format: formatString });
+ }
+
+ // If there’s no value, default to highlighting “today”.
+ else {
+ calendar.set('select', null).set('highlight', calendar.item.now);
+ }
+
+ // The keycode to movement mapping.
+ calendar.key = {
+ 40: 7, // Down
+ 38: -7, // Up
+ 39: function () {
+ return isRTL() ? -1 : 1;
+ }, // Right
+ 37: function () {
+ return isRTL() ? 1 : -1;
+ }, // Left
+ go: function (timeChange) {
+ var highlightedObject = calendar.item.highlight,
+ targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
+ calendar.set('highlight', targetDate, { interval: timeChange });
+ this.render();
+ }
+
+ // Bind some picker events.
+ };picker.on('render', function () {
+ picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
+ var value = this.value;
+ if (value) {
+ picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
+ picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
+ }
+ });
+ picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
+ var value = this.value;
+ if (value) {
+ picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
+ picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
+ }
+ });
+ }, 1).on('open', function () {
+ var includeToday = '';
+ if (calendar.disabled(calendar.get('now'))) {
+ includeToday = ':not(.' + settings.klass.buttonToday + ')';
+ }
+ picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
+ }, 1).on('close', function () {
+ picker.$root.find('button, select').attr('disabled', true);
+ }, 1);
+ } //DatePicker
+
+
+ /**
+ * Set a datepicker item object.
+ */
+ DatePicker.prototype.set = function (type, value, options) {
+
+ var calendar = this,
+ calendarItem = calendar.item;
+
+ // If the value is `null` just set it immediately.
+ if (value === null) {
+ if (type == 'clear') type = 'select';
+ calendarItem[type] = value;
+ return calendar;
+ }
+
+ // Otherwise go through the queue of methods, and invoke the functions.
+ // Update this as the time unit, and set the final value as this item.
+ // * In the case of `enable`, keep the queue but set `disable` instead.
+ // And in the case of `flip`, keep the queue but set `enable` instead.
+ calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
+ value = calendar[method](type, value, options);
+ return value;
+ }).pop();
+
+ // Check if we need to cascade through more updates.
+ if (type == 'select') {
+ calendar.set('highlight', calendarItem.select, options);
+ } else if (type == 'highlight') {
+ calendar.set('view', calendarItem.highlight, options);
+ } else if (type.match(/^(flip|min|max|disable|enable)$/)) {
+ if (calendarItem.select && calendar.disabled(calendarItem.select)) {
+ calendar.set('select', calendarItem.select, options);
+ }
+ if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
+ calendar.set('highlight', calendarItem.highlight, options);
+ }
+ }
+
+ return calendar;
+ }; //DatePicker.prototype.set
+
+
+ /**
+ * Get a datepicker item object.
+ */
+ DatePicker.prototype.get = function (type) {
+ return this.item[type];
+ }; //DatePicker.prototype.get
+
+
+ /**
+ * Create a picker date object.
+ */
+ DatePicker.prototype.create = function (type, value, options) {
+
+ var isInfiniteValue,
+ calendar = this;
+
+ // If there’s no value, use the type as the value.
+ value = value === undefined ? type : value;
+
+ // If it’s infinity, update the value.
+ if (value == -Infinity || value == Infinity) {
+ isInfiniteValue = value;
+ }
+
+ // If it’s an object, use the native date object.
+ else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
+ value = value.obj;
+ }
+
+ // If it’s an array, convert it into a date and make sure
+ // that it’s a valid date – otherwise default to today.
+ else if ($.isArray(value)) {
+ value = new Date(value[0], value[1], value[2]);
+ value = _.isDate(value) ? value : calendar.create().obj;
+ }
+
+ // If it’s a number or date object, make a normalized date.
+ else if (_.isInteger(value) || _.isDate(value)) {
+ value = calendar.normalize(new Date(value), options);
+ }
+
+ // If it’s a literal true or any other case, set it to now.
+ else /*if ( value === true )*/{
+ value = calendar.now(type, value, options);
+ }
+
+ // Return the compiled object.
+ return {
+ year: isInfiniteValue || value.getFullYear(),
+ month: isInfiniteValue || value.getMonth(),
+ date: isInfiniteValue || value.getDate(),
+ day: isInfiniteValue || value.getDay(),
+ obj: isInfiniteValue || value,
+ pick: isInfiniteValue || value.getTime()
+ };
+ }; //DatePicker.prototype.create
+
+
+ /**
+ * Create a range limit object using an array, date object,
+ * literal “true”, or integer relative to another time.
+ */
+ DatePicker.prototype.createRange = function (from, to) {
+
+ var calendar = this,
+ createDate = function (date) {
+ if (date === true || $.isArray(date) || _.isDate(date)) {
+ return calendar.create(date);
+ }
+ return date;
+ };
+
+ // Create objects if possible.
+ if (!_.isInteger(from)) {
+ from = createDate(from);
+ }
+ if (!_.isInteger(to)) {
+ to = createDate(to);
+ }
+
+ // Create relative dates.
+ if (_.isInteger(from) && $.isPlainObject(to)) {
+ from = [to.year, to.month, to.date + from];
+ } else if (_.isInteger(to) && $.isPlainObject(from)) {
+ to = [from.year, from.month, from.date + to];
+ }
+
+ return {
+ from: createDate(from),
+ to: createDate(to)
+ };
+ }; //DatePicker.prototype.createRange
+
+
+ /**
+ * Check if a date unit falls within a date range object.
+ */
+ DatePicker.prototype.withinRange = function (range, dateUnit) {
+ range = this.createRange(range.from, range.to);
+ return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
+ };
+
+ /**
+ * Check if two date range objects overlap.
+ */
+ DatePicker.prototype.overlapRanges = function (one, two) {
+
+ var calendar = this;
+
+ // Convert the ranges into comparable dates.
+ one = calendar.createRange(one.from, one.to);
+ two = calendar.createRange(two.from, two.to);
+
+ return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
+ };
+
+ /**
+ * Get the date today.
+ */
+ DatePicker.prototype.now = function (type, value, options) {
+ value = new Date();
+ if (options && options.rel) {
+ value.setDate(value.getDate() + options.rel);
+ }
+ return this.normalize(value, options);
+ };
+
+ /**
+ * Navigate to next/prev month.
+ */
+ DatePicker.prototype.navigate = function (type, value, options) {
+
+ var targetDateObject,
+ targetYear,
+ targetMonth,
+ targetDate,
+ isTargetArray = $.isArray(value),
+ isTargetObject = $.isPlainObject(value),
+ viewsetObject = this.item.view; /*,
+ safety = 100*/
+
+ if (isTargetArray || isTargetObject) {
+
+ if (isTargetObject) {
+ targetYear = value.year;
+ targetMonth = value.month;
+ targetDate = value.date;
+ } else {
+ targetYear = +value[0];
+ targetMonth = +value[1];
+ targetDate = +value[2];
+ }
+
+ // If we’re navigating months but the view is in a different
+ // month, navigate to the view’s year and month.
+ if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
+ targetYear = viewsetObject.year;
+ targetMonth = viewsetObject.month;
+ }
+
+ // Figure out the expected target year and month.
+ targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
+ targetYear = targetDateObject.getFullYear();
+ targetMonth = targetDateObject.getMonth();
+
+ // If the month we’re going to doesn’t have enough days,
+ // keep decreasing the date until we reach the month’s last date.
+ while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
+ targetDate -= 1;
+ /*safety -= 1
+ if ( !safety ) {
+ throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
+ }*/
+ }
+
+ value = [targetYear, targetMonth, targetDate];
+ }
+
+ return value;
+ }; //DatePicker.prototype.navigate
+
+
+ /**
+ * Normalize a date by setting the hours to midnight.
+ */
+ DatePicker.prototype.normalize = function (value /*, options*/) {
+ value.setHours(0, 0, 0, 0);
+ return value;
+ };
+
+ /**
+ * Measure the range of dates.
+ */
+ DatePicker.prototype.measure = function (type, value /*, options*/) {
+
+ var calendar = this;
+
+ // If it’s anything false-y, remove the limits.
+ if (!value) {
+ value = type == 'min' ? -Infinity : Infinity;
+ }
+
+ // If it’s a string, parse it.
+ else if (typeof value == 'string') {
+ value = calendar.parse(type, value);
+ }
+
+ // If it's an integer, get a date relative to today.
+ else if (_.isInteger(value)) {
+ value = calendar.now(type, value, { rel: value });
+ }
+
+ return value;
+ }; ///DatePicker.prototype.measure
+
+
+ /**
+ * Create a viewset object based on navigation.
+ */
+ DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
+ return this.create([dateObject.year, dateObject.month, 1]);
+ };
+
+ /**
+ * Validate a date as enabled and shift if needed.
+ */
+ DatePicker.prototype.validate = function (type, dateObject, options) {
+
+ var calendar = this,
+
+
+ // Keep a reference to the original date.
+ originalDateObject = dateObject,
+
+
+ // Make sure we have an interval.
+ interval = options && options.interval ? options.interval : 1,
+
+
+ // Check if the calendar enabled dates are inverted.
+ isFlippedBase = calendar.item.enable === -1,
+
+
+ // Check if we have any enabled dates after/before now.
+ hasEnabledBeforeTarget,
+ hasEnabledAfterTarget,
+
+
+ // The min & max limits.
+ minLimitObject = calendar.item.min,
+ maxLimitObject = calendar.item.max,
+
+
+ // Check if we’ve reached the limit during shifting.
+ reachedMin,
+ reachedMax,
+
+
+ // Check if the calendar is inverted and at least one weekday is enabled.
+ hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
+
+ // If there’s a date, check where it is relative to the target.
+ if ($.isArray(value)) {
+ var dateTime = calendar.create(value).pick;
+ if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
+ }
+
+ // Return only integers for enabled weekdays.
+ return _.isInteger(value);
+ }).length; /*,
+ safety = 100*/
+
+ // Cases to validate for:
+ // [1] Not inverted and date disabled.
+ // [2] Inverted and some dates enabled.
+ // [3] Not inverted and out of range.
+ //
+ // Cases to **not** validate for:
+ // • Navigating months.
+ // • Not inverted and date enabled.
+ // • Inverted and all dates disabled.
+ // • ..and anything else.
+ if (!options || !options.nav) if (
+ /* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
+ /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
+ /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {
+
+ // When inverted, flip the direction if there aren’t any enabled weekdays
+ // and there are no enabled dates in the direction of the interval.
+ if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
+ interval *= -1;
+ }
+
+ // Keep looping until we reach an enabled date.
+ while ( /*safety &&*/calendar.disabled(dateObject)) {
+
+ /*safety -= 1
+ if ( !safety ) {
+ throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
+ }*/
+
+ // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
+ if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
+ dateObject = originalDateObject;
+ interval = interval > 0 ? 1 : -1;
+ }
+
+ // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
+ if (dateObject.pick <= minLimitObject.pick) {
+ reachedMin = true;
+ interval = 1;
+ dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
+ } else if (dateObject.pick >= maxLimitObject.pick) {
+ reachedMax = true;
+ interval = -1;
+ dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
+ }
+
+ // If we’ve reached both limits, just break out of the loop.
+ if (reachedMin && reachedMax) {
+ break;
+ }
+
+ // Finally, create the shifted date using the interval and keep looping.
+ dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
+ }
+ } //endif
+
+
+ // Return the date object settled on.
+ return dateObject;
+ }; //DatePicker.prototype.validate
+
+
+ /**
+ * Check if a date is disabled.
+ */
+ DatePicker.prototype.disabled = function (dateToVerify) {
+
+ var calendar = this,
+
+
+ // Filter through the disabled dates to check if this is one.
+ isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
+
+ // If the date is a number, match the weekday with 0index and `firstDay` check.
+ if (_.isInteger(dateToDisable)) {
+ return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
+ }
+
+ // If it’s an array or a native JS date, create and match the exact date.
+ if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
+ return dateToVerify.pick === calendar.create(dateToDisable).pick;
+ }
+
+ // If it’s an object, match a date within the “from” and “to” range.
+ if ($.isPlainObject(dateToDisable)) {
+ return calendar.withinRange(dateToDisable, dateToVerify);
+ }
+ });
+
+ // If this date matches a disabled date, confirm it’s not inverted.
+ isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
+ return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
+ }).length;
+
+ // Check the calendar “enabled” flag and respectively flip the
+ // disabled state. Then also check if it’s beyond the min/max limits.
+ return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
+ }; //DatePicker.prototype.disabled
+
+
+ /**
+ * Parse a string into a usable type.
+ */
+ DatePicker.prototype.parse = function (type, value, options) {
+
+ var calendar = this,
+ parsingObject = {};
+
+ // If it’s already parsed, we’re good.
+ if (!value || typeof value != 'string') {
+ return value;
+ }
+
+ // We need a `.format` to parse the value with.
+ if (!(options && options.format)) {
+ options = options || {};
+ options.format = calendar.settings.format;
+ }
+
+ // Convert the format into an array and then map through it.
+ calendar.formats.toArray(options.format).map(function (label) {
+
+ var
+ // Grab the formatting label.
+ formattingLabel = calendar.formats[label],
+
+
+ // The format length is from the formatting label function or the
+ // label length without the escaping exclamation (!) mark.
+ formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;
+
+ // If there's a format label, split the value up to the format length.
+ // Then add it to the parsing object with appropriate label.
+ if (formattingLabel) {
+ parsingObject[label] = value.substr(0, formatLength);
+ }
+
+ // Update the value as the substring from format length to end.
+ value = value.substr(formatLength);
+ });
+
+ // Compensate for month 0index.
+ return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
+ }; //DatePicker.prototype.parse
+
+
+ /**
+ * Various formats to display the object in.
+ */
+ DatePicker.prototype.formats = function () {
+
+ // Return the length of the first word in a collection.
+ function getWordLengthFromCollection(string, collection, dateObject) {
+
+ // Grab the first word from the string.
+ var word = string.match(/\w+/)[0];
+
+ // If there's no month index, add it to the date object
+ if (!dateObject.mm && !dateObject.m) {
+ dateObject.m = collection.indexOf(word) + 1;
+ }
+
+ // Return the length of the word.
+ return word.length;
+ }
+
+ // Get the length of the first word in a string.
+ function getFirstWordLength(string) {
+ return string.match(/\w+/)[0].length;
+ }
+
+ return {
+
+ d: function (string, dateObject) {
+
+ // If there's string, then get the digits length.
+ // Otherwise return the selected date.
+ return string ? _.digits(string) : dateObject.date;
+ },
+ dd: function (string, dateObject) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected date with a leading zero.
+ return string ? 2 : _.lead(dateObject.date);
+ },
+ ddd: function (string, dateObject) {
+
+ // If there's a string, then get the length of the first word.
+ // Otherwise return the short selected weekday.
+ return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
+ },
+ dddd: function (string, dateObject) {
+
+ // If there's a string, then get the length of the first word.
+ // Otherwise return the full selected weekday.
+ return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
+ },
+ m: function (string, dateObject) {
+
+ // If there's a string, then get the length of the digits
+ // Otherwise return the selected month with 0index compensation.
+ return string ? _.digits(string) : dateObject.month + 1;
+ },
+ mm: function (string, dateObject) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected month with 0index and leading zero.
+ return string ? 2 : _.lead(dateObject.month + 1);
+ },
+ mmm: function (string, dateObject) {
+
+ var collection = this.settings.monthsShort;
+
+ // If there's a string, get length of the relevant month from the short
+ // months collection. Otherwise return the selected month from that collection.
+ return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
+ },
+ mmmm: function (string, dateObject) {
+
+ var collection = this.settings.monthsFull;
+
+ // If there's a string, get length of the relevant month from the full
+ // months collection. Otherwise return the selected month from that collection.
+ return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
+ },
+ yy: function (string, dateObject) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected year by slicing out the first 2 digits.
+ return string ? 2 : ('' + dateObject.year).slice(2);
+ },
+ yyyy: function (string, dateObject) {
+
+ // If there's a string, then the length is always 4.
+ // Otherwise return the selected year.
+ return string ? 4 : dateObject.year;
+ },
+
+ // Create an array by splitting the formatting string passed.
+ toArray: function (formatString) {
+ return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
+ },
+
+ // Format an object into a string using the formatting options.
+ toString: function (formatString, itemObject) {
+ var calendar = this;
+ return calendar.formats.toArray(formatString).map(function (label) {
+ return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '');
+ }).join('');
+ }
+ };
+ }(); //DatePicker.prototype.formats
+
+
+ /**
+ * Check if two date units are the exact.
+ */
+ DatePicker.prototype.isDateExact = function (one, two) {
+
+ var calendar = this;
+
+ // When we’re working with weekdays, do a direct comparison.
+ if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
+ return one === two;
+ }
+
+ // When we’re working with date representations, compare the “pick” value.
+ if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
+ return calendar.create(one).pick === calendar.create(two).pick;
+ }
+
+ // When we’re working with range objects, compare the “from” and “to”.
+ if ($.isPlainObject(one) && $.isPlainObject(two)) {
+ return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
+ }
+
+ return false;
+ };
+
+ /**
+ * Check if two date units overlap.
+ */
+ DatePicker.prototype.isDateOverlap = function (one, two) {
+
+ var calendar = this,
+ firstDay = calendar.settings.firstDay ? 1 : 0;
+
+ // When we’re working with a weekday index, compare the days.
+ if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
+ one = one % 7 + firstDay;
+ return one === calendar.create(two).day + 1;
+ }
+ if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
+ two = two % 7 + firstDay;
+ return two === calendar.create(one).day + 1;
+ }
+
+ // When we’re working with range objects, check if the ranges overlap.
+ if ($.isPlainObject(one) && $.isPlainObject(two)) {
+ return calendar.overlapRanges(one, two);
+ }
+
+ return false;
+ };
+
+ /**
+ * Flip the “enabled” state.
+ */
+ DatePicker.prototype.flipEnable = function (val) {
+ var itemObject = this.item;
+ itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
+ };
+
+ /**
+ * Mark a collection of dates as “disabled”.
+ */
+ DatePicker.prototype.deactivate = function (type, datesToDisable) {
+
+ var calendar = this,
+ disabledItems = calendar.item.disable.slice(0);
+
+ // If we’re flipping, that’s all we need to do.
+ if (datesToDisable == 'flip') {
+ calendar.flipEnable();
+ } else if (datesToDisable === false) {
+ calendar.flipEnable(1);
+ disabledItems = [];
+ } else if (datesToDisable === true) {
+ calendar.flipEnable(-1);
+ disabledItems = [];
+ }
+
+ // Otherwise go through the dates to disable.
+ else {
+
+ datesToDisable.map(function (unitToDisable) {
+
+ var matchFound;
+
+ // When we have disabled items, check for matches.
+ // If something is matched, immediately break out.
+ for (var index = 0; index < disabledItems.length; index += 1) {
+ if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
+ matchFound = true;
+ break;
+ }
+ }
+
+ // If nothing was found, add the validated unit to the collection.
+ if (!matchFound) {
+ if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
+ disabledItems.push(unitToDisable);
+ }
+ }
+ });
+ }
+
+ // Return the updated collection.
+ return disabledItems;
+ }; //DatePicker.prototype.deactivate
+
+
+ /**
+ * Mark a collection of dates as “enabled”.
+ */
+ DatePicker.prototype.activate = function (type, datesToEnable) {
+
+ var calendar = this,
+ disabledItems = calendar.item.disable,
+ disabledItemsCount = disabledItems.length;
+
+ // If we’re flipping, that’s all we need to do.
+ if (datesToEnable == 'flip') {
+ calendar.flipEnable();
+ } else if (datesToEnable === true) {
+ calendar.flipEnable(1);
+ disabledItems = [];
+ } else if (datesToEnable === false) {
+ calendar.flipEnable(-1);
+ disabledItems = [];
+ }
+
+ // Otherwise go through the disabled dates.
+ else {
+
+ datesToEnable.map(function (unitToEnable) {
+
+ var matchFound, disabledUnit, index, isExactRange;
+
+ // Go through the disabled items and try to find a match.
+ for (index = 0; index < disabledItemsCount; index += 1) {
+
+ disabledUnit = disabledItems[index];
+
+ // When an exact match is found, remove it from the collection.
+ if (calendar.isDateExact(disabledUnit, unitToEnable)) {
+ matchFound = disabledItems[index] = null;
+ isExactRange = true;
+ break;
+ }
+
+ // When an overlapped match is found, add the “inverted” state to it.
+ else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
+ if ($.isPlainObject(unitToEnable)) {
+ unitToEnable.inverted = true;
+ matchFound = unitToEnable;
+ } else if ($.isArray(unitToEnable)) {
+ matchFound = unitToEnable;
+ if (!matchFound[3]) matchFound.push('inverted');
+ } else if (_.isDate(unitToEnable)) {
+ matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
+ }
+ break;
+ }
+ }
+
+ // If a match was found, remove a previous duplicate entry.
+ if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
+ if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
+ disabledItems[index] = null;
+ break;
+ }
+ }
+
+ // In the event that we’re dealing with an exact range of dates,
+ // make sure there are no “inverted” dates because of it.
+ if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
+ if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
+ disabledItems[index] = null;
+ break;
+ }
+ }
+
+ // If something is still matched, add it into the collection.
+ if (matchFound) {
+ disabledItems.push(matchFound);
+ }
+ });
+ }
+
+ // Return the updated collection.
+ return disabledItems.filter(function (val) {
+ return val != null;
+ });
+ }; //DatePicker.prototype.activate
+
+
+ /**
+ * Create a string for the nodes in the picker.
+ */
+ DatePicker.prototype.nodes = function (isOpen) {
+
+ var calendar = this,
+ settings = calendar.settings,
+ calendarItem = calendar.item,
+ nowObject = calendarItem.now,
+ selectedObject = calendarItem.select,
+ highlightedObject = calendarItem.highlight,
+ viewsetObject = calendarItem.view,
+ disabledCollection = calendarItem.disable,
+ minLimitObject = calendarItem.min,
+ maxLimitObject = calendarItem.max,
+
+
+ // Create the calendar table head using a copy of weekday labels collection.
+ // * We do a copy so we don't mutate the original array.
+ tableHead = function (collection, fullCollection) {
+
+ // If the first day should be Monday, move Sunday to the end.
+ if (settings.firstDay) {
+ collection.push(collection.shift());
+ fullCollection.push(fullCollection.shift());
+ }
+
+ // Create and return the table head group.
+ return _.node('thead', _.node('tr', _.group({
+ min: 0,
+ max: DAYS_IN_WEEK - 1,
+ i: 1,
+ node: 'th',
+ item: function (counter) {
+ return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
+ }
+ }))); //endreturn
+
+ // Materialize modified
+ }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
+ //tableHead
+
+
+ // Create the nav for next/prev month.
+ createMonthNav = function (next) {
+
+ // Otherwise, return the created month tag.
+ return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
+
+ // If the focused month is outside the range, disabled the button.
+ next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
+ role: 'button',
+ controls: calendar.$node[0].id + '_table'
+ }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
+ },
+ //createMonthNav
+
+
+ // Create the month label.
+ //Materialize modified
+ createMonthLabel = function (override) {
+
+ var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
+
+ // Materialize modified
+ if (override == "short_months") {
+ monthsCollection = settings.monthsShort;
+ }
+
+ // If there are months to select, add a dropdown menu.
+ if (settings.selectMonths && override == undefined) {
+
+ return _.node('select', _.group({
+ min: 0,
+ max: 11,
+ i: 1,
+ node: 'option',
+ item: function (loopedMonth) {
+
+ return [
+
+ // The looped month and no classes.
+ monthsCollection[loopedMonth], 0,
+
+ // Set the value and selected index.
+ 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
+ }
+ }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
+ }
+
+ // Materialize modified
+ if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
+
+ // If there's a need for a month selector
+ return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
+ },
+ //createMonthLabel
+
+
+ // Create the year label.
+ // Materialize modified
+ createYearLabel = function (override) {
+
+ var focusedYear = viewsetObject.year,
+
+
+ // If years selector is set to a literal "true", set it to 5. Otherwise
+ // divide in half to get half before and half after focused year.
+ numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
+
+ // If there are years to select, add a dropdown menu.
+ if (numberYears) {
+
+ var minYear = minLimitObject.year,
+ maxYear = maxLimitObject.year,
+ lowestYear = focusedYear - numberYears,
+ highestYear = focusedYear + numberYears;
+
+ // If the min year is greater than the lowest year, increase the highest year
+ // by the difference and set the lowest year to the min year.
+ if (minYear > lowestYear) {
+ highestYear += minYear - lowestYear;
+ lowestYear = minYear;
+ }
+
+ // If the max year is less than the highest year, decrease the lowest year
+ // by the lower of the two: available and needed years. Then set the
+ // highest year to the max year.
+ if (maxYear < highestYear) {
+
+ var availableYears = lowestYear - minYear,
+ neededYears = highestYear - maxYear;
+
+ lowestYear -= availableYears > neededYears ? neededYears : availableYears;
+ highestYear = maxYear;
+ }
+
+ if (settings.selectYears && override == undefined) {
+ return _.node('select', _.group({
+ min: lowestYear,
+ max: highestYear,
+ i: 1,
+ node: 'option',
+ item: function (loopedYear) {
+ return [
+
+ // The looped year and no classes.
+ loopedYear, 0,
+
+ // Set the value and selected index.
+ 'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
+ }
+ }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
+ }
+ }
+
+ // Materialize modified
+ if (override === 'raw' && selectedObject != null) {
+ return _.node('div', selectedObject.year);
+ }
+
+ // Otherwise just return the year focused
+ return _.node('div', focusedYear, settings.klass.year);
+ }; //createYearLabel
+
+
+ // Materialize modified
+ createDayLabel = function () {
+ if (selectedObject != null) return selectedObject.date;else return nowObject.date;
+ };
+ createWeekdayLabel = function () {
+ var display_day;
+
+ if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
+ var weekday = settings.weekdaysShort[display_day];
+ return weekday;
+ };
+
+ // Create and return the entire calendar.
