diff --git a/.gitignore b/.gitignore
new file mode 100644
index 0000000..fadc7c1
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1,2 @@
+/vendor
+.env
diff --git a/app/Console/Commands/.gitkeep b/app/Console/Commands/.gitkeep
new file mode 100644
index 0000000..e69de29
diff --git a/app/Console/Kernel.php b/app/Console/Kernel.php
new file mode 100644
index 0000000..ad6e311
--- /dev/null
+++ b/app/Console/Kernel.php
@@ -0,0 +1,29 @@
+<?php
+
+namespace App\Console;
+
+use Illuminate\Console\Scheduling\Schedule;
+use Laravel\Lumen\Console\Kernel as ConsoleKernel;
+
+class Kernel extends ConsoleKernel
+{
+    /**
+     * The Artisan commands provided by your application.
+     *
+     * @var array
+     */
+    protected $commands = [
+        //
+    ];
+
+    /**
+     * Define the application's command schedule.
+     *
+     * @param  \Illuminate\Console\Scheduling\Schedule  $schedule
+     * @return void
+     */
+    protected function schedule(Schedule $schedule)
+    {
+        //
+    }
+}
diff --git a/app/Events/Event.php b/app/Events/Event.php
new file mode 100644
index 0000000..b8230f0
--- /dev/null
+++ b/app/Events/Event.php
@@ -0,0 +1,10 @@
+<?php
+
+namespace App\Events;
+
+use Illuminate\Queue\SerializesModels;
+
+abstract class Event
+{
+    use SerializesModels;
+}
diff --git a/app/Events/ExampleEvent.php b/app/Events/ExampleEvent.php
new file mode 100644
index 0000000..4bd1268
--- /dev/null
+++ b/app/Events/ExampleEvent.php
@@ -0,0 +1,16 @@
+<?php
+
+namespace App\Events;
+
+class ExampleEvent extends Event
+{
+    /**
+     * Create a new event instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        //
+    }
+}
diff --git a/app/Exceptions/Handler.php b/app/Exceptions/Handler.php
new file mode 100644
index 0000000..57dd402
--- /dev/null
+++ b/app/Exceptions/Handler.php
@@ -0,0 +1,49 @@
+<?php
+
+namespace App\Exceptions;
+
+use Exception;
+use Illuminate\Http\JsonResponse;
+use Illuminate\Validation\ValidationException;
+use Illuminate\Auth\Access\AuthorizationException;
+use Illuminate\Database\Eloquent\ModelNotFoundException;
+use Symfony\Component\HttpKernel\Exception\HttpException;
+use Laravel\Lumen\Exceptions\Handler as ExceptionHandler;
+
+class Handler extends ExceptionHandler
+{
+    /**
+     * Report or log an exception.
+     *
+     * This is a great spot to send exceptions to Sentry, Bugsnag, etc.
+     *
+     * @param  \Exception  $e
+     * @return void
+     */
+    public function report(Exception $e)
+    {
+        parent::report($e);
+    }
+
+    /**
+     * Render an exception into an HTTP response.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \Exception  $e
+     * @return \Illuminate\Http\Response
+     */
+    public function render($request, Exception $e) {
+ 		if($request->wantsJson() && !($e instanceof ValidationException)) {
+			if(is_object($e)) {
+				$e = substr(strrchr(get_class($e), "\\"), 1);
+			}
+
+    		return response()->json([
+				'code' => method_exists($e, 'getStatusCode') ? $e->getStatusCode() : 500, 
+				'message' => empty($e) ? 'Server error' : $e 
+			]);
+		}
+
+ 		return parent::render($request, $e);
+	} 
+}
diff --git a/app/Http/Controllers/ConstantsController.php b/app/Http/Controllers/ConstantsController.php
new file mode 100644
index 0000000..35c4cca
--- /dev/null
+++ b/app/Http/Controllers/ConstantsController.php
@@ -0,0 +1,55 @@
+<?php 
+
+namespace App\Http\Controllers;
+
+use App\School;
+use App\Subject;
+use App\Level;
+use App\Http\Controllers\Controller;
+use Illuminate\Http\Request;
+
+class ConstantsController extends Controller {
+
+	public function schools() {
+		return response()->json(School::with('level')->get());
+	}
+
+	public function addSchool(Request $request) {
+		$this->validate($request, [ 
+			'name' => 'required',
+			'city' => 'required',
+			'level' => 'required'
+		]);
+
+		if(School::where('name', $request['name'])
+				 ->where('city', $request['city'])
+				 ->where('level', $request['level'])
+				 ->first()) {
+			return MyResponse::show('School already exists', 400);
+		}
+
+		return response()->json(School::create($request->all()));
+	}
+
+	public function subjects() {
+		return response()->json(Subject::all());	
+	}
+	
+	public function addSubject(Request $request) {
+		$this->validate($request, [
+			'name' => 'required'
+		]);
+
+		if(Subject::where('name', $request['name'])
+			      ->first()) {
+			return MyResponse::show('Subject already exists', 400);
+		}
+
+		return response()->json(Subject::create($request->all()));
+	}
+
+	public function levels() {
+		return response()->json(Level::all());	
+	}
+}
+?>
diff --git a/app/Http/Controllers/Controller.php b/app/Http/Controllers/Controller.php
new file mode 100644
index 0000000..0ccb918
--- /dev/null
+++ b/app/Http/Controllers/Controller.php
@@ -0,0 +1,10 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use Laravel\Lumen\Routing\Controller as BaseController;
+
+class Controller extends BaseController
+{
+    //
+}
diff --git a/app/Http/Controllers/LoginsController.php b/app/Http/Controllers/LoginsController.php
new file mode 100644
index 0000000..de76510
--- /dev/null
+++ b/app/Http/Controllers/LoginsController.php
@@ -0,0 +1,15 @@
+<?php 
+
+namespace App\Http\Controllers;
+
+use App\Login;
+use App\Http\Controllers\Controller;
+use Illuminate\Http\Request;
+
+class LoginsController extends Controller {
+    
+	public function all() {
+		return response()->json(Login::all());
+	}
+}
+?>
diff --git a/app/Http/Controllers/MyResponse.php b/app/Http/Controllers/MyResponse.php
new file mode 100644
index 0000000..e62ae80
--- /dev/null
+++ b/app/Http/Controllers/MyResponse.php
@@ -0,0 +1,22 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use Illuminate\Http\JsonResponse;
+
+class MyResponse {
+
+	public static function show($message = 'Error has occured', $code = 400) {
+    	if(is_object($message)) { 
+			$message = $message->toArray();
+	 	}
+
+	    $data = [
+            'code' => $code,
+            'message' => $message
+        ];
+
+    	return new JsonResponse($data, 200, [], 0);
+	}	
+}
+?>
diff --git a/app/Http/Controllers/SessionsController.php b/app/Http/Controllers/SessionsController.php
new file mode 100644
index 0000000..3987fee
--- /dev/null
+++ b/app/Http/Controllers/SessionsController.php
@@ -0,0 +1,418 @@
+<?php 
+
+namespace App\Http\Controllers;
+
+use App\Session;
+use App\Review;
+use App\User;
+use App\Junction;
+use App\Interval;
+use App\School;
+use App\Http\Controllers\Controller;
+use Illuminate\Http\Request;
+use LaravelFCM\Message\OptionsBuilder;
+use LaravelFCM\Message\PayloadDataBuilder;
+use LaravelFCM\Message\PayloadNotificationBuilder;
+use FCM;
+
+class SessionsController extends Controller {
+    
+	public function create(Request $request) {
+		$student = UsersController::currentUser();
+
+		if($student->type != 'student') {
+			return MyResponse::show('Only student can create session', 400);
+		}
+
+		$fields = [
+			'lecture' => 'required',
+			'date' => 'required',
+			'time' => 'required',
+			'location' => 'required',
+			'mentor' => 'required',
+			'subject' => 'required'
+		];
+
+		$this->validate($request, $fields);
+
+		foreach($fields as $key => $value) {
+			$fields[$key] = $request[$key];
+		}
+
+		$fields['student'] = $student->id;
+
+		$school = Junction::where('user', $fields['student'])->first()->school; 
+		$fields['level'] = School::findOrFail($school)->level; 
+		
+		if(strtotime($fields['date']) <= strtotime('now')) {
+			return MyResponse::show('Date must be in future', 400);
+		}
+	
+		$day = strtolower(date('D', strtotime($fields['date'])));
+
+		$mentor = User::where('type', 'mentor')->findOrFail($fields['mentor']);
+
+		$interval = Interval::findOrFail($mentor->interval)[$day];
+
+		$intervalBegin = strtotime(substr($interval, 0, strpos($interval, ',')));	
+		$intervalEnd = strtotime(substr($interval, strpos($interval, ',') + 1));
+
+		$time = $fields['time'];
+		unset($fields['time']);
+
+		$sTimeBegin = substr($time, 0, strpos($time, ','));
+		$sTimeEnd = substr($time, strpos($time, ',') + 1);
+
+		if(!preg_match('/(2[0-3]|[01][0-9]):([0-5][0-9])/', $sTimeBegin)
+			|| !preg_match('/(2[0-3]|[01][0-9]):([0-5][0-9])/', $sTimeEnd)) {
+			return myresponse::show('Invalid time format', 400);	
+		}
+
+		$fields['timeBegin'] = $sTimeBegin;
+		$fields['timeEnd'] = $sTimeEnd;
+
+		$timeBegin = strtotime($sTimeBegin);
+		$timeEnd = strtotime($sTimeEnd);
+
+		if($timeBegin > $timeEnd) {
+			return MyResponse::show('Starting time must be before ending time', 400);
+		}
+	
+		$duration = ceil(abs($timeEnd - $timeBegin) / 3600);
+
+		if($duration < 1) {
+			return MyResponse::show('Session duration minimum is one hour', 400);
+		}
+
+		if($timeBegin < $intervalBegin
+			|| $timeBegin > $intervalEnd
+			|| $timeEnd > $intervalEnd) {
+			return MyResponse::show('Mentor is not available in specified time', 400);	
+		}
+
+		$fields['price'] = $mentor->price * $duration;
+
+		if(Session::where('lecture', $fields['lecture'])
+			     	  	 	->where('timeBegin', $fields['timeBegin'])
+			     	  	 	->where('timeEnd', $fields['timeEnd'])
+			     	   		->where('date', $fields['date'])
+			     	   		->where('location', $fields['location'])
+			     	   		->where('mentor', $fields['mentor'])
+			     	   		->where('subject', $fields['subject'])
+			     	   		->first()) {
+			return MyResponse::show('Session already exists', 400);
+		}
+
+		$name = $student->firstName . ' ' . $student->lastName;
+
+		$session = Session::create($fields);	
+		
+		$this->notify('New session', $name . ' has created a session.', ['session' => $session->id], $mentor->fcmToken);			
+
+		return response()->json($session);
+	} 
+		
+	public function update(Request $request, $id) {	
+		$session = Session::findOrFail($id);
+
+		if($session->status != 'accepted') {
+			return MyResponse::show('Session must be accepted', 400);
+		}
+
+		if(!is_null($session->dateEdit)
+			|| !is_null($session->timeBeginEdit)
+			|| !is_null($session->timeEndEdit)
+			|| !is_null($session->locationEdit)) {
+			return MyResponse::show('Previous update is not reviewed', 400);
+		}
+
+		$time = $request['time'];
+		
+		$timeBegin = substr($time, 0, strpos($time, ','));
+		$timeEnd = substr($time, strpos($time, ',') + 1);
+
+		if(isset($request['time']) && (!preg_match('/(2[0-3]|[01][0-9]):([0-5][0-9])/', $timeBegin)
+			|| !preg_match('/(2[0-3]|[01][0-9]):([0-5][0-9])/', $timeEnd))) {
+			return myresponse::show('Invalid time format', 400);	
+		}
+
+		unset($request['time']);
+
+		$request['timeBegin'] = $timeBegin . ':00';
+		$request['timeEnd'] = $timeEnd . ':00';
+
+		$fields = [
+			'date',
+			'timeBegin',
+			'timeEnd',
+			'location'
+		];
+
+		$old = [
+			$session->date,
+			$session->timeBegin,
+			$session->timeEnd,
+			$session->location
+		];
+
+		$edit = [];
+
+		for($i = 0; $i < sizeof($fields); $i++) {
+			$new = $request[$fields[$i]];
+			
+			if(!empty($new)) {
+				$edit[$fields[$i] . 'Edit'] = $new;
+			}else {
+				$edit[$fields[$i] . 'Edit'] = $old;
+			}
+		}
+		
+		$currentUser = UsersController::currentUser();
+
+		if($currentUser->type != 'mentor') {
+			return MyResponse::show('Only mentor can update session', 400);
+		}
+	
+		if($currentUser->id != $session->mentor) {
+			return MyResponse::show('Mentor not authorized', 400);
+		}
+
+		$user = User::findOrFail($session->student);
+
+		$name = $currentUser->firstName . ' ' . $currentUser->lastName;
+	
+		Session::where('id', $id)->update($edit);
+
+		$this->notify('Updated session', $name . ' has changed session details.', ['session' => $id], $user->fcmToken);				
+	
+		return response()->json(Session::find($id));
+	}
+
+	public function decideEdit($id, $status) {
+		if($status != 'accept' && $status != 'decline') {
+			return MyResponse::show('Invalid action', 400);
+		}
+
+		$session = Session::findOrFail($id);
+	
+		if($session->status != 'accepted') {
+			return MyResponse::show('Session must be accepted', 400);
+		}
+
+		if(is_null($session->dateEdit)
+			&& is_null($session->timeBeginEdit)
+			&& is_null($session->timeEndEdit)
+			&& is_null($session->locationEdit)) {
+			return MyResponse::show('Session is not updated', 400);
+		}
+
+		$currentUser = UsersController::currentUser();
+
+		if($currentUser->type != 'student') {
+			return MyResponse::show('Only student can review session update', 400);
+		}
+
+		if($currentUser->id != $session->student) {
+			return MyResponse::show('Student not authorized', 400);
+		}
+
+		$user = User::findOrFail($session->mentor);
+
+		$name = $currentUser->firstName . ' ' . $currentUser->lastName;
+
+		if($status == 'accept') {
+			Session::where('id', $id)->update([
+				'date' => $session->dateEdit, 
+				'timeBegin' => $session->timeBeginEdit, 
+				'timeEnd' => $session->timeEndEdit, 
+				'location' => $session->locationEdit, 
+			]);
+
+			$this->notify('Accepted changes', $name . ' has accepted session changes.', ['session' => $id], $user->fcmToken);				
+		}else {	
+			$this->notify('Declined changes', $name . ' has declined session changes.', ['session' => $id], $user->fcmToken);				
+		}
+		
+		Session::where('id', $id)->update([
+			'dateEdit' => null,
+			'timeBeginEdit' => null,
+			'timeEndEdit' => null,
+			'locationEdit' => null
+		]);
+	
+		return MyResponse::show('Success', 200);
+	}
+
+	public function decide($id, $status) {
+		if($status != 'accept' && $status != 'decline') {
+			return MyResponse::show('Invalid action', 400);
+		}
+		
+		$session = Session::findOrFail($id);
+	
+		if($status == 'accept') {
+			if($session->status == 'declined') {
+				return MyResponse::show('Session cannot be declined', 400);
+			}else if($session->status == 'accepted') {
+				return MyResponse::show('Session is already accepted', 400);
+			}
+		}else {
+			if($session->status == 'accepted') {
+				return MyResponse::show('Session cannot be accepted', 400);
+			}else if($session-status == 'declined') {
+				return MyResponse::show('Session is already declined', 400);
+			}	
+		}
+	
+		$currentUser = UsersController::currentUser();
+
+		if($currentUser->type != 'mentor') {
+			return MyResponse::show('Only mentor can ' . $status . ' session', 400);
+		}
+
+		if($currentUser->id != $session->mentor) {
+			return MyResponse::show('Mentor not authorized', 400);	
+		}
+	
+		$name = $currentUser->firstName . ' ' . $currentUser->lastName;
+		
+		$user = User::findOrFail($session->student);
+		
+		if($status == 'accept') {
+			Session::where('id', $id)->update(['status' => 'accepted']);
+			
+			$this->notify('Accepted session', $name . ' has accepted a session.', ['session' => $id], $user->fcmToken);			
+		}else {
+			Session::where('id', $id)->update(['status' => 'declined']);
+		
+			$this->notify('Declined session', $name . ' has declined a session.', ['session' => $id], $user->fcmToken);			
+		}
+	
+		return MyResponse::show('Success', 200);
+	}
+
+	public function cancel($id) {
+		$session = Session::findOrFail($id);
+
+		if($session->status != 'accepted') {
+			return MyResponse::show('Session must be accepted', 400);
+		}
+
+		if($session->canceled == 1) {
+			return MyResponse::show('Session is already canceled', 400);
+		}
+
+		$currentUser = UsersController::currentUser();
+
+		$user = User::findOrFail($session->student);
+
+		if($currentUser->type == 'student') {
+			$user = User::findOrFail($session->mentor);	
+		}
+	
+		if($currentUser->id != $session->student
+			&& $currentUser->id != $session->mentor) {
+			return MyResponse::show('User not authorized', 400);
+		}
+
+		$name = $currentUser->firstName . ' ' . $currentUser->lastName;
+		
+		Session::where('id', $id)->update(['canceled' => 1]);
+		
+		$this->notify('Canceled session', $name . ' has canceled a session.', ['session' => $id], $user->fcmToken);			
+
+		return MyResponse::show('Success', 200);
+	}
+
+	public function review(Request $request, $id) {
+		$this->validate($request, [
+			'rating' => 'required',
+			'description' => 'required'
+		]);
+
+		$session = Session::findOrFail($id);	
+		
+		$currentUser = UsersController::currentUser();
+
+		if($currentUser->type != 'student') {
+			return MyResponse::show('Only student can review session', 400);
+		}
+
+		if($currentUser->id != $session->student) {
+			return MyResponse::show('Student not authorized', 400);
+		}
+
+		if($session->status != 'accepted') {
+			return MyResponse::show('Session must be accepted', 400);
+		}
+	
+		if($session->canceled == 1) {
+			return MyResponse::show('Session must not be canceled', 400);
+		}
+
+		if(isset($session->review)) {
+			return MyResponse::show('Session already has a review', 400);
+		}
+
+		if($request['rating'] < 1 || $request['rating'] > 5) {
+			return MyResponse::show('Rating is out of bounds', 400);	
+		}
+
+		$review = Review::create($request->all());
+
+		Session::where('id', $id)->update(['review' => $review->id]);
+		
+		return response()->json($review);
+	}
+
+	public function get($id) {
+		$session = $this->getSession($id);
+		$user = UsersController::currentUser();
+
+		if($session->student != $user->id && $session->mentor != $user->id) {
+			return MyResponse::show('User not authorized', 400);
+		}
+
+		return response()->json($session);
+	}
+
+	public function all() {
+		$user = UsersController::currentUser();
+
+		return response()->json(Session::where($user->type, $user->id)->get());	
+	}
+
+	private function getSession($id) {
+		return Session::with('student', 'mentor', 'review', 'level', 'subject')->findOrFail($id);
+	}
+
+	private function notify($title, $body, $data, $token) {
+		//todo uncomment before release
+		return;
+
+		$optionBuilder = new OptionsBuilder();
+		$optionBuilder->setTimeToLive(60*20);
+
+		$notificationBuilder = new PayloadNotificationBuilder($title);
+		$notificationBuilder->setBody($body)
+				            ->setSound('default');
+				    
+		$dataBuilder = new PayloadDataBuilder();
+		$dataBuilder->addData($data);
+
+		$option = $optionBuilder->build();
+		$notification = $notificationBuilder->build();
+		$data = $dataBuilder->build();
+
+		$downstreamResponse = FCM::sendTo($token, $option, $notification, $data);
+
+		$downstreamResponse->numberSuccess();
+		$downstreamResponse->numberFailure();
+		$downstreamResponse->numberModification();
+
+		$downstreamResponse->tokensToDelete(); 
+		$downstreamResponse->tokensToModify(); 
+		$downstreamResponse->tokensToRetry();	
+	}
+}
+?>
diff --git a/app/Http/Controllers/UsersController.php b/app/Http/Controllers/UsersController.php
new file mode 100644
index 0000000..9b7e011
--- /dev/null
+++ b/app/Http/Controllers/UsersController.php
@@ -0,0 +1,477 @@
+<?php 
+
+namespace App\Http\Controllers;
+
+use Auth;
+use App\School;
+use App\Review;
+use App\Level;
+use App\Subject;
+use App\User;
+use App\Login;
+use App\Session;
+use App\Junction;
+use App\Interval;
+use App\Http\Controllers\Controller;
+use Illuminate\Http\Request;
+use Illuminate\Hashing\BcryptHashet;
+
+class UsersController extends Controller {
+   
+	public function register(Request $request) {
+		$fields = [
+			'email' => 'required',
+			'password' => 'required',
+			'firstName' => 'required',
+			'lastName' => 'required',
+			'type' => 'required'
+		];
+
+		$this->validate($request, $fields);
+
+		if(User::where('email', $request['email'])->first()) {
+			return MyResponse::show('Email is already in use', 400);
+		}
+
+		if($request['type'] == 'mentor') {
+			$fields = array_merge($fields, [
+				'interval' => 'required',
+				'price' => 'required',
+				'location' => 'required',
+				'promoted' => 'required',
+				'schools' => 'required',
+				'subjects' => 'required',
+				'levels' => 'required'
+			]);
+		}else if($request['type'] == 'mentor') {
+			$fields = array_merge($fields, [
+				'school' => 'required',
+				'grade' => 'required'
+			]);
+		}else {
+			return MyResponse::show('Invalid type', 400);	
+		}
+
+		$this->validate($request, $fields);
+	
+		$temp = [];
+
+		if($request['type'] == 'mentor') {	
+			if(sizeof($request['interval']) != 7) {
+				return MyResponse::show('Interval must contain whole week', 400);
+			}
+
+			$model = new Interval();
+
+			$days = $model->getColumns();
+
+			$count = 0;
+	
+			foreach($request['interval'] as $day => $i) {
+				$count++;
+				
+				if($day != $days[$count]) {
+					return MyResponse::show('Invalid day specified in interval', 400);
+				}
+
+				$timeBegin = substr($i, 0, strpos($i, ','));
+				$timeEnd = substr($i, strpos($i, ',') + 1);
+
+				if(!preg_match('/(2[0-3]|[01][0-9]):([0-5][0-9])/', $timeBegin)
+					|| !preg_match('/(2[0-3]|[01][0-9]):([0-5][0-9])/', $timeEnd)) {
+					return myresponse::show('Invalid time format', 400);	
+				}
+
+				$timeBegin = strtotime($timeBegin);
+				$timeEnd = strtotime($timeEnd);
+
+				if($timeBegin > $timeEnd) {
+					return MyResponse::show('Starting time must be before ending time', 400);
+				}
+			}
+			
+			$interval = Interval::create($request['interval']);
+			$request['interval'] = $interval->id;
+	
+			$columns = [
+				'school',
+				'subject',
+				'level'
+			];
+
+			foreach($columns as $column) {
+				$temp[$column] = explode(',', $request[$column . 's']);
+				unset($request[$column . 's']);
+			}
+		}else {
+			$temp['school'] = $request['school'];
+			unset($request['school']);
+		}
+				
+		$create = [];
+
+		foreach($fields as $key => $value) {
+			$create[$key] = $request[$key];
+		}
+
+		$create['password'] = $this->hashPassword($request['password']);
+		$create['accessToken'] = $this->createToken();
+
+		$user = User::create($create);
+		
+		if($request['type'] == 'mentor') {
+			foreach($temp as $key => $value) {
+				switch($key) {
+					case 'school':
+						$model = new School();
+						break;
+					case 'subject':
+						$model = new Subject();
+						break;
+					case 'level';
+						$model = new Level();
+						break;
+				}
+
+				foreach($value as $entry) {
+					if(Junction::where('user', $user->id)
+						       ->where($key, $entry)
+							   ->first()) {
+						continue;	
+					}
+						
+					if(!$model->where('id', $entry)->first()) {
+						return MyResponse::show('Invalid ' . $key, 400);	
+					}
+
+					Junction::create([
+						'user' => $user->id,
+						$key => $entry
+					]);
+				}
+			}
+		}else {
+			if(isset($request['school']) 
+				&& !Junction::where('user', $user->id)
+						       ->where('school', $request['school'])
+							   ->first()) {
+
+				if(School::where('id', $request['school'])->first()) {
+					return MyResponse::show('Invalid school', 400);	
+				}
+
+				Junction::create([
+					'user' => $user->id,
+					'school' => $temp['school']
+				]);
+			}
+		}
+
+		return response()->json(User::find($user->id));
+	} 
+
+	public function login(Request $request) {
+		$this->validate($request, [
+			'email' => 'required',
+			'password' => 'required',
+			'token' => 'required'
+		]);
+
+		$user = User::where('email', $request['email'])
+					->firstOrFail();
+
+		if(!app('hash')->check($request['password'], $user->password)) {
+			return MyResponse::show('Incorrect password', 400);		
+		}
+
+		if($user->active == 1) {
+			return MyResponse::show('User is already active', 400);
+		}
+
+		$accessToken = $this->createToken();
+
+		User::where('id', $user->id)
+		    ->update([
+				'accessToken' => $accessToken,
+				'fcmToken' => $request['token'],
+				'active' => 1
+			]);
+
+		$login = Login::create([
+			'user' => $user->id,
+			'ip' => $request->ip()
+		]);
+
+		return response()->json([
+			'accessToken' => $accessToken,
+			'login' => $login
+		]);	
+	}
+
+	public function logout() {
+		$user = UsersController::currentUser();
+
+		if($user->active == 0) {
+			return MyResponse::show('User must be active', 400);
+		}
+
+		$user->active = 0;
+	
+		return MyResponse::show('Success', 200);
+	}
+	
+	public function update(Request $request) {
+		$user = UsersController::currentUser();
+		
+		$fields = [
+			'firstName',
+			'lastName'
+		];
+
+		if($user->type == 'mentor') {
+			$fields = array_merge($fields, [
+				'interval',
+				'price',
+				'location',
+				'promoted'
+			]);
+
+			$columns = [
+				'school',
+				'subject',
+				'level'
+			];
+
+			foreach($columns as $column) {
+				$key = $column . 's';
+
+				if(isset($request[$key])) {
+					if(empty($request[$key])) {
+						return MyResponse::show($key . ' are required', 400);
+					}
+
+					$temp[$column] = explode(',', $request[$key]);
+					
+					Junction::where('user', $user->id)
+							->whereNotNull($column)
+							->delete();
+				}
+			}
+			
+			foreach($temp as $key => $value) {
+				$model = null;
+				
+				switch($key) {
+					case 'school':
+						$model = new School();
+						break;
+					case 'subject':
+						$model = new Subject();
+						break;
+					case 'level';
+						$model = new Level();
+						break;
+				}
+
+				foreach($value as $entry) {
+					if(!$model->where('id', $entry)->first()) {
+						return MyResponse::show('Invalid ' . $key, 400);	
+					}
+
+					Junction::create([
+						'user' => $user->id,
+						$key => $entry
+					]);
+				}
+			}
+		}else {
+			if(isset($request['school'])) {
+				if(empty($request['school'])) {
+					return MyResponse::show('School is required', 400);
+				}
+
+				Junction::where('user', $user->id)
+						->whereNotNull('school')
+						->delete();
+
+				if(!School::where('id', $request['school'])->first()) {
+					return MyResponse::show('Invalid school', 400);	
+				}
+
+				Junction::create([
+					'user' => $user->id,
+					'school' => $request['school']
+				]);
+			}
+
+			$fields = array_merge($fields, [
+				'grade'
+			]);
+		}
+				
+		$edit = [];
+
+		foreach($fields as $field) {
+			$new = $request[$field];
+
+			if(empty($new)) {
+				continue;	
+			}
+
+			$edit[$field] = $new;
+		}
+
+		$user->update($edit);
+	
+		return response()->json($user);
+	}
+
+	public function setImage(Request $request) {	
+		$user = UsersController::currentUser();
+
+		$this->validate($request, ['file' => 'required']);
+	
+		$file = $request->file('file');
+
+		$name = $user->id . '.' . $file->getClientOriginalExtension();
+
+		$path = 'images/profile';
+
+		if(!File::exists($path)) {
+			File::makeDirectory($path);	
+		}
+
+		$file->move($path, $name);
+
+		$user->image = $name;
+
+		return response()->json($user);
+	}
+
+	public function getImage($id) {
+		return response()->file(User::findOrFail($id)->image);
+	}
+
+	public function delete() {
+		$user = UsersController::currentUser();
+		
+		$user->active = 0;
+		$user->delete();
+
+		return MyResponse::show('Success', 200);
+	}
+
+	public function get($id) {
+		$view = true;
+
+		$user = User::findOrfail($id);
+			
+		if($user->id == UsersController::currentUser()->id) {
+			$view = false;
+		}
+
+		foreach($user as $key => $value) {
+			if(!isset($value) || empty($value)) {
+				unset($user[$key]);	
+			}
+		}
+
+		if($user->type == 'mentor') {
+			$user['schools'] = Junction::with('school')
+								       ->where('user', $id)
+								       ->whereNotNull('school')
+								       ->get();
+
+			$user['subjects'] = Junction::with('subject')
+		                                ->where('user', $id)
+								        ->whereNotNull('subject')
+								        ->get();
+	
+			$user['levels'] = Junction::with('level')
+									   ->where('user', $id)
+									   ->whereNotNull('level')
+									   ->get();
+
+			$user['sessions'] = Session::where('mentor', $user->id)->count();
+			
+			$user['students'] = sizeof(Session::where('mentor', $user->id)->groupBy('student')->get());
+					
+			$user['reviews'] = Session::where('mentor', $user->id)
+			                          ->whereNotNull('review')
+									  ->count();
+
+			$user['rating'] = $this->reviews($user->id, true);
+
+			if($view) {
+				$user->increment('views');	
+			}
+		}else {
+			$user['school'] = Junction::with('school')
+								      ->where('user', $id)
+								      ->whereNotNull('school')
+								      ->first();
+		}
+
+		return response()->json($user);
+	}
+	
+	public function all() {
+		return response()->json(User::all());	
+	}
+
+	public function reviews($id, $calculate = false) {
+		$user = User::findOrFail($id);
+
+		if($user->type != 'mentor') {
+			return MyResponse::show('Only mentors have reviews', 400);
+		}
+
+		$sessions = Session::where($user->type, $id)->get();
+		
+		$reviews = [];
+
+		$sum = 0;
+		$cnt = 0;
+
+		for($i = 0; $i < sizeof($sessions); $i++) {
+			$r = Review::find($sessions[$i]->review);
+			
+			if($r != null) {
+				$reviews[$i] = $r;
+				$sum += $reviews[$i]->rating;
+				$cnt++;
+			}
+		}	
+
+		if($calculate) {
+			$avg = 0;
+
+			if($cnt > 0) {
+				$avg = $sum / $cnt;
+			}
+
+			return $avg;
+		}
+
+		return response()->json($reviews);
+	}
+
+	private function hashPassword($password) {
+		return app('hash')->make($password);
+	}
+
+	private function createToken() {
+		do {
+			$token = str_random(64);
+		}while(User::where("accessToken", $token)->first() instanceof User);
+		
+		return $token;
+	}
+	
+	public static function currentUser() {
+		$user = User::findOrFail(Auth::user()->id);
+
+		return $user;
+	}
+}
+?>
diff --git a/app/Http/Middleware/Authenticate.php b/app/Http/Middleware/Authenticate.php
new file mode 100644
index 0000000..325f967
--- /dev/null
+++ b/app/Http/Middleware/Authenticate.php
@@ -0,0 +1,45 @@
+<?php
+
+namespace App\Http\Middleware;
+
+use Closure;
+use Illuminate\Http\Request;
+use Illuminate\Contracts\Auth\Factory as Auth;
+
+class Authenticate
+{
+    /**
+     * The authentication guard factory instance.
+     *
+     * @var \Illuminate\Contracts\Auth\Factory
+     */
+    protected $auth;
+
+    /**
+     * Create a new middleware instance.