+
+ return _.node(
+ // Date presentation View
+ 'div', _.node(
+ // Div for Year
+ 'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
+ // Div for short Month
+ 'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
+ // Div for Day
+ 'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
+ // Calendar container
+ _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
+ min: 0,
+ max: WEEKS_IN_CALENDAR - 1,
+ i: 1,
+ node: 'tr',
+ item: function (rowCounter) {
+
+ // If Monday is the first day and the month starts on Sunday, shift the date back a week.
+ var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
+
+ return [_.group({
+ min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
+ max: function () {
+ return this.min + DAYS_IN_WEEK - 1;
+ },
+ i: 1,
+ node: 'td',
+ item: function (targetDate) {
+
+ // Convert the time date from a relative date to a target date.
+ targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
+
+ var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
+ isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
+ isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
+ formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
+
+ return [_.node('div', targetDate.date, function (klasses) {
+
+ // Add the `infocus` or `outfocus` classes based on month in view.
+ klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
+
+ // Add the `today` class if needed.
+ if (nowObject.pick == targetDate.pick) {
+ klasses.push(settings.klass.now);
+ }
+
+ // Add the `selected` class if something's selected and the time matches.
+ if (isSelected) {
+ klasses.push(settings.klass.selected);
+ }
+
+ // Add the `highlighted` class if something's highlighted and the time matches.
+ if (isHighlighted) {
+ klasses.push(settings.klass.highlighted);
+ }
+
+ // Add the `disabled` class if something's disabled and the object matches.
+ if (isDisabled) {
+ klasses.push(settings.klass.disabled);
+ }
+
+ return klasses.join(' ');
+ }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
+ role: 'gridcell',
+ label: formattedDate,
+ selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
+ activedescendant: isHighlighted ? true : null,
+ disabled: isDisabled ? true : null
+ }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
+ }
+ })]; //endreturn
+ }
+ })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
+ role: 'grid',
+ controls: calendar.$node[0].id,
+ readonly: true
+ })), settings.klass.calendar_container) // end calendar
+
+ +
+
+ // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
+ _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
+ }; //DatePicker.prototype.nodes
+
+
+ /**
+ * The date picker defaults.
+ */
+ DatePicker.defaults = function (prefix) {
+
+ return {
+
+ // The title label to use for the month nav buttons
+ labelMonthNext: 'Next month',
+ labelMonthPrev: 'Previous month',
+
+ // The title label to use for the dropdown selectors
+ labelMonthSelect: 'Select a month',
+ labelYearSelect: 'Select a year',
+
+ // Months and weekdays
+ monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
+ monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
+ weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
+
+ // Materialize modified
+ weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
+
+ // Today and clear
+ today: 'Today',
+ clear: 'Clear',
+ close: 'Ok',
+
+ // Picker close behavior (Prevent a change in behaviour for backwards compatibility)
+ closeOnSelect: false,
+
+ // The format to show on the `input` element
+ format: 'd mmmm, yyyy',
+
+ // Classes
+ klass: {
+
+ table: prefix + 'table',
+
+ header: prefix + 'header',
+
+ // Materialize Added klasses
+ date_display: prefix + 'date-display',
+ day_display: prefix + 'day-display',
+ month_display: prefix + 'month-display',
+ year_display: prefix + 'year-display',
+ calendar_container: prefix + 'calendar-container',
+ // end
+
+
+ navPrev: prefix + 'nav--prev',
+ navNext: prefix + 'nav--next',
+ navDisabled: prefix + 'nav--disabled',
+
+ month: prefix + 'month',
+ year: prefix + 'year',
+
+ selectMonth: prefix + 'select--month',
+ selectYear: prefix + 'select--year',
+
+ weekdays: prefix + 'weekday',
+
+ day: prefix + 'day',
+ disabled: prefix + 'day--disabled',
+ selected: prefix + 'day--selected',
+ highlighted: prefix + 'day--highlighted',
+ now: prefix + 'day--today',
+ infocus: prefix + 'day--infocus',
+ outfocus: prefix + 'day--outfocus',
+
+ footer: prefix + 'footer',
+
+ buttonClear: prefix + 'button--clear',
+ buttonToday: prefix + 'button--today',
+ buttonClose: prefix + 'button--close'
+ }
+ };
+ }(Picker.klasses().picker + '__');
+
+ /**
+ * Extend the picker to add the date picker.
+ */
+ Picker.extend('pickadate', DatePicker);
+});
+; /*!
+ * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
+ * Copyright 2014 Wang Shenwei.
+ * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
+ *
+ * Further modified
+ * Copyright 2015 Ching Yaw Hao.
+ */
+
+(function ($) {
+ var $win = $(window),
+ $doc = $(document);
+
+ // Can I use inline svg ?
+ var svgNS = 'http://www.w3.org/2000/svg',
+ svgSupported = 'SVGAngle' in window && function () {
+ var supported,
+ el = document.createElement('div');
+ el.innerHTML = '';
+ supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
+ el.innerHTML = '';
+ return supported;
+ }();
+
+ // Can I use transition ?
+ var transitionSupported = function () {
+ var style = document.createElement('div').style;
+ return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
+ }();
+
+ // Listen touch events in touch screen device, instead of mouse events in desktop.
+ var touchSupported = 'ontouchstart' in window,
+ mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
+ mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
+ mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
+
+ // Vibrate the device if supported
+ var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
+
+ function createSvgElement(name) {
+ return document.createElementNS(svgNS, name);
+ }
+
+ function leadingZero(num) {
+ return (num < 10 ? '0' : '') + num;
+ }
+
+ // Get a unique id
+ var idCounter = 0;
+ function uniqueId(prefix) {
+ var id = ++idCounter + '';
+ return prefix ? prefix + id : id;
+ }
+
+ // Clock size
+ var dialRadius = 135,
+ outerRadius = 105,
+
+ // innerRadius = 80 on 12 hour clock
+ innerRadius = 70,
+ tickRadius = 20,
+ diameter = dialRadius * 2,
+ duration = transitionSupported ? 350 : 1;
+
+ // Popover template
+ var tpl = ['', '
', '
', '
', '
', '
', '
', '
', '', ':', '', '
', '
', '
', '
', '
', '
', '
', '
', '
', '
'].join('');
+
+ // ClockPicker
+ function ClockPicker(element, options) {
+ var popover = $(tpl),
+ plate = popover.find('.clockpicker-plate'),
+ holder = popover.find('.picker__holder'),
+ hoursView = popover.find('.clockpicker-hours'),
+ minutesView = popover.find('.clockpicker-minutes'),
+ amPmBlock = popover.find('.clockpicker-am-pm-block'),
+ isInput = element.prop('tagName') === 'INPUT',
+ input = isInput ? element : element.find('input'),
+ label = $("label[for=" + input.attr("id") + "]"),
+ self = this;
+
+ this.id = uniqueId('cp');
+ this.element = element;
+ this.holder = holder;
+ this.options = options;
+ this.isAppended = false;
+ this.isShown = false;
+ this.currentView = 'hours';
+ this.isInput = isInput;
+ this.input = input;
+ this.label = label;
+ this.popover = popover;
+ this.plate = plate;
+ this.hoursView = hoursView;
+ this.minutesView = minutesView;
+ this.amPmBlock = amPmBlock;
+ this.spanHours = popover.find('.clockpicker-span-hours');
+ this.spanMinutes = popover.find('.clockpicker-span-minutes');
+ this.spanAmPm = popover.find('.clockpicker-span-am-pm');
+ this.footer = popover.find('.picker__footer');
+ this.amOrPm = "PM";
+
+ // Setup for for 12 hour clock if option is selected
+ if (options.twelvehour) {
+ if (!options.ampmclickable) {
+ this.spanAmPm.empty();
+ $('AM
').appendTo(this.spanAmPm);
+ $('PM
').appendTo(this.spanAmPm);
+ } else {
+ this.spanAmPm.empty();
+ $('AM
').on("click", function () {
+ self.spanAmPm.children('#click-am').addClass("text-primary");
+ self.spanAmPm.children('#click-pm').removeClass("text-primary");
+ self.amOrPm = "AM";
+ }).appendTo(this.spanAmPm);
+ $('PM
').on("click", function () {
+ self.spanAmPm.children('#click-pm').addClass("text-primary");
+ self.spanAmPm.children('#click-am').removeClass("text-primary");
+ self.amOrPm = 'PM';
+ }).appendTo(this.spanAmPm);
+ }
+ }
+
+ // Add buttons to footer
+ $('').click($.proxy(this.clear, this)).appendTo(this.footer);
+ $('').click($.proxy(this.hide, this)).appendTo(this.footer);
+ $('').click($.proxy(this.done, this)).appendTo(this.footer);
+
+ this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
+ this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
+
+ // Show or toggle
+ input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
+
+ // Build ticks
+ var tickTpl = $(''),
+ i,
+ tick,
+ radian,
+ radius;
+
+ // Hours view
+ if (options.twelvehour) {
+ for (i = 1; i < 13; i += 1) {
+ tick = tickTpl.clone();
+ radian = i / 6 * Math.PI;
+ radius = outerRadius;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
+ top: dialRadius - Math.cos(radian) * radius - tickRadius
+ });
+ tick.html(i === 0 ? '00' : i);
+ hoursView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+ } else {
+ for (i = 0; i < 24; i += 1) {
+ tick = tickTpl.clone();
+ radian = i / 6 * Math.PI;
+ var inner = i > 0 && i < 13;
+ radius = inner ? innerRadius : outerRadius;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
+ top: dialRadius - Math.cos(radian) * radius - tickRadius
+ });
+ tick.html(i === 0 ? '00' : i);
+ hoursView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+ }
+
+ // Minutes view
+ for (i = 0; i < 60; i += 5) {
+ tick = tickTpl.clone();
+ radian = i / 30 * Math.PI;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
+ top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
+ });
+ tick.html(leadingZero(i));
+ minutesView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+
+ // Clicking on minutes view space
+ plate.on(mousedownEvent, function (e) {
+ if ($(e.target).closest('.clockpicker-tick').length === 0) {
+ mousedown(e, true);
+ }
+ });
+
+ // Mousedown or touchstart
+ function mousedown(e, space) {
+ var offset = plate.offset(),
+ isTouch = /^touch/.test(e.type),
+ x0 = offset.left + dialRadius,
+ y0 = offset.top + dialRadius,
+ dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
+ dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
+ z = Math.sqrt(dx * dx + dy * dy),
+ moved = false;
+
+ // When clicking on minutes view space, check the mouse position
+ if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
+ return;
+ }
+ e.preventDefault();
+
+ // Set cursor style of body after 200ms
+ var movingTimer = setTimeout(function () {
+ self.popover.addClass('clockpicker-moving');
+ }, 200);
+
+ // Clock
+ self.setHand(dx, dy, !space, true);
+
+ // Mousemove on document
+ $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
+ e.preventDefault();
+ var isTouch = /^touch/.test(e.type),
+ x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
+ y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
+ if (!moved && x === dx && y === dy) {
+ // Clicking in chrome on windows will trigger a mousemove event
+ return;
+ }
+ moved = true;
+ self.setHand(x, y, false, true);
+ });
+
+ // Mouseup on document
+ $doc.off(mouseupEvent).on(mouseupEvent, function (e) {
+ $doc.off(mouseupEvent);
+ e.preventDefault();
+ var isTouch = /^touch/.test(e.type),
+ x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
+ y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
+ if ((space || moved) && x === dx && y === dy) {
+ self.setHand(x, y);
+ }
+
+ if (self.currentView === 'hours') {
+ self.toggleView('minutes', duration / 2);
+ } else if (options.autoclose) {
+ self.minutesView.addClass('clockpicker-dial-out');
+ setTimeout(function () {
+ self.done();
+ }, duration / 2);
+ }
+ plate.prepend(canvas);
+
+ // Reset cursor style of body
+ clearTimeout(movingTimer);
+ self.popover.removeClass('clockpicker-moving');
+
+ // Unbind mousemove event
+ $doc.off(mousemoveEvent);
+ });
+ }
+
+ if (svgSupported) {
+ // Draw clock hands and others
+ var canvas = popover.find('.clockpicker-canvas'),
+ svg = createSvgElement('svg');
+ svg.setAttribute('class', 'clockpicker-svg');
+ svg.setAttribute('width', diameter);
+ svg.setAttribute('height', diameter);
+ var g = createSvgElement('g');
+ g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
+ var bearing = createSvgElement('circle');
+ bearing.setAttribute('class', 'clockpicker-canvas-bearing');
+ bearing.setAttribute('cx', 0);
+ bearing.setAttribute('cy', 0);
+ bearing.setAttribute('r', 4);
+ var hand = createSvgElement('line');
+ hand.setAttribute('x1', 0);
+ hand.setAttribute('y1', 0);
+ var bg = createSvgElement('circle');
+ bg.setAttribute('class', 'clockpicker-canvas-bg');
+ bg.setAttribute('r', tickRadius);
+ g.appendChild(hand);
+ g.appendChild(bg);
+ g.appendChild(bearing);
+ svg.appendChild(g);
+ canvas.append(svg);
+
+ this.hand = hand;
+ this.bg = bg;
+ this.bearing = bearing;
+ this.g = g;
+ this.canvas = canvas;
+ }
+
+ raiseCallback(this.options.init);
+ }
+
+ function raiseCallback(callbackFunction) {
+ if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
+ }
+
+ // Default options
+ ClockPicker.DEFAULTS = {
+ 'default': '', // default time, 'now' or '13:14' e.g.
+ fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
+ donetext: 'Ok', // done button text
+ cleartext: 'Clear',
+ canceltext: 'Cancel',
+ autoclose: false, // auto close when minute is selected
+ ampmclickable: true, // set am/pm button on itself
+ darktheme: false, // set to dark theme
+ twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
+ vibrate: true // vibrate the device when dragging clock hand
+ };
+
+ // Show or hide popover
+ ClockPicker.prototype.toggle = function () {
+ this[this.isShown ? 'hide' : 'show']();
+ };
+
+ // Set popover position
+ ClockPicker.prototype.locate = function () {
+ var element = this.element,
+ popover = this.popover,
+ offset = element.offset(),
+ width = element.outerWidth(),
+ height = element.outerHeight(),
+ align = this.options.align,
+ self = this;
+
+ popover.show();
+ };
+
+ // Show popover
+ ClockPicker.prototype.show = function (e) {
+ // Not show again
+ if (this.isShown) {
+ return;
+ }
+ raiseCallback(this.options.beforeShow);
+ $(':input').each(function () {
+ $(this).attr('tabindex', -1);
+ });
+ var self = this;
+ // Initialize
+ this.input.blur();
+ this.popover.addClass('picker--opened');
+ this.input.addClass('picker__input picker__input--active');
+ $(document.body).css('overflow', 'hidden');
+ // Get the time
+ var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
+ if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
+ if (value[1].indexOf("AM") > 0) {
+ this.amOrPm = 'AM';
+ } else {
+ this.amOrPm = 'PM';
+ }
+ value[1] = value[1].replace("AM", "").replace("PM", "");
+ }
+ if (value[0] === 'now') {
+ var now = new Date(+new Date() + this.options.fromnow);
+ value = [now.getHours(), now.getMinutes()];
+ if (this.options.twelvehour) {
+ this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
+ }
+ }
+ this.hours = +value[0] || 0;
+ this.minutes = +value[1] || 0;
+ this.spanHours.html(this.hours);
+ this.spanMinutes.html(leadingZero(this.minutes));
+ if (!this.isAppended) {
+
+ // Append popover to input by default
+ var containerEl = document.querySelector(this.options.container);
+ if (this.options.container && containerEl) {
+ containerEl.appendChild(this.popover[0]);
+ } else {
+ this.popover.insertAfter(this.input);
+ }
+
+ if (this.options.twelvehour) {
+ if (this.amOrPm === 'PM') {
+ this.spanAmPm.children('#click-pm').addClass("text-primary");
+ this.spanAmPm.children('#click-am').removeClass("text-primary");
+ } else {
+ this.spanAmPm.children('#click-am').addClass("text-primary");
+ this.spanAmPm.children('#click-pm').removeClass("text-primary");
+ }
+ }
+ // Reset position when resize
+ $win.on('resize.clockpicker' + this.id, function () {
+ if (self.isShown) {
+ self.locate();
+ }
+ });
+ this.isAppended = true;
+ }
+ // Toggle to hours view
+ this.toggleView('hours');
+ // Set position
+ this.locate();
+ this.isShown = true;
+ // Hide when clicking or tabbing on any element except the clock and input
+ $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
+ var target = $(e.target);
+ if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
+ self.hide();
+ }
+ });
+ // Hide when ESC is pressed
+ $doc.on('keyup.clockpicker.' + this.id, function (e) {
+ if (e.keyCode === 27) {
+ self.hide();
+ }
+ });
+ raiseCallback(this.options.afterShow);
+ };
+ // Hide popover
+ ClockPicker.prototype.hide = function () {
+ raiseCallback(this.options.beforeHide);
+ this.input.removeClass('picker__input picker__input--active');
+ this.popover.removeClass('picker--opened');
+ $(document.body).css('overflow', 'visible');
+ this.isShown = false;
+ $(':input').each(function (index) {
+ $(this).attr('tabindex', index + 1);
+ });
+ // Unbinding events on document
+ $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
+ $doc.off('keyup.clockpicker.' + this.id);
+ this.popover.hide();
+ raiseCallback(this.options.afterHide);
+ };
+ // Toggle to hours or minutes view
+ ClockPicker.prototype.toggleView = function (view, delay) {
+ var raiseAfterHourSelect = false;
+ if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
+ raiseCallback(this.options.beforeHourSelect);
+ raiseAfterHourSelect = true;
+ }
+ var isHours = view === 'hours',
+ nextView = isHours ? this.hoursView : this.minutesView,
+ hideView = isHours ? this.minutesView : this.hoursView;
+ this.currentView = view;
+
+ this.spanHours.toggleClass('text-primary', isHours);
+ this.spanMinutes.toggleClass('text-primary', !isHours);
+
+ // Let's make transitions
+ hideView.addClass('clockpicker-dial-out');
+ nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
+
+ // Reset clock hand
+ this.resetClock(delay);
+
+ // After transitions ended
+ clearTimeout(this.toggleViewTimer);
+ this.toggleViewTimer = setTimeout(function () {
+ hideView.css('visibility', 'hidden');
+ }, duration);
+
+ if (raiseAfterHourSelect) {
+ raiseCallback(this.options.afterHourSelect);
+ }
+ };
+
+ // Reset clock hand
+ ClockPicker.prototype.resetClock = function (delay) {
+ var view = this.currentView,
+ value = this[view],
+ isHours = view === 'hours',
+ unit = Math.PI / (isHours ? 6 : 30),
+ radian = value * unit,
+ radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
+ x = Math.sin(radian) * radius,
+ y = -Math.cos(radian) * radius,
+ self = this;
+
+ if (svgSupported && delay) {
+ self.canvas.addClass('clockpicker-canvas-out');
+ setTimeout(function () {
+ self.canvas.removeClass('clockpicker-canvas-out');
+ self.setHand(x, y);
+ }, delay);
+ } else this.setHand(x, y);
+ };
+
+ // Set clock hand to (x, y)
+ ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
+ var radian = Math.atan2(x, -y),
+ isHours = this.currentView === 'hours',
+ unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
+ z = Math.sqrt(x * x + y * y),
+ options = this.options,
+ inner = isHours && z < (outerRadius + innerRadius) / 2,
+ radius = inner ? innerRadius : outerRadius,
+ value;
+
+ if (options.twelvehour) {
+ radius = outerRadius;
+ }
+
+ // Radian should in range [0, 2PI]
+ if (radian < 0) {
+ radian = Math.PI * 2 + radian;
+ }
+
+ // Get the round value
+ value = Math.round(radian / unit);
+
+ // Get the round radian
+ radian = value * unit;
+
+ // Correct the hours or minutes
+ if (options.twelvehour) {
+ if (isHours) {
+ if (value === 0) value = 12;
+ } else {
+ if (roundBy5) value *= 5;
+ if (value === 60) value = 0;
+ }
+ } else {
+ if (isHours) {
+ if (value === 12) value = 0;
+ value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
+ } else {
+ if (roundBy5) value *= 5;
+ if (value === 60) value = 0;
+ }
+ }
+
+ // Once hours or minutes changed, vibrate the device
+ if (this[this.currentView] !== value) {
+ if (vibrate && this.options.vibrate) {
+ // Do not vibrate too frequently
+ if (!this.vibrateTimer) {
+ navigator[vibrate](10);
+ this.vibrateTimer = setTimeout($.proxy(function () {
+ this.vibrateTimer = null;
+ }, this), 100);
+ }
+ }
+ }
+
+ this[this.currentView] = value;
+ if (isHours) {
+ this['spanHours'].html(value);
+ } else {
+ this['spanMinutes'].html(leadingZero(value));
+ }
+
+ // If svg is not supported, just add an active class to the tick
+ if (!svgSupported) {
+ this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
+ var tick = $(this);
+ tick.toggleClass('active', value === +tick.html());
+ });
+ return;
+ }
+
+ // Set clock hand and others' position
+ var cx1 = Math.sin(radian) * (radius - tickRadius),
+ cy1 = -Math.cos(radian) * (radius - tickRadius),
+ cx2 = Math.sin(radian) * radius,
+ cy2 = -Math.cos(radian) * radius;
+ this.hand.setAttribute('x2', cx1);
+ this.hand.setAttribute('y2', cy1);
+ this.bg.setAttribute('cx', cx2);
+ this.bg.setAttribute('cy', cy2);
+ };
+
+ // Hours and minutes are selected
+ ClockPicker.prototype.done = function () {
+ raiseCallback(this.options.beforeDone);
+ this.hide();
+ this.label.addClass('active');
+
+ var last = this.input.prop('value'),
+ value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
+ if (this.options.twelvehour) {
+ value = value + this.amOrPm;
+ }
+
+ this.input.prop('value', value);
+ if (value !== last) {
+ this.input.triggerHandler('change');
+ if (!this.isInput) {
+ this.element.trigger('change');
+ }
+ }
+
+ if (this.options.autoclose) this.input.trigger('blur');
+
+ raiseCallback(this.options.afterDone);
+ };
+
+ // Clear input field
+ ClockPicker.prototype.clear = function () {
+ this.hide();
+ this.label.removeClass('active');
+
+ var last = this.input.prop('value'),
+ value = '';
+
+ this.input.prop('value', value);
+ if (value !== last) {
+ this.input.triggerHandler('change');
+ if (!this.isInput) {
+ this.element.trigger('change');
+ }
+ }
+
+ if (this.options.autoclose) {
+ this.input.trigger('blur');
+ }
+ };
+
+ // Remove clockpicker from input
+ ClockPicker.prototype.remove = function () {
+ this.element.removeData('clockpicker');
+ this.input.off('focus.clockpicker click.clockpicker');
+ if (this.isShown) {
+ this.hide();
+ }
+ if (this.isAppended) {
+ $win.off('resize.clockpicker' + this.id);
+ this.popover.remove();
+ }
+ };
+
+ // Extends $.fn.clockpicker
+ $.fn.pickatime = function (option) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ return this.each(function () {
+ var $this = $(this),
+ data = $this.data('clockpicker');
+ if (!data) {
+ var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
+ $this.data('clockpicker', new ClockPicker($this, options));
+ } else {
+ // Manual operatsions. show, hide, remove, e.g.
+ if (typeof data[option] === 'function') {
+ data[option].apply(data, args);
+ }
+ }
+ });
+ };
+})(jQuery);
+;(function ($) {
+
+ $.fn.characterCounter = function () {
+ return this.each(function () {
+ var $input = $(this);
+ var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+ // character counter has already been added appended to the parent container
+ if ($counterElement.length) {
+ return;
+ }
+
+ var itHasLengthAttribute = $input.attr('data-length') !== undefined;
+
+ if (itHasLengthAttribute) {
+ $input.on('input', updateCounter);
+ $input.on('focus', updateCounter);
+ $input.on('blur', removeCounterElement);
+
+ addCounterElement($input);
+ }
+ });
+ };
+
+ function updateCounter() {
+ var maxLength = +$(this).attr('data-length'),
+ actualLength = +$(this).val().length,
+ isValidLength = actualLength <= maxLength;
+
+ $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);
+
+ addInputStyle(isValidLength, $(this));
+ }
+
+ function addCounterElement($input) {
+ var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+ if ($counterElement.length) {
+ return;
+ }
+
+ $counterElement = $('').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);
+
+ $input.parent().append($counterElement);
+ }
+
+ function removeCounterElement() {
+ $(this).parent().find('span[class="character-counter"]').html('');
+ }
+
+ function addInputStyle(isValidLength, $input) {
+ var inputHasInvalidClass = $input.hasClass('invalid');
+ if (isValidLength && inputHasInvalidClass) {
+ $input.removeClass('invalid');
+ } else if (!isValidLength && !inputHasInvalidClass) {
+ $input.removeClass('valid');
+ $input.addClass('invalid');
+ }
+ }
+
+ $(document).ready(function () {
+ $('input, textarea').characterCounter();
+ });
+})(jQuery);
+;(function ($) {
+
+ var methods = {
+
+ init: function (options) {
+ var defaults = {
+ duration: 200, // ms
+ dist: -100, // zoom scale TODO: make this more intuitive as an option
+ shift: 0, // spacing for center image
+ padding: 0, // Padding between non center items
+ fullWidth: false, // Change to full width styles
+ indicators: false, // Toggle indicators
+ noWrap: false, // Don't wrap around and cycle through items.
+ onCycleTo: null // Callback for when a new slide is cycled to.