+     *
+     * @param  \Illuminate\Contracts\Auth\Factory  $auth
+     * @return void
+     */
+    public function __construct(Auth $auth)
+    {
+        $this->auth = $auth;
+    }
+
+    /**
+     * Handle an incoming request.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \Closure  $next
+     * @param  string|null  $guard
+     * @return mixed
+     */
+    public function handle($request, Closure $next, $guard = null)
+    {
+        if ($this->auth->guard($guard)->guest()) {
+     		return response('Unauthorized', 401);
+        }
+
+        return $next($request);
+    }
+}
diff --git a/app/Http/Middleware/ExampleMiddleware.php b/app/Http/Middleware/ExampleMiddleware.php
new file mode 100644
index 0000000..166581c
--- /dev/null
+++ b/app/Http/Middleware/ExampleMiddleware.php
@@ -0,0 +1,20 @@
+<?php
+
+namespace App\Http\Middleware;
+
+use Closure;
+
+class ExampleMiddleware
+{
+    /**
+     * Handle an incoming request.
+     *
+     * @param  \Illuminate\Http\Request  $request
+     * @param  \Closure  $next
+     * @return mixed
+     */
+    public function handle($request, Closure $next)
+    {
+        return $next($request);
+    }
+}
diff --git a/app/Http/routes.php b/app/Http/routes.php
new file mode 100644
index 0000000..58e73fd
--- /dev/null
+++ b/app/Http/routes.php
@@ -0,0 +1,48 @@
+<?php
+
+$app->get('/', function() use ($app) {
+	return view('home', [
+		'version' => '1.0', 
+		'year' => date('Y')
+	]);
+});
+
+$app->group(['prefix' => 'api/v1'], function($app) {
+	$app->get('schools', 'ConstantsController@schools');	
+	$app->get('subjects', 'ConstantsController@subjects');	
+	$app->get('levels', 'ConstantsController@levels');
+
+	$app->post('schools', 'ConstantsController@addSchool');
+	$app->post('subjects', 'ConstantsController@addSubject');
+
+	$app->get('logins', 'LoginsController@all');
+
+	$app->post('register', 'UsersController@register');	
+	$app->post('login', 'UsersController@login');
+	
+	$app->group(['middleware' => 'auth'], function($app) {
+		$app->put('account/image', 'UsersController@setImage');	
+		$app->put('account', 'UsersController@update');
+		$app->delete('account', 'UsersController@delete');	
+		$app->post('logout', 'UsersController@logout');
+	});
+
+	$app->group(['prefix' => 'users', 'middleware' => 'auth'], function($app) {
+		$app->get('all', 'UsersController@all');
+		$app->get('{id}', 'UsersController@get');
+		$app->get('{id}/reviews', 'UsersController@reviews');
+		$app->get('{id}/image', 'UsersController@getImage');	
+	});
+
+	$app->group(['prefix' => 'sessions', 'middleware' => 'auth'], function($app) {
+		$app->get('all', 'SessionsController@all');	
+		$app->post('create', 'SessionsController@create');	
+		$app->put('{id}', 'SessionsController@update');	
+		$app->get('{id}', 'SessionsController@get');	
+		$app->post('{id}/cancel', 'SessionsController@cancel');	
+		$app->post('{id}/review', 'SessionsController@review');	
+		$app->post('{id}/{status}', 'SessionsController@decide');	
+		$app->post('{id}/edit/{status}', 'SessionsController@decideEdit');	
+	});
+});
+?>
diff --git a/app/Interval.php b/app/Interval.php
new file mode 100644
index 0000000..bb45163
--- /dev/null
+++ b/app/Interval.php
@@ -0,0 +1,25 @@
+<?php namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Interval extends Model {
+
+	public $timestamps = false;
+
+	protected $fillable = [
+		'monday',
+		'tuesday',
+		'wednesday',
+		'thursday',
+		'friday',
+		'saturday',
+		'sunday'
+	]; 
+
+	public function getColumns() {
+		return $this->getConnection()
+		            ->getSchemaBuilder()
+					->getColumnListing($this->getTable());
+	}
+}
+?>
diff --git a/app/Jobs/ExampleJob.php b/app/Jobs/ExampleJob.php
new file mode 100644
index 0000000..7b65bb4
--- /dev/null
+++ b/app/Jobs/ExampleJob.php
@@ -0,0 +1,26 @@
+<?php
+
+namespace App\Jobs;
+
+class ExampleJob extends Job
+{
+    /**
+     * Create a new job instance.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        //
+    }
+
+    /**
+     * Execute the job.
+     *
+     * @return void
+     */
+    public function handle()
+    {
+        //
+    }
+}
diff --git a/app/Jobs/Job.php b/app/Jobs/Job.php
new file mode 100644
index 0000000..7c873e1
--- /dev/null
+++ b/app/Jobs/Job.php
@@ -0,0 +1,24 @@
+<?php
+
+namespace App\Jobs;
+
+use Illuminate\Bus\Queueable;
+use Illuminate\Queue\SerializesModels;
+use Illuminate\Queue\InteractsWithQueue;
+use Illuminate\Contracts\Queue\ShouldQueue;
+
+abstract class Job implements ShouldQueue
+{
+    /*
+    |--------------------------------------------------------------------------
+    | Queueable Jobs
+    |--------------------------------------------------------------------------
+    |
+    | This job base class provides a central location to place any logic that
+    | is shared across all of your jobs. The trait included with the class
+    | provides access to the "queueOn" and "delay" queue helper methods.
+    |
+    */
+
+    use InteractsWithQueue, Queueable, SerializesModels;
+}
diff --git a/app/Junction.php b/app/Junction.php
new file mode 100644
index 0000000..7e9020f
--- /dev/null
+++ b/app/Junction.php
@@ -0,0 +1,32 @@
+<?php namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Junction extends Model {
+
+	public $timestamps = false;
+
+	protected $fillable = [
+		'user',
+		'school',
+		'subject',
+		'level'
+	]; 	
+	
+	public function user() {
+		return $this->belongsTo('App\User', 'user');
+	}
+
+	public function school() {
+		return $this->belongsTo('App\School', 'school');
+	}
+
+	public function subject() {
+		return $this->belongsTo('App\Subject', 'subject');
+	}
+
+	public function level() {
+		return $this->belongsTo('App\Level', 'level');
+	}
+}
+?>
diff --git a/app/Level.php b/app/Level.php
new file mode 100644
index 0000000..f513630
--- /dev/null
+++ b/app/Level.php
@@ -0,0 +1,13 @@
+<?php namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Level extends Model {
+
+	public $timestamps = false;
+
+	protected $fillable = [
+		'name'
+	]; 	
+}
+?>
diff --git a/app/Listeners/ExampleListener.php b/app/Listeners/ExampleListener.php
new file mode 100644
index 0000000..77fc6a8
--- /dev/null
+++ b/app/Listeners/ExampleListener.php
@@ -0,0 +1,31 @@
+<?php
+
+namespace App\Listeners;
+
+use App\Events\ExampleEvent;
+use Illuminate\Queue\InteractsWithQueue;
+use Illuminate\Contracts\Queue\ShouldQueue;
+
+class ExampleListener
+{
+    /**
+     * Create the event listener.
+     *
+     * @return void
+     */
+    public function __construct()
+    {
+        //
+    }
+
+    /**
+     * Handle the event.
+     *
+     * @param  ExampleEvent  $event
+     * @return void
+     */
+    public function handle(ExampleEvent $event)
+    {
+        //
+    }
+}
diff --git a/app/Login.php b/app/Login.php
new file mode 100644
index 0000000..d9de405
--- /dev/null
+++ b/app/Login.php
@@ -0,0 +1,16 @@
+<?php namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Login extends Model {
+	
+	protected $fillable = [
+		'ip', 
+		'user'
+	]; 
+
+	public function user() {
+		return $this->belongsTo('App\User', 'user');	
+	}
+}
+?>
diff --git a/app/Providers/AppServiceProvider.php b/app/Providers/AppServiceProvider.php
new file mode 100644
index 0000000..ddec046
--- /dev/null
+++ b/app/Providers/AppServiceProvider.php
@@ -0,0 +1,18 @@
+<?php
+
+namespace App\Providers;
+
+use Illuminate\Support\ServiceProvider;
+
+class AppServiceProvider extends ServiceProvider
+{
+    /**
+     * Register any application services.
+     *
+     * @return void
+     */
+    public function register()
+    {
+        //
+    }
+}
diff --git a/app/Providers/AuthServiceProvider.php b/app/Providers/AuthServiceProvider.php
new file mode 100644
index 0000000..b16d4f6
--- /dev/null
+++ b/app/Providers/AuthServiceProvider.php
@@ -0,0 +1,23 @@
+<?php
+
+namespace App\Providers;
+
+use App\User;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Auth;
+use Illuminate\Support\Facades\Gate;
+use Illuminate\Support\ServiceProvider;
+
+class AuthServiceProvider extends ServiceProvider {
+    public function register() {}
+
+    public function boot() {
+    	Auth::viaRequest('api', function($request) {
+			if($request->header('accessToken')) {
+				return User::where('accessToken', $request->header('accessToken'))
+						   ->where('active', 1)
+						   ->first();
+			}
+		});
+	}
+}
diff --git a/app/Providers/EventServiceProvider.php b/app/Providers/EventServiceProvider.php
new file mode 100644
index 0000000..0b8f393
--- /dev/null
+++ b/app/Providers/EventServiceProvider.php
@@ -0,0 +1,19 @@
+<?php
+
+namespace App\Providers;
+
+use Laravel\Lumen\Providers\EventServiceProvider as ServiceProvider;
+
+class EventServiceProvider extends ServiceProvider
+{
+    /**
+     * The event listener mappings for the application.
+     *
+     * @var array
+     */
+    protected $listen = [
+        'App\Events\SomeEvent' => [
+            'App\Listeners\EventListener',
+        ],
+    ];
+}
diff --git a/app/Review.php b/app/Review.php
new file mode 100644
index 0000000..58ed23d
--- /dev/null
+++ b/app/Review.php
@@ -0,0 +1,12 @@
+<?php namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Review extends Model {
+	
+	protected $fillable = [
+		'rating',
+		'description'
+	]; 	
+}
+?>
diff --git a/app/School.php b/app/School.php
new file mode 100644
index 0000000..7ae1a50
--- /dev/null
+++ b/app/School.php
@@ -0,0 +1,19 @@
+<?php namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class School extends Model {
+
+	public $timestamps = false;
+
+	protected $fillable = [
+		'name',
+		'city',
+		'level'
+	]; 	
+	
+	public function level() {
+		return $this->belongsTo('App\Level', 'level');
+	}
+}
+?>
diff --git a/app/Session.php b/app/Session.php
new file mode 100644
index 0000000..f454705
--- /dev/null
+++ b/app/Session.php
@@ -0,0 +1,43 @@
+<?php namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Session extends Model {
+	
+	protected $fillable = [
+		'lecture', 
+		'timeBegin', 
+		'timeEnd', 
+		'date', 
+		'location',
+		'finished',
+		'canceled',
+		'accepted',
+		'mentor',
+		'student',
+		'review',
+		'subject',
+		'level'
+	]; 
+	
+	public function review() {
+		return $this->belongsTo('App\Review', 'review');
+	}
+
+	public function mentor() {
+		return $this->belongsTo('App\User', 'mentor');
+	}
+	
+	public function student() {
+		return $this->belongsTo('App\User', 'student');
+	}
+	
+	public function level() {
+		return $this->belongsTo('App\Level', 'level');
+	}
+	
+	public function subject() {
+		return $this->belongsTo('App\Subject', 'subject');
+	}
+}
+?>
diff --git a/app/Subject.php b/app/Subject.php
new file mode 100644
index 0000000..0a64694
--- /dev/null
+++ b/app/Subject.php
@@ -0,0 +1,13 @@
+<?php namespace App;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Subject extends Model {
+
+	public $timestamps = false;
+
+	protected $fillable = [
+		'name'
+	]; 	
+}
+?>
diff --git a/app/User.php b/app/User.php
new file mode 100644
index 0000000..4d03e52
--- /dev/null
+++ b/app/User.php
@@ -0,0 +1,53 @@
+<?php
+
+namespace App;
+
+use Illuminate\Auth\Authenticatable;
+use Laravel\Lumen\Auth\Authorizable;
+use Illuminate\Database\Eloquent\Model;
+use Illuminate\Database\Eloquent\SoftDeletes;
+use Illuminate\Contracts\Auth\Authenticatable as AuthenticatableContract;
+use Illuminate\Contracts\Auth\Access\Authorizable as AuthorizableContract;
+
+class User extends Model implements
+    AuthenticatableContract,
+    AuthorizableContract
+{
+    use Authenticatable, Authorizable, SoftDeletes;
+    /**
+     * The attributes that are mass assignable.
+     *
+     * @var array
+     */
+    protected $fillable = [
+        'firstName', 
+		'lastName',
+		'email',
+		'type',
+		'image',
+		'location',
+		'interval',
+		'price',
+		'grade',
+		'password',
+		'accessToken',
+		'fcmToken'
+	];
+
+    /**
+     * The attributes excluded from the model's JSON form.
+     *
+     * @var array
+     */
+    protected $hidden = [
+		'password',
+		'fcmToken',
+		'accessToken'
+    ];
+
+	protected $dates = ['deleted_at'];
+	
+	public function interval() {
+		return $this->belongsTo('App\Interval', 'interval');
+	}
+}
diff --git a/artisan b/artisan
new file mode 100644
index 0000000..6a9d095
--- /dev/null
+++ b/artisan
@@ -0,0 +1,35 @@
+#!/usr/bin/env php
+<?php
+
+use Symfony\Component\Console\Input\ArgvInput;
+use Symfony\Component\Console\Output\ConsoleOutput;
+
+/*
+|--------------------------------------------------------------------------
+| Create The Application
+|--------------------------------------------------------------------------
+|
+| First we need to get an application instance. This creates an instance
+| of the application / container and bootstraps the application so it
+| is ready to receive HTTP / Console requests from the environment.
+|
+*/
+
+$app = require __DIR__.'/bootstrap/app.php';
+
+/*
+|--------------------------------------------------------------------------
+| Run The Artisan Application
+|--------------------------------------------------------------------------
+|
+| When we run the console application, the current CLI command will be
+| executed in this console and the response sent back to a terminal
+| or another output device for the developers. Here goes nothing!
+|
+*/
+
+$kernel = $app->make(
+    'Illuminate\Contracts\Console\Kernel'
+);
+
+exit($kernel->handle(new ArgvInput, new ConsoleOutput));
diff --git a/bootstrap/app.php b/bootstrap/app.php
new file mode 100644
index 0000000..b32139f
--- /dev/null
+++ b/bootstrap/app.php
@@ -0,0 +1,103 @@
+<?php
+
+require_once __DIR__.'/../vendor/autoload.php';
+
+try {
+    (new Dotenv\Dotenv(__DIR__.'/../'))->load();
+} catch (Dotenv\Exception\InvalidPathException $e) {
+    //
+}
+
+/*
+|--------------------------------------------------------------------------
+| Create The Application
+|--------------------------------------------------------------------------
+|
+| Here we will load the environment and create the application instance
+| that serves as the central piece of this framework. We'll use this
+| application as an "IoC" container and router for this framework.
+|
+*/
+
+$app = new Fremail\NestedRouteGroups\Application(
+    realpath(__DIR__.'/../')
+);
+
+$app->withFacades();
+class_alias(\LaravelFCM\Facades\FCM::class, 'FCM');
+class_alias(\LaravelFCM\Facades\FCMGroup::class, 'FCMGroup');
+
+$app->withEloquent();
+
+/*
+|--------------------------------------------------------------------------
+| Register Container Bindings
+|--------------------------------------------------------------------------
+|
+| Now we will register a few bindings in the service container. We will
+| register the exception handler and the console kernel. You may add
+| your own bindings here if you like or you can make another file.
+|
+*/
+
+$app->singleton(
+    Illuminate\Contracts\Debug\ExceptionHandler::class,
+    App\Exceptions\Handler::class
+);
+
+$app->singleton(
+    Illuminate\Contracts\Console\Kernel::class,
+    App\Console\Kernel::class
+);
+
+/*
+|--------------------------------------------------------------------------
+| Register Middleware
+|--------------------------------------------------------------------------
+|
+| Next, we will register the middleware with the application. These can
+| be global middleware that run before and after each request into a
+| route or middleware that'll be assigned to some specific routes.
+|
+*/
+
+// $app->middleware([
+//    App\Http\Middleware\ExampleMiddleware::class
+// ]);
+
+$app->routeMiddleware([
+    'auth' => App\Http\Middleware\Authenticate::class,
+]);
+
+/*
+|--------------------------------------------------------------------------
+| Register Service Providers
+|--------------------------------------------------------------------------
+|
+| Here we will register all of the application's service providers which
+| are used to bind services into the container. Service providers are
+| totally optional, so you are not required to uncomment this line.
+|
+*/
+
+//$app->register(App\Providers\AppServiceProvider::class);
+$app->register(App\Providers\AuthServiceProvider::class);
+// $app->register(App\Providers\EventServiceProvider::class);
+$app->register(LaravelFCM\FCMServiceProvider::class);
+
+/*
+|--------------------------------------------------------------------------
+| Load The Application Routes
+|--------------------------------------------------------------------------
+|
+| Next we will include the routes file so that they can all be added to
+| the application. This will provide all of the URLs the application
+| can respond to, as well as the controllers that may handle them.
+|
+*/
+
+$app->group(['namespace' => 'App\Http\Controllers'], function ($app) {
+    require __DIR__.'/../app/Http/routes.php';
+});
+
+return $app;
diff --git a/composer.json b/composer.json
new file mode 100644
index 0000000..87b2c0a
--- /dev/null
+++ b/composer.json
@@ -0,0 +1,32 @@
+{
+    "name": "laravel/lumen",
+    "description": "The Laravel Lumen Framework.",
+    "keywords": ["framework", "laravel", "lumen"],
+    "license": "MIT",
+    "type": "project",
+    "require": {
+        "php": ">=5.5.9",
+        "laravel/lumen-framework": "5.2.*",
+        "vlucas/phpdotenv": "~2.2",
+        "fremail/lumen-nested-route-groups": "~1.1",
+        "brozot/laravel-fcm": "^1.2"
+    },
+    "require-dev": {
+        "fzaninotto/faker": "~1.4",
+        "phpunit/phpunit": "~4.0"
+    },
+    "autoload": {
+		"classmap": [
+		  	"database/"
+		],
+		"psr-4": {
+            "App\\": "app/"
+        }
+    },
+    "autoload-dev": {
+        "classmap": [
+            "tests/",
+            "database/"
+        ]
+    }
+}
diff --git a/composer.lock b/composer.lock
new file mode 100644
index 0000000..a0d93c9
--- /dev/null
+++ b/composer.lock
@@ -0,0 +1,3737 @@
+{
+    "_readme": [
+        "This file locks the dependencies of your project to a known state",
+        "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#composer-lock-the-lock-file",
+        "This file is @generated automatically"
+    ],
+    "hash": "4c338725743227cf619c92ade38c0172",
+    "content-hash": "0292a88e8dcc55d7e9d83c88f195b6b1",
+    "packages": [
+        {
+            "name": "brozot/laravel-fcm",
+            "version": "v1.2.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/brozot/Laravel-FCM.git",
+                "reference": "2122ba0fda51fbec87a14a1a9dc7e292f10b26df"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/brozot/Laravel-FCM/zipball/2122ba0fda51fbec87a14a1a9dc7e292f10b26df",
+                "reference": "2122ba0fda51fbec87a14a1a9dc7e292f10b26df",
+                "shasum": ""
+            },
+            "require": {
+                "guzzlehttp/guzzle": "~6.0",
+                "illuminate/support": "5.*",
+                "monolog/monolog": "^1.19",
+                "php": ">=5.5.9"
+            },
+            "require-dev": {
+                "laravel/laravel": "5.2.*",
+                "mockery/mockery": "0.9.*",
+                "phpunit/phpunit": "4.7.*",
+                "satooshi/php-coveralls": "dev-master"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "LaravelFCM\\": "src/",
+                    "LaravelFCM\\Mocks\\": "tests/mocks"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Brosy",
+                    "email": "nicolas.brosy@gmail.com"
+                }
+            ],
+            "description": "Laravel / Lumen package for Firebase Cloud Messaging ",
+            "keywords": [
+                "FCM",
+                "Firebase Cloud Messaging",
+                "firebase",
+                "laravel",
+                "lumen",
+                "notification",
+                "push"
+            ],
+            "time": "2017-04-20 06:27:21"
+        },
+        {
+            "name": "doctrine/inflector",
+            "version": "v1.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/inflector.git",
+                "reference": "90b2128806bfde671b6952ab8bea493942c1fdae"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/inflector/zipball/90b2128806bfde671b6952ab8bea493942c1fdae",
+                "reference": "90b2128806bfde671b6952ab8bea493942c1fdae",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "4.*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.1.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-0": {
+                    "Doctrine\\Common\\Inflector\\": "lib/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Benjamin Eberlei",
+                    "email": "kontakt@beberlei.de"
+                },
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Jonathan Wage",
+                    "email": "jonwage@gmail.com"
+                },
+                {
+                    "name": "Johannes Schmitt",
+                    "email": "schmittjoh@gmail.com"
+                }
+            ],
+            "description": "Common String Manipulations with regard to casing and singular/plural rules.",
+            "homepage": "http://www.doctrine-project.org",
+            "keywords": [
+                "inflection",
+                "pluralize",
+                "singularize",
+                "string"
+            ],
+            "time": "2015-11-06 14:35:42"
+        },
+        {
+            "name": "fremail/lumen-nested-route-groups",
+            "version": "1.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/fremail/lumen-nested-route-groups.git",
+                "reference": "bb0bef1a451d57d59037a608167757860d204105"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/fremail/lumen-nested-route-groups/zipball/bb0bef1a451d57d59037a608167757860d204105",
+                "reference": "bb0bef1a451d57d59037a608167757860d204105",
+                "shasum": ""
+            },
+            "require": {
+                "laravel/lumen-framework": "5.*",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Fremail\\NestedRouteGroups\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Anton Demushkin",
+                    "email": "fremail@yandex.com"
+                }
+            ],
+            "description": "Extends a lumen application for using nested route groups. In addition to the groups it's possible to use any() and match() methods.",
+            "keywords": [
+                "Match",
+                "any",
+                "group",
+                "lumen",
+                "route"
+            ],
+            "time": "2016-11-12 21:21:42"
+        },
+        {
+            "name": "guzzlehttp/guzzle",
+            "version": "6.3.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/guzzle/guzzle.git",
+                "reference": "f4db5a78a5ea468d4831de7f0bf9d9415e348699"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/guzzle/guzzle/zipball/f4db5a78a5ea468d4831de7f0bf9d9415e348699",
+                "reference": "f4db5a78a5ea468d4831de7f0bf9d9415e348699",
+                "shasum": ""
+            },
+            "require": {
+                "guzzlehttp/promises": "^1.0",
+                "guzzlehttp/psr7": "^1.4",
+                "php": ">=5.5"
+            },
+            "require-dev": {
+                "ext-curl": "*",
+                "phpunit/phpunit": "^4.0 || ^5.0",
+                "psr/log": "^1.0"
+            },
+            "suggest": {
+                "psr/log": "Required for using the Log middleware"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "6.2-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/functions_include.php"
+                ],
+                "psr-4": {
+                    "GuzzleHttp\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Michael Dowling",
+                    "email": "mtdowling@gmail.com",
+                    "homepage": "https://github.com/mtdowling"
+                }
+            ],
+            "description": "Guzzle is a PHP HTTP client library",
+            "homepage": "http://guzzlephp.org/",
+            "keywords": [
+                "client",
+                "curl",
+                "framework",
+                "http",
+                "http client",
+                "rest",
+                "web service"
+            ],
+            "time": "2017-06-22 18:50:49"
+        },
+        {
+            "name": "guzzlehttp/promises",
+            "version": "v1.3.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/guzzle/promises.git",
+                "reference": "a59da6cf61d80060647ff4d3eb2c03a2bc694646"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/guzzle/promises/zipball/a59da6cf61d80060647ff4d3eb2c03a2bc694646",
+                "reference": "a59da6cf61d80060647ff4d3eb2c03a2bc694646",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.4-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "GuzzleHttp\\Promise\\": "src/"
+                },
+                "files": [
+                    "src/functions_include.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Michael Dowling",
+                    "email": "mtdowling@gmail.com",
+                    "homepage": "https://github.com/mtdowling"
+                }
+            ],
+            "description": "Guzzle promises library",
+            "keywords": [
+                "promise"
+            ],
+            "time": "2016-12-20 10:07:11"
+        },
+        {
+            "name": "guzzlehttp/psr7",
+            "version": "1.4.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/guzzle/psr7.git",
+                "reference": "f5b8a8512e2b58b0071a7280e39f14f72e05d87c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/guzzle/psr7/zipball/f5b8a8512e2b58b0071a7280e39f14f72e05d87c",
+                "reference": "f5b8a8512e2b58b0071a7280e39f14f72e05d87c",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.4.0",
+                "psr/http-message": "~1.0"
+            },
+            "provide": {
+                "psr/http-message-implementation": "1.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "~4.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.4-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "GuzzleHttp\\Psr7\\": "src/"
+                },
+                "files": [
+                    "src/functions_include.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Michael Dowling",
+                    "email": "mtdowling@gmail.com",
+                    "homepage": "https://github.com/mtdowling"
+                },
+                {
+                    "name": "Tobias Schultze",
+                    "homepage": "https://github.com/Tobion"
+                }
+            ],
+            "description": "PSR-7 message implementation that also provides common utility methods",
+            "keywords": [
+                "http",
+                "message",
+                "request",
+                "response",
+                "stream",
+                "uri",
+                "url"
+            ],
+            "time": "2017-03-20 17:10:46"
+        },
+        {
+            "name": "illuminate/auth",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/auth.git",
+                "reference": "4098195b10a2c7a83f66bcd19663b4c60cd2106c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/auth/zipball/4098195b10a2c7a83f66bcd19663b4c60cd2106c",
+                "reference": "4098195b10a2c7a83f66bcd19663b4c60cd2106c",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/http": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "nesbot/carbon": "~1.20",
+                "php": ">=5.5.9"
+            },
+            "suggest": {
+                "illuminate/console": "Required to use the auth:clear-resets command (5.2.*).",
+                "illuminate/queue": "Required to fire login / logout events (5.2.*).",
+                "illuminate/session": "Required to use the session based guard (5.2.*)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Auth\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Auth package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/broadcasting",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/broadcasting.git",
+                "reference": "7137f24d2520697203d95bcac2d0831549b1ca0b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/broadcasting/zipball/7137f24d2520697203d95bcac2d0831549b1ca0b",
+                "reference": "7137f24d2520697203d95bcac2d0831549b1ca0b",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9"
+            },
+            "suggest": {
+                "pusher/pusher-php-server": "Required to use the Pusher broadcast driver (~2.0)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Broadcasting\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Broadcasting package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/bus",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/bus.git",
+                "reference": "1213ce87493bd2c0530051f86a2580bc1f60a7db"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/bus/zipball/1213ce87493bd2c0530051f86a2580bc1f60a7db",
+                "reference": "1213ce87493bd2c0530051f86a2580bc1f60a7db",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/pipeline": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Bus\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Bus package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-02 12:44:26"
+        },
+        {
+            "name": "illuminate/cache",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/cache.git",
+                "reference": "09bcee8982c40570947b799d65987aa030d7706b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/cache/zipball/09bcee8982c40570947b799d65987aa030d7706b",
+                "reference": "09bcee8982c40570947b799d65987aa030d7706b",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "nesbot/carbon": "~1.20",
+                "php": ">=5.5.9"
+            },
+            "suggest": {
+                "illuminate/database": "Required to use the database cache driver (5.2.*).",
+                "illuminate/filesystem": "Required to use the file cache driver (5.2.*).",
+                "illuminate/redis": "Required to use the redis cache driver (5.2.*)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Cache\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Cache package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-18 14:17:46"
+        },
+        {
+            "name": "illuminate/config",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/config.git",
+                "reference": "2db869c5b5a675cece410a0d0bc634dba0f69998"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/config/zipball/2db869c5b5a675cece410a0d0bc634dba0f69998",
+                "reference": "2db869c5b5a675cece410a0d0bc634dba0f69998",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/filesystem": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Config\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Config package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/console",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/console.git",
+                "reference": "c6d838c6f9ac3f1aec28cde93bf613283153785e"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/console/zipball/c6d838c6f9ac3f1aec28cde93bf613283153785e",
+                "reference": "c6d838c6f9ac3f1aec28cde93bf613283153785e",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "nesbot/carbon": "~1.20",
+                "php": ">=5.5.9",
+                "symfony/console": "2.8.*|3.0.*"
+            },
+            "suggest": {
+                "guzzlehttp/guzzle": "Required to use the ping methods on schedules (~5.3|~6.0).",
+                "mtdowling/cron-expression": "Required to use scheduling component (~1.0).",
+                "symfony/process": "Required to use scheduling component (2.8.*|3.0.*)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Console\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Console package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/container",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/container.git",
+                "reference": "5139cebc8293b6820b91aef6f4b4e18bde33c9b2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/container/zipball/5139cebc8293b6820b91aef6f4b4e18bde33c9b2",
+                "reference": "5139cebc8293b6820b91aef6f4b4e18bde33c9b2",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Container\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Container package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/contracts",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/contracts.git",
+                "reference": "22bde7b048a33c702d9737fc1446234fff9b1363"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/contracts/zipball/22bde7b048a33c702d9737fc1446234fff9b1363",
+                "reference": "22bde7b048a33c702d9737fc1446234fff9b1363",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Contracts\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Contracts package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-08 11:46:08"
+        },
+        {
+            "name": "illuminate/database",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/database.git",
+                "reference": "4a70c0598ed41d18a99f23c12be4e22b5006d30a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/database/zipball/4a70c0598ed41d18a99f23c12be4e22b5006d30a",
+                "reference": "4a70c0598ed41d18a99f23c12be4e22b5006d30a",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/container": "5.2.*",
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "nesbot/carbon": "~1.20",
+                "php": ">=5.5.9"
+            },
+            "suggest": {
+                "doctrine/dbal": "Required to rename columns and drop SQLite columns (~2.4).",
+                "fzaninotto/faker": "Required to use the eloquent factory builder (~1.4).",
+                "illuminate/console": "Required to use the database commands (5.2.*).",
+                "illuminate/events": "Required to use the observers with Eloquent (5.2.*).",
+                "illuminate/filesystem": "Required to use the migrations (5.2.*).",
+                "illuminate/pagination": "Required to paginate the result set (5.2.*)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Database\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Database package.",
+            "homepage": "http://laravel.com",
+            "keywords": [
+                "database",
+                "laravel",
+                "orm",
+                "sql"
+            ],
+            "time": "2016-08-25 07:01:20"
+        },
+        {
+            "name": "illuminate/encryption",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/encryption.git",
+                "reference": "9e930c111c35850d5c133316c8b0c61dcccaa942"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/encryption/zipball/9e930c111c35850d5c133316c8b0c61dcccaa942",
+                "reference": "9e930c111c35850d5c133316c8b0c61dcccaa942",
+                "shasum": ""
+            },
+            "require": {
+                "ext-mbstring": "*",
+                "ext-openssl": "*",
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "paragonie/random_compat": "~1.4",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Encryption\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Encryption package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/events",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/events.git",