+ };
+ options = $.extend(defaults, options);
+ var namespace = Materialize.objectSelectorString($(this));
+
+ return this.each(function (i) {
+
+ var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
+ var $indicators = $('');
+ var scrollingTimeout = null;
+ var oneTimeCallback = null;
+
+ // Initialize
+ var view = $(this);
+ var hasMultipleSlides = view.find('.carousel-item').length > 1;
+ var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
+ var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides;
+ var uniqueNamespace = view.attr('data-namespace') || namespace + i;
+ view.attr('data-namespace', uniqueNamespace);
+
+ // Options
+ var setCarouselHeight = function (imageOnly) {
+ var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
+ var firstImage = firstSlide.find('img').first();
+ if (firstImage.length) {
+ if (firstImage[0].complete) {
+ // If image won't trigger the load event
+ var imageHeight = firstImage.height();
+ if (imageHeight > 0) {
+ view.css('height', firstImage.height());
+ } else {
+ // If image still has no height, use the natural dimensions to calculate
+ var naturalWidth = firstImage[0].naturalWidth;
+ var naturalHeight = firstImage[0].naturalHeight;
+ var adjustedHeight = view.width() / naturalWidth * naturalHeight;
+ view.css('height', adjustedHeight);
+ }
+ } else {
+ // Get height when image is loaded normally
+ firstImage.on('load', function () {
+ view.css('height', $(this).height());
+ });
+ }
+ } else if (!imageOnly) {
+ var slideHeight = firstSlide.height();
+ view.css('height', slideHeight);
+ }
+ };
+
+ if (options.fullWidth) {
+ options.dist = 0;
+ setCarouselHeight();
+
+ // Offset fixed items when indicators.
+ if (showIndicators) {
+ view.find('.carousel-fixed-item').addClass('with-indicators');
+ }
+ }
+
+ // Don't double initialize.
+ if (view.hasClass('initialized')) {
+ // Recalculate variables
+ $(window).trigger('resize');
+
+ // Redraw carousel.
+ view.trigger('carouselNext', [0.000001]);
+ return true;
+ }
+
+ view.addClass('initialized');
+ pressed = false;
+ offset = target = 0;
+ images = [];
+ item_width = view.find('.carousel-item').first().innerWidth();
+ item_height = view.find('.carousel-item').first().innerHeight();
+ dim = item_width * 2 + options.padding;
+
+ view.find('.carousel-item').each(function (i) {
+ images.push($(this)[0]);
+ if (showIndicators) {
+ var $indicator = $('');
+
+ // Add active to first by default.
+ if (i === 0) {
+ $indicator.addClass('active');
+ }
+
+ // Handle clicks on indicators.
+ $indicator.click(function (e) {
+ e.stopPropagation();
+
+ var index = $(this).index();
+ cycleTo(index);
+ });
+ $indicators.append($indicator);
+ }
+ });
+
+ if (showIndicators) {
+ view.append($indicators);
+ }
+ count = images.length;
+
+ function setupEvents() {
+ if (typeof window.ontouchstart !== 'undefined') {
+ view.on('touchstart.carousel', tap);
+ view.on('touchmove.carousel', drag);
+ view.on('touchend.carousel', release);
+ }
+ view.on('mousedown.carousel', tap);
+ view.on('mousemove.carousel', drag);
+ view.on('mouseup.carousel', release);
+ view.on('mouseleave.carousel', release);
+ view.on('click.carousel', click);
+ }
+
+ function xpos(e) {
+ // touch event
+ if (e.targetTouches && e.targetTouches.length >= 1) {
+ return e.targetTouches[0].clientX;
+ }
+
+ // mouse event
+ return e.clientX;
+ }
+
+ function ypos(e) {
+ // touch event
+ if (e.targetTouches && e.targetTouches.length >= 1) {
+ return e.targetTouches[0].clientY;
+ }
+
+ // mouse event
+ return e.clientY;
+ }
+
+ function wrap(x) {
+ return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
+ }
+
+ function scroll(x) {
+ // Track scrolling state
+ scrolling = true;
+ if (!view.hasClass('scrolling')) {
+ view.addClass('scrolling');
+ }
+ if (scrollingTimeout != null) {
+ window.clearTimeout(scrollingTimeout);
+ }
+ scrollingTimeout = window.setTimeout(function () {
+ scrolling = false;
+ view.removeClass('scrolling');
+ }, options.duration);
+
+ // Start actual scroll
+ var i, half, delta, dir, tween, el, alignment, xTranslation;
+ var lastCenter = center;
+
+ offset = typeof x === 'number' ? x : offset;
+ center = Math.floor((offset + dim / 2) / dim);
+ delta = offset - center * dim;
+ dir = delta < 0 ? 1 : -1;
+ tween = -dir * delta * 2 / dim;
+ half = count >> 1;
+
+ if (!options.fullWidth) {
+ alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
+ alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
+ } else {
+ alignment = 'translateX(0)';
+ }
+
+ // Set indicator active
+ if (showIndicators) {
+ var diff = center % count;
+ var activeIndicator = $indicators.find('.indicator-item.active');
+ if (activeIndicator.index() !== diff) {
+ activeIndicator.removeClass('active');
+ $indicators.find('.indicator-item').eq(diff).addClass('active');
+ }
+ }
+
+ // center
+ // Don't show wrapped items.
+ if (!noWrap || center >= 0 && center < count) {
+ el = images[wrap(center)];
+
+ // Add active class to center item.
+ if (!$(el).hasClass('active')) {
+ view.find('.carousel-item').removeClass('active');
+ $(el).addClass('active');
+ }
+ el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
+ el.style.zIndex = 0;
+ if (options.fullWidth) {
+ tweenedOpacity = 1;
+ } else {
+ tweenedOpacity = 1 - 0.2 * tween;
+ }
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+ for (i = 1; i <= half; ++i) {
+ // right side
+ if (options.fullWidth) {
+ zTranslation = options.dist;
+ tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
+ } else {
+ zTranslation = options.dist * (i * 2 + tween * dir);
+ tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
+ }
+ // Don't show wrapped items.
+ if (!noWrap || center + i < count) {
+ el = images[wrap(center + i)];
+ el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
+ el.style.zIndex = -i;
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+ // left side
+ if (options.fullWidth) {
+ zTranslation = options.dist;
+ tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
+ } else {
+ zTranslation = options.dist * (i * 2 - tween * dir);
+ tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
+ }
+ // Don't show wrapped items.
+ if (!noWrap || center - i >= 0) {
+ el = images[wrap(center - i)];
+ el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
+ el.style.zIndex = -i;
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+ }
+
+ // center
+ // Don't show wrapped items.
+ if (!noWrap || center >= 0 && center < count) {
+ el = images[wrap(center)];
+ el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
+ el.style.zIndex = 0;
+ if (options.fullWidth) {
+ tweenedOpacity = 1;
+ } else {
+ tweenedOpacity = 1 - 0.2 * tween;
+ }
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+ // onCycleTo callback
+ if (lastCenter !== center && typeof options.onCycleTo === "function") {
+ var $curr_item = view.find('.carousel-item').eq(wrap(center));
+ options.onCycleTo.call(this, $curr_item, dragged);
+ }
+
+ // One time callback
+ if (typeof oneTimeCallback === "function") {
+ oneTimeCallback.call(this, $curr_item, dragged);
+ oneTimeCallback = null;
+ }
+ }
+
+ function track() {
+ var now, elapsed, delta, v;
+
+ now = Date.now();
+ elapsed = now - timestamp;
+ timestamp = now;
+ delta = offset - frame;
+ frame = offset;
+
+ v = 1000 * delta / (1 + elapsed);
+ velocity = 0.8 * v + 0.2 * velocity;
+ }
+
+ function autoScroll() {
+ var elapsed, delta;
+
+ if (amplitude) {
+ elapsed = Date.now() - timestamp;
+ delta = amplitude * Math.exp(-elapsed / options.duration);
+ if (delta > 2 || delta < -2) {
+ scroll(target - delta);
+ requestAnimationFrame(autoScroll);
+ } else {
+ scroll(target);
+ }
+ }
+ }
+
+ function click(e) {
+ // Disable clicks if carousel was dragged.
+ if (dragged) {
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+ } else if (!options.fullWidth) {
+ var clickedIndex = $(e.target).closest('.carousel-item').index();
+ var diff = wrap(center) - clickedIndex;
+
+ // Disable clicks if carousel was shifted by click
+ if (diff !== 0) {
+ e.preventDefault();
+ e.stopPropagation();
+ }
+ cycleTo(clickedIndex);
+ }
+ }
+
+ function cycleTo(n) {
+ var diff = center % count - n;
+
+ // Account for wraparound.
+ if (!noWrap) {
+ if (diff < 0) {
+ if (Math.abs(diff + count) < Math.abs(diff)) {
+ diff += count;
+ }
+ } else if (diff > 0) {
+ if (Math.abs(diff - count) < diff) {
+ diff -= count;
+ }
+ }
+ }
+
+ // Call prev or next accordingly.
+ if (diff < 0) {
+ view.trigger('carouselNext', [Math.abs(diff)]);
+ } else if (diff > 0) {
+ view.trigger('carouselPrev', [diff]);
+ }
+ }
+
+ function tap(e) {
+ // Fixes firefox draggable image bug
+ if (e.type === 'mousedown' && $(e.target).is('img')) {
+ e.preventDefault();
+ }
+ pressed = true;
+ dragged = false;
+ vertical_dragged = false;
+ reference = xpos(e);
+ referenceY = ypos(e);
+
+ velocity = amplitude = 0;
+ frame = offset;
+ timestamp = Date.now();
+ clearInterval(ticker);
+ ticker = setInterval(track, 100);
+ }
+
+ function drag(e) {
+ var x, delta, deltaY;
+ if (pressed) {
+ x = xpos(e);
+ y = ypos(e);
+ delta = reference - x;
+ deltaY = Math.abs(referenceY - y);
+ if (deltaY < 30 && !vertical_dragged) {
+ // If vertical scrolling don't allow dragging.
+ if (delta > 2 || delta < -2) {
+ dragged = true;
+ reference = x;
+ scroll(offset + delta);
+ }
+ } else if (dragged) {
+ // If dragging don't allow vertical scroll.
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+ } else {
+ // Vertical scrolling.
+ vertical_dragged = true;
+ }
+ }
+
+ if (dragged) {
+ // If dragging don't allow vertical scroll.
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+ }
+ }
+
+ function release(e) {
+ if (pressed) {
+ pressed = false;
+ } else {
+ return;
+ }
+
+ clearInterval(ticker);
+ target = offset;
+ if (velocity > 10 || velocity < -10) {
+ amplitude = 0.9 * velocity;
+ target = offset + amplitude;
+ }
+ target = Math.round(target / dim) * dim;
+
+ // No wrap of items.
+ if (noWrap) {
+ if (target >= dim * (count - 1)) {
+ target = dim * (count - 1);
+ } else if (target < 0) {
+ target = 0;
+ }
+ }
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+
+ if (dragged) {
+ e.preventDefault();
+ e.stopPropagation();
+ }
+ return false;
+ }
+
+ xform = 'transform';
+ ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
+ var e = prefix + 'Transform';
+ if (typeof document.body.style[e] !== 'undefined') {
+ xform = e;
+ return false;
+ }
+ return true;
+ });
+
+ var throttledResize = Materialize.throttle(function () {
+ if (options.fullWidth) {
+ item_width = view.find('.carousel-item').first().innerWidth();
+ var imageHeight = view.find('.carousel-item.active').height();
+ dim = item_width * 2 + options.padding;
+ offset = center * 2 * item_width;
+ target = offset;
+ setCarouselHeight(true);
+ } else {
+ scroll();
+ }
+ }, 200);
+ $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);
+
+ setupEvents();
+ scroll(offset);
+
+ $(this).on('carouselNext', function (e, n, callback) {
+ if (n === undefined) {
+ n = 1;
+ }
+ if (typeof callback === "function") {
+ oneTimeCallback = callback;
+ }
+
+ target = dim * Math.round(offset / dim) + dim * n;
+ if (offset !== target) {
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+ }
+ });
+
+ $(this).on('carouselPrev', function (e, n, callback) {
+ if (n === undefined) {
+ n = 1;
+ }
+ if (typeof callback === "function") {
+ oneTimeCallback = callback;
+ }
+
+ target = dim * Math.round(offset / dim) - dim * n;
+ if (offset !== target) {
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+ }
+ });
+
+ $(this).on('carouselSet', function (e, n, callback) {
+ if (n === undefined) {
+ n = 0;
+ }
+ if (typeof callback === "function") {
+ oneTimeCallback = callback;
+ }
+
+ cycleTo(n);
+ });
+ });
+ },
+ next: function (n, callback) {
+ $(this).trigger('carouselNext', [n, callback]);
+ },
+ prev: function (n, callback) {
+ $(this).trigger('carouselPrev', [n, callback]);
+ },
+ set: function (n, callback) {
+ $(this).trigger('carouselSet', [n, callback]);
+ },
+ destroy: function () {
+ var uniqueNamespace = $(this).attr('data-namespace');
+ $(this).removeAttr('data-namespace');
+ $(this).removeClass('initialized');
+ $(this).find('.indicators').remove();
+
+ // Remove event handlers
+ $(this).off('carouselNext carouselPrev carouselSet');
+ $(window).off('resize.carousel-' + uniqueNamespace);
+ if (typeof window.ontouchstart !== 'undefined') {
+ $(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
+ }
+ $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
+ }
+ };
+
+ $.fn.carousel = function (methodOrOptions) {
+ if (methods[methodOrOptions]) {
+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+ // Default to "init"
+ return methods.init.apply(this, arguments);
+ } else {
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
+ }
+ }; // Plugin end
+})(jQuery);
+;(function ($) {
+
+ var methods = {
+ init: function (options) {
+ return this.each(function () {
+ var origin = $('#' + $(this).attr('data-activates'));
+ var screen = $('body');
+
+ // Creating tap target
+ var tapTargetEl = $(this);
+ var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
+ var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
+ var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
+ var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
+
+ // Creating wrapper
+ if (!tapTargetWrapper.length) {
+ tapTargetWrapper = tapTargetEl.wrap($('')).parent();
+ }
+
+ // Creating content
+ if (!tapTargetContentEl.length) {
+ tapTargetContentEl = $('');
+ tapTargetEl.append(tapTargetContentEl);
+ }
+
+ // Creating foreground wave
+ if (!tapTargetWave.length) {
+ tapTargetWave = $('');
+
+ // Creating origin
+ if (!tapTargetOriginEl.length) {
+ tapTargetOriginEl = origin.clone(true, true);
+ tapTargetOriginEl.addClass('tap-target-origin');
+ tapTargetOriginEl.removeAttr('id');
+ tapTargetOriginEl.removeAttr('style');
+ tapTargetWave.append(tapTargetOriginEl);
+ }
+
+ tapTargetWrapper.append(tapTargetWave);
+ }
+
+ // Open
+ var openTapTarget = function () {
+ if (tapTargetWrapper.is('.open')) {
+ return;
+ }
+
+ // Adding open class
+ tapTargetWrapper.addClass('open');
+
+ setTimeout(function () {
+ tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
+ closeTapTarget();
+ tapTargetOriginEl.off('click.tapTarget');
+ });
+
+ $(document).off('click.tapTarget').on('click.tapTarget', function (e) {
+ closeTapTarget();
+ $(document).off('click.tapTarget');
+ });
+
+ var throttledCalc = Materialize.throttle(function () {
+ calculateTapTarget();
+ }, 200);
+ $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
+ }, 0);
+ };
+
+ // Close
+ var closeTapTarget = function () {
+ if (!tapTargetWrapper.is('.open')) {
+ return;
+ }
+
+ tapTargetWrapper.removeClass('open');
+ tapTargetOriginEl.off('click.tapTarget');
+ $(document).off('click.tapTarget');
+ $(window).off('resize.tapTarget');
+ };
+
+ // Pre calculate
+ var calculateTapTarget = function () {
+ // Element or parent is fixed position?
+ var isFixed = origin.css('position') === 'fixed';
+ if (!isFixed) {
+ var parents = origin.parents();
+ for (var i = 0; i < parents.length; i++) {
+ isFixed = $(parents[i]).css('position') == 'fixed';
+ if (isFixed) {
+ break;
+ }
+ }
+ }
+
+ // Calculating origin
+ var originWidth = origin.outerWidth();
+ var originHeight = origin.outerHeight();
+ var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
+ var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
+
+ // Calculating screen
+ var windowWidth = $(window).width();
+ var windowHeight = $(window).height();
+ var centerX = windowWidth / 2;
+ var centerY = windowHeight / 2;
+ var isLeft = originLeft <= centerX;
+ var isRight = originLeft > centerX;
+ var isTop = originTop <= centerY;
+ var isBottom = originTop > centerY;
+ var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
+ var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
+
+ // Calculating tap target
+ var tapTargetWidth = tapTargetEl.outerWidth();
+ var tapTargetHeight = tapTargetEl.outerHeight();
+ var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
+ var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
+ var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
+
+ // Calculating content
+ var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
+ var tapTargetTextHeight = tapTargetHeight / 2;
+ var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
+ var tapTargetTextBottom = 0;
+ var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
+ var tapTargetTextRight = 0;
+ var tapTargetTextPadding = originWidth;
+ var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
+
+ // Calculating wave
+ var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
+ var tapTargetWaveHeight = tapTargetWaveWidth;
+ var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
+ var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
+
+ // Setting tap target
+ var tapTargetWrapperCssObj = {};
+ tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
+ tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
+ tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
+ tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
+ tapTargetWrapperCssObj.position = tapTargetPosition;
+ tapTargetWrapper.css(tapTargetWrapperCssObj);
+
+ // Setting content
+ tapTargetContentEl.css({
+ width: tapTargetTextWidth,
+ height: tapTargetTextHeight,
+ top: tapTargetTextTop,
+ right: tapTargetTextRight,
+ bottom: tapTargetTextBottom,
+ left: tapTargetTextLeft,
+ padding: tapTargetTextPadding,
+ verticalAlign: tapTargetTextAlign
+ });
+
+ // Setting wave
+ tapTargetWave.css({
+ top: tapTargetWaveTop,
+ left: tapTargetWaveLeft,
+ width: tapTargetWaveWidth,
+ height: tapTargetWaveHeight
+ });
+ };
+
+ if (options == 'open') {
+ calculateTapTarget();
+ openTapTarget();
+ }
+
+ if (options == 'close') closeTapTarget();
+ });
+ },
+ open: function () {},
+ close: function () {}
+ };
+
+ $.fn.tapTarget = function (methodOrOptions) {
+ if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
+
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
+ };
+})(jQuery);
diff --git a/static/js/materialize.min.js b/static/js/materialize.min.js
new file mode 100644
index 00000000..3ec90acf
--- /dev/null
+++ b/static/js/materialize.min.js
@@ -0,0 +1,6 @@
+/*!