+                "reference": "9c16e022d9c4b9f875bf447f4384bd1b952c69b9"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/events/zipball/9c16e022d9c4b9f875bf447f4384bd1b952c69b9",
+                "reference": "9c16e022d9c4b9f875bf447f4384bd1b952c69b9",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/container": "5.2.*",
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Events\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Events package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/filesystem",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/filesystem.git",
+                "reference": "39668a50e0cf1d673e58e7dbb437475708cfb508"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/filesystem/zipball/39668a50e0cf1d673e58e7dbb437475708cfb508",
+                "reference": "39668a50e0cf1d673e58e7dbb437475708cfb508",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9",
+                "symfony/finder": "2.8.*|3.0.*"
+            },
+            "suggest": {
+                "league/flysystem": "Required to use the Flysystem local and FTP drivers (~1.0).",
+                "league/flysystem-aws-s3-v3": "Required to use the Flysystem S3 driver (~1.0).",
+                "league/flysystem-rackspace": "Required to use the Flysystem Rackspace driver (~1.0)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Filesystem\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Filesystem package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-17 17:21:29"
+        },
+        {
+            "name": "illuminate/hashing",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/hashing.git",
+                "reference": "a38de58f53a085888feb432acce8a6ea7c1a5b71"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/hashing/zipball/a38de58f53a085888feb432acce8a6ea7c1a5b71",
+                "reference": "a38de58f53a085888feb432acce8a6ea7c1a5b71",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Hashing\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Hashing package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/http",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/http.git",
+                "reference": "019d947e218f8dce421010a22d899d6f4b4ced45"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/http/zipball/019d947e218f8dce421010a22d899d6f4b4ced45",
+                "reference": "019d947e218f8dce421010a22d899d6f4b4ced45",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/session": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9",
+                "symfony/http-foundation": "2.8.*|3.0.*",
+                "symfony/http-kernel": "2.8.*|3.0.*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Http\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Http package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-10 17:33:08"
+        },
+        {
+            "name": "illuminate/pagination",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/pagination.git",
+                "reference": "a4450887251f443a1243ef537d98ce5bbea6b193"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/pagination/zipball/a4450887251f443a1243ef537d98ce5bbea6b193",
+                "reference": "a4450887251f443a1243ef537d98ce5bbea6b193",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Pagination\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Pagination package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/pipeline",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/pipeline.git",
+                "reference": "592d84b101437de3432851e4fa60a33f849164e5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/pipeline/zipball/592d84b101437de3432851e4fa60a33f849164e5",
+                "reference": "592d84b101437de3432851e4fa60a33f849164e5",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Pipeline\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Pipeline package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/queue",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/queue.git",
+                "reference": "363b6752051327b7e4e500e6d2fa5ae132ccef47"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/queue/zipball/363b6752051327b7e4e500e6d2fa5ae132ccef47",
+                "reference": "363b6752051327b7e4e500e6d2fa5ae132ccef47",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/console": "5.2.*",
+                "illuminate/container": "5.2.*",
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "nesbot/carbon": "~1.20",
+                "php": ">=5.5.9",
+                "symfony/debug": "2.8.*|3.0.*",
+                "symfony/process": "2.8.*|3.0.*"
+            },
+            "suggest": {
+                "aws/aws-sdk-php": "Required to use the SQS queue driver (~3.0).",
+                "illuminate/redis": "Required to use the Redis queue driver (5.2.*).",
+                "pda/pheanstalk": "Required to use the Beanstalk queue driver (~3.0)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Queue\\": ""
+                },
+                "classmap": [
+                    "IlluminateQueueClosure.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Queue package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/session",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/session.git",
+                "reference": "259ae8eaee714b4633b3ee4e51e98648840a976c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/session/zipball/259ae8eaee714b4633b3ee4e51e98648840a976c",
+                "reference": "259ae8eaee714b4633b3ee4e51e98648840a976c",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "nesbot/carbon": "~1.20",
+                "php": ">=5.5.9",
+                "symfony/finder": "2.8.*|3.0.*",
+                "symfony/http-foundation": "2.8.*|3.0.*"
+            },
+            "suggest": {
+                "illuminate/console": "Required to use the session:table command (5.2.*)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Session\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Session package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/support",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/support.git",
+                "reference": "510230ab62a7d85dc70203f4fdca6fb71a19e08a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/support/zipball/510230ab62a7d85dc70203f4fdca6fb71a19e08a",
+                "reference": "510230ab62a7d85dc70203f4fdca6fb71a19e08a",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/inflector": "~1.0",
+                "ext-mbstring": "*",
+                "illuminate/contracts": "5.2.*",
+                "paragonie/random_compat": "~1.4",
+                "php": ">=5.5.9"
+            },
+            "replace": {
+                "tightenco/collect": "self.version"
+            },
+            "suggest": {
+                "illuminate/filesystem": "Required to use the composer class (5.2.*).",
+                "jeremeamia/superclosure": "Required to be able to serialize closures (~2.2).",
+                "symfony/polyfill-php56": "Required to use the hash_equals function on PHP 5.5 (~1.0).",
+                "symfony/process": "Required to use the composer class (2.8.*|3.0.*).",
+                "symfony/var-dumper": "Improves the dd function (2.8.*|3.0.*)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Support\\": ""
+                },
+                "files": [
+                    "helpers.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Support package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-05 14:49:58"
+        },
+        {
+            "name": "illuminate/translation",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/translation.git",
+                "reference": "19247e4194e110d2d37713709e0e4b8bd0cae620"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/translation/zipball/19247e4194e110d2d37713709e0e4b8bd0cae620",
+                "reference": "19247e4194e110d2d37713709e0e4b8bd0cae620",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/filesystem": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9",
+                "symfony/translation": "2.8.*|3.0.*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Translation\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Translation package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "illuminate/validation",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/validation.git",
+                "reference": "24909f0ee0866256eca0a0b72977753886a8a479"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/validation/zipball/24909f0ee0866256eca0a0b72977753886a8a479",
+                "reference": "24909f0ee0866256eca0a0b72977753886a8a479",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/container": "5.2.*",
+                "illuminate/contracts": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9",
+                "symfony/http-foundation": "2.8.*|3.0.*",
+                "symfony/translation": "2.8.*|3.0.*"
+            },
+            "suggest": {
+                "illuminate/database": "Required to use the database presence verifier (5.2.*)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\Validation\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate Validation package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-18 13:15:33"
+        },
+        {
+            "name": "illuminate/view",
+            "version": "v5.2.45",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/illuminate/view.git",
+                "reference": "a3f9252c7d0dce3c2a9e70e40e9397f62850aa23"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/illuminate/view/zipball/a3f9252c7d0dce3c2a9e70e40e9397f62850aa23",
+                "reference": "a3f9252c7d0dce3c2a9e70e40e9397f62850aa23",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/container": "5.2.*",
+                "illuminate/contracts": "5.2.*",
+                "illuminate/events": "5.2.*",
+                "illuminate/filesystem": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "php": ">=5.5.9",
+                "symfony/debug": "2.8.*|3.0.*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Illuminate\\View\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Illuminate View package.",
+            "homepage": "http://laravel.com",
+            "time": "2016-08-01 13:49:14"
+        },
+        {
+            "name": "laravel/lumen-framework",
+            "version": "v5.2.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/lumen-framework.git",
+                "reference": "dafb4d4aad71d7ab8914db7769c4bbfcff4073f1"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/lumen-framework/zipball/dafb4d4aad71d7ab8914db7769c4bbfcff4073f1",
+                "reference": "dafb4d4aad71d7ab8914db7769c4bbfcff4073f1",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/auth": "5.2.*",
+                "illuminate/broadcasting": "5.2.*",
+                "illuminate/bus": "5.2.*",
+                "illuminate/cache": "5.2.*",
+                "illuminate/config": "5.2.*",
+                "illuminate/container": "5.2.*",
+                "illuminate/contracts": "5.2.*",
+                "illuminate/database": "5.2.*",
+                "illuminate/encryption": "5.2.*",
+                "illuminate/events": "5.2.*",
+                "illuminate/filesystem": "5.2.*",
+                "illuminate/hashing": "5.2.*",
+                "illuminate/http": "5.2.*",
+                "illuminate/pagination": "5.2.*",
+                "illuminate/pipeline": "5.2.*",
+                "illuminate/queue": "5.2.*",
+                "illuminate/support": "5.2.*",
+                "illuminate/translation": "5.2.*",
+                "illuminate/validation": "~5.2.7",
+                "illuminate/view": "5.2.*",
+                "monolog/monolog": "~1.11",
+                "mtdowling/cron-expression": "~1.0",
+                "nikic/fast-route": "0.7.*",
+                "paragonie/random_compat": "~1.1",
+                "php": ">=5.5.9",
+                "symfony/http-foundation": "2.8.*|3.0.*",
+                "symfony/http-kernel": "2.8.*|3.0.*",
+                "symfony/polyfill-php56": "~1.0"
+            },
+            "require-dev": {
+                "mockery/mockery": "~0.9",
+                "phpunit/phpunit": "~4.0"
+            },
+            "suggest": {
+                "vlucas/phpdotenv": "Required to use .env files (~2.2)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Laravel\\Lumen\\": "src/"
+                },
+                "files": [
+                    "src/helpers.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylorotwell@gmail.com"
+                }
+            ],
+            "description": "The Laravel Lumen Framework.",
+            "homepage": "http://laravel.com",
+            "keywords": [
+                "framework",
+                "laravel",
+                "lumen"
+            ],
+            "time": "2016-09-07 18:38:25"
+        },
+        {
+            "name": "monolog/monolog",
+            "version": "1.23.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/Seldaek/monolog.git",
+                "reference": "fd8c787753b3a2ad11bc60c063cff1358a32a3b4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/Seldaek/monolog/zipball/fd8c787753b3a2ad11bc60c063cff1358a32a3b4",
+                "reference": "fd8c787753b3a2ad11bc60c063cff1358a32a3b4",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.0",
+                "psr/log": "~1.0"
+            },
+            "provide": {
+                "psr/log-implementation": "1.0.0"
+            },
+            "require-dev": {
+                "aws/aws-sdk-php": "^2.4.9 || ^3.0",
+                "doctrine/couchdb": "~1.0@dev",
+                "graylog2/gelf-php": "~1.0",
+                "jakub-onderka/php-parallel-lint": "0.9",
+                "php-amqplib/php-amqplib": "~2.4",
+                "php-console/php-console": "^3.1.3",
+                "phpunit/phpunit": "~4.5",
+                "phpunit/phpunit-mock-objects": "2.3.0",
+                "ruflin/elastica": ">=0.90 <3.0",
+                "sentry/sentry": "^0.13",
+                "swiftmailer/swiftmailer": "^5.3|^6.0"
+            },
+            "suggest": {
+                "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+                "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+                "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+                "ext-mongo": "Allow sending log messages to a MongoDB server",
+                "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+                "mongodb/mongodb": "Allow sending log messages to a MongoDB server via PHP Driver",
+                "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib",
+                "php-console/php-console": "Allow sending log messages to Google Chrome",
+                "rollbar/rollbar": "Allow sending log messages to Rollbar",
+                "ruflin/elastica": "Allow sending log messages to an Elastic Search server",
+                "sentry/sentry": "Allow sending log messages to a Sentry server"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Monolog\\": "src/Monolog"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jordi Boggiano",
+                    "email": "j.boggiano@seld.be",
+                    "homepage": "http://seld.be"
+                }
+            ],
+            "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+            "homepage": "http://github.com/Seldaek/monolog",
+            "keywords": [
+                "log",
+                "logging",
+                "psr-3"
+            ],
+            "time": "2017-06-19 01:22:40"
+        },
+        {
+            "name": "mtdowling/cron-expression",
+            "version": "v1.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/mtdowling/cron-expression.git",
+                "reference": "9504fa9ea681b586028adaaa0877db4aecf32bad"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/mtdowling/cron-expression/zipball/9504fa9ea681b586028adaaa0877db4aecf32bad",
+                "reference": "9504fa9ea681b586028adaaa0877db4aecf32bad",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "~4.0|~5.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Cron\\": "src/Cron/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Michael Dowling",
+                    "email": "mtdowling@gmail.com",
+                    "homepage": "https://github.com/mtdowling"
+                }
+            ],
+            "description": "CRON for PHP: Calculate the next or previous run date and determine if a CRON expression is due",
+            "keywords": [
+                "cron",
+                "schedule"
+            ],
+            "time": "2017-01-23 04:29:33"
+        },
+        {
+            "name": "nesbot/carbon",
+            "version": "1.22.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/briannesbitt/Carbon.git",
+                "reference": "7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/briannesbitt/Carbon/zipball/7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc",
+                "reference": "7cdf42c0b1cc763ab7e4c33c47a24e27c66bfccc",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.0",
+                "symfony/translation": "~2.6 || ~3.0"
+            },
+            "require-dev": {
+                "friendsofphp/php-cs-fixer": "~2",
+                "phpunit/phpunit": "~4.0 || ~5.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.23-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Carbon\\": "src/Carbon/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Brian Nesbitt",
+                    "email": "brian@nesbot.com",
+                    "homepage": "http://nesbot.com"
+                }
+            ],
+            "description": "A simple API extension for DateTime.",
+            "homepage": "http://carbon.nesbot.com",
+            "keywords": [
+                "date",
+                "datetime",
+                "time"
+            ],
+            "time": "2017-01-16 07:55:07"
+        },
+        {
+            "name": "nikic/fast-route",
+            "version": "v0.7.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/nikic/FastRoute.git",
+                "reference": "8164b4a0d8afde4eae5f1bfc39084972ba23ad36"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/nikic/FastRoute/zipball/8164b4a0d8afde4eae5f1bfc39084972ba23ad36",
+                "reference": "8164b4a0d8afde4eae5f1bfc39084972ba23ad36",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.4.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "FastRoute\\": "src/"
+                },
+                "files": [
+                    "src/functions.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Nikita Popov",
+                    "email": "nikic@php.net"
+                }
+            ],
+            "description": "Fast request router for PHP",
+            "keywords": [
+                "router",
+                "routing"
+            ],
+            "time": "2015-12-20 19:50:12"
+        },
+        {
+            "name": "paragonie/random_compat",
+            "version": "v1.4.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/paragonie/random_compat.git",
+                "reference": "965cdeb01fdcab7653253aa81d40441d261f1e66"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/paragonie/random_compat/zipball/965cdeb01fdcab7653253aa81d40441d261f1e66",
+                "reference": "965cdeb01fdcab7653253aa81d40441d261f1e66",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.2.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "4.*|5.*"
+            },
+            "suggest": {
+                "ext-libsodium": "Provides a modern crypto API that can be used to generate random bytes."