+ * Materialize v0.100.2 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+function _classCallCheck(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}var _createClass=function(){function t(t,e){for(var i=0;i0&&e-1 in t))}if(!t.jQuery){var i=function(t,e){return new i.fn.init(t,e)};i.isWindow=function(t){return null!=t&&t==t.window},i.type=function(t){return null==t?t+"":"object"==typeof t||"function"==typeof t?o[r.call(t)]||"object":typeof t},i.isArray=Array.isArray||function(t){return"array"===i.type(t)},i.isPlainObject=function(t){var e;if(!t||"object"!==i.type(t)||t.nodeType||i.isWindow(t))return!1;try{if(t.constructor&&!a.call(t,"constructor")&&!a.call(t.constructor.prototype,"isPrototypeOf"))return!1}catch(t){return!1}for(e in t);return void 0===e||a.call(t,e)},i.each=function(t,i,n){var o=0,a=t.length,r=e(t);if(n){if(r)for(;a>o&&!1!==i.apply(t[o],n);o++);else for(o in t)if(!1===i.apply(t[o],n))break}else if(r)for(;a>o&&!1!==i.call(t[o],o,t[o]);o++);else for(o in t)if(!1===i.call(t[o],o,t[o]))break;return t},i.data=function(t,e,o){if(void 0===o){var a=(r=t[i.expando])&&n[r];if(void 0===e)return a;if(a&&e in a)return a[e]}else if(void 0!==e){var r=t[i.expando]||(t[i.expando]=++i.uuid);return n[r]=n[r]||{},n[r][e]=o,o}},i.removeData=function(t,e){var o=t[i.expando],a=o&&n[o];a&&i.each(e,function(t,e){delete a[e]})},i.extend=function(){var t,e,n,o,a,r,s=arguments[0]||{},l=1,c=arguments.length,u=!1;for("boolean"==typeof s&&(u=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==i.type(s)&&(s={}),l===c&&(s=this,l--);c>l;l++)if(null!=(a=arguments[l]))for(o in a)t=s[o],s!==(n=a[o])&&(u&&n&&(i.isPlainObject(n)||(e=i.isArray(n)))?(e?(e=!1,r=t&&i.isArray(t)?t:[]):r=t&&i.isPlainObject(t)?t:{},s[o]=i.extend(u,r,n)):void 0!==n&&(s[o]=n));return s},i.queue=function(t,n,o){if(t){n=(n||"fx")+"queue";var a=i.data(t,n);return o?(!a||i.isArray(o)?a=i.data(t,n,function(t,i){var n=i||[];return null!=t&&(e(Object(t))?function(t,e){for(var i=+e.length,n=0,o=t.length;i>n;)t[o++]=e[n++];if(i!==i)for(;void 0!==e[n];)t[o++]=e[n++];t.length=o}(n,"string"==typeof t?[t]:t):[].push.call(n,t)),n}(o)):a.push(o),a):a||[]}},i.dequeue=function(t,e){i.each(t.nodeType?[t]:t,function(t,n){e=e||"fx";var o=i.queue(n,e),a=o.shift();"inprogress"===a&&(a=o.shift()),a&&("fx"===e&&o.unshift("inprogress"),a.call(n,function(){i.dequeue(n,e)}))})},i.fn=i.prototype={init:function(t){if(t.nodeType)return this[0]=t,this;throw new Error("Not a DOM node.")},offset:function(){var e=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:e.top+(t.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:e.left+(t.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function t(){for(var t=this.offsetParent||document;t&&"html"===!t.nodeType.toLowerCase&&"static"===t.style.position;)t=t.offsetParent;return t||document}var e=this[0],t=t.apply(e),n=this.offset(),o=/^(?:body|html)$/i.test(t.nodeName)?{top:0,left:0}:i(t).offset();return n.top-=parseFloat(e.style.marginTop)||0,n.left-=parseFloat(e.style.marginLeft)||0,t.style&&(o.top+=parseFloat(t.style.borderTopWidth)||0,o.left+=parseFloat(t.style.borderLeftWidth)||0),{top:n.top-o.top,left:n.left-o.left}}};var n={};i.expando="velocity"+(new Date).getTime(),i.uuid=0;for(var o={},a=o.hasOwnProperty,r=o.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;lo;++o){var a=c(i,t,n);if(0===a)return i;i-=(l(i,t,n)-e)/a}return i}function d(){for(var e=0;b>e;++e)C[e]=l(e*w,t,n)}function p(e,i,o){var a,r,s=0;do{(a=l(r=i+(o-i)/2,t,n)-e)>0?o=r:i=r}while(Math.abs(a)>g&&++s=m?u(e,r):0==s?r:p(e,i,i+w)}function f(){T=!0,(t!=i||n!=o)&&d()}var v=4,m=.001,g=1e-7,y=10,b=11,w=1/(b-1),k="Float32Array"in e;if(4!==arguments.length)return!1;for(var x=0;4>x;++x)if("number"!=typeof arguments[x]||isNaN(arguments[x])||!isFinite(arguments[x]))return!1;t=Math.min(t,1),n=Math.min(n,1),t=Math.max(t,0),n=Math.max(n,0);var C=k?new Float32Array(b):new Array(b),T=!1,S=function(e){return T||f(),t===i&&n===o?e:0===e?0:1===e?1:l(h(e),i,o)};S.getControlPoints=function(){return[{x:t,y:i},{x:n,y:o}]};var P="generateBezier("+[t,i,n,o]+")";return S.toString=function(){return P},S}function c(t,e){var i=t;return v.isString(t)?b.Easings[t]||(i=!1):i=v.isArray(t)&&1===t.length?s.apply(null,t):v.isArray(t)&&2===t.length?w.apply(null,t.concat([e])):!(!v.isArray(t)||4!==t.length)&&l.apply(null,t),!1===i&&(i=b.Easings[b.defaults.easing]?b.defaults.easing:y),i}function u(t){if(t){var e=(new Date).getTime(),i=b.State.calls.length;i>1e4&&(b.State.calls=o(b.State.calls));for(var a=0;i>a;a++)if(b.State.calls[a]){var s=b.State.calls[a],l=s[0],c=s[2],h=s[3],f=!!h,m=null;h||(h=b.State.calls[a][3]=e-16);for(var g=Math.min((e-h)/c.duration,1),y=0,w=l.length;w>y;y++){var x=l[y],T=x.element;if(r(T)){var S=!1;if(c.display!==n&&null!==c.display&&"none"!==c.display){if("flex"===c.display){var P=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];p.each(P,function(t,e){k.setPropertyValue(T,"display",e)})}k.setPropertyValue(T,"display",c.display)}c.visibility!==n&&"hidden"!==c.visibility&&k.setPropertyValue(T,"visibility",c.visibility);for(var A in x)if("element"!==A){var O,E=x[A],_=v.isString(E.easing)?b.Easings[E.easing]:E.easing;if(1===g)O=E.endValue;else{var M=E.endValue-E.startValue;if(O=E.startValue+M*_(g,c,M),!f&&O===E.currentValue)continue}if(E.currentValue=O,"tween"===A)m=O;else{if(k.Hooks.registered[A]){var I=k.Hooks.getRoot(A),D=r(T).rootPropertyValueCache[I];D&&(E.rootPropertyValue=D)}var q=k.setPropertyValue(T,A,E.currentValue+(0===parseFloat(O)?"":E.unitType),E.rootPropertyValue,E.scrollData);k.Hooks.registered[A]&&(r(T).rootPropertyValueCache[I]=k.Normalizations.registered[I]?k.Normalizations.registered[I]("extract",null,q[1]):q[1]),"transform"===q[0]&&(S=!0)}}c.mobileHA&&r(T).transformCache.translate3d===n&&(r(T).transformCache.translate3d="(0px, 0px, 0px)",S=!0),S&&k.flushTransformCache(T)}}c.display!==n&&"none"!==c.display&&(b.State.calls[a][2].display=!1),c.visibility!==n&&"hidden"!==c.visibility&&(b.State.calls[a][2].visibility=!1),c.progress&&c.progress.call(s[1],s[1],g,Math.max(0,h+c.duration-e),h,m),1===g&&d(a)}}b.State.isTicking&&C(u)}function d(t,e){if(!b.State.calls[t])return!1;for(var i=b.State.calls[t][0],o=b.State.calls[t][1],a=b.State.calls[t][2],s=b.State.calls[t][4],l=!1,c=0,u=i.length;u>c;c++){var d=i[c].element;if(e||a.loop||("none"===a.display&&k.setPropertyValue(d,"display",a.display),"hidden"===a.visibility&&k.setPropertyValue(d,"visibility",a.visibility)),!0!==a.loop&&(p.queue(d)[1]===n||!/\.velocityQueueEntryFlag/i.test(p.queue(d)[1]))&&r(d)){r(d).isAnimating=!1,r(d).rootPropertyValueCache={};var h=!1;p.each(k.Lists.transforms3D,function(t,e){var i=/^scale/.test(e)?1:0,o=r(d).transformCache[e];r(d).transformCache[e]!==n&&new RegExp("^\\("+i+"[^.]").test(o)&&(h=!0,delete r(d).transformCache[e])}),a.mobileHA&&(h=!0,delete r(d).transformCache.translate3d),h&&k.flushTransformCache(d),k.Values.removeClass(d,"velocity-animating")}if(!e&&a.complete&&!a.loop&&c===u-1)try{a.complete.call(o,o)}catch(t){setTimeout(function(){throw t},1)}s&&!0!==a.loop&&s(o),r(d)&&!0===a.loop&&!e&&(p.each(r(d).tweensContainer,function(t,e){/^rotate/.test(t)&&360===parseFloat(e.endValue)&&(e.endValue=0,e.startValue=360),/^backgroundPosition/.test(t)&&100===parseFloat(e.endValue)&&"%"===e.unitType&&(e.endValue=0,e.startValue=100)}),b(d,"reverse",{loop:!0,delay:a.delay})),!1!==a.queue&&p.dequeue(d,a.queue)}b.State.calls[t]=!1;for(var f=0,v=b.State.calls.length;v>f;f++)if(!1!==b.State.calls[f]){l=!0;break}!1===l&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var p,h=function(){if(i.documentMode)return i.documentMode;for(var t=7;t>4;t--){var e=i.createElement("div");if(e.innerHTML="\x3c!--[if IE "+t+"]>0)},isWrapped:function(t){return t&&(t.jquery||e.Zepto&&e.Zepto.zepto.isZ(t))},isSVG:function(t){return e.SVGElement&&t instanceof e.SVGElement},isEmptyObject:function(t){for(var e in t)return!1;return!0}},m=!1;if(t.fn&&t.fn.jquery?(p=t,m=!0):p=e.Velocity.Utilities,8>=h&&!m)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");{if(!(7>=h)){var g=400,y="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:e.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:i.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:p,Redirects:{},Easings:{},Promise:e.Promise,defaults:{queue:"",duration:g,easing:y,begin:n,complete:n,progress:n,display:n,visibility:n,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(t){p.data(t,"velocity",{isSVG:v.isSVG(t),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};e.pageYOffset!==n?(b.State.scrollAnchor=e,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=i.documentElement||i.body.parentNode||i.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var w=function(){function t(t){return-t.tension*t.x-t.friction*t.v}function e(e,i,n){var o={x:e.x+n.dx*i,v:e.v+n.dv*i,tension:e.tension,friction:e.friction};return{dx:o.v,dv:t(o)}}function i(i,n){var o={dx:i.v,dv:t(i)},a=e(i,.5*n,o),r=e(i,.5*n,a),s=e(i,n,r),l=1/6*(o.dx+2*(a.dx+r.dx)+s.dx),c=1/6*(o.dv+2*(a.dv+r.dv)+s.dv);return i.x=i.x+l*n,i.v=i.v+c*n,i}return function t(e,n,o){var a,r,s,l={x:-1,v:0,tension:null,friction:null},c=[0],u=0;for(e=parseFloat(e)||500,n=parseFloat(n)||20,o=o||null,l.tension=e,l.friction=n,(a=null!==o)?(u=t(e,n),r=u/o*.016):r=.016;s=i(s||l,r),c.push(1+s.x),u+=16,Math.abs(s.x)>1e-4&&Math.abs(s.v)>1e-4;);return a?function(t){return c[t*(c.length-1)|0]}:u}}();b.Easings={linear:function(t){return t},swing:function(t){return.5-Math.cos(t*Math.PI)/2},spring:function(t){return 1-Math.cos(4.5*t*Math.PI)*Math.exp(6*-t)}},p.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(t,e){b.Easings[e[0]]=l.apply(null,e[1])});var k=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(a=0;a=h)switch(t){case"name":return"filter";case"extract":var n=i.toString().match(/alpha\(opacity=(.*)\)/i);return i=n?n[1]/100:1;case"inject":return e.style.zoom=1,parseFloat(i)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(i),10)+")"}else switch(t){case"name":return"opacity";case"extract":case"inject":return i}}},register:function(){9>=h||b.State.isGingerbread||(k.Lists.transformsBase=k.Lists.transformsBase.concat(k.Lists.transforms3D));for(t=0;to&&(o=1),a=!/(\d)$/i.test(o);break;case"skew":a=!/(deg|\d)$/i.test(o);break;case"rotate":a=!/(deg|\d)$/i.test(o)}return a||(r(i).transformCache[e]="("+o+")"),r(i).transformCache[e]}}}();for(var t=0;t=h||3!==a.split(" ").length||(a+=" 1"),a;case"inject":return 8>=h?4===o.split(" ").length&&(o=o.split(/\s+/).slice(0,3).join(" ")):3===o.split(" ").length&&(o+=" 1"),(8>=h?"rgb":"rgba")+"("+o.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(t){return t.replace(/-(\w)/g,function(t,e){return e.toUpperCase()})},SVGAttribute:function(t){var e="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(h||b.State.isAndroid&&!b.State.isChrome)&&(e+="|transform"),new RegExp("^("+e+")$","i").test(t)},prefixCheck:function(t){if(b.State.prefixMatches[t])return[b.State.prefixMatches[t],!0];for(var e=["","Webkit","Moz","ms","O"],i=0,n=e.length;n>i;i++){var o;if(o=0===i?t:e[i]+t.replace(/^\w/,function(t){return t.toUpperCase()}),v.isString(b.State.prefixElement.style[o]))return b.State.prefixMatches[t]=o,[o,!0]}return[t,!1]}},Values:{hexToRgb:function(t){var e,i=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,n=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return t=t.replace(i,function(t,e,i,n){return e+e+i+i+n+n}),e=n.exec(t),e?[parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16)]:[0,0,0]},isCSSNullValue:function(t){return 0==t||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(t)},getUnitType:function(t){return/^(rotate|skew)/i.test(t)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(t)?"":"px"},getDisplayType:function(t){var e=t&&t.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(e)?"inline":/^(li)$/i.test(e)?"list-item":/^(tr)$/i.test(e)?"table-row":/^(table)$/i.test(e)?"table":/^(tbody)$/i.test(e)?"table-row-group":"block"},addClass:function(t,e){t.classList?t.classList.add(e):t.className+=(t.className.length?" ":"")+e},removeClass:function(t,e){t.classList?t.classList.remove(e):t.className=t.className.toString().replace(new RegExp("(^|\\s)"+e.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(t,i,o,a){function s(t,i){function o(){c&&k.setPropertyValue(t,"display","none")}var l=0;if(8>=h)l=p.css(t,i);else{var c=!1;if(/^(width|height)$/.test(i)&&0===k.getPropertyValue(t,"display")&&(c=!0,k.setPropertyValue(t,"display",k.Values.getDisplayType(t))),!a){if("height"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var u=t.offsetHeight-(parseFloat(k.getPropertyValue(t,"borderTopWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderBottomWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingTop"))||0)-(parseFloat(k.getPropertyValue(t,"paddingBottom"))||0);return o(),u}if("width"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var d=t.offsetWidth-(parseFloat(k.getPropertyValue(t,"borderLeftWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderRightWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingLeft"))||0)-(parseFloat(k.getPropertyValue(t,"paddingRight"))||0);return o(),d}}var f;f=r(t)===n?e.getComputedStyle(t,null):r(t).computedStyle?r(t).computedStyle:r(t).computedStyle=e.getComputedStyle(t,null),"borderColor"===i&&(i="borderTopColor"),(""===(l=9===h&&"filter"===i?f.getPropertyValue(i):f[i])||null===l)&&(l=t.style[i]),o()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(i)){var v=s(t,"position");("fixed"===v||"absolute"===v&&/top|left/i.test(i))&&(l=p(t).position()[i]+"px")}return l}var l;if(k.Hooks.registered[i]){var c=i,u=k.Hooks.getRoot(c);o===n&&(o=k.getPropertyValue(t,k.Names.prefixCheck(u)[0])),k.Normalizations.registered[u]&&(o=k.Normalizations.registered[u]("extract",t,o)),l=k.Hooks.extractValue(c,o)}else if(k.Normalizations.registered[i]){var d,f;"transform"!==(d=k.Normalizations.registered[i]("name",t))&&(f=s(t,k.Names.prefixCheck(d)[0]),k.Values.isCSSNullValue(f)&&k.Hooks.templates[i]&&(f=k.Hooks.templates[i][1])),l=k.Normalizations.registered[i]("extract",t,f)}if(!/^[\d-]/.test(l))if(r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i))if(/^(height|width)$/i.test(i))try{l=t.getBBox()[i]}catch(t){l=0}else l=t.getAttribute(i);else l=s(t,k.Names.prefixCheck(i)[0]);return k.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+i+": "+l),l},setPropertyValue:function(t,i,n,o,a){var s=i;if("scroll"===i)a.container?a.container["scroll"+a.direction]=n:"Left"===a.direction?e.scrollTo(n,a.alternateValue):e.scrollTo(a.alternateValue,n);else if(k.Normalizations.registered[i]&&"transform"===k.Normalizations.registered[i]("name",t))k.Normalizations.registered[i]("inject",t,n),s="transform",n=r(t).transformCache[i];else{if(k.Hooks.registered[i]){var l=i,c=k.Hooks.getRoot(i);o=o||k.getPropertyValue(t,c),n=k.Hooks.injectValue(l,n,o),i=c}if(k.Normalizations.registered[i]&&(n=k.Normalizations.registered[i]("inject",t,n),i=k.Normalizations.registered[i]("name",t)),s=k.Names.prefixCheck(i)[0],8>=h)try{t.style[s]=n}catch(t){b.debug&&console.log("Browser does not support ["+n+"] for ["+s+"]")}else r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i)?t.setAttribute(i,n):t.style[s]=n;b.debug>=2&&console.log("Set "+i+" ("+s+"): "+n)}return[s,n]},flushTransformCache:function(t){function e(e){return parseFloat(k.getPropertyValue(t,e))}var i="";if((h||b.State.isAndroid&&!b.State.isChrome)&&r(t).isSVG){var n={translate:[e("translateX"),e("translateY")],skewX:[e("skewX")],skewY:[e("skewY")],scale:1!==e("scale")?[e("scale"),e("scale")]:[e("scaleX"),e("scaleY")],rotate:[e("rotateZ"),0,0]};p.each(r(t).transformCache,function(t){/^translate/i.test(t)?t="translate":/^scale/i.test(t)?t="scale":/^rotate/i.test(t)&&(t="rotate"),n[t]&&(i+=t+"("+n[t].join(" ")+") ",delete n[t])})}else{var o,a;p.each(r(t).transformCache,function(e){return o=r(t).transformCache[e],"transformPerspective"===e?(a=o,!0):(9===h&&"rotateZ"===e&&(e="rotate"),void(i+=e+o+" "))}),a&&(i="perspective"+a+" "+i)}k.setPropertyValue(t,"transform",i)}};k.Hooks.register(),k.Normalizations.register(),b.hook=function(t,e,i){var o=n;return t=a(t),p.each(t,function(t,a){if(r(a)===n&&b.init(a),i===n)o===n&&(o=b.CSS.getPropertyValue(a,e));else{var s=b.CSS.setPropertyValue(a,e,i);"transform"===s[0]&&b.CSS.flushTransformCache(a),o=s}}),o};var x=function(){function t(){return s?P.promise||null:l}function o(){function t(t){function d(t,e){var i=n,o=n,r=n;return v.isArray(t)?(i=t[0],!v.isArray(t[1])&&/^[\d-]/.test(t[1])||v.isFunction(t[1])||k.RegEx.isHex.test(t[1])?r=t[1]:(v.isString(t[1])&&!k.RegEx.isHex.test(t[1])||v.isArray(t[1]))&&(o=e?t[1]:c(t[1],s.duration),t[2]!==n&&(r=t[2]))):i=t,e||(o=o||s.easing),v.isFunction(i)&&(i=i.call(a,T,C)),v.isFunction(r)&&(r=r.call(a,T,C)),[i||0,o,r]}function h(t,e){var i,n;return n=(e||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(t){return i=t,""}),i||(i=k.Values.getUnitType(t)),[n,i]}if(s.begin&&0===T)try{s.begin.call(f,f)}catch(t){setTimeout(function(){throw t},1)}if("scroll"===A){var g,w,x,S=/^x$/i.test(s.axis)?"Left":"Top",O=parseFloat(s.offset)||0;s.container?v.isWrapped(s.container)||v.isNode(s.container)?(s.container=s.container[0]||s.container,g=s.container["scroll"+S],x=g+p(a).position()[S.toLowerCase()]+O):s.container=null:(g=b.State.scrollAnchor[b.State["scrollProperty"+S]],w=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===S?"Top":"Left")]],x=p(a).offset()[S.toLowerCase()]+O),l={scroll:{rootPropertyValue:!1,startValue:g,currentValue:g,endValue:x,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:S,alternateValue:w}},element:a},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,a)}else if("reverse"===A){if(!r(a).tweensContainer)return void p.dequeue(a,s.queue);"none"===r(a).opts.display&&(r(a).opts.display="auto"),"hidden"===r(a).opts.visibility&&(r(a).opts.visibility="visible"),r(a).opts.loop=!1,r(a).opts.begin=null,r(a).opts.complete=null,y.easing||delete s.easing,y.duration||delete s.duration,s=p.extend({},r(a).opts,s);M=p.extend(!0,{},r(a).tweensContainer);for(var E in M)if("element"!==E){var _=M[E].startValue;M[E].startValue=M[E].currentValue=M[E].endValue,M[E].endValue=_,v.isEmptyObject(y)||(M[E].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+E+"): "+JSON.stringify(M[E]),a)}l=M}else if("start"===A){var M;r(a).tweensContainer&&!0===r(a).isAnimating&&(M=r(a).tweensContainer),p.each(m,function(t,e){if(RegExp("^"+k.Lists.colors.join("$|^")+"$").test(t)){var i=d(e,!0),o=i[0],a=i[1],r=i[2];if(k.RegEx.isHex.test(o)){for(var s=["Red","Green","Blue"],l=k.Values.hexToRgb(o),c=r?k.Values.hexToRgb(r):n,u=0;u=1&&console.log("Unit ratios: "+JSON.stringify(l),a),l}();var X=/margin|padding|left|right|width|text|word|letter/i.test(q)||/X$/.test(q)||"x"===q?"x":"y";switch(F){case"%":L*="x"===X?o.percentToPxWidth:o.percentToPxHeight;break;case"px":break;default:L*=o[F+"ToPx"]}switch(W){case"%":L*=1/("x"===X?o.percentToPxWidth:o.percentToPxHeight);break;case"px":break;default:L*=1/o[W+"ToPx"]}}switch(Q){case"+":V=L+V;break;case"-":V=L-V;break;case"*":V*=L;break;case"/":V=L/V}l[q]={rootPropertyValue:$,startValue:L,currentValue:L,endValue:V,unitType:W,easing:H},b.debug&&console.log("tweensContainer ("+q+"): "+JSON.stringify(l[q]),a)}else b.debug&&console.log("Skipping ["+j+"] due to a lack of browser support.")}l.element=a}l.element&&(k.Values.addClass(a,"velocity-animating"),D.push(l),""===s.queue&&(r(a).tweensContainer=l,r(a).opts=s),r(a).isAnimating=!0,T===C-1?(b.State.calls.push([D,f,s,null,P.resolver]),!1===b.State.isTicking&&(b.State.isTicking=!0,u())):T++)}var o,a=this,s=p.extend({},b.defaults,y),l={};switch(r(a)===n&&b.init(a),parseFloat(s.delay)&&!1!==s.queue&&p.queue(a,s.queue,function(t){b.velocityQueueEntryFlag=!0,r(a).delayTimer={setTimeout:setTimeout(t,parseFloat(s.delay)),next:t}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=g;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}!1!==b.mock&&(!0===b.mock?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=c(s.easing,s.duration),s.begin&&!v.isFunction(s.begin)&&(s.begin=null),s.progress&&!v.isFunction(s.progress)&&(s.progress=null),s.complete&&!v.isFunction(s.complete)&&(s.complete=null),s.display!==n&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(a))),s.visibility!==n&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,!1===s.queue?s.delay?setTimeout(t,s.delay):t():p.queue(a,s.queue,function(e,i){return!0===i?(P.promise&&P.resolver(f),!0):(b.velocityQueueEntryFlag=!0,void t(e))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===p.queue(a)[0]||p.dequeue(a)}var s,l,h,f,m,y,w=arguments[0]&&(arguments[0].p||p.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||v.isString(arguments[0].properties));if(v.isWrapped(this)?(s=!1,h=0,f=this,l=this):(s=!0,h=1,f=w?arguments[0].elements||arguments[0].e:arguments[0]),f=a(f)){w?(m=arguments[0].properties||arguments[0].p,y=arguments[0].options||arguments[0].o):(m=arguments[h],y=arguments[h+1]);var C=f.length,T=0;if(!/^(stop|finish)$/i.test(m)&&!p.isPlainObject(y)){y={};for(var S=h+1;SV;V++){var H={delay:z.delay,progress:z.progress};V===q-1&&(H.display=z.display,H.visibility=z.visibility,H.complete=z.complete),x(f,"reverse",H)}return t()}};(b=p.extend(x,b)).animate=x;var C=e.requestAnimationFrame||f;return b.State.isMobile||i.hidden===n||i.addEventListener("visibilitychange",function(){i.hidden?(C=function(t){return setTimeout(function(){t(!0)},16)},u()):C=e.requestAnimationFrame||f}),t.Velocity=b,t!==e&&(t.fn.velocity=x,t.fn.velocity.defaults=b.defaults),p.each(["Down","Up"],function(t,e){b.Redirects["slide"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c=l.begin,u=l.complete,d={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},h={};l.display===n&&(l.display="Down"===e?"inline"===b.CSS.Values.getDisplayType(t)?"inline-block":"block":"none"),l.begin=function(){c&&c.call(r,r);for(var i in d){h[i]=t.style[i];var n=b.CSS.getPropertyValue(t,i);d[i]="Down"===e?[n,0]:[0,n]}h.overflow=t.style.overflow,t.style.overflow="hidden"},l.complete=function(){for(var e in h)t.style[e]=h[e];u&&u.call(r,r),s&&s.resolver(r)},b(t,d,l)}}),p.each(["In","Out"],function(t,e){b.Redirects["fade"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c={opacity:"In"===e?1:0},u=l.complete;l.complete=o!==a-1?l.begin=null:function(){u&&u.call(r,r),s&&s.resolver(r)},l.display===n&&(l.display="In"===e?"auto":"none"),b(this,c,l)}}),b}jQuery.fn.velocity=jQuery.fn.animate}}(window.jQuery||window.Zepto||window,window,document)})),function(t,e,i,n){"use strict";function o(t,e,i){return setTimeout(u(t,i),e)}function a(t,e,i){return!!Array.isArray(t)&&(r(t,i[e],i),!0)}function r(t,e,i){var o;if(t)if(t.forEach)t.forEach(e,i);else if(t.length!==n)for(o=0;o-1}function g(t){return t.trim().split(/\s+/g)}function y(t,e,i){if(t.indexOf&&!i)return t.indexOf(e);for(var n=0;ni[e]}):n.sort()),n}function k(t,e){for(var i,o,a=e[0].toUpperCase()+e.slice(1),r=0;r1&&!i.firstMultiple?i.firstMultiple=_(e):1===o&&(i.firstMultiple=!1);var a=i.firstInput,r=i.firstMultiple,s=r?r.center:a.center,l=e.center=M(n);e.timeStamp=ht(),e.deltaTime=e.timeStamp-a.timeStamp,e.angle=z(s,l),e.distance=q(s,l),O(i,e),e.offsetDirection=D(e.deltaX,e.deltaY),e.scale=r?H(r.pointers,n):1,e.rotation=r?V(r.pointers,n):0,E(i,e);var c=t.element;v(e.srcEvent.target,c)&&(c=e.srcEvent.target),e.target=c}function O(t,e){var i=e.center,n=t.offsetDelta||{},o=t.prevDelta||{},a=t.prevInput||{};(e.eventType===xt||a.eventType===Tt)&&(o=t.prevDelta={x:a.deltaX||0,y:a.deltaY||0},n=t.offsetDelta={x:i.x,y:i.y}),e.deltaX=o.x+(i.x-n.x),e.deltaY=o.y+(i.y-n.y)}function E(t,e){var i,o,a,r,s=t.lastInterval||e,l=e.timeStamp-s.timeStamp;if(e.eventType!=St&&(l>kt||s.velocity===n)){var c=s.deltaX-e.deltaX,u=s.deltaY-e.deltaY,d=I(l,c,u);o=d.x,a=d.y,i=pt(d.x)>pt(d.y)?d.x:d.y,r=D(c,u),t.lastInterval=e}else i=s.velocity,o=s.velocityX,a=s.velocityY,r=s.direction;e.velocity=i,e.velocityX=o,e.velocityY=a,e.direction=r}function _(t){for(var e=[],i=0;io;)i+=t[o].clientX,n+=t[o].clientY,o++;return{x:dt(i/e),y:dt(n/e)}}function I(t,e,i){return{x:e/t||0,y:i/t||0}}function D(t,e){return t===e?Pt:pt(t)>=pt(e)?t>0?At:Ot:e>0?Et:_t}function q(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return Math.sqrt(n*n+o*o)}function z(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return 180*Math.atan2(o,n)/Math.PI}function V(t,e){return z(e[1],e[0],zt)-z(t[1],t[0],zt)}function H(t,e){return q(e[0],e[1],zt)/q(t[0],t[1],zt)}function L(){this.evEl=Ht,this.evWin=Lt,this.allow=!0,this.pressed=!1,T.apply(this,arguments)}function j(){this.evEl=Nt,this.evWin=Wt,T.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function $(){this.evTarget=Qt,this.evWin=Xt,this.started=!1,T.apply(this,arguments)}function N(t,e){var i=b(t.touches),n=b(t.changedTouches);return e&(Tt|St)&&(i=w(i.concat(n),"identifier",!0)),[i,n]}function W(){this.evTarget=Yt,this.targetIds={},T.apply(this,arguments)}function F(t,e){var i=b(t.touches),n=this.targetIds;if(e&(xt|Ct)&&1===i.length)return n[i[0].identifier]=!0,[i,i];var o,a,r=b(t.changedTouches),s=[],l=this.target;if(a=i.filter(function(t){return v(t.target,l)}),e===xt)for(o=0;os&&(e.push(t),s=e.length-1):o&(Tt|St)&&(i=!0),0>s||(e[s]=t,this.callback(this.manager,o,{pointers:e,changedPointers:[t],pointerType:a,srcEvent:t}),i&&e.splice(s,1))}});var Ft={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Qt="touchstart",Xt="touchstart touchmove touchend touchcancel";c($,T,{handler:function(t){var e=Ft[t.type];if(e===xt&&(this.started=!0),this.started){var i=N.call(this,t,e);e&(Tt|St)&&0==i[0].length-i[1].length&&(this.started=!1),this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}});var Rt={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Yt="touchstart touchmove touchend touchcancel";c(W,T,{handler:function(t){var e=Rt[t.type],i=F.call(this,t,e);i&&this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}),c(Q,T,{handler:function(t,e,i){var n=i.pointerType==bt,o=i.pointerType==wt;if(n)this.mouse.allow=!1;else if(o&&!this.mouse.allow)return;e&(Tt|St)&&(this.mouse.allow=!0),this.callback(t,e,i)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Bt=k(ct.style,"touchAction"),Ut=Bt!==n,Gt="compute",Zt="auto",Jt="manipulation",Kt="none",te="pan-x",ee="pan-y";X.prototype={set:function(t){t==Gt&&(t=this.compute()),Ut&&(this.manager.element.style[Bt]=t),this.actions=t.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var t=[];return r(this.manager.recognizers,function(e){d(e.options.enable,[e])&&(t=t.concat(e.getTouchAction()))}),R(t.join(" "))},preventDefaults:function(t){if(!Ut){var e=t.srcEvent,i=t.offsetDirection;if(this.manager.session.prevented)return void e.preventDefault();var n=this.actions,o=m(n,Kt),a=m(n,ee),r=m(n,te);return o||a&&i&Mt||r&&i&It?this.preventSrc(e):void 0}},preventSrc:function(t){this.manager.session.prevented=!0,t.preventDefault()}};var ie=1,ne=2,oe=4,ae=8,re=ae,se=16;Y.prototype={defaults:{},set:function(t){return s(this.options,t),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(t){if(a(t,"recognizeWith",this))return this;var e=this.simultaneous;return t=G(t,this),e[t.id]||(e[t.id]=t,t.recognizeWith(this)),this},dropRecognizeWith:function(t){return a(t,"dropRecognizeWith",this)?this:(t=G(t,this),delete this.simultaneous[t.id],this)},requireFailure:function(t){if(a(t,"requireFailure",this))return this;var e=this.requireFail;return t=G(t,this),-1===y(e,t)&&(e.push(t),t.requireFailure(this)),this},dropRequireFailure:function(t){if(a(t,"dropRequireFailure",this))return this;t=G(t,this);var e=y(this.requireFail,t);return e>-1&&this.requireFail.splice(e,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(t){return!!this.simultaneous[t.id]},emit:function(t){function e(e){i.manager.emit(i.options.event+(e?B(n):""),t)}var i=this,n=this.state;ae>n&&e(!0),e(),n>=ae&&e(!0)},tryEmit:function(t){return this.canEmit()?this.emit(t):void(this.state=32)},canEmit:function(){for(var t=0;ta?At:Ot,i=a!=this.pX,n=Math.abs(t.deltaX)):(o=0===r?Pt:0>r?Et:_t,i=r!=this.pY,n=Math.abs(t.deltaY))),t.direction=o,i&&n>e.threshold&&o&e.direction},attrTest:function(t){return Z.prototype.attrTest.call(this,t)&&(this.state&ne||!(this.state&ne)&&this.directionTest(t))},emit:function(t){this.pX=t.deltaX,this.pY=t.deltaY;var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this._super.emit.call(this,t)}}),c(K,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.scale-1)>this.options.threshold||this.state&ne)},emit:function(t){if(this._super.emit.call(this,t),1!==t.scale){var e=t.scale<1?"in":"out";this.manager.emit(this.options.event+e,t)}}}),c(tt,Y,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Zt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distancee.time;if(this._input=t,!n||!i||t.eventType&(Tt|St)&&!a)this.reset();else if(t.eventType&xt)this.reset(),this._timer=o(function(){this.state=re,this.tryEmit()},e.time,this);else if(t.eventType&Tt)return re;return 32},reset:function(){clearTimeout(this._timer)},emit:function(t){this.state===re&&(t&&t.eventType&Tt?this.manager.emit(this.options.event+"up",t):(this._input.timeStamp=ht(),this.manager.emit(this.options.event,this._input)))}}),c(et,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.rotation)>this.options.threshold||this.state&ne)}}),c(it,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Mt|It,pointers:1},getTouchAction:function(){return J.prototype.getTouchAction.call(this)},attrTest:function(t){var e,i=this.options.direction;return i&(Mt|It)?e=t.velocity:i&Mt?e=t.velocityX:i&It&&(e=t.velocityY),this._super.attrTest.call(this,t)&&i&t.direction&&t.distance>this.options.threshold&&pt(e)>this.options.velocity&&t.eventType&Tt},emit:function(t){var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this.manager.emit(this.options.event,t)}}),c(nt,Y,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Jt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distance=0&&!n;)n=t[i[a]+"RequestAnimationFrame"],o=t[i[a]+"CancelRequestAnimationFrame"];n&&o||(n=function(t){var i=+Date.now(),n=Math.max(e+16,i);return setTimeout(function(){t(e=n)},n-i)},o=clearTimeout),t.requestAnimationFrame=n,t.cancelAnimationFrame=o}(window),Materialize.objectSelectorString=function(t){return((t.prop("tagName")||"")+(t.attr("id")||"")+(t.attr("class")||"")).replace(/\s/g,"")},Materialize.guid=function(){function t(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return t()+t()+"-"+t()+"-"+t()+"-"+t()+"-"+t()+t()+t()}}(),Materialize.escapeHash=function(t){return t.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(t){var e=$(t),i=!1;return e.add(e.parents()).each(function(){if("fixed"===$(this).css("position"))return i=!0,!1}),i};var getTime=Date.now||function(){return(new Date).getTime()};Materialize.throttle=function(t,e,i){var n,o,a,r=null,s=0;i||(i={});var l=function(){s=!1===i.leading?0:getTime(),r=null,a=t.apply(n,o),n=o=null};return function(){var c=getTime();s||!1!==i.leading||(s=c);var u=e-(c-s);return n=this,o=arguments,u<=0?(clearTimeout(r),r=null,s=c,a=t.apply(n,o),n=o=null):r||!1===i.trailing||(r=setTimeout(l,u)),a}};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,Materialize.Vel=Vel||Velocity,function(t){t.fn.collapsible=function(e,i){var n={accordion:void 0,onOpen:void 0,onClose:void 0},o=e;return e=t.extend(n,e),this.each(function(){function n(e){p=d.find("> li > .collapsible-header"),e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}),p.not(e).removeClass("active").parent().removeClass("active"),p.not(e).parent().children(".collapsible-body").stop(!0,!1).each(function(){t(this).is(":visible")&&t(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height",""),s(t(this).siblings(".collapsible-header"))}})})}function a(e){e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}})}function r(t,i){i||t.toggleClass("active"),e.accordion||"accordion"===h||void 0===h?n(t):a(t),s(t)}function s(t){t.hasClass("active")?"function"==typeof e.onOpen&&e.onOpen.call(this,t.parent()):"function"==typeof e.onClose&&e.onClose.call(this,t.parent())}function l(t){return c(t).length>0}function c(t){return t.closest("li > .collapsible-header")}function u(){d.off("click.collapse","> li > .collapsible-header")}var d=t(this),p=t(this).find("> li > .collapsible-header"),h=d.data("collapsible");if("destroy"!==o)if(i>=0&&i li > .collapsible-header",function(e){var i=t(e.target);l(i)&&(i=c(i)),r(i)}),e.accordion||"accordion"===h||void 0===h?r(p.filter(".active").first(),!0):p.filter(".active").each(function(){r(t(this),!0)});else u()})},t(document).ready(function(){t(".collapsible").collapsible()})}(jQuery),function(t){t.fn.scrollTo=function(e){return t(this).scrollTop(t(this).scrollTop()-t(this).offset().top+t(e).offset().top),this},t.fn.dropdown=function(e){var i={inDuration:300,outDuration:225,constrainWidth:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===e?(this.each(function(){t(this).trigger("open")}),!1):"close"===e?(this.each(function(){t(this).trigger("close")}),!1):void this.each(function(){function n(){void 0!==r.data("induration")&&(s.inDuration=r.data("induration")),void 0!==r.data("outduration")&&(s.outDuration=r.data("outduration")),void 0!==r.data("constrainwidth")&&(s.constrainWidth=r.data("constrainwidth")),void 0!==r.data("hover")&&(s.hover=r.data("hover")),void 0!==r.data("gutter")&&(s.gutter=r.data("gutter")),void 0!==r.data("beloworigin")&&(s.belowOrigin=r.data("beloworigin")),void 0!==r.data("alignment")&&(s.alignment=r.data("alignment")),void 0!==r.data("stoppropagation")&&(s.stopPropagation=r.data("stoppropagation"))}function o(e){"focus"===e&&(l=!0),n(),c.addClass("active"),r.addClass("active");var i=r[0].getBoundingClientRect().width;!0===s.constrainWidth?c.css("width",i):c.css("white-space","nowrap");var o=window.innerHeight,u=r.innerHeight(),d=r.offset().left,p=r.offset().top-t(window).scrollTop(),h=s.alignment,f=0,v=0,m=0;!0===s.belowOrigin&&(m=u);var g=0,y=0,b=r.parent();if(b.is("body")||(b[0].scrollHeight>b[0].clientHeight&&(g=b[0].scrollTop),b[0].scrollWidth>b[0].clientWidth&&(y=b[0].scrollLeft)),d+c.innerWidth()>t(window).width()?h="right":d-c.innerWidth()+r.innerWidth()<0&&(h="left"),p+c.innerHeight()>o)if(p+u-c.innerHeight()<0){var w=o-p-m;c.css("max-height",w)}else m||(m+=u),m-=c.innerHeight();"left"===h?(f=s.gutter,v=r.position().left+f):"right"===h&&(c.stop(!0,!0).css({opacity:0,left:0}),v=r.position().left+i-c.width()+(f=-s.gutter)),c.css({position:"absolute",top:r.position().top+m+g,left:v+y}),c.slideDown({queue:!1,duration:s.inDuration,easing:"easeOutCubic",complete:function(){t(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:s.inDuration,easing:"easeOutSine"}),setTimeout(function(){t(document).on("click."+c.attr("id"),function(e){a(),t(document).off("click."+c.attr("id"))})},0)}function a(){l=!1,c.fadeOut(s.outDuration),c.removeClass("active"),r.removeClass("active"),t(document).off("click."+c.attr("id")),setTimeout(function(){c.css("max-height","")},s.outDuration)}var r=t(this),s=t.extend({},i,e),l=!1,c=t("#"+r.attr("data-activates"));if(n(),r.after(c),s.hover){var u=!1;r.off("click."+r.attr("id")),r.on("mouseenter",function(t){!1===u&&(o(),u=!0)}),r.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-content").is(c)||(c.stop(!0,!0),a(),u=!1)}),c.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-button").is(r)||(c.stop(!0,!0),a(),u=!1)})}else r.off("click."+r.attr("id")),r.on("click."+r.attr("id"),function(e){l||(r[0]!=e.currentTarget||r.hasClass("active")||0!==t(e.target).closest(".dropdown-content").length?r.hasClass("active")&&(a(),t(document).off("click."+c.attr("id"))):(e.preventDefault(),s.stopPropagation&&e.stopPropagation(),o("click")))});r.on("open",function(t,e){o(e)}),r.on("close",a)})},t(document).ready(function(){t(".dropdown-button").dropdown()})}(jQuery),function(t,e){"use strict";var i={opacity:.5,inDuration:250,outDuration:250,ready:void 0,complete:void 0,dismissible:!0,startingTop:"4%",endingTop:"10%"},n=function(){function n(e,i){_classCallCheck(this,n),e[0].M_Modal&&e[0].M_Modal.destroy(),this.$el=e,this.options=t.extend({},n.defaults,i),this.isOpen=!1,this.$el[0].M_Modal=this,this.id=e.attr("id"),this.openingTrigger=void 0,this.$overlay=t(''),n._increment++,n._count++,this.$overlay[0].style.zIndex=1e3+2*n._increment,this.$el[0].style.zIndex=1e3+2*n._increment+1,this.setupEventHandlers()}return _createClass(n,[{key:"getInstance",value:function(){return this}},{key:"destroy",value:function(){this.removeEventHandlers(),this.$el[0].removeAttribute("style"),this.$overlay[0].parentNode&&this.$overlay[0].parentNode.removeChild(this.$overlay[0]),this.$el[0].M_Modal=void 0,n._count--}},{key:"setupEventHandlers",value:function(){this.handleOverlayClickBound=this.handleOverlayClick.bind(this),this.handleModalCloseClickBound=this.handleModalCloseClick.bind(this),1===n._count&&document.body.addEventListener("click",this.handleTriggerClick),this.$overlay[0].addEventListener("click",this.handleOverlayClickBound),this.$el[0].addEventListener("click",this.handleModalCloseClickBound)}},{key:"removeEventHandlers",value:function(){0===n._count&&document.body.removeEventListener("click",this.handleTriggerClick),this.$overlay[0].removeEventListener("click",this.handleOverlayClickBound),this.$el[0].removeEventListener("click",this.handleModalCloseClickBound)}},{key:"handleTriggerClick",value:function(e){var i=t(e.target).closest(".modal-trigger");if(e.target&&i.length){var n=i[0].getAttribute("href");n=n?n.slice(1):i[0].getAttribute("data-target");var o=document.getElementById(n).M_Modal;o&&o.open(i),e.preventDefault()}}},{key:"handleOverlayClick",value:function(){this.options.dismissible&&this.close()}},{key:"handleModalCloseClick",value:function(e){var i=t(e.target).closest(".modal-close");e.target&&i.length&&this.close()}},{key:"handleKeydown",value:function(t){27===t.keyCode&&this.options.dismissible&&this.close()}},{key:"animateIn",value:function(){var i=this;t.extend(this.$el[0].style,{display:"block",opacity:0}),t.extend(this.$overlay[0].style,{display:"block",opacity:0}),e(this.$overlay[0],{opacity:this.options.opacity},{duration:this.options.inDuration,queue:!1,ease:"easeOutCubic"});var n={duration:this.options.inDuration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof i.options.ready&&i.options.ready.call(i,i.$el,i.openingTrigger)}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:0,opacity:1},n):(e.hook(this.$el[0],"scaleX",.7),this.$el[0].style.top=this.options.startingTop,e(this.$el[0],{top:this.options.endingTop,opacity:1,scaleX:1},n))}},{key:"animateOut",value:function(){var t=this;e(this.$overlay[0],{opacity:0},{duration:this.options.outDuration,queue:!1,ease:"easeOutQuart"});var i={duration:this.options.outDuration,queue:!1,ease:"easeOutCubic",complete:function(){t.$el[0].style.display="none","function"==typeof t.options.complete&&t.options.complete.call(t,t.$el),t.$overlay[0].parentNode.removeChild(t.$overlay[0])}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:"-100%",opacity:0},i):e(this.$el[0],{top:this.options.startingTop,opacity:0,scaleX:.7},i)}},{key:"open",value:function(t){if(!this.isOpen){this.isOpen=!0;var e=document.body;return e.style.overflow="hidden",this.$el[0].classList.add("open"),e.appendChild(this.$overlay[0]),this.openingTrigger=t||void 0,this.options.dismissible&&(this.handleKeydownBound=this.handleKeydown.bind(this),document.addEventListener("keydown",this.handleKeydownBound)),this.animateIn(),this}}},{key:"close",value:function(){if(this.isOpen)return this.isOpen=!1,this.$el[0].classList.remove("open"),document.body.style.overflow="",this.options.dismissible&&document.removeEventListener("keydown",this.handleKeydownBound),this.animateOut(),this}}],[{key:"init",value:function(e,i){var o=[];return e.each(function(){o.push(new n(t(this),i))}),o}},{key:"defaults",get:function(){return i}}]),n}();n._increment=0,n._count=0,Materialize.Modal=n,t.fn.modal=function(e){return n.prototype[e]?"get"===e.slice(0,3)?this.first()[0].M_Modal[e]():this.each(function(){this.M_Modal[e]()}):"object"!=typeof e&&e?void t.error("Method "+e+" does not exist on jQuery.modal"):(n.init(this,arguments[0]),this)}}(jQuery,Materialize.Vel),function(t){t.fn.materialbox=function(){return this.each(function(){function e(){a=!1;var e=s.parent(".material-placeholder"),n=(window.innerWidth,window.innerHeight,s.data("width")),l=s.data("height");s.velocity("stop",!0),t("#materialbox-overlay").velocity("stop",!0),t(".materialbox-caption").velocity("stop",!0),t(window).off("scroll.materialbox"),t(document).off("keyup.materialbox"),t(window).off("resize.materialbox"),t("#materialbox-overlay").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){o=!1,t(this).remove()}}),s.velocity({width:n,height:l,left:0,top:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){e.css({height:"",width:"",position:"",top:"",left:""}),s.removeAttr("style"),s.attr("style",c),s.removeClass("active"),a=!0,i&&i.css("overflow","")}}),t(".materialbox-caption").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}if(!t(this).hasClass("initialized")){t(this).addClass("initialized");var i,n,o=!1,a=!0,r=200,s=t(this),l=t("").addClass("material-placeholder"),c=s.attr("style");s.wrap(l),s.on("click",function(){var r=s.parent(".material-placeholder"),l=window.innerWidth,c=window.innerHeight,u=s.width(),d=s.height();if(!1===a)return e(),!1;if(o&&!0===a)return e(),!1;a=!1,s.addClass("active"),o=!0,r.css({width:r[0].getBoundingClientRect().width,height:r[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),i=void 0,n=r[0].parentNode;for(;null!==n&&!t(n).is(document);){var p=t(n);"visible"!==p.css("overflow")&&(p.css("overflow","visible"),i=void 0===i?p:i.add(p)),n=n.parentNode}s.css({position:"absolute","z-index":1e3,"will-change":"left, top, width, height"}).data("width",u).data("height",d);var h=t('').css({opacity:0}).click(function(){!0===a&&e()});s.before(h);var f=h[0].getBoundingClientRect();if(h.css({width:l,height:c,left:-1*f.left,top:-1*f.top}),h.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"}),""!==s.data("caption")){var v=t('');v.text(s.data("caption")),t("body").append(v),v.css({display:"inline"}),v.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"})}var m=0,g=0;u/l>d/c?(m=.9*l,g=.9*l*(d/u)):(m=.9*c*(u/d),g=.9*c),s.hasClass("responsive-img")?s.velocity({"max-width":m,width:u},{duration:0,queue:!1,complete:function(){s.css({left:0,top:0}).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}})}}):s.css("left",0).css("top",0).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}}),t(window).on("scroll.materialbox",function(){o&&e()}),t(window).on("resize.materialbox",function(){o&&e()}),t(document).on("keyup.materialbox",function(t){27===t.keyCode&&!0===a&&o&&e()})})}})},t(document).ready(function(){t(".materialboxed").materialbox()})}(jQuery),function(t){t.fn.parallax=function(){var e=t(window).width();return this.each(function(i){function n(i){var n;n=e<601?o.height()>0?o.height():o.children("img").height():o.height()>0?o.height():500;var a=o.children("img").first(),r=a.height()-n,s=o.offset().top+n,l=o.offset().top,c=t(window).scrollTop(),u=window.innerHeight,d=(c+u-l)/(n+u),p=Math.round(r*d);i&&a.css("display","block"),s>c&&l=0?(s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})):(s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90}))};e.swipeable&&d>e.responsiveThreshold&&(e.swipeable=!1),0===(o=t(p.filter('[href="'+location.hash+'"]'))).length&&(o=t(this).find("li.tab a.active").first()),0===o.length&&(o=t(this).find("li.tab a").first()),o.addClass("active"),(m=p.index(o))<0&&(m=0),void 0!==o[0]&&(a=t(o[0].hash)).addClass("active"),u.find(".indicator").length||u.append(''),s=u.find(".indicator"),u.append(s),u.is(":visible")&&setTimeout(function(){s.css({right:b(o)}),s.css({left:w(o)})},0),t(window).off("resize.tabs-"+c).on("resize.tabs-"+c,function(){h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,m<0&&(m=0),0!==v&&0!==h&&(s.css({right:b(o)}),s.css({left:w(o)}))}),e.swipeable?(p.each(function(){var e=t(Materialize.escapeHash(this.hash));e.addClass("carousel-item"),f=f.add(e)}),r=f.wrapAll(''),f.css("display",""),t(".tabs-content.carousel").carousel({fullWidth:!0,noWrap:!0,onCycleTo:function(t){if(!y){var i=m;m=r.index(t),o.removeClass("active"),(o=p.eq(m)).addClass("active"),k(i),"function"==typeof e.onShow&&e.onShow.call(u[0],a)}}})):p.not(o).each(function(){t(Materialize.escapeHash(this.hash)).hide()}),u.off("click.tabs").on("click.tabs","a",function(i){if(t(this).parent().hasClass("disabled"))i.preventDefault();else if(!t(this).attr("target")){y=!0,h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,o.removeClass("active");var n=a;o=t(this),a=t(Materialize.escapeHash(this.hash)),p=u.find("li.tab a");o.position();o.addClass("active"),g=m,(m=p.index(t(this)))<0&&(m=0),e.swipeable?f.length&&f.carousel("set",m,function(){"function"==typeof e.onShow&&e.onShow.call(u[0],a)}):(void 0!==a&&(a.show(),a.addClass("active"),"function"==typeof e.onShow&&e.onShow.call(this,a)),void 0===n||n.is(a)||(n.hide(),n.removeClass("active"))),l=setTimeout(function(){y=!1},300),k(g),i.preventDefault()}})})},select_tab:function(t){this.find('a[href="#'+t+'"]').trigger("click")}};t.fn.tabs=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tabs"):e.init.apply(this,arguments)},t(document).ready(function(){t("ul.tabs").tabs()})}(jQuery),function(t){t.fn.tooltip=function(i){var n={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===i?(this.each(function(){t("#"+t(this).attr("data-tooltip-id")).remove(),t(this).removeAttr("data-tooltip-id"),t(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(i=t.extend(n,i),this.each(function(){var n=Materialize.guid(),o=t(this);o.attr("data-tooltip-id")&&t("#"+o.attr("data-tooltip-id")).remove(),o.attr("data-tooltip-id",n);var a,r,s,l,c,u,d=function(){a=o.attr("data-html")?"true"===o.attr("data-html"):i.html,r=o.attr("data-delay"),r=void 0===r||""===r?i.delay:r,s=o.attr("data-position"),s=void 0===s||""===s?i.position:s,l=o.attr("data-tooltip"),l=void 0===l||""===l?i.tooltip:l};d();c=function(){var e=t('');return l=a?t("").html(l):t("").text(l),e.append(l).appendTo(t("body")).attr("id",n),(u=t('')).appendTo(e),e}(),o.off("mouseenter.tooltip mouseleave.tooltip");var p,h=!1;o.on({"mouseenter.tooltip":function(t){p=setTimeout(function(){d(),h=!0,c.velocity("stop"),u.velocity("stop"),c.css({visibility:"visible",left:"0px",top:"0px"});var t,i,n,a=o.outerWidth(),r=o.outerHeight(),l=c.outerHeight(),p=c.outerWidth(),f="0px",v="0px",m=u[0].offsetWidth,g=u[0].offsetHeight,y=8,b=8,w=0;"top"===s?(t=o.offset().top-l-5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="-10px",u.