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "lib/random.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Paragon Initiative Enterprises",
+                    "email": "security@paragonie.com",
+                    "homepage": "https://paragonie.com"
+                }
+            ],
+            "description": "PHP 5.x polyfill for random_bytes() and random_int() from PHP 7",
+            "keywords": [
+                "csprng",
+                "pseudorandom",
+                "random"
+            ],
+            "time": "2017-03-13 16:22:52"
+        },
+        {
+            "name": "psr/http-message",
+            "version": "1.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-message.git",
+                "reference": "f6561bf28d520154e4b0ec72be95418abe6d9363"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-message/zipball/f6561bf28d520154e4b0ec72be95418abe6d9363",
+                "reference": "f6561bf28d520154e4b0ec72be95418abe6d9363",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Http\\Message\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "http://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for HTTP messages",
+            "homepage": "https://github.com/php-fig/http-message",
+            "keywords": [
+                "http",
+                "http-message",
+                "psr",
+                "psr-7",
+                "request",
+                "response"
+            ],
+            "time": "2016-08-06 14:39:51"
+        },
+        {
+            "name": "psr/log",
+            "version": "1.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/log.git",
+                "reference": "4ebe3a8bf773a19edfe0a84b6585ba3d401b724d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/log/zipball/4ebe3a8bf773a19edfe0a84b6585ba3d401b724d",
+                "reference": "4ebe3a8bf773a19edfe0a84b6585ba3d401b724d",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Log\\": "Psr/Log/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "http://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for logging libraries",
+            "homepage": "https://github.com/php-fig/log",
+            "keywords": [
+                "log",
+                "psr",
+                "psr-3"
+            ],
+            "time": "2016-10-10 12:19:37"
+        },
+        {
+            "name": "symfony/console",
+            "version": "v3.0.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/console.git",
+                "reference": "926061e74229e935d3c5b4e9ba87237316c6693f"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/console/zipball/926061e74229e935d3c5b4e9ba87237316c6693f",
+                "reference": "926061e74229e935d3c5b4e9ba87237316c6693f",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9",
+                "symfony/polyfill-mbstring": "~1.0"
+            },
+            "require-dev": {
+                "psr/log": "~1.0",
+                "symfony/event-dispatcher": "~2.8|~3.0",
+                "symfony/process": "~2.8|~3.0"
+            },
+            "suggest": {
+                "psr/log": "For using the console logger",
+                "symfony/event-dispatcher": "",
+                "symfony/process": ""
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Console\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony Console Component",
+            "homepage": "https://symfony.com",
+            "time": "2016-07-30 07:22:48"
+        },
+        {
+            "name": "symfony/debug",
+            "version": "v3.0.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/debug.git",
+                "reference": "697c527acd9ea1b2d3efac34d9806bf255278b0a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/debug/zipball/697c527acd9ea1b2d3efac34d9806bf255278b0a",
+                "reference": "697c527acd9ea1b2d3efac34d9806bf255278b0a",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9",
+                "psr/log": "~1.0"
+            },
+            "conflict": {
+                "symfony/http-kernel": ">=2.3,<2.3.24|~2.4.0|>=2.5,<2.5.9|>=2.6,<2.6.2"
+            },
+            "require-dev": {
+                "symfony/class-loader": "~2.8|~3.0",
+                "symfony/http-kernel": "~2.8|~3.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Debug\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony Debug Component",
+            "homepage": "https://symfony.com",
+            "time": "2016-07-30 07:22:48"
+        },
+        {
+            "name": "symfony/event-dispatcher",
+            "version": "v3.3.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/event-dispatcher.git",
+                "reference": "67535f1e3fd662bdc68d7ba317c93eecd973617e"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/event-dispatcher/zipball/67535f1e3fd662bdc68d7ba317c93eecd973617e",
+                "reference": "67535f1e3fd662bdc68d7ba317c93eecd973617e",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9"
+            },
+            "conflict": {
+                "symfony/dependency-injection": "<3.3"
+            },
+            "require-dev": {
+                "psr/log": "~1.0",
+                "symfony/config": "~2.8|~3.0",
+                "symfony/dependency-injection": "~3.3",
+                "symfony/expression-language": "~2.8|~3.0",
+                "symfony/stopwatch": "~2.8|~3.0"
+            },
+            "suggest": {
+                "symfony/dependency-injection": "",
+                "symfony/http-kernel": ""
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.3-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\EventDispatcher\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony EventDispatcher Component",
+            "homepage": "https://symfony.com",
+            "time": "2017-06-09 14:53:08"
+        },
+        {
+            "name": "symfony/finder",
+            "version": "v3.0.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/finder.git",
+                "reference": "3eb4e64c6145ef8b92adefb618a74ebdde9e3fe9"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/finder/zipball/3eb4e64c6145ef8b92adefb618a74ebdde9e3fe9",
+                "reference": "3eb4e64c6145ef8b92adefb618a74ebdde9e3fe9",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Finder\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony Finder Component",
+            "homepage": "https://symfony.com",
+            "time": "2016-06-29 05:40:00"
+        },
+        {
+            "name": "symfony/http-foundation",
+            "version": "v3.0.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/http-foundation.git",
+                "reference": "49ba00f8ede742169cb6b70abe33243f4d673f82"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/http-foundation/zipball/49ba00f8ede742169cb6b70abe33243f4d673f82",
+                "reference": "49ba00f8ede742169cb6b70abe33243f4d673f82",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9",
+                "symfony/polyfill-mbstring": "~1.1"
+            },
+            "require-dev": {
+                "symfony/expression-language": "~2.8|~3.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\HttpFoundation\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony HttpFoundation Component",
+            "homepage": "https://symfony.com",
+            "time": "2016-07-17 13:54:30"
+        },
+        {
+            "name": "symfony/http-kernel",
+            "version": "v3.0.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/http-kernel.git",
+                "reference": "d97ba4425e36e79c794e7d14ff36f00f081b37b3"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/http-kernel/zipball/d97ba4425e36e79c794e7d14ff36f00f081b37b3",
+                "reference": "d97ba4425e36e79c794e7d14ff36f00f081b37b3",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9",
+                "psr/log": "~1.0",
+                "symfony/debug": "~2.8|~3.0",
+                "symfony/event-dispatcher": "~2.8|~3.0",
+                "symfony/http-foundation": "~2.8.8|~3.0.8|~3.1.2|~3.2"
+            },
+            "conflict": {
+                "symfony/config": "<2.8"
+            },
+            "require-dev": {
+                "symfony/browser-kit": "~2.8|~3.0",
+                "symfony/class-loader": "~2.8|~3.0",
+                "symfony/config": "~2.8|~3.0",
+                "symfony/console": "~2.8|~3.0",
+                "symfony/css-selector": "~2.8|~3.0",
+                "symfony/dependency-injection": "~2.8|~3.0",
+                "symfony/dom-crawler": "~2.8|~3.0",
+                "symfony/expression-language": "~2.8|~3.0",
+                "symfony/finder": "~2.8|~3.0",
+                "symfony/process": "~2.8|~3.0",
+                "symfony/routing": "~2.8|~3.0",
+                "symfony/stopwatch": "~2.8|~3.0",
+                "symfony/templating": "~2.8|~3.0",
+                "symfony/translation": "~2.8|~3.0",
+                "symfony/var-dumper": "~2.8|~3.0"
+            },
+            "suggest": {
+                "symfony/browser-kit": "",
+                "symfony/class-loader": "",
+                "symfony/config": "",
+                "symfony/console": "",
+                "symfony/dependency-injection": "",
+                "symfony/finder": "",
+                "symfony/var-dumper": ""
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\HttpKernel\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony HttpKernel Component",
+            "homepage": "https://symfony.com",
+            "time": "2016-07-30 09:10:37"
+        },
+        {
+            "name": "symfony/polyfill-mbstring",
+            "version": "v1.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-mbstring.git",
+                "reference": "f29dca382a6485c3cbe6379f0c61230167681937"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/f29dca382a6485c3cbe6379f0c61230167681937",
+                "reference": "f29dca382a6485c3cbe6379f0c61230167681937",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3"
+            },
+            "suggest": {
+                "ext-mbstring": "For best performance"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.4-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Polyfill\\Mbstring\\": ""
+                },
+                "files": [
+                    "bootstrap.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill for the Mbstring extension",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "mbstring",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "time": "2017-06-09 14:24:12"
+        },
+        {
+            "name": "symfony/polyfill-php56",
+            "version": "v1.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-php56.git",
+                "reference": "bc0b7d6cb36b10cfabb170a3e359944a95174929"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-php56/zipball/bc0b7d6cb36b10cfabb170a3e359944a95174929",
+                "reference": "bc0b7d6cb36b10cfabb170a3e359944a95174929",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3",
+                "symfony/polyfill-util": "~1.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.4-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Polyfill\\Php56\\": ""
+                },
+                "files": [
+                    "bootstrap.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill backporting some PHP 5.6+ features to lower PHP versions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "time": "2017-06-09 08:25:21"
+        },
+        {
+            "name": "symfony/polyfill-util",
+            "version": "v1.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-util.git",
+                "reference": "ebccbde4aad410f6438d86d7d261c6b4d2b9a51d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-util/zipball/ebccbde4aad410f6438d86d7d261c6b4d2b9a51d",
+                "reference": "ebccbde4aad410f6438d86d7d261c6b4d2b9a51d",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.4-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Polyfill\\Util\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony utilities for portability of PHP codes",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compat",
+                "compatibility",
+                "polyfill",
+                "shim"
+            ],
+            "time": "2017-06-09 08:25:21"
+        },
+        {
+            "name": "symfony/process",
+            "version": "v3.0.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/process.git",
+                "reference": "768debc5996f599c4372b322d9061dba2a4bf505"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/process/zipball/768debc5996f599c4372b322d9061dba2a4bf505",
+                "reference": "768debc5996f599c4372b322d9061dba2a4bf505",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Process\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony Process Component",
+            "homepage": "https://symfony.com",
+            "time": "2016-07-28 11:13:34"
+        },
+        {
+            "name": "symfony/translation",
+            "version": "v3.0.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/translation.git",
+                "reference": "eee6c664853fd0576f21ae25725cfffeafe83f26"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/translation/zipball/eee6c664853fd0576f21ae25725cfffeafe83f26",
+                "reference": "eee6c664853fd0576f21ae25725cfffeafe83f26",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9",
+                "symfony/polyfill-mbstring": "~1.0"
+            },
+            "conflict": {
+                "symfony/config": "<2.8"
+            },
+            "require-dev": {
+                "psr/log": "~1.0",
+                "symfony/config": "~2.8|~3.0",
+                "symfony/intl": "~2.8|~3.0",
+                "symfony/yaml": "~2.8|~3.0"
+            },
+            "suggest": {
+                "psr/log": "To use logging capability in translator",
+                "symfony/config": "",
+                "symfony/yaml": ""
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Translation\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony Translation Component",
+            "homepage": "https://symfony.com",
+            "time": "2016-07-30 07:22:48"
+        },
+        {
+            "name": "vlucas/phpdotenv",
+            "version": "v2.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/vlucas/phpdotenv.git",
+                "reference": "3cc116adbe4b11be5ec557bf1d24dc5e3a21d18c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/vlucas/phpdotenv/zipball/3cc116adbe4b11be5ec557bf1d24dc5e3a21d18c",
+                "reference": "3cc116adbe4b11be5ec557bf1d24dc5e3a21d18c",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.9"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.8 || ^5.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.4-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Dotenv\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause-Attribution"
+            ],
+            "authors": [
+                {
+                    "name": "Vance Lucas",
+                    "email": "vance@vancelucas.com",
+                    "homepage": "http://www.vancelucas.com"
+                }
+            ],
+            "description": "Loads environment variables from `.env` to `getenv()`, `$_ENV` and `$_SERVER` automagically.",
+            "keywords": [
+                "dotenv",
+                "env",
+                "environment"
+            ],
+            "time": "2016-09-01 10:05:43"
+        }
+    ],
+    "packages-dev": [
+        {
+            "name": "doctrine/instantiator",
+            "version": "1.0.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/instantiator.git",
+                "reference": "8e884e78f9f0eb1329e445619e04456e64d8051d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/instantiator/zipball/8e884e78f9f0eb1329e445619e04456e64d8051d",
+                "reference": "8e884e78f9f0eb1329e445619e04456e64d8051d",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3,<8.0-DEV"
+            },
+            "require-dev": {
+                "athletic/athletic": "~0.1.8",
+                "ext-pdo": "*",
+                "ext-phar": "*",
+                "phpunit/phpunit": "~4.0",
+                "squizlabs/php_codesniffer": "~2.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Instantiator\\": "src/Doctrine/Instantiator/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Marco Pivetta",
+                    "email": "ocramius@gmail.com",
+                    "homepage": "http://ocramius.github.com/"
+                }
+            ],
+            "description": "A small, lightweight utility to instantiate objects in PHP without invoking their constructors",
+            "homepage": "https://github.com/doctrine/instantiator",
+            "keywords": [
+                "constructor",
+                "instantiate"
+            ],
+            "time": "2015-06-14 21:17:01"
+        },
+        {
+            "name": "fzaninotto/faker",
+            "version": "v1.6.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/fzaninotto/Faker.git",
+                "reference": "44f9a286a04b80c76a4e5fb7aad8bb539b920123"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/fzaninotto/Faker/zipball/44f9a286a04b80c76a4e5fb7aad8bb539b920123",
+                "reference": "44f9a286a04b80c76a4e5fb7aad8bb539b920123",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^5.3.3|^7.0"
+            },
+            "require-dev": {
+                "ext-intl": "*",
+                "phpunit/phpunit": "~4.0",
+                "squizlabs/php_codesniffer": "~1.5"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": []
+            },
+            "autoload": {
+                "psr-4": {
+                    "Faker\\": "src/Faker/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "François Zaninotto"
+                }
+            ],
+            "description": "Faker is a PHP library that generates fake data for you.",
+            "keywords": [
+                "data",
+                "faker",
+                "fixtures"
+            ],
+            "time": "2016-04-29 12:21:54"
+        },
+        {
+            "name": "phpdocumentor/reflection-common",
+            "version": "1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/ReflectionCommon.git",
+                "reference": "144c307535e82c8fdcaacbcfc1d6d8eeb896687c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/144c307535e82c8fdcaacbcfc1d6d8eeb896687c",
+                "reference": "144c307535e82c8fdcaacbcfc1d6d8eeb896687c",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.6"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": [
+                        "src"
+                    ]
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jaap van Otterdijk",
+                    "email": "opensource@ijaap.nl"
+                }
+            ],
+            "description": "Common reflection classes used by phpdocumentor to reflect the code structure",
+            "homepage": "http://www.phpdoc.org",
+            "keywords": [
+                "FQSEN",
+                "phpDocumentor",
+                "phpdoc",
+                "reflection",
+                "static analysis"
+            ],
+            "time": "2015-12-27 11:43:31"
+        },
+        {
+            "name": "phpdocumentor/reflection-docblock",
+            "version": "3.2.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/ReflectionDocBlock.git",
+                "reference": "4aada1f93c72c35e22fb1383b47fee43b8f1d157"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/ReflectionDocBlock/zipball/4aada1f93c72c35e22fb1383b47fee43b8f1d157",
+                "reference": "4aada1f93c72c35e22fb1383b47fee43b8f1d157",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5",
+                "phpdocumentor/reflection-common": "^1.0@dev",
+                "phpdocumentor/type-resolver": "^0.3.0",
+                "webmozart/assert": "^1.0"
+            },
+            "require-dev": {
+                "mockery/mockery": "^0.9.4",
+                "phpunit/phpunit": "^4.4"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": [
+                        "src/"
+                    ]
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Mike van Riel",
+                    "email": "me@mikevanriel.com"
+                }
+            ],
+            "description": "With this component, a library can provide support for annotations via DocBlocks or otherwise retrieve information that is embedded in a DocBlock.",
+            "time": "2017-08-08 06:39:58"
+        },
+        {
+            "name": "phpdocumentor/type-resolver",
+            "version": "0.3.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/TypeResolver.git",
+                "reference": "fb3933512008d8162b3cdf9e18dba9309b7c3773"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/fb3933512008d8162b3cdf9e18dba9309b7c3773",
+                "reference": "fb3933512008d8162b3cdf9e18dba9309b7c3773",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^5.5 || ^7.0",