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:l,marginLeft:p/2-m/2})):"left"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left-p-5,n=e(i,t,p,l),v="-10px",u.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:l/2,marginLeft:p})):"right"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left+a+5,n=e(i,t,p,l),v="+10px",u.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:l/2,marginLeft:"0px"})):(t=o.offset().top+o.outerHeight()+5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="+10px",u.css({top:0,left:0,marginLeft:p/2-m/2})),c.css({top:n.y,left:n.x}),y=Math.SQRT2*p/parseInt(m),b=Math.SQRT2*l/parseInt(g),w=Math.max(y,b),c.velocity({translateY:f,translateX:v},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),u.css({visibility:"visible"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:w,scaleY:w},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})},r)},"mouseleave.tooltip":function(){h=!1,clearTimeout(p),setTimeout(function(){!0!==h&&(c.velocity({opacity:0,translateY:0,translateX:0},{duration:225,queue:!1}),u.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){u.css({visibility:"hidden"}),c.css({visibility:"hidden"}),h=!1}}))},225)}})}))};var e=function(e,i,n,o){var a=e,r=i;return a<0?a=4:a+n>window.innerWidth&&(a-=a+n-window.innerWidth),r<0?r=4:r+o>window.innerHeight+t(window).scrollTop&&(r-=r+o-window.innerHeight),{x:a,y:r}};t(document).ready(function(){t(".tooltipped").tooltip()})}(jQuery),function(t){"use strict";function e(t){return null!==t&&t===t.window}function i(t){return e(t)?t:9===t.nodeType&&t.defaultView}function n(t){var e,n,o={top:0,left:0},a=t&&t.ownerDocument;return e=a.documentElement,void 0!==t.getBoundingClientRect&&(o=t.getBoundingClientRect()),n=i(a),{top:o.top+n.pageYOffset-e.clientTop,left:o.left+n.pageXOffset-e.clientLeft}}function o(t){var e="";for(var i in t)t.hasOwnProperty(i)&&(e+=i+":"+t[i]+";");return e}function a(t){if(!1===u.allowEvent(t))return null;for(var e=null,i=t.target||t.srcElement;null!==i.parentNode;){if(!(i instanceof SVGElement)&&-1!==i.className.indexOf("waves-effect")){e=i;break}i=i.parentNode}return e}function r(e){var i=a(e);null!==i&&(c.show(e,i),"ontouchstart"in t&&(i.addEventListener("touchend",c.hide,!1),i.addEventListener("touchcancel",c.hide,!1)),i.addEventListener("mouseup",c.hide,!1),i.addEventListener("mouseleave",c.hide,!1),i.addEventListener("dragend",c.hide,!1))}var s=s||{},l=document.querySelectorAll.bind(document),c={duration:750,show:function(t,e){if(2===t.button)return!1;var i=e||this,a=document.createElement("div");a.className="waves-ripple",i.appendChild(a);var r=n(i),s=t.pageY-r.top,l=t.pageX-r.left,u="scale("+i.clientWidth/100*10+")";"touches"in t&&(s=t.touches[0].pageY-r.top,l=t.touches[0].pageX-r.left),a.setAttribute("data-hold",Date.now()),a.setAttribute("data-scale",u),a.setAttribute("data-x",l),a.setAttribute("data-y",s);var d={top:s+"px",left:l+"px"};a.className=a.className+" waves-notransition",a.setAttribute("style",o(d)),a.className=a.className.replace("waves-notransition",""),d["-webkit-transform"]=u,d["-moz-transform"]=u,d["-ms-transform"]=u,d["-o-transform"]=u,d.transform=u,d.opacity="1",d["-webkit-transition-duration"]=c.duration+"ms",d["-moz-transition-duration"]=c.duration+"ms",d["-o-transition-duration"]=c.duration+"ms",d["transition-duration"]=c.duration+"ms",d["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",a.setAttribute("style",o(d))},hide:function(t){u.touchup(t);var e=this,i=(e.clientWidth,null),n=e.getElementsByClassName("waves-ripple");if(!(n.length>0))return!1;var a=(i=n[n.length-1]).getAttribute("data-x"),r=i.getAttribute("data-y"),s=i.getAttribute("data-scale"),l=350-(Date.now()-Number(i.getAttribute("data-hold")));l<0&&(l=0),setTimeout(function(){var t={top:r+"px",left:a+"px",opacity:"0","-webkit-transition-duration":c.duration+"ms","-moz-transition-duration":c.duration+"ms","-o-transition-duration":c.duration+"ms","transition-duration":c.duration+"ms","-webkit-transform":s,"-moz-transform":s,"-ms-transform":s,"-o-transform":s,transform:s};i.setAttribute("style",o(t)),setTimeout(function(){try{e.removeChild(i)}catch(t){return!1}},c.duration)},l)},wrapInput:function(t){for(var e=0;e0&&(u.touches-=1)},500):"mousedown"===t.type&&u.touches>0&&(e=!1),e},touchup:function(t){u.allowEvent(t)}};s.displayEffect=function(e){"duration"in(e=e||{})&&(c.duration=e.duration),c.wrapInput(l(".waves-effect")),"ontouchstart"in t&&document.body.addEventListener("touchstart",r,!1),document.body.addEventListener("mousedown",r,!1)},s.attach=function(e){"input"===e.tagName.toLowerCase()&&(c.wrapInput([e]),e=e.parentNode),"ontouchstart"in t&&e.addEventListener("touchstart",r,!1),e.addEventListener("mousedown",r,!1)},t.Waves=s,document.addEventListener("DOMContentLoaded",function(){s.displayEffect()},!1)}(window),function(t,e){"use strict";var i={displayLength:1/0,inDuration:300,outDuration:375,className:void 0,completeCallback:void 0,activationPercent:.8},n=function(){function n(e,i,o,a){if(_classCallCheck(this,n),e){this.options={displayLength:i,className:o,completeCallback:a},this.options=t.extend({},n.defaults,this.options),this.message=e,this.panning=!1,this.timeRemaining=this.options.displayLength,0===n._toasts.length&&n._createContainer(),n._toasts.push(this);var r=this.createToast();r.M_Toast=this,this.el=r,this._animateIn(),this.setTimer()}}return _createClass(n,[{key:"createToast",value:function(){var e=document.createElement("div");if(e.classList.add("toast"),this.options.className){var i=this.options.className.split(" "),o=void 0,a=void 0;for(o=0,a=i.length;oo||e.velocityX>1?(e.wasSwiped=!0,e.remove()):(e.el.style.transition="transform .2s, opacity .2s",e.el.style.transform="",e.el.style.opacity=""),n._draggedToast=null}}},{key:"_xPos",value:function(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}},{key:"removeAll",value:function(){for(var t in n._toasts)n._toasts[t].remove()}},{key:"defaults",get:function(){return i}}]),n}();n._toasts=[],n._container=null,n._draggedToast=null,Materialize.Toast=n,Materialize.toast=function(t,e,i,o){return new n(t,e,i,o)}}(jQuery,Materialize.Vel),function(t){var e={init:function(e){var i={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0,onOpen:null,onClose:null};e=t.extend(i,e),t(this).each(function(){var i=t(this),n=i.attr("data-activates"),o=t("#"+n);300!=e.menuWidth&&o.css("width",e.menuWidth);var a=t('.drag-target[data-sidenav="'+n+'"]');e.draggable?(a.length&&a.remove(),a=t('').attr("data-sidenav",n),t("body").append(a)):a=t(),"left"==e.edge?(o.css("transform","translateX(-100%)"),a.css({left:0})):(o.addClass("right-aligned").css("transform","translateX(100%)"),a.css({right:0})),o.hasClass("fixed")&&window.innerWidth>992&&o.css("transform","translateX(0)"),o.hasClass("fixed")&&t(window).resize(function(){window.innerWidth>992?0!==t("#sidenav-overlay").length&&l?r(!0):o.css("transform","translateX(0%)"):!1===l&&("left"===e.edge?o.css("transform","translateX(-100%)"):o.css("transform","translateX(100%)"))}),!0===e.closeOnClick&&o.on("click.itemclick","a:not(.collapsible-header)",function(){window.innerWidth>992&&o.hasClass("fixed")||r()});var r=function(i){s=!1,l=!1,t("body").css({overflow:"",width:""}),t("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}}),"left"===e.edge?(a.css({width:"",right:"",left:"0"}),o.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})):(a.css({width:"",right:"0",left:""}),o.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})),"function"==typeof e.onClose&&e.onClose.call(this,o)},s=!1,l=!1;e.draggable&&(a.on("click",function(){l&&r()}),a.hammer({prevent_default:!1}).on("pan",function(i){if("touch"==i.gesture.pointerType){i.gesture.direction;var n=i.gesture.center.x,a=i.gesture.center.y;i.gesture.velocityX;if(0===n&&0===a)return;var s=t("body"),c=t("#sidenav-overlay"),u=s.innerWidth();if(s.css("overflow","hidden"),s.width(u),0===c.length&&((c=t('')).css("opacity",0).click(function(){r()}),"function"==typeof e.onOpen&&e.onOpen.call(this,o),t("body").append(c)),"left"===e.edge&&(n>e.menuWidth?n=e.menuWidth:n<0&&(n=0)),"left"===e.edge)n=e.menuWidth/2&&(l=!0),o.css("transform","translateX("+(n-e.menuWidth)+"px)");else{n=window.innerWidth-e.menuWidth/2&&(l=!1);var d=n-e.menuWidth/2;d<0&&(d=0),o.css("transform","translateX("+d+"px)")}var p;"left"===e.edge?(p=n/e.menuWidth,c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"})):(p=Math.abs((n-window.innerWidth)/e.menuWidth),c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(i){if("touch"==i.gesture.pointerType){var n=t("#sidenav-overlay"),r=i.gesture.velocityX,c=i.gesture.center.x,u=c-e.menuWidth,d=c-e.menuWidth/2;u>0&&(u=0),d<0&&(d=0),s=!1,"left"===e.edge?l&&r<=.3||r<-.5?(0!==u&&o.velocity({translateX:[0,u]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:0,left:""}),l=!0):(!l||r>.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[-1*e.menuWidth-10,u]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:"",left:0})):l&&r>=-.3||r>.5?(0!==d&&o.velocity({translateX:[0,d]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:"",left:0}),l=!0):(!l||r<-.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[e.menuWidth+10,d]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:0,left:""}))}})),i.off("click.sidenav").on("click.sidenav",function(){if(!0===l)l=!1,s=!1,r();else{var i=t("body"),n=t(''),c=i.innerWidth();i.css("overflow","hidden"),i.width(c),t("body").append(a),"left"===e.edge?(a.css({width:"50%",right:0,left:""}),o.velocity({translateX:[0,-1*e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(a.css({width:"50%",right:"",left:0}),o.velocity({translateX:[0,e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),n.css("opacity",0).click(function(){l=!1,s=!1,r(),n.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}),t("body").append(n),n.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){l=!0,s=!1}}),"function"==typeof e.onOpen&&e.onOpen.call(this,o)}return!1})})},destroy:function(){var e=t("#sidenav-overlay"),i=t('.drag-target[data-sidenav="'+t(this).attr("data-activates")+'"]');e.trigger("click"),i.remove(),t(this).off("click"),e.remove()},show:function(){this.trigger("click")},hide:function(){t("#sidenav-overlay").trigger("click")}};t.fn.sideNav=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.sideNav"):e.init.apply(this,arguments)}}(jQuery),function(t){function e(e,i,n,o){var r=t();return t.each(a,function(t,a){if(a.height()>0){var s=a.offset().top,l=a.offset().left,c=l+a.width(),u=s+a.height();!(l>i||cn||u");n.html(s),e.is(":visible")?n.css("width",e.width()):n.css("width",t(window).width()/2),e.data("original-height")<=n.height()?e.css("height",n.height()):e.val().length0||t(i).is(":focus")||i.autofocus||void 0!==n.attr("placeholder")?n.siblings("label").addClass("active"):t(i)[0].validity?n.siblings("label").toggleClass("active",!0===t(i)[0].validity.badInput):n.siblings("label").removeClass("active")})};var i="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";t(document).on("change",i,function(){0===t(this).val().length&&void 0===t(this).attr("placeholder")||t(this).siblings("label").addClass("active"),validate_field(t(this))}),t(document).ready(function(){Materialize.updateTextFields()}),t(document).on("reset",function(e){var n=t(e.target);n.is("form")&&(n.find(i).removeClass("valid").removeClass("invalid"),n.find(i).each(function(){""===t(this).attr("value")&&t(this).siblings("label").removeClass("active")}),n.find("select.initialized").each(function(){var t=n.find("option[selected]").text();n.siblings("input.select-dropdown").val(t)}))}),t(document).on("focus",i,function(){t(this).siblings("label, .prefix").addClass("active")}),t(document).on("blur",i,function(){var e=t(this),i=".prefix";0===e.val().length&&!0!==e[0].validity.badInput&&void 0===e.attr("placeholder")&&(i+=", label"),e.siblings(i).removeClass("active"),validate_field(e)}),window.validate_field=function(t){var e=void 0!==t.attr("data-length"),i=parseInt(t.attr("data-length")),n=t.val().length;0!==t.val().length||!1!==t[0].validity.badInput||t.is(":required")?t.hasClass("validate")&&(t.is(":valid")&&e&&n<=i||t.is(":valid")&&!e?(t.removeClass("invalid"),t.addClass("valid")):(t.removeClass("valid"),t.addClass("invalid"))):t.hasClass("validate")&&(t.removeClass("valid"),t.removeClass("invalid"))};t(document).on("keyup.radio","input[type=radio], input[type=checkbox]",function(e){if(9===e.which)return t(this).addClass("tabbed"),void t(this).one("blur",function(e){t(this).removeClass("tabbed")})});var n=t(".hiddendiv").first();n.length||(n=t(''),t("body").append(n));t(".materialize-textarea").each(function(){var e=t(this);e.data("original-height",e.height()),e.data("previous-length",e.val().length)}),t("body").on("keyup keydown autoresize",".materialize-textarea",function(){e(t(this))}),t(document).on("change",'.file-field input[type="file"]',function(){for(var e=t(this).closest(".file-field").find("input.file-path"),i=t(this)[0].files,n=[],o=0;o');t(this).after(e)});var r=function(t){var e=-7+parseInt(t.parent().css("padding-left"))+"px";t.velocity({height:"30px",width:"30px",top:"-30px",marginLeft:e},{duration:300,easing:"easeOutExpo"})},s=function(t){var e=t.width()-15,i=parseFloat(t.attr("max")),n=parseFloat(t.attr("min"));return(parseFloat(t.val())-n)/(i-n)*e};t(document).on("change",o,function(e){var i=t(this).siblings(".thumb");i.find(".value").html(t(this).val()),i.hasClass("active")||r(i);var n=s(t(this));i.addClass("active").css("left",n)}),t(document).on("mousedown touchstart",o,function(e){var i=t(this).siblings(".thumb");if(i.length<=0&&(i=t(''),t(this).after(i)),i.find(".value").html(t(this).val()),a=!0,t(this).addClass("active"),i.hasClass("active")||r(i),"input"!==e.type){var n=s(t(this));i.addClass("active").css("left",n)}}),t(document).on("mouseup touchend",".range-field",function(){a=!1,t(this).removeClass("active")}),t(document).on("input mousemove touchmove",".range-field",function(e){var i=t(this).children(".thumb"),n=t(this).find(o);if(a){i.hasClass("active")||r(i);var l=s(n);i.addClass("active").css("left",l),i.find(".value").html(i.siblings(o).val())}}),t(document).on("mouseout touchleave",".range-field",function(){if(!a){var e=t(this).children(".thumb"),i=7+parseInt(t(this).css("padding-left"))+"px";e.hasClass("active")&&e.velocity({height:"0",width:"0",top:"10px",marginLeft:i},{duration:100}),e.removeClass("active")}}),t.fn.autocomplete=function(e){var i={data:{},limit:1/0,onAutocomplete:null,minLength:1};return e=t.extend(i,e),this.each(function(){var i,n=t(this),o=e.data,a=0,r=-1,s=n.closest(".input-field");if(t.isEmptyObject(o))n.off("keyup.autocomplete focus.autocomplete");else{var l,c=t('');s.length?(l=s.children(".autocomplete-content.dropdown-content").first()).length||s.append(c):(l=n.next(".autocomplete-content.dropdown-content")).length||n.after(c),l.length&&(c=l);var u=function(t,e){var i=e.find("img"),n=e.text().toLowerCase().indexOf(""+t.toLowerCase()),o=n+t.length-1,a=e.text().slice(0,n),r=e.text().slice(n,o+1),s=e.text().slice(o+1);e.html(""+a+""+r+""+s+""),i.length&&e.prepend(i)},d=function(){r=-1,c.find(".active").removeClass("active")},p=function(){c.empty(),d(),i=void 0};n.off("blur.autocomplete").on("blur.autocomplete",function(){p()}),n.off("keyup.autocomplete focus.autocomplete").on("keyup.autocomplete focus.autocomplete",function(r){a=0;var s=n.val().toLowerCase();if(13!==r.which&&38!==r.which&&40!==r.which){if(i!==s&&(p(),s.length>=e.minLength))for(var l in o)if(o.hasOwnProperty(l)&&-1!==l.toLowerCase().indexOf(s)){if(a>=e.limit)break;var d=t("");o[l]?d.append('
'+l+""):d.append(""+l+""),c.append(d),u(s,d),a++}i=s}}),n.off("keydown.autocomplete").on("keydown.autocomplete",function(t){var e,i=t.which,n=c.children("li").length,o=c.children(".active").first();13===i&&r>=0?(e=c.children("li").eq(r)).length&&(e.trigger("mousedown.autocomplete"),t.preventDefault()):38!==i&&40!==i||(t.preventDefault(),38===i&&r>0&&r--,40===i&&r=0&&c.children("li").eq(r).addClass("active"))}),c.off("mousedown.autocomplete touchstart.autocomplete").on("mousedown.autocomplete touchstart.autocomplete","li",function(){var i=t(this).text().trim();n.val(i),n.trigger("change"),p(),"function"==typeof e.onAutocomplete&&e.onAutocomplete.call(this,i)})}})}}),t.fn.material_select=function(e){function i(t,e,i){var o=t.indexOf(e),a=-1===o;return a?t.push(e):t.splice(o,1),i.siblings("ul.dropdown-content").find("li:not(.optgroup)").eq(e).toggleClass("active"),i.find("option").eq(e).prop("selected",a),n(t,i),a}function n(t,e){for(var i="",n=0,o=t.length;n');s.addClass(n.attr("class")),n.is(":disabled")&&s.addClass("disabled");var l=t(''),c=n.children("option, optgroup"),u=[],d=!1,p=n.find("option:selected").html()||n.find("option:first").html()||"",h=function(e,i,n){var a=i.is(":disabled")?"disabled ":"",r="optgroup-option"===n?"optgroup-option ":"",s=o?'":"",c=i.data("icon"),u=i.attr("class");if(c){var d="";return u&&(d=' class="'+u+'"'),l.append(t('
"+s+i.html()+"")),!0}l.append(t(''+s+i.html()+""))};c.length&&c.each(function(){if(t(this).is("option"))o?h(0,t(this),"multiple"):h(0,t(this));else if(t(this).is("optgroup")){var e=t(this).children("option");l.append(t(''+t(this).attr("label")+"")),e.each(function(){h(0,t(this),"optgroup-option")})}}),l.find("li:not(.optgroup)").each(function(a){t(this).click(function(r){if(!t(this).hasClass("disabled")&&!t(this).hasClass("optgroup")){var s=!0;o?(t('input[type="checkbox"]',this).prop("checked",function(t,e){return!e}),s=i(u,a,n),m.trigger("focus")):(l.find("li").removeClass("active"),t(this).toggleClass("active"),m.val(t(this).text())),g(l,t(this)),n.find("option").eq(a).prop("selected",s),n.trigger("change"),void 0!==e&&e()}r.stopPropagation()})}),n.wrap(s);var f=t('▼'),v=p.replace(/"/g,"""),m=t('');n.before(m),m.before(f),m.after(l),n.is(":disabled")||m.dropdown({hover:!1}),n.attr("tabindex")&&t(m[0]).attr("tabindex",n.attr("tabindex")),n.addClass("initialized"),m.on({focus:function(){if(t("ul.select-dropdown").not(l[0]).is(":visible")&&(t("input.select-dropdown").trigger("close"),t(window).off("click.select")),!l.is(":visible")){t(this).trigger("open",["focus"]);var e=t(this).val();o&&e.indexOf(",")>=0&&(e=e.split(",")[0]);var i=l.find("li").filter(function(){return t(this).text().toLowerCase()===e.toLowerCase()})[0];g(l,i,!0),t(window).off("click.select").on("click.select",function(){o&&(d||m.trigger("close")),t(window).off("click.select")})}},click:function(t){t.stopPropagation()}}),m.on("blur",function(){o||(t(this).trigger("close"),t(window).off("click.select")),l.find("li.selected").removeClass("selected")}),l.hover(function(){d=!0},function(){d=!1}),o&&n.find("option:selected:not(:disabled)").each(function(){var t=this.index;i(u,t,n),l.find("li:not(.optgroup)").eq(t).find(":checkbox").prop("checked",!0)});var g=function(e,i,n){if(i){e.find("li.selected").removeClass("selected");var a=t(i);a.addClass("selected"),o&&!n||l.scrollTo(a)}},y=[];m.on("keydown",function(e){if(9!=e.which)if(40!=e.which||l.is(":visible")){if(13!=e.which||l.is(":visible")){e.preventDefault();var i=String.fromCharCode(e.which).toLowerCase(),n=[9,13,27,38,40];if(i&&-1===n.indexOf(e.which)){y.push(i);var a=y.join(""),r=l.find("li").filter(function(){return 0===t(this).text().toLowerCase().indexOf(a)})[0];r&&g(l,r)}if(13==e.which){var s=l.find("li.selected:not(.disabled)")[0];s&&(t(s).trigger("click"),o||m.trigger("close"))}40==e.which&&(r=l.find("li.selected").length?l.find("li.selected").next("li:not(.disabled)")[0]:l.find("li:not(.disabled)")[0],g(l,r)),27==e.which&&m.trigger("close"),38==e.which&&(r=l.find("li.selected").prev("li:not(.disabled)")[0])&&g(l,r),setTimeout(function(){y=[]},1e3)}}else m.trigger("open");else m.trigger("close")})}})}}(jQuery),function(t){var e={init:function(e){var i={indicators:!0,height:400,transition:500,interval:6e3};return e=t.extend(i,e),this.each(function(){function i(t,e){t.hasClass("center-align")?t.velocity({opacity:0,translateY:-100},{duration:e,queue:!1}):t.hasClass("right-align")?t.velocity({opacity:0,translateX:100},{duration:e,queue:!1}):t.hasClass("left-align")&&t.velocity({opacity:0,translateX:-100},{duration:e,queue:!1})}function n(t){t>=c.length?t=0:t<0&&(t=c.length-1),(u=l.find(".active").index())!=t&&(o=c.eq(u),$caption=o.find(".caption"),o.removeClass("active"),o.velocity({opacity:0},{duration:e.transition,queue:!1,easing:"easeOutQuad",complete:function(){c.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),i($caption,e.transition),e.indicators&&a.eq(u).removeClass("active"),c.eq(t).velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,delay:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).addClass("active"),e.indicators&&a.eq(t).addClass("active"))}var o,a,r,s=t(this),l=s.find("ul.slides").first(),c=l.find("> li"),u=l.find(".active").index();-1!=u&&(o=c.eq(u)),s.hasClass("fullscreen")||(e.indicators?s.height(e.height+40):s.height(e.height),l.height(e.height)),c.find(".caption").each(function(){i(t(this),0)}),c.find("img").each(function(){var e="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";t(this).attr("src")!==e&&(t(this).css("background-image",'url("'+t(this).attr("src")+'")'),t(this).attr("src",e))}),e.indicators&&(a=t(''),c.each(function(i){var o=t('');o.click(function(){n(l.parent().find(t(this)).index()),clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),a.append(o)}),s.append(a),a=s.find("ul.indicators").find("li.indicator-item")),o?o.show():(c.first().addClass("active").velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),u=0,o=c.eq(u),e.indicators&&a.eq(u).addClass("active")),o.find("img").each(function(){o.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,queue:!1,easing:"easeOutQuad"})}),r=setInterval(function(){n((u=l.find(".active").index())+1)},e.transition+e.interval);var d=!1,p=!1,h=!1;s.hammer({prevent_default:!1}).on("pan",function(t){if("touch"===t.gesture.pointerType){clearInterval(r);var e=t.gesture.direction,i=t.gesture.deltaX,n=t.gesture.velocityX,o=t.gesture.velocityY;$curr_slide=l.find(".active"),Math.abs(n)>Math.abs(o)&&$curr_slide.velocity({translateX:i},{duration:50,queue:!1,easing:"easeOutQuad"}),4===e&&(i>s.innerWidth()/2||n<-.65)?h=!0:2===e&&(i<-1*s.innerWidth()/2||n>.65)&&(p=!0);var a;p&&(0===(a=$curr_slide.next()).length&&(a=c.first()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),h&&(0===(a=$curr_slide.prev()).length&&(a=c.last()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(t){"touch"===t.gesture.pointerType&&($curr_slide=l.find(".active"),d=!1,curr_index=l.find(".active").index(),!h&&!p||c.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):p?(n(curr_index+1),$curr_slide.velocity({translateX:-1*s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):h&&(n(curr_index-1),$curr_slide.velocity({translateX:s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),p=!1,h=!1,clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval))}),s.on("sliderPause",function(){clearInterval(r)}),s.on("sliderStart",function(){clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),s.on("sliderNext",function(){n((u=l.find(".active").index())+1)}),s.on("sliderPrev",function(){n((u=l.find(".active").index())-1)})})},pause:function(){t(this).trigger("sliderPause")},start:function(){t(this).trigger("sliderStart")},next:function(){t(this).trigger("sliderNext")},prev:function(){t(this).trigger("sliderPrev")}};t.fn.slider=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tooltip"):e.init.apply(this,arguments)}}(jQuery),function(t){t(document).ready(function(){t(document).on("click.card",".card",function(e){if(t(this).find("> .card-reveal").length){var i=t(e.target).closest(".card");void 0===i.data("initialOverflow")&&i.data("initialOverflow",void 0===i.css("overflow")?"":i.css("overflow")),t(e.target).is(t(".card-reveal .card-title"))||t(e.target).is(t(".card-reveal .card-title i"))?t(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){t(this).css({display:"none"}),i.css("overflow",i.data("initialOverflow"))}}):(t(e.target).is(t(".card .activator"))||t(e.target).is(t(".card .activator i")))&&(i.css("overflow","hidden"),t(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"}))}})})}(jQuery),function(t){var e={data:[],placeholder:"",secondaryPlaceholder:"",autocompleteOptions:{}};t(document).ready(function(){t(document).on("click",".chip .close",function(e){t(this).closest(".chips").attr("data-initialized")||t(this).closest(".chip").remove()})}),t.fn.material_chip=function(i){var n=this;if(this.$el=t(this),this.$document=t(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===i)return this.$el.data("chips");var o=t.extend({},e,i);n.hasAutocomplete=!t.isEmptyObject(o.autocompleteOptions.data),this.init=function(){var e=0;n.$el.each(function(){var i=t(this),a=Materialize.guid();n.chipId=a,o.data&&o.data instanceof Array||(o.data=[]),i.data("chips",o.data),i.attr("data-index",e),i.attr("data-initialized",!0),i.hasClass(n.SELS.CHIPS)||i.addClass("chips"),n.chips(i,a),e++})},this.handleEvents=function(){var e=n.SELS;n.$document.off("click.chips-focus",e.CHIPS).on("click.chips-focus",e.CHIPS,function(i){t(i.target).find(e.INPUT).focus()}),n.$document.off("click.chips-select",e.CHIP).on("click.chips-select",e.CHIP,function(i){var o=t(i.target);if(o.length){var a=o.hasClass("selected"),r=o.closest(e.CHIPS);t(e.CHIP).removeClass("selected"),a||n.selectChip(o.index(),r)}}),n.$document.off("keydown.chips").on("keydown.chips",function(i){if(!t(i.target).is("input, textarea")){var o,a=n.$document.find(e.CHIP+e.SELECTED_CHIP),r=a.closest(e.CHIPS),s=a.siblings(e.CHIP).length;if(a.length)if(8===i.which||46===i.which){i.preventDefault(),o=a.index(),n.deleteChip(o,r);var l=null;o+1s)return void r.find("input").focus();n.selectChip(o,r)}}}),n.$document.off("focusin.chips",e.CHIPS+" "+e.INPUT).on("focusin.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.addClass("focus"),n.siblings("label, .prefix").addClass("active"),t(e.CHIP).removeClass("selected")}),n.$document.off("focusout.chips",e.CHIPS+" "+e.INPUT).on("focusout.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.removeClass("focus"),void 0!==n.data("chips")&&n.data("chips").length||n.siblings("label").removeClass("active"),n.siblings(".prefix").removeClass("active")}),n.$document.off("keydown.chips-add",e.CHIPS+" "+e.INPUT).on("keydown.chips-add",e.CHIPS+" "+e.INPUT,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=a.children(e.CHIP).length;if(13===i.which){if(n.hasAutocomplete&&a.find(".autocomplete-content.dropdown-content").length&&a.find(".autocomplete-content.dropdown-content").children().length)return;return i.preventDefault(),n.addChip({tag:o.val()},a),void o.val("")}if((8===i.keyCode||37===i.keyCode)&&""===o.val()&&r)return i.preventDefault(),n.selectChip(r-1,a),void o.blur()}),n.$document.off("click.chips-delete",e.CHIPS+" "+e.DELETE).on("click.chips-delete",e.CHIPS+" "+e.DELETE,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=o.closest(e.CHIP);i.stopPropagation(),n.deleteChip(r.index(),a),a.find("input").focus()})},this.chips=function(e,i){e.empty(),e.data("chips").forEach(function(t){e.append(n.renderChip(t))}),e.append(t('')),n.setPlaceholder(e);var a=e.next("label");a.length&&(a.attr("for",i),void 0!==e.data("chips")&&e.data("chips").length&&a.addClass("active"));var r=t("#"+i);n.hasAutocomplete&&(o.autocompleteOptions.onAutocomplete=function(t){n.addChip({tag:t},e),r.val(""),r.focus()},r.autocomplete(o.autocompleteOptions))},this.renderChip=function(e){if(e.tag){var i=t('');return i.text(e.tag),e.image&&i.prepend(t("
").attr("src",e.image)),i.append(t('close')),i}},this.setPlaceholder=function(t){void 0!==t.data("chips")&&!t.data("chips").length&&o.placeholder?t.find("input").prop("placeholder",o.placeholder):(void 0===t.data("chips")||t.data("chips").length)&&o.secondaryPlaceholder&&t.find("input").prop("placeholder",o.secondaryPlaceholder)},this.isValid=function(t,e){for(var i=t.data("chips"),n=!1,o=0;o=o&&!t(this).hasClass("pinned")&&(i(t(this)),t(this).css("top",e.offset),t(this).addClass("pinned")),oe.bottom&&!t(this).hasClass("pin-bottom")&&(i(t(this)),t(this).addClass("pin-bottom"),t(this).css("top",e.bottom-r))})}var o=Materialize.guid(),a=t(this),r=t(this).offset().top;t(this).data("pushpin-id",o),n(a,t(window).scrollTop()),t(window).on("scroll."+o,function(){var i=t(window).scrollTop()+e.offset;n(a,i)})}))}}(jQuery),function(t){t(document).ready(function(){t.fn.reverse=[].reverse,t(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(i){var n=t(this);e(n)}),t(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(e){var n=t(this);i(n)}),t(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(n){var o=t(this).parent();o.hasClass("active")?i(o):e(o)}),t(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(e){var i=t(this).parent();n(i)})}),t.fn.extend({openFAB:function(){e(t(this))},closeFAB:function(){i(t(this))},openToolbar:function(){n(t(this))},closeToolbar:function(){o(t(this))}});var e=function(e){var i=e;if(!1===i.hasClass("active")){var n,o;!0===i.hasClass("horizontal")?o=40:n=40,i.addClass("active"),i.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:n+"px",translateX:o+"px"},{duration:0});var a=0;i.find("ul .btn-floating").reverse().each(function(){t(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:a}),a+=40})}},i=function(t){var e,i,n=t;!0===n.hasClass("horizontal")?i=40:e=40,n.removeClass("active");n.find("ul .btn-floating").velocity("stop",!0),n.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:e+"px",translateX:i+"px"},{duration:80})},n=function(e){if("true"!==e.attr("data-open")){var i,n,a,r=window.innerWidth,s=window.innerHeight,l=e[0].getBoundingClientRect(),c=e.find("> a").first(),u=e.find("> ul").first(),d=t(''),p=c.css("background-color");c.append(d),i=l.left-r/2+l.width/2,n=s-l.bottom,a=r/d.width(),e.attr("data-origin-bottom",l.bottom),e.attr("data-origin-left",l.left),e.attr("data-origin-width",l.width),e.addClass("active"),e.attr("data-open",!0),e.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+i+"px)",transition:"none"}),c.css({transform:"translateY("+-n+"px)",transition:"none"}),d.css({"background-color":p}),setTimeout(function(){e.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),c.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){e.css({overflow:"hidden","background-color":p}),d.css({transform:"scale("+a+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),u.find("> li > a").css({opacity:1}),t(window).on("scroll.fabToolbarClose",function(){o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose")}),t(document).on("click.fabToolbarClose",function(i){t(i.target).closest(u).length||(o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose"))})},100)},0)}},o=function(t){if("true"===t.attr("data-open")){var e,i,n=window.innerWidth,o=window.innerHeight,a=t.attr("data-origin-width"),r=t.attr("data-origin-bottom"),s=t.attr("data-origin-left"),l=t.find("> .btn-floating").first(),c=t.find("> ul").first(),u=t.find(".fab-backdrop"),d=l.css("background-color");e=s-n/2+a/2,i=o-r,n/u.width(),t.removeClass("active"),t.attr("data-open",!1),t.css({"background-color":"transparent",transition:"none"}),l.css({transition:"none"}),u.css({transform:"scale(0)","background-color":d}),c.find("> li > a").css({opacity:""}),setTimeout(function(){u.remove(),t.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-e+"px,0,0)"}),l.css({overflow:"",transform:"translate3d(0,"+i+"px,0)"}),setTimeout(function(){t.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),l.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(t){Materialize.fadeInImage=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}i.css({opacity:0}),t(i).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),t(i).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(e,i){i.start=100;var n=e/100,o=150-(100-e)/1.75;o<100&&(o=100),e>=0&&t(this).css({"-webkit-filter":"grayscale("+n+")brightness("+o+"%)",filter:"grayscale("+n+")brightness("+o+"%)"})}})},Materialize.showStaggeredList=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}var n=0;i.find("li").velocity({translateX:"-100px"},{duration:0}),i.find("li").each(function(){t(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:n,easing:[60,10]}),n+=120})},t(document).ready(function(){var e=!1,i=!1;t(".dismissable").each(function(){t(this).hammer({prevent_default:!1}).on("pan",function(n){if("touch"===n.gesture.pointerType){var o=t(this),a=n.gesture.direction,r=n.gesture.deltaX,s=n.gesture.velocityX;o.velocity({translateX:r},{duration:50,queue:!1,easing:"easeOutQuad"}),4===a&&(r>o.innerWidth()/2||s<-.75)&&(e=!0),2===a&&(r<-1*o.innerWidth()/2||s>.75)&&(i=!0)}}).on("panend",function(n){if(Math.abs(n.gesture.deltaX)s.getBoundingClientRect().top+window.pageYOffset+a&&!0!==n.done&&("function"==typeof r?r.call(this,s):"string"==typeof r&&new Function(r)(s),n.done=!0)}},n=Materialize.throttle(function(){i()},t.throttle||100);e||(window.addEventListener("scroll",n),window.addEventListener("resize",n),e=!0),setTimeout(n,0)}}(jQuery),function(t){Materialize.Picker=t(jQuery)}(function(t){function e(a,s,u,d){function p(){return e._.node("div",e._.node("div",e._.node("div",e._.node("div",T.component.nodes(b.open),k.box),k.wrap),k.frame),k.holder)}function h(){x.data(s,T).addClass(k.input).attr("tabindex",-1).val(x.data("value")?T.get("select",w.format):a.value),w.editable||x.on("focus."+b.id+" click."+b.id,function(t){t.preventDefault(),T.$root.eq(0).focus()}).on("keydown."+b.id,m),o(a,{haspopup:!0,expanded:!1,readonly:!1,owns:a.id+"_root"})}function f(){T.$root.on({keydown:m,focusin:function(t){T.$root.removeClass(k.focused),t.stopPropagation()},"mousedown click":function(e){var i=e.target;i!=T.$root.children()[0]&&(e.stopPropagation(),"mousedown"!=e.type||t(i).is("input, select, textarea, button, option")||(e.preventDefault(),T.$root.eq(0).focus()))}}).on({focus:function(){x.addClass(k.target)},blur:function(){x.removeClass(k.target)}}).on("focus.toOpen",g).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var e=t(this),i=e.data(),n=e.hasClass(k.navDisabled)||e.hasClass(k.disabled),o=r();o=o&&(o.type||o.href)&&o,(n||o&&!t.contains(T.$root[0],o))&&T.$root.eq(0).focus(),!n&&i.nav?T.set("highlight",T.component.item.highlight,{nav:i.nav}):!n&&"pick"in i?(T.set("select",i.pick),w.closeOnSelect&&T.close(!0)):i.clear?(T.clear(),w.closeOnSelect&&T.close(!0)):i.close&&T.close(!0)}),o(T.$root[0],"hidden",!0)}function v(){var e;!0===w.hiddenName?(e=a.name,a.name=""):e=(e=["string"==typeof w.hiddenPrefix?w.hiddenPrefix:"","string"==typeof w.hiddenSuffix?w.hiddenSuffix:"_submit"])[0]+a.name+e[1],T._hidden=t('")[0],x.on("change."+b.id,function(){T._hidden.value=a.value?T.get("select",w.formatSubmit):""}),w.container?t(w.container).append(T._hidden):x.before(T._hidden)}function m(t){var e=t.keyCode,i=/^(8|46)$/.test(e);if(27==e)return T.close(),!1;(32==e||i||!b.open&&T.component.key[e])&&(t.preventDefault(),t.stopPropagation(),i?T.clear().close():T.open())}function g(t){t.stopPropagation(),"focus"==t.type&&T.$root.addClass(k.focused),T.open()}if(!a)return e;var y=!1,b={id:a.id||"P"+Math.abs(~~(Math.random()*new Date))},w=u?t.extend(!0,{},u.defaults,d):d||{},k=t.extend({},e.klasses(),w.klass),x=t(a),C=function(){return this.start()},T=C.prototype={constructor:C,$node:x,start:function(){return b&&b.start?T:(b.methods={},b.start=!0,b.open=!1,b.type=a.type,a.autofocus=a==r(),a.readOnly=!w.editable,a.id=a.id||b.id,"text"!=a.type&&(a.type="text"),T.component=new u(T,w),T.$root=t(e._.node("div",p(),k.picker,'id="'+a.id+'_root" tabindex="0"')),f(),w.formatSubmit&&v(),h(),w.container?t(w.container).append(T.$root):x.before(T.$root),T.on({start:T.component.onStart,render:T.component.onRender,stop:T.component.onStop,open:T.component.onOpen,close:T.component.onClose,set:T.component.onSet}).on({start:w.onStart,render:w.onRender,stop:w.onStop,open:w.onOpen,close:w.onClose,set:w.onSet}),y=i(T.$root.children()[0]),a.autofocus&&T.open(),T.trigger("start").trigger("render"))},render:function(t){return t?T.$root.html(p()):T.$root.find("."+k.box).html(T.component.nodes(b.open)),T.trigger("render")},stop:function(){return b.start?(T.close(),T._hidden&&T._hidden.parentNode.removeChild(T._hidden),T.$root.remove(),x.removeClass(k.input).removeData(s),setTimeout(function(){x.off("."+b.id)},0),a.type=b.type,a.readOnly=!1,T.trigger("stop"),b.methods={},b.start=!1,T):T},open:function(i){return b.open?T:(x.addClass(k.active),o(a,"expanded",!0),setTimeout(function(){T.$root.addClass(k.opened),o(T.$root[0],"hidden",!1)},0),!1!==i&&(b.open=!0,y&&c.css("overflow","hidden").css("padding-right","+="+n()),T.$root.eq(0).focus(),l.on("click."+b.id+" focusin."+b.id,function(t){var e=t.target;e!=a&&e!=document&&3!=t.which&&T.close(e===T.$root.children()[0])}).on("keydown."+b.id,function(i){var n=i.keyCode,o=T.component.key[n],a=i.target;27==n?T.close(!0):a!=T.$root[0]||!o&&13!=n?t.contains(T.$root[0],a)&&13==n&&(i.preventDefault(),a.click()):(i.preventDefault(),o?e._.trigger(T.component.key.go,T,[e._.trigger(o)]):T.$root.find("."+k.highlighted).hasClass(k.disabled)||(T.set("select",T.component.item.highlight),w.closeOnSelect&&T.close(!0)))})),T.trigger("open"))},close:function(t){return t&&(T.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){T.$root.on("focus.toOpen",g)},0)),x.removeClass(k.active),o(a,"expanded",!1),setTimeout(function(){T.$root.removeClass(k.opened+" "+k.focused),o(T.$root[0],"hidden",!0)},0),b.open?(b.open=!1,y&&c.css("overflow","").css("padding-right","-="+n()),l.off("."+b.id),T.trigger("close")):T},clear:function(t){return T.set("clear",null,t)},set:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(n=r&&t.isPlainObject(i)?i:n||{},e){r||(s[e]=i);for(o in s)a=s[o],o in T.component.item&&(void 0===a&&(a=null),T.component.set(o,a,n)),"select"!=o&&"clear"!=o||x.val("clear"==o?"":T.get(o,w.format)).trigger("change");T.render()}return n.muted?T:T.trigger("set",s)},get:function(t,i){if(t=t||"value",null!=b[t])return b[t];if("valueSubmit"==t){if(T._hidden)return T._hidden.value;t="value"}if("value"==t)return a.value;if(t in T.component.item){if("string"==typeof i){var n=T.component.get(t);return n?e._.trigger(T.component.formats.toString,T.component,[i,n]):""}return T.component.get(t)}},on:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(e){r||(s[e]=i);for(o in s)a=s[o],n&&(o="_"+o),b.methods[o]=b.methods[o]||[],b.methods[o].push(a)}return T},off:function(){var t,e,i=arguments;for(t=0,namesCount=i.length;t').appendTo("body"),i=e[0].offsetWidth;e.css("overflow","scroll");var n=t('').appendTo(e)[0].offsetWidth;return e.remove(),i-n}function o(e,i,n){if(t.isPlainObject(i))for(var o in i)a(e,o,i[o]);else a(e,i,n)}function a(t,e,i){t.setAttribute(("role"==e?"":"aria-")+e,i)}function r(){try{return document.activeElement}catch(t){}}var s=t(window),l=t(document),c=t(document.documentElement);return e.klasses=function(t){return t=t||"picker",{picker:t,opened:t+"--opened",focused:t+"--focused",input:t+"__input",active:t+"__input--active",target:t+"__input--target",holder:t+"__holder",frame:t+"__frame",wrap:t+"__wrap",box:t+"__box"}},e._={group:function(t){for(var i,n="",o=e._.trigger(t.min,t);o<=e._.trigger(t.max,t,[o]);o+=t.i)i=e._.trigger(t.item,t,[o]),n+=e._.node(t.node,i[0],i[1],i[2]);return n},node:function(e,i,n,o){return i?(i=t.isArray(i)?i.join(""):i,n=n?' class="'+n+'"':"",o=o?" "+o:"","<"+e+n+o+">"+i+""+e+">"):""},lead:function(t){return(t<10?"0":"")+t},trigger:function(t,e,i){return"function"==typeof t?t.apply(e,i||[]):t},digits:function(t){return/\d/.test(t[1])?2:1},isDate:function(t){return{}.toString.call(t).indexOf("Date")>-1&&this.isInteger(t.getDate())},isInteger:function(t){return{}.toString.call(t).indexOf("Number")>-1&&t%1==0},ariaAttr:function(e,i){t.isPlainObject(e)||(e={attribute:i}),i="";for(var n in e){var o=("role"==n?"":"aria-")+n;i+=null==e[n]?"":o+'="'+e[n]+'"'}return i}},e.extend=function(i,n){t.fn[i]=function(o,a){var r=this.data(i);return"picker"==o?r:r&&"string"==typeof o?e._.trigger(r[o],r,[a]):this.each(function(){t(this).data(i)||new e(this,i,n,o)})},t.fn[i].defaults=n.defaults},e}),function(t){t(Materialize.Picker,jQuery)}(function(t,e){function i(t,e){var i=this,n=t.$node[0],o=n.value,a=t.$node.data("value"),r=a||o,s=a?e.formatSubmit:e.format,l=function(){return n.currentStyle?"rtl"==n.currentStyle.direction:"rtl"==getComputedStyle(t.$root[0]).direction};i.settings=e,i.$node=t.$node,i.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},i.item={},i.item.clear=null,i.item.disable=(e.disable||[]).slice(0),i.item.enable=-function(t){return!0===t[0]?t.shift():-1}(i.item.disable),i.set("min",e.min).set("max",e.max).set("now"),r?i.set("select",r,{format:s}):i.set("select",null).set("highlight",i.item.now),i.key={40:7,38:-7,39:function(){return l()?-1:1},37:function(){return l()?1:-1},go:function(t){var e=i.item.highlight,n=new Date(e.year,e.month,e.date+t);i.set("highlight",n,{interval:t}),this.render()}},t.on("render",function(){t.$root.find("."+e.klass.selectMonth).on("change",function(){var i=this.value;i&&(t.set("highlight",[t.get("view").year,i,t.get("highlight").date]),t.$root.find("."+e.klass.selectMonth).trigger("focus"))}),t.$root.find("."+e.klass.selectYear).on("change",function(){var i=this.value;i&&(t.set("highlight",[i,t.get("view").month,t.get("highlight").date]),t.$root.find("."+e.klass.selectYear).trigger("focus"))})},1).on("open",function(){var n="";i.disabled(i.get("now"))&&(n=":not(."+e.klass.buttonToday+")"),t.$root.find("button"+n+", select").attr("disabled",!1)},1).on("close",function(){t.$root.find("button, select").attr("disabled",!0)},1)}var n=t._;i.prototype.set=function(t,e,i){var n=this,o=n.item;return null===e?("clear"==t&&(t="select"),o[t]=e,n):(o["enable"==t?"disable":"flip"==t?"enable":t]=n.queue[t].split(" ").map(function(o){return e=n[o](t,e,i)}).pop(),"select"==t?n.set("highlight",o.select,i):"highlight"==t?n.set("view",o.highlight,i):t.match(/^(flip|min|max|disable|enable)$/)&&(o.select&&n.disabled(o.select)&&n.set("select",o.select,i),o.highlight&&n.disabled(o.highlight)&&n.set("highlight",o.highlight,i)),n)},i.prototype.get=function(t){return this.item[t]},i.prototype.create=function(t,i,o){var a,r=this;return i=void 0===i?t:i,i==-1/0||i==1/0?a=i:e.isPlainObject(i)&&n.isInteger(i.pick)?i=i.obj:e.isArray(i)?(i=new Date(i[0],i[1],i[2]),i=n.isDate(i)?i:r.create().obj):i=n.isInteger(i)||n.isDate(i)?r.normalize(new Date(i),o):r.now(t,i,o),{year:a||i.getFullYear(),month:a||i.getMonth(),date:a||i.getDate(),day:a||i.getDay(),obj:a||i,pick:a||i.getTime()}},i.prototype.createRange=function(t,i){var o=this,a=function(t){return!0===t||e.isArray(t)||n.isDate(t)?o.create(t):t};return n.isInteger(t)||(t=a(t)),n.isInteger(i)||(i=a(i)),n.isInteger(t)&&e.isPlainObject(i)?t=[i.year,i.month,i.date+t]:n.isInteger(i)&&e.isPlainObject(t)&&(i=[t.year,t.month,t.date+i]),{from:a(t),to:a(i)}},i.prototype.withinRange=function(t,e){return t=this.createRange(t.from,t.to),e.pick>=t.from.pick&&e.pick<=t.to.pick},i.prototype.overlapRanges=function(t,e){var i=this;return t=i.createRange(t.from,t.to),e=i.createRange(e.from,e.to),i.withinRange(t,e.from)||i.withinRange(t,e.to)||i.withinRange(e,t.from)||i.withinRange(e,t.to)},i.prototype.now=function(t,e,i){return e=new Date,i&&i.rel&&e.setDate(e.getDate()+i.rel),this.normalize(e,i)},i.prototype.navigate=function(t,i,n){var o,a,r,s,l=e.isArray(i),c=e.isPlainObject(i),u=this.item.view;if(l||c){for(c?(a=i.year,r=i.month,s=i.date):(a=+i[0],r=+i[1],s=+i[2]),n&&n.nav&&u&&u.month!==r&&(a=u.year,r=u.month),a=(o=new Date(a,r+(n&&n.nav?n.nav:0),1)).getFullYear(),r=o.getMonth();new Date(a,r,s).getMonth()!==r;)s-=1;i=[a,r,s]}return i},i.prototype.normalize=function(t){return t.setHours(0,0,0,0),t},i.prototype.measure=function(t,e){var i=this;return e?"string"==typeof e?e=i.parse(t,e):n.isInteger(e)&&(e=i.now(t,e,{rel:e})):e="min"==t?-1/0:1/0,e},i.prototype.viewset=function(t,e){return this.create([e.year,e.month,1])},i.prototype.validate=function(t,i,o){var a,r,s,l,c=this,u=i,d=o&&o.interval?o.interval:1,p=-1===c.item.enable,h=c.item.min,f=c.item.max,v=p&&c.item.disable.filter(function(t){if(e.isArray(t)){var o=c.create(t).pick;oi.pick&&(r=!0)}return n.isInteger(t)}).length;if((!o||!o.nav)&&(!p&&c.disabled(i)||p&&c.disabled(i)&&(v||a||r)||!p&&(i.pick<=h.pick||i.pick>=f.pick)))for(p&&!v&&(!r&&d>0||!a&&d<0)&&(d*=-1);c.disabled(i)&&(Math.abs(d)>1&&(i.monthu.month)&&(i=u,d=d>0?1:-1),i.pick<=h.pick?(s=!0,d=1,i=c.create([h.year,h.month,h.date+(i.pick===h.pick?0:-1)])):i.pick>=f.pick&&(l=!0,d=-1,i=c.create([f.year,f.month,f.date+(i.pick===f.pick?0:1)])),!s||!l);)i=c.create([i.year,i.month,i.date+d]);return i},i.prototype.disabled=function(t){var i=this,o=i.item.disable.filter(function(o){return n.isInteger(o)?t.day===(i.settings.firstDay?o:o-1)%7:e.isArray(o)||n.isDate(o)?t.pick===i.create(o).pick:e.isPlainObject(o)?i.withinRange(o,t):void 0});return o=o.length&&!o.filter(function(t){return e.isArray(t)&&"inverted"==t[3]||e.isPlainObject(t)&&t.inverted}).length,-1===i.item.enable?!o:o||t.picki.item.max.pick},i.prototype.parse=function(t,e,i){var o=this,a={};return e&&"string"==typeof e?(i&&i.format||((i=i||{}).format=o.settings.format),o.formats.toArray(i.format).map(function(t){var i=o.formats[t],r=i?n.trigger(i,o,[e,a]):t.replace(/^!/,"").length;i&&(a[t]=e.substr(0,r)),e=e.substr(r)}),[a.yyyy||a.yy,+(a.mm||a.m)-1,a.dd||a.d]):e},i.prototype.formats=function(){function t(t,e,i){var n=t.match(/\w+/)[0];return i.mm||i.m||(i.m=e.indexOf(n)+1),n.length}function e(t){return t.match(/\w+/)[0].length}return{d:function(t,e){return t?n.digits(t):e.date},dd:function(t,e){return t?2:n.lead(e.date)},ddd:function(t,i){return t?e(t):this.settings.weekdaysShort[i.day]},dddd:function(t,i){return t?e(t):this.settings.weekdaysFull[i.day]},m:function(t,e){return t?n.digits(t):e.month+1},mm:function(t,e){return t?2:n.lead(e.month+1)},mmm:function(e,i){var n=this.settings.monthsShort;return e?t(e,n,i):n[i.month]},mmmm:function(e,i){var n=this.settings.monthsFull;return e?t(e,n,i):n[i.month]},yy:function(t,e){return t?2:(""+e.year).slice(2)},yyyy:function(t,e){return t?4:e.year},toArray:function(t){return t.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(t,e){var i=this;return i.formats.toArray(t).map(function(t){return n.trigger(i.formats[t],i,[0,e])||t.replace(/^!