+                "phpdocumentor/reflection-common": "^1.0"
+            },
+            "require-dev": {
+                "mockery/mockery": "^0.9.4",
+                "phpunit/phpunit": "^5.2||^4.8.24"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": [
+                        "src/"
+                    ]
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Mike van Riel",
+                    "email": "me@mikevanriel.com"
+                }
+            ],
+            "time": "2017-06-03 08:32:36"
+        },
+        {
+            "name": "phpspec/prophecy",
+            "version": "v1.7.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpspec/prophecy.git",
+                "reference": "93d39f1f7f9326d746203c7c056f300f7f126073"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpspec/prophecy/zipball/93d39f1f7f9326d746203c7c056f300f7f126073",
+                "reference": "93d39f1f7f9326d746203c7c056f300f7f126073",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/instantiator": "^1.0.2",
+                "php": "^5.3|^7.0",
+                "phpdocumentor/reflection-docblock": "^2.0|^3.0.2",
+                "sebastian/comparator": "^1.1|^2.0",
+                "sebastian/recursion-context": "^1.0|^2.0|^3.0"
+            },
+            "require-dev": {
+                "phpspec/phpspec": "^2.5|^3.2",
+                "phpunit/phpunit": "^4.8 || ^5.6.5"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.6.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-0": {
+                    "Prophecy\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Konstantin Kudryashov",
+                    "email": "ever.zet@gmail.com",
+                    "homepage": "http://everzet.com"
+                },
+                {
+                    "name": "Marcello Duarte",
+                    "email": "marcello.duarte@gmail.com"
+                }
+            ],
+            "description": "Highly opinionated mocking framework for PHP 5.3+",
+            "homepage": "https://github.com/phpspec/prophecy",
+            "keywords": [
+                "Double",
+                "Dummy",
+                "fake",
+                "mock",
+                "spy",
+                "stub"
+            ],
+            "time": "2017-03-02 20:05:34"
+        },
+        {
+            "name": "phpunit/php-code-coverage",
+            "version": "2.2.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-code-coverage.git",
+                "reference": "eabf68b476ac7d0f73793aada060f1c1a9bf8979"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/eabf68b476ac7d0f73793aada060f1c1a9bf8979",
+                "reference": "eabf68b476ac7d0f73793aada060f1c1a9bf8979",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3",
+                "phpunit/php-file-iterator": "~1.3",
+                "phpunit/php-text-template": "~1.2",
+                "phpunit/php-token-stream": "~1.3",
+                "sebastian/environment": "^1.3.2",
+                "sebastian/version": "~1.0"
+            },
+            "require-dev": {
+                "ext-xdebug": ">=2.1.4",
+                "phpunit/phpunit": "~4"
+            },
+            "suggest": {
+                "ext-dom": "*",
+                "ext-xdebug": ">=2.2.1",
+                "ext-xmlwriter": "*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.2.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sb@sebastian-bergmann.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library that provides collection, processing, and rendering functionality for PHP code coverage information.",
+            "homepage": "https://github.com/sebastianbergmann/php-code-coverage",
+            "keywords": [
+                "coverage",
+                "testing",
+                "xunit"
+            ],
+            "time": "2015-10-06 15:47:00"
+        },
+        {
+            "name": "phpunit/php-file-iterator",
+            "version": "1.4.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-file-iterator.git",
+                "reference": "3cc8f69b3028d0f96a9078e6295d86e9bf019be5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/3cc8f69b3028d0f96a9078e6295d86e9bf019be5",
+                "reference": "3cc8f69b3028d0f96a9078e6295d86e9bf019be5",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.4.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sb@sebastian-bergmann.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "FilterIterator implementation that filters files based on a list of suffixes.",
+            "homepage": "https://github.com/sebastianbergmann/php-file-iterator/",
+            "keywords": [
+                "filesystem",
+                "iterator"
+            ],
+            "time": "2016-10-03 07:40:28"
+        },
+        {
+            "name": "phpunit/php-text-template",
+            "version": "1.2.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-text-template.git",
+                "reference": "31f8b717e51d9a2afca6c9f046f5d69fc27c8686"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/31f8b717e51d9a2afca6c9f046f5d69fc27c8686",
+                "reference": "31f8b717e51d9a2afca6c9f046f5d69fc27c8686",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3"
+            },
+            "type": "library",
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Simple template engine.",
+            "homepage": "https://github.com/sebastianbergmann/php-text-template/",
+            "keywords": [
+                "template"
+            ],
+            "time": "2015-06-21 13:50:34"
+        },
+        {
+            "name": "phpunit/php-timer",
+            "version": "1.0.9",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-timer.git",
+                "reference": "3dcf38ca72b158baf0bc245e9184d3fdffa9c46f"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/3dcf38ca72b158baf0bc245e9184d3fdffa9c46f",
+                "reference": "3dcf38ca72b158baf0bc245e9184d3fdffa9c46f",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^5.3.3 || ^7.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.8.35 || ^5.7 || ^6.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sb@sebastian-bergmann.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Utility class for timing",
+            "homepage": "https://github.com/sebastianbergmann/php-timer/",
+            "keywords": [
+                "timer"
+            ],
+            "time": "2017-02-26 11:10:40"
+        },
+        {
+            "name": "phpunit/php-token-stream",
+            "version": "1.4.11",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-token-stream.git",
+                "reference": "e03f8f67534427a787e21a385a67ec3ca6978ea7"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-token-stream/zipball/e03f8f67534427a787e21a385a67ec3ca6978ea7",
+                "reference": "e03f8f67534427a787e21a385a67ec3ca6978ea7",
+                "shasum": ""
+            },
+            "require": {
+                "ext-tokenizer": "*",
+                "php": ">=5.3.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "~4.2"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.4-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Wrapper around PHP's tokenizer extension.",
+            "homepage": "https://github.com/sebastianbergmann/php-token-stream/",
+            "keywords": [
+                "tokenizer"
+            ],
+            "time": "2017-02-27 10:12:30"
+        },
+        {
+            "name": "phpunit/phpunit",
+            "version": "4.8.36",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/phpunit.git",
+                "reference": "46023de9a91eec7dfb06cc56cb4e260017298517"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/46023de9a91eec7dfb06cc56cb4e260017298517",
+                "reference": "46023de9a91eec7dfb06cc56cb4e260017298517",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-json": "*",
+                "ext-pcre": "*",
+                "ext-reflection": "*",
+                "ext-spl": "*",
+                "php": ">=5.3.3",
+                "phpspec/prophecy": "^1.3.1",
+                "phpunit/php-code-coverage": "~2.1",
+                "phpunit/php-file-iterator": "~1.4",
+                "phpunit/php-text-template": "~1.2",
+                "phpunit/php-timer": "^1.0.6",
+                "phpunit/phpunit-mock-objects": "~2.3",
+                "sebastian/comparator": "~1.2.2",
+                "sebastian/diff": "~1.2",
+                "sebastian/environment": "~1.3",
+                "sebastian/exporter": "~1.2",
+                "sebastian/global-state": "~1.0",
+                "sebastian/version": "~1.0",
+                "symfony/yaml": "~2.1|~3.0"
+            },
+            "suggest": {
+                "phpunit/php-invoker": "~1.1"
+            },
+            "bin": [
+                "phpunit"
+            ],
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.8.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "The PHP Unit Testing framework.",
+            "homepage": "https://phpunit.de/",
+            "keywords": [
+                "phpunit",
+                "testing",
+                "xunit"
+            ],
+            "time": "2017-06-21 08:07:12"
+        },
+        {
+            "name": "phpunit/phpunit-mock-objects",
+            "version": "2.3.8",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/phpunit-mock-objects.git",
+                "reference": "ac8e7a3db35738d56ee9a76e78a4e03d97628983"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/phpunit-mock-objects/zipball/ac8e7a3db35738d56ee9a76e78a4e03d97628983",
+                "reference": "ac8e7a3db35738d56ee9a76e78a4e03d97628983",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/instantiator": "^1.0.2",
+                "php": ">=5.3.3",
+                "phpunit/php-text-template": "~1.2",
+                "sebastian/exporter": "~1.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "~4.4"
+            },
+            "suggest": {
+                "ext-soap": "*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.3.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sb@sebastian-bergmann.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Mock Object library for PHPUnit",
+            "homepage": "https://github.com/sebastianbergmann/phpunit-mock-objects/",
+            "keywords": [
+                "mock",
+                "xunit"
+            ],
+            "time": "2015-10-02 06:51:40"
+        },
+        {
+            "name": "sebastian/comparator",
+            "version": "1.2.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/comparator.git",
+                "reference": "2b7424b55f5047b47ac6e5ccb20b2aea4011d9be"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/2b7424b55f5047b47ac6e5ccb20b2aea4011d9be",
+                "reference": "2b7424b55f5047b47ac6e5ccb20b2aea4011d9be",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3",
+                "sebastian/diff": "~1.2",
+                "sebastian/exporter": "~1.2 || ~2.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "~4.4"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.2.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Volker Dusch",
+                    "email": "github@wallbash.com"
+                },
+                {
+                    "name": "Bernhard Schussek",
+                    "email": "bschussek@2bepublished.at"
+                },
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Provides the functionality to compare PHP values for equality",
+            "homepage": "http://www.github.com/sebastianbergmann/comparator",
+            "keywords": [
+                "comparator",
+                "compare",
+                "equality"
+            ],
+            "time": "2017-01-29 09:50:25"
+        },
+        {
+            "name": "sebastian/diff",
+            "version": "1.4.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/diff.git",
+                "reference": "7f066a26a962dbe58ddea9f72a4e82874a3975a4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/7f066a26a962dbe58ddea9f72a4e82874a3975a4",
+                "reference": "7f066a26a962dbe58ddea9f72a4e82874a3975a4",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^5.3.3 || ^7.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.8.35 || ^5.7 || ^6.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.4-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Kore Nordmann",
+                    "email": "mail@kore-nordmann.de"
+                },
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Diff implementation",
+            "homepage": "https://github.com/sebastianbergmann/diff",
+            "keywords": [
+                "diff"
+            ],
+            "time": "2017-05-22 07:24:03"
+        },
+        {
+            "name": "sebastian/environment",
+            "version": "1.3.8",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/environment.git",
+                "reference": "be2c607e43ce4c89ecd60e75c6a85c126e754aea"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/be2c607e43ce4c89ecd60e75c6a85c126e754aea",
+                "reference": "be2c607e43ce4c89ecd60e75c6a85c126e754aea",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^5.3.3 || ^7.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.8 || ^5.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.3.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Provides functionality to handle HHVM/PHP environments",
+            "homepage": "http://www.github.com/sebastianbergmann/environment",
+            "keywords": [
+                "Xdebug",
+                "environment",
+                "hhvm"
+            ],
+            "time": "2016-08-18 05:49:44"
+        },
+        {
+            "name": "sebastian/exporter",
+            "version": "1.2.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/exporter.git",
+                "reference": "42c4c2eec485ee3e159ec9884f95b431287edde4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/42c4c2eec485ee3e159ec9884f95b431287edde4",
+                "reference": "42c4c2eec485ee3e159ec9884f95b431287edde4",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3",
+                "sebastian/recursion-context": "~1.0"
+            },
+            "require-dev": {
+                "ext-mbstring": "*",
+                "phpunit/phpunit": "~4.4"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.3.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Volker Dusch",
+                    "email": "github@wallbash.com"
+                },
+                {
+                    "name": "Bernhard Schussek",
+                    "email": "bschussek@2bepublished.at"
+                },
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Adam Harvey",
+                    "email": "aharvey@php.net"
+                }
+            ],
+            "description": "Provides the functionality to export PHP variables for visualization",
+            "homepage": "http://www.github.com/sebastianbergmann/exporter",
+            "keywords": [
+                "export",
+                "exporter"
+            ],
+            "time": "2016-06-17 09:04:28"
+        },
+        {
+            "name": "sebastian/global-state",
+            "version": "1.1.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/global-state.git",
+                "reference": "bc37d50fea7d017d3d340f230811c9f1d7280af4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/bc37d50fea7d017d3d340f230811c9f1d7280af4",
+                "reference": "bc37d50fea7d017d3d340f230811c9f1d7280af4",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "~4.2"
+            },
+            "suggest": {
+                "ext-uopz": "*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Snapshotting of global state",
+            "homepage": "http://www.github.com/sebastianbergmann/global-state",
+            "keywords": [
+                "global state"
+            ],
+            "time": "2015-10-12 03:26:01"
+        },
+        {
+            "name": "sebastian/recursion-context",
+            "version": "1.0.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/recursion-context.git",
+                "reference": "b19cc3298482a335a95f3016d2f8a6950f0fbcd7"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/b19cc3298482a335a95f3016d2f8a6950f0fbcd7",
+                "reference": "b19cc3298482a335a95f3016d2f8a6950f0fbcd7",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "~4.4"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Adam Harvey",
+                    "email": "aharvey@php.net"
+                }
+            ],
+            "description": "Provides functionality to recursively process PHP variables",
+            "homepage": "http://www.github.com/sebastianbergmann/recursion-context",
+            "time": "2016-10-03 07:41:43"
+        },
+        {
+            "name": "sebastian/version",
+            "version": "1.0.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/version.git",
+                "reference": "58b3a85e7999757d6ad81c787a1fbf5ff6c628c6"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/58b3a85e7999757d6ad81c787a1fbf5ff6c628c6",
+                "reference": "58b3a85e7999757d6ad81c787a1fbf5ff6c628c6",
+                "shasum": ""
+            },
+            "type": "library",
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library that helps with managing the version number of Git-hosted PHP projects",
+            "homepage": "https://github.com/sebastianbergmann/version",
+            "time": "2015-06-21 13:59:46"
+        },
+        {
+            "name": "symfony/yaml",
+            "version": "v3.3.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/yaml.git",
+                "reference": "ddc23324e6cfe066f3dd34a37ff494fa80b617ed"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/yaml/zipball/ddc23324e6cfe066f3dd34a37ff494fa80b617ed",
+                "reference": "ddc23324e6cfe066f3dd34a37ff494fa80b617ed",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.5.9"
+            },
+            "require-dev": {
+                "symfony/console": "~2.8|~3.0"
+            },
+            "suggest": {
+                "symfony/console": "For validating YAML files using the lint command"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.3-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Yaml\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony Yaml Component",
+            "homepage": "https://symfony.com",
+            "time": "2017-07-23 12:43:26"
+        },
+        {
+            "name": "webmozart/assert",
+            "version": "1.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/webmozart/assert.git",
+                "reference": "2db61e59ff05fe5126d152bd0655c9ea113e550f"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/webmozart/assert/zipball/2db61e59ff05fe5126d152bd0655c9ea113e550f",
+                "reference": "2db61e59ff05fe5126d152bd0655c9ea113e550f",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^5.3.3 || ^7.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.6",
+                "sebastian/version": "^1.0.1"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.3-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Webmozart\\Assert\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Bernhard Schussek",
+                    "email": "bschussek@gmail.com"
+                }
+            ],
+            "description": "Assertions to validate method input/output with nice error messages.",
+            "keywords": [
+                "assert",
+                "check",
+                "validate"
+            ],
+            "time": "2016-11-23 20:04:58"
+        }
+    ],
+    "aliases": [],
+    "minimum-stability": "stable",
+    "stability-flags": [],
+    "prefer-stable": false,
+    "prefer-lowest": false,
+    "platform": {
+        "php": ">=5.5.9"
+    },
+    "platform-dev": []
+}
diff --git a/config/fcm.php b/config/fcm.php
new file mode 100755
index 0000000..887cbf9
--- /dev/null
+++ b/config/fcm.php
@@ -0,0 +1,12 @@
+<?php
+return [
+    'driver' => env('FCM_PROTOCOL', 'http'),
+    'log_enabled' => true,
+    'http' => [
+        'server_key' => env('FCM_SERVER_KEY', 'Your FCM server key'),
+        'sender_id' => env('FCM_SENDER_ID', 'Your sender id'),
+        'server_send_url' => 'https://fcm.googleapis.com/fcm/send',
+        'server_group_url' => 'https://android.googleapis.com/gcm/notification',
+        'timeout' => 30.0
+    ]
+];
diff --git a/database/factories/ModelFactory.php b/database/factories/ModelFactory.php
new file mode 100644
index 0000000..b795b09
--- /dev/null
+++ b/database/factories/ModelFactory.php
@@ -0,0 +1,19 @@
+<?php
+
+/*
+|--------------------------------------------------------------------------
+| Model Factories
+|--------------------------------------------------------------------------
+|
+| Here you may define all of your model factories. Model factories give
+| you a convenient way to create models for testing and seeding your
+| database. Just tell the factory how a default model should look.