/,"")}).join("")}}}(),i.prototype.isDateExact=function(t,i){var o=this;return n.isInteger(t)&&n.isInteger(i)||"boolean"==typeof t&&"boolean"==typeof i?t===i:(n.isDate(t)||e.isArray(t))&&(n.isDate(i)||e.isArray(i))?o.create(t).pick===o.create(i).pick:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&(o.isDateExact(t.from,i.from)&&o.isDateExact(t.to,i.to))},i.prototype.isDateOverlap=function(t,i){var o=this,a=o.settings.firstDay?1:0;return n.isInteger(t)&&(n.isDate(i)||e.isArray(i))?(t=t%7+a)===o.create(i).day+1:n.isInteger(i)&&(n.isDate(t)||e.isArray(t))?(i=i%7+a)===o.create(t).day+1:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&o.overlapRanges(t,i)},i.prototype.flipEnable=function(t){var e=this.item;e.enable=t||(-1==e.enable?1:-1)},i.prototype.deactivate=function(t,i){var o=this,a=o.item.disable.slice(0);return"flip"==i?o.flipEnable():!1===i?(o.flipEnable(1),a=[]):!0===i?(o.flipEnable(-1),a=[]):i.map(function(t){for(var i,r=0;r=d.year&&l.month>=d.month||!t&&l.year<=u.year&&l.month<=u.month?" "+i.klass.navDisabled:""),"data-nav="+(t||-1)+" "+n.ariaAttr({role:"button",controls:e.$node[0].id+"_table"})+' title="'+(t?i.labelMonthNext:i.labelMonthPrev)+'"')},f=function(o){var a=i.showMonthsShort?i.monthsShort:i.monthsFull;return"short_months"==o&&(a=i.monthsShort),i.selectMonths&&void 0==o?n.node("select",n.group({min:0,max:11,i:1,node:"option",item:function(t){return[a[t],0,"value="+t+(l.month==t?" selected":"")+(l.year==u.year&&td.month?" disabled":"")]}}),i.klass.selectMonth+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelMonthSelect+'"'):"short_months"==o?null!=r?a[r.month]:a[l.month]:n.node("div",a[l.month],i.klass.month)},v=function(o){var a=l.year,s=!0===i.selectYears?5:~~(i.selectYears/2);if(s){var c=u.year,p=d.year,h=a-s,f=a+s;if(c>h&&(f+=c-h,h=c),pm?m:v,f=p}if(i.selectYears&&void 0==o)return n.node("select",n.group({min:h,max:f,i:1,node:"option",item:function(t){return[t,0,"value="+t+(a==t?" selected":"")]}}),i.klass.selectYear+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelYearSelect+'"')}return"raw"===o&&null!=r?n.node("div",r.year):n.node("div",a,i.klass.year)};return createDayLabel=function(){return null!=r?r.date:a.date},createWeekdayLabel=function(){var t;return t=null!=r?r.day:a.day,i.weekdaysShort[t]},n.node("div",n.node("div",v("raw"),i.klass.year_display)+n.node("span",createWeekdayLabel()+", ","picker__weekday-display")+n.node("span",f("short_months")+" ",i.klass.month_display)+n.node("span",createDayLabel(),i.klass.day_display),i.klass.date_display)+n.node("div",n.node("div",n.node("div",(i.selectYears,f()+v()+h()+h(1)),i.klass.header)+n.node("table",p+n.node("tbody",n.group({min:0,max:5,i:1,node:"tr",item:function(t){var o=i.firstDay&&0===e.create([l.year,l.month,1]).day?-7:0;return[n.group({min:7*t-l.day+o+1,max:function(){return this.min+7-1},i:1,node:"td",item:function(t){t=e.create([l.year,l.month,t+(i.firstDay?1:0)]);var o=r&&r.pick==t.pick,p=s&&s.pick==t.pick,h=c&&e.disabled(t)||t.pickd.pick,f=n.trigger(e.formats.toString,e,[i.format,t]);return[n.node("div",t.date,function(e){return e.push(l.month==t.month?i.klass.infocus:i.klass.outfocus),a.pick==t.pick&&e.push(i.klass.now),o&&e.push(i.klass.selected),p&&e.push(i.klass.highlighted),h&&e.push(i.klass.disabled),e.join(" ")}([i.klass.day]),"data-pick="+t.pick+" "+n.ariaAttr({role:"gridcell",label:f,selected:!(!o||e.$node.val()!==f)||null,activedescendant:!!p||null,disabled:!!h||null})+" "+(h?"":'tabindex="0"')),"",n.ariaAttr({role:"presentation"})]}})]}})),i.klass.table,'id="'+e.$node[0].id+'_table" '+n.ariaAttr({role:"grid",controls:e.$node[0].id,readonly:!0})),i.klass.calendar_container)+n.node("div",n.node("button",i.today,"btn-flat picker__today waves-effect","type=button data-pick="+a.pick+(t&&!e.disabled(a)?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.clear,"btn-flat picker__clear waves-effect","type=button data-clear=1"+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.close,"btn-flat picker__close waves-effect","type=button data-close=true "+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id})),i.klass.footer),"picker__container__wrapper")},i.defaults=function(t){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Ok",closeOnSelect:!1,format:"d mmmm, yyyy",klass:{table:t+"table",header:t+"header",date_display:t+"date-display",day_display:t+"day-display",month_display:t+"month-display",year_display:t+"year-display",calendar_container:t+"calendar-container",navPrev:t+"nav--prev",navNext:t+"nav--next",navDisabled:t+"nav--disabled",month:t+"month",year:t+"year",selectMonth:t+"select--month",selectYear:t+"select--year",weekdays:t+"weekday",day:t+"day",disabled:t+"day--disabled",selected:t+"day--selected",highlighted:t+"day--highlighted",now:t+"day--today",infocus:t+"day--infocus",outfocus:t+"day--outfocus",footer:t+"footer",buttonClear:t+"button--clear",buttonToday:t+"button--today",buttonClose:t+"button--close"}}}(t.klasses().picker+"__"),t.extend("pickadate",i)}),function(t){function e(t){return document.createElementNS(l,t)}function i(t){return(t<10?"0":"")+t}function n(t){var e=++m+"";return t?t+e:e}function o(o,r){function l(t,e){var i=d.offset(),n=/^touch/.test(t.type),o=i.left+g,a=i.top+g,l=(n?t.originalEvent.touches[0]:t).pageX-o,c=(n?t.originalEvent.touches[0]:t).pageY-a,u=Math.sqrt(l*l+c*c),p=!1;if(!e||!(uy+w)){t.preventDefault();var v=setTimeout(function(){E.popover.addClass("clockpicker-moving")},200);E.setHand(l,c,!e,!0),s.off(h).on(h,function(t){t.preventDefault();var e=/^touch/.test(t.type),i=(e?t.originalEvent.touches[0]:t).pageX-o,n=(e?t.originalEvent.touches[0]:t).pageY-a;(p||i!==l||n!==c)&&(p=!0,E.setHand(i,n,!1,!0))}),s.off(f).on(f,function(t){s.off(f),t.preventDefault();var i=/^touch/.test(t.type),n=(i?t.originalEvent.changedTouches[0]:t).pageX-o,u=(i?t.originalEvent.changedTouches[0]:t).pageY-a;(e||p)&&n===l&&u===c&&E.setHand(n,u),"hours"===E.currentView?E.toggleView("minutes",x/2):r.autoclose&&(E.minutesView.addClass("clockpicker-dial-out"),setTimeout(function(){E.done()},x/2)),d.prepend(z),clearTimeout(v),E.popover.removeClass("clockpicker-moving"),s.off(h)})}}var u=t(C),d=u.find(".clockpicker-plate"),v=u.find(".picker__holder"),m=u.find(".clockpicker-hours"),T=u.find(".clockpicker-minutes"),S=u.find(".clockpicker-am-pm-block"),P="INPUT"===o.prop("tagName"),A=P?o:o.find("input"),O=t("label[for="+A.attr("id")+"]"),E=this;this.id=n("cp"),this.element=o,this.holder=v,this.options=r,this.isAppended=!1,this.isShown=!1,this.currentView="hours",this.isInput=P,this.input=A,this.label=O,this.popover=u,this.plate=d,this.hoursView=m,this.minutesView=T,this.amPmBlock=S,this.spanHours=u.find(".clockpicker-span-hours"),this.spanMinutes=u.find(".clockpicker-span-minutes"),this.spanAmPm=u.find(".clockpicker-span-am-pm"),this.footer=u.find(".picker__footer"),this.amOrPm="PM",r.twelvehour&&(r.ampmclickable?(this.spanAmPm.empty(),t('AM
').on("click",function(){E.spanAmPm.children("#click-am").addClass("text-primary"),E.spanAmPm.children("#click-pm").removeClass("text-primary"),E.amOrPm="AM"}).appendTo(this.spanAmPm),t('PM
').on("click",function(){E.spanAmPm.children("#click-pm").addClass("text-primary"),E.spanAmPm.children("#click-am").removeClass("text-primary"),E.amOrPm="PM"}).appendTo(this.spanAmPm)):(this.spanAmPm.empty(),t('AM
').appendTo(this.spanAmPm),t('PM
').appendTo(this.spanAmPm))),t('").click(t.proxy(this.clear,this)).appendTo(this.footer),t('").click(t.proxy(this.hide,this)).appendTo(this.footer),t('").click(t.proxy(this.done,this)).appendTo(this.footer),this.spanHours.click(t.proxy(this.toggleView,this,"hours")),this.spanMinutes.click(t.proxy(this.toggleView,this,"minutes")),A.on("focus.clockpicker click.clockpicker",t.proxy(this.show,this));var _,M,I,D,q=t('');if(r.twelvehour)for(_=1;_<13;_+=1)M=q.clone(),I=_/6*Math.PI,D=y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);else for(_=0;_<24;_+=1)M=q.clone(),I=_/6*Math.PI,D=_>0&&_<13?b:y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);for(_=0;_<60;_+=5)M=q.clone(),I=_/30*Math.PI,M.css({left:g+Math.sin(I)*y-w,top:g-Math.cos(I)*y-w}),M.html(i(_)),T.append(M),M.on(p,l);if(d.on(p,function(e){0===t(e.target).closest(".clockpicker-tick").length&&l(e,!0)}),c){var z=u.find(".clockpicker-canvas"),V=e("svg");V.setAttribute("class","clockpicker-svg"),V.setAttribute("width",k),V.setAttribute("height",k);var H=e("g");H.setAttribute("transform","translate("+g+","+g+")");var L=e("circle");L.setAttribute("class","clockpicker-canvas-bearing"),L.setAttribute("cx",0),L.setAttribute("cy",0),L.setAttribute("r",4);var j=e("line");j.setAttribute("x1",0),j.setAttribute("y1",0);var $=e("circle");$.setAttribute("class","clockpicker-canvas-bg"),$.setAttribute("r",w),H.appendChild(j),H.appendChild($),H.appendChild(L),V.appendChild(H),z.append(V),this.hand=j,this.bg=$,this.bearing=L,this.g=H,this.canvas=z}a(this.options.init)}function a(t){t&&"function"==typeof t&&t()}var r=t(window),s=t(document),l="http://www.w3.org/2000/svg",c="SVGAngle"in window&&function(){var t,e=document.createElement("div");return e.innerHTML="",t=(e.firstChild&&e.firstChild.namespaceURI)==l,e.innerHTML="",t}(),u=function(){var t=document.createElement("div").style;return"transition"in t||"WebkitTransition"in t||"MozTransition"in t||"msTransition"in t||"OTransition"in t}(),d="ontouchstart"in window,p="mousedown"+(d?" touchstart":""),h="mousemove.clockpicker"+(d?" touchmove.clockpicker":""),f="mouseup.clockpicker"+(d?" touchend.clockpicker":""),v=navigator.vibrate?"vibrate":navigator.webkitVibrate?"webkitVibrate":null,m=0,g=135,y=105,b=70,w=20,k=2*g,x=u?350:1,C=['"].join("");o.DEFAULTS={default:"",fromnow:0,donetext:"Ok",cleartext:"Clear",canceltext:"Cancel",autoclose:!1,ampmclickable:!0,darktheme:!1,twelvehour:!0,vibrate:!0},o.prototype.toggle=function(){this[this.isShown?"hide":"show"]()},o.prototype.locate=function(){var t=this.element,e=this.popover;t.offset(),t.outerWidth(),t.outerHeight(),this.options.align;e.show()},o.prototype.show=function(e){if(!this.isShown){a(this.options.beforeShow),t(":input").each(function(){t(this).attr("tabindex",-1)});var n=this;this.input.blur(),this.popover.addClass("picker--opened"),this.input.addClass("picker__input picker__input--active"),t(document.body).css("overflow","hidden");var o=((this.input.prop("value")||this.options.default||"")+"").split(":");if(this.options.twelvehour&&void 0!==o[1]&&(o[1].indexOf("AM")>0?this.amOrPm="AM":this.amOrPm="PM",o[1]=o[1].replace("AM","").replace("PM","")),"now"===o[0]){var l=new Date(+new Date+this.options.fromnow);o=[l.getHours(),l.getMinutes()],this.options.twelvehour&&(this.amOrPm=o[0]>=12&&o[0]<24?"PM":"AM")}if(this.hours=+o[0]||0,this.minutes=+o[1]||0,this.spanHours.html(this.hours),this.spanMinutes.html(i(this.minutes)),!this.isAppended){var c=document.querySelector(this.options.container);this.options.container&&c?c.appendChild(this.popover[0]):this.popover.insertAfter(this.input),this.options.twelvehour&&("PM"===this.amOrPm?(this.spanAmPm.children("#click-pm").addClass("text-primary"),this.spanAmPm.children("#click-am").removeClass("text-primary")):(this.spanAmPm.children("#click-am").addClass("text-primary"),this.spanAmPm.children("#click-pm").removeClass("text-primary"))),r.on("resize.clockpicker"+this.id,function(){n.isShown&&n.locate()}),this.isAppended=!0}this.toggleView("hours"),this.locate(),this.isShown=!0,s.on("click.clockpicker."+this.id+" focusin.clockpicker."+this.id,function(e){var i=t(e.target);0===i.closest(n.popover.find(".picker__wrap")).length&&0===i.closest(n.input).length&&n.hide()}),s.on("keyup.clockpicker."+this.id,function(t){27===t.keyCode&&n.hide()}),a(this.options.afterShow)}},o.prototype.hide=function(){a(this.options.beforeHide),this.input.removeClass("picker__input picker__input--active"),this.popover.removeClass("picker--opened"),t(document.body).css("overflow","visible"),this.isShown=!1,t(":input").each(function(e){t(this).attr("tabindex",e+1)}),s.off("click.clockpicker."+this.id+" focusin.clockpicker."+this.id),s.off("keyup.clockpicker."+this.id),this.popover.hide(),a(this.options.afterHide)},o.prototype.toggleView=function(e,i){var n=!1;"minutes"===e&&"visible"===t(this.hoursView).css("visibility")&&(a(this.options.beforeHourSelect),n=!0);var o="hours"===e,r=o?this.hoursView:this.minutesView,s=o?this.minutesView:this.hoursView;this.currentView=e,this.spanHours.toggleClass("text-primary",o),this.spanMinutes.toggleClass("text-primary",!o),s.addClass("clockpicker-dial-out"),r.css("visibility","visible").removeClass("clockpicker-dial-out"),this.resetClock(i),clearTimeout(this.toggleViewTimer),this.toggleViewTimer=setTimeout(function(){s.css("visibility","hidden")},x),n&&a(this.options.afterHourSelect)},o.prototype.resetClock=function(t){var e=this.currentView,i=this[e],n="hours"===e,o=i*(Math.PI/(n?6:30)),a=n&&i>0&&i<13?b:y,r=Math.sin(o)*a,s=-Math.cos(o)*a,l=this;c&&t?(l.canvas.addClass("clockpicker-canvas-out"),setTimeout(function(){l.canvas.removeClass("clockpicker-canvas-out"),l.setHand(r,s)},t)):this.setHand(r,s)},o.prototype.setHand=function(e,n,o,a){var r,s=Math.atan2(e,-n),l="hours"===this.currentView,u=Math.PI/(l||o?6:30),d=Math.sqrt(e*e+n*n),p=this.options,h=l&&d<(y+b)/2,f=h?b:y;if(p.twelvehour&&(f=y),s<0&&(s=2*Math.PI+s),r=Math.round(s/u),s=r*u,p.twelvehour?l?0===r&&(r=12):(o&&(r*=5),60===r&&(r=0)):l?(12===r&&(r=0),r=h?0===r?12:r:0===r?0:r+12):(o&&(r*=5),60===r&&(r=0)),this[this.currentView]!==r&&v&&this.options.vibrate&&(this.vibrateTimer||(navigator[v](10),this.vibrateTimer=setTimeout(t.proxy(function(){this.vibrateTimer=null},this),100))),this[this.currentView]=r,l?this.spanHours.html(r):this.spanMinutes.html(i(r)),c){var m=Math.sin(s)*(f-w),g=-Math.cos(s)*(f-w),k=Math.sin(s)*f,x=-Math.cos(s)*f;this.hand.setAttribute("x2",m),this.hand.setAttribute("y2",g),this.bg.setAttribute("cx",k),this.bg.setAttribute("cy",x)}else this[l?"hoursView":"minutesView"].find(".clockpicker-tick").each(function(){var e=t(this);e.toggleClass("active",r===+e.html())})},o.prototype.done=function(){a(this.options.beforeDone),this.hide(),this.label.addClass("active");var t=this.input.prop("value"),e=i(this.hours)+":"+i(this.minutes);this.options.twelvehour&&(e+=this.amOrPm),this.input.prop("value",e),e!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur"),a(this.options.afterDone)},o.prototype.clear=function(){this.hide(),this.label.removeClass("active");var t=this.input.prop("value");this.input.prop("value",""),""!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur")},o.prototype.remove=function(){this.element.removeData("clockpicker"),this.input.off("focus.clockpicker click.clockpicker"),this.isShown&&this.hide(),this.isAppended&&(r.off("resize.clockpicker"+this.id),this.popover.remove())},t.fn.pickatime=function(e){var i=Array.prototype.slice.call(arguments,1);return this.each(function(){var n=t(this),a=n.data("clockpicker");if(a)"function"==typeof a[e]&&a[e].apply(a,i);else{var r=t.extend({},o.DEFAULTS,n.data(),"object"==typeof e&&e);n.data("clockpicker",new o(n,r))}})}}(jQuery),function(t){function e(){var e=+t(this).attr("data-length"),i=+t(this).val().length,n=i<=e;t(this).parent().find('span[class="character-counter"]').html(i+"/"+e),o(n,t(this))}function i(e){var i=e.parent().find('span[class="character-counter"]');i.length||(i=t("").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),e.parent().append(i))}function n(){t(this).parent().find('span[class="character-counter"]').html("")}function o(t,e){var i=e.hasClass("invalid");t&&i?e.removeClass("invalid"):t||i||(e.removeClass("valid"),e.addClass("invalid"))}t.fn.characterCounter=function(){return this.each(function(){var o=t(this);o.parent().find('span[class="character-counter"]').length||void 0!==o.attr("data-length")&&(o.on("input",e),o.on("focus",e),o.on("blur",n),i(o))})},t(document).ready(function(){t("input, textarea").characterCounter()})}(jQuery),function(t){var e={init:function(e){var i={duration:200,dist:-100,shift:0,padding:0,fullWidth:!1,indicators:!1,noWrap:!1,onCycleTo:null};e=t.extend(i,e);var n=Materialize.objectSelectorString(t(this));return this.each(function(i){function o(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}function a(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientY:t.clientY}function r(t){return t>=C?t%C:t<0?r(C+t%C):t}function s(i){E=!0,j.hasClass("scrolling")||j.addClass("scrolling"),null!=H&&window.clearTimeout(H),H=window.setTimeout(function(){E=!1,j.removeClass("scrolling")},e.duration);var n,o,a,s,l,c,u,d=w;if(b="number"==typeof i?i:b,w=Math.floor((b+x/2)/x),a=b-w*x,s=a<0?1:-1,l=-s*a*2/x,o=C>>1,e.fullWidth?u="translateX(0)":(u="translateX("+(j[0].clientWidth-m)/2+"px) ",u+="translateY("+(j[0].clientHeight-g)/2+"px)"),N){var p=w%C,h=V.find(".indicator-item.active");h.index()!==p&&(h.removeClass("active"),V.find(".indicator-item").eq(p).addClass("active"))}for((!W||w>=0&&w0?1-l:1):(zTranslation=e.dist*(2*n-l*s),tweenedOpacity=1-.2*(2*n-l*s)),(!W||w-n>=0)&&((c=v[r(w-n)]).style[_]=u+" translateX("+(-e.shift+(-x*n-a)/2)+"px) translateZ("+zTranslation+"px)",c.style.zIndex=-n,c.style.opacity=tweenedOpacity,c.style.display="block");if((!W||w>=0&&w2||i<-2?(s(A-i),requestAnimationFrame(c)):s(A))}function u(i){if(q)return i.preventDefault(),i.stopPropagation(),!1;if(!e.fullWidth){var n=t(i.target).closest(".carousel-item").index();0!==r(w)-n&&(i.preventDefault(),i.stopPropagation()),d(n)}}function d(t){var e=w%C-t;W||(e<0?Math.abs(e+C)0&&Math.abs(e-C)0&&j.trigger("carouselPrev",[e])}function p(e){"mousedown"===e.type&&t(e.target).is("img")&&e.preventDefault(),k=!0,q=!1,z=!1,T=o(e),S=a(e),O=P=0,M=b,I=Date.now(),clearInterval(D),D=setInterval(l,100)}function h(t){var e,i;if(k)if(e=o(t),y=a(t),i=T-e,Math.abs(S-y)<30&&!z)(i>2||i<-2)&&(q=!0,T=e,s(b+i));else{if(q)return t.preventDefault(),t.stopPropagation(),!1;z=!0}if(q)return t.preventDefault(),t.stopPropagation(),!1}function f(t){if(k)return k=!1,clearInterval(D),A=b,(O>10||O<-10)&&(A=b+(P=.9*O)),A=Math.round(A/x)*x,W&&(A>=x*(C-1)?A=x*(C-1):A<0&&(A=0)),P=A-b,I=Date.now(),requestAnimationFrame(c),q&&(t.preventDefault(),t.stopPropagation()),!1}var v,m,g,b,w,k,x,C,T,S,P,A,O,E,_,M,I,D,q,z,V=t(''),H=null,L=null,j=t(this),$=j.find(".carousel-item").length>1,N=(j.attr("data-indicators")||e.indicators)&&$,W=j.attr("data-no-wrap")||e.noWrap||!$,F=j.attr("data-namespace")||n+i;j.attr("data-namespace",F);var Q=function(e){var i=j.find(".carousel-item.active").length?j.find(".carousel-item.active").first():j.find(".carousel-item").first(),n=i.find("img").first();if(n.length)if(n[0].complete)if(n.height()>0)j.css("height",n.height());else{var o=n[0].naturalWidth,a=n[0].naturalHeight,r=j.width()/o*a;j.css("height",r)}else n.on("load",function(){j.css("height",t(this).height())});else if(!e){var s=i.height();j.css("height",s)}};if(e.fullWidth&&(e.dist=0,Q(),N&&j.find(".carousel-fixed-item").addClass("with-indicators")),j.hasClass("initialized"))return t(window).trigger("resize"),j.trigger("carouselNext",[1e-6]),!0;j.addClass("initialized"),k=!1,b=A=0,v=[],m=j.find(".carousel-item").first().innerWidth(),g=j.find(".carousel-item").first().innerHeight(),x=2*m+e.padding,j.find(".carousel-item").each(function(e){if(v.push(t(this)[0]),N){var i=t('');0===e&&i.addClass("active"),i.click(function(e){e.stopPropagation(),d(t(this).index())}),V.append(i)}}),N&&j.append(V),C=v.length,_="transform",["webkit","Moz","O","ms"].every(function(t){var e=t+"Transform";return void 0===document.body.style[e]||(_=e,!1)});var X=Materialize.throttle(function(){if(e.fullWidth){m=j.find(".carousel-item").first().innerWidth();j.find(".carousel-item.active").height();x=2*m+e.padding,A=b=2*w*m,Q(!0)}else s()},200);t(window).off("resize.carousel-"+F).on("resize.carousel-"+F,X),void 0!==window.ontouchstart&&(j.on("touchstart.carousel",p),j.on("touchmove.carousel",h),j.on("touchend.carousel",f)),j.on("mousedown.carousel",p),j.on("mousemove.carousel",h),j.on("mouseup.carousel",f),j.on("mouseleave.carousel",f),j.on("click.carousel",u),s(b),t(this).on("carouselNext",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)+x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselPrev",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)-x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselSet",function(t,e,i){void 0===e&&(e=0),"function"==typeof i&&(L=i),d(e)})})},next:function(e,i){t(this).trigger("carouselNext",[e,i])},prev:function(e,i){t(this).trigger("carouselPrev",[e,i])},set:function(e,i){t(this).trigger("carouselSet",[e,i])},destroy:function(){var e=t(this).attr("data-namespace");t(this).removeAttr("data-namespace"),t(this).removeClass("initialized"),t(this).find(".indicators").remove(),t(this).off("carouselNext carouselPrev carouselSet"),t(window).off("resize.carousel-"+e),void 0!==window.ontouchstart&&t(this).off("touchstart.carousel touchmove.carousel touchend.carousel"),t(this).off("mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel")}};t.fn.carousel=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.carousel"):e.init.apply(this,arguments)}}(jQuery),function(t){var e={init:function(e){return this.each(function(){var i=t("#"+t(this).attr("data-activates")),n=(t("body"),t(this)),o=n.parent(".tap-target-wrapper"),a=o.find(".tap-target-wave"),r=o.find(".tap-target-origin"),s=n.find(".tap-target-content");o.length||(o=n.wrap(t('')).parent()),s.length||(s=t(''),n.append(s)),a.length||(a=t(''),r.length||((r=i.clone(!0,!0)).addClass("tap-target-origin"),r.removeAttr("id"),r.removeAttr("style"),a.append(r)),o.append(a));var l=function(){o.is(".open")&&(o.removeClass("open"),r.off("click.tapTarget"),t(document).off("click.tapTarget"),t(window).off("resize.tapTarget"))},c=function(){var e="fixed"===i.css("position");if(!e)for(var r=i.parents(),l=0;lv,b=d<=m,w=d>m,k=p>=.25*h&&p<=.75*h,x=n.outerWidth(),C=n.outerHeight(),T=d+u/2-C/2,S=p+c/2-x/2,P=e?"fixed":"absolute",A=k?x:x/2+c,O=C/2,E=b?C/2:0,_=g&&!k?x/2-c:0,M=c,I=w?"bottom":"top",D=2*c,q=D,z=C/2-q/2,V=x/2-D/2,H={};H.top=b?T:"",H.right=y?h-S-x:"",H.bottom=w?f-T-C:"",H.left=g?S:"",H.position=P,o.css(H),s.css({width:A,height:O,top:E,right:0,bottom:0,left:_,padding:M,verticalAlign:I}),a.css({top:z,left:V,width:D,height:q})};"open"==e&&(c(),o.is(".open")||(o.addClass("open"),setTimeout(function(){r.off("click.tapTarget").on("click.tapTarget",function(t){l(),r.off("click.tapTarget")}),t(document).off("click.tapTarget").on("click.tapTarget",function(e){l(),t(document).off("click.tapTarget")});var e=Materialize.throttle(function(){c()},200);t(window).off("resize.tapTarget").on("resize.tapTarget",e)},0))),"close"==e&&l()})},open:function(){},close:function(){}};t.fn.tapTarget=function(i){if(e[i]||"object"==typeof i)return e.init.apply(this,arguments);t.error("Method "+i+" does not exist on jQuery.tap-target")}}(jQuery);
\ No newline at end of file
diff --git a/static/timeago.js b/static/js/timeago.js
similarity index 100%
rename from static/timeago.js
rename to static/js/timeago.js
diff --git a/templates/activity.html b/templates/activity.html
deleted file mode 100644
index dceb87d5..00000000
--- a/templates/activity.html
+++ /dev/null
@@ -1,41 +0,0 @@
-
-
-
-
- Community Activity
-
-
-
-
-
- Community Activity
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
diff --git a/templates/index.html b/templates/index.html
index 4f2c5ca0..25130350 100644
--- a/templates/index.html
+++ b/templates/index.html
@@ -1,7 +1,124 @@
-Community website
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+