+|
+*/
+
+$factory->define(App\User::class, function ($faker) {
+    return [
+        'name' => $faker->name,
+        'email' => $faker->email,
+    ];
+});
diff --git a/database/migrations/.gitkeep b/database/migrations/.gitkeep
new file mode 100644
index 0000000..e69de29
diff --git a/database/migrations/1_0_0_0_create_table_intervals.php b/database/migrations/1_0_0_0_create_table_intervals.php
new file mode 100644
index 0000000..3461bcf
--- /dev/null
+++ b/database/migrations/1_0_0_0_create_table_intervals.php
@@ -0,0 +1,36 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableIntervals extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('intervals', function (Blueprint $table) {
+            $table->increments('id');
+ 			$table->string('mon', 11)->default('00:00,23:59');
+ 			$table->string('tue', 11)->default('00:00,23:59');
+ 			$table->string('wed', 11)->default('00:00,23:59');
+ 			$table->string('thu', 11)->default('00:00,23:59');
+ 			$table->string('fri', 11)->default('00:00,23:59');
+ 			$table->string('sat', 11)->default('00:00,23:59');
+ 			$table->string('sun', 11)->default('00:00,23:59');
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('intervals');
+    }
+}
diff --git a/database/migrations/1_0_0_0_create_table_levels.php b/database/migrations/1_0_0_0_create_table_levels.php
new file mode 100644
index 0000000..8d0bb2e
--- /dev/null
+++ b/database/migrations/1_0_0_0_create_table_levels.php
@@ -0,0 +1,30 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableLevels extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('levels', function (Blueprint $table) {
+            $table->increments('id');
+ 			$table->string('name', 50)->unique();
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('levels');
+    }
+}
diff --git a/database/migrations/1_0_0_0_create_table_reviews.php b/database/migrations/1_0_0_0_create_table_reviews.php
new file mode 100644
index 0000000..10994c4
--- /dev/null
+++ b/database/migrations/1_0_0_0_create_table_reviews.php
@@ -0,0 +1,32 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableReviews extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('reviews', function (Blueprint $table) {
+            $table->increments('id');
+			$table->tinyInteger('rating');
+			$table->string('description', 500)->nullable();
+			$table->timestamps();
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('reviews');
+    }
+}
diff --git a/database/migrations/1_0_0_0_create_table_subjects.php b/database/migrations/1_0_0_0_create_table_subjects.php
new file mode 100644
index 0000000..c9edb53
--- /dev/null
+++ b/database/migrations/1_0_0_0_create_table_subjects.php
@@ -0,0 +1,30 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableSubjects extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('subjects', function (Blueprint $table) {
+            $table->increments('id');
+			$table->string('name', 50)->unique();
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('subjects');
+    }
+}
diff --git a/database/migrations/1_1_0_0_create_table_users.php b/database/migrations/1_1_0_0_create_table_users.php
new file mode 100644
index 0000000..8cb0a80
--- /dev/null
+++ b/database/migrations/1_1_0_0_create_table_users.php
@@ -0,0 +1,50 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableUsers extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('users', function (Blueprint $table) {
+            $table->increments('id');
+			$table->enum('type', ['student', 'mentor']);
+			$table->string('firstName', 50);
+			$table->string('lastName', 50);
+			$table->string('email')->unique();
+			$table->string('password', 60);
+			$table->string('accessToken', 64)->unique();
+			$table->text('image')->nullable();
+			$table->string('fcmToken')->nullable();
+			$table->boolean('active')->default(0);
+			$table->integer('views')->default(0);
+	
+			$table->integer('interval')->unsigned()->nullable();
+			$table->foreign('interval')->references('id')->on('intervals');
+			$table->string('location')->nullable();
+			$table->smallInteger('price')->nullable();
+			$table->boolean('promoted')->default(0);
+			
+			$table->smallInteger('grade')->nullable();
+			
+			$table->softDeletes();
+			$table->timestamps();
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('users');
+    }
+}
diff --git a/database/migrations/2_0_0_0_create_table_logins.php b/database/migrations/2_0_0_0_create_table_logins.php
new file mode 100644
index 0000000..6a9a080
--- /dev/null
+++ b/database/migrations/2_0_0_0_create_table_logins.php
@@ -0,0 +1,33 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableLogins extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('logins', function (Blueprint $table) {
+            $table->increments('id');
+         	$table->string('ip', 15);
+			$table->integer('user')->unsigned();
+			$table->foreign('user')->references('id')->on('users');
+			$table->timestamps();
+        });
+	}
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('logins');
+    }
+}
diff --git a/database/migrations/2_0_0_0_create_table_schools.php b/database/migrations/2_0_0_0_create_table_schools.php
new file mode 100644
index 0000000..0d67b00
--- /dev/null
+++ b/database/migrations/2_0_0_0_create_table_schools.php
@@ -0,0 +1,33 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableSchools extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('schools', function (Blueprint $table) {
+            $table->increments('id');
+          	$table->string('name', 50);
+			$table->string('city', 50);
+			$table->integer('level')->unsigned()->nullable();
+			$table->foreign('level')->references('id')->on('levels');
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('schools');
+    }
+}
diff --git a/database/migrations/2_0_0_0_create_table_sessions.php b/database/migrations/2_0_0_0_create_table_sessions.php
new file mode 100644
index 0000000..d9921ee
--- /dev/null
+++ b/database/migrations/2_0_0_0_create_table_sessions.php
@@ -0,0 +1,52 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableSessions extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('sessions', function (Blueprint $table) {
+            $table->increments('id');
+			$table->string('lecture', 50);
+			$table->smallInteger('price')->default(0);;
+			$table->string('location');
+			$table->string('locationEdit')->nullable();
+			$table->time('timeBegin', 11);	
+			$table->time('timeEnd', 11);	
+			$table->time('timeBeginEdit')->nullable();	
+			$table->time('timeEndEdit')->nullable();	
+			$table->date('date');	
+			$table->date('dateEdit')->nullable();	
+			$table->enum('status', ['accepted', 'declined'])->nullable();
+			$table->boolean('canceled')->default(0);	
+            $table->integer('mentor')->unsigned();
+			$table->foreign('mentor')->references('id')->on('users');
+            $table->integer('student')->unsigned();
+			$table->foreign('student')->references('id')->on('users');
+			$table->integer('subject')->unsigned()->nullable();
+			$table->foreign('subject')->references('id')->on('subjects');
+            $table->integer('level')->unsigned()->nullable();
+			$table->foreign('level')->references('id')->on('levels');
+			$table->integer('review')->unsigned()->nullable();
+			$table->foreign('review')->references('id')->on('reviews');
+			$table->timestamps();
+        });    
+	}
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('sessions');
+    }
+}
diff --git a/database/migrations/3_0_0_0_create_table_junctions.php b/database/migrations/3_0_0_0_create_table_junctions.php
new file mode 100644
index 0000000..288f927
--- /dev/null
+++ b/database/migrations/3_0_0_0_create_table_junctions.php
@@ -0,0 +1,37 @@
+<?php
+
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Database\Migrations\Migration;
+
+class CreateTableJunctions extends Migration
+{
+    /**
+     * Run the migrations.
+     *
+     * @return void
+     */
+    public function up()
+    {
+        Schema::create('junctions', function (Blueprint $table) {
+    		$table->increments('id');
+            $table->integer('user')->unsigned();
+			$table->foreign('user')->references('id')->on('users');
+			$table->integer('school')->unsigned()->nullable();
+			$table->foreign('school')->references('id')->on('schools');
+			$table->integer('subject')->unsigned()->nullable();
+			$table->foreign('subject')->references('id')->on('subjects');
+			$table->integer('level')->unsigned()->nullable();
+			$table->foreign('level')->references('id')->on('levels');
+		});
+    }
+
+    /**
+     * Reverse the migrations.
+     *
+     * @return void
+     */
+    public function down()
+    {
+        Schema::drop('junctions');
+    }
+}
diff --git a/database/seeds/DatabaseSeeder.php b/database/seeds/DatabaseSeeder.php
new file mode 100644
index 0000000..8673de3
--- /dev/null
+++ b/database/seeds/DatabaseSeeder.php
@@ -0,0 +1,13 @@
+<?php
+
+use Illuminate\Database\Seeder;
+
+class DatabaseSeeder extends Seeder {
+    
+	public function run() {
+    	$this->call('LevelTableSeeder');
+    	$this->call('SubjectTableSeeder');
+    	$this->call('IntervalTableSeeder');
+		$this->call('SchoolTableSeeder');
+	}
+}
diff --git a/database/seeds/LevelTableSeeder.php b/database/seeds/LevelTableSeeder.php
new file mode 100644
index 0000000..ba185d1
--- /dev/null
+++ b/database/seeds/LevelTableSeeder.php
@@ -0,0 +1,18 @@
+<?php 
+	
+use Illuminate\Database\Seeder;
+
+class LevelTableSeeder extends Seeder {
+
+	public function run() {
+		DB::table('levels')->delete();
+
+		DB::table('levels')->insert([
+			['name' => 'Osnovna skola'],
+			['name' => 'Srednja skola'],
+			['name' => 'Visa skola'],
+			['name' => 'Fakultet']
+		]);
+    }
+}
+?>
diff --git a/database/seeds/SchoolTableSeeder.php b/database/seeds/SchoolTableSeeder.php
new file mode 100644
index 0000000..2d3d351
--- /dev/null
+++ b/database/seeds/SchoolTableSeeder.php
@@ -0,0 +1,22 @@
+<?php 
+	
+use Illuminate\Database\Seeder;
+
+class SchoolTableSeeder extends Seeder {
+
+	public function run() {
+		DB::table('schools')->delete();
+
+		DB::table('schools')->insert([
+			['name' => 'Visoka poslovna skola', 'city' => 'Beograd', 'level' => 3],
+			['name' => 'Gimnazija', 'city' => 'Krusevac', 'level' => 2],
+			['name' => 'Tehnicka skola', 'city' => 'Novi Sad', 'level' => 2],
+			['name' => 'Ekonomska skola', 'city' => 'Nis', 'level' => 2],
+			['name' => 'OS Vuk Karadzic', 'city' => 'Kragujevac', 'level' => 1],
+			['name' => 'Ekonomska skola', 'city' => 'Beograd', 'level' => 2],
+			['name' => 'Gradjevinska skola', 'city' => 'Beograd', 'level' => 2],
+			['name' => 'Pravni fakultet', 'city' => 'Kraljevo', 'level' => 4]
+		]);
+    }
+}
+?>
diff --git a/database/seeds/SubjectTableSeeder.php b/database/seeds/SubjectTableSeeder.php
new file mode 100644
index 0000000..98ada75
--- /dev/null
+++ b/database/seeds/SubjectTableSeeder.php
@@ -0,0 +1,22 @@
+<?php 
+	
+use Illuminate\Database\Seeder;
+
+class SubjectTableSeeder extends Seeder {
+
+	public function run() {
+		DB::table('subjects')->delete();
+
+		DB::table('subjects')->insert([
+			['name' => 'Matematika'],
+			['name' => 'Fizika'],
+			['name' => 'Srpski jezik'],
+			['name' => 'Knjizevnost'],
+			['name' => 'Osnove racunarskih sistema'],
+			['name' => 'Svet oko nas'],
+			['name' => 'Programiranje 1'],
+			['name' => 'Hemija']
+		]);
+    }
+}
+?>
diff --git a/doc/brief.pdf b/doc/brief.pdf
new file mode 100644
index 0000000..4fb3f1f
Binary files /dev/null and b/doc/brief.pdf differ
diff --git a/doc/spec.pages b/doc/spec.pages
new file mode 100644
index 0000000..9e6c579
Binary files /dev/null and b/doc/spec.pages differ
diff --git a/doc/spec.pdf b/doc/spec.pdf
new file mode 100644
index 0000000..36daf1d
Binary files /dev/null and b/doc/spec.pdf differ
diff --git a/phpunit.xml b/phpunit.xml
new file mode 100644
index 0000000..77c29fe
--- /dev/null
+++ b/phpunit.xml
@@ -0,0 +1,26 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<phpunit backupGlobals="false"
+         backupStaticAttributes="false"
+         bootstrap="bootstrap/app.php"
+         colors="true"
+         convertErrorsToExceptions="true"
+         convertNoticesToExceptions="true"
+         convertWarningsToExceptions="true"
+         processIsolation="false"
+         stopOnFailure="false"
+         syntaxCheck="false">
+    <testsuites>
+        <testsuite name="Application Test Suite">
+            <directory>./tests/</directory>
+        </testsuite>
+    </testsuites>
+    <filter>
+        <whitelist>
+            <directory suffix=".php">app/</directory>
+        </whitelist>
+    </filter>
+    <php>
+        <env name="APP_ENV" value="testing"/>
+        <env name="CACHE_DRIVER" value="array"/>
+    </php>
+</phpunit>
diff --git a/public/.htaccess b/public/.htaccess
new file mode 100644
index 0000000..8eb2dd0
--- /dev/null
+++ b/public/.htaccess
@@ -0,0 +1,16 @@
+<IfModule mod_rewrite.c>
+    <IfModule mod_negotiation.c>
+        Options -MultiViews
+    </IfModule>
+
+    RewriteEngine On
+
+    # Redirect Trailing Slashes If Not A Folder...
+    RewriteCond %{REQUEST_FILENAME} !-d
+    RewriteRule ^(.*)/$ /$1 [L,R=301]
+
+    # Handle Front Controller...
+    RewriteCond %{REQUEST_FILENAME} !-d
+    RewriteCond %{REQUEST_FILENAME} !-f
+    RewriteRule ^ index.php [L]
+</IfModule>
diff --git a/public/index.php b/public/index.php
new file mode 100644
index 0000000..391d6ca
--- /dev/null
+++ b/public/index.php
@@ -0,0 +1,28 @@
+<?php
+
+/*
+|--------------------------------------------------------------------------
+| Create The Application
+|--------------------------------------------------------------------------
+|
+| First we need to get an application instance. This creates an instance
+| of the application / container and bootstraps the application so it
+| is ready to receive HTTP / Console requests from the environment.
+|
+*/
+
+$app = require __DIR__.'/../bootstrap/app.php';
+
+/*
+|--------------------------------------------------------------------------
+| Run The Application
+|--------------------------------------------------------------------------
+|
+| Once we have the application, we can handle the incoming request
+| through the kernel, and send the associated response back to
+| the client's browser allowing them to enjoy the creative
+| and wonderful application we have prepared for them.
+|
+*/
+
+$app->run($app->request);
diff --git a/readme.md b/readme.md
new file mode 100644
index 0000000..9605e5f
--- /dev/null
+++ b/readme.md
@@ -0,0 +1,21 @@
+## Lumen PHP Framework
+
+[![Build Status](https://travis-ci.org/laravel/lumen-framework.svg)](https://travis-ci.org/laravel/lumen-framework)
+[![Total Downloads](https://poser.pugx.org/laravel/lumen-framework/d/total.svg)](https://packagist.org/packages/laravel/lumen-framework)
+[![Latest Stable Version](https://poser.pugx.org/laravel/lumen-framework/v/stable.svg)](https://packagist.org/packages/laravel/lumen-framework)
+[![Latest Unstable Version](https://poser.pugx.org/laravel/lumen-framework/v/unstable.svg)](https://packagist.org/packages/laravel/lumen-framework)
+[![License](https://poser.pugx.org/laravel/lumen-framework/license.svg)](https://packagist.org/packages/laravel/lumen-framework)
+
+Laravel Lumen is a stunningly fast PHP micro-framework for building web applications with expressive, elegant syntax. We believe development must be an enjoyable, creative experience to be truly fulfilling. Lumen attempts to take the pain out of development by easing common tasks used in the majority of web projects, such as routing, database abstraction, queueing, and caching.
+
+## Official Documentation
+
+Documentation for the framework can be found on the [Lumen website](http://lumen.laravel.com/docs).
+
+## Security Vulnerabilities
+
+If you discover a security vulnerability within Laravel, please send an e-mail to Taylor Otwell at taylor@laravel.com. All security vulnerabilities will be promptly addressed.
+
+### License
+
+The Lumen framework is open-sourced software licensed under the [MIT license](http://opensource.org/licenses/MIT)
diff --git a/resources/views/.gitkeep b/resources/views/.gitkeep
new file mode 100644
index 0000000..e69de29
diff --git a/resources/views/home.blade.php b/resources/views/home.blade.php
new file mode 100644
index 0000000..5db970b
--- /dev/null
+++ b/resources/views/home.blade.php
@@ -0,0 +1,9 @@
+<html>
+	<head>
+		<title>Home</title>
+	</head>
+	<body>
+		<h1>PetPlus API v{{$version}}</h1>                                                                                
+		<p>Developed by <a href="http://www.ecloga.org">Ecloga Apps</a> &copy; {{$year}}</p>
+	</body>
+</html>
diff --git a/storage/app/.gitignore b/storage/app/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/app/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/storage/framework/views/.gitignore b/storage/framework/views/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/framework/views/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/storage/logs/.gitignore b/storage/logs/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/logs/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/tests/ExampleTest.php b/tests/ExampleTest.php
new file mode 100644
index 0000000..2b206c6
--- /dev/null
+++ b/tests/ExampleTest.php
@@ -0,0 +1,20 @@
+<?php
+
+use Laravel\Lumen\Testing\DatabaseTransactions;
+
+class ExampleTest extends TestCase
+{
+    /**
+     * A basic test example.
+     *
+     * @return void
+     */
+    public function testExample()
+    {
+        $this->get('/');
+
+        $this->assertEquals(
+            $this->response->getContent(), $this->app->version()
+        );
+    }
+}
diff --git a/tests/TestCase.php b/tests/TestCase.php
new file mode 100644
index 0000000..651d9cb
--- /dev/null
+++ b/tests/TestCase.php
@@ -0,0 +1,14 @@
+<?php
+
+class TestCase extends Laravel\Lumen\Testing\TestCase
+{
+    /**
+     * Creates the application.
+     *
+     * @return \Laravel\Lumen\Application
+     */
+    public function createApplication()
+    {
+        return require __DIR__.'/../bootstrap/app.php';
+    }
+}